summaryrefslogtreecommitdiff
path: root/node_modules/markdown-it
diff options
context:
space:
mode:
Diffstat (limited to 'node_modules/markdown-it')
-rw-r--r--node_modules/markdown-it/LICENSE22
-rw-r--r--node_modules/markdown-it/README.md307
-rw-r--r--node_modules/markdown-it/bin/markdown-it.js117
-rw-r--r--node_modules/markdown-it/dist/markdown-it.js8356
-rw-r--r--node_modules/markdown-it/dist/markdown-it.min.js3
-rw-r--r--node_modules/markdown-it/index.js4
-rw-r--r--node_modules/markdown-it/lib/common/entities.js6
-rw-r--r--node_modules/markdown-it/lib/common/html_blocks.js70
-rw-r--r--node_modules/markdown-it/lib/common/html_re.js28
-rw-r--r--node_modules/markdown-it/lib/common/utils.js317
-rw-r--r--node_modules/markdown-it/lib/helpers/index.js7
-rw-r--r--node_modules/markdown-it/lib/helpers/parse_link_destination.js82
-rw-r--r--node_modules/markdown-it/lib/helpers/parse_link_label.js48
-rw-r--r--node_modules/markdown-it/lib/helpers/parse_link_title.js55
-rw-r--r--node_modules/markdown-it/lib/index.js582
-rw-r--r--node_modules/markdown-it/lib/parser_block.js122
-rw-r--r--node_modules/markdown-it/lib/parser_core.js58
-rw-r--r--node_modules/markdown-it/lib/parser_inline.js177
-rw-r--r--node_modules/markdown-it/lib/presets/commonmark.js80
-rw-r--r--node_modules/markdown-it/lib/presets/default.js41
-rw-r--r--node_modules/markdown-it/lib/presets/zero.js62
-rw-r--r--node_modules/markdown-it/lib/renderer.js341
-rw-r--r--node_modules/markdown-it/lib/ruler.js352
-rw-r--r--node_modules/markdown-it/lib/rules_block/blockquote.js284
-rw-r--r--node_modules/markdown-it/lib/rules_block/code.js34
-rw-r--r--node_modules/markdown-it/lib/rules_block/fence.js98
-rw-r--r--node_modules/markdown-it/lib/rules_block/heading.js55
-rw-r--r--node_modules/markdown-it/lib/rules_block/hr.js45
-rw-r--r--node_modules/markdown-it/lib/rules_block/html_block.js74
-rw-r--r--node_modules/markdown-it/lib/rules_block/lheading.js83
-rw-r--r--node_modules/markdown-it/lib/rules_block/list.js364
-rw-r--r--node_modules/markdown-it/lib/rules_block/paragraph.js52
-rw-r--r--node_modules/markdown-it/lib/rules_block/reference.js198
-rw-r--r--node_modules/markdown-it/lib/rules_block/state_block.js231
-rw-r--r--node_modules/markdown-it/lib/rules_block/table.js221
-rw-r--r--node_modules/markdown-it/lib/rules_core/block.js16
-rw-r--r--node_modules/markdown-it/lib/rules_core/inline.js13
-rw-r--r--node_modules/markdown-it/lib/rules_core/linkify.js133
-rw-r--r--node_modules/markdown-it/lib/rules_core/normalize.js21
-rw-r--r--node_modules/markdown-it/lib/rules_core/replacements.js107
-rw-r--r--node_modules/markdown-it/lib/rules_core/smartquotes.js201
-rw-r--r--node_modules/markdown-it/lib/rules_core/state_core.js20
-rw-r--r--node_modules/markdown-it/lib/rules_inline/autolink.js76
-rw-r--r--node_modules/markdown-it/lib/rules_inline/backticks.js63
-rw-r--r--node_modules/markdown-it/lib/rules_inline/balance_pairs.js130
-rw-r--r--node_modules/markdown-it/lib/rules_inline/emphasis.js130
-rw-r--r--node_modules/markdown-it/lib/rules_inline/entity.js48
-rw-r--r--node_modules/markdown-it/lib/rules_inline/escape.js52
-rw-r--r--node_modules/markdown-it/lib/rules_inline/html_inline.js47
-rw-r--r--node_modules/markdown-it/lib/rules_inline/image.js152
-rw-r--r--node_modules/markdown-it/lib/rules_inline/link.js148
-rw-r--r--node_modules/markdown-it/lib/rules_inline/newline.js46
-rw-r--r--node_modules/markdown-it/lib/rules_inline/state_inline.js154
-rw-r--r--node_modules/markdown-it/lib/rules_inline/strikethrough.js130
-rw-r--r--node_modules/markdown-it/lib/rules_inline/text.js89
-rw-r--r--node_modules/markdown-it/lib/rules_inline/text_collapse.js41
-rw-r--r--node_modules/markdown-it/lib/token.js201
-rw-r--r--node_modules/markdown-it/package.json87
58 files changed, 15081 insertions, 0 deletions
diff --git a/node_modules/markdown-it/LICENSE b/node_modules/markdown-it/LICENSE
new file mode 100644
index 0000000..7ffa058
--- /dev/null
+++ b/node_modules/markdown-it/LICENSE
@@ -0,0 +1,22 @@
+Copyright (c) 2014 Vitaly Puzrin, Alex Kocharin.
