diff options
Diffstat (limited to 'node_modules/markdown-it/dist')
-rw-r--r-- | node_modules/markdown-it/dist/markdown-it.js | 8356 | ||||
-rw-r--r-- | node_modules/markdown-it/dist/markdown-it.min.js | 3 |
2 files changed, 8359 insertions, 0 deletions
diff --git a/node_modules/markdown-it/dist/markdown-it.js b/node_modules/markdown-it/dist/markdown-it.js new file mode 100644 index 0000000..1ef5530 --- /dev/null +++ b/node_modules/markdown-it/dist/markdown-it.js @@ -0,0 +1,8356 @@ +/*! markdown-it 12.3.2 https://github.com/markdown-it/markdown-it @license MIT */ +(function(global, factory) { + typeof exports === "object" && typeof module !== "undefined" ? module.exports = factory() : typeof define === "function" && define.amd ? define(factory) : (global = typeof globalThis !== "undefined" ? globalThis : global || self, + global.markdownit = factory()); +})(this, (function() { + "use strict"; + function createCommonjsModule(fn, basedir, module) { + return module = { + path: basedir, + exports: {}, + require: function(path, base) { + return commonjsRequire(path, base === undefined || base === null ? module.path : base); + } + }, fn(module, module.exports), module.exports; + } + function getAugmentedNamespace(n) { + if (n.__esModule) return n; + var a = Object.defineProperty({}, "__esModule", { + value: true + }); + Object.keys(n).forEach((function(k) { + var d = Object.getOwnPropertyDescriptor(n, k); + Object.defineProperty(a, k, d.get ? d : { + enumerable: true, + get: function() { + return n[k]; + } + }); + })); + return a; + } + function commonjsRequire() { + throw new Error("Dynamic requires are not currently supported by @rollup/plugin-commonjs"); + } + var require$$0 = { + Aacute: "\xc1", + aacute: "\xe1", + Abreve: "\u0102", + abreve: "\u0103", + ac: "\u223e", + acd: "\u223f", + acE: "\u223e\u0333", + Acirc: "\xc2", + acirc: "\xe2", + acute: "\xb4", + Acy: "\u0410", + acy: "\u0430", + AElig: "\xc6", + aelig: "\xe6", + af: "\u2061", + Afr: "\ud835\udd04", + afr: "\ud835\udd1e", + Agrave: "\xc0", + agrave: "\xe0", + alefsym: "\u2135", + aleph: "\u2135", + Alpha: "\u0391", + alpha: "\u03b1", + Amacr: "\u0100", + amacr: "\u0101", + amalg: "\u2a3f", + amp: "&", + AMP: "&", + andand: "\u2a55", + And: "\u2a53", + and: "\u2227", + andd: "\u2a5c", + andslope: "\u2a58", + andv: "\u2a5a", + ang: "\u2220", + ange: "\u29a4", + angle: "\u2220", + angmsdaa: "\u29a8", + angmsdab: "\u29a9", + angmsdac: "\u29aa", + angmsdad: "\u29ab", + angmsdae: "\u29ac", + angmsdaf: "\u29ad", + angmsdag: "\u29ae", + angmsdah: "\u29af", + angmsd: "\u2221", + angrt: "\u221f", + angrtvb: "\u22be", + angrtvbd: "\u299d", + angsph: "\u2222", + angst: "\xc5", + angzarr: "\u237c", + Aogon: "\u0104", + aogon: "\u0105", + Aopf: "\ud835\udd38", + aopf: "\ud835\udd52", + apacir: "\u2a6f", + ap: "\u2248", + apE: "\u2a70", + ape: "\u224a", + apid: "\u224b", + apos: "'", + ApplyFunction: "\u2061", + approx: "\u2248", + approxeq: "\u224a", + Aring: "\xc5", + aring: "\xe5", + Ascr: "\ud835\udc9c", + ascr: "\ud835\udcb6", + Assign: "\u2254", + ast: "*", + asymp: "\u2248", + asympeq: "\u224d", + Atilde: "\xc3", + atilde: "\xe3", + Auml: "\xc4", + auml: "\xe4", + awconint: "\u2233", + awint: "\u2a11", + backcong: "\u224c", + backepsilon: "\u03f6", + backprime: "\u2035", + backsim: "\u223d", + backsimeq: "\u22cd", + Backslash: "\u2216", + Barv: "\u2ae7", + barvee: "\u22bd", + barwed: "\u2305", + Barwed: "\u2306", + barwedge: "\u2305", + bbrk: "\u23b5", + bbrktbrk: "\u23b6", + bcong: "\u224c", + Bcy: "\u0411", + bcy: "\u0431", + bdquo: "\u201e", + becaus: "\u2235", + because: "\u2235", + Because: "\u2235", + bemptyv: "\u29b0", + bepsi: "\u03f6", + bernou: "\u212c", + Bernoullis: "\u212c", + Beta: "\u0392", + beta: "\u03b2", + beth: "\u2136", + between: "\u226c", + Bfr: "\ud835\udd05", + bfr: "\ud835\udd1f", + bigcap: "\u22c2", + bigcirc: "\u25ef", + bigcup: "\u22c3", + bigodot: "\u2a00", + bigoplus: "\u2a01", + bigotimes: "\u2a02", + bigsqcup: "\u2a06", + bigstar: "\u2605", + bigtriangledown: "\u25bd", + bigtriangleup: "\u25b3", + biguplus: "\u2a04", + bigvee: "\u22c1", + bigwedge: "\u22c0", + bkarow: "\u290d", + blacklozenge: "\u29eb", + blacksquare: "\u25aa", + blacktriangle: "\u25b4", + blacktriangledown: "\u25be", + blacktriangleleft: "\u25c2", + blacktriangleright: "\u25b8", + blank: "\u2423", + blk12: "\u2592", + blk14: "\u2591", + blk34: "\u2593", + block: "\u2588", + bne: "=\u20e5", + bnequiv: "\u2261\u20e5", + bNot: "\u2aed", + bnot: "\u2310", + Bopf: "\ud835\udd39", + bopf: "\ud835\udd53", + bot: "\u22a5", + bottom: "\u22a5", + bowtie: "\u22c8", + boxbox: "\u29c9", + boxdl: "\u2510", + boxdL: "\u2555", + boxDl: "\u2556", + boxDL: "\u2557", + boxdr: "\u250c", + boxdR: "\u2552", + boxDr: "\u2553", + boxDR: "\u2554", + boxh: "\u2500", + boxH: "\u2550", + boxhd: "\u252c", + boxHd: "\u2564", + boxhD: "\u2565", + boxHD: "\u2566", + boxhu: "\u2534", + boxHu: "\u2567", + boxhU: "\u2568", + boxHU: "\u2569", + boxminus: "\u229f", + boxplus: "\u229e", + boxtimes: "\u22a0", + boxul: "\u2518", + boxuL: "\u255b", + boxUl: "\u255c", + boxUL: "\u255d", + boxur: "\u2514", + boxuR: "\u2558", + boxUr: "\u2559", + boxUR: "\u255a", + boxv: "\u2502", + boxV: "\u2551", + boxvh: "\u253c", + boxvH: "\u256a", + boxVh: "\u256b", + boxVH: "\u256c", + boxvl: "\u2524", + boxvL: "\u2561", + boxVl: "\u2562", + boxVL: "\u2563", + boxvr: "\u251c", + boxvR: "\u255e", + boxVr: "\u255f", + boxVR: "\u2560", + bprime: "\u2035", + breve: "\u02d8", + Breve: "\u02d8", + brvbar: "\xa6", + bscr: "\ud835\udcb7", + Bscr: "\u212c", + bsemi: "\u204f", + bsim: "\u223d", + bsime: "\u22cd", + bsolb: "\u29c5", + bsol: "\\", + bsolhsub: "\u27c8", + bull: "\u2022", + bullet: "\u2022", + bump: "\u224e", + bumpE: "\u2aae", + bumpe: "\u224f", + Bumpeq: "\u224e", + bumpeq: "\u224f", + Cacute: "\u0106", + cacute: "\u0107", + capand: "\u2a44", + capbrcup: "\u2a49", + capcap: "\u2a4b", + cap: "\u2229", + Cap: "\u22d2", + capcup: "\u2a47", + capdot: "\u2a40", + CapitalDifferentialD: "\u2145", + caps: "\u2229\ufe00", + caret: "\u2041", + caron: "\u02c7", + Cayleys: "\u212d", + ccaps: "\u2a4d", + Ccaron: "\u010c", + ccaron: "\u010d", + Ccedil: "\xc7", + ccedil: "\xe7", + Ccirc: "\u0108", + ccirc: "\u0109", + Cconint: "\u2230", + ccups: "\u2a4c", + ccupssm: "\u2a50", + Cdot: "\u010a", + cdot: "\u010b", + cedil: "\xb8", + Cedilla: "\xb8", + cemptyv: "\u29b2", + cent: "\xa2", + centerdot: "\xb7", + CenterDot: "\xb7", + cfr: "\ud835\udd20", + Cfr: "\u212d", + CHcy: "\u0427", + chcy: "\u0447", + check: "\u2713", + checkmark: "\u2713", + Chi: "\u03a7", + chi: "\u03c7", + circ: "\u02c6", + circeq: "\u2257", + circlearrowleft: "\u21ba", + circlearrowright: "\u21bb", + circledast: "\u229b", + circledcirc: "\u229a", + circleddash: "\u229d", + CircleDot: "\u2299", + circledR: "\xae", + circledS: "\u24c8", + CircleMinus: "\u2296", + CirclePlus: "\u2295", + CircleTimes: "\u2297", + cir: "\u25cb", + cirE: "\u29c3", + cire: "\u2257", + cirfnint: "\u2a10", + cirmid: "\u2aef", + cirscir: "\u29c2", + ClockwiseContourIntegral: "\u2232", + CloseCurlyDoubleQuote: "\u201d", + CloseCurlyQuote: "\u2019", + clubs: "\u2663", + clubsuit: "\u2663", + colon: ":", + Colon: "\u2237", + Colone: "\u2a74", + colone: "\u2254", + coloneq: "\u2254", + comma: ",", + commat: "@", + comp: "\u2201", + compfn: "\u2218", + complement: "\u2201", + complexes: "\u2102", + cong: "\u2245", + congdot: "\u2a6d", + Congruent: "\u2261", + conint: "\u222e", + Conint: "\u222f", + ContourIntegral: "\u222e", + copf: "\ud835\udd54", + Copf: "\u2102", + coprod: "\u2210", + Coproduct: "\u2210", + copy: "\xa9", + COPY: "\xa9", + copysr: "\u2117", + CounterClockwiseContourIntegral: "\u2233", + crarr: "\u21b5", + cross: "\u2717", + Cross: "\u2a2f", + Cscr: "\ud835\udc9e", + cscr: "\ud835\udcb8", + csub: "\u2acf", + csube: "\u2ad1", + csup: "\u2ad0", + csupe: "\u2ad2", + ctdot: "\u22ef", + cudarrl: "\u2938", + cudarrr: "\u2935", + cuepr: "\u22de", + cuesc: "\u22df", + cularr: "\u21b6", + cularrp: "\u293d", + cupbrcap: "\u2a48", + cupcap: "\u2a46", + CupCap: "\u224d", + cup: "\u222a", + Cup: "\u22d3", + cupcup: "\u2a4a", + cupdot: "\u228d", + cupor: "\u2a45", + cups: "\u222a\ufe00", + curarr: "\u21b7", + curarrm: "\u293c", + curlyeqprec: "\u22de", + curlyeqsucc: "\u22df", + curlyvee: "\u22ce", + curlywedge: "\u22cf", + curren: "\xa4", + curvearrowleft: "\u21b6", + curvearrowright: "\u21b7", + cuvee: "\u22ce", + cuwed: "\u22cf", + cwconint: "\u2232", + cwint: "\u2231", + cylcty: "\u232d", + dagger: "\u2020", + Dagger: "\u2021", + daleth: "\u2138", + darr: "\u2193", + Darr: "\u21a1", + dArr: "\u21d3", + dash: "\u2010", + Dashv: "\u2ae4", + dashv: "\u22a3", + dbkarow: "\u290f", + dblac: "\u02dd", + Dcaron: "\u010e", + dcaron: "\u010f", + Dcy: "\u0414", + dcy: "\u0434", + ddagger: "\u2021", + ddarr: "\u21ca", + DD: "\u2145", + dd: "\u2146", + DDotrahd: "\u2911", + ddotseq: "\u2a77", + deg: "\xb0", + Del: "\u2207", + Delta: "\u0394", + delta: "\u03b4", + demptyv: "\u29b1", + dfisht: "\u297f", + Dfr: "\ud835\udd07", + dfr: "\ud835\udd21", + dHar: "\u2965", + dharl: "\u21c3", + dharr: "\u21c2", + DiacriticalAcute: "\xb4", + DiacriticalDot: "\u02d9", + DiacriticalDoubleAcute: "\u02dd", + DiacriticalGrave: "`", + DiacriticalTilde: "\u02dc", + diam: "\u22c4", + diamond: "\u22c4", + Diamond: "\u22c4", + diamondsuit: "\u2666", + diams: "\u2666", + die: "\xa8", + DifferentialD: "\u2146", + digamma: "\u03dd", + disin: "\u22f2", + div: "\xf7", + divide: "\xf7", + divideontimes: "\u22c7", + divonx: "\u22c7", + DJcy: "\u0402", + djcy: "\u0452", + dlcorn: "\u231e", + dlcrop: "\u230d", + dollar: "$", + Dopf: "\ud835\udd3b", + dopf: "\ud835\udd55", + Dot: "\xa8", + dot: "\u02d9", + DotDot: "\u20dc", + doteq: "\u2250", + doteqdot: "\u2251", + DotEqual: "\u2250", + dotminus: "\u2238", + dotplus: "\u2214", + dotsquare: "\u22a1", + doublebarwedge: "\u2306", + DoubleContourIntegral: "\u222f", + DoubleDot: "\xa8", + DoubleDownArrow: "\u21d3", + DoubleLeftArrow: "\u21d0", + DoubleLeftRightArrow: "\u21d4", + DoubleLeftTee: "\u2ae4", + DoubleLongLeftArrow: "\u27f8", + DoubleLongLeftRightArrow: "\u27fa", + DoubleLongRightArrow: "\u27f9", + DoubleRightArrow: "\u21d2", + DoubleRightTee: "\u22a8", + DoubleUpArrow: "\u21d1", + DoubleUpDownArrow: "\u21d5", + DoubleVerticalBar: "\u2225", + DownArrowBar: "\u2913", + downarrow: "\u2193", + DownArrow: "\u2193", + Downarrow: "\u21d3", + DownArrowUpArrow: "\u21f5", + DownBreve: "\u0311", + downdownarrows: "\u21ca", + downharpoonleft: "\u21c3", + downharpoonright: "\u21c2", + DownLeftRightVector: "\u2950", + DownLeftTeeVector: "\u295e", + DownLeftVectorBar: "\u2956", + DownLeftVector: "\u21bd", + DownRightTeeVector: "\u295f", + DownRightVectorBar: "\u2957", + DownRightVector: "\u21c1", + DownTeeArrow: "\u21a7", + DownTee: "\u22a4", + drbkarow: "\u2910", + drcorn: "\u231f", + drcrop: "\u230c", + Dscr: "\ud835\udc9f", + dscr: "\ud835\udcb9", + DScy: "\u0405", + dscy: "\u0455", + dsol: "\u29f6", + Dstrok: "\u0110", + dstrok: "\u0111", + dtdot: "\u22f1", + dtri: "\u25bf", + dtrif: "\u25be", + duarr: "\u21f5", + duhar: "\u296f", + dwangle: "\u29a6", + DZcy: "\u040f", + dzcy: "\u045f", + dzigrarr: "\u27ff", + Eacute: "\xc9", + eacute: "\xe9", + easter: "\u2a6e", + Ecaron: "\u011a", + ecaron: "\u011b", + Ecirc: "\xca", + ecirc: "\xea", + ecir: "\u2256", + ecolon: "\u2255", + Ecy: "\u042d", + ecy: "\u044d", + eDDot: "\u2a77", + Edot: "\u0116", + edot: "\u0117", + eDot: "\u2251", + ee: "\u2147", + efDot: "\u2252", + Efr: "\ud835\udd08", + efr: "\ud835\udd22", + eg: "\u2a9a", + Egrave: "\xc8", + egrave: "\xe8", + egs: "\u2a96", + egsdot: "\u2a98", + el: "\u2a99", + Element: "\u2208", + elinters: "\u23e7", + ell: "\u2113", + els: "\u2a95", + elsdot: "\u2a97", + Emacr: "\u0112", + emacr: "\u0113", + empty: "\u2205", + emptyset: "\u2205", + EmptySmallSquare: "\u25fb", + emptyv: "\u2205", + EmptyVerySmallSquare: "\u25ab", + emsp13: "\u2004", + emsp14: "\u2005", + emsp: "\u2003", + ENG: "\u014a", + eng: "\u014b", + ensp: "\u2002", + Eogon: "\u0118", + eogon: "\u0119", + Eopf: "\ud835\udd3c", + eopf: "\ud835\udd56", + epar: "\u22d5", + eparsl: "\u29e3", + eplus: "\u2a71", + epsi: "\u03b5", + Epsilon: "\u0395", + epsilon: "\u03b5", + epsiv: "\u03f5", + eqcirc: "\u2256", + eqcolon: "\u2255", + eqsim: "\u2242", + eqslantgtr: "\u2a96", + eqslantless: "\u2a95", + Equal: "\u2a75", + equals: "=", + EqualTilde: "\u2242", + equest: "\u225f", + Equilibrium: "\u21cc", + equiv: "\u2261", + equivDD: "\u2a78", + eqvparsl: "\u29e5", + erarr: "\u2971", + erDot: "\u2253", + escr: "\u212f", + Escr: "\u2130", + esdot: "\u2250", + Esim: "\u2a73", + esim: "\u2242", + Eta: "\u0397", + eta: "\u03b7", + ETH: "\xd0", + eth: "\xf0", + Euml: "\xcb", + euml: "\xeb", + euro: "\u20ac", + excl: "!", + exist: "\u2203", + Exists: "\u2203", + expectation: "\u2130", + exponentiale: "\u2147", + ExponentialE: "\u2147", + fallingdotseq: "\u2252", + Fcy: "\u0424", + fcy: "\u0444", + female: "\u2640", + ffilig: "\ufb03", + fflig: "\ufb00", + ffllig: "\ufb04", + Ffr: "\ud835\udd09", + ffr: "\ud835\udd23", + filig: "\ufb01", + FilledSmallSquare: "\u25fc", + FilledVerySmallSquare: "\u25aa", + fjlig: "fj", + flat: "\u266d", + fllig: "\ufb02", + fltns: "\u25b1", + fnof: "\u0192", + Fopf: "\ud835\udd3d", + fopf: "\ud835\udd57", + forall: "\u2200", + ForAll: "\u2200", + fork: "\u22d4", + forkv: "\u2ad9", + Fouriertrf: "\u2131", + fpartint: "\u2a0d", + frac12: "\xbd", + frac13: "\u2153", + frac14: "\xbc", + frac15: "\u2155", + frac16: "\u2159", + frac18: "\u215b", + frac23: "\u2154", + frac25: "\u2156", + frac34: "\xbe", + frac35: "\u2157", + frac38: "\u215c", + frac45: "\u2158", + frac56: "\u215a", + frac58: "\u215d", + frac78: "\u215e", + frasl: "\u2044", + frown: "\u2322", + fscr: "\ud835\udcbb", + Fscr: "\u2131", + gacute: "\u01f5", + Gamma: "\u0393", + gamma: "\u03b3", + Gammad: "\u03dc", + gammad: "\u03dd", + gap: "\u2a86", + Gbreve: "\u011e", + gbreve: "\u011f", + Gcedil: "\u0122", + Gcirc: "\u011c", + gcirc: "\u011d", + Gcy: "\u0413", + gcy: "\u0433", + Gdot: "\u0120", + gdot: "\u0121", + ge: "\u2265", + gE: "\u2267", + gEl: "\u2a8c", + gel: "\u22db", + geq: "\u2265", + geqq: "\u2267", + geqslant: "\u2a7e", + gescc: "\u2aa9", + ges: "\u2a7e", + gesdot: "\u2a80", + gesdoto: "\u2a82", + gesdotol: "\u2a84", + gesl: "\u22db\ufe00", + gesles: "\u2a94", + Gfr: "\ud835\udd0a", + gfr: "\ud835\udd24", + gg: "\u226b", + Gg: "\u22d9", + ggg: "\u22d9", + gimel: "\u2137", + GJcy: "\u0403", + gjcy: "\u0453", + gla: "\u2aa5", + gl: "\u2277", + glE: "\u2a92", + glj: "\u2aa4", + gnap: "\u2a8a", + gnapprox: "\u2a8a", + gne: "\u2a88", + gnE: "\u2269", + gneq: "\u2a88", + gneqq: "\u2269", + gnsim: "\u22e7", + Gopf: "\ud835\udd3e", + gopf: "\ud835\udd58", + grave: "`", + GreaterEqual: "\u2265", + GreaterEqualLess: "\u22db", + GreaterFullEqual: "\u2267", + GreaterGreater: "\u2aa2", + GreaterLess: "\u2277", + GreaterSlantEqual: "\u2a7e", + GreaterTilde: "\u2273", + Gscr: "\ud835\udca2", + gscr: "\u210a", + gsim: "\u2273", + gsime: "\u2a8e", + gsiml: "\u2a90", + gtcc: "\u2aa7", + gtcir: "\u2a7a", + gt: ">", + GT: ">", + Gt: "\u226b", + gtdot: "\u22d7", + gtlPar: "\u2995", + gtquest: "\u2a7c", + gtrapprox: "\u2a86", + gtrarr: "\u2978", + gtrdot: "\u22d7", + gtreqless: "\u22db", + gtreqqless: "\u2a8c", + gtrless: "\u2277", + gtrsim: "\u2273", + gvertneqq: "\u2269\ufe00", + gvnE: "\u2269\ufe00", + Hacek: "\u02c7", + hairsp: "\u200a", + half: "\xbd", + hamilt: "\u210b", + HARDcy: "\u042a", + hardcy: "\u044a", + harrcir: "\u2948", + harr: "\u2194", + hArr: "\u21d4", + harrw: "\u21ad", + Hat: "^", + hbar: "\u210f", + Hcirc: "\u0124", + hcirc: "\u0125", + hearts: "\u2665", + heartsuit: "\u2665", + hellip: "\u2026", + hercon: "\u22b9", + hfr: "\ud835\udd25", + Hfr: "\u210c", + HilbertSpace: "\u210b", + hksearow: "\u2925", + hkswarow: "\u2926", + hoarr: "\u21ff", + homtht: "\u223b", + hookleftarrow: "\u21a9", + hookrightarrow: "\u21aa", + hopf: "\ud835\udd59", + Hopf: "\u210d", + horbar: "\u2015", + HorizontalLine: "\u2500", + hscr: "\ud835\udcbd", + Hscr: "\u210b", + hslash: "\u210f", + Hstrok: "\u0126", + hstrok: "\u0127", + HumpDownHump: "\u224e", + HumpEqual: "\u224f", + hybull: "\u2043", + hyphen: "\u2010", + Iacute: "\xcd", + iacute: "\xed", + ic: "\u2063", + Icirc: "\xce", + icirc: "\xee", + Icy: "\u0418", + icy: "\u0438", + Idot: "\u0130", + IEcy: "\u0415", + iecy: "\u0435", + iexcl: "\xa1", + iff: "\u21d4", + ifr: "\ud835\udd26", + Ifr: "\u2111", + Igrave: "\xcc", + igrave: "\xec", + ii: "\u2148", + iiiint: "\u2a0c", + iiint: "\u222d", + iinfin: "\u29dc", + iiota: "\u2129", + IJlig: "\u0132", + ijlig: "\u0133", + Imacr: "\u012a", + imacr: "\u012b", + image: "\u2111", + ImaginaryI: "\u2148", + imagline: "\u2110", + imagpart: "\u2111", + imath: "\u0131", + Im: "\u2111", + imof: "\u22b7", + imped: "\u01b5", + Implies: "\u21d2", + incare: "\u2105", + in: "\u2208", + infin: "\u221e", + infintie: "\u29dd", + inodot: "\u0131", + intcal: "\u22ba", + int: "\u222b", + Int: "\u222c", + integers: "\u2124", + Integral: "\u222b", + intercal: "\u22ba", + Intersection: "\u22c2", + intlarhk: "\u2a17", + intprod: "\u2a3c", + InvisibleComma: "\u2063", + InvisibleTimes: "\u2062", + IOcy: "\u0401", + iocy: "\u0451", + Iogon: "\u012e", + iogon: "\u012f", + Iopf: "\ud835\udd40", + iopf: "\ud835\udd5a", + Iota: "\u0399", + iota: "\u03b9", + iprod: "\u2a3c", + iquest: "\xbf", + iscr: "\ud835\udcbe", + Iscr: "\u2110", + isin: "\u2208", + isindot: "\u22f5", + isinE: "\u22f9", + isins: "\u22f4", + isinsv: "\u22f3", + isinv: "\u2208", + it: "\u2062", + Itilde: "\u0128", + itilde: "\u0129", + Iukcy: "\u0406", + iukcy: "\u0456", + Iuml: "\xcf", + iuml: "\xef", + Jcirc: "\u0134", + jcirc: "\u0135", + Jcy: "\u0419", + jcy: "\u0439", + Jfr: "\ud835\udd0d", + jfr: "\ud835\udd27", + jmath: "\u0237", + Jopf: "\ud835\udd41", + jopf: "\ud835\udd5b", + Jscr: "\ud835\udca5", + jscr: "\ud835\udcbf", + Jsercy: "\u0408", + jsercy: "\u0458", + Jukcy: "\u0404", + jukcy: "\u0454", + Kappa: "\u039a", + kappa: "\u03ba", + kappav: "\u03f0", + Kcedil: "\u0136", + kcedil: "\u0137", + Kcy: "\u041a", + kcy: "\u043a", + Kfr: "\ud835\udd0e", + kfr: "\ud835\udd28", + kgreen: "\u0138", + KHcy: "\u0425", + khcy: "\u0445", + KJcy: "\u040c", + kjcy: "\u045c", + Kopf: "\ud835\udd42", + kopf: "\ud835\udd5c", + Kscr: "\ud835\udca6", + kscr: "\ud835\udcc0", + lAarr: "\u21da", + Lacute: "\u0139", + lacute: "\u013a", + laemptyv: "\u29b4", + lagran: "\u2112", + Lambda: "\u039b", + lambda: "\u03bb", + lang: "\u27e8", + Lang: "\u27ea", + langd: "\u2991", + langle: "\u27e8", + lap: "\u2a85", + Laplacetrf: "\u2112", + laquo: "\xab", + larrb: "\u21e4", + larrbfs: "\u291f", + larr: "\u2190", + Larr: "\u219e", + lArr: "\u21d0", + larrfs: "\u291d", + larrhk: "\u21a9", + larrlp: "\u21ab", + larrpl: "\u2939", + larrsim: "\u2973", + larrtl: "\u21a2", + latail: "\u2919", + lAtail: "\u291b", + lat: "\u2aab", + late: "\u2aad", + lates: "\u2aad\ufe00", + lbarr: "\u290c", + lBarr: "\u290e", + lbbrk: "\u2772", + lbrace: "{", + lbrack: "[", + lbrke: "\u298b", + lbrksld: "\u298f", + lbrkslu: "\u298d", + Lcaron: "\u013d", + lcaron: "\u013e", + Lcedil: "\u013b", + lcedil: "\u013c", + lceil: "\u2308", + lcub: "{", + Lcy: "\u041b", + lcy: "\u043b", + ldca: "\u2936", + ldquo: "\u201c", + ldquor: "\u201e", + ldrdhar: "\u2967", + ldrushar: "\u294b", + ldsh: "\u21b2", + le: "\u2264", + lE: "\u2266", + LeftAngleBracket: "\u27e8", + LeftArrowBar: "\u21e4", + leftarrow: "\u2190", + LeftArrow: "\u2190", + Leftarrow: "\u21d0", + LeftArrowRightArrow: "\u21c6", + leftarrowtail: "\u21a2", + LeftCeiling: "\u2308", + LeftDoubleBracket: "\u27e6", + LeftDownTeeVector: "\u2961", + LeftDownVectorBar: "\u2959", + LeftDownVector: "\u21c3", + LeftFloor: "\u230a", + leftharpoondown: "\u21bd", + leftharpoonup: "\u21bc", + leftleftarrows: "\u21c7", + leftrightarrow: "\u2194", + LeftRightArrow: "\u2194", + Leftrightarrow: "\u21d4", + leftrightarrows: "\u21c6", + leftrightharpoons: "\u21cb", + leftrightsquigarrow: "\u21ad", + LeftRightVector: "\u294e", + LeftTeeArrow: "\u21a4", + LeftTee: "\u22a3", + LeftTeeVector: "\u295a", + leftthreetimes: "\u22cb", + LeftTriangleBar: "\u29cf", + LeftTriangle: "\u22b2", + LeftTriangleEqual: "\u22b4", + LeftUpDownVector: "\u2951", + LeftUpTeeVector: "\u2960", + LeftUpVectorBar: "\u2958", + LeftUpVector: "\u21bf", + LeftVectorBar: "\u2952", + LeftVector: "\u21bc", + lEg: "\u2a8b", + leg: "\u22da", + leq: "\u2264", + leqq: "\u2266", + leqslant: "\u2a7d", + lescc: "\u2aa8", + les: "\u2a7d", + lesdot: "\u2a7f", + lesdoto: "\u2a81", + lesdotor: "\u2a83", + lesg: "\u22da\ufe00", + lesges: "\u2a93", + lessapprox: "\u2a85", + lessdot: "\u22d6", + lesseqgtr: "\u22da", + lesseqqgtr: "\u2a8b", + LessEqualGreater: "\u22da", + LessFullEqual: "\u2266", + LessGreater: "\u2276", + lessgtr: "\u2276", + LessLess: "\u2aa1", + lesssim: "\u2272", + LessSlantEqual: "\u2a7d", + LessTilde: "\u2272", + lfisht: "\u297c", + lfloor: "\u230a", + Lfr: "\ud835\udd0f", + lfr: "\ud835\udd29", + lg: "\u2276", + lgE: "\u2a91", + lHar: "\u2962", + lhard: "\u21bd", + lharu: "\u21bc", + lharul: "\u296a", + lhblk: "\u2584", + LJcy: "\u0409", + ljcy: "\u0459", + llarr: "\u21c7", + ll: "\u226a", + Ll: "\u22d8", + llcorner: "\u231e", + Lleftarrow: "\u21da", + llhard: "\u296b", + lltri: "\u25fa", + Lmidot: "\u013f", + lmidot: "\u0140", + lmoustache: "\u23b0", + lmoust: "\u23b0", + lnap: "\u2a89", + lnapprox: "\u2a89", + lne: "\u2a87", + lnE: "\u2268", + lneq: "\u2a87", + lneqq: "\u2268", + lnsim: "\u22e6", + loang: "\u27ec", + loarr: "\u21fd", + lobrk: "\u27e6", + longleftarrow: "\u27f5", + LongLeftArrow: "\u27f5", + Longleftarrow: "\u27f8", + longleftrightarrow: "\u27f7", + LongLeftRightArrow: "\u27f7", + Longleftrightarrow: "\u27fa", + longmapsto: "\u27fc", + longrightarrow: "\u27f6", + LongRightArrow: "\u27f6", + Longrightarrow: "\u27f9", + looparrowleft: "\u21ab", + looparrowright: "\u21ac", + lopar: "\u2985", + Lopf: "\ud835\udd43", + lopf: "\ud835\udd5d", + loplus: "\u2a2d", + lotimes: "\u2a34", + lowast: "\u2217", + lowbar: "_", + LowerLeftArrow: "\u2199", + LowerRightArrow: "\u2198", + loz: "\u25ca", + lozenge: "\u25ca", + lozf: "\u29eb", + lpar: "(", + lparlt: "\u2993", + lrarr: "\u21c6", + lrcorner: "\u231f", + lrhar: "\u21cb", + lrhard: "\u296d", + lrm: "\u200e", + lrtri: "\u22bf", + lsaquo: "\u2039", + lscr: "\ud835\udcc1", + Lscr: "\u2112", + lsh: "\u21b0", + Lsh: "\u21b0", + lsim: "\u2272", + lsime: "\u2a8d", + lsimg: "\u2a8f", + lsqb: "[", + lsquo: "\u2018", + lsquor: "\u201a", + Lstrok: "\u0141", + lstrok: "\u0142", + ltcc: "\u2aa6", + ltcir: "\u2a79", + lt: "<", + LT: "<", + Lt: "\u226a", + ltdot: "\u22d6", + lthree: "\u22cb", + ltimes: "\u22c9", + ltlarr: "\u2976", + ltquest: "\u2a7b", + ltri: "\u25c3", + ltrie: "\u22b4", + ltrif: "\u25c2", + ltrPar: "\u2996", + lurdshar: "\u294a", + luruhar: "\u2966", + lvertneqq: "\u2268\ufe00", + lvnE: "\u2268\ufe00", + macr: "\xaf", + male: "\u2642", + malt: "\u2720", + maltese: "\u2720", + Map: "\u2905", + map: "\u21a6", + mapsto: "\u21a6", + mapstodown: "\u21a7", + mapstoleft: "\u21a4", + mapstoup: "\u21a5", + marker: "\u25ae", + mcomma: "\u2a29", + Mcy: "\u041c", + mcy: "\u043c", + mdash: "\u2014", + mDDot: "\u223a", + measuredangle: "\u2221", + MediumSpace: "\u205f", + Mellintrf: "\u2133", + Mfr: "\ud835\udd10", + mfr: "\ud835\udd2a", + mho: "\u2127", + micro: "\xb5", + midast: "*", + midcir: "\u2af0", + mid: "\u2223", + middot: "\xb7", + minusb: "\u229f", + minus: "\u2212", + minusd: "\u2238", + minusdu: "\u2a2a", + MinusPlus: "\u2213", + mlcp: "\u2adb", + mldr: "\u2026", + mnplus: "\u2213", + models: "\u22a7", + Mopf: "\ud835\udd44", + mopf: "\ud835\udd5e", + mp: "\u2213", + mscr: "\ud835\udcc2", + Mscr: "\u2133", + mstpos: "\u223e", + Mu: "\u039c", + mu: "\u03bc", + multimap: "\u22b8", + mumap: "\u22b8", + nabla: "\u2207", + Nacute: "\u0143", + nacute: "\u0144", + nang: "\u2220\u20d2", + nap: "\u2249", + napE: "\u2a70\u0338", + napid: "\u224b\u0338", + napos: "\u0149", + napprox: "\u2249", + natural: "\u266e", + naturals: "\u2115", + natur: "\u266e", + nbsp: "\xa0", + nbump: "\u224e\u0338", + nbumpe: "\u224f\u0338", + ncap: "\u2a43", + Ncaron: "\u0147", + ncaron: "\u0148", + Ncedil: "\u0145", + ncedil: "\u0146", + ncong: "\u2247", + ncongdot: "\u2a6d\u0338", + ncup: "\u2a42", + Ncy: "\u041d", + ncy: "\u043d", + ndash: "\u2013", + nearhk: "\u2924", + nearr: "\u2197", + neArr: "\u21d7", + nearrow: "\u2197", + ne: "\u2260", + nedot: "\u2250\u0338", + NegativeMediumSpace: "\u200b", + NegativeThickSpace: "\u200b", + NegativeThinSpace: "\u200b", + NegativeVeryThinSpace: "\u200b", + nequiv: "\u2262", + nesear: "\u2928", + nesim: "\u2242\u0338", + NestedGreaterGreater: "\u226b", + NestedLessLess: "\u226a", + NewLine: "\n", + nexist: "\u2204", + nexists: "\u2204", + Nfr: "\ud835\udd11", + nfr: "\ud835\udd2b", + ngE: "\u2267\u0338", + nge: "\u2271", + ngeq: "\u2271", + ngeqq: "\u2267\u0338", + ngeqslant: "\u2a7e\u0338", + nges: "\u2a7e\u0338", + nGg: "\u22d9\u0338", + ngsim: "\u2275", + nGt: "\u226b\u20d2", + ngt: "\u226f", + ngtr: "\u226f", + nGtv: "\u226b\u0338", + nharr: "\u21ae", + nhArr: "\u21ce", + nhpar: "\u2af2", + ni: "\u220b", + nis: "\u22fc", + nisd: "\u22fa", + niv: "\u220b", + NJcy: "\u040a", + njcy: "\u045a", + nlarr: "\u219a", + nlArr: "\u21cd", + nldr: "\u2025", + nlE: "\u2266\u0338", + nle: "\u2270", + nleftarrow: "\u219a", + nLeftarrow: "\u21cd", + nleftrightarrow: "\u21ae", + nLeftrightarrow: "\u21ce", + nleq: "\u2270", + nleqq: "\u2266\u0338", + nleqslant: "\u2a7d\u0338", + nles: "\u2a7d\u0338", + nless: "\u226e", + nLl: "\u22d8\u0338", + nlsim: "\u2274", + nLt: "\u226a\u20d2", + nlt: "\u226e", + nltri: "\u22ea", + nltrie: "\u22ec", + nLtv: "\u226a\u0338", + nmid: "\u2224", + NoBreak: "\u2060", + NonBreakingSpace: "\xa0", + nopf: "\ud835\udd5f", + Nopf: "\u2115", + Not: "\u2aec", + not: "\xac", + NotCongruent: "\u2262", + NotCupCap: "\u226d", + NotDoubleVerticalBar: "\u2226", + NotElement: "\u2209", + NotEqual: "\u2260", + NotEqualTilde: "\u2242\u0338", + NotExists: "\u2204", + NotGreater: "\u226f", + NotGreaterEqual: "\u2271", + NotGreaterFullEqual: "\u2267\u0338", + NotGreaterGreater: "\u226b\u0338", + NotGreaterLess: "\u2279", + NotGreaterSlantEqual: "\u2a7e\u0338", + NotGreaterTilde: "\u2275", + NotHumpDownHump: "\u224e\u0338", + NotHumpEqual: "\u224f\u0338", + notin: "\u2209", + notindot: "\u22f5\u0338", + notinE: "\u22f9\u0338", + notinva: "\u2209", + notinvb: "\u22f7", + notinvc: "\u22f6", + NotLeftTriangleBar: "\u29cf\u0338", + NotLeftTriangle: "\u22ea", + NotLeftTriangleEqual: "\u22ec", + NotLess: "\u226e", + NotLessEqual: "\u2270", + NotLessGreater: "\u2278", + NotLessLess: "\u226a\u0338", + NotLessSlantEqual: "\u2a7d\u0338", + NotLessTilde: "\u2274", + NotNestedGreaterGreater: "\u2aa2\u0338", + NotNestedLessLess: "\u2aa1\u0338", + notni: "\u220c", + notniva: "\u220c", + notnivb: "\u22fe", + notnivc: "\u22fd", + NotPrecedes: "\u2280", + NotPrecedesEqual: "\u2aaf\u0338", + NotPrecedesSlantEqual: "\u22e0", + NotReverseElement: "\u220c", + NotRightTriangleBar: "\u29d0\u0338", + NotRightTriangle: "\u22eb", + NotRightTriangleEqual: "\u22ed", + NotSquareSubset: "\u228f\u0338", + NotSquareSubsetEqual: "\u22e2", + NotSquareSuperset: "\u2290\u0338", + NotSquareSupersetEqual: "\u22e3", + NotSubset: "\u2282\u20d2", + NotSubsetEqual: "\u2288", + NotSucceeds: "\u2281", + NotSucceedsEqual: "\u2ab0\u0338", + NotSucceedsSlantEqual: "\u22e1", + NotSucceedsTilde: "\u227f\u0338", + NotSuperset: "\u2283\u20d2", + NotSupersetEqual: "\u2289", + NotTilde: "\u2241", + NotTildeEqual: "\u2244", + NotTildeFullEqual: "\u2247", + NotTildeTilde: "\u2249", + NotVerticalBar: "\u2224", + nparallel: "\u2226", + npar: "\u2226", + nparsl: "\u2afd\u20e5", + npart: "\u2202\u0338", + npolint: "\u2a14", + npr: "\u2280", + nprcue: "\u22e0", + nprec: "\u2280", + npreceq: "\u2aaf\u0338", + npre: "\u2aaf\u0338", + nrarrc: "\u2933\u0338", + nrarr: "\u219b", + nrArr: "\u21cf", + nrarrw: "\u219d\u0338", + nrightarrow: "\u219b", + nRightarrow: "\u21cf", + nrtri: "\u22eb", + nrtrie: "\u22ed", + nsc: "\u2281", + nsccue: "\u22e1", + nsce: "\u2ab0\u0338", + Nscr: "\ud835\udca9", + nscr: "\ud835\udcc3", + nshortmid: "\u2224", + nshortparallel: "\u2226", + nsim: "\u2241", + nsime: "\u2244", + nsimeq: "\u2244", + nsmid: "\u2224", + nspar: "\u2226", + nsqsube: "\u22e2", + nsqsupe: "\u22e3", + nsub: "\u2284", + nsubE: "\u2ac5\u0338", + nsube: "\u2288", + nsubset: "\u2282\u20d2", + nsubseteq: "\u2288", + nsubseteqq: "\u2ac5\u0338", + nsucc: "\u2281", + nsucceq: "\u2ab0\u0338", + nsup: "\u2285", + nsupE: "\u2ac6\u0338", + nsupe: "\u2289", + nsupset: "\u2283\u20d2", + nsupseteq: "\u2289", + nsupseteqq: "\u2ac6\u0338", + ntgl: "\u2279", + Ntilde: "\xd1", + ntilde: "\xf1", + ntlg: "\u2278", + ntriangleleft: "\u22ea", + ntrianglelefteq: "\u22ec", + ntriangleright: "\u22eb", + ntrianglerighteq: "\u22ed", + Nu: "\u039d", + nu: "\u03bd", + num: "#", + numero: "\u2116", + numsp: "\u2007", + nvap: "\u224d\u20d2", + nvdash: "\u22ac", + nvDash: "\u22ad", + nVdash: "\u22ae", + nVDash: "\u22af", + nvge: "\u2265\u20d2", + nvgt: ">\u20d2", + nvHarr: "\u2904", + nvinfin: "\u29de", + nvlArr: "\u2902", + nvle: "\u2264\u20d2", + nvlt: "<\u20d2", + nvltrie: "\u22b4\u20d2", + nvrArr: "\u2903", + nvrtrie: "\u22b5\u20d2", + nvsim: "\u223c\u20d2", + nwarhk: "\u2923", + nwarr: "\u2196", + nwArr: "\u21d6", + nwarrow: "\u2196", + nwnear: "\u2927", + Oacute: "\xd3", + oacute: "\xf3", + oast: "\u229b", + Ocirc: "\xd4", + ocirc: "\xf4", + ocir: "\u229a", + Ocy: "\u041e", + ocy: "\u043e", + odash: "\u229d", + Odblac: "\u0150", + odblac: "\u0151", + odiv: "\u2a38", + odot: "\u2299", + odsold: "\u29bc", + OElig: "\u0152", + oelig: "\u0153", + ofcir: "\u29bf", + Ofr: "\ud835\udd12", + ofr: "\ud835\udd2c", + ogon: "\u02db", + Ograve: "\xd2", + ograve: "\xf2", + ogt: "\u29c1", + ohbar: "\u29b5", + ohm: "\u03a9", + oint: "\u222e", + olarr: "\u21ba", + olcir: "\u29be", + olcross: "\u29bb", + oline: "\u203e", + olt: "\u29c0", + Omacr: "\u014c", + omacr: "\u014d", + Omega: "\u03a9", + omega: "\u03c9", + Omicron: "\u039f", + omicron: "\u03bf", + omid: "\u29b6", + ominus: "\u2296", + Oopf: "\ud835\udd46", + oopf: "\ud835\udd60", + opar: "\u29b7", + OpenCurlyDoubleQuote: "\u201c", + OpenCurlyQuote: "\u2018", + operp: "\u29b9", + oplus: "\u2295", + orarr: "\u21bb", + Or: "\u2a54", + or: "\u2228", + ord: "\u2a5d", + order: "\u2134", + orderof: "\u2134", + ordf: "\xaa", + ordm: "\xba", + origof: "\u22b6", + oror: "\u2a56", + orslope: "\u2a57", + orv: "\u2a5b", + oS: "\u24c8", + Oscr: "\ud835\udcaa", + oscr: "\u2134", + Oslash: "\xd8", + oslash: "\xf8", + osol: "\u2298", + Otilde: "\xd5", + otilde: "\xf5", + otimesas: "\u2a36", + Otimes: "\u2a37", + otimes: "\u2297", + Ouml: "\xd6", + ouml: "\xf6", + ovbar: "\u233d", + OverBar: "\u203e", + OverBrace: "\u23de", + OverBracket: "\u23b4", + OverParenthesis: "\u23dc", + para: "\xb6", + parallel: "\u2225", + par: "\u2225", + parsim: "\u2af3", + parsl: "\u2afd", + part: "\u2202", + PartialD: "\u2202", + Pcy: "\u041f", + pcy: "\u043f", + percnt: "%", + period: ".", + permil: "\u2030", + perp: "\u22a5", + pertenk: "\u2031", + Pfr: "\ud835\udd13", + pfr: "\ud835\udd2d", + Phi: "\u03a6", + phi: "\u03c6", + phiv: "\u03d5", + phmmat: "\u2133", + phone: "\u260e", + Pi: "\u03a0", + pi: "\u03c0", + pitchfork: "\u22d4", + piv: "\u03d6", + planck: "\u210f", + planckh: "\u210e", + plankv: "\u210f", + plusacir: "\u2a23", + plusb: "\u229e", + pluscir: "\u2a22", + plus: "+", + plusdo: "\u2214", + plusdu: "\u2a25", + pluse: "\u2a72", + PlusMinus: "\xb1", + plusmn: "\xb1", + plussim: "\u2a26", + plustwo: "\u2a27", + pm: "\xb1", + Poincareplane: "\u210c", + pointint: "\u2a15", + popf: "\ud835\udd61", + Popf: "\u2119", + pound: "\xa3", + prap: "\u2ab7", + Pr: "\u2abb", + pr: "\u227a", + prcue: "\u227c", + precapprox: "\u2ab7", + prec: "\u227a", + preccurlyeq: "\u227c", + Precedes: "\u227a", + PrecedesEqual: "\u2aaf", + PrecedesSlantEqual: "\u227c", + PrecedesTilde: "\u227e", + preceq: "\u2aaf", + precnapprox: "\u2ab9", + precneqq: "\u2ab5", + precnsim: "\u22e8", + pre: "\u2aaf", + prE: "\u2ab3", + precsim: "\u227e", + prime: "\u2032", + Prime: "\u2033", + primes: "\u2119", + prnap: "\u2ab9", + prnE: "\u2ab5", + prnsim: "\u22e8", + prod: "\u220f", + Product: "\u220f", + profalar: "\u232e", + profline: "\u2312", + profsurf: "\u2313", + prop: "\u221d", + Proportional: "\u221d", + Proportion: "\u2237", + propto: "\u221d", + prsim: "\u227e", + prurel: "\u22b0", + Pscr: "\ud835\udcab", + pscr: "\ud835\udcc5", + Psi: "\u03a8", + psi: "\u03c8", + puncsp: "\u2008", + Qfr: "\ud835\udd14", + qfr: "\ud835\udd2e", + qint: "\u2a0c", + qopf: "\ud835\udd62", + Qopf: "\u211a", + qprime: "\u2057", + Qscr: "\ud835\udcac", + qscr: "\ud835\udcc6", + quaternions: "\u210d", + quatint: "\u2a16", + quest: "?", + questeq: "\u225f", + quot: '"', + QUOT: '"', + rAarr: "\u21db", + race: "\u223d\u0331", + Racute: "\u0154", + racute: "\u0155", + radic: "\u221a", + raemptyv: "\u29b3", + rang: "\u27e9", + Rang: "\u27eb", + rangd: "\u2992", + range: "\u29a5", + rangle: "\u27e9", + raquo: "\xbb", + rarrap: "\u2975", + rarrb: "\u21e5", + rarrbfs: "\u2920", + rarrc: "\u2933", + rarr: "\u2192", + Rarr: "\u21a0", + rArr: "\u21d2", + rarrfs: "\u291e", + rarrhk: "\u21aa", + rarrlp: "\u21ac", + rarrpl: "\u2945", + rarrsim: "\u2974", + Rarrtl: "\u2916", + rarrtl: "\u21a3", + rarrw: "\u219d", + ratail: "\u291a", + rAtail: "\u291c", + ratio: "\u2236", + rationals: "\u211a", + rbarr: "\u290d", + rBarr: "\u290f", + RBarr: "\u2910", + rbbrk: "\u2773", + rbrace: "}", + rbrack: "]", + rbrke: "\u298c", + rbrksld: "\u298e", + rbrkslu: "\u2990", + Rcaron: "\u0158", + rcaron: "\u0159", + Rcedil: "\u0156", + rcedil: "\u0157", + rceil: "\u2309", + rcub: "}", + Rcy: "\u0420", + rcy: "\u0440", + rdca: "\u2937", + rdldhar: "\u2969", + rdquo: "\u201d", + rdquor: "\u201d", + rdsh: "\u21b3", + real: "\u211c", + realine: "\u211b", + realpart: "\u211c", + reals: "\u211d", + Re: "\u211c", + rect: "\u25ad", + reg: "\xae", + REG: "\xae", + ReverseElement: "\u220b", + ReverseEquilibrium: "\u21cb", + ReverseUpEquilibrium: "\u296f", + rfisht: "\u297d", + rfloor: "\u230b", + rfr: "\ud835\udd2f", + Rfr: "\u211c", + rHar: "\u2964", + rhard: "\u21c1", + rharu: "\u21c0", + rharul: "\u296c", + Rho: "\u03a1", + rho: "\u03c1", + rhov: "\u03f1", + RightAngleBracket: "\u27e9", + RightArrowBar: "\u21e5", + rightarrow: "\u2192", + RightArrow: "\u2192", + Rightarrow: "\u21d2", + RightArrowLeftArrow: "\u21c4", + rightarrowtail: "\u21a3", + RightCeiling: "\u2309", + RightDoubleBracket: "\u27e7", + RightDownTeeVector: "\u295d", + RightDownVectorBar: "\u2955", + RightDownVector: "\u21c2", + RightFloor: "\u230b", + rightharpoondown: "\u21c1", + rightharpoonup: "\u21c0", + rightleftarrows: "\u21c4", + rightleftharpoons: "\u21cc", + rightrightarrows: "\u21c9", + rightsquigarrow: "\u219d", + RightTeeArrow: "\u21a6", + RightTee: "\u22a2", + RightTeeVector: "\u295b", + rightthreetimes: "\u22cc", + RightTriangleBar: "\u29d0", + RightTriangle: "\u22b3", + RightTriangleEqual: "\u22b5", + RightUpDownVector: "\u294f", + RightUpTeeVector: "\u295c", + RightUpVectorBar: "\u2954", + RightUpVector: "\u21be", + RightVectorBar: "\u2953", + RightVector: "\u21c0", + ring: "\u02da", + risingdotseq: "\u2253", + rlarr: "\u21c4", + rlhar: "\u21cc", + rlm: "\u200f", + rmoustache: "\u23b1", + rmoust: "\u23b1", + rnmid: "\u2aee", + roang: "\u27ed", + roarr: "\u21fe", + robrk: "\u27e7", + ropar: "\u2986", + ropf: "\ud835\udd63", + Ropf: "\u211d", + roplus: "\u2a2e", + rotimes: "\u2a35", + RoundImplies: "\u2970", + rpar: ")", + rpargt: "\u2994", + rppolint: "\u2a12", + rrarr: "\u21c9", + Rrightarrow: "\u21db", + rsaquo: "\u203a", + rscr: "\ud835\udcc7", + Rscr: "\u211b", + rsh: "\u21b1", + Rsh: "\u21b1", + rsqb: "]", + rsquo: "\u2019", + rsquor: "\u2019", + rthree: "\u22cc", + rtimes: "\u22ca", + rtri: "\u25b9", + rtrie: "\u22b5", + rtrif: "\u25b8", + rtriltri: "\u29ce", + RuleDelayed: "\u29f4", + ruluhar: "\u2968", + rx: "\u211e", + Sacute: "\u015a", + sacute: "\u015b", + sbquo: "\u201a", + scap: "\u2ab8", + Scaron: "\u0160", + scaron: "\u0161", + Sc: "\u2abc", + sc: "\u227b", + sccue: "\u227d", + sce: "\u2ab0", + scE: "\u2ab4", + Scedil: "\u015e", + scedil: "\u015f", + Scirc: "\u015c", + scirc: "\u015d", + scnap: "\u2aba", + scnE: "\u2ab6", + scnsim: "\u22e9", + scpolint: "\u2a13", + scsim: "\u227f", + Scy: "\u0421", + scy: "\u0441", + sdotb: "\u22a1", + sdot: "\u22c5", + sdote: "\u2a66", + searhk: "\u2925", + searr: "\u2198", + seArr: "\u21d8", + searrow: "\u2198", + sect: "\xa7", + semi: ";", + seswar: "\u2929", + setminus: "\u2216", + setmn: "\u2216", + sext: "\u2736", + Sfr: "\ud835\udd16", + sfr: "\ud835\udd30", + sfrown: "\u2322", + sharp: "\u266f", + SHCHcy: "\u0429", + shchcy: "\u0449", + SHcy: "\u0428", + shcy: "\u0448", + ShortDownArrow: "\u2193", + ShortLeftArrow: "\u2190", + shortmid: "\u2223", + shortparallel: "\u2225", + ShortRightArrow: "\u2192", + ShortUpArrow: "\u2191", + shy: "\xad", + Sigma: "\u03a3", + sigma: "\u03c3", + sigmaf: "\u03c2", + sigmav: "\u03c2", + sim: "\u223c", + simdot: "\u2a6a", + sime: "\u2243", + simeq: "\u2243", + simg: "\u2a9e", + simgE: "\u2aa0", + siml: "\u2a9d", + simlE: "\u2a9f", + simne: "\u2246", + simplus: "\u2a24", + simrarr: "\u2972", + slarr: "\u2190", + SmallCircle: "\u2218", + smallsetminus: "\u2216", + smashp: "\u2a33", + smeparsl: "\u29e4", + smid: "\u2223", + smile: "\u2323", + smt: "\u2aaa", + smte: "\u2aac", + smtes: "\u2aac\ufe00", + SOFTcy: "\u042c", + softcy: "\u044c", + solbar: "\u233f", + solb: "\u29c4", + sol: "/", + Sopf: "\ud835\udd4a", + sopf: "\ud835\udd64", + spades: "\u2660", + spadesuit: "\u2660", + spar: "\u2225", + sqcap: "\u2293", + sqcaps: "\u2293\ufe00", + sqcup: "\u2294", + sqcups: "\u2294\ufe00", + Sqrt: "\u221a", + sqsub: "\u228f", + sqsube: "\u2291", + sqsubset: "\u228f", + sqsubseteq: "\u2291", + sqsup: "\u2290", + sqsupe: "\u2292", + sqsupset: "\u2290", + sqsupseteq: "\u2292", + square: "\u25a1", + Square: "\u25a1", + SquareIntersection: "\u2293", + SquareSubset: "\u228f", + SquareSubsetEqual: "\u2291", + SquareSuperset: "\u2290", + SquareSupersetEqual: "\u2292", + SquareUnion: "\u2294", + squarf: "\u25aa", + squ: "\u25a1", + squf: "\u25aa", + srarr: "\u2192", + Sscr: "\ud835\udcae", + sscr: "\ud835\udcc8", + ssetmn: "\u2216", + ssmile: "\u2323", + sstarf: "\u22c6", + Star: "\u22c6", + star: "\u2606", + starf: "\u2605", + straightepsilon: "\u03f5", + straightphi: "\u03d5", + strns: "\xaf", + sub: "\u2282", + Sub: "\u22d0", + subdot: "\u2abd", + subE: "\u2ac5", + sube: "\u2286", + subedot: "\u2ac3", + submult: "\u2ac1", + subnE: "\u2acb", + subne: "\u228a", + subplus: "\u2abf", + subrarr: "\u2979", + subset: "\u2282", + Subset: "\u22d0", + subseteq: "\u2286", + subseteqq: "\u2ac5", + SubsetEqual: "\u2286", + subsetneq: "\u228a", + subsetneqq: "\u2acb", + subsim: "\u2ac7", + subsub: "\u2ad5", + subsup: "\u2ad3", + succapprox: "\u2ab8", + succ: "\u227b", + succcurlyeq: "\u227d", + Succeeds: "\u227b", + SucceedsEqual: "\u2ab0", + SucceedsSlantEqual: "\u227d", + SucceedsTilde: "\u227f", + succeq: "\u2ab0", + succnapprox: "\u2aba", + succneqq: "\u2ab6", + succnsim: "\u22e9", + succsim: "\u227f", + SuchThat: "\u220b", + sum: "\u2211", + Sum: "\u2211", + sung: "\u266a", + sup1: "\xb9", + sup2: "\xb2", + sup3: "\xb3", + sup: "\u2283", + Sup: "\u22d1", + supdot: "\u2abe", + supdsub: "\u2ad8", + supE: "\u2ac6", + supe: "\u2287", + supedot: "\u2ac4", + Superset: "\u2283", + SupersetEqual: "\u2287", + suphsol: "\u27c9", + suphsub: "\u2ad7", + suplarr: "\u297b", + supmult: "\u2ac2", + supnE: "\u2acc", + supne: "\u228b", + supplus: "\u2ac0", + supset: "\u2283", + Supset: "\u22d1", + supseteq: "\u2287", + supseteqq: "\u2ac6", + supsetneq: "\u228b", + supsetneqq: "\u2acc", + supsim: "\u2ac8", + supsub: "\u2ad4", + supsup: "\u2ad6", + swarhk: "\u2926", + swarr: "\u2199", + swArr: "\u21d9", + swarrow: "\u2199", + swnwar: "\u292a", + szlig: "\xdf", + Tab: "\t", + target: "\u2316", + Tau: "\u03a4", + tau: "\u03c4", + tbrk: "\u23b4", + Tcaron: "\u0164", + tcaron: "\u0165", + Tcedil: "\u0162", + tcedil: "\u0163", + Tcy: "\u0422", + tcy: "\u0442", + tdot: "\u20db", + telrec: "\u2315", + Tfr: "\ud835\udd17", + tfr: "\ud835\udd31", + there4: "\u2234", + therefore: "\u2234", + Therefore: "\u2234", + Theta: "\u0398", + theta: "\u03b8", + thetasym: "\u03d1", + thetav: "\u03d1", + thickapprox: "\u2248", + thicksim: "\u223c", + ThickSpace: "\u205f\u200a", + ThinSpace: "\u2009", + thinsp: "\u2009", + thkap: "\u2248", + thksim: "\u223c", + THORN: "\xde", + thorn: "\xfe", + tilde: "\u02dc", + Tilde: "\u223c", + TildeEqual: "\u2243", + TildeFullEqual: "\u2245", + TildeTilde: "\u2248", + timesbar: "\u2a31", + timesb: "\u22a0", + times: "\xd7", + timesd: "\u2a30", + tint: "\u222d", + toea: "\u2928", + topbot: "\u2336", + topcir: "\u2af1", + top: "\u22a4", + Topf: "\ud835\udd4b", + topf: "\ud835\udd65", + topfork: "\u2ada", + tosa: "\u2929", + tprime: "\u2034", + trade: "\u2122", + TRADE: "\u2122", + triangle: "\u25b5", + triangledown: "\u25bf", + triangleleft: "\u25c3", + trianglelefteq: "\u22b4", + triangleq: "\u225c", + triangleright: "\u25b9", + trianglerighteq: "\u22b5", + tridot: "\u25ec", + trie: "\u225c", + triminus: "\u2a3a", + TripleDot: "\u20db", + triplus: "\u2a39", + trisb: "\u29cd", + tritime: "\u2a3b", + trpezium: "\u23e2", + Tscr: "\ud835\udcaf", + tscr: "\ud835\udcc9", + TScy: "\u0426", + tscy: "\u0446", + TSHcy: "\u040b", + tshcy: "\u045b", + Tstrok: "\u0166", + tstrok: "\u0167", + twixt: "\u226c", + twoheadleftarrow: "\u219e", + twoheadrightarrow: "\u21a0", + Uacute: "\xda", + uacute: "\xfa", + uarr: "\u2191", + Uarr: "\u219f", + uArr: "\u21d1", + Uarrocir: "\u2949", + Ubrcy: "\u040e", + ubrcy: "\u045e", + Ubreve: "\u016c", + ubreve: "\u016d", + Ucirc: "\xdb", + ucirc: "\xfb", + Ucy: "\u0423", + ucy: "\u0443", + udarr: "\u21c5", + Udblac: "\u0170", + udblac: "\u0171", + udhar: "\u296e", + ufisht: "\u297e", + Ufr: "\ud835\udd18", + ufr: "\ud835\udd32", + Ugrave: "\xd9", + ugrave: "\xf9", + uHar: "\u2963", + uharl: "\u21bf", + uharr: "\u21be", + uhblk: "\u2580", + ulcorn: "\u231c", + ulcorner: "\u231c", + ulcrop: "\u230f", + ultri: "\u25f8", + Umacr: "\u016a", + umacr: "\u016b", + uml: "\xa8", + UnderBar: "_", + UnderBrace: "\u23df", + UnderBracket: "\u23b5", + UnderParenthesis: "\u23dd", + Union: "\u22c3", + UnionPlus: "\u228e", + Uogon: "\u0172", + uogon: "\u0173", + Uopf: "\ud835\udd4c", + uopf: "\ud835\udd66", + UpArrowBar: "\u2912", + uparrow: "\u2191", + UpArrow: "\u2191", + Uparrow: "\u21d1", + UpArrowDownArrow: "\u21c5", + updownarrow: "\u2195", + UpDownArrow: "\u2195", + Updownarrow: "\u21d5", + UpEquilibrium: "\u296e", + upharpoonleft: "\u21bf", + upharpoonright: "\u21be", + uplus: "\u228e", + UpperLeftArrow: "\u2196", + UpperRightArrow: "\u2197", + upsi: "\u03c5", + Upsi: "\u03d2", + upsih: "\u03d2", + Upsilon: "\u03a5", + upsilon: "\u03c5", + UpTeeArrow: "\u21a5", + UpTee: "\u22a5", + upuparrows: "\u21c8", + urcorn: "\u231d", + urcorner: "\u231d", + urcrop: "\u230e", + Uring: "\u016e", + uring: "\u016f", + urtri: "\u25f9", + Uscr: "\ud835\udcb0", + uscr: "\ud835\udcca", + utdot: "\u22f0", + Utilde: "\u0168", + utilde: "\u0169", + utri: "\u25b5", + utrif: "\u25b4", + uuarr: "\u21c8", + Uuml: "\xdc", + uuml: "\xfc", + uwangle: "\u29a7", + vangrt: "\u299c", + varepsilon: "\u03f5", + varkappa: "\u03f0", + varnothing: "\u2205", + varphi: "\u03d5", + varpi: "\u03d6", + varpropto: "\u221d", + varr: "\u2195", + vArr: "\u21d5", + varrho: "\u03f1", + varsigma: "\u03c2", + varsubsetneq: "\u228a\ufe00", + varsubsetneqq: "\u2acb\ufe00", + varsupsetneq: "\u228b\ufe00", + varsupsetneqq: "\u2acc\ufe00", + vartheta: "\u03d1", + vartriangleleft: "\u22b2", + vartriangleright: "\u22b3", + vBar: "\u2ae8", + Vbar: "\u2aeb", + vBarv: "\u2ae9", + Vcy: "\u0412", + vcy: "\u0432", + vdash: "\u22a2", + vDash: "\u22a8", + Vdash: "\u22a9", + VDash: "\u22ab", + Vdashl: "\u2ae6", + veebar: "\u22bb", + vee: "\u2228", + Vee: "\u22c1", + veeeq: "\u225a", + vellip: "\u22ee", + verbar: "|", + Verbar: "\u2016", + vert: "|", + Vert: "\u2016", + VerticalBar: "\u2223", + VerticalLine: "|", + VerticalSeparator: "\u2758", + VerticalTilde: "\u2240", + VeryThinSpace: "\u200a", + Vfr: "\ud835\udd19", + vfr: "\ud835\udd33", + vltri: "\u22b2", + vnsub: "\u2282\u20d2", + vnsup: "\u2283\u20d2", + Vopf: "\ud835\udd4d", + vopf: "\ud835\udd67", + vprop: "\u221d", + vrtri: "\u22b3", + Vscr: "\ud835\udcb1", + vscr: "\ud835\udccb", + vsubnE: "\u2acb\ufe00", + vsubne: "\u228a\ufe00", + vsupnE: "\u2acc\ufe00", + vsupne: "\u228b\ufe00", + Vvdash: "\u22aa", + vzigzag: "\u299a", + Wcirc: "\u0174", + wcirc: "\u0175", + wedbar: "\u2a5f", + wedge: "\u2227", + Wedge: "\u22c0", + wedgeq: "\u2259", + weierp: "\u2118", + Wfr: "\ud835\udd1a", + wfr: "\ud835\udd34", + Wopf: "\ud835\udd4e", + wopf: "\ud835\udd68", + wp: "\u2118", + wr: "\u2240", + wreath: "\u2240", + Wscr: "\ud835\udcb2", + wscr: "\ud835\udccc", + xcap: "\u22c2", + xcirc: "\u25ef", + xcup: "\u22c3", + xdtri: "\u25bd", + Xfr: "\ud835\udd1b", + xfr: "\ud835\udd35", + xharr: "\u27f7", + xhArr: "\u27fa", + Xi: "\u039e", + xi: "\u03be", + xlarr: "\u27f5", + xlArr: "\u27f8", + xmap: "\u27fc", + xnis: "\u22fb", + xodot: "\u2a00", + Xopf: "\ud835\udd4f", + xopf: "\ud835\udd69", + xoplus: "\u2a01", + xotime: "\u2a02", + xrarr: "\u27f6", + xrArr: "\u27f9", + Xscr: "\ud835\udcb3", + xscr: "\ud835\udccd", + xsqcup: "\u2a06", + xuplus: "\u2a04", + xutri: "\u25b3", + xvee: "\u22c1", + xwedge: "\u22c0", + Yacute: "\xdd", + yacute: "\xfd", + YAcy: "\u042f", + yacy: "\u044f", + Ycirc: "\u0176", + ycirc: "\u0177", + Ycy: "\u042b", + ycy: "\u044b", + yen: "\xa5", + Yfr: "\ud835\udd1c", + yfr: "\ud835\udd36", + YIcy: "\u0407", + yicy: "\u0457", + Yopf: "\ud835\udd50", + yopf: "\ud835\udd6a", + Yscr: "\ud835\udcb4", + yscr: "\ud835\udcce", + YUcy: "\u042e", + yucy: "\u044e", + yuml: "\xff", + Yuml: "\u0178", + Zacute: "\u0179", + zacute: "\u017a", + Zcaron: "\u017d", + zcaron: "\u017e", + Zcy: "\u0417", + zcy: "\u0437", + Zdot: "\u017b", + zdot: "\u017c", + zeetrf: "\u2128", + ZeroWidthSpace: "\u200b", + Zeta: "\u0396", + zeta: "\u03b6", + zfr: "\ud835\udd37", + Zfr: "\u2128", + ZHcy: "\u0416", + zhcy: "\u0436", + zigrarr: "\u21dd", + zopf: "\ud835\udd6b", + Zopf: "\u2124", + Zscr: "\ud835\udcb5", + zscr: "\ud835\udccf", + zwj: "\u200d", + zwnj: "\u200c" + }; + /*eslint quotes:0*/ var entities = require$$0; + var regex$4 = /[!-#%-\*,-\/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0A76\u0AF0\u0C84\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E4E\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD803[\uDF55-\uDF59]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC8\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDC3B\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71\uDEF7\uDEF8]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD81B[\uDE97-\uDE9A]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/; + var encodeCache = {}; + // Create a lookup array where anything but characters in `chars` string + // and alphanumeric chars is percent-encoded. + + function getEncodeCache(exclude) { + var i, ch, cache = encodeCache[exclude]; + if (cache) { + return cache; + } + cache = encodeCache[exclude] = []; + for (i = 0; i < 128; i++) { + ch = String.fromCharCode(i); + if (/^[0-9a-z]$/i.test(ch)) { + // always allow unencoded alphanumeric characters + cache.push(ch); + } else { + cache.push("%" + ("0" + i.toString(16).toUpperCase()).slice(-2)); + } + } + for (i = 0; i < exclude.length; i++) { + cache[exclude.charCodeAt(i)] = exclude[i]; + } + return cache; + } + // Encode unsafe characters with percent-encoding, skipping already + // encoded sequences. + + // - string - string to encode + // - exclude - list of characters to ignore (in addition to a-zA-Z0-9) + // - keepEscaped - don't encode '%' in a correct escape sequence (default: true) + + function encode$2(string, exclude, keepEscaped) { + var i, l, code, nextCode, cache, result = ""; + if (typeof exclude !== "string") { + // encode(string, keepEscaped) + keepEscaped = exclude; + exclude = encode$2.defaultChars; + } + if (typeof keepEscaped === "undefined") { + keepEscaped = true; + } + cache = getEncodeCache(exclude); + for (i = 0, l = string.length; i < l; i++) { + code = string.charCodeAt(i); + if (keepEscaped && code === 37 /* % */ && i + 2 < l) { + if (/^[0-9a-f]{2}$/i.test(string.slice(i + 1, i + 3))) { + result += string.slice(i, i + 3); + i += 2; + continue; + } + } + if (code < 128) { + result += cache[code]; + continue; + } + if (code >= 55296 && code <= 57343) { + if (code >= 55296 && code <= 56319 && i + 1 < l) { + nextCode = string.charCodeAt(i + 1); + if (nextCode >= 56320 && nextCode <= 57343) { + result += encodeURIComponent(string[i] + string[i + 1]); + i++; + continue; + } + } + result += "%EF%BF%BD"; + continue; + } + result += encodeURIComponent(string[i]); + } + return result; + } + encode$2.defaultChars = ";/?:@&=+$,-_.!~*'()#"; + encode$2.componentChars = "-_.!~*'()"; + var encode_1 = encode$2; + /* eslint-disable no-bitwise */ var decodeCache = {}; + function getDecodeCache(exclude) { + var i, ch, cache = decodeCache[exclude]; + if (cache) { + return cache; + } + cache = decodeCache[exclude] = []; + for (i = 0; i < 128; i++) { + ch = String.fromCharCode(i); + cache.push(ch); + } + for (i = 0; i < exclude.length; i++) { + ch = exclude.charCodeAt(i); + cache[ch] = "%" + ("0" + ch.toString(16).toUpperCase()).slice(-2); + } + return cache; + } + // Decode percent-encoded string. + + function decode$2(string, exclude) { + var cache; + if (typeof exclude !== "string") { + exclude = decode$2.defaultChars; + } + cache = getDecodeCache(exclude); + return string.replace(/(%[a-f0-9]{2})+/gi, (function(seq) { + var i, l, b1, b2, b3, b4, chr, result = ""; + for (i = 0, l = seq.length; i < l; i += 3) { + b1 = parseInt(seq.slice(i + 1, i + 3), 16); + if (b1 < 128) { + result += cache[b1]; + continue; + } + if ((b1 & 224) === 192 && i + 3 < l) { + // 110xxxxx 10xxxxxx + b2 = parseInt(seq.slice(i + 4, i + 6), 16); + if ((b2 & 192) === 128) { + chr = b1 << 6 & 1984 | b2 & 63; + if (chr < 128) { + result += "\ufffd\ufffd"; + } else { + result += String.fromCharCode(chr); + } + i += 3; + continue; + } + } + if ((b1 & 240) === 224 && i + 6 < l) { + // 1110xxxx 10xxxxxx 10xxxxxx + b2 = parseInt(seq.slice(i + 4, i + 6), 16); + b3 = parseInt(seq.slice(i + 7, i + 9), 16); + if ((b2 & 192) === 128 && (b3 & 192) === 128) { + chr = b1 << 12 & 61440 | b2 << 6 & 4032 | b3 & 63; + if (chr < 2048 || chr >= 55296 && chr <= 57343) { + result += "\ufffd\ufffd\ufffd"; + } else { + result += String.fromCharCode(chr); + } + i += 6; + continue; + } + } + if ((b1 & 248) === 240 && i + 9 < l) { + // 111110xx 10xxxxxx 10xxxxxx 10xxxxxx + b2 = parseInt(seq.slice(i + 4, i + 6), 16); + b3 = parseInt(seq.slice(i + 7, i + 9), 16); + b4 = parseInt(seq.slice(i + 10, i + 12), 16); + if ((b2 & 192) === 128 && (b3 & 192) === 128 && (b4 & 192) === 128) { + chr = b1 << 18 & 1835008 | b2 << 12 & 258048 | b3 << 6 & 4032 | b4 & 63; + if (chr < 65536 || chr > 1114111) { + result += "\ufffd\ufffd\ufffd\ufffd"; + } else { + chr -= 65536; + result += String.fromCharCode(55296 + (chr >> 10), 56320 + (chr & 1023)); + } + i += 9; + continue; + } + } + result += "\ufffd"; + } + return result; + })); + } + decode$2.defaultChars = ";/?:@&=+$,#"; + decode$2.componentChars = ""; + var decode_1 = decode$2; + var format$1 = function format(url) { + var result = ""; + result += url.protocol || ""; + result += url.slashes ? "//" : ""; + result += url.auth ? url.auth + "@" : ""; + if (url.hostname && url.hostname.indexOf(":") !== -1) { + // ipv6 address + result += "[" + url.hostname + "]"; + } else { + result += url.hostname || ""; + } + result += url.port ? ":" + url.port : ""; + result += url.pathname || ""; + result += url.search || ""; + result += url.hash || ""; + return result; + }; + // Copyright Joyent, Inc. and other Node contributors. + + // Changes from joyent/node: + + // 1. No leading slash in paths, + // e.g. in `url.parse('http://foo?bar')` pathname is ``, not `/` + + // 2. Backslashes are not replaced with slashes, + // so `http:\\example.org\` is treated like a relative path + + // 3. Trailing colon is treated like a part of the path, + // i.e. in `http://example.org:foo` pathname is `:foo` + + // 4. Nothing is URL-encoded in the resulting object, + // (in joyent/node some chars in auth and paths are encoded) + + // 5. `url.parse()` does not have `parseQueryString` argument + + // 6. Removed extraneous result properties: `host`, `path`, `query`, etc., + // which can be constructed using other parts of the url. + + function Url() { + this.protocol = null; + this.slashes = null; + this.auth = null; + this.port = null; + this.hostname = null; + this.hash = null; + this.search = null; + this.pathname = null; + } + // Reference: RFC 3986, RFC 1808, RFC 2396 + // define these here so at least they only have to be + // compiled once on the first module load. + var protocolPattern = /^([a-z0-9.+-]+:)/i, portPattern = /:[0-9]*$/, + // Special case for a simple path URL + simplePathPattern = /^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/, + // RFC 2396: characters reserved for delimiting URLs. + // We actually just auto-escape these. + delims = [ "<", ">", '"', "`", " ", "\r", "\n", "\t" ], + // RFC 2396: characters not allowed for various reasons. + unwise = [ "{", "}", "|", "\\", "^", "`" ].concat(delims), + // Allowed by RFCs, but cause of XSS attacks. Always escape these. + autoEscape = [ "'" ].concat(unwise), + // Characters that are never ever allowed in a hostname. + // Note that any invalid chars are also handled, but these + // are the ones that are *expected* to be seen, so we fast-path + // them. + nonHostChars = [ "%", "/", "?", ";", "#" ].concat(autoEscape), hostEndingChars = [ "/", "?", "#" ], hostnameMaxLen = 255, hostnamePartPattern = /^[+a-z0-9A-Z_-]{0,63}$/, hostnamePartStart = /^([+a-z0-9A-Z_-]{0,63})(.*)$/, + // protocols that can allow "unsafe" and "unwise" chars. + /* eslint-disable no-script-url */ + // protocols that never have a hostname. + hostlessProtocol = { + javascript: true, + "javascript:": true + }, + // protocols that always contain a // bit. + slashedProtocol = { + http: true, + https: true, + ftp: true, + gopher: true, + file: true, + "http:": true, + "https:": true, + "ftp:": true, + "gopher:": true, + "file:": true + }; + /* eslint-enable no-script-url */ function urlParse(url, slashesDenoteHost) { + if (url && url instanceof Url) { + return url; + } + var u = new Url; + u.parse(url, slashesDenoteHost); + return u; + } + Url.prototype.parse = function(url, slashesDenoteHost) { + var i, l, lowerProto, hec, slashes, rest = url; + // trim before proceeding. + // This is to support parse stuff like " http://foo.com \n" + rest = rest.trim(); + if (!slashesDenoteHost && url.split("#").length === 1) { + // Try fast path regexp + var simplePath = simplePathPattern.exec(rest); + if (simplePath) { + this.pathname = simplePath[1]; + if (simplePath[2]) { + this.search = simplePath[2]; + } + return this; + } + } + var proto = protocolPattern.exec(rest); + if (proto) { + proto = proto[0]; + lowerProto = proto.toLowerCase(); + this.protocol = proto; + rest = rest.substr(proto.length); + } + // figure out if it's got a host + // user@server is *always* interpreted as a hostname, and url + // resolution will treat //foo/bar as host=foo,path=bar because that's + // how the browser resolves relative URLs. + if (slashesDenoteHost || proto || rest.match(/^\/\/[^@\/]+@[^@\/]+/)) { + slashes = rest.substr(0, 2) === "//"; + if (slashes && !(proto && hostlessProtocol[proto])) { + rest = rest.substr(2); + this.slashes = true; + } + } + if (!hostlessProtocol[proto] && (slashes || proto && !slashedProtocol[proto])) { + // there's a hostname. + // the first instance of /, ?, ;, or # ends the host. + // If there is an @ in the hostname, then non-host chars *are* allowed + // to the left of the last @ sign, unless some host-ending character + // comes *before* the @-sign. + // URLs are obnoxious. + // ex: + // http://a@b@c/ => user:a@b host:c + // http://a@b?@c => user:a host:c path:/?@c + // v0.12 TODO(isaacs): This is not quite how Chrome does things. + // Review our test case against browsers more comprehensively. + // find the first instance of any hostEndingChars + var hostEnd = -1; + for (i = 0; i < hostEndingChars.length; i++) { + hec = rest.indexOf(hostEndingChars[i]); + if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) { + hostEnd = hec; + } + } + // at this point, either we have an explicit point where the + // auth portion cannot go past, or the last @ char is the decider. + var auth, atSign; + if (hostEnd === -1) { + // atSign can be anywhere. + atSign = rest.lastIndexOf("@"); + } else { + // atSign must be in auth portion. + // http://a@b/c@d => host:b auth:a path:/c@d + atSign = rest.lastIndexOf("@", hostEnd); + } + // Now we have a portion which is definitely the auth. + // Pull that off. + if (atSign !== -1) { + auth = rest.slice(0, atSign); + rest = rest.slice(atSign + 1); + this.auth = auth; + } + // the host is the remaining to the left of the first non-host char + hostEnd = -1; + for (i = 0; i < nonHostChars.length; i++) { + hec = rest.indexOf(nonHostChars[i]); + if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) { + hostEnd = hec; + } + } + // if we still have not hit it, then the entire thing is a host. + if (hostEnd === -1) { + hostEnd = rest.length; + } + if (rest[hostEnd - 1] === ":") { + hostEnd--; + } + var host = rest.slice(0, hostEnd); + rest = rest.slice(hostEnd); + // pull out port. + this.parseHost(host); + // we've indicated that there is a hostname, + // so even if it's empty, it has to be present. + this.hostname = this.hostname || ""; + // if hostname begins with [ and ends with ] + // assume that it's an IPv6 address. + var ipv6Hostname = this.hostname[0] === "[" && this.hostname[this.hostname.length - 1] === "]"; + // validate a little. + if (!ipv6Hostname) { + var hostparts = this.hostname.split(/\./); + for (i = 0, l = hostparts.length; i < l; i++) { + var part = hostparts[i]; + if (!part) { + continue; + } + if (!part.match(hostnamePartPattern)) { + var newpart = ""; + for (var j = 0, k = part.length; j < k; j++) { + if (part.charCodeAt(j) > 127) { + // we replace non-ASCII char with a temporary placeholder + // we need this to make sure size of hostname is not + // broken by replacing non-ASCII by nothing + newpart += "x"; + } else { + newpart += part[j]; + } + } + // we test again with ASCII char only + if (!newpart.match(hostnamePartPattern)) { + var validParts = hostparts.slice(0, i); + var notHost = hostparts.slice(i + 1); + var bit = part.match(hostnamePartStart); + if (bit) { + validParts.push(bit[1]); + notHost.unshift(bit[2]); + } + if (notHost.length) { + rest = notHost.join(".") + rest; + } + this.hostname = validParts.join("."); + break; + } + } + } + } + if (this.hostname.length > hostnameMaxLen) { + this.hostname = ""; + } + // strip [ and ] from the hostname + // the host field still retains them, though + if (ipv6Hostname) { + this.hostname = this.hostname.substr(1, this.hostname.length - 2); + } + } + // chop off from the tail first. + var hash = rest.indexOf("#"); + if (hash !== -1) { + // got a fragment string. + this.hash = rest.substr(hash); + rest = rest.slice(0, hash); + } + var qm = rest.indexOf("?"); + if (qm !== -1) { + this.search = rest.substr(qm); + rest = rest.slice(0, qm); + } + if (rest) { + this.pathname = rest; + } + if (slashedProtocol[lowerProto] && this.hostname && !this.pathname) { + this.pathname = ""; + } + return this; + }; + Url.prototype.parseHost = function(host) { + var port = portPattern.exec(host); + if (port) { + port = port[0]; + if (port !== ":") { + this.port = port.substr(1); + } + host = host.substr(0, host.length - port.length); + } + if (host) { + this.hostname = host; + } + }; + var parse$1 = urlParse; + var encode$1 = encode_1; + var decode$1 = decode_1; + var format = format$1; + var parse = parse$1; + var mdurl = { + encode: encode$1, + decode: decode$1, + format: format, + parse: parse + }; + var regex$3 = /[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/; + var regex$2 = /[\0-\x1F\x7F-\x9F]/; + var regex$1 = /[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804[\uDCBD\uDCCD]|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/; + var regex = /[ \xA0\u1680\u2000-\u200A\u2028\u2029\u202F\u205F\u3000]/; + var Any = regex$3; + var Cc = regex$2; + var Cf = regex$1; + var P = regex$4; + var Z = regex; + var uc_micro = { + Any: Any, + Cc: Cc, + Cf: Cf, + P: P, + Z: Z + }; + var utils = createCommonjsModule((function(module, exports) { + function _class(obj) { + return Object.prototype.toString.call(obj); + } + function isString(obj) { + return _class(obj) === "[object String]"; + } + var _hasOwnProperty = Object.prototype.hasOwnProperty; + function has(object, key) { + return _hasOwnProperty.call(object, key); + } + // Merge objects + + function assign(obj /*from1, from2, from3, ...*/) { + var sources = Array.prototype.slice.call(arguments, 1); + sources.forEach((function(source) { + if (!source) { + return; + } + if (typeof source !== "object") { + throw new TypeError(source + "must be object"); + } + Object.keys(source).forEach((function(key) { + obj[key] = source[key]; + })); + })); + return obj; + } + // Remove element from array and put another array at those position. + // Useful for some operations with tokens + function arrayReplaceAt(src, pos, newElements) { + return [].concat(src.slice(0, pos), newElements, src.slice(pos + 1)); + } + //////////////////////////////////////////////////////////////////////////////// + function isValidEntityCode(c) { + /*eslint no-bitwise:0*/ + // broken sequence + if (c >= 55296 && c <= 57343) { + return false; + } + // never used + if (c >= 64976 && c <= 65007) { + return false; + } + if ((c & 65535) === 65535 || (c & 65535) === 65534) { + return false; + } + // control codes + if (c >= 0 && c <= 8) { + return false; + } + if (c === 11) { + return false; + } + if (c >= 14 && c <= 31) { + return false; + } + if (c >= 127 && c <= 159) { + return false; + } + // out of range + if (c > 1114111) { + return false; + } + return true; + } + function fromCodePoint(c) { + /*eslint no-bitwise:0*/ + if (c > 65535) { + c -= 65536; + var surrogate1 = 55296 + (c >> 10), surrogate2 = 56320 + (c & 1023); + return String.fromCharCode(surrogate1, surrogate2); + } + return String.fromCharCode(c); + } + var UNESCAPE_MD_RE = /\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g; + var ENTITY_RE = /&([a-z#][a-z0-9]{1,31});/gi; + var UNESCAPE_ALL_RE = new RegExp(UNESCAPE_MD_RE.source + "|" + ENTITY_RE.source, "gi"); + var DIGITAL_ENTITY_TEST_RE = /^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i; + function replaceEntityPattern(match, name) { + var code = 0; + if (has(entities, name)) { + return entities[name]; + } + if (name.charCodeAt(0) === 35 /* # */ && DIGITAL_ENTITY_TEST_RE.test(name)) { + code = name[1].toLowerCase() === "x" ? parseInt(name.slice(2), 16) : parseInt(name.slice(1), 10); + if (isValidEntityCode(code)) { + return fromCodePoint(code); + } + } + return match; + } + /*function replaceEntities(str) { + if (str.indexOf('&') < 0) { return str; } + + return str.replace(ENTITY_RE, replaceEntityPattern); + }*/ function unescapeMd(str) { + if (str.indexOf("\\") < 0) { + return str; + } + return str.replace(UNESCAPE_MD_RE, "$1"); + } + function unescapeAll(str) { + if (str.indexOf("\\") < 0 && str.indexOf("&") < 0) { + return str; + } + return str.replace(UNESCAPE_ALL_RE, (function(match, escaped, entity) { + if (escaped) { + return escaped; + } + return replaceEntityPattern(match, entity); + })); + } + //////////////////////////////////////////////////////////////////////////////// + var HTML_ESCAPE_TEST_RE = /[&<>"]/; + var HTML_ESCAPE_REPLACE_RE = /[&<>"]/g; + var HTML_REPLACEMENTS = { + "&": "&", + "<": "<", + ">": ">", + '"': """ + }; + function replaceUnsafeChar(ch) { + return HTML_REPLACEMENTS[ch]; + } + function escapeHtml(str) { + if (HTML_ESCAPE_TEST_RE.test(str)) { + return str.replace(HTML_ESCAPE_REPLACE_RE, replaceUnsafeChar); + } + return str; + } + //////////////////////////////////////////////////////////////////////////////// + var REGEXP_ESCAPE_RE = /[.?*+^$[\]\\(){}|-]/g; + function escapeRE(str) { + return str.replace(REGEXP_ESCAPE_RE, "\\$&"); + } + //////////////////////////////////////////////////////////////////////////////// + function isSpace(code) { + switch (code) { + case 9: + case 32: + return true; + } + return false; + } + // Zs (unicode class) || [\t\f\v\r\n] + function isWhiteSpace(code) { + if (code >= 8192 && code <= 8202) { + return true; + } + switch (code) { + case 9: + // \t + case 10: + // \n + case 11: + // \v + case 12: + // \f + case 13: + // \r + case 32: + case 160: + case 5760: + case 8239: + case 8287: + case 12288: + return true; + } + return false; + } + //////////////////////////////////////////////////////////////////////////////// + /*eslint-disable max-len*/ + // Currently without astral characters support. + function isPunctChar(ch) { + return regex$4.test(ch); + } + // Markdown ASCII punctuation characters. + + // !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~ + // http://spec.commonmark.org/0.15/#ascii-punctuation-character + + // Don't confuse with unicode punctuation !!! It lacks some chars in ascii range. + + function isMdAsciiPunct(ch) { + switch (ch) { + case 33 /* ! */ : + case 34 /* " */ : + case 35 /* # */ : + case 36 /* $ */ : + case 37 /* % */ : + case 38 /* & */ : + case 39 /* ' */ : + case 40 /* ( */ : + case 41 /* ) */ : + case 42 /* * */ : + case 43 /* + */ : + case 44 /* , */ : + case 45 /* - */ : + case 46 /* . */ : + case 47 /* / */ : + case 58 /* : */ : + case 59 /* ; */ : + case 60 /* < */ : + case 61 /* = */ : + case 62 /* > */ : + case 63 /* ? */ : + case 64 /* @ */ : + case 91 /* [ */ : + case 92 /* \ */ : + case 93 /* ] */ : + case 94 /* ^ */ : + case 95 /* _ */ : + case 96 /* ` */ : + case 123 /* { */ : + case 124 /* | */ : + case 125 /* } */ : + case 126 /* ~ */ : + return true; + + default: + return false; + } + } + // Hepler to unify [reference labels]. + + function normalizeReference(str) { + // Trim and collapse whitespace + str = str.trim().replace(/\s+/g, " "); + // In node v10 'ẞ'.toLowerCase() === 'Ṿ', which is presumed to be a bug + // fixed in v12 (couldn't find any details). + + // So treat this one as a special case + // (remove this when node v10 is no longer supported). + + if ("\u1e9e".toLowerCase() === "\u1e7e") { + str = str.replace(/\u1e9e/g, "\xdf"); + } + // .toLowerCase().toUpperCase() should get rid of all differences + // between letter variants. + + // Simple .toLowerCase() doesn't normalize 125 code points correctly, + // and .toUpperCase doesn't normalize 6 of them (list of exceptions: + // İ, ϴ, ẞ, Ω, K, Å - those are already uppercased, but have differently + // uppercased versions). + + // Here's an example showing how it happens. Lets take greek letter omega: + // uppercase U+0398 (Θ), U+03f4 (ϴ) and lowercase U+03b8 (θ), U+03d1 (ϑ) + + // Unicode entries: + // 0398;GREEK CAPITAL LETTER THETA;Lu;0;L;;;;;N;;;;03B8; + // 03B8;GREEK SMALL LETTER THETA;Ll;0;L;;;;;N;;;0398;;0398 + // 03D1;GREEK THETA SYMBOL;Ll;0;L;<compat> 03B8;;;;N;GREEK SMALL LETTER SCRIPT THETA;;0398;;0398 + // 03F4;GREEK CAPITAL THETA SYMBOL;Lu;0;L;<compat> 0398;;;;N;;;;03B8; + + // Case-insensitive comparison should treat all of them as equivalent. + + // But .toLowerCase() doesn't change ϑ (it's already lowercase), + // and .toUpperCase() doesn't change ϴ (already uppercase). + + // Applying first lower then upper case normalizes any character: + // '\u0398\u03f4\u03b8\u03d1'.toLowerCase().toUpperCase() === '\u0398\u0398\u0398\u0398' + + // Note: this is equivalent to unicode case folding; unicode normalization + // is a different step that is not required here. + + // Final result should be uppercased, because it's later stored in an object + // (this avoid a conflict with Object.prototype members, + // most notably, `__proto__`) + + return str.toLowerCase().toUpperCase(); + } + //////////////////////////////////////////////////////////////////////////////// + // Re-export libraries commonly used in both markdown-it and its plugins, + // so plugins won't have to depend on them explicitly, which reduces their + // bundled size (e.g. a browser build). + + exports.lib = {}; + exports.lib.mdurl = mdurl; + exports.lib.ucmicro = uc_micro; + exports.assign = assign; + exports.isString = isString; + exports.has = has; + exports.unescapeMd = unescapeMd; + exports.unescapeAll = unescapeAll; + exports.isValidEntityCode = isValidEntityCode; + exports.fromCodePoint = fromCodePoint; + // exports.replaceEntities = replaceEntities; + exports.escapeHtml = escapeHtml; + exports.arrayReplaceAt = arrayReplaceAt; + exports.isSpace = isSpace; + exports.isWhiteSpace = isWhiteSpace; + exports.isMdAsciiPunct = isMdAsciiPunct; + exports.isPunctChar = isPunctChar; + exports.escapeRE = escapeRE; + exports.normalizeReference = normalizeReference; + })); + // Parse link label + var parse_link_label = function parseLinkLabel(state, start, disableNested) { + var level, found, marker, prevPos, labelEnd = -1, max = state.posMax, oldPos = state.pos; + state.pos = start + 1; + level = 1; + while (state.pos < max) { + marker = state.src.charCodeAt(state.pos); + if (marker === 93 /* ] */) { + level--; + if (level === 0) { + found = true; + break; + } + } + prevPos = state.pos; + state.md.inline.skipToken(state); + if (marker === 91 /* [ */) { + if (prevPos === state.pos - 1) { + // increase level if we find text `[`, which is not a part of any token + level++; + } else if (disableNested) { + state.pos = oldPos; + return -1; + } + } + } + if (found) { + labelEnd = state.pos; + } + // restore old state + state.pos = oldPos; + return labelEnd; + }; + var unescapeAll$2 = utils.unescapeAll; + var parse_link_destination = function parseLinkDestination(str, pos, max) { + var code, level, lines = 0, start = pos, result = { + ok: false, + pos: 0, + lines: 0, + str: "" + }; + if (str.charCodeAt(pos) === 60 /* < */) { + pos++; + while (pos < max) { + code = str.charCodeAt(pos); + if (code === 10 /* \n */) { + return result; + } + if (code === 60 /* < */) { + return result; + } + if (code === 62 /* > */) { + result.pos = pos + 1; + result.str = unescapeAll$2(str.slice(start + 1, pos)); + result.ok = true; + return result; + } + if (code === 92 /* \ */ && pos + 1 < max) { + pos += 2; + continue; + } + pos++; + } + // no closing '>' + return result; + } + // this should be ... } else { ... branch + level = 0; + while (pos < max) { + code = str.charCodeAt(pos); + if (code === 32) { + break; + } + // ascii control characters + if (code < 32 || code === 127) { + break; + } + if (code === 92 /* \ */ && pos + 1 < max) { + if (str.charCodeAt(pos + 1) === 32) { + break; + } + pos += 2; + continue; + } + if (code === 40 /* ( */) { + level++; + if (level > 32) { + return result; + } + } + if (code === 41 /* ) */) { + if (level === 0) { + break; + } + level--; + } + pos++; + } + if (start === pos) { + return result; + } + if (level !== 0) { + return result; + } + result.str = unescapeAll$2(str.slice(start, pos)); + result.lines = lines; + result.pos = pos; + result.ok = true; + return result; + }; + var unescapeAll$1 = utils.unescapeAll; + var parse_link_title = function parseLinkTitle(str, pos, max) { + var code, marker, lines = 0, start = pos, result = { + ok: false, + pos: 0, + lines: 0, + str: "" + }; + if (pos >= max) { + return result; + } + marker = str.charCodeAt(pos); + if (marker !== 34 /* " */ && marker !== 39 /* ' */ && marker !== 40 /* ( */) { + return result; + } + pos++; + // if opening marker is "(", switch it to closing marker ")" + if (marker === 40) { + marker = 41; + } + while (pos < max) { + code = str.charCodeAt(pos); + if (code === marker) { + result.pos = pos + 1; + result.lines = lines; + result.str = unescapeAll$1(str.slice(start + 1, pos)); + result.ok = true; + return result; + } else if (code === 40 /* ( */ && marker === 41 /* ) */) { + return result; + } else if (code === 10) { + lines++; + } else if (code === 92 /* \ */ && pos + 1 < max) { + pos++; + if (str.charCodeAt(pos) === 10) { + lines++; + } + } + pos++; + } + return result; + }; + var parseLinkLabel = parse_link_label; + var parseLinkDestination = parse_link_destination; + var parseLinkTitle = parse_link_title; + var helpers = { + parseLinkLabel: parseLinkLabel, + parseLinkDestination: parseLinkDestination, + parseLinkTitle: parseLinkTitle + }; + var assign$1 = utils.assign; + var unescapeAll = utils.unescapeAll; + var escapeHtml = utils.escapeHtml; + //////////////////////////////////////////////////////////////////////////////// + var default_rules = {}; + default_rules.code_inline = function(tokens, idx, options, env, slf) { + var token = tokens[idx]; + return "<code" + slf.renderAttrs(token) + ">" + escapeHtml(tokens[idx].content) + "</code>"; + }; + default_rules.code_block = function(tokens, idx, options, env, slf) { + var token = tokens[idx]; + return "<pre" + slf.renderAttrs(token) + "><code>" + escapeHtml(tokens[idx].content) + "</code></pre>\n"; + }; + default_rules.fence = function(tokens, idx, options, env, slf) { + var token = tokens[idx], info = token.info ? unescapeAll(token.info).trim() : "", langName = "", langAttrs = "", highlighted, i, arr, tmpAttrs, tmpToken; + if (info) { + arr = info.split(/(\s+)/g); + langName = arr[0]; + langAttrs = arr.slice(2).join(""); + } + if (options.highlight) { + highlighted = options.highlight(token.content, langName, langAttrs) || escapeHtml(token.content); + } else { + highlighted = escapeHtml(token.content); + } + if (highlighted.indexOf("<pre") === 0) { + return highlighted + "\n"; + } + // If language exists, inject class gently, without modifying original token. + // May be, one day we will add .deepClone() for token and simplify this part, but + // now we prefer to keep things local. + if (info) { + i = token.attrIndex("class"); + tmpAttrs = token.attrs ? token.attrs.slice() : []; + if (i < 0) { + tmpAttrs.push([ "class", options.langPrefix + langName ]); + } else { + tmpAttrs[i] = tmpAttrs[i].slice(); + tmpAttrs[i][1] += " " + options.langPrefix + langName; + } + // Fake token just to render attributes + tmpToken = { + attrs: tmpAttrs + }; + return "<pre><code" + slf.renderAttrs(tmpToken) + ">" + highlighted + "</code></pre>\n"; + } + return "<pre><code" + slf.renderAttrs(token) + ">" + highlighted + "</code></pre>\n"; + }; + default_rules.image = function(tokens, idx, options, env, slf) { + var token = tokens[idx]; + // "alt" attr MUST be set, even if empty. Because it's mandatory and + // should be placed on proper position for tests. + + // Replace content with actual value + token.attrs[token.attrIndex("alt")][1] = slf.renderInlineAsText(token.children, options, env); + return slf.renderToken(tokens, idx, options); + }; + default_rules.hardbreak = function(tokens, idx, options /*, env */) { + return options.xhtmlOut ? "<br />\n" : "<br>\n"; + }; + default_rules.softbreak = function(tokens, idx, options /*, env */) { + return options.breaks ? options.xhtmlOut ? "<br />\n" : "<br>\n" : "\n"; + }; + default_rules.text = function(tokens, idx /*, options, env */) { + return escapeHtml(tokens[idx].content); + }; + default_rules.html_block = function(tokens, idx /*, options, env */) { + return tokens[idx].content; + }; + default_rules.html_inline = function(tokens, idx /*, options, env */) { + return tokens[idx].content; + }; + /** + * new Renderer() + * + * Creates new [[Renderer]] instance and fill [[Renderer#rules]] with defaults. + **/ function Renderer() { + /** + * Renderer#rules -> Object + * + * Contains render rules for tokens. Can be updated and extended. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.renderer.rules.strong_open = function () { return '<b>'; }; + * md.renderer.rules.strong_close = function () { return '</b>'; }; + * + * var result = md.renderInline(...); + * ``` + * + * Each rule is called as independent static function with fixed signature: + * + * ```javascript + * function my_token_render(tokens, idx, options, env, renderer) { + * // ... + * return renderedHTML; + * } + * ``` + * + * See [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js) + * for more details and examples. + **/ + this.rules = assign$1({}, default_rules); + } + /** + * Renderer.renderAttrs(token) -> String + * + * Render token attributes to string. + **/ Renderer.prototype.renderAttrs = function renderAttrs(token) { + var i, l, result; + if (!token.attrs) { + return ""; + } + result = ""; + for (i = 0, l = token.attrs.length; i < l; i++) { + result += " " + escapeHtml(token.attrs[i][0]) + '="' + escapeHtml(token.attrs[i][1]) + '"'; + } + return result; + }; + /** + * Renderer.renderToken(tokens, idx, options) -> String + * - tokens (Array): list of tokens + * - idx (Numbed): token index to render + * - options (Object): params of parser instance + * + * Default token renderer. Can be overriden by custom function + * in [[Renderer#rules]]. + **/ Renderer.prototype.renderToken = function renderToken(tokens, idx, options) { + var nextToken, result = "", needLf = false, token = tokens[idx]; + // Tight list paragraphs + if (token.hidden) { + return ""; + } + // Insert a newline between hidden paragraph and subsequent opening + // block-level tag. + + // For example, here we should insert a newline before blockquote: + // - a + // > + + if (token.block && token.nesting !== -1 && idx && tokens[idx - 1].hidden) { + result += "\n"; + } + // Add token name, e.g. `<img` + result += (token.nesting === -1 ? "</" : "<") + token.tag; + // Encode attributes, e.g. `<img src="foo"` + result += this.renderAttrs(token); + // Add a slash for self-closing tags, e.g. `<img src="foo" /` + if (token.nesting === 0 && options.xhtmlOut) { + result += " /"; + } + // Check if we need to add a newline after this tag + if (token.block) { + needLf = true; + if (token.nesting === 1) { + if (idx + 1 < tokens.length) { + nextToken = tokens[idx + 1]; + if (nextToken.type === "inline" || nextToken.hidden) { + // Block-level tag containing an inline tag. + needLf = false; + } else if (nextToken.nesting === -1 && nextToken.tag === token.tag) { + // Opening tag + closing tag of the same type. E.g. `<li></li>`. + needLf = false; + } + } + } + } + result += needLf ? ">\n" : ">"; + return result; + }; + /** + * Renderer.renderInline(tokens, options, env) -> String + * - tokens (Array): list on block tokens to render + * - options (Object): params of parser instance + * - env (Object): additional data from parsed input (references, for example) + * + * The same as [[Renderer.render]], but for single token of `inline` type. + **/ Renderer.prototype.renderInline = function(tokens, options, env) { + var type, result = "", rules = this.rules; + for (var i = 0, len = tokens.length; i < len; i++) { + type = tokens[i].type; + if (typeof rules[type] !== "undefined") { + result += rules[type](tokens, i, options, env, this); + } else { + result += this.renderToken(tokens, i, options); + } + } + return result; + }; + /** internal + * Renderer.renderInlineAsText(tokens, options, env) -> String + * - tokens (Array): list on block tokens to render + * - options (Object): params of parser instance + * - env (Object): additional data from parsed input (references, for example) + * + * Special kludge for image `alt` attributes to conform CommonMark spec. + * Don't try to use it! Spec requires to show `alt` content with stripped markup, + * instead of simple escaping. + **/ Renderer.prototype.renderInlineAsText = function(tokens, options, env) { + var result = ""; + for (var i = 0, len = tokens.length; i < len; i++) { + if (tokens[i].type === "text") { + result += tokens[i].content; + } else if (tokens[i].type === "image") { + result += this.renderInlineAsText(tokens[i].children, options, env); + } else if (tokens[i].type === "softbreak") { + result += "\n"; + } + } + return result; + }; + /** + * Renderer.render(tokens, options, env) -> String + * - tokens (Array): list on block tokens to render + * - options (Object): params of parser instance + * - env (Object): additional data from parsed input (references, for example) + * + * Takes token stream and generates HTML. Probably, you will never need to call + * this method directly. + **/ Renderer.prototype.render = function(tokens, options, env) { + var i, len, type, result = "", rules = this.rules; + for (i = 0, len = tokens.length; i < len; i++) { + type = tokens[i].type; + if (type === "inline") { + result += this.renderInline(tokens[i].children, options, env); + } else if (typeof rules[type] !== "undefined") { + result += rules[tokens[i].type](tokens, i, options, env, this); + } else { + result += this.renderToken(tokens, i, options, env); + } + } + return result; + }; + var renderer = Renderer; + /** + * class Ruler + * + * Helper class, used by [[MarkdownIt#core]], [[MarkdownIt#block]] and + * [[MarkdownIt#inline]] to manage sequences of functions (rules): + * + * - keep rules in defined order + * - assign the name to each rule + * - enable/disable rules + * - add/replace rules + * - allow assign rules to additional named chains (in the same) + * - cacheing lists of active rules + * + * You will not need use this class directly until write plugins. For simple + * rules control use [[MarkdownIt.disable]], [[MarkdownIt.enable]] and + * [[MarkdownIt.use]]. + **/ + /** + * new Ruler() + **/ function Ruler() { + // List of added rules. Each element is: + // { + // name: XXX, + // enabled: Boolean, + // fn: Function(), + // alt: [ name2, name3 ] + // } + this.__rules__ = []; + // Cached rule chains. + + // First level - chain name, '' for default. + // Second level - diginal anchor for fast filtering by charcodes. + + this.__cache__ = null; + } + //////////////////////////////////////////////////////////////////////////////// + // Helper methods, should not be used directly + // Find rule index by name + + Ruler.prototype.__find__ = function(name) { + for (var i = 0; i < this.__rules__.length; i++) { + if (this.__rules__[i].name === name) { + return i; + } + } + return -1; + }; + // Build rules lookup cache + + Ruler.prototype.__compile__ = function() { + var self = this; + var chains = [ "" ]; + // collect unique names + self.__rules__.forEach((function(rule) { + if (!rule.enabled) { + return; + } + rule.alt.forEach((function(altName) { + if (chains.indexOf(altName) < 0) { + chains.push(altName); + } + })); + })); + self.__cache__ = {}; + chains.forEach((function(chain) { + self.__cache__[chain] = []; + self.__rules__.forEach((function(rule) { + if (!rule.enabled) { + return; + } + if (chain && rule.alt.indexOf(chain) < 0) { + return; + } + self.__cache__[chain].push(rule.fn); + })); + })); + }; + /** + * Ruler.at(name, fn [, options]) + * - name (String): rule name to replace. + * - fn (Function): new rule function. + * - options (Object): new rule options (not mandatory). + * + * Replace rule by name with new function & options. Throws error if name not + * found. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * Replace existing typographer replacement rule with new one: + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.core.ruler.at('replacements', function replace(state) { + * //... + * }); + * ``` + **/ Ruler.prototype.at = function(name, fn, options) { + var index = this.__find__(name); + var opt = options || {}; + if (index === -1) { + throw new Error("Parser rule not found: " + name); + } + this.__rules__[index].fn = fn; + this.__rules__[index].alt = opt.alt || []; + this.__cache__ = null; + }; + /** + * Ruler.before(beforeName, ruleName, fn [, options]) + * - beforeName (String): new rule will be added before this one. + * - ruleName (String): name of added rule. + * - fn (Function): rule function. + * - options (Object): rule options (not mandatory). + * + * Add new rule to chain before one with given name. See also + * [[Ruler.after]], [[Ruler.push]]. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.block.ruler.before('paragraph', 'my_rule', function replace(state) { + * //... + * }); + * ``` + **/ Ruler.prototype.before = function(beforeName, ruleName, fn, options) { + var index = this.