+
+Permission is hereby granted, free of charge, to any person
+obtaining a copy of this software and associated documentation
+files (the "Software"), to deal in the Software without
+restriction, including without limitation the rights to use,
+copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the
+Software is furnished to do so, subject to the following
+conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
+OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT
+HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR
+OTHER DEALINGS IN THE SOFTWARE.
diff --git a/node_modules/markdown-it/README.md b/node_modules/markdown-it/README.md
new file mode 100644
index 0000000..0e866de
--- /dev/null
+++ b/node_modules/markdown-it/README.md
@@ -0,0 +1,307 @@
+# markdown-it <!-- omit in toc -->
+
+[![CI](https://github.com/markdown-it/markdown-it/workflows/CI/badge.svg)](https://github.com/markdown-it/markdown-it/actions)
+[![NPM version](https://img.shields.io/npm/v/markdown-it.svg?style=flat)](https://www.npmjs.org/package/markdown-it)
+[![Coverage Status](https://coveralls.io/repos/markdown-it/markdown-it/badge.svg?branch=master&service=github)](https://coveralls.io/github/markdown-it/markdown-it?branch=master)
+[![Gitter](https://badges.gitter.im/Join%20Chat.svg)](https://gitter.im/markdown-it/markdown-it)
+
+> Markdown parser done right. Fast and easy to extend.
+
+__[Live demo](https://markdown-it.github.io)__
+
+- Follows the __[CommonMark spec](http://spec.commonmark.org/)__ + adds syntax extensions & sugar (URL autolinking, typographer).
+- Configurable syntax! You can add new rules and even replace existing ones.
+- High speed.
+- [Safe](https://github.com/markdown-it/markdown-it/tree/master/docs/security.md) by default.
+- Community-written __[plugins](https://www.npmjs.org/browse/keyword/markdown-it-plugin)__ and [other packages](https://www.npmjs.org/browse/keyword/markdown-it) on npm.
+
+__Table of content__
+
+- [Install](#install)
+- [Usage examples](#usage-examples)
+ - [Simple](#simple)
+ - [Init with presets and options](#init-with-presets-and-options)
+ - [Plugins load](#plugins-load)
+ - [Syntax highlighting](#syntax-highlighting)
+ - [Linkify](#linkify)
+- [API](#api)
+- [Syntax extensions](#syntax-extensions)
+ - [Manage rules](#manage-rules)
+- [Benchmark](#benchmark)
+- [markdown-it for enterprise](#markdown-it-for-enterprise)
+- [Authors](#authors)
+- [References / Thanks](#references--thanks)
+
+## Install
+
+**node.js**:
+
+```bash
+npm install markdown-it --save
+```
+
+**browser (CDN):**
+
+- [jsDeliver CDN](http://www.jsdelivr.com/#!markdown-it "jsDelivr CDN")
+- [cdnjs.com CDN](https://cdnjs.com/libraries/markdown-it "cdnjs.com")
+
+
+## Usage examples
+
+See also:
+
+- __[API documentation](https://markdown-it.github.io/markdown-it/)__ - for more
+ info and examples.
+- [Development info](https://github.com/markdown-it/markdown-it/tree/master/docs) -
+ for plugins writers.
+
+
+### Simple
+
+```js
+// node.js, "classic" way:
+var MarkdownIt = require('markdown-it'),
+ md = new MarkdownIt();
+var result = md.render('# markdown-it rulezz!');
+
+// node.js, the same, but with sugar:
+var md = require('markdown-it')();
+var result = md.render('# markdown-it rulezz!');
+
+// browser without AMD, added to "window" on script load
+// Note, there is no dash in "markdownit".
+var md = window.markdownit();
+var result = md.render('# markdown-it rulezz!');
+```
+
+Single line rendering, without paragraph wrap:
+
+```js
+var md = require('markdown-it')();
+var result = md.renderInline('__markdown-it__ rulezz!');
+```
+
+
+### Init with presets and options
+
+(*) presets define combinations of active rules and options. Can be
+`"commonmark"`, `"zero"` or `"default"` (if skipped). See
+[API docs](https://markdown-it.github.io/markdown-it/#MarkdownIt.new) for more details.