__find__(beforeName); + var opt = options || {}; + if (index === -1) { + throw new Error("Parser rule not found: " + beforeName); + } + this.__rules__.splice(index, 0, { + name: ruleName, + enabled: true, + fn: fn, + alt: opt.alt || [] + }); + this.__cache__ = null; + }; + /** + * Ruler.after(afterName, ruleName, fn [, options]) + * - afterName (String): new rule will be added after this one. + * - ruleName (String): name of added rule. + * - fn (Function): rule function. + * - options (Object): rule options (not mandatory). + * + * Add new rule to chain after one with given name. See also + * [[Ruler.before]], [[Ruler.push]]. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.inline.ruler.after('text', 'my_rule', function replace(state) { + * //... + * }); + * ``` + **/ Ruler.prototype.after = function(afterName, ruleName, fn, options) { + var index = this.__find__(afterName); + var opt = options || {}; + if (index === -1) { + throw new Error("Parser rule not found: " + afterName); + } + this.__rules__.splice(index + 1, 0, { + name: ruleName, + enabled: true, + fn: fn, + alt: opt.alt || [] + }); + this.__cache__ = null; + }; + /** + * Ruler.push(ruleName, fn [, options]) + * - ruleName (String): name of added rule. + * - fn (Function): rule function. + * - options (Object): rule options (not mandatory). + * + * Push new rule to the end of chain. See also + * [[Ruler.before]], [[Ruler.after]]. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.core.ruler.push('my_rule', function replace(state) { + * //... + * }); + * ``` + **/ Ruler.prototype.push = function(ruleName, fn, options) { + var opt = options || {}; + this.__rules__.push({ + name: ruleName, + enabled: true, + fn: fn, + alt: opt.alt || [] + }); + this.__cache__ = null; + }; + /** + * Ruler.enable(list [, ignoreInvalid]) -> Array + * - list (String|Array): list of rule names to enable. + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Enable rules with given names. If any rule name not found - throw Error. + * Errors can be disabled by second param. + * + * Returns list of found rule names (if no exception happened). + * + * See also [[Ruler.disable]], [[Ruler.enableOnly]]. + **/ Ruler.prototype.enable = function(list, ignoreInvalid) { + if (!Array.isArray(list)) { + list = [ list ]; + } + var result = []; + // Search by name and enable + list.forEach((function(name) { + var idx = this.__find__(name); + if (idx < 0) { + if (ignoreInvalid) { + return; + } + throw new Error("Rules manager: invalid rule name " + name); + } + this.__rules__[idx].enabled = true; + result.push(name); + }), this); + this.__cache__ = null; + return result; + }; + /** + * Ruler.enableOnly(list [, ignoreInvalid]) + * - list (String|Array): list of rule names to enable (whitelist). + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Enable rules with given names, and disable everything else. If any rule name + * not found - throw Error. Errors can be disabled by second param. + * + * See also [[Ruler.disable]], [[Ruler.enable]]. + **/ Ruler.prototype.enableOnly = function(list, ignoreInvalid) { + if (!Array.isArray(list)) { + list = [ list ]; + } + this.__rules__.forEach((function(rule) { + rule.enabled = false; + })); + this.enable(list, ignoreInvalid); + }; + /** + * Ruler.disable(list [, ignoreInvalid]) -> Array + * - list (String|Array): list of rule names to disable. + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Disable rules with given names. If any rule name not found - throw Error. + * Errors can be disabled by second param. + * + * Returns list of found rule names (if no exception happened). + * + * See also [[Ruler.enable]], [[Ruler.enableOnly]]. + **/ Ruler.prototype.disable = function(list, ignoreInvalid) { + if (!Array.isArray(list)) { + list = [ list ]; + } + var result = []; + // Search by name and disable + list.forEach((function(name) { + var idx = this.__find__(name); + if (idx < 0) { + if (ignoreInvalid) { + return; + } + throw new Error("Rules manager: invalid rule name " + name); + } + this.__rules__[idx].enabled = false; + result.push(name); + }), this); + this.__cache__ = null; + return result; + }; + /** + * Ruler.getRules(chainName) -> Array + * + * Return array of active functions (rules) for given chain name. It analyzes + * rules configuration, compiles caches if not exists and returns result. + * + * Default chain name is `''` (empty string). It can't be skipped. That's + * done intentionally, to keep signature monomorphic for high speed. + **/ Ruler.prototype.getRules = function(chainName) { + if (this.__cache__ === null) { + this.__compile__(); + } + // Chain can be empty, if rules disabled. But we still have to return Array. + return this.__cache__[chainName] || []; + }; + var ruler = Ruler; + // Normalize input string + // https://spec.commonmark.org/0.29/#line-ending + var NEWLINES_RE = /\r\n?|\n/g; + var NULL_RE = /\0/g; + var normalize = function normalize(state) { + var str; + // Normalize newlines + str = state.src.replace(NEWLINES_RE, "\n"); + // Replace NULL characters + str = str.replace(NULL_RE, "\ufffd"); + state.src = str; + }; + var block = function block(state) { + var token; + if (state.inlineMode) { + token = new state.Token("inline", "", 0); + token.content = state.src; + token.map = [ 0, 1 ]; + token.children = []; + state.tokens.push(token); + } else { + state.md.block.parse(state.src, state.md, state.env, state.tokens); + } + }; + var inline = function inline(state) { + var tokens = state.tokens, tok, i, l; + // Parse inlines + for (i = 0, l = tokens.length; i < l; i++) { + tok = tokens[i]; + if (tok.type === "inline") { + state.md.inline.parse(tok.content, state.md, state.env, tok.children); + } + } + }; + var arrayReplaceAt = utils.arrayReplaceAt; + function isLinkOpen(str) { + return /^<a[>\s]/i.test(str); + } + function isLinkClose(str) { + return /^<\/a\s*>/i.test(str); + } + var linkify = function linkify(state) { + var i, j, l, tokens, token, currentToken, nodes, ln, text, pos, lastPos, level, htmlLinkLevel, url, fullUrl, urlText, blockTokens = state.tokens, links; + if (!state.md.options.linkify) { + return; + } + for (j = 0, l = blockTokens.length; j < l; j++) { + if (blockTokens[j].type !== "inline" || !state.md.linkify.pretest(blockTokens[j].content)) { + continue; + } + tokens = blockTokens[j].children; + htmlLinkLevel = 0; + // We scan from the end, to keep position when new tags added. + // Use reversed logic in links start/end match + for (i = tokens.length - 1; i >= 0; i--) { + currentToken = tokens[i]; + // Skip content of markdown links + if (currentToken.type === "link_close") { + i--; + while (tokens[i].level !== currentToken.level && tokens[i].type !== "link_open") { + i--; + } + continue; + } + // Skip content of html tag links + if (currentToken.type === "html_inline") { + if (isLinkOpen(currentToken.content) && htmlLinkLevel > 0) { + htmlLinkLevel--; + } + if (isLinkClose(currentToken.content)) { + htmlLinkLevel++; + } + } + if (htmlLinkLevel > 0) { + continue; + } + if (currentToken.type === "text" && state.md.linkify.test(currentToken.content)) { + text = currentToken.content; + links = state.md.linkify.match(text); + // Now split string to nodes + nodes = []; + level = currentToken.level; + lastPos = 0; + for (ln = 0; ln < links.length; ln++) { + url = links[ln].url; + fullUrl = state.md.normalizeLink(url); + if (!state.md.validateLink(fullUrl)) { + continue; + } + urlText = links[ln].text; + // Linkifier might send raw hostnames like "example.com", where url + // starts with domain name. So we prepend http:// in those cases, + // and remove it afterwards. + + if (!links[ln].schema) { + urlText = state.md.normalizeLinkText("http://" + urlText).replace(/^http:\/\//, ""); + } else if (links[ln].schema === "mailto:" && !/^mailto:/i.test(urlText)) { + urlText = state.md.normalizeLinkText("mailto:" + urlText).replace(/^mailto:/, ""); + } else { + urlText = state.md.normalizeLinkText(urlText); + } + pos = links[ln].index; + if (pos > lastPos) { + token = new state.Token("text", "", 0); + token.content = text.slice(lastPos, pos); + token.level = level; + nodes.push(token); + } + token = new state.Token("link_open", "a", 1); + token.attrs = [ [ "href", fullUrl ] ]; + token.level = level++; + token.markup = "linkify"; + token.info = "auto"; + nodes.push(token); + token = new state.Token("text", "", 0); + token.content = urlText; + token.level = level; + nodes.push(token); + token = new state.Token("link_close", "a", -1); + token.level = --level; + token.markup = "linkify"; + token.info = "auto"; + nodes.push(token); + lastPos = links[ln].lastIndex; + } + if (lastPos < text.length) { + token = new state.Token("text", "", 0); + token.content = text.slice(lastPos); + token.level = level; + nodes.push(token); + } + // replace current node + blockTokens[j].children = tokens = arrayReplaceAt(tokens, i, nodes); + } + } + } + }; + // Simple typographic replacements + // TODO: + // - fractionals 1/2, 1/4, 3/4 -> ½, ¼, ¾ + // - miltiplication 2 x 4 -> 2 × 4 + var RARE_RE = /\+-|\.\.|\?\?\?\?|!!!!|,,|--/; + // Workaround for phantomjs - need regex without /g flag, + // or root check will fail every second time + var SCOPED_ABBR_TEST_RE = /\((c|tm|r|p)\)/i; + var SCOPED_ABBR_RE = /\((c|tm|r|p)\)/gi; + var SCOPED_ABBR = { + c: "\xa9", + r: "\xae", + p: "\xa7", + tm: "\u2122" + }; + function replaceFn(match, name) { + return SCOPED_ABBR[name.toLowerCase()]; + } + function replace_scoped(inlineTokens) { + var i, token, inside_autolink = 0; + for (i = inlineTokens.length - 1; i >= 0; i--) { + token = inlineTokens[i]; + if (token.type === "text" && !inside_autolink) { + token.content = token.content.replace(SCOPED_ABBR_RE, replaceFn); + } + if (token.type === "link_open" && token.info === "auto") { + inside_autolink--; + } + if (token.type === "link_close" && token.info === "auto") { + inside_autolink++; + } + } + } + function replace_rare(inlineTokens) { + var i, token, inside_autolink = 0; + for (i = inlineTokens.length - 1; i >= 0; i--) { + token = inlineTokens[i]; + if (token.type === "text" && !inside_autolink) { + if (RARE_RE.test(token.content)) { + token.content = token.content.replace(/\+-/g, "\xb1").replace(/\.{2,}/g, "\u2026").replace(/([?!])\u2026/g, "$1..").replace(/([?!]){4,}/g, "$1$1$1").replace(/,{2,}/g, ",").replace(/(^|[^-])---(?=[^-]|$)/gm, "$1\u2014").replace(/(^|\s)--(?=\s|$)/gm, "$1\u2013").replace(/(^|[^-\s])--(?=[^-\s]|$)/gm, "$1\u2013"); + } + } + if (token.type === "link_open" && token.info === "auto") { + inside_autolink--; + } + if (token.type === "link_close" && token.info === "auto") { + inside_autolink++; + } + } + } + var replacements = function replace(state) { + var blkIdx; + if (!state.md.options.typographer) { + return; + } + for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) { + if (state.tokens[blkIdx].type !== "inline") { + continue; + } + if (SCOPED_ABBR_TEST_RE.test(state.tokens[blkIdx].content)) { + replace_scoped(state.tokens[blkIdx].children); + } + if (RARE_RE.test(state.tokens[blkIdx].content)) { + replace_rare(state.tokens[blkIdx].children); + } + } + }; + var isWhiteSpace$1 = utils.isWhiteSpace; + var isPunctChar$1 = utils.isPunctChar; + var isMdAsciiPunct$1 = utils.isMdAsciiPunct; + var QUOTE_TEST_RE = /['"]/; + var QUOTE_RE = /['"]/g; + var APOSTROPHE = "\u2019"; + /* ’ */ function replaceAt(str, index, ch) { + return str.substr(0, index) + ch + str.substr(index + 1); + } + function process_inlines(tokens, state) { + var i, token, text, t, pos, max, thisLevel, item, lastChar, nextChar, isLastPunctChar, isNextPunctChar, isLastWhiteSpace, isNextWhiteSpace, canOpen, canClose, j, isSingle, stack, openQuote, closeQuote; + stack = []; + for (i = 0; i < tokens.length; i++) { + token = tokens[i]; + thisLevel = tokens[i].level; + for (j = stack.length - 1; j >= 0; j--) { + if (stack[j].level <= thisLevel) { + break; + } + } + stack.length = j + 1; + if (token.type !== "text") { + continue; + } + text = token.content; + pos = 0; + max = text.length; + /*eslint no-labels:0,block-scoped-var:0*/ OUTER: while (pos < max) { + QUOTE_RE.lastIndex = pos; + t = QUOTE_RE.exec(text); + if (!t) { + break; + } + canOpen = canClose = true; + pos = t.index + 1; + isSingle = t[0] === "'"; + // Find previous character, + // default to space if it's the beginning of the line + + lastChar = 32; + if (t.index - 1 >= 0) { + lastChar = text.charCodeAt(t.index - 1); + } else { + for (j = i - 1; j >= 0; j--) { + if (tokens[j].type === "softbreak" || tokens[j].type === "hardbreak") break; + // lastChar defaults to 0x20 + if (!tokens[j].content) continue; + // should skip all tokens except 'text', 'html_inline' or 'code_inline' + lastChar = tokens[j].content.charCodeAt(tokens[j].content.length - 1); + break; + } + } + // Find next character, + // default to space if it's the end of the line + + nextChar = 32; + if (pos < max) { + nextChar = text.charCodeAt(pos); + } else { + for (j = i + 1; j < tokens.length; j++) { + if (tokens[j].type === "softbreak" || tokens[j].type === "hardbreak") break; + // nextChar defaults to 0x20 + if (!tokens[j].content) continue; + // should skip all tokens except 'text', 'html_inline' or 'code_inline' + nextChar = tokens[j].content.charCodeAt(0); + break; + } + } + isLastPunctChar = isMdAsciiPunct$1(lastChar) || isPunctChar$1(String.fromCharCode(lastChar)); + isNextPunctChar = isMdAsciiPunct$1(nextChar) || isPunctChar$1(String.fromCharCode(nextChar)); + isLastWhiteSpace = isWhiteSpace$1(lastChar); + isNextWhiteSpace = isWhiteSpace$1(nextChar); + if (isNextWhiteSpace) { + canOpen = false; + } else if (isNextPunctChar) { + if (!(isLastWhiteSpace || isLastPunctChar)) { + canOpen = false; + } + } + if (isLastWhiteSpace) { + canClose = false; + } else if (isLastPunctChar) { + if (!(isNextWhiteSpace || isNextPunctChar)) { + canClose = false; + } + } + if (nextChar === 34 /* " */ && t[0] === '"') { + if (lastChar >= 48 /* 0 */ && lastChar <= 57 /* 9 */) { + // special case: 1"" - count first quote as an inch + canClose = canOpen = false; + } + } + if (canOpen && canClose) { + // Replace quotes in the middle of punctuation sequence, but not + // in the middle of the words, i.e.: + // 1. foo " bar " baz - not replaced + // 2. foo-"-bar-"-baz - replaced + // 3. foo"bar"baz - not replaced + canOpen = isLastPunctChar; + canClose = isNextPunctChar; + } + if (!canOpen && !canClose) { + // middle of word + if (isSingle) { + token.content = replaceAt(token.content, t.index, APOSTROPHE); + } + continue; + } + if (canClose) { + // this could be a closing quote, rewind the stack to get a match + for (j = stack.length - 1; j >= 0; j--) { + item = stack[j]; + if (stack[j].level < thisLevel) { + break; + } + if (item.single === isSingle && stack[j].level === thisLevel) { + item = stack[j]; + if (isSingle) { + openQuote = state.md.options.quotes[2]; + closeQuote = state.md.options.quotes[3]; + } else { + openQuote = state.md.options.quotes[0]; + closeQuote = state.md.options.quotes[1]; + } + // replace token.content *before* tokens[item.token].content, + // because, if they are pointing at the same token, replaceAt + // could mess up indices when quote length != 1 + token.content = replaceAt(token.content, t.index, closeQuote); + tokens[item.token].content = replaceAt(tokens[item.token].content, item.pos, openQuote); + pos += closeQuote.length - 1; + if (item.token === i) { + pos += openQuote.length - 1; + } + text = token.content; + max = text.length; + stack.length = j; + continue OUTER; + } + } + } + if (canOpen) { + stack.push({ + token: i, + pos: t.index, + single: isSingle, + level: thisLevel + }); + } else if (canClose && isSingle) { + token.content = replaceAt(token.content, t.index, APOSTROPHE); + } + } + } + } + var smartquotes = function smartquotes(state) { + /*eslint max-depth:0*/ + var blkIdx; + if (!state.md.options.typographer) { + return; + } + for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) { + if (state.tokens[blkIdx].type !== "inline" || !QUOTE_TEST_RE.test(state.tokens[blkIdx].content)) { + continue; + } + process_inlines(state.tokens[blkIdx].children, state); + } + }; + // Token class + /** + * class Token + **/ + /** + * new Token(type, tag, nesting) + * + * Create new token and fill passed properties. + **/ function Token(type, tag, nesting) { + /** + * Token#type -> String + * + * Type of the token (string, e.g. "paragraph_open") + **/ + this.type = type; + /** + * Token#tag -> String + * + * html tag name, e.g. "p" + **/ this.tag = tag; + /** + * Token#attrs -> Array + * + * Html attributes. Format: `[ [ name1, value1 ], [ name2, value2 ] ]` + **/ this.attrs = null; + /** + * Token#map -> Array + * + * Source map info. Format: `[ line_begin, line_end ]` + **/ this.map = null; + /** + * Token#nesting -> Number + * + * Level change (number in {-1, 0, 1} set), where: + * + * - `1` means the tag is opening + * - `0` means the tag is self-closing + * - `-1` means the tag is closing + **/ this.nesting = nesting; + /** + * Token#level -> Number + * + * nesting level, the same as `state.level` + **/ this.level = 0; + /** + * Token#children -> Array + * + * An array of child nodes (inline and img tokens) + **/ this.children = null; + /** + * Token#content -> String + * + * In a case of self-closing tag (code, html, fence, etc.), + * it has contents of this tag. + **/ this.content = ""; + /** + * Token#markup -> String + * + * '*' or '_' for emphasis, fence string for fence, etc. + **/ this.markup = ""; + /** + * Token#info -> String + * + * Additional information: + * + * - Info string for "fence" tokens + * - The value "auto" for autolink "link_open" and "link_close" tokens + * - The string value of the item marker for ordered-list "list_item_open" tokens + **/ this.info = ""; + /** + * Token#meta -> Object + * + * A place for plugins to store an arbitrary data + **/ this.meta = null; + /** + * Token#block -> Boolean + * + * True for block-level tokens, false for inline tokens. + * Used in renderer to calculate line breaks + **/ this.block = false; + /** + * Token#hidden -> Boolean + * + * If it's true, ignore this element when rendering. Used for tight lists + * to hide paragraphs. + **/ this.hidden = false; + } + /** + * Token.attrIndex(name) -> Number + * + * Search attribute index by name. + **/ Token.prototype.attrIndex = function attrIndex(name) { + var attrs, i, len; + if (!this.attrs) { + return -1; + } + attrs = this.attrs; + for (i = 0, len = attrs.length; i < len; i++) { + if (attrs[i][0] === name) { + return i; + } + } + return -1; + }; + /** + * Token.attrPush(attrData) + * + * Add `[ name, value ]` attribute to list. Init attrs if necessary + **/ Token.prototype.attrPush = function attrPush(attrData) { + if (this.attrs) { + this.attrs.push(attrData); + } else { + this.attrs = [ attrData ]; + } + }; + /** + * Token.attrSet(name, value) + * + * Set `name` attribute to `value`. Override old value if exists. + **/ Token.prototype.attrSet = function attrSet(name, value) { + var idx = this.attrIndex(name), attrData = [ name, value ]; + if (idx < 0) { + this.attrPush(attrData); + } else { + this.attrs[idx] = attrData; + } + }; + /** + * Token.attrGet(name) + * + * Get the value of attribute `name`, or null if it does not exist. + **/ Token.prototype.attrGet = function attrGet(name) { + var idx = this.attrIndex(name), value = null; + if (idx >= 0) { + value = this.attrs[idx][1]; + } + return value; + }; + /** + * Token.attrJoin(name, value) + * + * Join value to existing attribute via space. Or create new attribute if not + * exists. Useful to operate with token classes. + **/ Token.prototype.attrJoin = function attrJoin(name, value) { + var idx = this.attrIndex(name); + if (idx < 0) { + this.attrPush([ name, value ]); + } else { + this.attrs[idx][1] = this.attrs[idx][1] + " " + value; + } + }; + var token = Token; + function StateCore(src, md, env) { + this.src = src; + this.env = env; + this.tokens = []; + this.inlineMode = false; + this.md = md; + // link to parser instance + } + // re-export Token class to use in core rules + StateCore.prototype.Token = token; + var state_core = StateCore; + var _rules$2 = [ [ "normalize", normalize ], [ "block", block ], [ "inline", inline ], [ "linkify", linkify ], [ "replacements", replacements ], [ "smartquotes", smartquotes ] ]; + /** + * new Core() + **/ function Core() { + /** + * Core#ruler -> Ruler + * + * [[Ruler]] instance. Keep configuration of core rules. + **/ + this.ruler = new ruler; + for (var i = 0; i < _rules$2.length; i++) { + this.ruler.push(_rules$2[i][0], _rules$2[i][1]); + } + } + /** + * Core.process(state) + * + * Executes core chain rules. + **/ Core.prototype.process = function(state) { + var i, l, rules; + rules = this.ruler.getRules(""); + for (i = 0, l = rules.length; i < l; i++) { + rules[i](state); + } + }; + Core.prototype.State = state_core; + var parser_core = Core; + var isSpace$a = utils.isSpace; + function getLine(state, line) { + var pos = state.bMarks[line] + state.tShift[line], max = state.eMarks[line]; + return state.src.substr(pos, max - pos); + } + function escapedSplit(str) { + var result = [], pos = 0, max = str.length, ch, isEscaped = false, lastPos = 0, current = ""; + ch = str.charCodeAt(pos); + while (pos < max) { + if (ch === 124 /* | */) { + if (!isEscaped) { + // pipe separating cells, '|' + result.push(current + str.substring(lastPos, pos)); + current = ""; + lastPos = pos + 1; + } else { + // escaped pipe, '\|' + current += str.substring(lastPos, pos - 1); + lastPos = pos; + } + } + isEscaped = ch === 92 /* \ */; + pos++; + ch = str.charCodeAt(pos); + } + result.push(current + str.substring(lastPos)); + return result; + } + var table = function table(state, startLine, endLine, silent) { + var ch, lineText, pos, i, l, nextLine, columns, columnCount, token, aligns, t, tableLines, tbodyLines, oldParentType, terminate, terminatorRules, firstCh, secondCh; + // should have at least two lines + if (startLine + 2 > endLine) { + return false; + } + nextLine = startLine + 1; + if (state.sCount[nextLine] < state.blkIndent) { + return false; + } + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[nextLine] - state.blkIndent >= 4) { + return false; + } + // first character of the second line should be '|', '-', ':', + // and no other characters are allowed but spaces; + // basically, this is the equivalent of /^[-:|][-:|\s]*$/ regexp + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + if (pos >= state.eMarks[nextLine]) { + return false; + } + firstCh = state.src.charCodeAt(pos++); + if (firstCh !== 124 /* | */ && firstCh !== 45 /* - */ && firstCh !== 58 /* : */) { + return false; + } + if (pos >= state.eMarks[nextLine]) { + return false; + } + secondCh = state.src.charCodeAt(pos++); + if (secondCh !== 124 /* | */ && secondCh !== 45 /* - */ && secondCh !== 58 /* : */ && !isSpace$a(secondCh)) { + return false; + } + // if first character is '-', then second character must not be a space + // (due to parsing ambiguity with list) + if (firstCh === 45 /* - */ && isSpace$a(secondCh)) { + return false; + } + while (pos < state.eMarks[nextLine]) { + ch = state.src.charCodeAt(pos); + if (ch !== 124 /* | */ && ch !== 45 /* - */ && ch !== 58 /* : */ && !isSpace$a(ch)) { + return false; + } + pos++; + } + lineText = getLine(state, startLine + 1); + columns = lineText.split("|"); + aligns = []; + for (i = 0; i < columns.length; i++) { + t = columns[i].trim(); + if (!t) { + // allow empty columns before and after table, but not in between columns; + // e.g. allow ` |---| `, disallow ` ---||--- ` + if (i === 0 || i === columns.length - 1) { + continue; + } else { + return false; + } + } + if (!/^:?-+:?$/.test(t)) { + return false; + } + if (t.charCodeAt(t.length - 1) === 58 /* : */) { + aligns.push(t.charCodeAt(0) === 58 /* : */ ? "center" : "right"); + } else if (t.charCodeAt(0) === 58 /* : */) { + aligns.push("left"); + } else { + aligns.push(""); + } + } + lineText = getLine(state, startLine).trim(); + if (lineText.indexOf("|") === -1) { + return false; + } + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + columns = escapedSplit(lineText); + if (columns.length && columns[0] === "") columns.shift(); + if (columns.length && columns[columns.length - 1] === "") columns.pop(); + // header row will define an amount of columns in the entire table, + // and align row should be exactly the same (the rest of the rows can differ) + columnCount = columns.length; + if (columnCount === 0 || columnCount !== aligns.length) { + return false; + } + if (silent) { + return true; + } + oldParentType = state.parentType; + state.parentType = "table"; + // use 'blockquote' lists for termination because it's + // the most similar to tables + terminatorRules = state.md.block.ruler.getRules("blockquote"); + token = state.push("table_open", "table", 1); + token.map = tableLines = [ startLine, 0 ]; + token = state.push("thead_open", "thead", 1); + token.map = [ startLine, startLine + 1 ]; + token = state.push("tr_open", "tr", 1); + token.map = [ startLine, startLine + 1 ]; + for (i = 0; i < columns.length; i++) { + token = state.push("th_open", "th", 1); + if (aligns[i]) { + token.attrs = [ [ "style", "text-align:" + aligns[i] ] ]; + } + token = state.push("inline", "", 0); + token.content = columns[i].trim(); + token.children = []; + token = state.push("th_close", "th", -1); + } + token = state.push("tr_close", "tr", -1); + token = state.push("thead_close", "thead", -1); + for (nextLine = startLine + 2; nextLine < endLine; nextLine++) { + if (state.sCount[nextLine] < state.blkIndent) { + break; + } + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + break; + } + lineText = getLine(state, nextLine).trim(); + if (!lineText) { + break; + } + if (state.sCount[nextLine] - state.blkIndent >= 4) { + break; + } + columns = escapedSplit(lineText); + if (columns.length && columns[0] === "") columns.shift(); + if (columns.length && columns[columns.length - 1] === "") columns.pop(); + if (nextLine === startLine + 2) { + token = state.push("tbody_open", "tbody", 1); + token.map = tbodyLines = [ startLine + 2, 0 ]; + } + token = state.push("tr_open", "tr", 1); + token.map = [ nextLine, nextLine + 1 ]; + for (i = 0; i < columnCount; i++) { + token = state.push("td_open", "td", 1); + if (aligns[i]) { + token.attrs = [ [ "style", "text-align:" + aligns[i] ] ]; + } + token = state.push("inline", "", 0); + token.content = columns[i] ? columns[i].trim() : ""; + token.children = []; + token = state.push("td_close", "td", -1); + } + token = state.push("tr_close", "tr", -1); + } + if (tbodyLines) { + token = state.push("tbody_close", "tbody", -1); + tbodyLines[1] = nextLine; + } + token = state.push("table_close", "table", -1); + tableLines[1] = nextLine; + state.parentType = oldParentType; + state.line = nextLine; + return true; + }; + // Code block (4 spaces padded) + var code = function code(state, startLine, endLine /*, silent*/) { + var nextLine, last, token; + if (state.sCount[startLine] - state.blkIndent < 4) { + return false; + } + last = nextLine = startLine + 1; + while (nextLine < endLine) { + if (state.isEmpty(nextLine)) { + nextLine++; + continue; + } + if (state.sCount[nextLine] - state.blkIndent >= 4) { + nextLine++; + last = nextLine; + continue; + } + break; + } + state.line = last; + token = state.push("code_block", "code", 0); + token.content = state.getLines(startLine, last, 4 + state.blkIndent, false) + "\n"; + token.map = [ startLine, state.line ]; + return true; + }; + // fences (``` lang, ~~~ lang) + var fence = function fence(state, startLine, endLine, silent) { + var marker, len, params, nextLine, mem, token, markup, haveEndMarker = false, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + if (pos + 3 > max) { + return false; + } + marker = state.src.charCodeAt(pos); + if (marker !== 126 /* ~ */ && marker !== 96 /* ` */) { + return false; + } + // scan marker length + mem = pos; + pos = state.skipChars(pos, marker); + len = pos - mem; + if (len < 3) { + return false; + } + markup = state.src.slice(mem, pos); + params = state.src.slice(pos, max); + if (marker === 96 /* ` */) { + if (params.indexOf(String.fromCharCode(marker)) >= 0) { + return false; + } + } + // Since start is found, we can report success here in validation mode + if (silent) { + return true; + } + // search end of block + nextLine = startLine; + for (;;) { + nextLine++; + if (nextLine >= endLine) { + // unclosed block should be autoclosed by end of document. + // also block seems to be autoclosed by end of parent + break; + } + pos = mem = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + if (pos < max && state.sCount[nextLine] < state.blkIndent) { + // non-empty line with negative indent should stop the list: + // - ``` + // test + break; + } + if (state.src.charCodeAt(pos) !== marker) { + continue; + } + if (state.sCount[nextLine] - state.blkIndent >= 4) { + // closing fence should be indented less than 4 spaces + continue; + } + pos = state.skipChars(pos, marker); + // closing code fence must be at least as long as the opening one + if (pos - mem < len) { + continue; + } + // make sure tail has spaces only + pos = state.skipSpaces(pos); + if (pos < max) { + continue; + } + haveEndMarker = true; + // found! + break; + } + // If a fence has heading spaces, they should be removed from its inner block + len = state.sCount[startLine]; + state.line = nextLine + (haveEndMarker ? 1 : 0); + token = state.push("fence", "code", 0); + token.info = params; + token.content = state.getLines(startLine + 1, nextLine, len, true); + token.markup = markup; + token.map = [ startLine, state.line ]; + return true; + }; + var isSpace$9 = utils.isSpace; + var blockquote = function blockquote(state, startLine, endLine, silent) { + var adjustTab, ch, i, initial, l, lastLineEmpty, lines, nextLine, offset, oldBMarks, oldBSCount, oldIndent, oldParentType, oldSCount, oldTShift, spaceAfterMarker, terminate, terminatorRules, token, isOutdented, oldLineMax = state.lineMax, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + // check the block quote marker + if (state.src.charCodeAt(pos++) !== 62 /* > */) { + return false; + } + // we know that it's going to be a valid blockquote, + // so no point trying to find the end of it in silent mode + if (silent) { + return true; + } + // set offset past spaces and ">" + initial = offset = state.sCount[startLine] + 1; + // skip one optional space after '>' + if (state.src.charCodeAt(pos) === 32 /* space */) { + // ' > test ' + // ^ -- position start of line here: + pos++; + initial++; + offset++; + adjustTab = false; + spaceAfterMarker = true; + } else if (state.src.charCodeAt(pos) === 9 /* tab */) { + spaceAfterMarker = true; + if ((state.bsCount[startLine] + offset) % 4 === 3) { + // ' >\t test ' + // ^ -- position start of line here (tab has width===1) + pos++; + initial++; + offset++; + adjustTab = false; + } else { + // ' >\t test ' + // ^ -- position start of line here + shift bsCount slightly + // to make extra space appear + adjustTab = true; + } + } else { + spaceAfterMarker = false; + } + oldBMarks = [ state.bMarks[startLine] ]; + state.bMarks[startLine] = pos; + while (pos < max) { + ch = state.src.charCodeAt(pos); + if (isSpace$9(ch)) { + if (ch === 9) { + offset += 4 - (offset + state.bsCount[startLine] + (adjustTab ? 1 : 0)) % 4; + } else { + offset++; + } + } else { + break; + } + pos++; + } + oldBSCount = [ state.bsCount[startLine] ]; + state.bsCount[startLine] = state.sCount[startLine] + 1 + (spaceAfterMarker ? 1 : 0); + lastLineEmpty = pos >= max; + oldSCount = [ state.sCount[startLine] ]; + state.sCount[startLine] = offset - initial; + oldTShift = [ state.tShift[startLine] ]; + state.tShift[startLine] = pos - state.bMarks[startLine]; + terminatorRules = state.md.block.ruler.getRules("blockquote"); + oldParentType = state.parentType; + state.parentType = "blockquote"; + // Search the end of the block + + // Block ends with either: + // 1. an empty line outside: + // ``` + // > test + + // ``` + // 2. an empty line inside: + // ``` + // > + // test + // ``` + // 3. another tag: + // ``` + // > test + // - - - + // ``` + for (nextLine = startLine + 1; nextLine < endLine; nextLine++) { + // check if it's outdented, i.e. it's inside list item and indented + // less than said list item: + // ``` + // 1. anything + // > current blockquote + // 2. checking this line + // ``` + isOutdented = state.sCount[nextLine] < state.blkIndent; + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + if (pos >= max) { + // Case 1: line is not inside the blockquote, and this line is empty. + break; + } + if (state.src.charCodeAt(pos++) === 62 /* > */ && !isOutdented) { + // This line is inside the blockquote. + // set offset past spaces and ">" + initial = offset = state.sCount[nextLine] + 1; + // skip one optional space after '>' + if (state.src.charCodeAt(pos) === 32 /* space */) { + // ' > test ' + // ^ -- position start of line here: + pos++; + initial++; + offset++; + adjustTab = false; + spaceAfterMarker = true; + } else if (state.src.charCodeAt(pos) === 9 /* tab */) { + spaceAfterMarker = true; + if ((state.bsCount[nextLine] + offset) % 4 === 3) { + // ' >\t test ' + // ^ -- position start of line here (tab has width===1) + pos++; + initial++; + offset++; + adjustTab = false; + } else { + // ' >\t test ' + // ^ -- position start of line here + shift bsCount slightly + // to make extra space appear + adjustTab = true; + } + } else { + spaceAfterMarker = false; + } + oldBMarks.push(state.bMarks[nextLine]); + state.bMarks[nextLine] = pos; + while (pos < max) { + ch = state.src.charCodeAt(pos); + if (isSpace$9(ch)) { + if (ch === 9) { + offset += 4 - (offset + state.bsCount[nextLine] + (adjustTab ? 1 : 0)) % 4; + } else { + offset++; + } + } else { + break; + } + pos++; + } + lastLineEmpty = pos >= max; + oldBSCount.push(state.bsCount[nextLine]); + state.bsCount[nextLine] = state.sCount[nextLine] + 1 + (spaceAfterMarker ? 1 : 0); + oldSCount.push(state.sCount[nextLine]); + state.sCount[nextLine] = offset - initial; + oldTShift.push(state.tShift[nextLine]); + state.tShift[nextLine] = pos - state.bMarks[nextLine]; + continue; + } + // Case 2: line is not inside the blockquote, and the last line was empty. + if (lastLineEmpty) { + break; + } + // Case 3: another tag found. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + // Quirk to enforce "hard termination mode" for paragraphs; + // normally if you call `tokenize(state, startLine, nextLine)`, + // paragraphs will look below nextLine for paragraph continuation, + // but if blockquote is terminated by another tag, they shouldn't + state.lineMax = nextLine; + if (state.blkIndent !== 0) { + // state.blkIndent was non-zero, we now set it to zero, + // so we need to re-calculate all offsets to appear as + // if indent wasn't changed + oldBMarks.push(state.bMarks[nextLine]); + oldBSCount.push(state.bsCount[nextLine]); + oldTShift.push(state.tShift[nextLine]); + oldSCount.push(state.sCount[nextLine]); + state.sCount[nextLine] -= state.blkIndent; + } + break; + } + oldBMarks.push(state.bMarks[nextLine]); + oldBSCount.push(state.bsCount[nextLine]); + oldTShift.push(state.tShift[nextLine]); + oldSCount.push(state.sCount[nextLine]); + // A negative indentation means that this is a paragraph continuation + + state.sCount[nextLine] = -1; + } + oldIndent = state.blkIndent; + state.blkIndent = 0; + token = state.push("blockquote_open", "blockquote", 1); + token.markup = ">"; + token.map = lines = [ startLine, 0 ]; + state.md.block.tokenize(state, startLine, nextLine); + token = state.push("blockquote_close", "blockquote", -1); + token.markup = ">"; + state.lineMax = oldLineMax; + state.parentType = oldParentType; + lines[1] = state.line; + // Restore original tShift; this might not be necessary since the parser + // has already been here, but just to make sure we can do that. + for (i = 0; i < oldTShift.length; i++) { + state.bMarks[i + startLine] = oldBMarks[i]; + state.tShift[i + startLine] = oldTShift[i]; + state.sCount[i + startLine] = oldSCount[i]; + state.bsCount[i + startLine] = oldBSCount[i]; + } + state.blkIndent = oldIndent; + return true; + }; + var isSpace$8 = utils.isSpace; + var hr = function hr(state, startLine, endLine, silent) { + var marker, cnt, ch, token, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + marker = state.src.charCodeAt(pos++); + // Check hr marker + if (marker !== 42 /* * */ && marker !== 45 /* - */ && marker !== 95 /* _ */) { + return false; + } + // markers can be mixed with spaces, but there should be at least 3 of them + cnt = 1; + while (pos < max) { + ch = state.src.charCodeAt(pos++); + if (ch !== marker && !isSpace$8(ch)) { + return false; + } + if (ch === marker) { + cnt++; + } + } + if (cnt < 3) { + return false; + } + if (silent) { + return true; + } + state.line = startLine + 1; + token = state.push("hr", "hr", 0); + token.map = [ startLine, state.line ]; + token.markup = Array(cnt + 1).join(String.fromCharCode(marker)); + return true; + }; + var isSpace$7 = utils.isSpace; + // Search `[-+*][\n ]`, returns next pos after marker on success + // or -1 on fail. + function skipBulletListMarker(state, startLine) { + var marker, pos, max, ch; + pos = state.bMarks[startLine] + state.tShift[startLine]; + max = state.eMarks[startLine]; + marker = state.src.charCodeAt(pos++); + // Check bullet + if (marker !== 42 /* * */ && marker !== 45 /* - */ && marker !== 43 /* + */) { + return -1; + } + if (pos < max) { + ch = state.src.charCodeAt(pos); + if (!isSpace$7(ch)) { + // " -test " - is not a list item + return -1; + } + } + return pos; + } + // Search `\d+[.)][\n ]`, returns next pos after marker on success + // or -1 on fail. + function skipOrderedListMarker(state, startLine) { + var ch, start = state.bMarks[startLine] + state.tShift[startLine], pos = start, max = state.eMarks[startLine]; + // List marker should have at least 2 chars (digit + dot) + if (pos + 1 >= max) { + return -1; + } + ch = state.src.charCodeAt(pos++); + if (ch < 48 /* 0 */ || ch > 57 /* 9 */) { + return -1; + } + for (;;) { + // EOL -> fail + if (pos >= max) { + return -1; + } + ch = state.src.charCodeAt(pos++); + if (ch >= 48 /* 0 */ && ch <= 57 /* 9 */) { + // List marker should have no more than 9 digits + // (prevents integer overflow in browsers) + if (pos - start >= 10) { + return -1; + } + continue; + } + // found valid marker + if (ch === 41 /* ) */ || ch === 46 /* . */) { + break; + } + return -1; + } + if (pos < max) { + ch = state.src.charCodeAt(pos); + if (!isSpace$7(ch)) { + // " 1.test " - is not a list item + return -1; + } + } + return pos; + } + function markTightParagraphs(state, idx) { + var i, l, level = state.level + 2; + for (i = idx + 2, l = state.tokens.length - 2; i < l; i++) { + if (state.tokens[i].level === level && state.tokens[i].type === "paragraph_open") { + state.tokens[i + 2].hidden = true; + state.tokens[i].hidden = true; + i += 2; + } + } + } + var list = function list(state, startLine, endLine, silent) { + var ch, contentStart, i, indent, indentAfterMarker, initial, isOrdered, itemLines, l, listLines, listTokIdx, markerCharCode, markerValue, max, nextLine, offset, oldListIndent, oldParentType, oldSCount, oldTShift, oldTight, pos, posAfterMarker, prevEmptyEnd, start, terminate, terminatorRules, token, isTerminatingParagraph = false, tight = true; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + // Special case: + // - item 1 + // - item 2 + // - item 3 + // - item 4 + // - this one is a paragraph continuation + if (state.listIndent >= 0 && state.sCount[startLine] - state.listIndent >= 4 && state.sCount[startLine] < state.blkIndent) { + return false; + } + // limit conditions when list can interrupt + // a paragraph (validation mode only) + if (silent && state.parentType === "paragraph") { + // Next list item should still terminate previous list item; + // This code can fail if plugins use blkIndent as well as lists, + // but I hope the spec gets fixed long before that happens. + if (state.sCount[startLine] >= state.blkIndent) { + isTerminatingParagraph = true; + } + } + // Detect list type and position after marker + if ((posAfterMarker = skipOrderedListMarker(state, startLine)) >= 0) { + isOrdered = true; + start = state.bMarks[startLine] + state.tShift[startLine]; + markerValue = Number(state.src.slice(start, posAfterMarker - 1)); + // If we're starting a new ordered list right after + // a paragraph, it should start with 1. + if (isTerminatingParagraph && markerValue !== 1) return false; + } else if ((posAfterMarker = skipBulletListMarker(state, startLine)) >= 0) { + isOrdered = false; + } else { + return false; + } + // If we're starting a new unordered list right after + // a paragraph, first line should not be empty. + if (isTerminatingParagraph) { + if (state.skipSpaces(posAfterMarker) >= state.eMarks[startLine]) return false; + } + // We should terminate list on style change. Remember first one to compare. + markerCharCode = state.src.charCodeAt(posAfterMarker - 1); + // For validation mode we can terminate immediately + if (silent) { + return true; + } + // Start list + listTokIdx = state.tokens.length; + if (isOrdered) { + token = state.push("ordered_list_open", "ol", 1); + if (markerValue !== 1) { + token.attrs = [ [ "start", markerValue ] ]; + } + } else { + token = state.push("bullet_list_open", "ul", 1); + } + token.map = listLines = [ startLine, 0 ]; + token.markup = String.fromCharCode(markerCharCode); + + // Iterate list items + + nextLine = startLine; + prevEmptyEnd = false; + terminatorRules = state.md.block.ruler.getRules("list"); + oldParentType = state.parentType; + state.parentType = "list"; + while (nextLine < endLine) { + pos = posAfterMarker; + max = state.eMarks[nextLine]; + initial = offset = state.sCount[nextLine] + posAfterMarker - (state.bMarks[startLine] + state.tShift[startLine]); + while (pos < max) { + ch = state.src.charCodeAt(pos); + if (ch === 9) { + offset += 4 - (offset + state.bsCount[nextLine]) % 4; + } else if (ch === 32) { + offset++; + } else { + break; + } + pos++; + } + contentStart = pos; + if (contentStart >= max) { + // trimming space in "- \n 3" case, indent is 1 here + indentAfterMarker = 1; + } else { + indentAfterMarker = offset - initial; + } + // If we have more than 4 spaces, the indent is 1 + // (the rest is just indented code block) + if (indentAfterMarker > 4) { + indentAfterMarker = 1; + } + // " - test" + // ^^^^^ - calculating total length of this thing + indent = initial + indentAfterMarker; + // Run subparser & write tokens + token = state.push("list_item_open", "li", 1); + token.markup = String.fromCharCode(markerCharCode); + token.map = itemLines = [ startLine, 0 ]; + if (isOrdered) { + token.info = state.src.slice(start, posAfterMarker - 1); + } + // change current state, then restore it after parser subcall + oldTight = state.tight; + oldTShift = state.tShift[startLine]; + oldSCount = state.sCount[startLine]; + // - example list + // ^ listIndent position will be here + // ^ blkIndent position will be here + + oldListIndent = state.listIndent; + state.listIndent = state.blkIndent; + state.blkIndent = indent; + state.tight = true; + state.tShift[startLine] = contentStart - state.bMarks[startLine]; + state.sCount[startLine] = offset; + if (contentStart >= max && state.isEmpty(startLine + 1)) { + // workaround for this case + // (list item is empty, list terminates before "foo"): + // ~~~~~~~~ + // - + // foo + // ~~~~~~~~ + state.line = Math.min(state.line + 2, endLine); + } else { + state.md.block.tokenize(state, startLine, endLine, true); + } + // If any of list item is tight, mark list as tight + if (!state.tight || prevEmptyEnd) { + tight = false; + } + // Item become loose if finish with empty line, + // but we should filter last element, because it means list finish + prevEmptyEnd = state.line - startLine > 1 && state.isEmpty(state.line - 1); + state.blkIndent = state.listIndent; + state.listIndent = oldListIndent; + state.tShift[startLine] = oldTShift; + state.sCount[startLine] = oldSCount; + state.tight = oldTight; + token = state.push("list_item_close", "li", -1); + token.markup = String.fromCharCode(markerCharCode); + nextLine = startLine = state.line; + itemLines[1] = nextLine; + contentStart = state.bMarks[startLine]; + if (nextLine >= endLine) { + break; + } + + // Try to check if list is terminated or continued. + + if (state.sCount[nextLine] < state.blkIndent) { + break; + } + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + break; + } + // fail if terminating block found + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + break; + } + // fail if list has another type + if (isOrdered) { + posAfterMarker = skipOrderedListMarker(state, nextLine); + if (posAfterMarker < 0) { + break; + } + start = state.bMarks[nextLine] + state.tShift[nextLine]; + } else { + posAfterMarker = skipBulletListMarker(state, nextLine); + if (posAfterMarker < 0) { + break; + } + } + if (markerCharCode !== state.src.charCodeAt(posAfterMarker - 1)) { + break; + } + } + // Finalize list + if (isOrdered) { + token = state.push("ordered_list_close", "ol", -1); + } else { + token = state.push("bullet_list_close", "ul", -1); + } + token.markup = String.fromCharCode(markerCharCode); + listLines[1] = nextLine; + state.line = nextLine; + state.parentType = oldParentType; + // mark paragraphs tight if needed + if (tight) { + markTightParagraphs(state, listTokIdx); + } + return true; + }; + var normalizeReference$2 = utils.normalizeReference; + var isSpace$6 = utils.isSpace; + var reference = function reference(state, startLine, _endLine, silent) { + var ch, destEndPos, destEndLineNo, endLine, href, i, l, label, labelEnd, oldParentType, res, start, str, terminate, terminatorRules, title, lines = 0, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine], nextLine = startLine + 1; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + if (state.src.charCodeAt(pos) !== 91 /* [ */) { + return false; + } + // Simple check to quickly interrupt scan on [link](url) at the start of line. + // Can be useful on practice: https://github.com/markdown-it/markdown-it/issues/54 + while (++pos < max) { + if (state.src.charCodeAt(pos) === 93 /* ] */ && state.src.charCodeAt(pos - 1) !== 92 /* \ */) { + if (pos + 1 === max) { + return false; + } + if (state.src.charCodeAt(pos + 1) !== 58 /* : */) { + return false; + } + break; + } + } + endLine = state.lineMax; + // jump line-by-line until empty one or EOF + terminatorRules = state.md.block.ruler.getRules("reference"); + oldParentType = state.parentType; + state.parentType = "reference"; + for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { + // this would be a code block normally, but after paragraph + // it's considered a lazy continuation regardless of what's there + if (state.sCount[nextLine] - state.blkIndent > 3) { + continue; + } + // quirk for blockquotes, this line should already be checked by that rule + if (state.sCount[nextLine] < 0) { + continue; + } + // Some tags can terminate paragraph without empty line. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + break; + } + } + str = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); + max = str.length; + for (pos = 1; pos < max; pos++) { + ch = str.charCodeAt(pos); + if (ch === 91 /* [ */) { + return false; + } else if (ch === 93 /* ] */) { + labelEnd = pos; + break; + } else if (ch === 10 /* \n */) { + lines++; + } else if (ch === 92 /* \ */) { + pos++; + if (pos < max && str.charCodeAt(pos) === 10) { + lines++; + } + } + } + if (labelEnd < 0 || str.charCodeAt(labelEnd + 1) !== 58 /* : */) { + return false; + } + // [label]: destination 'title' + // ^^^ skip optional whitespace here + for (pos = labelEnd + 2; pos < max; pos++) { + ch = str.charCodeAt(pos); + if (ch === 10) { + lines++; + } else if (isSpace$6(ch)) ; else { + break; + } + } + // [label]: destination 'title' + // ^^^^^^^^^^^ parse this + res = state.md.helpers.parseLinkDestination(str, pos, max); + if (!res.ok) { + return false; + } + href = state.md.normalizeLink(res.str); + if (!state.md.validateLink(href)) { + return false; + } + pos = res.pos; + lines += res.lines; + // save cursor state, we could require to rollback later + destEndPos = pos; + destEndLineNo = lines; + // [label]: destination 'title' + // ^^^ skipping those spaces + start = pos; + for (;pos < max; pos++) { + ch = str.charCodeAt(pos); + if (ch === 10) { + lines++; + } else if (isSpace$6(ch)) ; else { + break; + } + } + // [label]: destination 'title' + // ^^^^^^^ parse this + res = state.md.helpers.parseLinkTitle(str, pos, max); + if (pos < max && start !== pos && res.ok) { + title = res.str; + pos = res.pos; + lines += res.lines; + } else { + title = ""; + pos = destEndPos; + lines = destEndLineNo; + } + // skip trailing spaces until the rest of the line + while (pos < max) { + ch = str.charCodeAt(pos); + if (!isSpace$6(ch)) { + break; + } + pos++; + } + if (pos < max && str.charCodeAt(pos) !== 10) { + if (title) { + // garbage at the end of the line after title, + // but it could still be a valid reference if we roll back + title = ""; + pos = destEndPos; + lines = destEndLineNo; + while (pos < max) { + ch = str.charCodeAt(pos); + if (!isSpace$6(ch)) { + break; + } + pos++; + } + } + } + if (pos < max && str.charCodeAt(pos) !== 10) { + // garbage at the end of the line + return false; + } + label = normalizeReference$2(str.slice(1, labelEnd)); + if (!label) { + // CommonMark 0.20 disallows empty labels + return false; + } + // Reference can not terminate anything. This check is for safety only. + /*istanbul ignore if*/ if (silent) { + return true; + } + if (typeof state.env.references === "undefined") { + state.env.references = {}; + } + if (typeof state.env.references[label] === "undefined") { + state.env.references[label] = { + title: title, + href: href + }; + } + state.parentType = oldParentType; + state.line = startLine + lines + 1; + return true; + }; + // List of valid html blocks names, accorting to commonmark spec + var html_blocks = [ "address", "article", "aside", "base", "basefont", "blockquote", "body", "caption", "center", "col", "colgroup", "dd", "details", "dialog", "dir", "div", "dl", "dt", "fieldset", "figcaption", "figure", "footer", "form", "frame", "frameset", "h1", "h2", "h3", "h4", "h5", "h6", "head", "header", "hr", "html", "iframe", "legend", "li", "link", "main", "menu", "menuitem", "nav", "noframes", "ol", "optgroup", "option", "p", "param", "section", "source", "summary", "table", "tbody", "td", "tfoot", "th", "thead", "title", "tr", "track", "ul" ]; + // Regexps to match html elements + var attr_name = "[a-zA-Z_:][a-zA-Z0-9:._-]*"; + var unquoted = "[^\"'=<>`\\x00-\\x20]+"; + var single_quoted = "'[^']*'"; + var double_quoted = '"[^"]*"'; + var attr_value = "(?:" + unquoted + "|" + single_quoted + "|" + double_quoted + ")"; + var attribute = "(?:\\s+" + attr_name + "(?:\\s*=\\s*" + attr_value + ")?)"; + var open_tag = "<[A-Za-z][A-Za-z0-9\\-]*" + attribute + "*\\s*\\/?>"; + var close_tag = "<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>"; + var comment = "\x3c!----\x3e|\x3c!--(?:-?[^>-])(?:-?[^-])*--\x3e"; + var processing = "<[?][\\s\\S]*?[?]>"; + var declaration = "<![A-Z]+\\s+[^>]*>"; + var cdata = "<!\\[CDATA\\[[\\s\\S]*?\\]\\]>"; + var HTML_TAG_RE$1 = new RegExp("^(?:" + open_tag + "|" + close_tag + "|" + comment + "|" + processing + "|" + declaration + "|" + cdata + ")"); + var HTML_OPEN_CLOSE_TAG_RE$1 = new RegExp("^(?:" + open_tag + "|" + close_tag + ")"); + var HTML_TAG_RE_1 = HTML_TAG_RE$1; + var HTML_OPEN_CLOSE_TAG_RE_1 = HTML_OPEN_CLOSE_TAG_RE$1; + var html_re = { + HTML_TAG_RE: HTML_TAG_RE_1, + HTML_OPEN_CLOSE_TAG_RE: HTML_OPEN_CLOSE_TAG_RE_1 + }; + var HTML_OPEN_CLOSE_TAG_RE = html_re.HTML_OPEN_CLOSE_TAG_RE; + // An array of opening and corresponding closing sequences for html tags, + // last argument defines whether it can terminate a paragraph or not + + var HTML_SEQUENCES = [ [ /^<(script|pre|style|textarea)(?=(\s|>|$))/i, /<\/(script|pre|style|textarea)>/i, true ], [ /^<!--/, /-->/, true ], [ /^<\?/, /\?>/, true ], [ /^<![A-Z]/, />/, true ], [ /^<!\[CDATA\[/, /\]\]>/, true ], [ new RegExp("^</?(" + html_blocks.join("|") + ")(?=(\\s|/?>|$))", "i"), /^$/, true ], [ new RegExp(HTML_OPEN_CLOSE_TAG_RE.source + "\\s*$"), /^$/, false ] ]; + var html_block = function html_block(state, startLine, endLine, silent) { + var i, nextLine, token, lineText, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + if (!state.md.options.html) { + return false; + } + if (state.src.charCodeAt(pos) !== 60 /* < */) { + return false; + } + lineText = state.src.slice(pos, max); + for (i = 0; i < HTML_SEQUENCES.length; i++) { + if (HTML_SEQUENCES[i][0].test(lineText)) { + break; + } + } + if (i === HTML_SEQUENCES.length) { + return false; + } + if (silent) { + // true if this sequence can be a terminator, false otherwise + return HTML_SEQUENCES[i][2]; + } + nextLine = startLine + 1; + // If we are here - we detected HTML block. + // Let's roll down till block end. + if (!HTML_SEQUENCES[i][1].test(lineText)) { + for (;nextLine < endLine; nextLine++) { + if (state.sCount[nextLine] < state.blkIndent) { + break; + } + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + lineText = state.src.slice(pos, max); + if (HTML_SEQUENCES[i][1].test(lineText)) { + if (lineText.length !== 0) { + nextLine++; + } + break; + } + } + } + state.line = nextLine; + token = state.push("html_block", "", 0); + token.map = [ startLine, nextLine ]; + token.content = state.getLines(startLine, nextLine, state.blkIndent, true); + return true; + }; + var isSpace$5 = utils.isSpace; + var heading = function heading(state, startLine, endLine, silent) { + var ch, level, tmp, token, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + ch = state.src.charCodeAt(pos); + if (ch !== 35 /* # */ || pos >= max) { + return false; + } + // count heading level + level = 1; + ch = state.src.charCodeAt(++pos); + while (ch === 35 /* # */ && pos < max && level <= 6) { + level++; + ch = state.src.charCodeAt(++pos); + } + if (level > 6 || pos < max && !isSpace$5(ch)) { + return false; + } + if (silent) { + return true; + } + // Let's cut tails like ' ### ' from the end of string + max = state.skipSpacesBack(max, pos); + tmp = state.skipCharsBack(max, 35, pos); + // # + if (tmp > pos && isSpace$5(state.src.charCodeAt(tmp - 1))) { + max = tmp; + } + state.line = startLine + 1; + token = state.push("heading_open", "h" + String(level), 1); + token.markup = "########".slice(0, level); + token.map = [ startLine, state.line ]; + token = state.push("inline", "", 0); + token.content = state.src.slice(pos, max).trim(); + token.map = [ startLine, state.line ]; + token.children = []; + token = state.push("heading_close", "h" + String(level), -1); + token.markup = "########".slice(0, level); + return true; + }; + // lheading (---, ===) + var lheading = function lheading(state, startLine, endLine /*, silent*/) { + var content, terminate, i, l, token, pos, max, level, marker, nextLine = startLine + 1, oldParentType, terminatorRules = state.md.block.ruler.getRules("paragraph"); + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + oldParentType = state.parentType; + state.parentType = "paragraph"; + // use paragraph to match terminatorRules + // jump line-by-line until empty one or EOF + for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { + // this would be a code block normally, but after paragraph + // it's considered a lazy continuation regardless of what's there + if (state.sCount[nextLine] - state.blkIndent > 3) { + continue; + } + + // Check for underline in setext header + + if (state.sCount[nextLine] >= state.blkIndent) { + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + if (pos < max) { + marker = state.src.charCodeAt(pos); + if (marker === 45 /* - */ || marker === 61 /* = */) { + pos = state.skipChars(pos, marker); + pos = state.skipSpaces(pos); + if (pos >= max) { + level = marker === 61 /* = */ ? 1 : 2; + break; + } + } + } + } + // quirk for blockquotes, this line should already be checked by that rule + if (state.sCount[nextLine] < 0) { + continue; + } + // Some tags can terminate paragraph without empty line. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + break; + } + } + if (!level) { + // Didn't find valid underline + return false; + } + content = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); + state.line = nextLine + 1; + token = state.push("heading_open", "h" + String(level), 1); + token.markup = String.fromCharCode(marker); + token.map = [ startLine, state.line ]; + token = state.push("inline", "", 0); + token.content = content; + token.map = [ startLine, state.line - 1 ]; + token.children = []; + token = state.push("heading_close", "h" + String(level), -1); + token.markup = String.fromCharCode(marker); + state.parentType = oldParentType; + return true; + }; + // Paragraph + var paragraph = function paragraph(state, startLine /*, endLine*/) { + var content, terminate, i, l, token, oldParentType, nextLine = startLine + 1, terminatorRules = state.md.block.ruler.getRules("paragraph"), endLine = state.lineMax; + oldParentType = state.parentType; + state.parentType = "paragraph"; + // jump line-by-line until empty one or EOF + for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { + // this would be a code block normally, but after paragraph + // it's considered a lazy continuation regardless of what's there + if (state.sCount[nextLine] - state.blkIndent > 3) { + continue; + } + // quirk for blockquotes, this line should already be checked by that rule + if (state.sCount[nextLine] < 0) { + continue; + } + // Some tags can terminate paragraph without empty line. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + break; + } + } + content = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); + state.line = nextLine; + token = state.push("paragraph_open", "p", 1); + token.map = [ startLine, state.line ]; + token = state.push("inline", "", 0); + token.content = content; + token.map = [ startLine, state.line ]; + token.children = []; + token = state.push("paragraph_close", "p", -1); + state.parentType = oldParentType; + return true; + }; + var isSpace$4 = utils.isSpace; + function StateBlock(src, md, env, tokens) { + var ch, s, start, pos, len, indent, offset, indent_found; + this.src = src; + // link to parser instance + this.md = md; + this.env = env; + + // Internal state vartiables + + this.tokens = tokens; + this.bMarks = []; + // line begin offsets for fast jumps + this.eMarks = []; + // line end offsets for fast jumps + this.tShift = []; + // offsets of the first non-space characters (tabs not expanded) + this.sCount = []; + // indents for each line (tabs expanded) + // An amount of virtual spaces (tabs expanded) between beginning + // of each line (bMarks) and real beginning of that line. + + // It exists only as a hack because blockquotes override bMarks + // losing information in the process. + + // It's used only when expanding tabs, you can think about it as + // an initial tab length, e.g. bsCount=21 applied to string `\t123` + // means first tab should be expanded to 4-21%4 === 3 spaces. + + this.bsCount = []; + // block parser variables + this.blkIndent = 0; + // required block content indent (for example, if we are + // inside a list, it would be positioned after list marker) + this.line = 0; + // line index in src + this.lineMax = 0; + // lines count + this.tight = false; + // loose/tight mode for lists + this.ddIndent = -1; + // indent of the current dd block (-1 if there isn't any) + this.listIndent = -1; + // indent of the current list block (-1 if there isn't any) + // can be 'blockquote', 'list', 'root', 'paragraph' or 'reference' + // used in lists to determine if they interrupt a paragraph + this.parentType = "root"; + this.level = 0; + // renderer + this.result = ""; + // Create caches + // Generate markers. + s = this.src; + indent_found = false; + for (start = pos = indent = offset = 0, len = s.length; pos < len; pos++) { + ch = s.charCodeAt(pos); + if (!indent_found) { + if (isSpace$4(ch)) { + indent++; + if (ch === 9) { + offset += 4 - offset % 4; + } else { + offset++; + } + continue; + } else { + indent_found = true; + } + } + if (ch === 10 || pos === len - 1) { + if (ch !== 10) { + pos++; + } + this.bMarks.push(start); + this.eMarks.push(pos); + this.tShift.push(indent); + this.sCount.push(offset); + this.bsCount.push(0); + indent_found = false; + indent = 0; + offset = 0; + start = pos + 1; + } + } + // Push fake entry to simplify cache bounds checks + this.bMarks.push(s.length); + this.eMarks.push(s.length); + this.tShift.push(0); + this.sCount.push(0); + this.bsCount.push(0); + this.lineMax = this.bMarks.length - 1; + // don't count last fake line + } + // Push new token to "stream". + + StateBlock.prototype.push = function(type, tag, nesting) { + var token$1 = new token(type, tag, nesting); + token$1.block = true; + if (nesting < 0) this.level--; + // closing tag + token$1.level = this.level; + if (nesting > 0) this.level++; + // opening tag + this.tokens.push(token$1); + return token$1; + }; + StateBlock.prototype.isEmpty = function isEmpty(line) { + return this.bMarks[line] + this.tShift[line] >= this.eMarks[line]; + }; + StateBlock.prototype.skipEmptyLines = function skipEmptyLines(from) { + for (var max = this.lineMax; from < max; from++) { + if (this.bMarks[from] + this.tShift[from] < this.eMarks[from]) { + break; + } + } + return from; + }; + // Skip spaces from given position. + StateBlock.prototype.skipSpaces = function skipSpaces(pos) { + var ch; + for (var max = this.src.length; pos < max; pos++) { + ch = this.src.charCodeAt(pos); + if (!isSpace$4(ch)) { + break; + } + } + return pos; + }; + // Skip spaces from given position in reverse. + StateBlock.prototype.skipSpacesBack = function skipSpacesBack(pos, min) { + if (pos <= min) { + return pos; + } + while (pos > min) { + if (!isSpace$4(this.src.charCodeAt(--pos))) { + return pos + 1; + } + } + return pos; + }; + // Skip char codes from given position + StateBlock.prototype.skipChars = function skipChars(pos, code) { + for (var max = this.src.length; pos < max; pos++) { + if (this.src.charCodeAt(pos) !== code) { + break; + } + } + return pos; + }; + // Skip char codes reverse from given position - 1 + StateBlock.prototype.skipCharsBack = function skipCharsBack(pos, code, min) { + if (pos <= min) { + return pos; + } + while (pos > min) { + if (code !== this.src.charCodeAt(--pos)) { + return pos + 1; + } + } + return pos; + }; + // cut lines range from source. + StateBlock.prototype.getLines = function getLines(begin, end, indent, keepLastLF) { + var i, lineIndent, ch, first, last, queue, lineStart, line = begin; + if (begin >= end) { + return ""; + } + queue = new Array(end - begin); + for (i = 0; line < end; line++, i++) { + lineIndent = 0; + lineStart = first = this.bMarks[line]; + if (line + 1 < end || keepLastLF) { + // No need for bounds check because we have fake entry on tail. + last = this.eMarks[line] + 1; + } else { + last = this.eMarks[line]; + } + while (first < last && lineIndent < indent) { + ch = this.src.charCodeAt(first); + if (isSpace$4(ch)) { + if (ch === 9) { + lineIndent += 4 - (lineIndent + this.bsCount[line]) % 4; + } else { + lineIndent++; + } + } else if (first - lineStart < this.tShift[line]) { + // patched tShift masked characters to look like spaces (blockquotes, list markers) + lineIndent++; + } else { + break; + } + first++; + } + if (lineIndent > indent) { + // partially expanding tabs in code blocks, e.g '\t\tfoobar' + // with indent=2 becomes ' \tfoobar' + queue[i] = new Array(lineIndent - indent + 1).join(" ") + this.src.slice(first, last); + } else { + queue[i] = this.src.slice(first, last); + } + } + return queue.join(""); + }; + // re-export Token class to use in block rules + StateBlock.prototype.Token = token; + var state_block = StateBlock; + var _rules$1 = [ + // First 2 params - rule name & source. Secondary array - list of rules, + // which can be terminated by this one. + [ "table", table, [ "paragraph", "reference" ] ], [ "code", code ], [ "fence", fence, [ "paragraph", "reference", "blockquote", "list" ] ], [ "blockquote", blockquote, [ "paragraph", "reference", "blockquote", "list" ] ], [ "hr", hr, [ "paragraph", "reference", "blockquote", "list" ] ], [ "list", list, [ "paragraph", "reference", "blockquote" ] ], [ "reference", reference ], [ "html_block", html_block, [ "paragraph", "reference", "blockquote" ] ], [ "heading", heading, [ "paragraph", "reference", "blockquote" ] ], [ "lheading", lheading ], [ "paragraph", paragraph ] ]; + /** + * new ParserBlock() + **/ function ParserBlock() { + /** + * ParserBlock#ruler -> Ruler + * + * [[Ruler]] instance. Keep configuration of block rules. + **/ + this.ruler = new ruler; + for (var i = 0; i < _rules$1.length; i++) { + this.ruler.push(_rules$1[i][0], _rules$1[i][1], { + alt: (_rules$1[i][2] || []).slice() + }); + } + } + // Generate tokens for input range + + ParserBlock.prototype.tokenize = function(state, startLine, endLine) { + var ok, i, rules = this.ruler.getRules(""), len = rules.length, line = startLine, hasEmptyLines = false, maxNesting = state.md.options.maxNesting; + while (line < endLine) { + state.line = line = state.skipEmptyLines(line); + if (line >= endLine) { + break; + } + // Termination condition for nested calls. + // Nested calls currently used for blockquotes & lists + if (state.sCount[line] < state.blkIndent) { + break; + } + // If nesting level exceeded - skip tail to the end. That's not ordinary + // situation and we should not care about content. + if (state.level >= maxNesting) { + state.line = endLine; + break; + } + // Try all possible rules. + // On success, rule should: + + // - update `state.line` + // - update `state.tokens` + // - return true + for (i = 0; i < len; i++) { + ok = rules[i](state, line, endLine, false); + if (ok) { + break; + } + } + // set state.tight if we had an empty line before current tag + // i.e. latest empty line should not count + state.tight = !hasEmptyLines; + // paragraph might "eat" one newline after it in nested lists + if (state.isEmpty(state.line - 1)) { + hasEmptyLines = true; + } + line = state.line; + if (line < endLine && state.isEmpty(line)) { + hasEmptyLines = true; + line++; + state.line = line; + } + } + }; + /** + * ParserBlock.parse(str, md, env, outTokens) + * + * Process input string and push block tokens into `outTokens` + **/ ParserBlock.prototype.parse = function(src, md, env, outTokens) { + var state; + if (!src) { + return; + } + state = new this.State(src, md, env, outTokens); + this.tokenize(state, state.line, state.lineMax); + }; + ParserBlock.prototype.State = state_block; + var parser_block = ParserBlock; + // Skip text characters for text token, place those to pending buffer + // Rule to skip pure text + // '{}$%@~+=:' reserved for extentions + // !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~ + // !!!! Don't confuse with "Markdown ASCII Punctuation" chars + // http://spec.commonmark.org/0.15/#ascii-punctuation-character + function isTerminatorChar(ch) { + switch (ch) { + case 10 /* \n */ : + case 33 /* ! */ : + case 35 /* # */ : + case 36 /* $ */ : + case 37 /* % */ : + case 38 /* & */ : + case 42 /* * */ : + case 43 /* + */ : + case 45 /* - */ : + case 58 /* : */ : + case 60 /* < */ : + case 61 /* = */ : + case 62 /* > */ : + case 64 /* @ */ : + case 91 /* [ */ : + case 92 /* \ */ : + case 93 /* ] */ : + case 94 /* ^ */ : + case 95 /* _ */ : + case 96 /* ` */ : + case 123 /* { */ : + case 125 /* } */ : + case 126 /* ~ */ : + return true; + + default: + return false; + } + } + var text = function text(state, silent) { + var pos = state.pos; + while (pos < state.posMax && !isTerminatorChar(state.src.charCodeAt(pos))) { + pos++; + } + if (pos === state.pos) { + return false; + } + if (!silent) { + state.pending += state.src.slice(state.pos, pos); + } + state.pos = pos; + return true; + }; + var isSpace$3 = utils.isSpace; + var newline = function newline(state, silent) { + var pmax, max, ws, pos = state.pos; + if (state.src.charCodeAt(pos) !== 10 /* \n */) { + return false; + } + pmax = state.pending.length - 1; + max = state.posMax; + // ' \n' -> hardbreak + // Lookup in pending chars is bad practice! Don't copy to other rules! + // Pending string is stored in concat mode, indexed lookups will cause + // convertion to flat mode. + if (!silent) { + if (pmax >= 0 && state.pending.charCodeAt(pmax) === 32) { + if (pmax >= 1 && state.pending.charCodeAt(pmax - 1) === 32) { + // Find whitespaces tail of pending chars. + ws = pmax - 1; + while (ws >= 1 && state.pending.charCodeAt(ws - 1) === 32) ws--; + state.pending = state.pending.slice(0, ws); + state.push("hardbreak", "br", 0); + } else { + state.pending = state.pending.slice(0, -1); + state.push("softbreak", "br", 0); + } + } else { + state.push("softbreak", "br", 0); + } + } + pos++; + // skip heading spaces for next line + while (pos < max && isSpace$3(state.src.charCodeAt(pos))) { + pos++; + } + state.pos = pos; + return true; + }; + var isSpace$2 = utils.isSpace; + var ESCAPED = []; + for (var i = 0; i < 256; i++) { + ESCAPED.push(0); + } + "\\!\"#$%&'()*+,./:;<=>?@[]^_`{|}~-".split("").forEach((function(ch) { + ESCAPED[ch.charCodeAt(0)] = 1; + })); + var _escape = function escape(state, silent) { + var ch, pos = state.pos, max = state.posMax; + if (state.src.charCodeAt(pos) !== 92 /* \ */) { + return false; + } + pos++; + if (pos < max) { + ch = state.src.charCodeAt(pos); + if (ch < 256 && ESCAPED[ch] !== 0) { + if (!silent) { + state.pending += state.src[pos]; + } + state.pos += 2; + return true; + } + if (ch === 10) { + if (!silent) { + state.push("hardbreak", "br", 0); + } + pos++; + // skip leading whitespaces from next line + while (pos < max) { + ch = state.src.charCodeAt(pos); + if (!isSpace$2(ch)) { + break; + } + pos++; + } + state.pos = pos; + return true; + } + } + if (!silent) { + state.pending += "\\"; + } + state.pos++; + return true; + }; + // Parse backticks + var backticks = function backtick(state, silent) { + var start, max, marker, token, matchStart, matchEnd, openerLength, closerLength, pos = state.pos, ch = state.src.charCodeAt(pos); + if (ch !== 96 /* ` */) { + return false; + } + start = pos; + pos++; + max = state.posMax; + // scan marker length + while (pos < max && state.src.charCodeAt(pos) === 96 /* ` */) { + pos++; + } + marker = state.src.slice(start, pos); + openerLength = marker.length; + if (state.backticksScanned && (state.backticks[openerLength] || 0) <= start) { + if (!silent) state.pending += marker; + state.pos += openerLength; + return true; + } + matchStart = matchEnd = pos; + // Nothing found in the cache, scan until the end of the line (or until marker is found) + while ((matchStart = state.src.indexOf("`", matchEnd)) !== -1) { + matchEnd = matchStart + 1; + // scan marker length + while (matchEnd < max && state.src.charCodeAt(matchEnd) === 96 /* ` */) { + matchEnd++; + } + closerLength = matchEnd - matchStart; + if (closerLength === openerLength) { + // Found matching closer length. + if (!silent) { + token = state.push("code_inline", "code", 0); + token.markup = marker; + token.content = state.src.slice(pos, matchStart).replace(/\n/g, " ").replace(/^ (.+) $/, "$1"); + } + state.pos = matchEnd; + return true; + } + // Some different length found, put it in cache as upper limit of where closer can be found + state.backticks[closerLength] = matchStart; + } + // Scanned through the end, didn't find anything + state.backticksScanned = true; + if (!silent) state.pending += marker; + state.pos += openerLength; + return true; + }; + // ~~strike through~~ + // Insert each marker as a separate text token, and add it to delimiter list + + var tokenize$1 = function strikethrough(state, silent) { + var i, scanned, token, len, ch, start = state.pos, marker = state.src.charCodeAt(start); + if (silent) { + return false; + } + if (marker !== 126 /* ~ */) { + return false; + } + scanned = state.scanDelims(state.pos, true); + len = scanned.length; + ch = String.fromCharCode(marker); + if (len < 2) { + return false; + } + if (len % 2) { + token = state.push("text", "", 0); + token.content = ch; + len--; + } + for (i = 0; i < len; i += 2) { + token = state.push("text", "", 0); + token.content = ch + ch; + state.delimiters.push({ + marker: marker, + length: 0, + // disable "rule of 3" length checks meant for emphasis + token: state.tokens.length - 1, + end: -1, + open: scanned.can_open, + close: scanned.can_close + }); + } + state.pos += scanned.length; + return true; + }; + function postProcess$1(state, delimiters) { + var i, j, startDelim, endDelim, token, loneMarkers = [], max = delimiters.length; + for (i = 0; i < max; i++) { + startDelim = delimiters[i]; + if (startDelim.marker !== 126 /* ~ */) { + continue; + } + if (startDelim.end === -1) { + continue; + } + endDelim = delimiters[startDelim.end]; + token = state.tokens[startDelim.token]; + token.type = "s_open"; + token.tag = "s"; + token.nesting = 1; + token.markup = "~~"; + token.content = ""; + token = state.tokens[endDelim.token]; + token.type = "s_close"; + token.tag = "s"; + token.nesting = -1; + token.markup = "~~"; + token.content = ""; + if (state.tokens[endDelim.token - 1].type === "text" && state.tokens[endDelim.token - 1].content === "~") { + loneMarkers.push(endDelim.token - 1); + } + } + // If a marker sequence has an odd number of characters, it's splitted + // like this: `~~~~~` -> `~` + `~~` + `~~`, leaving one marker at the + // start of the sequence. + + // So, we have to move all those markers after subsequent s_close tags. + + while (loneMarkers.length) { + i = loneMarkers.pop(); + j = i + 1; + while (j < state.tokens.length && state.tokens[j].type === "s_close") { + j++; + } + j--; + if (i !== j) { + token = state.tokens[j]; + state.tokens[j] = state.tokens[i]; + state.tokens[i] = token; + } + } + } + // Walk through delimiter list and replace text tokens with tags + + var postProcess_1$1 = function strikethrough(state) { + var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length; + postProcess$1(state, state.delimiters); + for (curr = 0; curr < max; curr++) { + if (tokens_meta[curr] && tokens_meta[curr].delimiters) { + postProcess$1(state, tokens_meta[curr].delimiters); + } + } + }; + var strikethrough = { + tokenize: tokenize$1, + postProcess: postProcess_1$1 + }; + // Process *this* and _that_ + // Insert each marker as a separate text token, and add it to delimiter list + + var tokenize = function emphasis(state, silent) { + var i, scanned, token, start = state.pos, marker = state.src.charCodeAt(start); + if (silent) { + return false; + } + if (marker !== 95 /* _ */ && marker !== 42 /* * */) { + return false; + } + scanned = state.scanDelims(state.pos, marker === 42); + for (i = 0; i < scanned.length; i++) { + token = state.push("text", "", 0); + token.content = String.fromCharCode(marker); + state.delimiters.push({ + // Char code of the starting marker (number). + marker: marker, + // Total length of these series of delimiters. + length: scanned.length, + // A position of the token this delimiter corresponds to. + token: state.tokens.length - 1, + // If this delimiter is matched as a valid opener, `end` will be + // equal to its position, otherwise it's `-1`. + end: -1, + // Boolean flags that determine if this delimiter could open or close + // an emphasis. + open: scanned.can_open, + close: scanned.can_close + }); + } + state.pos += scanned.length; + return true; + }; + function postProcess(state, delimiters) { + var i, startDelim, endDelim, token, ch, isStrong, max = delimiters.length; + for (i = max - 1; i >= 0; i--) { + startDelim = delimiters[i]; + if (startDelim.marker !== 95 /* _ */ && startDelim.marker !== 42 /* * */) { + continue; + } + // Process only opening markers + if (startDelim.end === -1) { + continue; + } + endDelim = delimiters[startDelim.end]; + // If the previous delimiter has the same marker and is adjacent to this one, + // merge those into one strong delimiter. + + // `<em><em>whatever</em></em>` -> `<strong>whatever</strong>` + + isStrong = i > 0 && delimiters[i - 1].end === startDelim.end + 1 && + // check that first two markers match and adjacent + delimiters[i - 1].marker === startDelim.marker && delimiters[i - 1].token === startDelim.token - 1 && + // check that last two markers are adjacent (we can safely assume they match) + delimiters[startDelim.end + 1].token === endDelim.token + 1; + ch = String.fromCharCode(startDelim.marker); + token = state.tokens[startDelim.token]; + token.type = isStrong ? "strong_open" : "em_open"; + token.tag = isStrong ? "strong" : "em"; + token.nesting = 1; + token.markup = isStrong ? ch + ch : ch; + token.content = ""; + token = state.tokens[endDelim.token]; + token.type = isStrong ? "strong_close" : "em_close"; + token.tag = isStrong ? "strong" : "em"; + token.nesting = -1; + token.markup = isStrong ? ch + ch : ch; + token.content = ""; + if (isStrong) { + state.tokens[delimiters[i - 1].token].content = ""; + state.tokens[delimiters[startDelim.end + 1].token].content = ""; + i--; + } + } + } + // Walk through delimiter list and replace text tokens with tags + + var postProcess_1 = function emphasis(state) { + var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length; + postProcess(state, state.delimiters); + for (curr = 0; curr < max; curr++) { + if (tokens_meta[curr] && tokens_meta[curr].delimiters) { + postProcess(state, tokens_meta[curr].delimiters); + } + } + }; + var emphasis = { + tokenize: tokenize, + postProcess: postProcess_1 + }; + var normalizeReference$1 = utils.normalizeReference; + var isSpace$1 = utils.isSpace; + var link = function link(state, silent) { + var attrs, code, label, labelEnd, labelStart, pos, res, ref, token, href = "", title = "", oldPos = state.pos, max = state.posMax, start = state.pos, parseReference = true; + if (state.src.charCodeAt(state.pos) !== 91 /* [ */) { + return false; + } + labelStart = state.pos + 1; + labelEnd = state.md.helpers.parseLinkLabel(state, state.pos, true); + // parser failed to find ']', so it's not a valid link + if (labelEnd < 0) { + return false; + } + pos = labelEnd + 1; + if (pos < max && state.src.charCodeAt(pos) === 40 /* ( */) { + // Inline link + // might have found a valid shortcut link, disable reference parsing + parseReference = false; + // [link]( <href> "title" ) + // ^^ skipping these spaces + pos++; + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace$1(code) && code !== 10) { + break; + } + } + if (pos >= max) { + return false; + } + // [link]( <href> "title" ) + // ^^^^^^ parsing link destination + start = pos; + res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax); + if (res.ok) { + href = state.md.normalizeLink(res.str); + if (state.md.validateLink(href)) { + pos = res.pos; + } else { + href = ""; + } + // [link]( <href> "title" ) + // ^^ skipping these spaces + start = pos; + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace$1(code) && code !== 10) { + break; + } + } + // [link]( <href> "title" ) + // ^^^^^^^ parsing link title + res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax); + if (pos < max && start !== pos && res.ok) { + title = res.str; + pos = res.pos; + // [link]( <href> "title" ) + // ^^ skipping these spaces + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace$1(code) && code !== 10) { + break; + } + } + } + } + if (pos >= max || state.src.charCodeAt(pos) !== 41 /* ) */) { + // parsing a valid shortcut link failed, fallback to reference + parseReference = true; + } + pos++; + } + if (parseReference) { + // Link reference + if (typeof state.env.references === "undefined") { + return false; + } + if (pos < max && state.src.charCodeAt(pos) === 91 /* [ */) { + start = pos + 1; + pos = state.md.helpers.parseLinkLabel(state, pos); + if (pos >= 0) { + label = state.src.slice(start, pos++); + } else { + pos = labelEnd + 1; + } + } else { + pos = labelEnd + 1; + } + // covers label === '' and label === undefined + // (collapsed reference link and shortcut reference link respectively) + if (!label) { + label = state.src.slice(labelStart, labelEnd); + } + ref = state.env.references[normalizeReference$1(label)]; + if (!ref) { + state.pos = oldPos; + return false; + } + href = ref.href; + title = ref.title; + } + + // We found the end of the link, and know for a fact it's a valid link; + // so all that's left to do is to call tokenizer. + + if (!silent) { + state.pos = labelStart; + state.posMax = labelEnd; + token = state.push("link_open", "a", 1); + token.attrs = attrs = [ [ "href", href ] ]; + if (title) { + attrs.push([ "title", title ]); + } + state.md.inline.tokenize(state); + token = state.push("link_close", "a", -1); + } + state.pos = pos; + state.posMax = max; + return true; + }; + var normalizeReference = utils.normalizeReference; + var isSpace = utils.isSpace; + var image = function image(state, silent) { + var attrs, code, content, label, labelEnd, labelStart, pos, ref, res, title, token, tokens, start, href = "", oldPos = state.pos, max = state.posMax; + if (state.src.charCodeAt(state.pos) !== 33 /* ! */) { + return false; + } + if (state.src.charCodeAt(state.pos + 1) !== 91 /* [ */) { + return false; + } + labelStart = state.pos + 2; + labelEnd = state.md.helpers.parseLinkLabel(state, state.pos + 1, false); + // parser failed to find ']', so it's not a valid link + if (labelEnd < 0) { + return false; + } + pos = labelEnd + 1; + if (pos < max && state.src.charCodeAt(pos) === 40 /* ( */) { + // Inline link + // [link]( <href> "title" ) + // ^^ skipping these spaces + pos++; + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 10) { + break; + } + } + if (pos >= max) { + return false; + } + // [link]( <href> "title" ) + // ^^^^^^ parsing link destination + start = pos; + res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax); + if (res.ok) { + href = state.md.normalizeLink(res.str); + if (state.md.validateLink(href)) { + pos = res.pos; + } else { + href = ""; + } + } + // [link]( <href> "title" ) + // ^^ skipping these spaces + start = pos; + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 10) { + break; + } + } + // [link]( <href> "title" ) + // ^^^^^^^ parsing link title + res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax); + if (pos < max && start !== pos && res.ok) { + title = res.str; + pos = res.pos; + // [link]( <href> "title" ) + // ^^ skipping these spaces + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 10) { + break; + } + } + } else { + title = ""; + } + if (pos >= max || state.src.charCodeAt(pos) !== 41 /* ) */) { + state.pos = oldPos; + return false; + } + pos++; + } else { + // Link reference + if (typeof state.env.references === "undefined") { + return false; + } + if (pos < max && state.src.charCodeAt(pos) === 91 /* [ */) { + start = pos + 1; + pos = state.md.helpers.parseLinkLabel(state, pos); + if (pos >= 0) { + label = state.src.slice(start, pos++); + } else { + pos = labelEnd + 1; + } + } else { + pos = labelEnd + 1; + } + // covers label === '' and label === undefined + // (collapsed reference link and shortcut reference link respectively) + if (!label) { + label = state.src.slice(labelStart, labelEnd); + } + ref = state.env.references[normalizeReference(label)]; + if (!ref) { + state.pos = oldPos; + return false; + } + href = ref.href; + title = ref.title; + } + + // We found the end of the link, and know for a fact it's a valid link; + // so all that's left to do is to call tokenizer. + + if (!silent) { + content = state.src.slice(labelStart, labelEnd); + state.md.inline.parse(content, state.md, state.env, tokens = []); + token = state.push("image", "img", 0); + token.attrs = attrs = [ [ "src", href ], [ "alt", "" ] ]; + token.children = tokens; + token.content = content; + if (title) { + attrs.push([ "title", title ]); + } + } + state.pos = pos; + state.posMax = max; + return true; + }; + // Process autolinks '<protocol:...>' + /*eslint max-len:0*/ var EMAIL_RE = /^([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)$/; + var AUTOLINK_RE = /^([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)$/; + var autolink = function autolink(state, silent) { + var url, fullUrl, token, ch, start, max, pos = state.pos; + if (state.src.charCodeAt(pos) !== 60 /* < */) { + return false; + } + start = state.pos; + max = state.posMax; + for (;;) { + if (++pos >= max) return false; + ch = state.src.charCodeAt(pos); + if (ch === 60 /* < */) return false; + if (ch === 62 /* > */) break; + } + url = state.src.slice(start + 1, pos); + if (AUTOLINK_RE.test(url)) { + fullUrl = state.md.normalizeLink(url); + if (!state.md.validateLink(fullUrl)) { + return false; + } + if (!silent) { + token = state.push("link_open", "a", 1); + token.attrs = [ [ "href", fullUrl ] ]; + token.markup = "autolink"; + token.info = "auto"; + token = state.push("text", "", 0); + token.content = state.md.normalizeLinkText(url); + token = state.push("link_close", "a", -1); + token.markup = "autolink"; + token.info = "auto"; + } + state.pos += url.length + 2; + return true; + } + if (EMAIL_RE.test(url)) { + fullUrl = state.md.normalizeLink("mailto:" + url); + if (!state.md.validateLink(fullUrl)) { + return false; + } + if (!silent) { + token = state.push("link_open", "a", 1); + token.attrs = [ [ "href", fullUrl ] ]; + token.markup = "autolink"; + token.info = "auto"; + token = state.push("text", "", 0); + token.content = state.md.normalizeLinkText(url); + token = state.push("link_close", "a", -1); + token.markup = "autolink"; + token.info = "auto"; + } + state.pos += url.length + 2; + return true; + } + return false; + }; + var HTML_TAG_RE = html_re.HTML_TAG_RE; + function isLetter(ch) { + /*eslint no-bitwise:0*/ + var lc = ch | 32; + // to lower case + return lc >= 97 /* a */ && lc <= 122 /* z */; + } + var html_inline = function html_inline(state, silent) { + var ch, match, max, token, pos = state.pos; + if (!state.md.options.html) { + return false; + } + // Check start + max = state.posMax; + if (state.src.charCodeAt(pos) !== 60 /* < */ || pos + 2 >= max) { + return false; + } + // Quick fail on second char + ch = state.src.charCodeAt(pos + 1); + if (ch !== 33 /* ! */ && ch !== 63 /* ? */ && ch !== 47 /* / */ && !isLetter(ch)) { + return false; + } + match = state.src.slice(pos).match(HTML_TAG_RE); + if (!match) { + return false; + } + if (!silent) { + token = state.push("html_inline", "", 0); + token.content = state.src.slice(pos, pos + match[0].length); + } + state.pos += match[0].length; + return true; + }; + var has = utils.has; + var isValidEntityCode = utils.isValidEntityCode; + var fromCodePoint = utils.fromCodePoint; + var DIGITAL_RE = /^&#((?:x[a-f0-9]{1,6}|[0-9]{1,7}));/i; + var NAMED_RE = /^&([a-z][a-z0-9]{1,31});/i; + var entity = function entity(state, silent) { + var ch, code, match, pos = state.pos, max = state.posMax; + if (state.src.charCodeAt(pos) !== 38 /* & */) { + return false; + } + if (pos + 1 < max) { + ch = state.src.charCodeAt(pos + 1); + if (ch === 35 /* # */) { + match = state.src.slice(pos).match(DIGITAL_RE); + if (match) { + if (!silent) { + code = match[1][0].toLowerCase() === "x" ? parseInt(match[1].slice(1), 16) : parseInt(match[1], 10); + state.pending += isValidEntityCode(code) ? fromCodePoint(code) : fromCodePoint(65533); + } + state.pos += match[0].length; + return true; + } + } else { + match = state.src.slice(pos).match(NAMED_RE); + if (match) { + if (has(entities, match[1])) { + if (!silent) { + state.pending += entities[match[1]]; + } + state.pos += match[0].length; + return true; + } + } + } + } + if (!silent) { + state.pending += "&"; + } + state.pos++; + return true; + }; + // For each opening emphasis-like marker find a matching closing one + function processDelimiters(state, delimiters) { + var closerIdx, openerIdx, closer, opener, minOpenerIdx, newMinOpenerIdx, isOddMatch, lastJump, openersBottom = {}, max = delimiters.length; + if (!max) return; + // headerIdx is the first delimiter of the current (where closer is) delimiter run + var headerIdx = 0; + var lastTokenIdx = -2; + // needs any value lower than -1 + var jumps = []; + for (closerIdx = 0; closerIdx < max; closerIdx++) { + closer = delimiters[closerIdx]; + jumps.push(0); + // markers belong to same delimiter run if: + // - they have adjacent tokens + // - AND markers are the same + + if (delimiters[headerIdx].marker !== closer.marker || lastTokenIdx !== closer.token - 1) { + headerIdx = closerIdx; + } + lastTokenIdx = closer.token; + // Length is only used for emphasis-specific "rule of 3", + // if it's not defined (in strikethrough or 3rd party plugins), + // we can default it to 0 to disable those checks. + + closer.length = closer.length || 0; + if (!closer.close) continue; + // Previously calculated lower bounds (previous fails) + // for each marker, each delimiter length modulo 3, + // and for whether this closer can be an opener; + // https://github.com/commonmark/cmark/commit/34250e12ccebdc6372b8b49c44fab57c72443460 + if (!openersBottom.hasOwnProperty(closer.marker)) { + openersBottom[closer.marker] = [ -1, -1, -1, -1, -1, -1 ]; + } + minOpenerIdx = openersBottom[closer.marker][(closer.open ? 3 : 0) + closer.length % 3]; + openerIdx = headerIdx - jumps[headerIdx] - 1; + newMinOpenerIdx = openerIdx; + for (;openerIdx > minOpenerIdx; openerIdx -= jumps[openerIdx] + 1) { + opener = delimiters[openerIdx]; + if (opener.marker !== closer.marker) continue; + if (opener.open && opener.end < 0) { + isOddMatch = false; + // from spec: + + // If one of the delimiters can both open and close emphasis, then the + // sum of the lengths of the delimiter runs containing the opening and + // closing delimiters must not be a multiple of 3 unless both lengths + // are multiples of 3. + + if (opener.close || closer.open) { + if ((opener.length + closer.length) % 3 === 0) { + if (opener.length % 3 !== 0 || closer.length % 3 !== 0) { + isOddMatch = true; + } + } + } + if (!isOddMatch) { + // If previous delimiter cannot be an opener, we can safely skip + // the entire sequence in future checks. This is required to make + // sure algorithm has linear complexity (see *_*_*_*_*_... case). + lastJump = openerIdx > 0 && !delimiters[openerIdx - 1].open ? jumps[openerIdx - 1] + 1 : 0; + jumps[closerIdx] = closerIdx - openerIdx + lastJump; + jumps[openerIdx] = lastJump; + closer.open = false; + opener.end = closerIdx; + opener.close = false; + newMinOpenerIdx = -1; + // treat next token as start of run, + // it optimizes skips in **<...>**a**<...>** pathological case + lastTokenIdx = -2; + break; + } + } + } + if (newMinOpenerIdx !== -1) { + // If match for this delimiter run failed, we want to set lower bound for + // future lookups. This is required to make sure algorithm has linear + // complexity. + // See details here: + // https://github.com/commonmark/cmark/issues/178#issuecomment-270417442 + openersBottom[closer.marker][(closer.open ? 3 : 0) + (closer.length || 0) % 3] = newMinOpenerIdx; + } + } + } + var balance_pairs = function link_pairs(state) { + var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length; + processDelimiters(state, state.delimiters); + for (curr = 0; curr < max; curr++) { + if (tokens_meta[curr] && tokens_meta[curr].delimiters) { + processDelimiters(state, tokens_meta[curr].delimiters); + } + } + }; + // Clean up tokens after emphasis and strikethrough postprocessing: + var text_collapse = function text_collapse(state) { + var curr, last, level = 0, tokens = state.tokens, max = state.tokens.length; + for (curr = last = 0; curr < max; curr++) { + // re-calculate levels after emphasis/strikethrough turns some text nodes + // into opening/closing tags + if (tokens[curr].nesting < 0) level--; + // closing tag + tokens[curr].level = level; + if (tokens[curr].nesting > 0) level++; + // opening tag + if (tokens[curr].type === "text" && curr + 1 < max && tokens[curr + 1].type === "text") { + // collapse two adjacent text nodes + tokens[curr + 1].content = tokens[curr].content + tokens[curr + 1].content; + } else { + if (curr !== last) { + tokens[last] = tokens[curr]; + } + last++; + } + } + if (curr !== last) { + tokens.length = last; + } + }; + var isWhiteSpace = utils.isWhiteSpace; + var isPunctChar = utils.isPunctChar; + var isMdAsciiPunct = utils.isMdAsciiPunct; + function StateInline(src, md, env, outTokens) { + this.src = src; + this.env = env; + this.md = md; + this.tokens = outTokens; + this.tokens_meta = Array(outTokens.length); + this.pos = 0; + this.posMax = this.src.length; + this.level = 0; + this.pending = ""; + this.pendingLevel = 0; + // Stores { start: end } pairs. Useful for backtrack + // optimization of pairs parse (emphasis, strikes). + this.cache = {}; + // List of emphasis-like delimiters for current tag + this.delimiters = []; + // Stack of delimiter lists for upper level tags + this._prev_delimiters = []; + // backtick length => last seen position + this.backticks = {}; + this.backticksScanned = false; + } + // Flush pending text + + StateInline.prototype.pushPending = function() { + var token$1 = new token("text", "", 0); + token$1.content = this.pending; + token$1.level = this.pendingLevel; + this.tokens.push(token$1); + this.pending = ""; + return token$1; + }; + // Push new token to "stream". + // If pending text exists - flush it as text token + + StateInline.prototype.push = function(type, tag, nesting) { + if (this.pending) { + this.pushPending(); + } + var token$1 = new token(type, tag, nesting); + var token_meta = null; + if (nesting < 0) { + // closing tag + this.level--; + this.delimiters = this._prev_delimiters.pop(); + } + token$1.level = this.level; + if (nesting > 0) { + // opening tag + this.level++; + this._prev_delimiters.push(this.delimiters); + this.delimiters = []; + token_meta = { + delimiters: this.delimiters + }; + } + this.pendingLevel = this.level; + this.tokens.push(token$1); + this.tokens_meta.push(token_meta); + return token$1; + }; + // Scan a sequence of emphasis-like markers, and determine whether + // it can start an emphasis sequence or end an emphasis sequence. + + // - start - position to scan from (it should point at a valid marker); + // - canSplitWord - determine if these markers can be found inside a word + + StateInline.prototype.scanDelims = function(start, canSplitWord) { + var pos = start, lastChar, nextChar, count, can_open, can_close, isLastWhiteSpace, isLastPunctChar, isNextWhiteSpace, isNextPunctChar, left_flanking = true, right_flanking = true, max = this.posMax, marker = this.src.charCodeAt(start); + // treat beginning of the line as a whitespace + lastChar = start > 0 ? this.src.charCodeAt(start - 1) : 32; + while (pos < max && this.src.charCodeAt(pos) === marker) { + pos++; + } + count = pos - start; + // treat end of the line as a whitespace + nextChar = pos < max ? this.src.charCodeAt(pos) : 32; + isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar)); + isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar)); + isLastWhiteSpace = isWhiteSpace(lastChar); + isNextWhiteSpace = isWhiteSpace(nextChar); + if (isNextWhiteSpace) { + left_flanking = false; + } else if (isNextPunctChar) { + if (!(isLastWhiteSpace || isLastPunctChar)) { + left_flanking = false; + } + } + if (isLastWhiteSpace) { + right_flanking = false; + } else if (isLastPunctChar) { + if (!(isNextWhiteSpace || isNextPunctChar)) { + right_flanking = false; + } + } + if (!canSplitWord) { + can_open = left_flanking && (!right_flanking || isLastPunctChar); + can_close = right_flanking && (!left_flanking || isNextPunctChar); + } else { + can_open = left_flanking; + can_close = right_flanking; + } + return { + can_open: can_open, + can_close: can_close, + length: count + }; + }; + // re-export Token class to use in block rules + StateInline.prototype.Token = token; + var state_inline = StateInline; + //////////////////////////////////////////////////////////////////////////////// + // Parser rules + var _rules = [ [ "text", text ], [ "newline", newline ], [ "escape", _escape ], [ "backticks", backticks ], [ "strikethrough", strikethrough.tokenize ], [ "emphasis", emphasis.tokenize ], [ "link", link ], [ "image", image ], [ "autolink", autolink ], [ "html_inline", html_inline ], [ "entity", entity ] ]; + var _rules2 = [ [ "balance_pairs", balance_pairs ], [ "strikethrough", strikethrough.postProcess ], [ "emphasis", emphasis.postProcess ], [ "text_collapse", text_collapse ] ]; + /** + * new ParserInline() + **/ function ParserInline() { + var i; + /** + * ParserInline#ruler -> Ruler + * + * [[Ruler]] instance. Keep configuration of inline rules. + **/ this.ruler = new ruler; + for (i = 0; i < _rules.length; i++) { + this.ruler.push(_rules[i][0], _rules[i][1]); + } + /** + * ParserInline#ruler2 -> Ruler + * + * [[Ruler]] instance. Second ruler used for post-processing + * (e.g. in emphasis-like rules). + **/ this.ruler2 = new ruler; + for (i = 0; i < _rules2.length; i++) { + this.ruler2.push(_rules2[i][0], _rules2[i][1]); + } + } + // Skip single token by running all rules in validation mode; + // returns `true` if any rule reported success + + ParserInline.prototype.skipToken = function(state) { + var ok, i, pos = state.pos, rules = this.ruler.getRules(""), len = rules.length, maxNesting = state.md.options.maxNesting, cache = state.cache; + if (typeof cache[pos] !== "undefined") { + state.pos = cache[pos]; + return; + } + if (state.level < maxNesting) { + for (i = 0; i < len; i++) { + // Increment state.level and decrement it later to limit recursion. + // It's harmless to do here, because no tokens are created. But ideally, + // we'd need a separate private state variable for this purpose. + state.level++; + ok = rules[i](state, true); + state.level--; + if (ok) { + break; + } + } + } else { + // Too much nesting, just skip until the end of the paragraph. + // NOTE: this will cause links to behave incorrectly in the following case, + // when an amount of `[` is exactly equal to `maxNesting + 1`: + // [[[[[[[[[[[[[[[[[[[[[foo]() + // TODO: remove this workaround when CM standard will allow nested links + // (we can replace it by preventing links from being parsed in + // validation mode) + state.pos = state.posMax; + } + if (!ok) { + state.pos++; + } + cache[pos] = state.pos; + }; + // Generate tokens for input range + + ParserInline.prototype.tokenize = function(state) { + var ok, i, rules = this.ruler.getRules(""), len = rules.length, end = state.posMax, maxNesting = state.md.options.maxNesting; + while (state.pos < end) { + // Try all possible rules. + // On success, rule should: + // - update `state.pos` + // - update `state.tokens` + // - return true + if (state.level < maxNesting) { + for (i = 0; i < len; i++) { + ok = rules[i](state, false); + if (ok) { + break; + } + } + } + if (ok) { + if (state.pos >= end) { + break; + } + continue; + } + state.pending += state.src[state.pos++]; + } + if (state.pending) { + state.pushPending(); + } + }; + /** + * ParserInline.parse(str, md, env, outTokens) + * + * Process input string and push inline tokens into `outTokens` + **/ ParserInline.prototype.parse = function(str, md, env, outTokens) { + var i, rules, len; + var state = new this.State(str, md, env, outTokens); + this.tokenize(state); + rules = this.ruler2.getRules(""); + len = rules.length; + for (i = 0; i < len; i++) { + rules[i](state); + } + }; + ParserInline.prototype.State = state_inline; + var parser_inline = ParserInline; + var re = function(opts) { + var re = {}; + // Use direct extract instead of `regenerate` to reduse browserified size + re.src_Any = regex$3.source; + re.src_Cc = regex$2.source; + re.src_Z = regex.source; + re.src_P = regex$4.source; + // \p{\Z\P\Cc\CF} (white spaces + control + format + punctuation) + re.src_ZPCc = [ re.src_Z, re.src_P, re.src_Cc ].join("|"); + // \p{\Z\Cc} (white spaces + control) + re.src_ZCc = [ re.src_Z, re.src_Cc ].join("|"); + // Experimental. List of chars, completely prohibited in links + // because can separate it from other part of text + var text_separators = "[><\uff5c]"; + // All possible word characters (everything without punctuation, spaces & controls) + // Defined via punctuation & spaces to save space + // Should be something like \p{\L\N\S\M} (\w but without `_`) + re.src_pseudo_letter = "(?:(?!" + text_separators + "|" + re.src_ZPCc + ")" + re.src_Any + ")"; + // The same as abothe but without [0-9] + // var src_pseudo_letter_non_d = '(?:(?![0-9]|' + src_ZPCc + ')' + src_Any + ')'; + //////////////////////////////////////////////////////////////////////////////// + re.src_ip4 = "(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)"; + // Prohibit any of "@/[]()" in user/pass to avoid wrong domain fetch. + re.src_auth = "(?:(?:(?!" + re.src_ZCc + "|[@/\\[\\]()]).)+@)?"; + re.src_port = "(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?"; + re.src_host_terminator = "(?=$|" + text_separators + "|" + re.src_ZPCc + ")(?!-|_|:\\d|\\.-|\\.(?!$|" + re.src_ZPCc + "))"; + re.src_path = "(?:" + "[/?#]" + "(?:" + "(?!" + re.src_ZCc + "|" + text_separators + "|[()[\\]{}.,\"'?!\\-;]).|" + "\\[(?:(?!" + re.src_ZCc + "|\\]).)*\\]|" + "\\((?:(?!" + re.src_ZCc + "|[)]).)*\\)|" + "\\{(?:(?!" + re.src_ZCc + "|[}]).)*\\}|" + '\\"(?:(?!' + re.src_ZCc + '|["]).)+\\"|' + "\\'(?:(?!" + re.src_ZCc + "|[']).)+\\'|" + "\\'(?=" + re.src_pseudo_letter + "|[-]).|" + // allow `I'm_king` if no pair found + "\\.{2,}[a-zA-Z0-9%/&]|" + // google has many dots in "google search" links (#66, #81). + // github has ... in commit range links, + // Restrict to + // - english + // - percent-encoded + // - parts of file path + // - params separator + // until more examples found. + "\\.(?!" + re.src_ZCc + "|[.]).|" + (opts && opts["---"] ? "\\-(?!--(?:[^-]|$))(?:-*)|" : "\\-+|") + ",(?!" + re.src_ZCc + ").|" + // allow `,,,` in paths + ";(?!" + re.src_ZCc + ").|" + // allow `;` if not followed by space-like char + "\\!+(?!" + re.src_ZCc + "|[!]).|" + // allow `!!!` in paths, but not at the end + "\\?(?!" + re.src_ZCc + "|[?])." + ")+" + "|\\/" + ")?"; + // Allow anything in markdown spec, forbid quote (") at the first position + // because emails enclosed in quotes are far more common + re.src_email_name = '[\\-;:&=\\+\\$,\\.a-zA-Z0-9_][\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]*'; + re.src_xn = "xn--[a-z0-9\\-]{1,59}"; + // More to read about domain names + // http://serverfault.com/questions/638260/ + re.src_domain_root = + // Allow letters & digits (http://test1) + "(?:" + re.src_xn + "|" + re.src_pseudo_letter + "{1,63}" + ")"; + re.src_domain = "(?:" + re.src_xn + "|" + "(?:" + re.src_pseudo_letter + ")" + "|" + "(?:" + re.src_pseudo_letter + "(?:-|" + re.src_pseudo_letter + "){0,61}" + re.src_pseudo_letter + ")" + ")"; + re.src_host = "(?:" + + // Don't need IP check, because digits are already allowed in normal domain names + // src_ip4 + + // '|' + + "(?:(?:(?:" + re.src_domain + ")\\.)*" + re.src_domain /*_root*/ + ")" + ")"; + re.tpl_host_fuzzy = "(?:" + re.src_ip4 + "|" + "(?:(?:(?:" + re.src_domain + ")\\.)+(?:%TLDS%))" + ")"; + re.tpl_host_no_ip_fuzzy = "(?:(?:(?:" + re.src_domain + ")\\.)+(?:%TLDS%))"; + re.src_host_strict = re.src_host + re.src_host_terminator; + re.tpl_host_fuzzy_strict = re.tpl_host_fuzzy + re.src_host_terminator; + re.src_host_port_strict = re.src_host + re.src_port + re.src_host_terminator; + re.tpl_host_port_fuzzy_strict = re.tpl_host_fuzzy + re.src_port + re.src_host_terminator; + re.tpl_host_port_no_ip_fuzzy_strict = re.tpl_host_no_ip_fuzzy + re.src_port + re.src_host_terminator; + //////////////////////////////////////////////////////////////////////////////// + // Main rules + // Rude test fuzzy links by host, for quick deny + re.tpl_host_fuzzy_test = "localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:" + re.src_ZPCc + "|>|$))"; + re.tpl_email_fuzzy = "(^|" + text_separators + '|"|\\(|' + re.src_ZCc + ")" + "(" + re.src_email_name + "@" + re.tpl_host_fuzzy_strict + ")"; + re.tpl_link_fuzzy = + // Fuzzy link can't be prepended with .:/\- and non punctuation. + // but can start with > (markdown blockquote) + "(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|" + re.src_ZPCc + "))" + "((?![$+<=>^`|\uff5c])" + re.tpl_host_port_fuzzy_strict + re.src_path + ")"; + re.tpl_link_no_ip_fuzzy = + // Fuzzy link can't be prepended with .:/\- and non punctuation. + // but can start with > (markdown blockquote) + "(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|" + re.src_ZPCc + "))" + "((?![$+<=>^`|\uff5c])" + re.tpl_host_port_no_ip_fuzzy_strict + re.src_path + ")"; + return re; + }; + //////////////////////////////////////////////////////////////////////////////// + // Helpers + // Merge objects + + function assign(obj /*from1, from2, from3, ...*/) { + var sources = Array.prototype.slice.call(arguments, 1); + sources.forEach((function(source) { + if (!source) { + return; + } + Object.keys(source).forEach((function(key) { + obj[key] = source[key]; + })); + })); + return obj; + } + function _class(obj) { + return Object.prototype.toString.call(obj); + } + function isString(obj) { + return _class(obj) === "[object String]"; + } + function isObject(obj) { + return _class(obj) === "[object Object]"; + } + function isRegExp(obj) { + return _class(obj) === "[object RegExp]"; + } + function isFunction(obj) { + return _class(obj) === "[object Function]"; + } + function escapeRE(str) { + return str.replace(/[.?*+^$[\]\\(){}|-]/g, "\\$&"); + } + //////////////////////////////////////////////////////////////////////////////// + var defaultOptions = { + fuzzyLink: true, + fuzzyEmail: true, + fuzzyIP: false + }; + function isOptionsObj(obj) { + return Object.keys(obj || {}).reduce((function(acc, k) { + return acc || defaultOptions.hasOwnProperty(k); + }), false); + } + var defaultSchemas = { + "http:": { + validate: function(text, pos, self) { + var tail = text.slice(pos); + if (!self.re.http) { + // compile lazily, because "host"-containing variables can change on tlds update. + self.re.http = new RegExp("^\\/\\/" + self.re.src_auth + self.re.src_host_port_strict + self.re.src_path, "i"); + } + if (self.re.http.test(tail)) { + return tail.match(self.re.http)[0].length; + } + return 0; + } + }, + "https:": "http:", + "ftp:": "http:", + "//": { + validate: function(text, pos, self) { + var tail = text.slice(pos); + if (!self.re.no_http) { + // compile lazily, because "host"-containing variables can change on tlds update. + self.re.no_http = new RegExp("^" + self.re.src_auth + + // Don't allow single-level domains, because of false positives like '//test' + // with code comments + "(?:localhost|(?:(?:" + self.re.src_domain + ")\\.)+" + self.re.src_domain_root + ")" + self.re.src_port + self.re.src_host_terminator + self.re.src_path, "i"); + } + if (self.re.no_http.test(tail)) { + // should not be `://` & `///`, that protects from errors in protocol name + if (pos >= 3 && text[pos - 3] === ":") { + return 0; + } + if (pos >= 3 && text[pos - 3] === "/") { + return 0; + } + return tail.match(self.re.no_http)[0].length; + } + return 0; + } + }, + "mailto:": { + validate: function(text, pos, self) { + var tail = text.slice(pos); + if (!self.re.mailto) { + self.re.mailto = new RegExp("^" + self.re.src_email_name + "@" + self.re.src_host_strict, "i"); + } + if (self.re.mailto.test(tail)) { + return tail.match(self.re.mailto)[0].length; + } + return 0; + } + } + }; + /*eslint-disable max-len*/ + // RE pattern for 2-character tlds (autogenerated by ./support/tlds_2char_gen.js) + var tlds_2ch_src_re = "a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]"; + // DON'T try to make PRs with changes. Extend TLDs with LinkifyIt.tlds() instead + var tlds_default = "biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|\u0440\u0444".split("|"); + /*eslint-enable max-len*/ + //////////////////////////////////////////////////////////////////////////////// + function resetScanCache(self) { + self.__index__ = -1; + self.__text_cache__ = ""; + } + function createValidator(re) { + return function(text, pos) { + var tail = text.slice(pos); + if (re.test(tail)) { + return tail.match(re)[0].length; + } + return 0; + }; + } + function createNormalizer() { + return function(match, self) { + self.normalize(match); + }; + } + // Schemas compiler. Build regexps. + + function compile(self) { + // Load & clone RE patterns. + var re$1 = self.re = re(self.__opts__); + // Define dynamic patterns + var tlds = self.__tlds__.slice(); + self.onCompile(); + if (!self.__tlds_replaced__) { + tlds.push(tlds_2ch_src_re); + } + tlds.push(re$1.src_xn); + re$1.src_tlds = tlds.join("|"); + function untpl(tpl) { + return tpl.replace("%TLDS%", re$1.src_tlds); + } + re$1.email_fuzzy = RegExp(untpl(re$1.tpl_email_fuzzy), "i"); + re$1.link_fuzzy = RegExp(untpl(re$1.tpl_link_fuzzy), "i"); + re$1.link_no_ip_fuzzy = RegExp(untpl(re$1.tpl_link_no_ip_fuzzy), "i"); + re$1.host_fuzzy_test = RegExp(untpl(re$1.tpl_host_fuzzy_test), "i"); + + // Compile each schema + + var aliases = []; + self.__compiled__ = {}; + // Reset compiled data + function schemaError(name, val) { + throw new Error('(LinkifyIt) Invalid schema "' + name + '": ' + val); + } + Object.keys(self.__schemas__).forEach((function(name) { + var val = self.__schemas__[name]; + // skip disabled methods + if (val === null) { + return; + } + var compiled = { + validate: null, + link: null + }; + self.__compiled__[name] = compiled; + if (isObject(val)) { + if (isRegExp(val.validate)) { + compiled.validate = createValidator(val.validate); + } else if (isFunction(val.validate)) { + compiled.validate = val.validate; + } else { + schemaError(name, val); + } + if (isFunction(val.normalize)) { + compiled.normalize = val.normalize; + } else if (!val.normalize) { + compiled.normalize = createNormalizer(); + } else { + schemaError(name, val); + } + return; + } + if (isString(val)) { + aliases.push(name); + return; + } + schemaError(name, val); + })); + + // Compile postponed aliases + + aliases.forEach((function(alias) { + if (!self.__compiled__[self.__schemas__[alias]]) { + // Silently fail on missed schemas to avoid errons on disable. + // schemaError(alias, self.__schemas__[alias]); + return; + } + self.__compiled__[alias].validate = self.__compiled__[self.__schemas__[alias]].validate; + self.__compiled__[alias].normalize = self.__compiled__[self.__schemas__[alias]].normalize; + })); + + // Fake record for guessed links + + self.__compiled__[""] = { + validate: null, + normalize: createNormalizer() + }; + + // Build schema condition + + var slist = Object.keys(self.__compiled__).filter((function(name) { + // Filter disabled & fake schemas + return name.length > 0 && self.__compiled__[name]; + })).map(escapeRE).join("|"); + // (?!_) cause 1.5x slowdown + self.re.schema_test = RegExp("(^|(?!_)(?:[><\uff5c]|" + re$1.src_ZPCc + "))(" + slist + ")", "i"); + self.re.schema_search = RegExp("(^|(?!_)(?:[><\uff5c]|" + re$1.src_ZPCc + "))(" + slist + ")", "ig"); + self.re.pretest = RegExp("(" + self.re.schema_test.source + ")|(" + self.re.host_fuzzy_test.source + ")|@", "i"); + + // Cleanup + + resetScanCache(self); + } + /** + * class Match + * + * Match result. Single element of array, returned by [[LinkifyIt#match]] + **/ function Match(self, shift) { + var start = self.__index__, end = self.__last_index__, text = self.__text_cache__.slice(start, end); + /** + * Match#schema -> String + * + * Prefix (protocol) for matched string. + **/ this.schema = self.__schema__.toLowerCase(); + /** + * Match#index -> Number + * + * First position of matched string. + **/ this.index = start + shift; + /** + * Match#lastIndex -> Number + * + * Next position after matched string. + **/ this.lastIndex = end + shift; + /** + * Match#raw -> String + * + * Matched string. + **/ this.raw = text; + /** + * Match#text -> String + * + * Notmalized text of matched string. + **/ this.text = text; + /** + * Match#url -> String + * + * Normalized url of matched string. + **/ this.url = text; + } + function createMatch(self, shift) { + var match = new Match(self, shift); + self.__compiled__[match.schema].normalize(match, self); + return match; + } + /** + * class LinkifyIt + **/ + /** + * new LinkifyIt(schemas, options) + * - schemas (Object): Optional. Additional schemas to validate (prefix/validator) + * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false } + * + * Creates new linkifier instance with optional additional schemas. + * Can be called without `new` keyword for convenience. + * + * By default understands: + * + * - `http(s)://...` , `ftp://...`, `mailto:...` & `//...` links + * - "fuzzy" links and emails (example.com, foo@bar.com). + * + * `schemas` is an object, where each key/value describes protocol/rule: + * + * - __key__ - link prefix (usually, protocol name with `:` at the end, `skype:` + * for example). `linkify-it` makes shure that prefix is not preceeded with + * alphanumeric char and symbols. Only whitespaces and punctuation allowed. + * - __value__ - rule to check tail after link prefix + * - _String_ - just alias to existing rule + * - _Object_ + * - _validate_ - validator function (should return matched length on success), + * or `RegExp`. + * - _normalize_ - optional function to normalize text & url of matched result + * (for example, for @twitter mentions). + * + * `options`: + * + * - __fuzzyLink__ - recognige URL-s without `http(s):` prefix. Default `true`. + * - __fuzzyIP__ - allow IPs in fuzzy links above. Can conflict with some texts + * like version numbers. Default `false`. + * - __fuzzyEmail__ - recognize emails without `mailto:` prefix. + * + **/ function LinkifyIt(schemas, options) { + if (!(this instanceof LinkifyIt)) { + return new LinkifyIt(schemas, options); + } + if (!options) { + if (isOptionsObj(schemas)) { + options = schemas; + schemas = {}; + } + } + this.__opts__ = assign({}, defaultOptions, options); + // Cache last tested result. Used to skip repeating steps on next `match` call. + this.__index__ = -1; + this.__last_index__ = -1; + // Next scan position + this.__schema__ = ""; + this.__text_cache__ = ""; + this.__schemas__ = assign({}, defaultSchemas, schemas); + this.__compiled__ = {}; + this.__tlds__ = tlds_default; + this.__tlds_replaced__ = false; + this.re = {}; + compile(this); + } + /** chainable + * LinkifyIt#add(schema, definition) + * - schema (String): rule name (fixed pattern prefix) + * - definition (String|RegExp|Object): schema definition + * + * Add new rule definition. See constructor description for details. + **/ LinkifyIt.prototype.add = function add(schema, definition) { + this.__schemas__[schema] = definition; + compile(this); + return this; + }; + /** chainable + * LinkifyIt#set(options) + * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false } + * + * Set recognition options for links without schema. + **/ LinkifyIt.prototype.set = function set(options) { + this.__opts__ = assign(this.__opts__, options); + return this; + }; + /** + * LinkifyIt#test(text) -> Boolean + * + * Searches linkifiable pattern and returns `true` on success or `false` on fail. + **/ LinkifyIt.prototype.test = function test(text) { + // Reset scan cache + this.__text_cache__ = text; + this.__index__ = -1; + if (!text.length) { + return false; + } + var m, ml, me, len, shift, next, re, tld_pos, at_pos; + // try to scan for link with schema - that's the most simple rule + if (this.re.schema_test.test(text)) { + re = this.re.schema_search; + re.lastIndex = 0; + while ((m = re.exec(text)) !== null) { + len = this.testSchemaAt(text, m[2], re.lastIndex); + if (len) { + this.__schema__ = m[2]; + this.__index__ = m.index + m[1].length; + this.__last_index__ = m.index + m[0].length + len; + break; + } + } + } + if (this.__opts__.fuzzyLink && this.__compiled__["http:"]) { + // guess schemaless links + tld_pos = text.search(this.re.host_fuzzy_test); + if (tld_pos >= 0) { + // if tld is located after found link - no need to check fuzzy pattern + if (this.__index__ < 0 || tld_pos < this.__index__) { + if ((ml = text.match(this.__opts__.fuzzyIP ? this.re.link_fuzzy : this.re.link_no_ip_fuzzy)) !== null) { + shift = ml.index + ml[1].length; + if (this.__index__ < 0 || shift < this.__index__) { + this.__schema__ = ""; + this.__index__ = shift; + this.__last_index__ = ml.index + ml[0].length; + } + } + } + } + } + if (this.__opts__.fuzzyEmail && this.__compiled__["mailto:"]) { + // guess schemaless emails + at_pos = text.indexOf("@"); + if (at_pos >= 0) { + // We can't skip this check, because this cases are possible: + // 192.168.1.1@gmail.com, my.in@example.com + if ((me = text.match(this.re.email_fuzzy)) !== null) { + shift = me.index + me[1].length; + next = me.index + me[0].length; + if (this.__index__ < 0 || shift < this.__index__ || shift === this.__index__ && next > this.__last_index__) { + this.__schema__ = "mailto:"; + this.__index__ = shift; + this.__last_index__ = next; + } + } + } + } + return this.__index__ >= 0; + }; + /** + * LinkifyIt#pretest(text) -> Boolean + * + * Very quick check, that can give false positives. Returns true if link MAY BE + * can exists. Can be used for speed optimization, when you need to check that + * link NOT exists. + **/ LinkifyIt.prototype.pretest = function pretest(text) { + return this.re.pretest.test(text); + }; + /** + * LinkifyIt#testSchemaAt(text, name, position) -> Number + * - text (String): text to scan + * - name (String): rule (schema) name + * - position (Number): text offset to check from + * + * Similar to [[LinkifyIt#test]] but checks only specific protocol tail exactly + * at given position. Returns length of found pattern (0 on fail). + **/ LinkifyIt.prototype.testSchemaAt = function testSchemaAt(text, schema, pos) { + // If not supported schema check requested - terminate + if (!this.__compiled__[schema.toLowerCase()]) { + return 0; + } + return this.__compiled__[schema.toLowerCase()].validate(text, pos, this); + }; + /** + * LinkifyIt#match(text) -> Array|null + * + * Returns array of found link descriptions or `null` on fail. We strongly + * recommend to use [[LinkifyIt#test]] first, for best speed. + * + * ##### Result match description + * + * - __schema__ - link schema, can be empty for fuzzy links, or `//` for + * protocol-neutral links. + * - __index__ - offset of matched text + * - __lastIndex__ - index of next char after mathch end + * - __raw__ - matched text + * - __text__ - normalized text + * - __url__ - link, generated from matched text + **/ LinkifyIt.prototype.match = function match(text) { + var shift = 0, result = []; + // Try to take previous element from cache, if .test() called before + if (this.__index__ >= 0 && this.__text_cache__ === text) { + result.push(createMatch(this, shift)); + shift = this.__last_index__; + } + // Cut head if cache was used + var tail = shift ? text.slice(shift) : text; + // Scan string until end reached + while (this.test(tail)) { + result.push(createMatch(this, shift)); + tail = tail.slice(this.__last_index__); + shift += this.__last_index__; + } + if (result.length) { + return result; + } + return null; + }; + /** chainable + * LinkifyIt#tlds(list [, keepOld]) -> this + * - list (Array): list of tlds + * - keepOld (Boolean): merge with current list if `true` (`false` by default) + * + * Load (or merge) new tlds list. Those are user for fuzzy links (without prefix) + * to avoid false positives. By default this algorythm used: + * + * - hostname with any 2-letter root zones are ok. + * - biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|рф + * are ok. + * - encoded (`xn--...`) root zones are ok. + * + * If list is replaced, then exact match for 2-chars root zones will be checked. + **/ LinkifyIt.prototype.tlds = function tlds(list, keepOld) { + list = Array.isArray(list) ? list : [ list ]; + if (!keepOld) { + this.__tlds__ = list.slice(); + this.__tlds_replaced__ = true; + compile(this); + return this; + } + this.__tlds__ = this.__tlds__.concat(list).sort().filter((function(el, idx, arr) { + return el !== arr[idx - 1]; + })).reverse(); + compile(this); + return this; + }; + /** + * LinkifyIt#normalize(match) + * + * Default normalizer (if schema does not define it's own). + **/ LinkifyIt.prototype.normalize = function normalize(match) { + // Do minimal possible changes by default. Need to collect feedback prior + // to move forward https://github.com/markdown-it/linkify-it/issues/1 + if (!match.schema) { + match.url = "http://" + match.url; + } + if (match.schema === "mailto:" && !/^mailto:/i.test(match.url)) { + match.url = "mailto:" + match.url; + } + }; + /** + * LinkifyIt#onCompile() + * + * Override to modify basic RegExp-s. + **/ LinkifyIt.prototype.onCompile = function onCompile() {}; + var linkifyIt = LinkifyIt; + /*! https://mths.be/punycode v1.4.1 by @mathias */ + /** Highest positive signed 32-bit float value */ var maxInt = 2147483647; + // aka. 0x7FFFFFFF or 2^31-1 + /** Bootstring parameters */ var base = 36; + var tMin = 1; + var tMax = 26; + var skew = 38; + var damp = 700; + var initialBias = 72; + var initialN = 128; + // 0x80 + var delimiter = "-"; + // '\x2D' + /** Regular expressions */ var regexPunycode = /^xn--/; + var regexNonASCII = /[^\x20-\x7E]/; + // unprintable ASCII chars + non-ASCII chars + var regexSeparators = /[\x2E\u3002\uFF0E\uFF61]/g; + // RFC 3490 separators + /** Error messages */ var errors = { + overflow: "Overflow: input needs wider integers to process", + "not-basic": "Illegal input >= 0x80 (not a basic code point)", + "invalid-input": "Invalid input" + }; + /** Convenience shortcuts */ var baseMinusTMin = base - tMin; + var floor = Math.floor; + var stringFromCharCode = String.fromCharCode; + /*--------------------------------------------------------------------------*/ + /** + * A generic error utility function. + * @private + * @param {String} type The error type. + * @returns {Error} Throws a `RangeError` with the applicable error message. + */ function error(type) { + throw new RangeError(errors[type]); + } + /** + * A generic `Array#map` utility function. + * @private + * @param {Array} array The array to iterate over. + * @param {Function} callback The function that gets called for every array + * item. + * @returns {Array} A new array of values returned by the callback function. + */ function map(array, fn) { + var length = array.length; + var result = []; + while (length--) { + result[length] = fn(array[length]); + } + return result; + } + /** + * A simple `Array#map`-like wrapper to work with domain name strings or email + * addresses. + * @private + * @param {String} domain The domain name or email address. + * @param {Function} callback The function that gets called for every + * character. + * @returns {Array} A new string of characters returned by the callback + * function. + */ function mapDomain(string, fn) { + var parts = string.split("@"); + var result = ""; + if (parts.length > 1) { + // In email addresses, only the domain name should be punycoded. Leave + // the local part (i.e. everything up to `@`) intact. + result = parts[0] + "@"; + string = parts[1]; + } + // Avoid `split(regex)` for IE8 compatibility. See #17. + string = string.replace(regexSeparators, "."); + var labels = string.split("."); + var encoded = map(labels, fn).join("."); + return result + encoded; + } + /** + * Creates an array containing the numeric code points of each Unicode + * character in the string. While JavaScript uses UCS-2 internally, + * this function will convert a pair of surrogate halves (each of which + * UCS-2 exposes as separate characters) into a single code point, + * matching UTF-16. + * @see `punycode.ucs2.encode` + * @see <https://mathiasbynens.be/notes/javascript-encoding> + * @memberOf punycode.ucs2 + * @name decode + * @param {String} string The Unicode input string (UCS-2). + * @returns {Array} The new array of code points. + */ function ucs2decode(string) { + var output = [], counter = 0, length = string.length, value, extra; + while (counter < length) { + value = string.charCodeAt(counter++); + if (value >= 55296 && value <= 56319 && counter < length) { + // high surrogate, and there is a next character + extra = string.charCodeAt(counter++); + if ((extra & 64512) == 56320) { + // low surrogate + output.push(((value & 1023) << 10) + (extra & 1023) + 65536); + } else { + // unmatched surrogate; only append this code unit, in case the next + // code unit is the high surrogate of a surrogate pair + output.push(value); + counter--; + } + } else { + output.push(value); + } + } + return output; + } + /** + * Creates a string based on an array of numeric code points. + * @see `punycode.ucs2.decode` + * @memberOf punycode.ucs2 + * @name encode + * @param {Array} codePoints The array of numeric code points. + * @returns {String} The new Unicode string (UCS-2). + */ function ucs2encode(array) { + return map(array, (function(value) { + var output = ""; + if (value > 65535) { + value -= 65536; + output += stringFromCharCode(value >>> 10 & 1023 | 55296); + value = 56320 | value & 1023; + } + output += stringFromCharCode(value); + return output; + })).join(""); + } + /** + * Converts a basic code point into a digit/integer. + * @see `digitToBasic()` + * @private + * @param {Number} codePoint The basic numeric code point value. + * @returns {Number} The numeric value of a basic code point (for use in + * representing integers) in the range `0` to `base - 1`, or `base` if + * the code point does not represent a value. + */ function basicToDigit(codePoint) { + if (codePoint - 48 < 10) { + return codePoint - 22; + } + if (codePoint - 65 < 26) { + return codePoint - 65; + } + if (codePoint - 97 < 26) { + return codePoint - 97; + } + return base; + } + /** + * Converts a digit/integer into a basic code point. + * @see `basicToDigit()` + * @private + * @param {Number} digit The numeric value of a basic code point. + * @returns {Number} The basic code point whose value (when used for + * representing integers) is `digit`, which needs to be in the range + * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is + * used; else, the lowercase form is used. The behavior is undefined + * if `flag` is non-zero and `digit` has no uppercase form. + */ function digitToBasic(digit, flag) { + // 0..25 map to ASCII a..z or A..Z + // 26..35 map to ASCII 0..9 + return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5); + } + /** + * Bias adaptation function as per section 3.4 of RFC 3492. + * https://tools.ietf.org/html/rfc3492#section-3.4 + * @private + */ function adapt(delta, numPoints, firstTime) { + var k = 0; + delta = firstTime ? floor(delta / damp) : delta >> 1; + delta += floor(delta / numPoints); + for (;delta > baseMinusTMin * tMax >> 1; k += base) { + delta = floor(delta / baseMinusTMin); + } + return floor(k + (baseMinusTMin + 1) * delta / (delta + skew)); + } + /** + * Converts a Punycode string of ASCII-only symbols to a string of Unicode + * symbols. + * @memberOf punycode + * @param {String} input The Punycode string of ASCII-only symbols. + * @returns {String} The resulting string of Unicode symbols. + */ function decode(input) { + // Don't use UCS-2 + var output = [], inputLength = input.length, out, i = 0, n = initialN, bias = initialBias, basic, j, index, oldi, w, k, digit, t, + /** Cached calculation results */ + baseMinusT; + // Handle the basic code points: let `basic` be the number of input code + // points before the last delimiter, or `0` if there is none, then copy + // the first basic code points to the output. + basic = input.lastIndexOf(delimiter); + if (basic < 0) { + basic = 0; + } + for (j = 0; j < basic; ++j) { + // if it's not a basic code point + if (input.charCodeAt(j) >= 128) { + error("not-basic"); + } + output.push(input.charCodeAt(j)); + } + // Main decoding loop: start just after the last delimiter if any basic code + // points were copied; start at the beginning otherwise. + for (index = basic > 0 ? basic + 1 : 0; index < inputLength; ) { + // `index` is the index of the next character to be consumed. + // Decode a generalized variable-length integer into `delta`, + // which gets added to `i`. The overflow checking is easier + // if we increase `i` as we go, then subtract off its starting + // value at the end to obtain `delta`. + for (oldi = i, w = 1, k = base; ;k += base) { + if (index >= inputLength) { + error("invalid-input"); + } + digit = basicToDigit(input.charCodeAt(index++)); + if (digit >= base || digit > floor((maxInt - i) / w)) { + error("overflow"); + } + i += digit * w; + t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; + if (digit < t) { + break; + } + baseMinusT = base - t; + if (w > floor(maxInt / baseMinusT)) { + error("overflow"); + } + w *= baseMinusT; + } + out = output.length + 1; + bias = adapt(i - oldi, out, oldi == 0); + // `i` was supposed to wrap around from `out` to `0`, + // incrementing `n` each time, so we'll fix that now: + if (floor(i / out) > maxInt - n) { + error("overflow"); + } + n += floor(i / out); + i %= out; + // Insert `n` at position `i` of the output + output.splice(i++, 0, n); + } + return ucs2encode(output); + } + /** + * Converts a string of Unicode symbols (e.g. a domain name label) to a + * Punycode string of ASCII-only symbols. + * @memberOf punycode + * @param {String} input The string of Unicode symbols. + * @returns {String} The resulting Punycode string of ASCII-only symbols. + */ function encode(input) { + var n, delta, handledCPCount, basicLength, bias, j, m, q, k, t, currentValue, output = [], + /** `inputLength` will hold the number of code points in `input`. */ + inputLength, + /** Cached calculation results */ + handledCPCountPlusOne, baseMinusT, qMinusT; + // Convert the input in UCS-2 to Unicode + input = ucs2decode(input); + // Cache the length + inputLength = input.length; + // Initialize the state + n = initialN; + delta = 0; + bias = initialBias; + // Handle the basic code points + for (j = 0; j < inputLength; ++j) { + currentValue = input[j]; + if (currentValue < 128) { + output.push(stringFromCharCode(currentValue)); + } + } + handledCPCount = basicLength = output.length; + // `handledCPCount` is the number of code points that have been handled; + // `basicLength` is the number of basic code points. + // Finish the basic string - if it is not empty - with a delimiter + if (basicLength) { + output.push(delimiter); + } + // Main encoding loop: + while (handledCPCount < inputLength) { + // All non-basic code points < n have been handled already. Find the next + // larger one: + for (m = maxInt, j = 0; j < inputLength; ++j) { + currentValue = input[j]; + if (currentValue >= n && currentValue < m) { + m = currentValue; + } + } + // Increase `delta` enough to advance the decoder's <n,i> state to <m,0>, + // but guard against overflow + handledCPCountPlusOne = handledCPCount + 1; + if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) { + error("overflow"); + } + delta += (m - n) * handledCPCountPlusOne; + n = m; + for (j = 0; j < inputLength; ++j) { + currentValue = input[j]; + if (currentValue < n && ++delta > maxInt) { + error("overflow"); + } + if (currentValue == n) { + // Represent delta as a generalized variable-length integer + for (q = delta, k = base; ;k += base) { + t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; + if (q < t) { + break; + } + qMinusT = q - t; + baseMinusT = base - t; + output.push(stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0))); + q = floor(qMinusT / baseMinusT); + } + output.push(stringFromCharCode(digitToBasic(q, 0))); + bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength); + delta = 0; + ++handledCPCount; + } + } + ++delta; + ++n; + } + return output.join(""); + } + /** + * Converts a Punycode string representing a domain name or an email address + * to Unicode. Only the Punycoded parts of the input will be converted, i.e. + * it doesn't matter if you call it on a string that has already been + * converted to Unicode. + * @memberOf punycode + * @param {String} input The Punycoded domain name or email address to + * convert to Unicode. + * @returns {String} The Unicode representation of the given Punycode + * string. + */ function toUnicode(input) { + return mapDomain(input, (function(string) { + return regexPunycode.test(string) ? decode(string.slice(4).toLowerCase()) : string; + })); + } + /** + * Converts a Unicode string representing a domain name or an email address to + * Punycode. Only the non-ASCII parts of the domain name will be converted, + * i.e. it doesn't matter if you call it with a domain that's already in + * ASCII. + * @memberOf punycode + * @param {String} input The domain name or email address to convert, as a + * Unicode string. + * @returns {String} The Punycode representation of the given domain name or + * email address. + */ function toASCII(input) { + return mapDomain(input, (function(string) { + return regexNonASCII.test(string) ? "xn--" + encode(string) : string; + })); + } + var version = "1.4.1"; + /** + * An object of methods to convert from JavaScript's internal character + * representation (UCS-2) to Unicode code points, and back. + * @see <https://mathiasbynens.be/notes/javascript-encoding> + * @memberOf punycode + * @type Object + */ var ucs2 = { + decode: ucs2decode, + encode: ucs2encode + }; + var punycode$1 = { + version: version, + ucs2: ucs2, + toASCII: toASCII, + toUnicode: toUnicode, + encode: encode, + decode: decode + }; + var punycode$2 = Object.freeze({ + __proto__: null, + decode: decode, + encode: encode, + toUnicode: toUnicode, + toASCII: toASCII, + version: version, + ucs2: ucs2, + default: punycode$1 + }); + // markdown-it default options + var _default = { + options: { + html: false, + // Enable HTML tags in source + xhtmlOut: false, + // Use '/' to close single tags (<br />) + breaks: false, + // Convert '\n' in paragraphs into <br> + langPrefix: "language-", + // CSS language prefix for fenced blocks + linkify: false, + // autoconvert URL-like texts to links + // Enable some language-neutral replacements + quotes beautification + typographer: false, + // Double + single quotes replacement pairs, when typographer enabled, + // and smartquotes on. Could be either a String or an Array. + // For example, you can use '«»„“' for Russian, '„“‚‘' for German, + // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). + quotes: "\u201c\u201d\u2018\u2019", + /* “”‘’ */ + // Highlighter function. Should return escaped HTML, + // or '' if the source string is not changed and should be escaped externaly. + // If result starts with <pre... internal wrapper is skipped. + // function (/*str, lang*/) { return ''; } + highlight: null, + maxNesting: 100 + }, + components: { + core: {}, + block: {}, + inline: {} + } + }; + // "Zero" preset, with nothing enabled. Useful for manual configuring of simple + var zero = { + options: { + html: false, + // Enable HTML tags in source + xhtmlOut: false, + // Use '/' to close single tags (<br />) + breaks: false, + // Convert '\n' in paragraphs into <br> + langPrefix: "language-", + // CSS language prefix for fenced blocks + linkify: false, + // autoconvert URL-like texts to links + // Enable some language-neutral replacements + quotes beautification + typographer: false, + // Double + single quotes replacement pairs, when typographer enabled, + // and smartquotes on. Could be either a String or an Array. + // For example, you can use '«»„“' for Russian, '„“‚‘' for German, + // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). + quotes: "\u201c\u201d\u2018\u2019", + /* “”‘’ */ + // Highlighter function. Should return escaped HTML, + // or '' if the source string is not changed and should be escaped externaly. + // If result starts with <pre... internal wrapper is skipped. + // function (/*str, lang*/) { return ''; } + highlight: null, + maxNesting: 20 + }, + components: { + core: { + rules: [ "normalize", "block", "inline" ] + }, + block: { + rules: [ "paragraph" ] + }, + inline: { + rules: [ "text" ], + rules2: [ "balance_pairs", "text_collapse" ] + } + } + }; + // Commonmark default options + var commonmark = { + options: { + html: true, + // Enable HTML tags in source + xhtmlOut: true, + // Use '/' to close single tags (<br />) + breaks: false, + // Convert '\n' in paragraphs into <br> + langPrefix: "language-", + // CSS language prefix for fenced blocks + linkify: false, + // autoconvert URL-like texts to links + // Enable some language-neutral replacements + quotes beautification + typographer: false, + // Double + single quotes replacement pairs, when typographer enabled, + // and smartquotes on. Could be either a String or an Array. + // For example, you can use '«»„“' for Russian, '„“‚‘' for German, + // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). + quotes: "\u201c\u201d\u2018\u2019", + /* “”‘’ */ + // Highlighter function. Should return escaped HTML, + // or '' if the source string is not changed and should be escaped externaly. + // If result starts with <pre... internal wrapper is skipped. + // function (/*str, lang*/) { return ''; } + highlight: null, + maxNesting: 20 + }, + components: { + core: { + rules: [ "normalize", "block", "inline" ] + }, + block: { + rules: [ "blockquote", "code", "fence", "heading", "hr", "html_block", "lheading", "list", "reference", "paragraph" ] + }, + inline: { + rules: [ "autolink", "backticks", "emphasis", "entity", "escape", "html_inline", "image", "link", "newline", "text" ], + rules2: [ "balance_pairs", "emphasis", "text_collapse" ] + } + } + }; + var punycode = getAugmentedNamespace(punycode$2); + var config = { + default: _default, + zero: zero, + commonmark: commonmark + }; + //////////////////////////////////////////////////////////////////////////////// + + // This validator can prohibit more than really needed to prevent XSS. It's a + // tradeoff to keep code simple and to be secure by default. + + // If you need different setup - override validator method as you wish. Or + // replace it with dummy function and use external sanitizer. + + var BAD_PROTO_RE = /^(vbscript|javascript|file|data):/; + var GOOD_DATA_RE = /^data:image\/(gif|png|jpeg|webp);/; + function validateLink(url) { + // url should be normalized at this point, and existing entities are decoded + var str = url.trim().toLowerCase(); + return BAD_PROTO_RE.test(str) ? GOOD_DATA_RE.test(str) ? true : false : true; + } + //////////////////////////////////////////////////////////////////////////////// + var RECODE_HOSTNAME_FOR = [ "http:", "https:", "mailto:" ]; + function normalizeLink(url) { + var parsed = mdurl.parse(url, true); + if (parsed.hostname) { + // Encode hostnames in urls like: + // `http://host/`, `https://host/`, `mailto:user@host`, `//host/` + // We don't encode unknown schemas, because it's likely that we encode + // something we shouldn't (e.g. `skype:name` treated as `skype:host`) + if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) { + try { + parsed.hostname = punycode.toASCII(parsed.hostname); + } catch (er) {} + } + } + return mdurl.encode(mdurl.format(parsed)); + } + function normalizeLinkText(url) { + var parsed = mdurl.parse(url, true); + if (parsed.hostname) { + // Encode hostnames in urls like: + // `http://host/`, `https://host/`, `mailto:user@host`, `//host/` + // We don't encode unknown schemas, because it's likely that we encode + // something we shouldn't (e.g. `skype:name` treated as `skype:host`) + if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) { + try { + parsed.hostname = punycode.toUnicode(parsed.hostname); + } catch (er) {} + } + } + // add '%' to exclude list because of https://github.com/markdown-it/markdown-it/issues/720 + return mdurl.decode(mdurl.format(parsed), mdurl.decode.defaultChars + "%"); + } + /** + * class MarkdownIt + * + * Main parser/renderer class. + * + * ##### Usage + * + * ```javascript + * // node.js, "classic" way: + * var MarkdownIt = require('markdown-it'), + * md = new MarkdownIt(); + * var result = md.render('# markdown-it rulezz!'); + * + * // node.js, the same, but with sugar: + * var md = require('markdown-it')(); + * var result = md.render('# markdown-it rulezz!'); + * + * // browser without AMD, added to "window" on script load + * // Note, there are no dash. + * var md = window.markdownit(); + * var result = md.render('# markdown-it rulezz!'); + * ``` + * + * Single line rendering, without paragraph wrap: + * + * ```javascript + * var md = require('markdown-it')(); + * var result = md.renderInline('__markdown-it__ rulezz!'); + * ``` + **/ + /** + * new MarkdownIt([presetName, options]) + * - presetName (String): optional, `commonmark` / `zero` + * - options (Object) + * + * Creates parser instanse with given config. Can be called without `new`. + * + * ##### presetName + * + * MarkdownIt provides named presets as a convenience to quickly + * enable/disable active syntax rules and options for common use cases. + * + * - ["commonmark"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/commonmark.js) - + * configures parser to strict [CommonMark](http://commonmark.org/) mode. + * - [default](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/default.js) - + * similar to GFM, used when no preset name given. Enables all available rules, + * but still without html, typographer & autolinker. + * - ["zero"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/zero.js) - + * all rules disabled. Useful to quickly setup your config via `.enable()`. + * For example, when you need only `bold` and `italic` markup and nothing else. + * + * ##### options: + * + * - __html__ - `false`. Set `true` to enable HTML tags in source. Be careful! + * That's not safe! You may need external sanitizer to protect output from XSS. + * It's better to extend features via plugins, instead of enabling HTML. + * - __xhtmlOut__ - `false`. Set `true` to add '/' when closing single tags + * (`<br />`). This is needed only for full CommonMark compatibility. In real + * world you will need HTML output. + * - __breaks__ - `false`. Set `true` to convert `\n` in paragraphs into `<br>`. + * - __langPrefix__ - `language-`. CSS language class prefix for fenced blocks. + * Can be useful for external highlighters. + * - __linkify__ - `false`. Set `true` to autoconvert URL-like text to links. + * - __typographer__ - `false`. Set `true` to enable [some language-neutral + * replacement](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js) + + * quotes beautification (smartquotes). + * - __quotes__ - `“”‘’`, String or Array. Double + single quotes replacement + * pairs, when typographer enabled and smartquotes on. For example, you can + * use `'«»„“'` for Russian, `'„“‚‘'` for German, and + * `['«\xA0', '\xA0»', '‹\xA0', '\xA0›']` for French (including nbsp). + * - __highlight__ - `null`. Highlighter function for fenced code blocks. + * Highlighter `function (str, lang)` should return escaped HTML. It can also + * return empty string if the source was not changed and should be escaped + * externaly. If result starts with <pre... internal wrapper is skipped. + * + * ##### Example + * + * ```javascript + * // commonmark mode + * var md = require('markdown-it')('commonmark'); + * + * // default mode + * var md = require('markdown-it')(); + * + * // enable everything + * var md = require('markdown-it')({ + * html: true, + * linkify: true, + * typographer: true + * }); + * ``` + * + * ##### Syntax highlighting + * + * ```js + * var hljs = require('highlight.js') // https://highlightjs.org/ + * + * var md = require('markdown-it')({ + * highlight: function (str, lang) { + * if (lang && hljs.getLanguage(lang)) { + * try { + * return hljs.highlight(str, { language: lang, ignoreIllegals: true }).value; + * } catch (__) {} + * } + * + * return ''; // use external default escaping + * } + * }); + * ``` + * + * Or with full wrapper override (if you need assign class to `<pre>`): + * + * ```javascript + * var hljs = require('highlight.js') // https://highlightjs.org/ + * + * // Actual default values + * var md = require('markdown-it')({ + * highlight: function (str, lang) { + * if (lang && hljs.getLanguage(lang)) { + * try { + * return '<pre class="hljs"><code>' + + * hljs.highlight(str, { language: lang, ignoreIllegals: true }).value + + * '</code></pre>'; + * } catch (__) {} + * } + * + * return '<pre class="hljs"><code>' + md.utils.escapeHtml(str) + '</code></pre>'; + * } + * }); + * ``` + * + **/ function MarkdownIt(presetName, options) { + if (!(this instanceof MarkdownIt)) { + return new MarkdownIt(presetName, options); + } + if (!options) { + if (!utils.isString(presetName)) { + options = presetName || {}; + presetName = "default"; + } + } + /** + * MarkdownIt#inline -> ParserInline + * + * Instance of [[ParserInline]]. You may need it to add new rules when + * writing plugins. For simple rules control use [[MarkdownIt.disable]] and + * [[MarkdownIt.enable]]. + **/ this.inline = new parser_inline; + /** + * MarkdownIt#block -> ParserBlock + * + * Instance of [[ParserBlock]]. You may need it to add new rules when + * writing plugins. For simple rules control use [[MarkdownIt.disable]] and + * [[MarkdownIt.enable]]. + **/ this.block = new parser_block; + /** + * MarkdownIt#core -> Core + * + * Instance of [[Core]] chain executor. You may need it to add new rules when + * writing plugins. For simple rules control use [[MarkdownIt.disable]] and + * [[MarkdownIt.enable]]. + **/ this.core = new parser_core; + /** + * MarkdownIt#renderer -> Renderer + * + * Instance of [[Renderer]]. Use it to modify output look. Or to add rendering + * rules for new token types, generated by plugins. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * function myToken(tokens, idx, options, env, self) { + * //... + * return result; + * }; + * + * md.renderer.rules['my_token'] = myToken + * ``` + * + * See [[Renderer]] docs and [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js). + **/ this.renderer = new renderer; + /** + * MarkdownIt#linkify -> LinkifyIt + * + * [linkify-it](https://github.com/markdown-it/linkify-it) instance. + * Used by [linkify](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/linkify.js) + * rule. + **/ this.linkify = new linkifyIt; + /** + * MarkdownIt#validateLink(url) -> Boolean + * + * Link validation function. CommonMark allows too much in links. By default + * we disable `javascript:`, `vbscript:`, `file:` schemas, and almost all `data:...` schemas + * except some embedded image types. + * + * You can change this behaviour: + * + * ```javascript + * var md = require('markdown-it')(); + * // enable everything + * md.validateLink = function () { return true; } + * ``` + **/ this.validateLink = validateLink; + /** + * MarkdownIt#normalizeLink(url) -> String + * + * Function used to encode link url to a machine-readable format, + * which includes url-encoding, punycode, etc. + **/ this.normalizeLink = normalizeLink; + /** + * MarkdownIt#normalizeLinkText(url) -> String + * + * Function used to decode link url to a human-readable format` + **/ this.normalizeLinkText = normalizeLinkText; + // Expose utils & helpers for easy acces from plugins + /** + * MarkdownIt#utils -> utils + * + * Assorted utility functions, useful to write plugins. See details + * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/common/utils.js). + **/ this.utils = utils; + /** + * MarkdownIt#helpers -> helpers + * + * Link components parser functions, useful to write plugins. See details + * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/helpers). + **/ this.helpers = utils.assign({}, helpers); + this.options = {}; + this.configure(presetName); + if (options) { + this.set(options); + } + } + /** chainable + * MarkdownIt.set(options) + * + * Set parser options (in the same format as in constructor). Probably, you + * will never need it, but you can change options after constructor call. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')() + * .set({ html: true, breaks: true }) + * .set({ typographer, true }); + * ``` + * + * __Note:__ To achieve the best possible performance, don't modify a + * `markdown-it` instance options on the fly. If you need multiple configurations + * it's best to create multiple instances and initialize each with separate + * config. + **/ MarkdownIt.prototype.set = function(options) { + utils.assign(this.options, options); + return this; + }; + /** chainable, internal + * MarkdownIt.configure(presets) + * + * Batch load of all options and compenent settings. This is internal method, + * and you probably will not need it. But if you will - see available presets + * and data structure [here](https://github.com/markdown-it/markdown-it/tree/master/lib/presets) + * + * We strongly recommend to use presets instead of direct config loads. That + * will give better compatibility with next versions. + **/ MarkdownIt.prototype.configure = function(presets) { + var self = this, presetName; + if (utils.isString(presets)) { + presetName = presets; + presets = config[presetName]; + if (!presets) { + throw new Error('Wrong `markdown-it` preset "' + presetName + '", check name'); + } + } + if (!presets) { + throw new Error("Wrong `markdown-it` preset, can't be empty"); + } + if (presets.options) { + self.set(presets.options); + } + if (presets.components) { + Object.keys(presets.components).forEach((function(name) { + if (presets.components[name].rules) { + self[name].ruler.enableOnly(presets.components[name].rules); + } + if (presets.components[name].rules2) { + self[name].ruler2.enableOnly(presets.components[name].rules2); + } + })); + } + return this; + }; + /** chainable + * MarkdownIt.enable(list, ignoreInvalid) + * - list (String|Array): rule name or list of rule names to enable + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Enable list or rules. It will automatically find appropriate components, + * containing rules with given names. If rule not found, and `ignoreInvalid` + * not set - throws exception. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')() + * .enable(['sub', 'sup']) + * .disable('smartquotes'); + * ``` + **/ MarkdownIt.prototype.enable = function(list, ignoreInvalid) { + var result = []; + if (!Array.isArray(list)) { + list = [ list ]; + } + [ "core", "block", "inline" ].forEach((function(chain) { + result = result.concat(this[chain].ruler.enable(list, true)); + }), this); + result = result.concat(this.inline.ruler2.enable(list, true)); + var missed = list.filter((function(name) { + return result.indexOf(name) < 0; + })); + if (missed.length && !ignoreInvalid) { + throw new Error("MarkdownIt. Failed to enable unknown rule(s): " + missed); + } + return this; + }; + /** chainable + * MarkdownIt.disable(list, ignoreInvalid) + * - list (String|Array): rule name or list of rule names to disable. + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * The same as [[MarkdownIt.enable]], but turn specified rules off. + **/ MarkdownIt.prototype.disable = function(list, ignoreInvalid) { + var result = []; + if (!Array.isArray(list)) { + list = [ list ]; + } + [ "core", "block", "inline" ].forEach((function(chain) { + result = result.concat(this[chain].ruler.disable(list, true)); + }), this); + result = result.concat(this.inline.ruler2.disable(list, true)); + var missed = list.filter((function(name) { + return result.indexOf(name) < 0; + })); + if (missed.length && !ignoreInvalid) { + throw new Error("MarkdownIt. Failed to disable unknown rule(s): " + missed); + } + return this; + }; + /** chainable + * MarkdownIt.use(plugin, params) + * + * Load specified plugin with given params into current parser instance. + * It's just a sugar to call `plugin(md, params)` with curring. + * + * ##### Example + * + * ```javascript + * var iterator = require('markdown-it-for-inline'); + * var md = require('markdown-it')() + * .use(iterator, 'foo_replace', 'text', function (tokens, idx) { + * tokens[idx].content = tokens[idx].content.replace(/foo/g, 'bar'); + * }); + * ``` + **/ MarkdownIt.prototype.use = function(plugin /*, params, ... */) { + var args = [ this ].concat(Array.prototype.slice.call(arguments, 1)); + plugin.apply(plugin, args); + return this; + }; + /** internal + * MarkdownIt.parse(src, env) -> Array + * - src (String): source string + * - env (Object): environment sandbox + * + * Parse input string and return list of block tokens (special token type + * "inline" will contain list of inline tokens). You should not call this + * method directly, until you write custom renderer (for example, to produce + * AST). + * + * `env` is used to pass data between "distributed" rules and return additional + * metadata like reference info, needed for the renderer. It also can be used to + * inject data in specific cases. Usually, you will be ok to pass `{}`, + * and then pass updated object to renderer. + **/ MarkdownIt.prototype.parse = function(src, env) { + if (typeof src !== "string") { + throw new Error("Input data should be a String"); + } + var state = new this.core.State(src, this, env); + this.core.process(state); + return state.tokens; + }; + /** + * MarkdownIt.render(src [, env]) -> String + * - src (String): source string + * - env (Object): environment sandbox + * + * Render markdown string into html. It does all magic for you :). + * + * `env` can be used to inject additional metadata (`{}` by default). + * But you will not need it with high probability. See also comment + * in [[MarkdownIt.parse]]. + **/ MarkdownIt.prototype.render = function(src, env) { + env = env || {}; + return this.renderer.render(this.parse(src, env), this.options, env); + }; + /** internal + * MarkdownIt.parseInline(src, env) -> Array + * - src (String): source string + * - env (Object): environment sandbox + * + * The same as [[MarkdownIt.parse]] but skip all block rules. It returns the + * block tokens list with the single `inline` element, containing parsed inline + * tokens in `children` property. Also updates `env` object. + **/ MarkdownIt.prototype.parseInline = function(src, env) { + var state = new this.core.State(src, this, env); + state.inlineMode = true; + this.core.process(state); + return state.tokens; + }; + /** + * MarkdownIt.renderInline(src [, env]) -> String + * - src (String): source string + * - env (Object): environment sandbox + * + * Similar to [[MarkdownIt.render]] but for single paragraph content. Result + * will NOT be wrapped into `<p>` tags. + **/ MarkdownIt.prototype.renderInline = function(src, env) { + env = env || {}; + return this.renderer.render(this.parseInline(src, env), this.options, env); + }; + var lib = MarkdownIt; + var markdownIt = lib; + return markdownIt; +})); diff --git a/node_modules/markdown-it/dist/markdown-it.min.js b/node_modules/markdown-it/dist/markdown-it.min.js new file mode 100644 index 0000000..5df7d1b --- /dev/null +++ b/node_modules/markdown-it/dist/markdown-it.min.js @@ -0,0 +1,3 @@ +/*! markdown-it 12.3.2 https://github.com/markdown-it/markdown-it @license MIT */ +!function(e,r){"object"==typeof exports&&"undefined"!=typeof module?module.exports=r():"function"==typeof define&&define.amd?define(r):(e="undefined"!=typeof globalThis?globalThis:e||self).markdownit=r()}(this,(function(){"use strict";function e(e){if(e.__esModule)return e;var r=Object.defineProperty({},"__esModule",{value:!0});return Object.keys(e).forEach((function(t){var n=Object.getOwnPropertyDescriptor(e,t);Object.defineProperty(r,t,n.get?n:{enumerable:!0,get:function(){return e[t]}})})),r}var r={Aacute:"\xc1",aacute:"\xe1",Abreve:"\u0102",abreve:"\u0103",ac:"\u223e",acd:"\u223f",acE:"\u223e\u0333",Acirc:"\xc2",acirc:"\xe2",acute:"\xb4",Acy:"\u0410",acy:"\u0430",AElig:"\xc6",aelig:"\xe6",af:"\u2061",Afr:"\ud835\udd04",afr:"\ud835\udd1e",Agrave:"\xc0",agrave:"\xe0",alefsym:"\u2135",aleph:"\u2135",Alpha:"\u0391",alpha:"\u03b1",Amacr:"\u0100",amacr:"\u0101",amalg:"\u2a3f",amp:"&",AMP:"&",andand:"\u2a55",And:"\u2a53",and:"\u2227",andd:"\u2a5c",andslope:"\u2a58",andv:"\u2a5a",ang:"\u2220",ange:"\u29a4",angle:"\u2220",angmsdaa:"\u29a8",angmsdab:"\u29a9",angmsdac:"\u29aa",angmsdad:"\u29ab",angmsdae:"\u29ac",angmsdaf:"\u29ad",angmsdag:"\u29ae",angmsdah:"\u29af",angmsd:"\u2221",angrt:"\u221f",angrtvb:"\u22be",angrtvbd:"\u299d",angsph:"\u2222",angst:"\xc5",angzarr:"\u237c",Aogon:"\u0104",aogon:"\u0105",Aopf:"\ud835\udd38",aopf:"\ud835\udd52",apacir:"\u2a6f",ap:"\u2248",apE:"\u2a70",ape:"\u224a",apid:"\u224b",apos:"'",ApplyFunction:"\u2061",approx:"\u2248",approxeq:"\u224a",Aring:"\xc5",aring:"\xe5",Ascr:"\ud835\udc9c",ascr:"\ud835\udcb6",Assign:"\u2254",ast:"*",asymp:"\u2248",asympeq:"\u224d",Atilde:"\xc3",atilde:"\xe3",Auml:"\xc4",auml:"\xe4",awconint:"\u2233",awint:"\u2a11",backcong:"\u224c",backepsilon:"\u03f6",backprime:"\u2035",backsim:"\u223d",backsimeq:"\u22cd",Backslash:"\u2216",Barv:"\u2ae7",barvee:"\u22bd",barwed:"\u2305",Barwed:"\u2306",barwedge:"\u2305",bbrk:"\u23b5",bbrktbrk:"\u23b6",bcong:"\u224c",Bcy:"\u0411",bcy:"\u0431",bdquo:"\u201e",becaus:"\u2235",because:"\u2235",Because:"\u2235",bemptyv:"\u29b0",bepsi:"\u03f6",bernou:"\u212c",Bernoullis:"\u212c",Beta:"\u0392",beta:"\u03b2",beth:"\u2136",between:"\u226c",Bfr:"\ud835\udd05",bfr:"\ud835\udd1f",bigcap:"\u22c2",bigcirc:"\u25ef",bigcup:"\u22c3",bigodot:"\u2a00",bigoplus:"\u2a01",bigotimes:"\u2a02",bigsqcup:"\u2a06",bigstar:"\u2605",bigtriangledown:"\u25bd",bigtriangleup:"\u25b3",biguplus:"\u2a04",bigvee:"\u22c1",bigwedge:"\u22c0",bkarow:"\u290d",blacklozenge:"\u29eb",blacksquare:"\u25aa",blacktriangle:"\u25b4",blacktriangledown:"\u25be",blacktriangleleft:"\u25c2",blacktriangleright:"\u25b8",blank:"\u2423",blk12:"\u2592",blk14:"\u2591",blk34:"\u2593",block:"\u2588",bne:"=\u20e5",bnequiv:"\u2261\u20e5",bNot:"\u2aed",bnot:"\u2310",Bopf:"\ud835\udd39",bopf:"\ud835\udd53",bot:"\u22a5",bottom:"\u22a5",bowtie:"\u22c8",boxbox:"\u29c9",boxdl:"\u2510",boxdL:"\u2555",boxDl:"\u2556",boxDL:"\u2557",boxdr:"\u250c",boxdR:"\u2552",boxDr:"\u2553",boxDR:"\u2554",boxh:"\u2500",boxH:"\u2550",boxhd:"\u252c",boxHd:"\u2564",boxhD:"\u2565",boxHD:"\u2566",boxhu:"\u2534",boxHu:"\u2567",boxhU:"\u2568",boxHU:"\u2569",boxminus:"\u229f",boxplus:"\u229e",boxtimes:"\u22a0",boxul:"\u2518",boxuL:"\u255b",boxUl:"\u255c",boxUL:"\u255d",boxur:"\u2514",boxuR:"\u2558",boxUr:"\u2559",boxUR:"\u255a",boxv:"\u2502",boxV:"\u2551",boxvh:"\u253c",boxvH:"\u256a",boxVh:"\u256b",boxVH:"\u256c",boxvl:"\u2524",boxvL:"\u2561",boxVl:"\u2562",boxVL:"\u2563",boxvr:"\u251c",boxvR:"\u255e",boxVr:"\u255f",boxVR:"\u2560",bprime:"\u2035",breve:"\u02d8",Breve:"\u02d8",brvbar:"\xa6",bscr:"\ud835\udcb7",Bscr:"\u212c",bsemi:"\u204f",bsim:"\u223d",bsime:"\u22cd",bsolb:"\u29c5",bsol:"\\",bsolhsub:"\u27c8",bull:"\u2022",bullet:"\u2022",bump:"\u224e",bumpE:"\u2aae",bumpe:"\u224f",Bumpeq:"\u224e",bumpeq:"\u224f",Cacute:"\u0106",cacute:"\u0107",capand:"\u2a44",capbrcup:"\u2a49",capcap:"\u2a4b",cap:"\u2229",Cap:"\u22d2",capcup:"\u2a47",capdot:"\u2a40",CapitalDifferentialD:"\u2145",caps:"\u2229\ufe00",caret:"\u2041",caron:"\u02c7",Cayleys:"\u212d",ccaps:"\u2a4d",Ccaron:"\u010c",ccaron:"\u010d",Ccedil:"\xc7",ccedil:"\xe7",Ccirc:"\u0108",ccirc:"\u0109",Cconint:"\u2230",ccups:"\u2a4c",ccupssm:"\u2a50",Cdot:"\u010a",cdot:"\u010b",cedil:"\xb8",Cedilla:"\xb8",cemptyv:"\u29b2",cent:"\xa2",centerdot:"\xb7",CenterDot:"\xb7",cfr:"\ud835\udd20",Cfr:"\u212d",CHcy:"\u0427",chcy:"\u0447",check:"\u2713",checkmark:"\u2713",Chi:"\u03a7",chi:"\u03c7",circ:"\u02c6",circeq:"\u2257",circlearrowleft:"\u21ba",circlearrowright:"\u21bb",circledast:"\u229b",circledcirc:"\u229a",circleddash:"\u229d",CircleDot:"\u2299",circledR:"\xae",circledS:"\u24c8",CircleMinus:"\u2296",CirclePlus:"\u2295",CircleTimes:"\u2297",cir:"\u25cb",cirE:"\u29c3",cire:"\u2257",cirfnint:"\u2a10",cirmid:"\u2aef",cirscir:"\u29c2",ClockwiseContourIntegral:"\u2232",CloseCurlyDoubleQuote:"\u201d",CloseCurlyQuote:"\u2019",clubs:"\u2663",clubsuit:"\u2663",colon:":",Colon:"\u2237",Colone:"\u2a74",colone:"\u2254",coloneq:"\u2254",comma:",",commat:"@",comp:"\u2201",compfn:"\u2218",complement:"\u2201",complexes:"\u2102",cong:"\u2245",congdot:"\u2a6d",Congruent:"\u2261",conint:"\u222e",Conint:"\u222f",ContourIntegral:"\u222e",copf:"\ud835\udd54",Copf:"\u2102",coprod:"\u2210",Coproduct:"\u2210",copy:"\xa9",COPY:"\xa9",copysr:"\u2117",CounterClockwiseContourIntegral:"\u2233",crarr:"\u21b5",cross:"\u2717",Cross:"\u2a2f",Cscr:"\ud835\udc9e",cscr:"\ud835\udcb8",csub:"\u2acf",csube:"\u2ad1",csup:"\u2ad0",csupe:"\u2ad2",ctdot:"\u22ef",cudarrl:"\u2938",cudarrr:"\u2935",cuepr:"\u22de",cuesc:"\u22df",cularr:"\u21b6",cularrp:"\u293d",cupbrcap:"\u2a48",cupcap:"\u2a46",CupCap:"\u224d",cup:"\u222a",Cup:"\u22d3",cupcup:"\u2a4a",cupdot:"\u228d",cupor:"\u2a45",cups:"\u222a\ufe00",curarr:"\u21b7",curarrm:"\u293c",curlyeqprec:"\u22de",curlyeqsucc:"\u22df",curlyvee:"\u22ce",curlywedge:"\u22cf",curren:"\xa4",curvearrowleft:"\u21b6",curvearrowright:"\u21b7",cuvee:"\u22ce",cuwed:"\u22cf",cwconint:"\u2232",cwint:"\u2231",cylcty:"\u232d",dagger:"\u2020",Dagger:"\u2021",daleth:"\u2138",darr:"\u2193",Darr:"\u21a1",dArr:"\u21d3",dash:"\u2010",Dashv:"\u2ae4",dashv:"\u22a3",dbkarow:"\u290f",dblac:"\u02dd",Dcaron:"\u010e",dcaron:"\u010f",Dcy:"\u0414",dcy:"\u0434",ddagger:"\u2021",ddarr:"\u21ca",DD:"\u2145",dd:"\u2146",DDotrahd:"\u2911",ddotseq:"\u2a77",deg:"\xb0",Del:"\u2207",Delta:"\u0394",delta:"\u03b4",demptyv:"\u29b1",dfisht:"\u297f",Dfr:"\ud835\udd07",dfr:"\ud835\udd21",dHar:"\u2965",dharl:"\u21c3",dharr:"\u21c2",DiacriticalAcute:"\xb4",DiacriticalDot:"\u02d9",DiacriticalDoubleAcute:"\u02dd",DiacriticalGrave:"`",DiacriticalTilde:"\u02dc",diam:"\u22c4",diamond:"\u22c4",Diamond:"\u22c4",diamondsuit:"\u2666",diams:"\u2666",die:"\xa8",DifferentialD:"\u2146",digamma:"\u03dd",disin:"\u22f2",div:"\xf7",divide:"\xf7",divideontimes:"\u22c7",divonx:"\u22c7",DJcy:"\u0402",djcy:"\u0452",dlcorn:"\u231e",dlcrop:"\u230d",dollar:"$",Dopf:"\ud835\udd3b",dopf:"\ud835\udd55",Dot:"\xa8",dot:"\u02d9",DotDot:"\u20dc",doteq:"\u2250",doteqdot:"\u2251",DotEqual:"\u2250",dotminus:"\u2238",dotplus:"\u2214",dotsquare:"\u22a1",doublebarwedge:"\u2306",DoubleContourIntegral:"\u222f",DoubleDot:"\xa8",DoubleDownArrow:"\u21d3",DoubleLeftArrow:"\u21d0",DoubleLeftRightArrow:"\u21d4",DoubleLeftTee:"\u2ae4",DoubleLongLeftArrow:"\u27f8",DoubleLongLeftRightArrow:"\u27fa",DoubleLongRightArrow:"\u27f9",DoubleRightArrow:"\u21d2",DoubleRightTee:"\u22a8",DoubleUpArrow:"\u21d1",DoubleUpDownArrow:"\u21d5",DoubleVerticalBar:"\u2225",DownArrowBar:"\u2913",downarrow:"\u2193",DownArrow:"\u2193",Downarrow:"\u21d3",DownArrowUpArrow:"\u21f5",DownBreve:"\u0311",downdownarrows:"\u21ca",downharpoonleft:"\u21c3",downharpoonright:"\u21c2",DownLeftRightVector:"\u2950",DownLeftTeeVector:"\u295e",DownLeftVectorBar:"\u2956",DownLeftVector:"\u21bd",DownRightTeeVector:"\u295f",DownRightVectorBar:"\u2957",DownRightVector:"\u21c1",DownTeeArrow:"\u21a7",DownTee:"\u22a4",drbkarow:"\u2910",drcorn:"\u231f",drcrop:"\u230c",Dscr:"\ud835\udc9f",dscr:"\ud835\udcb9",DScy:"\u0405",dscy:"\u0455",dsol:"\u29f6",Dstrok:"\u0110",dstrok:"\u0111",dtdot:"\u22f1",dtri:"\u25bf",dtrif:"\u25be",duarr:"\u21f5",duhar:"\u296f",dwangle:"\u29a6",DZcy:"\u040f",dzcy:"\u045f",dzigrarr:"\u27ff",Eacute:"\xc9",eacute:"\xe9",easter:"\u2a6e",Ecaron:"\u011a",ecaron:"\u011b",Ecirc:"\xca",ecirc:"\xea",ecir:"\u2256",ecolon:"\u2255",Ecy:"\u042d",ecy:"\u044d",eDDot:"\u2a77",Edot:"\u0116",edot:"\u0117",eDot:"\u2251",ee:"\u2147",efDot:"\u2252",Efr:"\ud835\udd08",efr:"\ud835\udd22",eg:"\u2a9a",Egrave:"\xc8",egrave:"\xe8",egs:"\u2a96",egsdot:"\u2a98",el:"\u2a99",Element:"\u2208",elinters:"\u23e7",ell:"\u2113",els:"\u2a95",elsdot:"\u2a97",Emacr:"\u0112",emacr:"\u0113",empty:"\u2205",emptyset:"\u2205",EmptySmallSquare:"\u25fb",emptyv:"\u2205",EmptyVerySmallSquare:"\u25ab",emsp13:"\u2004",emsp14:"\u2005",emsp:"\u2003",ENG:"\u014a",eng:"\u014b",ensp:"\u2002",Eogon:"\u0118",eogon:"\u0119",Eopf:"\ud835\udd3c",eopf:"\ud835\udd56",epar:"\u22d5",eparsl:"\u29e3",eplus:"\u2a71",epsi:"\u03b5",Epsilon:"\u0395",epsilon:"\u03b5",epsiv:"\u03f5",eqcirc:"\u2256",eqcolon:"\u2255",eqsim:"\u2242",eqslantgtr:"\u2a96",eqslantless:"\u2a95",Equal:"\u2a75",equals:"=",EqualTilde:"\u2242",equest:"\u225f",Equilibrium:"\u21cc",equiv:"\u2261",equivDD:"\u2a78",eqvparsl:"\u29e5",erarr:"\u2971",erDot:"\u2253",escr:"\u212f",Escr:"\u2130",esdot:"\u2250",Esim:"\u2a73",esim:"\u2242",Eta:"\u0397",eta:"\u03b7",ETH:"\xd0",eth:"\xf0",Euml:"\xcb",euml:"\xeb",euro:"\u20ac",excl:"!",exist:"\u2203",Exists:"\u2203",expectation:"\u2130",exponentiale:"\u2147",ExponentialE:"\u2147",fallingdotseq:"\u2252",Fcy:"\u0424",fcy:"\u0444",female:"\u2640",ffilig:"\ufb03",fflig:"\ufb00",ffllig:"\ufb04",Ffr:"\ud835\udd09",ffr:"\ud835\udd23",filig:"\ufb01",FilledSmallSquare:"\u25fc",FilledVerySmallSquare:"\u25aa",fjlig:"fj",flat:"\u266d",fllig:"\ufb02",fltns:"\u25b1",fnof:"\u0192",Fopf:"\ud835\udd3d",fopf:"\ud835\udd57",forall:"\u2200",ForAll:"\u2200",fork:"\u22d4",forkv:"\u2ad9",Fouriertrf:"\u2131",fpartint:"\u2a0d",frac12:"\xbd",frac13:"\u2153",frac14:"\xbc",frac15:"\u2155",frac16:"\u2159",frac18:"\u215b",frac23:"\u2154",frac25:"\u2156",frac34:"\xbe",frac35:"\u2157",frac38:"\u215c",frac45:"\u2158",frac56:"\u215a",frac58:"\u215d",frac78:"\u215e",frasl:"\u2044",frown:"\u2322",fscr:"\ud835\udcbb",Fscr:"\u2131",gacute:"\u01f5",Gamma:"\u0393",gamma:"\u03b3",Gammad:"\u03dc",gammad:"\u03dd",gap:"\u2a86",Gbreve:"\u011e",gbreve:"\u011f",Gcedil:"\u0122",Gcirc:"\u011c",gcirc:"\u011d",Gcy:"\u0413",gcy:"\u0433",Gdot:"\u0120",gdot:"\u0121",ge:"\u2265",gE:"\u2267",gEl:"\u2a8c",gel:"\u22db",geq:"\u2265",geqq:"\u2267",geqslant:"\u2a7e",gescc:"\u2aa9",ges:"\u2a7e",gesdot:"\u2a80",gesdoto:"\u2a82",gesdotol:"\u2a84",gesl:"\u22db\ufe00",gesles:"\u2a94",Gfr:"\ud835\udd0a",gfr:"\ud835\udd24",gg:"\u226b",Gg:"\u22d9",ggg:"\u22d9",gimel:"\u2137",GJcy:"\u0403",gjcy:"\u0453",gla:"\u2aa5",gl:"\u2277",glE:"\u2a92",glj:"\u2aa4",gnap:"\u2a8a",gnapprox:"\u2a8a",gne:"\u2a88",gnE:"\u2269",gneq:"\u2a88",gneqq:"\u2269",gnsim:"\u22e7",Gopf:"\ud835\udd3e",gopf:"\ud835\udd58",grave:"`",GreaterEqual:"\u2265",GreaterEqualLess:"\u22db",GreaterFullEqual:"\u2267",GreaterGreater:"\u2aa2",GreaterLess:"\u2277",GreaterSlantEqual:"\u2a7e",GreaterTilde:"\u2273",Gscr:"\ud835\udca2",gscr:"\u210a",gsim:"\u2273",gsime:"\u2a8e",gsiml:"\u2a90",gtcc:"\u2aa7",gtcir:"\u2a7a",gt:">",GT:">",Gt:"\u226b",gtdot:"\u22d7",gtlPar:"\u2995",gtquest:"\u2a7c",gtrapprox:"\u2a86",gtrarr:"\u2978",gtrdot:"\u22d7",gtreqless:"\u22db",gtreqqless:"\u2a8c",gtrless:"\u2277",gtrsim:"\u2273",gvertneqq:"\u2269\ufe00",gvnE:"\u2269\ufe00",Hacek:"\u02c7",hairsp:"\u200a",half:"\xbd",hamilt:"\u210b",HARDcy:"\u042a",hardcy:"\u044a",harrcir:"\u2948",harr:"\u2194",hArr:"\u21d4",harrw:"\u21ad",Hat:"^",hbar:"\u210f",Hcirc:"\u0124",hcirc:"\u0125",hearts:"\u2665",heartsuit:"\u2665",hellip:"\u2026",hercon:"\u22b9",hfr:"\ud835\udd25",Hfr:"\u210c",HilbertSpace:"\u210b",hksearow:"\u2925",hkswarow:"\u2926",hoarr:"\u21ff",homtht:"\u223b",hookleftarrow:"\u21a9",hookrightarrow:"\u21aa",hopf:"\ud835\udd59",Hopf:"\u210d",horbar:"\u2015",HorizontalLine:"\u2500",hscr:"\ud835\udcbd",Hscr:"\u210b",hslash:"\u210f",Hstrok:"\u0126",hstrok:"\u0127",HumpDownHump:"\u224e",HumpEqual:"\u224f",hybull:"\u2043",hyphen:"\u2010",Iacute:"\xcd",iacute:"\xed",ic:"\u2063",Icirc:"\xce",icirc:"\xee",Icy:"\u0418",icy:"\u0438",Idot:"\u0130",IEcy:"\u0415",iecy:"\u0435",iexcl:"\xa1",iff:"\u21d4",ifr:"\ud835\udd26",Ifr:"\u2111",Igrave:"\xcc",igrave:"\xec",ii:"\u2148",iiiint:"\u2a0c",iiint:"\u222d",iinfin:"\u29dc",iiota:"\u2129",IJlig:"\u0132",ijlig:"\u0133",Imacr:"\u012a",imacr:"\u012b",image:"\u2111",ImaginaryI:"\u2148",imagline:"\u2110",imagpart:"\u2111",imath:"\u0131",Im:"\u2111",imof:"\u22b7",imped:"\u01b5",Implies:"\u21d2",incare:"\u2105",in:"\u2208",infin:"\u221e",infintie:"\u29dd",inodot:"\u0131",intcal:"\u22ba",int:"\u222b",Int:"\u222c",integers:"\u2124",Integral:"\u222b",intercal:"\u22ba",Intersection:"\u22c2",intlarhk:"\u2a17",intprod:"\u2a3c",InvisibleComma:"\u2063",InvisibleTimes:"\u2062",IOcy:"\u0401",iocy:"\u0451",Iogon:"\u012e",iogon:"\u012f",Iopf:"\ud835\udd40",iopf:"\ud835\udd5a",Iota:"\u0399",iota:"\u03b9",iprod:"\u2a3c",iquest:"\xbf",iscr:"\ud835\udcbe",Iscr:"\u2110",isin:"\u2208",isindot:"\u22f5",isinE:"\u22f9",isins:"\u22f4",isinsv:"\u22f3",isinv:"\u2208",it:"\u2062",Itilde:"\u0128",itilde:"\u0129",Iukcy:"\u0406",iukcy:"\u0456",Iuml:"\xcf",iuml:"\xef",Jcirc:"\u0134",jcirc:"\u0135",Jcy:"\u0419",jcy:"\u0439",Jfr:"\ud835\udd0d",jfr:"\ud835\udd27",jmath:"\u0237",Jopf:"\ud835\udd41",jopf:"\ud835\udd5b",Jscr:"\ud835\udca5",jscr:"\ud835\udcbf",Jsercy:"\u0408",jsercy:"\u0458",Jukcy:"\u0404",jukcy:"\u0454",Kappa:"\u039a",kappa:"\u03ba",kappav:"\u03f0",Kcedil:"\u0136",kcedil:"\u0137",Kcy:"\u041a",kcy:"\u043a",Kfr:"\ud835\udd0e",kfr:"\ud835\udd28",kgreen:"\u0138",KHcy:"\u0425",khcy:"\u0445",KJcy:"\u040c",kjcy:"\u045c",Kopf:"\ud835\udd42",kopf:"\ud835\udd5c",Kscr:"\ud835\udca6",kscr:"\ud835\udcc0",lAarr:"\u21da",Lacute:"\u0139",lacute:"\u013a",laemptyv:"\u29b4",lagran:"\u2112",Lambda:"\u039b",lambda:"\u03bb",lang:"\u27e8",Lang:"\u27ea",langd:"\u2991",langle:"\u27e8",lap:"\u2a85",Laplacetrf:"\u2112",laquo:"\xab",larrb:"\u21e4",larrbfs:"\u291f",larr:"\u2190",Larr:"\u219e",lArr:"\u21d0",larrfs:"\u291d",larrhk:"\u21a9",larrlp:"\u21ab",larrpl:"\u2939",larrsim:"\u2973",larrtl:"\u21a2",latail:"\u2919",lAtail:"\u291b",lat:"\u2aab",late:"\u2aad",lates:"\u2aad\ufe00",lbarr:"\u290c",lBarr:"\u290e",lbbrk:"\u2772",lbrace:"{",lbrack:"[",lbrke:"\u298b",lbrksld:"\u298f",lbrkslu:"\u298d",Lcaron:"\u013d",lcaron:"\u013e",Lcedil:"\u013b",lcedil:"\u013c",lceil:"\u2308",lcub:"{",Lcy:"\u041b",lcy:"\u043b",ldca:"\u2936",ldquo:"\u201c",ldquor:"\u201e",ldrdhar:"\u2967",ldrushar:"\u294b",ldsh:"\u21b2",le:"\u2264",lE:"\u2266",LeftAngleBracket:"\u27e8",LeftArrowBar:"\u21e4",leftarrow:"\u2190",LeftArrow:"\u2190",Leftarrow:"\u21d0",LeftArrowRightArrow:"\u21c6",leftarrowtail:"\u21a2",LeftCeiling:"\u2308",LeftDoubleBracket:"\u27e6",LeftDownTeeVector:"\u2961",LeftDownVectorBar:"\u2959",LeftDownVector:"\u21c3",LeftFloor:"\u230a",leftharpoondown:"\u21bd",leftharpoonup:"\u21bc",leftleftarrows:"\u21c7",leftrightarrow:"\u2194",LeftRightArrow:"\u2194",Leftrightarrow:"\u21d4",leftrightarrows:"\u21c6",leftrightharpoons:"\u21cb",leftrightsquigarrow:"\u21ad",LeftRightVector:"\u294e",LeftTeeArrow:"\u21a4",LeftTee:"\u22a3",LeftTeeVector:"\u295a",leftthreetimes:"\u22cb",LeftTriangleBar:"\u29cf",LeftTriangle:"\u22b2",LeftTriangleEqual:"\u22b4",LeftUpDownVector:"\u2951",LeftUpTeeVector:"\u2960",LeftUpVectorBar:"\u2958",LeftUpVector:"\u21bf",LeftVectorBar:"\u2952",LeftVector:"\u21bc",lEg:"\u2a8b",leg:"\u22da",leq:"\u2264",leqq:"\u2266",leqslant:"\u2a7d",lescc:"\u2aa8",les:"\u2a7d",lesdot:"\u2a7f",lesdoto:"\u2a81",lesdotor:"\u2a83",lesg:"\u22da\ufe00",lesges:"\u2a93",lessapprox:"\u2a85",lessdot:"\u22d6",lesseqgtr:"\u22da",lesseqqgtr:"\u2a8b",LessEqualGreater:"\u22da",LessFullEqual:"\u2266",LessGreater:"\u2276",lessgtr:"\u2276",LessLess:"\u2aa1",lesssim:"\u2272",LessSlantEqual:"\u2a7d",LessTilde:"\u2272",lfisht:"\u297c",lfloor:"\u230a",Lfr:"\ud835\udd0f",lfr:"\ud835\udd29",lg:"\u2276",lgE:"\u2a91",lHar:"\u2962",lhard:"\u21bd",lharu:"\u21bc",lharul:"\u296a",lhblk:"\u2584",LJcy:"\u0409",ljcy:"\u0459",llarr:"\u21c7",ll:"\u226a",Ll:"\u22d8",llcorner:"\u231e",Lleftarrow:"\u21da",llhard:"\u296b",lltri:"\u25fa",Lmidot:"\u013f",lmidot:"\u0140",lmoustache:"\u23b0",lmoust:"\u23b0",lnap:"\u2a89",lnapprox:"\u2a89",lne:"\u2a87",lnE:"\u2268",lneq:"\u2a87",lneqq:"\u2268",lnsim:"\u22e6",loang:"\u27ec",loarr:"\u21fd",lobrk:"\u27e6",longleftarrow:"\u27f5",LongLeftArrow:"\u27f5",Longleftarrow:"\u27f8",longleftrightarrow:"\u27f7",LongLeftRightArrow:"\u27f7",Longleftrightarrow:"\u27fa",longmapsto:"\u27fc",longrightarrow:"\u27f6",LongRightArrow:"\u27f6",Longrightarrow:"\u27f9",looparrowleft:"\u21ab",looparrowright:"\u21ac",lopar:"\u2985",Lopf:"\ud835\udd43",lopf:"\ud835\udd5d",loplus:"\u2a2d",lotimes:"\u2a34",lowast:"\u2217",lowbar:"_",LowerLeftArrow:"\u2199",LowerRightArrow:"\u2198",loz:"\u25ca",lozenge:"\u25ca",lozf:"\u29eb",lpar:"(",lparlt:"\u2993",lrarr:"\u21c6",lrcorner:"\u231f",lrhar:"\u21cb",lrhard:"\u296d",lrm:"\u200e",lrtri:"\u22bf",lsaquo:"\u2039",lscr:"\ud835\udcc1",Lscr:"\u2112",lsh:"\u21b0",Lsh:"\u21b0",lsim:"\u2272",lsime:"\u2a8d",lsimg:"\u2a8f",lsqb:"[",lsquo:"\u2018",lsquor:"\u201a",Lstrok:"\u0141",lstrok:"\u0142",ltcc:"\u2aa6",ltcir:"\u2a79",lt:"<",LT:"<",Lt:"\u226a",ltdot:"\u22d6",lthree:"\u22cb",ltimes:"\u22c9",ltlarr:"\u2976",ltquest:"\u2a7b",ltri:"\u25c3",ltrie:"\u22b4",ltrif:"\u25c2",ltrPar:"\u2996",lurdshar:"\u294a",luruhar:"\u2966",lvertneqq:"\u2268\ufe00",lvnE:"\u2268\ufe00",macr:"\xaf",male:"\u2642",malt:"\u2720",maltese:"\u2720",Map:"\u2905",map:"\u21a6",mapsto:"\u21a6",mapstodown:"\u21a7",mapstoleft:"\u21a4",mapstoup:"\u21a5",marker:"\u25ae",mcomma:"\u2a29",Mcy:"\u041c",mcy:"\u043c",mdash:"\u2014",mDDot:"\u223a",measuredangle:"\u2221",MediumSpace:"\u205f",Mellintrf:"\u2133",Mfr:"\ud835\udd10",mfr:"\ud835\udd2a",mho:"\u2127",micro:"\xb5",midast:"*",midcir:"\u2af0",mid:"\u2223",middot:"\xb7",minusb:"\u229f",minus:"\u2212",minusd:"\u2238",minusdu:"\u2a2a",MinusPlus:"\u2213",mlcp:"\u2adb",mldr:"\u2026",mnplus:"\u2213",models:"\u22a7",Mopf:"\ud835\udd44",mopf:"\ud835\udd5e",mp:"\u2213",mscr:"\ud835\udcc2",Mscr:"\u2133",mstpos:"\u223e",Mu:"\u039c",mu:"\u03bc",multimap:"\u22b8",mumap:"\u22b8",nabla:"\u2207",Nacute:"\u0143",nacute:"\u0144",nang:"\u2220\u20d2",nap:"\u2249",napE:"\u2a70\u0338",napid:"\u224b\u0338",napos:"\u0149",napprox:"\u2249",natural:"\u266e",naturals:"\u2115",natur:"\u266e",nbsp:"\xa0",nbump:"\u224e\u0338",nbumpe:"\u224f\u0338",ncap:"\u2a43",Ncaron:"\u0147",ncaron:"\u0148",Ncedil:"\u0145",ncedil:"\u0146",ncong:"\u2247",ncongdot:"\u2a6d\u0338",ncup:"\u2a42",Ncy:"\u041d",ncy:"\u043d",ndash:"\u2013",nearhk:"\u2924",nearr:"\u2197",neArr:"\u21d7",nearrow:"\u2197",ne:"\u2260",nedot:"\u2250\u0338",NegativeMediumSpace:"\u200b",NegativeThickSpace:"\u200b",NegativeThinSpace:"\u200b",NegativeVeryThinSpace:"\u200b",nequiv:"\u2262",nesear:"\u2928",nesim:"\u2242\u0338",NestedGreaterGreater:"\u226b",NestedLessLess:"\u226a",NewLine:"\n",nexist:"\u2204",nexists:"\u2204",Nfr:"\ud835\udd11",nfr:"\ud835\udd2b",ngE:"\u2267\u0338",nge:"\u2271",ngeq:"\u2271",ngeqq:"\u2267\u0338",ngeqslant:"\u2a7e\u0338",nges:"\u2a7e\u0338",nGg:"\u22d9\u0338",ngsim:"\u2275",nGt:"\u226b\u20d2",ngt:"\u226f",ngtr:"\u226f",nGtv:"\u226b\u0338",nharr:"\u21ae",nhArr:"\u21ce",nhpar:"\u2af2",ni:"\u220b",nis:"\u22fc",nisd:"\u22fa",niv:"\u220b",NJcy:"\u040a",njcy:"\u045a",nlarr:"\u219a",nlArr:"\u21cd",nldr:"\u2025",nlE:"\u2266\u0338",nle:"\u2270",nleftarrow:"\u219a",nLeftarrow:"\u21cd",nleftrightarrow:"\u21ae",nLeftrightarrow:"\u21ce",nleq:"\u2270",nleqq:"\u2266\u0338",nleqslant:"\u2a7d\u0338",nles:"\u2a7d\u0338",nless:"\u226e",nLl:"\u22d8\u0338",nlsim:"\u2274",nLt:"\u226a\u20d2",nlt:"\u226e",nltri:"\u22ea",nltrie:"\u22ec",nLtv:"\u226a\u0338",nmid:"\u2224",NoBreak:"\u2060",NonBreakingSpace:"\xa0",nopf:"\ud835\udd5f",Nopf:"\u2115",Not:"\u2aec",not:"\xac",NotCongruent:"\u2262",NotCupCap:"\u226d",NotDoubleVerticalBar:"\u2226",NotElement:"\u2209",NotEqual:"\u2260",NotEqualTilde:"\u2242\u0338",NotExists:"\u2204",NotGreater:"\u226f",NotGreaterEqual:"\u2271",NotGreaterFullEqual:"\u2267\u0338",NotGreaterGreater:"\u226b\u0338",NotGreaterLess:"\u2279",NotGreaterSlantEqual:"\u2a7e\u0338",NotGreaterTilde:"\u2275",NotHumpDownHump:"\u224e\u0338",NotHumpEqual:"\u224f\u0338",notin:"\u2209",notindot:"\u22f5\u0338",notinE:"\u22f9\u0338",notinva:"\u2209",notinvb:"\u22f7",notinvc:"\u22f6",NotLeftTriangleBar:"\u29cf\u0338",NotLeftTriangle:"\u22ea",NotLeftTriangleEqual:"\u22ec",NotLess:"\u226e",NotLessEqual:"\u2270",NotLessGreater:"\u2278",NotLessLess:"\u226a\u0338",NotLessSlantEqual:"\u2a7d\u0338",NotLessTilde:"\u2274",NotNestedGreaterGreater:"\u2aa2\u0338",NotNestedLessLess:"\u2aa1\u0338",notni:"\u220c",notniva:"\u220c",notnivb:"\u22fe",notnivc:"\u22fd",NotPrecedes:"\u2280",NotPrecedesEqual:"\u2aaf\u0338",NotPrecedesSlantEqual:"\u22e0",NotReverseElement:"\u220c",NotRightTriangleBar:"\u29d0\u0338",NotRightTriangle:"\u22eb",NotRightTriangleEqual:"\u22ed",NotSquareSubset:"\u228f\u0338",NotSquareSubsetEqual:"\u22e2",NotSquareSuperset:"\u2290\u0338",NotSquareSupersetEqual:"\u22e3",NotSubset:"\u2282\u20d2",NotSubsetEqual:"\u2288",NotSucceeds:"\u2281",NotSucceedsEqual:"\u2ab0\u0338",NotSucceedsSlantEqual:"\u22e1",NotSucceedsTilde:"\u227f\u0338",NotSuperset:"\u2283\u20d2",NotSupersetEqual:"\u2289",NotTilde:"\u2241",NotTildeEqual:"\u2244",NotTildeFullEqual:"\u2247",NotTildeTilde:"\u2249",NotVerticalBar:"\u2224",nparallel:"\u2226",npar:"\u2226",nparsl:"\u2afd\u20e5",npart:"\u2202\u0338",npolint:"\u2a14",npr:"\u2280",nprcue:"\u22e0",nprec:"\u2280",npreceq:"\u2aaf\u0338",npre:"\u2aaf\u0338",nrarrc:"\u2933\u0338",nrarr:"\u219b",nrArr:"\u21cf",nrarrw:"\u219d\u0338",nrightarrow:"\u219b",nRightarrow:"\u21cf",nrtri:"\u22eb",nrtrie:"\u22ed",nsc:"\u2281",nsccue:"\u22e1",nsce:"\u2ab0\u0338",Nscr:"\ud835\udca9",nscr:"\ud835\udcc3",nshortmid:"\u2224",nshortparallel:"\u2226",nsim:"\u2241",nsime:"\u2244",nsimeq:"\u2244",nsmid:"\u2224",nspar:"\u2226",nsqsube:"\u22e2",nsqsupe:"\u22e3",nsub:"\u2284",nsubE:"\u2ac5\u0338",nsube:"\u2288",nsubset:"\u2282\u20d2",nsubseteq:"\u2288",nsubseteqq:"\u2ac5\u0338",nsucc:"\u2281",nsucceq:"\u2ab0\u0338",nsup:"\u2285",nsupE:"\u2ac6\u0338",nsupe:"\u2289",nsupset:"\u2283\u20d2",nsupseteq:"\u2289",nsupseteqq:"\u2ac6\u0338",ntgl:"\u2279",Ntilde:"\xd1",ntilde:"\xf1",ntlg:"\u2278",ntriangleleft:"\u22ea",ntrianglelefteq:"\u22ec",ntriangleright:"\u22eb",ntrianglerighteq:"\u22ed",Nu:"\u039d",nu:"\u03bd",num:"#",numero:"\u2116",numsp:"\u2007",nvap:"\u224d\u20d2",nvdash:"\u22ac",nvDash:"\u22ad",nVdash:"\u22ae",nVDash:"\u22af",nvge:"\u2265\u20d2",nvgt:">\u20d2",nvHarr:"\u2904",nvinfin:"\u29de",nvlArr:"\u2902",nvle:"\u2264\u20d2",nvlt:"<\u20d2",nvltrie:"\u22b4\u20d2",nvrArr:"\u2903",nvrtrie:"\u22b5\u20d2",nvsim:"\u223c\u20d2",nwarhk:"\u2923",nwarr:"\u2196",nwArr:"\u21d6",nwarrow:"\u2196",nwnear:"\u2927",Oacute:"\xd3",oacute:"\xf3",oast:"\u229b",Ocirc:"\xd4",ocirc:"\xf4",ocir:"\u229a",Ocy:"\u041e",ocy:"\u043e",odash:"\u229d",Odblac:"\u0150",odblac:"\u0151",odiv:"\u2a38",odot:"\u2299",odsold:"\u29bc",OElig:"\u0152",oelig:"\u0153",ofcir:"\u29bf",Ofr:"\ud835\udd12",ofr:"\ud835\udd2c",ogon:"\u02db",Ograve:"\xd2",ograve:"\xf2",ogt:"\u29c1",ohbar:"\u29b5",ohm:"\u03a9",oint:"\u222e",olarr:"\u21ba",olcir:"\u29be",olcross:"\u29bb",oline:"\u203e",olt:"\u29c0",Omacr:"\u014c",omacr:"\u014d",Omega:"\u03a9",omega:"\u03c9",Omicron:"\u039f",omicron:"\u03bf",omid:"\u29b6",ominus:"\u2296",Oopf:"\ud835\udd46",oopf:"\ud835\udd60",opar:"\u29b7",OpenCurlyDoubleQuote:"\u201c",OpenCurlyQuote:"\u2018",operp:"\u29b9",oplus:"\u2295",orarr:"\u21bb",Or:"\u2a54",or:"\u2228",ord:"\u2a5d",order:"\u2134",orderof:"\u2134",ordf:"\xaa",ordm:"\xba",origof:"\u22b6",oror:"\u2a56",orslope:"\u2a57",orv:"\u2a5b",oS:"\u24c8",Oscr:"\ud835\udcaa",oscr:"\u2134",Oslash:"\xd8",oslash:"\xf8",osol:"\u2298",Otilde:"\xd5",otilde:"\xf5",otimesas:"\u2a36",Otimes:"\u2a37",otimes:"\u2297",Ouml:"\xd6",ouml:"\xf6",ovbar:"\u233d",OverBar:"\u203e",OverBrace:"\u23de",OverBracket:"\u23b4",OverParenthesis:"\u23dc",para:"\xb6",parallel:"\u2225",par:"\u2225",parsim:"\u2af3",parsl:"\u2afd",part:"\u2202",PartialD:"\u2202",Pcy:"\u041f",pcy:"\u043f",percnt:"%",period:".",permil:"\u2030",perp:"\u22a5",pertenk:"\u2031",Pfr:"\ud835\udd13",pfr:"\ud835\udd2d",Phi:"\u03a6",phi:"\u03c6",phiv:"\u03d5",phmmat:"\u2133",phone:"\u260e",Pi:"\u03a0",pi:"\u03c0",pitchfork:"\u22d4",piv:"\u03d6",planck:"\u210f",planckh:"\u210e",plankv:"\u210f",plusacir:"\u2a23",plusb:"\u229e",pluscir:"\u2a22",plus:"+",plusdo:"\u2214",plusdu:"\u2a25",pluse:"\u2a72",PlusMinus:"\xb1",plusmn:"\xb1",plussim:"\u2a26",plustwo:"\u2a27",pm:"\xb1",Poincareplane:"\u210c",pointint:"\u2a15",popf:"\ud835\udd61",Popf:"\u2119",pound:"\xa3",prap:"\u2ab7",Pr:"\u2abb",pr:"\u227a",prcue:"\u227c",precapprox:"\u2ab7",prec:"\u227a",preccurlyeq:"\u227c",Precedes:"\u227a",PrecedesEqual:"\u2aaf",PrecedesSlantEqual:"\u227c",PrecedesTilde:"\u227e",preceq:"\u2aaf",precnapprox:"\u2ab9",precneqq:"\u2ab5",precnsim:"\u22e8",pre:"\u2aaf",prE:"\u2ab3",precsim:"\u227e",prime:"\u2032",Prime:"\u2033",primes:"\u2119",prnap:"\u2ab9",prnE:"\u2ab5",prnsim:"\u22e8",prod:"\u220f",Product:"\u220f",profalar:"\u232e",profline:"\u2312",profsurf:"\u2313",prop:"\u221d",Proportional:"\u221d",Proportion:"\u2237",propto:"\u221d",prsim:"\u227e",prurel:"\u22b0",Pscr:"\ud835\udcab",pscr:"\ud835\udcc5",Psi:"\u03a8",psi:"\u03c8",puncsp:"\u2008",Qfr:"\ud835\udd14",qfr:"\ud835\udd2e",qint:"\u2a0c",qopf:"\ud835\udd62",Qopf:"\u211a",qprime:"\u2057",Qscr:"\ud835\udcac",qscr:"\ud835\udcc6",quaternions:"\u210d",quatint:"\u2a16",quest:"?",questeq:"\u225f",quot:'"',QUOT:'"',rAarr:"\u21db",race:"\u223d\u0331",Racute:"\u0154",racute:"\u0155",radic:"\u221a",raemptyv:"\u29b3",rang:"\u27e9",Rang:"\u27eb",rangd:"\u2992",range:"\u29a5",rangle:"\u27e9",raquo:"\xbb",rarrap:"\u2975",rarrb:"\u21e5",rarrbfs:"\u2920",rarrc:"\u2933",rarr:"\u2192",Rarr:"\u21a0",rArr:"\u21d2",rarrfs:"\u291e",rarrhk:"\u21aa",rarrlp:"\u21ac",rarrpl:"\u2945",rarrsim:"\u2974",Rarrtl:"\u2916",rarrtl:"\u21a3",rarrw:"\u219d",ratail:"\u291a",rAtail:"\u291c",ratio:"\u2236",rationals:"\u211a",rbarr:"\u290d",rBarr:"\u290f",RBarr:"\u2910",rbbrk:"\u2773",rbrace:"}",rbrack:"]",rbrke:"\u298c",rbrksld:"\u298e",rbrkslu:"\u2990",Rcaron:"\u0158",rcaron:"\u0159",Rcedil:"\u0156",rcedil:"\u0157",rceil:"\u2309",rcub:"}",Rcy:"\u0420",rcy:"\u0440",rdca:"\u2937",rdldhar:"\u2969",rdquo:"\u201d",rdquor:"\u201d",rdsh:"\u21b3",real:"\u211c",realine:"\u211b",realpart:"\u211c",reals:"\u211d",Re:"\u211c",rect:"\u25ad",reg:"\xae",REG:"\xae",ReverseElement:"\u220b",ReverseEquilibrium:"\u21cb",ReverseUpEquilibrium:"\u296f",rfisht:"\u297d",rfloor:"\u230b",rfr:"\ud835\udd2f",Rfr:"\u211c",rHar:"\u2964",rhard:"\u21c1",rharu:"\u21c0",rharul:"\u296c",Rho:"\u03a1",rho:"\u03c1",rhov:"\u03f1",RightAngleBracket:"\u27e9",RightArrowBar:"\u21e5",rightarrow:"\u2192",RightArrow:"\u2192",Rightarrow:"\u21d2",RightArrowLeftArrow:"\u21c4",rightarrowtail:"\u21a3",RightCeiling:"\u2309",RightDoubleBracket:"\u27e7",RightDownTeeVector:"\u295d",RightDownVectorBar:"\u2955",RightDownVector:"\u21c2",RightFloor:"\u230b",rightharpoondown:"\u21c1",rightharpoonup:"\u21c0",rightleftarrows:"\u21c4",rightleftharpoons:"\u21cc",rightrightarrows:"\u21c9",rightsquigarrow:"\u219d",RightTeeArrow:"\u21a6",RightTee:"\u22a2",RightTeeVector:"\u295b",rightthreetimes:"\u22cc",RightTriangleBar:"\u29d0",RightTriangle:"\u22b3",RightTriangleEqual:"\u22b5",RightUpDownVector:"\u294f",RightUpTeeVector:"\u295c",RightUpVectorBar:"\u2954",RightUpVector:"\u21be",RightVectorBar:"\u2953",RightVector:"\u21c0",ring:"\u02da",risingdotseq:"\u2253",rlarr:"\u21c4",rlhar:"\u21cc",rlm:"\u200f",rmoustache:"\u23b1",rmoust:"\u23b1",rnmid:"\u2aee",roang:"\u27ed",roarr:"\u21fe",robrk:"\u27e7",ropar:"\u2986",ropf:"\ud835\udd63",Ropf:"\u211d",roplus:"\u2a2e",rotimes:"\u2a35",RoundImplies:"\u2970",rpar:")",rpargt:"\u2994",rppolint:"\u2a12",rrarr:"\u21c9",Rrightarrow:"\u21db",rsaquo:"\u203a",rscr:"\ud835\udcc7",Rscr:"\u211b",rsh:"\u21b1",Rsh:"\u21b1",rsqb:"]",rsquo:"\u2019",rsquor:"\u2019",rthree:"\u22cc",rtimes:"\u22ca",rtri:"\u25b9",rtrie:"\u22b5",rtrif:"\u25b8",rtriltri:"\u29ce",RuleDelayed:"\u29f4",ruluhar:"\u2968",rx:"\u211e",Sacute:"\u015a",sacute:"\u015b",sbquo:"\u201a",scap:"\u2ab8",Scaron:"\u0160",scaron:"\u0161",Sc:"\u2abc",sc:"\u227b",sccue:"\u227d",sce:"\u2ab0",scE:"\u2ab4",Scedil:"\u015e",scedil:"\u015f",Scirc:"\u015c",scirc:"\u015d",scnap:"\u2aba",scnE:"\u2ab6",scnsim:"\u22e9",scpolint:"\u2a13",scsim:"\u227f",Scy:"\u0421",scy:"\u0441",sdotb:"\u22a1",sdot:"\u22c5",sdote:"\u2a66",searhk:"\u2925",searr:"\u2198",seArr:"\u21d8",searrow:"\u2198",sect:"\xa7",semi:";",seswar:"\u2929",setminus:"\u2216",setmn:"\u2216",sext:"\u2736",Sfr:"\ud835\udd16",sfr:"\ud835\udd30",sfrown:"\u2322",sharp:"\u266f",SHCHcy:"\u0429",shchcy:"\u0449",SHcy:"\u0428",shcy:"\u0448",ShortDownArrow:"\u2193",ShortLeftArrow:"\u2190",shortmid:"\u2223",shortparallel:"\u2225",ShortRightArrow:"\u2192",ShortUpArrow:"\u2191",shy:"\xad",Sigma:"\u03a3",sigma:"\u03c3",sigmaf:"\u03c2",sigmav:"\u03c2",sim:"\u223c",simdot:"\u2a6a",sime:"\u2243",simeq:"\u2243",simg:"\u2a9e",simgE:"\u2aa0",siml:"\u2a9d",simlE:"\u2a9f",simne:"\u2246",simplus:"\u2a24",simrarr:"\u2972",slarr:"\u2190",SmallCircle:"\u2218",smallsetminus:"\u2216",smashp:"\u2a33",smeparsl:"\u29e4",smid:"\u2223",smile:"\u2323",smt:"\u2aaa",smte:"\u2aac",smtes:"\u2aac\ufe00",SOFTcy:"\u042c",softcy:"\u044c",solbar:"\u233f",solb:"\u29c4",sol:"/",Sopf:"\ud835\udd4a",sopf:"\ud835\udd64",spades:"\u2660",spadesuit:"\u2660",spar:"\u2225",sqcap:"\u2293",sqcaps:"\u2293\ufe00",sqcup:"\u2294",sqcups:"\u2294\ufe00",Sqrt:"\u221a",sqsub:"\u228f",sqsube:"\u2291",sqsubset:"\u228f",sqsubseteq:"\u2291",sqsup:"\u2290",sqsupe:"\u2292",sqsupset:"\u2290",sqsupseteq:"\u2292",square:"\u25a1",Square:"\u25a1",SquareIntersection:"\u2293",SquareSubset:"\u228f",SquareSubsetEqual:"\u2291",SquareSuperset:"\u2290",SquareSupersetEqual:"\u2292",SquareUnion:"\u2294",squarf:"\u25aa",squ:"\u25a1",squf:"\u25aa",srarr:"\u2192",Sscr:"\ud835\udcae",sscr:"\ud835\udcc8",ssetmn:"\u2216",ssmile:"\u2323",sstarf:"\u22c6",Star:"\u22c6",star:"\u2606",starf:"\u2605",straightepsilon:"\u03f5",straightphi:"\u03d5",strns:"\xaf",sub:"\u2282",Sub:"\u22d0",subdot:"\u2abd",subE:"\u2ac5",sube:"\u2286",subedot:"\u2ac3",submult:"\u2ac1",subnE:"\u2acb",subne:"\u228a",subplus:"\u2abf",subrarr:"\u2979",subset:"\u2282",Subset:"\u22d0",subseteq:"\u2286",subseteqq:"\u2ac5",SubsetEqual:"\u2286",subsetneq:"\u228a",subsetneqq:"\u2acb",subsim:"\u2ac7",subsub:"\u2ad5",subsup:"\u2ad3",succapprox:"\u2ab8",succ:"\u227b",succcurlyeq:"\u227d",Succeeds:"\u227b",SucceedsEqual:"\u2ab0",SucceedsSlantEqual:"\u227d",SucceedsTilde:"\u227f",succeq:"\u2ab0",succnapprox:"\u2aba",succneqq:"\u2ab6",succnsim:"\u22e9",succsim:"\u227f",SuchThat:"\u220b",sum:"\u2211",Sum:"\u2211",sung:"\u266a",sup1:"\xb9",sup2:"\xb2",sup3:"\xb3",sup:"\u2283",Sup:"\u22d1",supdot:"\u2abe",supdsub:"\u2ad8",supE:"\u2ac6",supe:"\u2287",supedot:"\u2ac4",Superset:"\u2283",SupersetEqual:"\u2287",suphsol:"\u27c9",suphsub:"\u2ad7",suplarr:"\u297b",supmult:"\u2ac2",supnE:"\u2acc",supne:"\u228b",supplus:"\u2ac0",supset:"\u2283",Supset:"\u22d1",supseteq:"\u2287",supseteqq:"\u2ac6",supsetneq:"\u228b",supsetneqq:"\u2acc",supsim:"\u2ac8",supsub:"\u2ad4",supsup:"\u2ad6",swarhk:"\u2926",swarr:"\u2199",swArr:"\u21d9",swarrow:"\u2199",swnwar:"\u292a",szlig:"\xdf",Tab:"\t",target:"\u2316",Tau:"\u03a4",tau:"\u03c4",tbrk:"\u23b4",Tcaron:"\u0164",tcaron:"\u0165",Tcedil:"\u0162",tcedil:"\u0163",Tcy:"\u0422",tcy:"\u0442",tdot:"\u20db",telrec:"\u2315",Tfr:"\ud835\udd17",tfr:"\ud835\udd31",there4:"\u2234",therefore:"\u2234",Therefore:"\u2234",Theta:"\u0398",theta:"\u03b8",thetasym:"\u03d1",thetav:"\u03d1",thickapprox:"\u2248",thicksim:"\u223c",ThickSpace:"\u205f\u200a",ThinSpace:"\u2009",thinsp:"\u2009",thkap:"\u2248",thksim:"\u223c",THORN:"\xde",thorn:"\xfe",tilde:"\u02dc",Tilde:"\u223c",TildeEqual:"\u2243",TildeFullEqual:"\u2245",TildeTilde:"\u2248",timesbar:"\u2a31",timesb:"\u22a0",times:"\xd7",timesd:"\u2a30",tint:"\u222d",toea:"\u2928",topbot:"\u2336",topcir:"\u2af1",top:"\u22a4",Topf:"\ud835\udd4b",topf:"\ud835\udd65",topfork:"\u2ada",tosa:"\u2929",tprime:"\u2034",trade:"\u2122",TRADE:"\u2122",triangle:"\u25b5",triangledown:"\u25bf",triangleleft:"\u25c3",trianglelefteq:"\u22b4",triangleq:"\u225c",triangleright:"\u25b9",trianglerighteq:"\u22b5",tridot:"\u25ec",trie:"\u225c",triminus:"\u2a3a",TripleDot:"\u20db",triplus:"\u2a39",trisb:"\u29cd",tritime:"\u2a3b",trpezium:"\u23e2",Tscr:"\ud835\udcaf",tscr:"\ud835\udcc9",TScy:"\u0426",tscy:"\u0446",TSHcy:"\u040b",tshcy:"\u045b",Tstrok:"\u0166",tstrok:"\u0167",twixt:"\u226c",twoheadleftarrow:"\u219e",twoheadrightarrow:"\u21a0",Uacute:"\xda",uacute:"\xfa",uarr:"\u2191",Uarr:"\u219f",uArr:"\u21d1",Uarrocir:"\u2949",Ubrcy:"\u040e",ubrcy:"\u045e",Ubreve:"\u016c",ubreve:"\u016d",Ucirc:"\xdb",ucirc:"\xfb",Ucy:"\u0423",ucy:"\u0443",udarr:"\u21c5",Udblac:"\u0170",udblac:"\u0171",udhar:"\u296e",ufisht:"\u297e",Ufr:"\ud835\udd18",ufr:"\ud835\udd32",Ugrave:"\xd9",ugrave:"\xf9",uHar:"\u2963",uharl:"\u21bf",uharr:"\u21be",uhblk:"\u2580",ulcorn:"\u231c",ulcorner:"\u231c",ulcrop:"\u230f",ultri:"\u25f8",Umacr:"\u016a",umacr:"\u016b",uml:"\xa8",UnderBar:"_",UnderBrace:"\u23df",UnderBracket:"\u23b5",UnderParenthesis:"\u23dd",Union:"\u22c3",UnionPlus:"\u228e",Uogon:"\u0172",uogon:"\u0173",Uopf:"\ud835\udd4c",uopf:"\ud835\udd66",UpArrowBar:"\u2912",uparrow:"\u2191",UpArrow:"\u2191",Uparrow:"\u21d1",UpArrowDownArrow:"\u21c5",updownarrow:"\u2195",UpDownArrow:"\u2195",Updownarrow:"\u21d5",UpEquilibrium:"\u296e",upharpoonleft:"\u21bf",upharpoonright:"\u21be",uplus:"\u228e",UpperLeftArrow:"\u2196",UpperRightArrow:"\u2197",upsi:"\u03c5",Upsi:"\u03d2",upsih:"\u03d2",Upsilon:"\u03a5",upsilon:"\u03c5",UpTeeArrow:"\u21a5",UpTee:"\u22a5",upuparrows:"\u21c8",urcorn:"\u231d",urcorner:"\u231d",urcrop:"\u230e",Uring:"\u016e",uring:"\u016f",urtri:"\u25f9",Uscr:"\ud835\udcb0",uscr:"\ud835\udcca",utdot:"\u22f0",Utilde:"\u0168",utilde:"\u0169",utri:"\u25b5",utrif:"\u25b4",uuarr:"\u21c8",Uuml:"\xdc",uuml:"\xfc",uwangle:"\u29a7",vangrt:"\u299c",varepsilon:"\u03f5",varkappa:"\u03f0",varnothing:"\u2205",varphi:"\u03d5",varpi:"\u03d6",varpropto:"\u221d",varr:"\u2195",vArr:"\u21d5",varrho:"\u03f1",varsigma:"\u03c2",varsubsetneq:"\u228a\ufe00",varsubsetneqq:"\u2acb\ufe00",varsupsetneq:"\u228b\ufe00",varsupsetneqq:"\u2acc\ufe00",vartheta:"\u03d1",vartriangleleft:"\u22b2",vartriangleright:"\u22b3",vBar:"\u2ae8",Vbar:"\u2aeb",vBarv:"\u2ae9",Vcy:"\u0412",vcy:"\u0432",vdash:"\u22a2",vDash:"\u22a8",Vdash:"\u22a9",VDash:"\u22ab",Vdashl:"\u2ae6",veebar:"\u22bb",vee:"\u2228",Vee:"\u22c1",veeeq:"\u225a",vellip:"\u22ee",verbar:"|",Verbar:"\u2016",vert:"|",Vert:"\u2016",VerticalBar:"\u2223",VerticalLine:"|",VerticalSeparator:"\u2758",VerticalTilde:"\u2240",VeryThinSpace:"\u200a",Vfr:"\ud835\udd19",vfr:"\ud835\udd33",vltri:"\u22b2",vnsub:"\u2282\u20d2",vnsup:"\u2283\u20d2",Vopf:"\ud835\udd4d",vopf:"\ud835\udd67",vprop:"\u221d",vrtri:"\u22b3",Vscr:"\ud835\udcb1",vscr:"\ud835\udccb",vsubnE:"\u2acb\ufe00",vsubne:"\u228a\ufe00",vsupnE:"\u2acc\ufe00",vsupne:"\u228b\ufe00",Vvdash:"\u22aa",vzigzag:"\u299a",Wcirc:"\u0174",wcirc:"\u0175",wedbar:"\u2a5f",wedge:"\u2227",Wedge:"\u22c0",wedgeq:"\u2259",weierp:"\u2118",Wfr:"\ud835\udd1a",wfr:"\ud835\udd34",Wopf:"\ud835\udd4e",wopf:"\ud835\udd68",wp:"\u2118",wr:"\u2240",wreath:"\u2240",Wscr:"\ud835\udcb2",wscr:"\ud835\udccc",xcap:"\u22c2",xcirc:"\u25ef",xcup:"\u22c3",xdtri:"\u25bd",Xfr:"\ud835\udd1b",xfr:"\ud835\udd35",xharr:"\u27f7",xhArr:"\u27fa",Xi:"\u039e",xi:"\u03be",xlarr:"\u27f5",xlArr:"\u27f8",xmap:"\u27fc",xnis:"\u22fb",xodot:"\u2a00",Xopf:"\ud835\udd4f",xopf:"\ud835\udd69",xoplus:"\u2a01",xotime:"\u2a02",xrarr:"\u27f6",xrArr:"\u27f9",Xscr:"\ud835\udcb3",xscr:"\ud835\udccd",xsqcup:"\u2a06",xuplus:"\u2a04",xutri:"\u25b3",xvee:"\u22c1",xwedge:"\u22c0",Yacute:"\xdd",yacute:"\xfd",YAcy:"\u042f",yacy:"\u044f",Ycirc:"\u0176",ycirc:"\u0177",Ycy:"\u042b",ycy:"\u044b",yen:"\xa5",Yfr:"\ud835\udd1c",yfr:"\ud835\udd36",YIcy:"\u0407",yicy:"\u0457",Yopf:"\ud835\udd50",yopf:"\ud835\udd6a",Yscr:"\ud835\udcb4",yscr:"\ud835\udcce",YUcy:"\u042e",yucy:"\u044e",yuml:"\xff",Yuml:"\u0178",Zacute:"\u0179",zacute:"\u017a",Zcaron:"\u017d",zcaron:"\u017e",Zcy:"\u0417",zcy:"\u0437",Zdot:"\u017b",zdot:"\u017c",zeetrf:"\u2128",ZeroWidthSpace:"\u200b",Zeta:"\u0396",zeta:"\u03b6",zfr:"\ud835\udd37",Zfr:"\u2128",ZHcy:"\u0416",zhcy:"\u0436",zigrarr:"\u21dd",zopf:"\ud835\udd6b",Zopf:"\u2124",Zscr:"\ud835\udcb5",zscr:"\ud835\udccf",zwj:"\u200d",zwnj:"\u200c"},t=/[!-#%-\*,-\/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0A76\u0AF0\u0C84\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E4E\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD803[\uDF55-\uDF59]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC8\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDC3B\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71\uDEF7\uDEF8]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD81B[\uDE97-\uDE9A]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/,n={};function s(e,r,t){var o,i,a,c,l,u="";for("string"!=typeof r&&(t=r,r=s.defaultChars),void 0===t&&(t=!0),l=function(e){var r,t,s=n[e];if(s)return s;for(s=n[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),/^[0-9a-z]$/i.test(t)?s.push(t):s.push("%"+("0"+r.toString(16).toUpperCase()).slice(-2));for(r=0;r<e.length;r++)s[e.charCodeAt(r)]=e[r];return s}(r),o=0,i=e.length;o<i;o++)if(a=e.charCodeAt(o),t&&37===a&&o+2<i&&/^[0-9a-f]{2}$/i.test(e.slice(o+1,o+3)))u+=e.slice(o,o+3),o+=2;else if(a<128)u+=l[a];else if(a>=55296&&a<=57343){if(a>=55296&&a<=56319&&o+1<i&&(c=e.charCodeAt(o+1))>=56320&&c<=57343){u+=encodeURIComponent(e[o]+e[o+1]),o++;continue}u+="%EF%BF%BD"}else u+=encodeURIComponent(e[o]);return u}s.defaultChars=";/?:@&=+$,-_.!~*'()#",s.componentChars="-_.!~*'()";var o=s,i={};function a(e,r){var t;return"string"!=typeof r&&(r=a.defaultChars),t=function(e){var r,t,n=i[e];if(n)return n;for(n=i[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),n.push(t);for(r=0;r<e.length;r++)n[t=e.charCodeAt(r)]="%"+("0"+t.toString(16).toUpperCase()).slice(-2);return n}(r),e.replace(/(%[a-f0-9]{2})+/gi,(function(e){var r,n,s,o,i,a,c,l="";for(r=0,n=e.length;r<n;r+=3)(s=parseInt(e.slice(r+1,r+3),16))<128?l+=t[s]:192==(224&s)&&r+3<n&&128==(192&(o=parseInt(e.slice(r+4,r+6),16)))?(l+=(c=s<<6&1984|63&o)<128?"\ufffd\ufffd":String.fromCharCode(c),r+=3):224==(240&s)&&r+6<n&&(o=parseInt(e.slice(r+4,r+6),16),i=parseInt(e.slice(r+7,r+9),16),128==(192&o)&&128==(192&i))?(l+=(c=s<<12&61440|o<<6&4032|63&i)<2048||c>=55296&&c<=57343?"\ufffd\ufffd\ufffd":String.fromCharCode(c),r+=6):240==(248&s)&&r+9<n&&(o=parseInt(e.slice(r+4,r+6),16),i=parseInt(e.slice(r+7,r+9),16),a=parseInt(e.slice(r+10,r+12),16),128==(192&o)&&128==(192&i)&&128==(192&a))?((c=s<<18&1835008|o<<12&258048|i<<6&4032|63&a)<65536||c>1114111?l+="\ufffd\ufffd\ufffd\ufffd":(c-=65536,l+=String.fromCharCode(55296+(c>>10),56320+(1023&c))),r+=9):l+="\ufffd";return l}))}a.defaultChars=";/?:@&=+$,#",a.componentChars="";var c=a;function l(){this.protocol=null,this.slashes=null,this.auth=null,this.port=null,this.hostname=null,this.hash=null,this.search=null,this.pathname=null}var u=/^([a-z0-9.+-]+:)/i,p=/:[0-9]*$/,h=/^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/,f=["{","}","|","\\","^","`"].concat(["<",">",'"',"`"," ","\r","\n","\t"]),d=["'"].concat(f),m=["%","/","?",";","#"].concat(d),g=["/","?","#"],_=/^[+a-z0-9A-Z_-]{0,63}$/,k=/^([+a-z0-9A-Z_-]{0,63})(.*)$/,b={javascript:!0,"javascript:":!0},v={http:!0,https:!0,ftp:!0,gopher:!0,file:!0,"http:":!0,"https:":!0,"ftp:":!0,"gopher:":!0,"file:":!0};l.prototype.parse=function(e,r){var t,n,s,o,i,a=e;if(a=a.trim(),!r&&1===e.split("#").length){var c=h.exec(a);if(c)return this.pathname=c[1],c[2]&&(this.search=c[2]),this}var l=u.exec(a);if(l&&(s=(l=l[0]).toLowerCase(),this.protocol=l,a=a.substr(l.length)),(r||l||a.match(/^\/\/[^@\/]+@[^@\/]+/))&&(!(i="//"===a.substr(0,2))||l&&b[l]||(a=a.substr(2),this.slashes=!0)),!b[l]&&(i||l&&!v[l])){var p,f,d=-1;for(t=0;t<g.length;t++)-1!==(o=a.indexOf(g[t]))&&(-1===d||o<d)&&(d=o);for(-1!==(f=-1===d?a.lastIndexOf("@"):a.lastIndexOf("@",d))&&(p=a.slice(0,f),a=a.slice(f+1),this.auth=p),d=-1,t=0;t<m.length;t++)-1!==(o=a.indexOf(m[t]))&&(-1===d||o<d)&&(d=o);-1===d&&(d=a.length),":"===a[d-1]&&d--;var C=a.slice(0,d);a=a.slice(d),this.parseHost(C),this.hostname=this.hostname||"";var y="["===this.hostname[0]&&"]"===this.hostname[this.hostname.length-1];if(!y){var A=this.hostname.split(/\./);for(t=0,n=A.length;t<n;t++){var x=A[t];if(x&&!x.match(_)){for(var D="",w=0,E=x.length;w<E;w++)x.charCodeAt(w)>127?D+="x":D+=x[w];if(!D.match(_)){var q=A.slice(0,t),S=A.slice(t+1),F=x.match(k);F&&(q.push(F[1]),S.unshift(F[2])),S.length&&(a=S.join(".")+a),this.hostname=q.join(".");break}}}}this.hostname.length>255&&(this.hostname=""),y&&(this.hostname=this.hostname.substr(1,this.hostname.length-2))}var L=a.indexOf("#");-1!==L&&(this.hash=a.substr(L),a=a.slice(0,L));var z=a.indexOf("?");return-1!==z&&(this.search=a.substr(z),a=a.slice(0,z)),a&&(this.pathname=a),v[s]&&this.hostname&&!this.pathname&&(this.pathname=""),this},l.prototype.parseHost=function(e){var r=p.exec(e);r&&(":"!==(r=r[0])&&(this.port=r.substr(1)),e=e.substr(0,e.length-r.length)),e&&(this.hostname=e)};var C={encode:o,decode:c,format:function(e){var r="";return r+=e.protocol||"",r+=e.slashes?"//":"",r+=e.auth?e.auth+"@":"",e.hostname&&-1!==e.hostname.indexOf(":")?r+="["+e.hostname+"]":r+=e.hostname||"",r+=e.port?":"+e.port:"",r+=e.pathname||"",r+=e.search||"",r+=e.hash||""},parse:function(e,r){if(e&&e instanceof l)return e;var t=new l;return t.parse(e,r),t}},y=/[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/,A=/[\0-\x1F\x7F-\x9F]/,x=/[ \xA0\u1680\u2000-\u200A\u2028\u2029\u202F\u205F\u3000]/,D={Any:y,Cc:A,Cf:/[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804[\uDCBD\uDCCD]|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/,P:t,Z:x},w=function(e,r,t){return t={path:r,exports:{},require:function(e,r){return function(){throw new Error("Dynamic requires are not currently supported by @rollup/plugin-commonjs")}(null==r&&t.path)}},e(t,t.exports),t.exports}((function(e,n){var s=Object.prototype.hasOwnProperty;function o(e,r){return s.call(e,r)}function i(e){return!(e>=55296&&e<=57343)&&(!(e>=64976&&e<=65007)&&(65535!=(65535&e)&&65534!=(65535&e)&&(!(e>=0&&e<=8)&&(11!==e&&(!(e>=14&&e<=31)&&(!(e>=127&&e<=159)&&!(e>1114111)))))))}function a(e){if(e>65535){var r=55296+((e-=65536)>>10),t=56320+(1023&e);return String.fromCharCode(r,t)}return String.fromCharCode(e)}var c=/\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g,l=new RegExp(c.source+"|"+/&([a-z#][a-z0-9]{1,31});/gi.source,"gi"),u=/^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i;var p=/[&<>"]/,h=/[&<>"]/g,f={"&":"&","<":"<",">":">",'"':"""};function d(e){return f[e]}var m=/[.?*+^$[\]\\(){}|-]/g;n.lib={},n.lib.mdurl=C,n.lib.ucmicro=D,n.assign=function(e){var r=Array.prototype.slice.call(arguments,1);return r.forEach((function(r){if(r){if("object"!=typeof r)throw new TypeError(r+"must be object");Object.keys(r).forEach((function(t){e[t]=r[t]}))}})),e},n.isString=function(e){return"[object String]"===function(e){return Object.prototype.toString.call(e)}(e)},n.has=o,n.unescapeMd=function(e){return e.indexOf("\\")<0?e:e.replace(c,"$1")},n.unescapeAll=function(e){return e.indexOf("\\")<0&&e.indexOf("&")<0?e:e.replace(l,(function(e,t,n){return t||function(e,t){var n=0;return o(r,t)?r[t]:35===t.charCodeAt(0)&&u.test(t)&&i(n="x"===t[1].toLowerCase()?parseInt(t.slice(2),16):parseInt(t.slice(1),10))?a(n):e}(e,n)}))},n.isValidEntityCode=i,n.fromCodePoint=a,n.escapeHtml=function(e){return p.test(e)?e.replace(h,d):e},n.arrayReplaceAt=function(e,r,t){return[].concat(e.slice(0,r),t,e.slice(r+1))},n.isSpace=function(e){switch(e){case 9:case 32:return!0}return!1},n.isWhiteSpace=function(e){if(e>=8192&&e<=8202)return!0;switch(e){case 9:case 10:case 11:case 12:case 13:case 32:case 160:case 5760:case 8239:case 8287:case 12288:return!0}return!1},n.isMdAsciiPunct=function(e){switch(e){case 33:case 34:case 35:case 36:case 37:case 38:case 39:case 40:case 41:case 42:case 43:case 44:case 45:case 46:case 47:case 58:case 59:case 60:case 61:case 62:case 63:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 124:case 125:case 126:return!0;default:return!1}},n.isPunctChar=function(e){return t.test(e)},n.escapeRE=function(e){return e.replace(m,"\\$&")},n.normalizeReference=function(e){return e=e.trim().replace(/\s+/g," "),"\u1e7e"==="\u1e9e".toLowerCase()&&(e=e.replace(/\u1e9e/g,"\xdf")),e.toLowerCase().toUpperCase()}})),E=w.unescapeAll,q=w.unescapeAll,S=function(e,r,t){var n,s,o=r,i={ok:!1,pos:0,lines:0,str:""};if(60===e.charCodeAt(r)){for(r++;r<t;){if(10===(n=e.charCodeAt(r)))return i;if(60===n)return i;if(62===n)return i.pos=r+1,i.str=E(e.slice(o+1,r)),i.ok=!0,i;92===n&&r+1<t?r+=2:r++}return i}for(s=0;r<t&&32!==(n=e.charCodeAt(r))&&!(n<32||127===n);)if(92===n&&r+1<t){if(32===e.charCodeAt(r+1))break;r+=2}else{if(40===n&&++s>32)return i;if(41===n){if(0===s)break;s--}r++}return o===r||0!==s||(i.str=E(e.slice(o,r)),i.lines=0,i.pos=r,i.ok=!0),i},F=function(e,r,t){var n,s,o=0,i=r,a={ok:!1,pos:0,lines:0,str:""};if(r>=t)return a;if(34!==(s=e.charCodeAt(r))&&39!==s&&40!==s)return a;for(r++,40===s&&(s=41);r<t;){if((n=e.charCodeAt(r))===s)return a.pos=r+1,a.lines=o,a.str=q(e.slice(i+1,r)),a.ok=!0,a;if(40===n&&41===s)return a;10===n?o++:92===n&&r+1<t&&(r++,10===e.charCodeAt(r)&&o++),r++}return a},L={parseLinkLabel:function(e,r,t){var n,s,o,i,a=-1,c=e.posMax,l=e.pos;for(e.pos=r+1,n=1;e.pos<c;){if(93===(o=e.src.charCodeAt(e.pos))&&0===--n){s=!0;break}if(i=e.pos,e.md.inline.skipToken(e),91===o)if(i===e.pos-1)n++;else if(t)return e.pos=l,-1}return s&&(a=e.pos),e.pos=l,a},parseLinkDestination:S,parseLinkTitle:F},z=w.assign,T=w.unescapeAll,I=w.escapeHtml,M={};function R(){this.rules=z({},M)}M.code_inline=function(e,r,t,n,s){var o=e[r];return"<code"+s.renderAttrs(o)+">"+I(e[r].content)+"</code>"},M.code_block=function(e,r,t,n,s){var o=e[r];return"<pre"+s.renderAttrs(o)+"><code>"+I(e[r].content)+"</code></pre>\n"},M.fence=function(e,r,t,n,s){var o,i,a,c,l,u=e[r],p=u.info?T(u.info).trim():"",h="",f="";return p&&(h=(a=p.split(/(\s+)/g))[0],f=a.slice(2).join("")),0===(o=t.highlight&&t.highlight(u.content,h,f)||I(u.content)).indexOf("<pre")?o+"\n":p?(i=u.attrIndex("class"),c=u.attrs?u.attrs.slice():[],i<0?c.push(["class",t.langPrefix+h]):(c[i]=c[i].slice(),c[i][1]+=" "+t.langPrefix+h),l={attrs:c},"<pre><code"+s.renderAttrs(l)+">"+o+"</code></pre>\n"):"<pre><code"+s.renderAttrs(u)+">"+o+"</code></pre>\n"},M.image=function(e,r,t,n,s){var o=e[r];return o.attrs[o.attrIndex("alt")][1]=s.renderInlineAsText(o.children,t,n),s.renderToken(e,r,t)},M.hardbreak=function(e,r,t){return t.xhtmlOut?"<br />\n":"<br>\n"},M.softbreak=function(e,r,t){return t.breaks?t.xhtmlOut?"<br />\n":"<br>\n":"\n"},M.text=function(e,r){return I(e[r].content)},M.html_block=function(e,r){return e[r].content},M.html_inline=function(e,r){return e[r].content},R.prototype.renderAttrs=function(e){var r,t,n;if(!e.attrs)return"";for(n="",r=0,t=e.attrs.length;r<t;r++)n+=" "+I(e.attrs[r][0])+'="'+I(e.attrs[r][1])+'"';return n},R.prototype.renderToken=function(e,r,t){var n,s="",o=!1,i=e[r];return i.hidden?"":(i.block&&-1!==i.nesting&&r&&e[r-1].hidden&&(s+="\n"),s+=(-1===i.nesting?"</":"<")+i.tag,s+=this.renderAttrs(i),0===i.nesting&&t.xhtmlOut&&(s+=" /"),i.block&&(o=!0,1===i.nesting&&r+1<e.length&&("inline"===(n=e[r+1]).type||n.hidden||-1===n.nesting&&n.tag===i.tag)&&(o=!1)),s+=o?">\n":">")},R.prototype.renderInline=function(e,r,t){for(var n,s="",o=this.rules,i=0,a=e.length;i<a;i++)void 0!==o[n=e[i].type]?s+=o[n](e,i,r,t,this):s+=this.renderToken(e,i,r);return s},R.prototype.renderInlineAsText=function(e,r,t){for(var n="",s=0,o=e.length;s<o;s++)"text"===e[s].type?n+=e[s].content:"image"===e[s].type?n+=this.renderInlineAsText(e[s].children,r,t):"softbreak"===e[s].type&&(n+="\n");return n},R.prototype.render=function(e,r,t){var n,s,o,i="",a=this.rules;for(n=0,s=e.length;n<s;n++)"inline"===(o=e[n].type)?i+=this.renderInline(e[n].children,r,t):void 0!==a[o]?i+=a[e[n].type](e,n,r,t,this):i+=this.renderToken(e,n,r,t);return i};var B=R;function N(){this.__rules__=[],this.__cache__=null}N.prototype.__find__=function(e){for(var r=0;r<this.__rules__.length;r++)if(this.__rules__[r].name===e)return r;return-1},N.prototype.__compile__=function(){var e=this,r=[""];e.__rules__.forEach((function(e){e.enabled&&e.alt.forEach((function(e){r.indexOf(e)<0&&r.push(e)}))})),e.__cache__={},r.forEach((function(r){e.__cache__[r]=[],e.__rules__.forEach((function(t){t.enabled&&(r&&t.alt.indexOf(r)<0||e.__cache__[r].push(t.fn))}))}))},N.prototype.at=function(e,r,t){var n=this.__find__(e),s=t||{};if(-1===n)throw new Error("Parser rule not found: "+e);this.__rules__[n].fn=r,this.__rules__[n].alt=s.alt||[],this.__cache__=null},N.prototype.before=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},N.prototype.after=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s+1,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},N.prototype.push=function(e,r,t){var n=t||{};this.__rules__.push({name:e,enabled:!0,fn:r,alt:n.alt||[]}),this.__cache__=null},N.prototype.enable=function(e,r){Array.isArray(e)||(e=[e]);var t=[];return e.forEach((function(e){var n=this.__find__(e);if(n<0){if(r)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[n].enabled=!0,t.push(e)}),this),this.__cache__=null,t},N.prototype.enableOnly=function(e,r){Array.isArray(e)||(e=[e]),this.__rules__.forEach((function(e){e.enabled=!1})),this.enable(e,r)},N.prototype.disable=function(e,r){Array.isArray(e)||(e=[e]);var t=[];return e.forEach((function(e){var n=this.__find__(e);if(n<0){if(r)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[n].enabled=!1,t.push(e)}),this),this.__cache__=null,t},N.prototype.getRules=function(e){return null===this.__cache__&&this.__compile__(),this.__cache__[e]||[]};var O=N,P=/\r\n?|\n/g,j=/\0/g,U=w.arrayReplaceAt;function V(e){return/^<\/a\s*>/i.test(e)}var Z=/\+-|\.\.|\?\?\?\?|!!!!|,,|--/,G=/\((c|tm|r|p)\)/i,$=/\((c|tm|r|p)\)/gi,H={c:"\xa9",r:"\xae",p:"\xa7",tm:"\u2122"};function J(e,r){return H[r.toLowerCase()]}function W(e){var r,t,n=0;for(r=e.length-1;r>=0;r--)"text"!==(t=e[r]).type||n||(t.content=t.content.replace($,J)),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}function Y(e){var r,t,n=0;for(r=e.length-1;r>=0;r--)"text"!==(t=e[r]).type||n||Z.test(t.content)&&(t.content=t.content.replace(/\+-/g,"\xb1").replace(/\.{2,}/g,"\u2026").replace(/([?!])\u2026/g,"$1..").replace(/([?!]){4,}/g,"$1$1$1").replace(/,{2,}/g,",").replace(/(^|[^-])---(?=[^-]|$)/gm,"$1\u2014").replace(/(^|\s)--(?=\s|$)/gm,"$1\u2013").replace(/(^|[^-\s])--(?=[^-\s]|$)/gm,"$1\u2013")),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}var K=w.isWhiteSpace,Q=w.isPunctChar,X=w.isMdAsciiPunct,ee=/['"]/,re=/['"]/g;function te(e,r,t){return e.substr(0,r)+t+e.substr(r+1)}function ne(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C,y;for(v=[],t=0;t<e.length;t++){for(n=e[t],c=e[t].level,k=v.length-1;k>=0&&!(v[k].level<=c);k--);if(v.length=k+1,"text"===n.type){i=0,a=(s=n.content).length;e:for(;i<a&&(re.lastIndex=i,o=re.exec(s));){if(g=_=!0,i=o.index+1,b="'"===o[0],u=32,o.index-1>=0)u=s.charCodeAt(o.index-1);else for(k=t-1;k>=0&&("softbreak"!==e[k].type&&"hardbreak"!==e[k].type);k--)if(e[k].content){u=e[k].content.charCodeAt(e[k].content.length-1);break}if(p=32,i<a)p=s.charCodeAt(i);else for(k=t+1;k<e.length&&("softbreak"!==e[k].type&&"hardbreak"!==e[k].type);k++)if(e[k].content){p=e[k].content.charCodeAt(0);break}if(h=X(u)||Q(String.fromCharCode(u)),f=X(p)||Q(String.fromCharCode(p)),d=K(u),(m=K(p))?g=!1:f&&(d||h||(g=!1)),d?_=!1:h&&(m||f||(_=!1)),34===p&&'"'===o[0]&&u>=48&&u<=57&&(_=g=!1),g&&_&&(g=h,_=f),g||_){if(_)for(k=v.length-1;k>=0&&(l=v[k],!(v[k].level<c));k--)if(l.single===b&&v[k].level===c){l=v[k],b?(C=r.md.options.quotes[2],y=r.md.options.quotes[3]):(C=r.md.options.quotes[0],y=r.md.options.quotes[1]),n.content=te(n.content,o.index,y),e[l.token].content=te(e[l.token].content,l.pos,C),i+=y.length-1,l.token===t&&(i+=C.length-1),a=(s=n.content).length,v.length=k;continue e}g?v.push({token:t,pos:o.index,single:b,level:c}):_&&b&&(n.content=te(n.content,o.index,"\u2019"))}else b&&(n.content=te(n.content,o.index,"\u2019"))}}}}function se(e,r,t){this.type=e,this.tag=r,this.attrs=null,this.map=null,this.nesting=t,this.level=0,this.children=null,this.content="",this.markup="",this.info="",this.meta=null,this.block=!1,this.hidden=!1}se.prototype.attrIndex=function(e){var r,t,n;if(!this.attrs)return-1;for(t=0,n=(r=this.attrs).length;t<n;t++)if(r[t][0]===e)return t;return-1},se.prototype.attrPush=function(e){this.attrs?this.attrs.push(e):this.attrs=[e]},se.prototype.attrSet=function(e,r){var t=this.attrIndex(e),n=[e,r];t<0?this.attrPush(n):this.attrs[t]=n},se.prototype.attrGet=function(e){var r=this.attrIndex(e),t=null;return r>=0&&(t=this.attrs[r][1]),t},se.prototype.attrJoin=function(e,r){var t=this.attrIndex(e);t<0?this.attrPush([e,r]):this.attrs[t][1]=this.attrs[t][1]+" "+r};var oe=se;function ie(e,r,t){this.src=e,this.env=t,this.tokens=[],this.inlineMode=!1,this.md=r}ie.prototype.Token=oe;var ae=ie,ce=[["normalize",function(e){var r;r=(r=e.src.replace(P,"\n")).replace(j,"\ufffd"),e.src=r}],["block",function(e){var r;e.inlineMode?((r=new e.Token("inline","",0)).content=e.src,r.map=[0,1],r.children=[],e.tokens.push(r)):e.md.block.parse(e.src,e.md,e.env,e.tokens)}],["inline",function(e){var r,t,n,s=e.tokens;for(t=0,n=s.length;t<n;t++)"inline"===(r=s[t]).type&&e.md.inline.parse(r.content,e.md,e.env,r.children)}],["linkify",function(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b=e.tokens;if(e.md.options.linkify)for(t=0,n=b.length;t<n;t++)if("inline"===b[t].type&&e.md.linkify.pretest(b[t].content))for(f=0,r=(s=b[t].children).length-1;r>=0;r--)if("link_close"!==(i=s[r]).type){if("html_inline"===i.type&&(k=i.content,/^<a[>\s]/i.test(k)&&f>0&&f--,V(i.content)&&f++),!(f>0)&&"text"===i.type&&e.md.linkify.test(i.content)){for(l=i.content,_=e.md.linkify.match(l),a=[],h=i.level,p=0,c=0;c<_.length;c++)d=_[c].url,m=e.md.normalizeLink(d),e.md.validateLink(m)&&(g=_[c].text,g=_[c].schema?"mailto:"!==_[c].schema||/^mailto:/i.test(g)?e.md.normalizeLinkText(g):e.md.normalizeLinkText("mailto:"+g).replace(/^mailto:/,""):e.md.normalizeLinkText("http://"+g).replace(/^http:\/\//,""),(u=_[c].index)>p&&((o=new e.Token("text","",0)).content=l.slice(p,u),o.level=h,a.push(o)),(o=new e.Token("link_open","a",1)).attrs=[["href",m]],o.level=h++,o.markup="linkify",o.info="auto",a.push(o),(o=new e.Token("text","",0)).content=g,o.level=h,a.push(o),(o=new e.Token("link_close","a",-1)).level=--h,o.markup="linkify",o.info="auto",a.push(o),p=_[c].lastIndex);p<l.length&&((o=new e.Token("text","",0)).content=l.slice(p),o.level=h,a.push(o)),b[t].children=s=U(s,r,a)}}else for(r--;s[r].level!==i.level&&"link_open"!==s[r].type;)r--}],["replacements",function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;r>=0;r--)"inline"===e.tokens[r].type&&(G.test(e.tokens[r].content)&&W(e.tokens[r].children),Z.test(e.tokens[r].content)&&Y(e.tokens[r].children))}],["smartquotes",function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;r>=0;r--)"inline"===e.tokens[r].type&&ee.test(e.tokens[r].content)&&ne(e.tokens[r].children,e)}]];function le(){this.ruler=new O;for(var e=0;e<ce.length;e++)this.ruler.push(ce[e][0],ce[e][1])}le.prototype.process=function(e){var r,t,n;for(r=0,t=(n=this.ruler.getRules("")).length;r<t;r++)n[r](e)},le.prototype.State=ae;var ue=le,pe=w.isSpace;function he(e,r){var t=e.bMarks[r]+e.tShift[r],n=e.eMarks[r];return e.src.substr(t,n-t)}function fe(e){var r,t=[],n=0,s=e.length,o=!1,i=0,a="";for(r=e.charCodeAt(n);n<s;)124===r&&(o?(a+=e.substring(i,n-1),i=n):(t.push(a+e.substring(i,n)),a="",i=n+1)),o=92===r,n++,r=e.charCodeAt(n);return t.push(a+e.substring(i)),t}var de=w.isSpace,me=w.isSpace,ge=w.isSpace;function _e(e,r){var t,n,s,o;return n=e.bMarks[r]+e.tShift[r],s=e.eMarks[r],42!==(t=e.src.charCodeAt(n++))&&45!==t&&43!==t||n<s&&(o=e.src.charCodeAt(n),!ge(o))?-1:n}function ke(e,r){var t,n=e.bMarks[r]+e.tShift[r],s=n,o=e.eMarks[r];if(s+1>=o)return-1;if((t=e.src.charCodeAt(s++))<48||t>57)return-1;for(;;){if(s>=o)return-1;if(!((t=e.src.charCodeAt(s++))>=48&&t<=57)){if(41===t||46===t)break;return-1}if(s-n>=10)return-1}return s<o&&(t=e.src.charCodeAt(s),!ge(t))?-1:s}var be=w.normalizeReference,ve=w.isSpace,Ce="<[A-Za-z][A-Za-z0-9\\-]*(?:\\s+[a-zA-Z_:][a-zA-Z0-9:._-]*(?:\\s*=\\s*(?:[^\"'=<>`\\x00-\\x20]+|'[^']*'|\"[^\"]*\"))?)*\\s*\\/?>",ye="<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>",Ae={HTML_TAG_RE:new RegExp("^(?:"+Ce+"|"+ye+"|\x3c!----\x3e|\x3c!--(?:-?[^>-])(?:-?[^-])*--\x3e|<[?][\\s\\S]*?[?]>|<![A-Z]+\\s+[^>]*>|<!\\[CDATA\\[[\\s\\S]*?\\]\\]>)"),HTML_OPEN_CLOSE_TAG_RE:new RegExp("^(?:"+Ce+"|"+ye+")")},xe=Ae.HTML_OPEN_CLOSE_TAG_RE,De=[[/^<(script|pre|style|textarea)(?=(\s|>|$))/i,/<\/(script|pre|style|textarea)>/i,!0],[/^<!--/,/-->/,!0],[/^<\?/,/\?>/,!0],[/^<![A-Z]/,/>/,!0],[/^<!\[CDATA\[/,/\]\]>/,!0],[new RegExp("^</?("+["address","article","aside","base","basefont","blockquote","body","caption","center","col","colgroup","dd","details","dialog","dir","div","dl","dt","fieldset","figcaption","figure","footer","form","frame","frameset","h1","h2","h3","h4","h5","h6","head","header","hr","html","iframe","legend","li","link","main","menu","menuitem","nav","noframes","ol","optgroup","option","p","param","section","source","summary","table","tbody","td","tfoot","th","thead","title","tr","track","ul"].join("|")+")(?=(\\s|/?>|$))","i"),/^$/,!0],[new RegExp(xe.source+"\\s*$"),/^$/,!1]],we=w.isSpace,Ee=w.isSpace;function qe(e,r,t,n){var s,o,i,a,c,l,u,p;for(this.src=e,this.md=r,this.env=t,this.tokens=n,this.bMarks=[],this.eMarks=[],this.tShift=[],this.sCount=[],this.bsCount=[],this.blkIndent=0,this.line=0,this.lineMax=0,this.tight=!1,this.ddIndent=-1,this.listIndent=-1,this.parentType="root",this.level=0,this.result="",p=!1,i=a=l=u=0,c=(o=this.src).length;a<c;a++){if(s=o.charCodeAt(a),!p){if(Ee(s)){l++,9===s?u+=4-u%4:u++;continue}p=!0}10!==s&&a!==c-1||(10!==s&&a++,this.bMarks.push(i),this.eMarks.push(a),this.tShift.push(l),this.sCount.push(u),this.bsCount.push(0),p=!1,l=0,u=0,i=a+1)}this.bMarks.push(o.length),this.eMarks.push(o.length),this.tShift.push(0),this.sCount.push(0),this.bsCount.push(0),this.lineMax=this.bMarks.length-1}qe.prototype.push=function(e,r,t){var n=new oe(e,r,t);return n.block=!0,t<0&&this.level--,n.level=this.level,t>0&&this.level++,this.tokens.push(n),n},qe.prototype.isEmpty=function(e){return this.bMarks[e]+this.tShift[e]>=this.eMarks[e]},qe.prototype.skipEmptyLines=function(e){for(var r=this.lineMax;e<r&&!(this.bMarks[e]+this.tShift[e]<this.eMarks[e]);e++);return e},qe.prototype.skipSpaces=function(e){for(var r,t=this.src.length;e<t&&(r=this.src.charCodeAt(e),Ee(r));e++);return e},qe.prototype.skipSpacesBack=function(e,r){if(e<=r)return e;for(;e>r;)if(!Ee(this.src.charCodeAt(--e)))return e+1;return e},qe.prototype.skipChars=function(e,r){for(var t=this.src.length;e<t&&this.src.charCodeAt(e)===r;e++);return e},qe.prototype.skipCharsBack=function(e,r,t){if(e<=t)return e;for(;e>t;)if(r!==this.src.charCodeAt(--e))return e+1;return e},qe.prototype.getLines=function(e,r,t,n){var s,o,i,a,c,l,u,p=e;if(e>=r)return"";for(l=new Array(r-e),s=0;p<r;p++,s++){for(o=0,u=a=this.bMarks[p],c=p+1<r||n?this.eMarks[p]+1:this.eMarks[p];a<c&&o<t;){if(i=this.src.charCodeAt(a),Ee(i))9===i?o+=4-(o+this.bsCount[p])%4:o++;else{if(!(a-u<this.tShift[p]))break;o++}a++}l[s]=o>t?new Array(o-t+1).join(" ")+this.src.slice(a,c):this.src.slice(a,c)}return l.join("")},qe.prototype.Token=oe;var Se=qe,Fe=[["table",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C;if(r+2>t)return!1;if(l=r+1,e.sCount[l]<e.blkIndent)return!1;if(e.sCount[l]-e.blkIndent>=4)return!1;if((i=e.bMarks[l]+e.tShift[l])>=e.eMarks[l])return!1;if(124!==(v=e.src.charCodeAt(i++))&&45!==v&&58!==v)return!1;if(i>=e.eMarks[l])return!1;if(124!==(C=e.src.charCodeAt(i++))&&45!==C&&58!==C&&!pe(C))return!1;if(45===v&&pe(C))return!1;for(;i<e.eMarks[l];){if(124!==(s=e.src.charCodeAt(i))&&45!==s&&58!==s&&!pe(s))return!1;i++}for(u=(o=he(e,r+1)).split("|"),f=[],a=0;a<u.length;a++){if(!(d=u[a].trim())){if(0===a||a===u.length-1)continue;return!1}if(!/^:?-+:?$/.test(d))return!1;58===d.charCodeAt(d.length-1)?f.push(58===d.charCodeAt(0)?"center":"right"):58===d.charCodeAt(0)?f.push("left"):f.push("")}if(-1===(o=he(e,r).trim()).indexOf("|"))return!1;if(e.sCount[r]-e.blkIndent>=4)return!1;if((u=fe(o)).length&&""===u[0]&&u.shift(),u.length&&""===u[u.length-1]&&u.pop(),0===(p=u.length)||p!==f.length)return!1;if(n)return!0;for(_=e.parentType,e.parentType="table",b=e.md.block.ruler.getRules("blockquote"),(h=e.push("table_open","table",1)).map=m=[r,0],(h=e.push("thead_open","thead",1)).map=[r,r+1],(h=e.push("tr_open","tr",1)).map=[r,r+1],a=0;a<u.length;a++)h=e.push("th_open","th",1),f[a]&&(h.attrs=[["style","text-align:"+f[a]]]),(h=e.push("inline","",0)).content=u[a].trim(),h.children=[],h=e.push("th_close","th",-1);for(h=e.push("tr_close","tr",-1),h=e.push("thead_close","thead",-1),l=r+2;l<t&&!(e.sCount[l]<e.blkIndent);l++){for(k=!1,a=0,c=b.length;a<c;a++)if(b[a](e,l,t,!0)){k=!0;break}if(k)break;if(!(o=he(e,l).trim()))break;if(e.sCount[l]-e.blkIndent>=4)break;for((u=fe(o)).length&&""===u[0]&&u.shift(),u.length&&""===u[u.length-1]&&u.pop(),l===r+2&&((h=e.push("tbody_open","tbody",1)).map=g=[r+2,0]),(h=e.push("tr_open","tr",1)).map=[l,l+1],a=0;a<p;a++)h=e.push("td_open","td",1),f[a]&&(h.attrs=[["style","text-align:"+f[a]]]),(h=e.push("inline","",0)).content=u[a]?u[a].trim():"",h.children=[],h=e.push("td_close","td",-1);h=e.push("tr_close","tr",-1)}return g&&(h=e.push("tbody_close","tbody",-1),g[1]=l),h=e.push("table_close","table",-1),m[1]=l,e.parentType=_,e.line=l,!0},["paragraph","reference"]],["code",function(e,r,t){var n,s,o;if(e.sCount[r]-e.blkIndent<4)return!1;for(s=n=r+1;n<t;)if(e.isEmpty(n))n++;else{if(!(e.sCount[n]-e.blkIndent>=4))break;s=++n}return e.line=s,(o=e.push("code_block","code",0)).content=e.getLines(r,s,4+e.blkIndent,!1)+"\n",o.map=[r,e.line],!0}],["fence",function(e,r,t,n){var s,o,i,a,c,l,u,p=!1,h=e.bMarks[r]+e.tShift[r],f=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(h+3>f)return!1;if(126!==(s=e.src.charCodeAt(h))&&96!==s)return!1;if(c=h,(o=(h=e.skipChars(h,s))-c)<3)return!1;if(u=e.src.slice(c,h),i=e.src.slice(h,f),96===s&&i.indexOf(String.fromCharCode(s))>=0)return!1;if(n)return!0;for(a=r;!(++a>=t)&&!((h=c=e.bMarks[a]+e.tShift[a])<(f=e.eMarks[a])&&e.sCount[a]<e.blkIndent);)if(e.src.charCodeAt(h)===s&&!(e.sCount[a]-e.blkIndent>=4||(h=e.skipChars(h,s))-c<o||(h=e.skipSpaces(h))<f)){p=!0;break}return o=e.sCount[r],e.line=a+(p?1:0),(l=e.push("fence","code",0)).info=i,l.content=e.getLines(r+1,a,o,!0),l.markup=u,l.map=[r,e.line],!0},["paragraph","reference","blockquote","list"]],["blockquote",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C,y,A,x=e.lineMax,D=e.bMarks[r]+e.tShift[r],w=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(62!==e.src.charCodeAt(D++))return!1;if(n)return!0;for(a=h=e.sCount[r]+1,32===e.src.charCodeAt(D)?(D++,a++,h++,s=!1,b=!0):9===e.src.charCodeAt(D)?(b=!0,(e.bsCount[r]+h)%4==3?(D++,a++,h++,s=!1):s=!0):b=!1,f=[e.bMarks[r]],e.bMarks[r]=D;D<w&&(o=e.src.charCodeAt(D),de(o));)9===o?h+=4-(h+e.bsCount[r]+(s?1:0))%4:h++,D++;for(d=[e.bsCount[r]],e.bsCount[r]=e.sCount[r]+1+(b?1:0),l=D>=w,_=[e.sCount[r]],e.sCount[r]=h-a,k=[e.tShift[r]],e.tShift[r]=D-e.bMarks[r],C=e.md.block.ruler.getRules("blockquote"),g=e.parentType,e.parentType="blockquote",p=r+1;p<t&&(A=e.sCount[p]<e.blkIndent,!((D=e.bMarks[p]+e.tShift[p])>=(w=e.eMarks[p])));p++)if(62!==e.src.charCodeAt(D++)||A){if(l)break;for(v=!1,i=0,c=C.length;i<c;i++)if(C[i](e,p,t,!0)){v=!0;break}if(v){e.lineMax=p,0!==e.blkIndent&&(f.push(e.bMarks[p]),d.push(e.bsCount[p]),k.push(e.tShift[p]),_.push(e.sCount[p]),e.sCount[p]-=e.blkIndent);break}f.push(e.bMarks[p]),d.push(e.bsCount[p]),k.push(e.tShift[p]),_.push(e.sCount[p]),e.sCount[p]=-1}else{for(a=h=e.sCount[p]+1,32===e.src.charCodeAt(D)?(D++,a++,h++,s=!1,b=!0):9===e.src.charCodeAt(D)?(b=!0,(e.bsCount[p]+h)%4==3?(D++,a++,h++,s=!1):s=!0):b=!1,f.push(e.bMarks[p]),e.bMarks[p]=D;D<w&&(o=e.src.charCodeAt(D),de(o));)9===o?h+=4-(h+e.bsCount[p]+(s?1:0))%4:h++,D++;l=D>=w,d.push(e.bsCount[p]),e.bsCount[p]=e.sCount[p]+1+(b?1:0),_.push(e.sCount[p]),e.sCount[p]=h-a,k.push(e.tShift[p]),e.tShift[p]=D-e.bMarks[p]}for(m=e.blkIndent,e.blkIndent=0,(y=e.push("blockquote_open","blockquote",1)).markup=">",y.map=u=[r,0],e.md.block.tokenize(e,r,p),(y=e.push("blockquote_close","blockquote",-1)).markup=">",e.lineMax=x,e.parentType=g,u[1]=e.line,i=0;i<k.length;i++)e.bMarks[i+r]=f[i],e.tShift[i+r]=k[i],e.sCount[i+r]=_[i],e.bsCount[i+r]=d[i];return e.blkIndent=m,!0},["paragraph","reference","blockquote","list"]],["hr",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(42!==(s=e.src.charCodeAt(c++))&&45!==s&&95!==s)return!1;for(o=1;c<l;){if((i=e.src.charCodeAt(c++))!==s&&!me(i))return!1;i===s&&o++}return!(o<3)&&(n||(e.line=r+1,(a=e.push("hr","hr",0)).map=[r,e.line],a.markup=Array(o+1).join(String.fromCharCode(s))),!0)},["paragraph","reference","blockquote","list"]],["list",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C,y,A,x,D,w,E,q,S,F,L,z=!1,T=!0;if(e.sCount[r]-e.blkIndent>=4)return!1;if(e.listIndent>=0&&e.sCount[r]-e.listIndent>=4&&e.sCount[r]<e.blkIndent)return!1;if(n&&"paragraph"===e.parentType&&e.sCount[r]>=e.blkIndent&&(z=!0),(w=ke(e,r))>=0){if(u=!0,q=e.bMarks[r]+e.tShift[r],g=Number(e.src.slice(q,w-1)),z&&1!==g)return!1}else{if(!((w=_e(e,r))>=0))return!1;u=!1}if(z&&e.skipSpaces(w)>=e.eMarks[r])return!1;if(m=e.src.charCodeAt(w-1),n)return!0;for(d=e.tokens.length,u?(L=e.push("ordered_list_open","ol",1),1!==g&&(L.attrs=[["start",g]])):L=e.push("bullet_list_open","ul",1),L.map=f=[r,0],L.markup=String.fromCharCode(m),k=r,E=!1,F=e.md.block.ruler.getRules("list"),C=e.parentType,e.parentType="list";k<t;){for(D=w,_=e.eMarks[k],l=b=e.sCount[k]+w-(e.bMarks[r]+e.tShift[r]);D<_;){if(9===(s=e.src.charCodeAt(D)))b+=4-(b+e.bsCount[k])%4;else{if(32!==s)break;b++}D++}if((c=(o=D)>=_?1:b-l)>4&&(c=1),a=l+c,(L=e.push("list_item_open","li",1)).markup=String.fromCharCode(m),L.map=p=[r,0],u&&(L.info=e.src.slice(q,w-1)),x=e.tight,A=e.tShift[r],y=e.sCount[r],v=e.listIndent,e.listIndent=e.blkIndent,e.blkIndent=a,e.tight=!0,e.tShift[r]=o-e.bMarks[r],e.sCount[r]=b,o>=_&&e.isEmpty(r+1)?e.line=Math.min(e.line+2,t):e.md.block.tokenize(e,r,t,!0),e.tight&&!E||(T=!1),E=e.line-r>1&&e.isEmpty(e.line-1),e.blkIndent=e.listIndent,e.listIndent=v,e.tShift[r]=A,e.sCount[r]=y,e.tight=x,(L=e.push("list_item_close","li",-1)).markup=String.fromCharCode(m),k=r=e.line,p[1]=k,o=e.bMarks[r],k>=t)break;if(e.sCount[k]<e.blkIndent)break;if(e.sCount[r]-e.blkIndent>=4)break;for(S=!1,i=0,h=F.length;i<h;i++)if(F[i](e,k,t,!0)){S=!0;break}if(S)break;if(u){if((w=ke(e,k))<0)break;q=e.bMarks[k]+e.tShift[k]}else if((w=_e(e,k))<0)break;if(m!==e.src.charCodeAt(w-1))break}return(L=u?e.push("ordered_list_close","ol",-1):e.push("bullet_list_close","ul",-1)).markup=String.fromCharCode(m),f[1]=k,e.line=k,e.parentType=C,T&&function(e,r){var t,n,s=e.level+2;for(t=r+2,n=e.tokens.length-2;t<n;t++)e.tokens[t].level===s&&"paragraph_open"===e.tokens[t].type&&(e.tokens[t+2].hidden=!0,e.tokens[t].hidden=!0,t+=2)}(e,d),!0},["paragraph","reference","blockquote"]],["reference",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v=0,C=e.bMarks[r]+e.tShift[r],y=e.eMarks[r],A=r+1;if(e.sCount[r]-e.blkIndent>=4)return!1;if(91!==e.src.charCodeAt(C))return!1;for(;++C<y;)if(93===e.src.charCodeAt(C)&&92!==e.src.charCodeAt(C-1)){if(C+1===y)return!1;if(58!==e.src.charCodeAt(C+1))return!1;break}for(a=e.lineMax,k=e.md.block.ruler.getRules("reference"),f=e.parentType,e.parentType="reference";A<a&&!e.isEmpty(A);A++)if(!(e.sCount[A]-e.blkIndent>3||e.sCount[A]<0)){for(_=!1,l=0,u=k.length;l<u;l++)if(k[l](e,A,a,!0)){_=!0;break}if(_)break}for(y=(g=e.getLines(r,A,e.blkIndent,!1).trim()).length,C=1;C<y;C++){if(91===(s=g.charCodeAt(C)))return!1;if(93===s){h=C;break}(10===s||92===s&&++C<y&&10===g.charCodeAt(C))&&v++}if(h<0||58!==g.charCodeAt(h+1))return!1;for(C=h+2;C<y;C++)if(10===(s=g.charCodeAt(C)))v++;else if(!ve(s))break;if(!(d=e.md.helpers.parseLinkDestination(g,C,y)).ok)return!1;if(c=e.md.normalizeLink(d.str),!e.md.validateLink(c))return!1;for(o=C=d.pos,i=v+=d.lines,m=C;C<y;C++)if(10===(s=g.charCodeAt(C)))v++;else if(!ve(s))break;for(d=e.md.helpers.parseLinkTitle(g,C,y),C<y&&m!==C&&d.ok?(b=d.str,C=d.pos,v+=d.lines):(b="",C=o,v=i);C<y&&(s=g.charCodeAt(C),ve(s));)C++;if(C<y&&10!==g.charCodeAt(C)&&b)for(b="",C=o,v=i;C<y&&(s=g.charCodeAt(C),ve(s));)C++;return!(C<y&&10!==g.charCodeAt(C))&&(!!(p=be(g.slice(1,h)))&&(n||(void 0===e.env.references&&(e.env.references={}),void 0===e.env.references[p]&&(e.env.references[p]={title:b,href:c}),e.parentType=f,e.line=r+v+1),!0))}],["html_block",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(!e.md.options.html)return!1;if(60!==e.src.charCodeAt(c))return!1;for(a=e.src.slice(c,l),s=0;s<De.length&&!De[s][0].test(a);s++);if(s===De.length)return!1;if(n)return De[s][2];if(o=r+1,!De[s][1].test(a))for(;o<t&&!(e.sCount[o]<e.blkIndent);o++)if(c=e.bMarks[o]+e.tShift[o],l=e.eMarks[o],a=e.src.slice(c,l),De[s][1].test(a)){0!==a.length&&o++;break}return e.line=o,(i=e.push("html_block","",0)).map=[r,o],i.content=e.getLines(r,o,e.blkIndent,!0),!0},["paragraph","reference","blockquote"]],["heading",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(35!==(s=e.src.charCodeAt(c))||c>=l)return!1;for(o=1,s=e.src.charCodeAt(++c);35===s&&c<l&&o<=6;)o++,s=e.src.charCodeAt(++c);return!(o>6||c<l&&!we(s))&&(n||(l=e.skipSpacesBack(l,c),(i=e.skipCharsBack(l,35,c))>c&&we(e.src.charCodeAt(i-1))&&(l=i),e.line=r+1,(a=e.push("heading_open","h"+String(o),1)).markup="########".slice(0,o),a.map=[r,e.line],(a=e.push("inline","",0)).content=e.src.slice(c,l).trim(),a.map=[r,e.line],a.children=[],(a=e.push("heading_close","h"+String(o),-1)).markup="########".slice(0,o)),!0)},["paragraph","reference","blockquote"]],["lheading",function(e,r,t){var n,s,o,i,a,c,l,u,p,h,f=r+1,d=e.md.block.ruler.getRules("paragraph");if(e.sCount[r]-e.blkIndent>=4)return!1;for(h=e.parentType,e.parentType="paragraph";f<t&&!e.isEmpty(f);f++)if(!(e.sCount[f]-e.blkIndent>3)){if(e.sCount[f]>=e.blkIndent&&(c=e.bMarks[f]+e.tShift[f])<(l=e.eMarks[f])&&(45===(p=e.src.charCodeAt(c))||61===p)&&(c=e.skipChars(c,p),(c=e.skipSpaces(c))>=l)){u=61===p?1:2;break}if(!(e.sCount[f]<0)){for(s=!1,o=0,i=d.length;o<i;o++)if(d[o](e,f,t,!0)){s=!0;break}if(s)break}}return!!u&&(n=e.getLines(r,f,e.blkIndent,!1).trim(),e.line=f+1,(a=e.push("heading_open","h"+String(u),1)).markup=String.fromCharCode(p),a.map=[r,e.line],(a=e.push("inline","",0)).content=n,a.map=[r,e.line-1],a.children=[],(a=e.push("heading_close","h"+String(u),-1)).markup=String.fromCharCode(p),e.parentType=h,!0)}],["paragraph",function(e,r){var t,n,s,o,i,a,c=r+1,l=e.md.block.ruler.getRules("paragraph"),u=e.lineMax;for(a=e.parentType,e.parentType="paragraph";c<u&&!e.isEmpty(c);c++)if(!(e.sCount[c]-e.blkIndent>3||e.sCount[c]<0)){for(n=!1,s=0,o=l.length;s<o;s++)if(l[s](e,c,u,!0)){n=!0;break}if(n)break}return t=e.getLines(r,c,e.blkIndent,!1).trim(),e.line=c,(i=e.push("paragraph_open","p",1)).map=[r,e.line],(i=e.push("inline","",0)).content=t,i.map=[r,e.line],i.children=[],i=e.push("paragraph_close","p",-1),e.parentType=a,!0}]];function Le(){this.ruler=new O;for(var e=0;e<Fe.length;e++)this.ruler.push(Fe[e][0],Fe[e][1],{alt:(Fe[e][2]||[]).slice()})}Le.prototype.tokenize=function(e,r,t){for(var n,s=this.ruler.getRules(""),o=s.length,i=r,a=!1,c=e.md.options.maxNesting;i<t&&(e.line=i=e.skipEmptyLines(i),!(i>=t))&&!(e.sCount[i]<e.blkIndent);){if(e.level>=c){e.line=t;break}for(n=0;n<o&&!s[n](e,i,t,!1);n++);e.tight=!a,e.isEmpty(e.line-1)&&(a=!0),(i=e.line)<t&&e.isEmpty(i)&&(a=!0,i++,e.line=i)}},Le.prototype.parse=function(e,r,t,n){var s;e&&(s=new this.State(e,r,t,n),this.tokenize(s,s.line,s.lineMax))},Le.prototype.State=Se;var ze=Le;function Te(e){switch(e){case 10:case 33:case 35:case 36:case 37:case 38:case 42:case 43:case 45:case 58:case 60:case 61:case 62:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 125:case 126:return!0;default:return!1}}for(var Ie=w.isSpace,Me=w.isSpace,Re=[],Be=0;Be<256;Be++)Re.push(0);"\\!\"#$%&'()*+,./:;<=>?@[]^_`{|}~-".split("").forEach((function(e){Re[e.charCodeAt(0)]=1}));function Ne(e,r){var t,n,s,o,i,a=[],c=r.length;for(t=0;t<c;t++)126===(s=r[t]).marker&&-1!==s.end&&(o=r[s.end],(i=e.tokens[s.token]).type="s_open",i.tag="s",i.nesting=1,i.markup="~~",i.content="",(i=e.tokens[o.token]).type="s_close",i.tag="s",i.nesting=-1,i.markup="~~",i.content="","text"===e.tokens[o.token-1].type&&"~"===e.tokens[o.token-1].content&&a.push(o.token-1));for(;a.length;){for(n=(t=a.pop())+1;n<e.tokens.length&&"s_close"===e.tokens[n].type;)n++;t!==--n&&(i=e.tokens[n],e.tokens[n]=e.tokens[t],e.tokens[t]=i)}}var Oe={tokenize:function(e,r){var t,n,s,o,i=e.pos,a=e.src.charCodeAt(i);if(r)return!1;if(126!==a)return!1;if(s=(n=e.scanDelims(e.pos,!0)).length,o=String.fromCharCode(a),s<2)return!1;for(s%2&&(e.push("text","",0).content=o,s--),t=0;t<s;t+=2)e.push("text","",0).content=o+o,e.delimiters.push({marker:a,length:0,token:e.tokens.length-1,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},postProcess:function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Ne(e,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Ne(e,t[r].delimiters)}};function Pe(e,r){var t,n,s,o,i,a;for(t=r.length-1;t>=0;t--)95!==(n=r[t]).marker&&42!==n.marker||-1!==n.end&&(s=r[n.end],a=t>0&&r[t-1].end===n.end+1&&r[t-1].marker===n.marker&&r[t-1].token===n.token-1&&r[n.end+1].token===s.token+1,i=String.fromCharCode(n.marker),(o=e.tokens[n.token]).type=a?"strong_open":"em_open",o.tag=a?"strong":"em",o.nesting=1,o.markup=a?i+i:i,o.content="",(o=e.tokens[s.token]).type=a?"strong_close":"em_close",o.tag=a?"strong":"em",o.nesting=-1,o.markup=a?i+i:i,o.content="",a&&(e.tokens[r[t-1].token].content="",e.tokens[r[n.end+1].token].content="",t--))}var je={tokenize:function(e,r){var t,n,s=e.pos,o=e.src.charCodeAt(s);if(r)return!1;if(95!==o&&42!==o)return!1;for(n=e.scanDelims(e.pos,42===o),t=0;t<n.length;t++)e.push("text","",0).content=String.fromCharCode(o),e.delimiters.push({marker:o,length:n.length,token:e.tokens.length-1,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},postProcess:function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Pe(e,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Pe(e,t[r].delimiters)}},Ue=w.normalizeReference,Ve=w.isSpace,Ze=w.normalizeReference,Ge=w.isSpace,$e=/^([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)$/,He=/^([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)$/,Je=Ae.HTML_TAG_RE;var We=w.has,Ye=w.isValidEntityCode,Ke=w.fromCodePoint,Qe=/^&#((?:x[a-f0-9]{1,6}|[0-9]{1,7}));/i,Xe=/^&([a-z][a-z0-9]{1,31});/i;function er(e,r){var t,n,s,o,i,a,c,l,u={},p=r.length;if(p){var h=0,f=-2,d=[];for(t=0;t<p;t++)if(s=r[t],d.push(0),r[h].marker===s.marker&&f===s.token-1||(h=t),f=s.token,s.length=s.length||0,s.close){for(u.hasOwnProperty(s.marker)||(u[s.marker]=[-1,-1,-1,-1,-1,-1]),i=u[s.marker][(s.open?3:0)+s.length%3],a=n=h-d[h]-1;n>i;n-=d[n]+1)if((o=r[n]).marker===s.marker&&o.open&&o.end<0&&(c=!1,(o.close||s.open)&&(o.length+s.length)%3==0&&(o.length%3==0&&s.length%3==0||(c=!0)),!c)){l=n>0&&!r[n-1].open?d[n-1]+1:0,d[t]=t-n+l,d[n]=l,s.open=!1,o.end=t,o.close=!1,a=-1,f=-2;break}-1!==a&&(u[s.marker][(s.open?3:0)+(s.length||0)%3]=a)}}}var rr=w.isWhiteSpace,tr=w.isPunctChar,nr=w.isMdAsciiPunct;function sr(e,r,t,n){this.src=e,this.env=t,this.md=r,this.tokens=n,this.tokens_meta=Array(n.length),this.pos=0,this.posMax=this.src.length,this.level=0,this.pending="",this.pendingLevel=0,this.cache={},this.delimiters=[],this._prev_delimiters=[],this.backticks={},this.backticksScanned=!1}sr.prototype.pushPending=function(){var e=new oe("text","",0);return e.content=this.pending,e.level=this.pendingLevel,this.tokens.push(e),this.pending="",e},sr.prototype.push=function(e,r,t){this.pending&&this.pushPending();var n=new oe(e,r,t),s=null;return t<0&&(this.level--,this.delimiters=this._prev_delimiters.pop()),n.level=this.level,t>0&&(this.level++,this._prev_delimiters.push(this.delimiters),this.delimiters=[],s={delimiters:this.delimiters}),this.pendingLevel=this.level,this.tokens.push(n),this.tokens_meta.push(s),n},sr.prototype.scanDelims=function(e,r){var t,n,s,o,i,a,c,l,u,p=e,h=!0,f=!0,d=this.posMax,m=this.src.charCodeAt(e);for(t=e>0?this.src.charCodeAt(e-1):32;p<d&&this.src.charCodeAt(p)===m;)p++;return s=p-e,n=p<d?this.src.charCodeAt(p):32,c=nr(t)||tr(String.fromCharCode(t)),u=nr(n)||tr(String.fromCharCode(n)),a=rr(t),(l=rr(n))?h=!1:u&&(a||c||(h=!1)),a?f=!1:c&&(l||u||(f=!1)),r?(o=h,i=f):(o=h&&(!f||c),i=f&&(!h||u)),{can_open:o,can_close:i,length:s}},sr.prototype.Token=oe;var or=sr,ir=[["text",function(e,r){for(var t=e.pos;t<e.posMax&&!Te(e.src.charCodeAt(t));)t++;return t!==e.pos&&(r||(e.pending+=e.src.slice(e.pos,t)),e.pos=t,!0)}],["newline",function(e,r){var t,n,s,o=e.pos;if(10!==e.src.charCodeAt(o))return!1;if(t=e.pending.length-1,n=e.posMax,!r)if(t>=0&&32===e.pending.charCodeAt(t))if(t>=1&&32===e.pending.charCodeAt(t-1)){for(s=t-1;s>=1&&32===e.pending.charCodeAt(s-1);)s--;e.pending=e.pending.slice(0,s),e.push("hardbreak","br",0)}else e.pending=e.pending.slice(0,-1),e.push("softbreak","br",0);else e.push("softbreak","br",0);for(o++;o<n&&Ie(e.src.charCodeAt(o));)o++;return e.pos=o,!0}],["escape",function(e,r){var t,n=e.pos,s=e.posMax;if(92!==e.src.charCodeAt(n))return!1;if(++n<s){if((t=e.src.charCodeAt(n))<256&&0!==Re[t])return r||(e.pending+=e.src[n]),e.pos+=2,!0;if(10===t){for(r||e.push("hardbreak","br",0),n++;n<s&&(t=e.src.charCodeAt(n),Me(t));)n++;return e.pos=n,!0}}return r||(e.pending+="\\"),e.pos++,!0}],["backticks",function(e,r){var t,n,s,o,i,a,c,l,u=e.pos;if(96!==e.src.charCodeAt(u))return!1;for(t=u,u++,n=e.posMax;u<n&&96===e.src.charCodeAt(u);)u++;if(c=(s=e.src.slice(t,u)).length,e.backticksScanned&&(e.backticks[c]||0)<=t)return r||(e.pending+=s),e.pos+=c,!0;for(i=a=u;-1!==(i=e.src.indexOf("`",a));){for(a=i+1;a<n&&96===e.src.charCodeAt(a);)a++;if((l=a-i)===c)return r||((o=e.push("code_inline","code",0)).markup=s,o.content=e.src.slice(u,i).replace(/\n/g," ").replace(/^ (.+) $/,"$1")),e.pos=a,!0;e.backticks[l]=i}return e.backticksScanned=!0,r||(e.pending+=s),e.pos+=c,!0}],["strikethrough",Oe.tokenize],["emphasis",je.tokenize],["link",function(e,r){var t,n,s,o,i,a,c,l,u="",p="",h=e.pos,f=e.posMax,d=e.pos,m=!0;if(91!==e.src.charCodeAt(e.pos))return!1;if(i=e.pos+1,(o=e.md.helpers.parseLinkLabel(e,e.pos,!0))<0)return!1;if((a=o+1)<f&&40===e.src.charCodeAt(a)){for(m=!1,a++;a<f&&(n=e.src.charCodeAt(a),Ve(n)||10===n);a++);if(a>=f)return!1;if(d=a,(c=e.md.helpers.parseLinkDestination(e.src,a,e.posMax)).ok){for(u=e.md.normalizeLink(c.str),e.md.validateLink(u)?a=c.pos:u="",d=a;a<f&&(n=e.src.charCodeAt(a),Ve(n)||10===n);a++);if(c=e.md.helpers.parseLinkTitle(e.src,a,e.posMax),a<f&&d!==a&&c.ok)for(p=c.str,a=c.pos;a<f&&(n=e.src.charCodeAt(a),Ve(n)||10===n);a++);}(a>=f||41!==e.src.charCodeAt(a))&&(m=!0),a++}if(m){if(void 0===e.env.references)return!1;if(a<f&&91===e.src.charCodeAt(a)?(d=a+1,(a=e.md.helpers.parseLinkLabel(e,a))>=0?s=e.src.slice(d,a++):a=o+1):a=o+1,s||(s=e.src.slice(i,o)),!(l=e.env.references[Ue(s)]))return e.pos=h,!1;u=l.href,p=l.title}return r||(e.pos=i,e.posMax=o,e.push("link_open","a",1).attrs=t=[["href",u]],p&&t.push(["title",p]),e.md.inline.tokenize(e),e.push("link_close","a",-1)),e.pos=a,e.posMax=f,!0}],["image",function(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m="",g=e.pos,_=e.posMax;if(33!==e.src.charCodeAt(e.pos))return!1;if(91!==e.src.charCodeAt(e.pos+1))return!1;if(a=e.pos+2,(i=e.md.helpers.parseLinkLabel(e,e.pos+1,!1))<0)return!1;if((c=i+1)<_&&40===e.src.charCodeAt(c)){for(c++;c<_&&(n=e.src.charCodeAt(c),Ge(n)||10===n);c++);if(c>=_)return!1;for(d=c,(u=e.md.helpers.parseLinkDestination(e.src,c,e.posMax)).ok&&(m=e.md.normalizeLink(u.str),e.md.validateLink(m)?c=u.pos:m=""),d=c;c<_&&(n=e.src.charCodeAt(c),Ge(n)||10===n);c++);if(u=e.md.helpers.parseLinkTitle(e.src,c,e.posMax),c<_&&d!==c&&u.ok)for(p=u.str,c=u.pos;c<_&&(n=e.src.charCodeAt(c),Ge(n)||10===n);c++);else p="";if(c>=_||41!==e.src.charCodeAt(c))return e.pos=g,!1;c++}else{if(void 0===e.env.references)return!1;if(c<_&&91===e.src.charCodeAt(c)?(d=c+1,(c=e.md.helpers.parseLinkLabel(e,c))>=0?o=e.src.slice(d,c++):c=i+1):c=i+1,o||(o=e.src.slice(a,i)),!(l=e.env.references[Ze(o)]))return e.pos=g,!1;m=l.href,p=l.title}return r||(s=e.src.slice(a,i),e.md.inline.parse(s,e.md,e.env,f=[]),(h=e.push("image","img",0)).attrs=t=[["src",m],["alt",""]],h.children=f,h.content=s,p&&t.push(["title",p])),e.pos=c,e.posMax=_,!0}],["autolink",function(e,r){var t,n,s,o,i,a,c=e.pos;if(60!==e.src.charCodeAt(c))return!1;for(i=e.pos,a=e.posMax;;){if(++c>=a)return!1;if(60===(o=e.src.charCodeAt(c)))return!1;if(62===o)break}return t=e.src.slice(i+1,c),He.test(t)?(n=e.md.normalizeLink(t),!!e.md.validateLink(n)&&(r||((s=e.push("link_open","a",1)).attrs=[["href",n]],s.markup="autolink",s.info="auto",(s=e.push("text","",0)).content=e.md.normalizeLinkText(t),(s=e.push("link_close","a",-1)).markup="autolink",s.info="auto"),e.pos+=t.length+2,!0)):!!$e.test(t)&&(n=e.md.normalizeLink("mailto:"+t),!!e.md.validateLink(n)&&(r||((s=e.push("link_open","a",1)).attrs=[["href",n]],s.markup="autolink",s.info="auto",(s=e.push("text","",0)).content=e.md.normalizeLinkText(t),(s=e.push("link_close","a",-1)).markup="autolink",s.info="auto"),e.pos+=t.length+2,!0))}],["html_inline",function(e,r){var t,n,s,o=e.pos;return!!e.md.options.html&&(s=e.posMax,!(60!==e.src.charCodeAt(o)||o+2>=s)&&(!(33!==(t=e.src.charCodeAt(o+1))&&63!==t&&47!==t&&!function(e){var r=32|e;return r>=97&&r<=122}(t))&&(!!(n=e.src.slice(o).match(Je))&&(r||(e.push("html_inline","",0).content=e.src.slice(o,o+n[0].length)),e.pos+=n[0].length,!0))))}],["entity",function(e,t){var n,s,o=e.pos,i=e.posMax;if(38!==e.src.charCodeAt(o))return!1;if(o+1<i)if(35===e.src.charCodeAt(o+1)){if(s=e.src.slice(o).match(Qe))return t||(n="x"===s[1][0].toLowerCase()?parseInt(s[1].slice(1),16):parseInt(s[1],10),e.pending+=Ye(n)?Ke(n):Ke(65533)),e.pos+=s[0].length,!0}else if((s=e.src.slice(o).match(Xe))&&We(r,s[1]))return t||(e.pending+=r[s[1]]),e.pos+=s[0].length,!0;return t||(e.pending+="&"),e.pos++,!0}]],ar=[["balance_pairs",function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(er(0,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&er(0,t[r].delimiters)}],["strikethrough",Oe.postProcess],["emphasis",je.postProcess],["text_collapse",function(e){var r,t,n=0,s=e.tokens,o=e.tokens.length;for(r=t=0;r<o;r++)s[r].nesting<0&&n--,s[r].level=n,s[r].nesting>0&&n++,"text"===s[r].type&&r+1<o&&"text"===s[r+1].type?s[r+1].content=s[r].content+s[r+1].content:(r!==t&&(s[t]=s[r]),t++);r!==t&&(s.length=t)}]];function cr(){var e;for(this.ruler=new O,e=0;e<ir.length;e++)this.ruler.push(ir[e][0],ir[e][1]);for(this.ruler2=new O,e=0;e<ar.length;e++)this.ruler2.push(ar[e][0],ar[e][1])}cr.prototype.skipToken=function(e){var r,t,n=e.pos,s=this.ruler.getRules(""),o=s.length,i=e.md.options.maxNesting,a=e.cache;if(void 0===a[n]){if(e.level<i)for(t=0;t<o&&(e.level++,r=s[t](e,!0),e.level--,!r);t++);else e.pos=e.posMax;r||e.pos++,a[n]=e.pos}else e.pos=a[n]},cr.prototype.tokenize=function(e){for(var r,t,n=this.ruler.getRules(""),s=n.length,o=e.posMax,i=e.md.options.maxNesting;e.pos<o;){if(e.level<i)for(t=0;t<s&&!(r=n[t](e,!1));t++);if(r){if(e.pos>=o)break}else e.pending+=e.src[e.pos++]}e.pending&&e.pushPending()},cr.prototype.parse=function(e,r,t,n){var s,o,i,a=new this.State(e,r,t,n);for(this.tokenize(a),i=(o=this.ruler2.getRules("")).length,s=0;s<i;s++)o[s](a)},cr.prototype.State=or;var lr=cr;function ur(e){var r=Array.prototype.slice.call(arguments,1);return r.forEach((function(r){r&&Object.keys(r).forEach((function(t){e[t]=r[t]}))})),e}function pr(e){return Object.prototype.toString.call(e)}function hr(e){return"[object Function]"===pr(e)}function fr(e){return e.replace(/[.?*+^$[\]\\(){}|-]/g,"\\$&")}var dr={fuzzyLink:!0,fuzzyEmail:!0,fuzzyIP:!1};var mr={"http:":{validate:function(e,r,t){var n=e.slice(r);return t.re.http||(t.re.http=new RegExp("^\\/\\/"+t.re.src_auth+t.re.src_host_port_strict+t.re.src_path,"i")),t.re.http.test(n)?n.match(t.re.http)[0].length:0}},"https:":"http:","ftp:":"http:","//":{validate:function(e,r,t){var n=e.slice(r);return t.re.no_http||(t.re.no_http=new RegExp("^"+t.re.src_auth+"(?:localhost|(?:(?:"+t.re.src_domain+")\\.)+"+t.re.src_domain_root+")"+t.re.src_port+t.re.src_host_terminator+t.re.src_path,"i")),t.re.no_http.test(n)?r>=3&&":"===e[r-3]||r>=3&&"/"===e[r-3]?0:n.match(t.re.no_http)[0].length:0}},"mailto:":{validate:function(e,r,t){var n=e.slice(r);return t.re.mailto||(t.re.mailto=new RegExp("^"+t.re.src_email_name+"@"+t.re.src_host_strict,"i")),t.re.mailto.test(n)?n.match(t.re.mailto)[0].length:0}}},gr="biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|\u0440\u0444".split("|");function _r(e){var r=e.re=function(e){var r={};return r.src_Any=y.source,r.src_Cc=A.source,r.src_Z=x.source,r.src_P=t.source,r.src_ZPCc=[r.src_Z,r.src_P,r.src_Cc].join("|"),r.src_ZCc=[r.src_Z,r.src_Cc].join("|"),r.src_pseudo_letter="(?:(?![><\uff5c]|"+r.src_ZPCc+")"+r.src_Any+")",r.src_ip4="(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)",r.src_auth="(?:(?:(?!"+r.src_ZCc+"|[@/\\[\\]()]).)+@)?",r.src_port="(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?",r.src_host_terminator="(?=$|[><\uff5c]|"+r.src_ZPCc+")(?!-|_|:\\d|\\.-|\\.(?!$|"+r.src_ZPCc+"))",r.src_path="(?:[/?#](?:(?!"+r.src_ZCc+"|[><\uff5c]|[()[\\]{}.,\"'?!\\-;]).|\\[(?:(?!"+r.src_ZCc+"|\\]).)*\\]|\\((?:(?!"+r.src_ZCc+"|[)]).)*\\)|\\{(?:(?!"+r.src_ZCc+'|[}]).)*\\}|\\"(?:(?!'+r.src_ZCc+'|["]).)+\\"|\\\'(?:(?!'+r.src_ZCc+"|[']).)+\\'|\\'(?="+r.src_pseudo_letter+"|[-]).|\\.{2,}[a-zA-Z0-9%/&]|\\.(?!"+r.src_ZCc+"|[.]).|"+(e&&e["---"]?"\\-(?!--(?:[^-]|$))(?:-*)|":"\\-+|")+",(?!"+r.src_ZCc+").|;(?!"+r.src_ZCc+").|\\!+(?!"+r.src_ZCc+"|[!]).|\\?(?!"+r.src_ZCc+"|[?]).)+|\\/)?",r.src_email_name='[\\-;:&=\\+\\$,\\.a-zA-Z0-9_][\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]*',r.src_xn="xn--[a-z0-9\\-]{1,59}",r.src_domain_root="(?:"+r.src_xn+"|"+r.src_pseudo_letter+"{1,63})",r.src_domain="(?:"+r.src_xn+"|(?:"+r.src_pseudo_letter+")|(?:"+r.src_pseudo_letter+"(?:-|"+r.src_pseudo_letter+"){0,61}"+r.src_pseudo_letter+"))",r.src_host="(?:(?:(?:(?:"+r.src_domain+")\\.)*"+r.src_domain+"))",r.tpl_host_fuzzy="(?:"+r.src_ip4+"|(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%)))",r.tpl_host_no_ip_fuzzy="(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%))",r.src_host_strict=r.src_host+r.src_host_terminator,r.tpl_host_fuzzy_strict=r.tpl_host_fuzzy+r.src_host_terminator,r.src_host_port_strict=r.src_host+r.src_port+r.src_host_terminator,r.tpl_host_port_fuzzy_strict=r.tpl_host_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_port_no_ip_fuzzy_strict=r.tpl_host_no_ip_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_fuzzy_test="localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:"+r.src_ZPCc+"|>|$))",r.tpl_email_fuzzy='(^|[><\uff5c]|"|\\(|'+r.src_ZCc+")("+r.src_email_name+"@"+r.tpl_host_fuzzy_strict+")",r.tpl_link_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_fuzzy_strict+r.src_path+")",r.tpl_link_no_ip_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_no_ip_fuzzy_strict+r.src_path+")",r}(e.__opts__),n=e.__tlds__.slice();function s(e){return e.replace("%TLDS%",r.src_tlds)}e.onCompile(),e.__tlds_replaced__||n.push("a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]"),n.push(r.src_xn),r.src_tlds=n.join("|"),r.email_fuzzy=RegExp(s(r.tpl_email_fuzzy),"i"),r.link_fuzzy=RegExp(s(r.tpl_link_fuzzy),"i"),r.link_no_ip_fuzzy=RegExp(s(r.tpl_link_no_ip_fuzzy),"i"),r.host_fuzzy_test=RegExp(s(r.tpl_host_fuzzy_test),"i");var o=[];function i(e,r){throw new Error('(LinkifyIt) Invalid schema "'+e+'": '+r)}e.__compiled__={},Object.keys(e.__schemas__).forEach((function(r){var t=e.__schemas__[r];if(null!==t){var n={validate:null,link:null};if(e.__compiled__[r]=n,"[object Object]"===pr(t))return!function(e){return"[object RegExp]"===pr(e)}(t.validate)?hr(t.validate)?n.validate=t.validate:i(r,t):n.validate=function(e){return function(r,t){var n=r.slice(t);return e.test(n)?n.match(e)[0].length:0}}(t.validate),void(hr(t.normalize)?n.normalize=t.normalize:t.normalize?i(r,t):n.normalize=function(e,r){r.normalize(e)});!function(e){return"[object String]"===pr(e)}(t)?i(r,t):o.push(r)}})),o.forEach((function(r){e.__compiled__[e.__schemas__[r]]&&(e.__compiled__[r].validate=e.__compiled__[e.__schemas__[r]].validate,e.__compiled__[r].normalize=e.__compiled__[e.__schemas__[r]].normalize)})),e.__compiled__[""]={validate:null,normalize:function(e,r){r.normalize(e)}};var a=Object.keys(e.__compiled__).filter((function(r){return r.length>0&&e.__compiled__[r]})).map(fr).join("|");e.re.schema_test=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","i"),e.re.schema_search=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","ig"),e.re.pretest=RegExp("("+e.re.schema_test.source+")|("+e.re.host_fuzzy_test.source+")|@","i"),function(e){e.__index__=-1,e.__text_cache__=""}(e)}function kr(e,r){var t=e.__index__,n=e.__last_index__,s=e.__text_cache__.slice(t,n);this.schema=e.__schema__.toLowerCase(),this.index=t+r,this.lastIndex=n+r,this.raw=s,this.text=s,this.url=s}function br(e,r){var t=new kr(e,r);return e.__compiled__[t.schema].normalize(t,e),t}function vr(e,r){if(!(this instanceof vr))return new vr(e,r);var t;r||(t=e,Object.keys(t||{}).reduce((function(e,r){return e||dr.hasOwnProperty(r)}),!1)&&(r=e,e={})),this.__opts__=ur({},dr,r),this.__index__=-1,this.__last_index__=-1,this.__schema__="",this.__text_cache__="",this.__schemas__=ur({},mr,e),this.__compiled__={},this.__tlds__=gr,this.__tlds_replaced__=!1,this.re={},_r(this)}vr.prototype.add=function(e,r){return this.__schemas__[e]=r,_r(this),this},vr.prototype.set=function(e){return this.__opts__=ur(this.__opts__,e),this},vr.prototype.test=function(e){if(this.__text_cache__=e,this.__index__=-1,!e.length)return!1;var r,t,n,s,o,i,a,c;if(this.re.schema_test.test(e))for((a=this.re.schema_search).lastIndex=0;null!==(r=a.exec(e));)if(s=this.testSchemaAt(e,r[2],a.lastIndex)){this.__schema__=r[2],this.__index__=r.index+r[1].length,this.__last_index__=r.index+r[0].length+s;break}return this.__opts__.fuzzyLink&&this.__compiled__["http:"]&&(c=e.search(this.re.host_fuzzy_test))>=0&&(this.__index__<0||c<this.__index__)&&null!==(t=e.match(this.__opts__.fuzzyIP?this.re.link_fuzzy:this.re.link_no_ip_fuzzy))&&(o=t.index+t[1].length,(this.__index__<0||o<this.__index__)&&(this.__schema__="",this.__index__=o,this.__last_index__=t.index+t[0].length)),this.__opts__.fuzzyEmail&&this.__compiled__["mailto:"]&&e.indexOf("@")>=0&&null!==(n=e.match(this.re.email_fuzzy))&&(o=n.index+n[1].length,i=n.index+n[0].length,(this.__index__<0||o<this.__index__||o===this.__index__&&i>this.__last_index__)&&(this.__schema__="mailto:",this.__index__=o,this.__last_index__=i)),this.__index__>=0},vr.prototype.pretest=function(e){return this.re.pretest.test(e)},vr.prototype.testSchemaAt=function(e,r,t){return this.__compiled__[r.toLowerCase()]?this.__compiled__[r.toLowerCase()].validate(e,t,this):0},vr.prototype.match=function(e){var r=0,t=[];this.__index__>=0&&this.__text_cache__===e&&(t.push(br(this,r)),r=this.__last_index__);for(var n=r?e.slice(r):e;this.test(n);)t.push(br(this,r)),n=n.slice(this.__last_index__),r+=this.__last_index__;return t.length?t:null},vr.prototype.tlds=function(e,r){return e=Array.isArray(e)?e:[e],r?(this.__tlds__=this.__tlds__.concat(e).sort().filter((function(e,r,t){return e!==t[r-1]})).reverse(),_r(this),this):(this.__tlds__=e.slice(),this.__tlds_replaced__=!0,_r(this),this)},vr.prototype.normalize=function(e){e.schema||(e.url="http://"+e.url),"mailto:"!==e.schema||/^mailto:/i.test(e.url)||(e.url="mailto:"+e.url)},vr.prototype.onCompile=function(){};var Cr=vr,yr=2147483647,Ar=36,xr=/^xn--/,Dr=/[^\x20-\x7E]/,wr=/[\x2E\u3002\uFF0E\uFF61]/g,Er={overflow:"Overflow: input needs wider integers to process","not-basic":"Illegal input >= 0x80 (not a basic code point)","invalid-input":"Invalid input"},qr=Math.floor,Sr=String.fromCharCode; +/*! https://mths.be/punycode v1.4.1 by @mathias */function Fr(e){throw new RangeError(Er[e])}function Lr(e,r){for(var t=e.length,n=[];t--;)n[t]=r(e[t]);return n}function zr(e,r){var t=e.split("@"),n="";return t.length>1&&(n=t[0]+"@",e=t[1]),n+Lr((e=e.replace(wr,".")).split("."),r).join(".")}function Tr(e){for(var r,t,n=[],s=0,o=e.length;s<o;)(r=e.charCodeAt(s++))>=55296&&r<=56319&&s<o?56320==(64512&(t=e.charCodeAt(s++)))?n.push(((1023&r)<<10)+(1023&t)+65536):(n.push(r),s--):n.push(r);return n}function Ir(e){return Lr(e,(function(e){var r="";return e>65535&&(r+=Sr((e-=65536)>>>10&1023|55296),e=56320|1023&e),r+=Sr(e)})).join("")}function Mr(e,r){return e+22+75*(e<26)-((0!=r)<<5)}function Rr(e,r,t){var n=0;for(e=t?qr(e/700):e>>1,e+=qr(e/r);e>455;n+=Ar)e=qr(e/35);return qr(n+36*e/(e+38))}function Br(e){var r,t,n,s,o,i,a,c,l,u,p,h=[],f=e.length,d=0,m=128,g=72;for((t=e.lastIndexOf("-"))<0&&(t=0),n=0;n<t;++n)e.charCodeAt(n)>=128&&Fr("not-basic"),h.push(e.charCodeAt(n));for(s=t>0?t+1:0;s<f;){for(o=d,i=1,a=Ar;s>=f&&Fr("invalid-input"),((c=(p=e.charCodeAt(s++))-48<10?p-22:p-65<26?p-65:p-97<26?p-97:Ar)>=Ar||c>qr((yr-d)/i))&&Fr("overflow"),d+=c*i,!(c<(l=a<=g?1:a>=g+26?26:a-g));a+=Ar)i>qr(yr/(u=Ar-l))&&Fr("overflow"),i*=u;g=Rr(d-o,r=h.length+1,0==o),qr(d/r)>yr-m&&Fr("overflow"),m+=qr(d/r),d%=r,h.splice(d++,0,m)}return Ir(h)}function Nr(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,g=[];for(h=(e=Tr(e)).length,r=128,t=0,o=72,i=0;i<h;++i)(p=e[i])<128&&g.push(Sr(p));for(n=s=g.length,s&&g.push("-");n<h;){for(a=yr,i=0;i<h;++i)(p=e[i])>=r&&p<a&&(a=p);for(a-r>qr((yr-t)/(f=n+1))&&Fr("overflow"),t+=(a-r)*f,r=a,i=0;i<h;++i)if((p=e[i])<r&&++t>yr&&Fr("overflow"),p==r){for(c=t,l=Ar;!(c<(u=l<=o?1:l>=o+26?26:l-o));l+=Ar)m=c-u,d=Ar-u,g.push(Sr(Mr(u+m%d,0))),c=qr(m/d);g.push(Sr(Mr(c,0))),o=Rr(t,f,n==s),t=0,++n}++t,++r}return g.join("")}function Or(e){return zr(e,(function(e){return xr.test(e)?Br(e.slice(4).toLowerCase()):e}))}function Pr(e){return zr(e,(function(e){return Dr.test(e)?"xn--"+Nr(e):e}))}var jr="1.4.1",Ur={decode:Tr,encode:Ir},Vr={version:jr,ucs2:Ur,toASCII:Pr,toUnicode:Or,encode:Nr,decode:Br},Zr=e(Object.freeze({__proto__:null,decode:Br,encode:Nr,toUnicode:Or,toASCII:Pr,version:jr,ucs2:Ur,default:Vr})),Gr={default:{options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:100},components:{core:{},block:{},inline:{}}},zero:{options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["paragraph"]},inline:{rules:["text"],rules2:["balance_pairs","text_collapse"]}}},commonmark:{options:{html:!0,xhtmlOut:!0,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["blockquote","code","fence","heading","hr","html_block","lheading","list","reference","paragraph"]},inline:{rules:["autolink","backticks","emphasis","entity","escape","html_inline","image","link","newline","text"],rules2:["balance_pairs","emphasis","text_collapse"]}}}},$r=/^(vbscript|javascript|file|data):/,Hr=/^data:image\/(gif|png|jpeg|webp);/;function Jr(e){var r=e.trim().toLowerCase();return!$r.test(r)||!!Hr.test(r)}var Wr=["http:","https:","mailto:"];function Yr(e){var r=C.parse(e,!0);if(r.hostname&&(!r.protocol||Wr.indexOf(r.protocol)>=0))try{r.hostname=Zr.toASCII(r.hostname)}catch(e){}return C.encode(C.format(r))}function Kr(e){var r=C.parse(e,!0);if(r.hostname&&(!r.protocol||Wr.indexOf(r.protocol)>=0))try{r.hostname=Zr.toUnicode(r.hostname)}catch(e){}return C.decode(C.format(r),C.decode.defaultChars+"%")}function Qr(e,r){if(!(this instanceof Qr))return new Qr(e,r);r||w.isString(e)||(r=e||{},e="default"),this.inline=new lr,this.block=new ze,this.core=new ue,this.renderer=new B,this.linkify=new Cr,this.validateLink=Jr,this.normalizeLink=Yr,this.normalizeLinkText=Kr,this.utils=w,this.helpers=w.assign({},L),this.options={},this.configure(e),r&&this.set(r)}return Qr.prototype.set=function(e){return w.assign(this.options,e),this},Qr.prototype.configure=function(e){var r,t=this;if(w.isString(e)&&!(e=Gr[r=e]))throw new Error('Wrong `markdown-it` preset "'+r+'", check name');if(!e)throw new Error("Wrong `markdown-it` preset, can't be empty");return e.options&&t.set(e.options),e.components&&Object.keys(e.components).forEach((function(r){e.components[r].rules&&t[r].ruler.enableOnly(e.components[r].rules),e.components[r].rules2&&t[r].ruler2.enableOnly(e.components[r].rules2)})),this},Qr.prototype.enable=function(e,r){var t=[];Array.isArray(e)||(e=[e]),["core","block","inline"].forEach((function(r){t=t.concat(this[r].ruler.enable(e,!0))}),this),t=t.concat(this.inline.ruler2.enable(e,!0));var n=e.filter((function(e){return t.indexOf(e)<0}));if(n.length&&!r)throw new Error("MarkdownIt. Failed to enable unknown rule(s): "+n);return this},Qr.prototype.disable=function(e,r){var t=[];Array.isArray(e)||(e=[e]),["core","block","inline"].forEach((function(r){t=t.concat(this[r].ruler.disable(e,!0))}),this),t=t.concat(this.inline.ruler2.disable(e,!0));var n=e.filter((function(e){return t.indexOf(e)<0}));if(n.length&&!r)throw new Error("MarkdownIt. Failed to disable unknown rule(s): "+n);return this},Qr.prototype.use=function(e){var r=[this].concat(Array.prototype.slice.call(arguments,1));return e.apply(e,r),this},Qr.prototype.parse=function(e,r){if("string"!=typeof e)throw new Error("Input data should be a String");var t=new this.core.State(e,this,r);return this.core.process(t),t.tokens},Qr.prototype.render=function(e,r){return r=r||{},this.renderer.render(this.parse(e,r),this.options,r)},Qr.prototype.parseInline=function(e,r){var t=new this.core.State(e,this,r);return t.inlineMode=!0,this.core.process(t),t.tokens},Qr.prototype.renderInline=function(e,r){return r=r||{},this.renderer.render(this.parseInline(e,r),this.options,r)},Qr})); |