+
+```js
+// commonmark mode
+var md = require('markdown-it')('commonmark');
+
+// default mode
+var md = require('markdown-it')();
+
+// enable everything
+var md = require('markdown-it')({
+ html: true,
+ linkify: true,
+ typographer: true
+});
+
+// full options list (defaults)
+var md = require('markdown-it')({
+ html: false, // Enable HTML tags in source
+ xhtmlOut: false, // Use '/' to close single tags (<br />).
+ // This is only for full CommonMark compatibility.
+ breaks: false, // Convert '\n' in paragraphs into <br>
+ langPrefix: 'language-', // CSS language prefix for fenced blocks. Can be
+ // useful for external highlighters.
+ linkify: false, // Autoconvert URL-like text to links
+
+ // Enable some language-neutral replacement + quotes beautification
+ // For the full list of replacements, see https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js
+ typographer: false,
+
+ // Double + single quotes replacement pairs, when typographer enabled,
+ // and smartquotes on. Could be either a String or an Array.
+ //
+ // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+ // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+ quotes: '“”‘’',
+
+ // Highlighter function. Should return escaped HTML,
+ // or '' if the source string is not changed and should be escaped externally.
+ // If result starts with <pre... internal wrapper is skipped.
+ highlight: function (/*str, lang*/) { return ''; }
+});
+```
+
+### Plugins load
+
+```js
+var md = require('markdown-it')()
+ .use(plugin1)
+ .use(plugin2, opts, ...)
+ .use(plugin3);
+```
+
+
+### Syntax highlighting
+
+Apply syntax highlighting to fenced code blocks with the `highlight` option:
+
+```js
+var hljs = require('highlight.js'); // https://highlightjs.org/
+
+// Actual default values
+var md = require('markdown-it')({
+ highlight: function (str, lang) {
+ if (lang && hljs.getLanguage(lang)) {
+ try {
+ return hljs.highlight(str, { language: lang }).value;
+ } catch (__) {}
+ }
+
+ return ''; // use external default escaping
+ }
+});
+```
+
+Or with full wrapper override (if you need assign class to `<pre>`):
+
+```js
+var hljs = require('highlight.js'); // https://highlightjs.org/
+
+// Actual default values
+var md = require('markdown-it')({
+ highlight: function (str, lang) {
+ if (lang && hljs.getLanguage(lang)) {
+ try {
+ return '<pre class="hljs"><code>' +
+ hljs.highlight(str, { language: lang, ignoreIllegals: true }).value +
+ '</code></pre>';
+ } catch (__) {}
+ }
+
+ return '<pre class="hljs"><code>' + md.utils.escapeHtml(str) + '</code></pre>';
+ }
+});
+```
+
+### Linkify
+
+`linkify: true` uses [linkify-it](https://github.com/markdown-it/linkify-it). To
+configure linkify-it, access the linkify instance through `md.linkify`:
+
+```js
+md.linkify.set({ fuzzyEmail: false }); // disables converting email to link
+```
+
+
+## API
+
+__[API documentation](https://markdown-it.github.io/markdown-it/)__
+
+If you are going to write plugins - take a look at
+[Development info](https://github.com/markdown-it/markdown-it/tree/master/docs).
+
+
+## Syntax extensions
+
+Embedded (enabled by default):
+
+- [Tables](https://help.github.com/articles/organizing-information-with-tables/) (GFM)
+- [Strikethrough](https://help.github.com/articles/basic-writing-and-formatting-syntax/#styling-text) (GFM)
+
+Via plugins:
+
+- [subscript](https://github.com/markdown-it/markdown-it-sub)
+- [superscript](https://github.com/markdown-it/markdown-it-sup)
+- [footnote](https://github.com/markdown-it/markdown-it-footnote)
+- [definition list](https://github.com/markdown-it/markdown-it-deflist)
+- [abbreviation](https://github.com/markdown-it/markdown-it-abbr)
+- [emoji](https://github.com/markdown-it/markdown-it-emoji)
+- [custom container](https://github.com/markdown-it/markdown-it-container)
+- [insert](https://github.com/markdown-it/markdown-it-ins)
+- [mark](https://github.com/markdown-it/markdown-it-mark)
+- ... and [others](https://www.npmjs.org/browse/keyword/markdown-it-plugin)
+
+
+### Manage rules
+
+By default all rules are enabled, but can be restricted by options. On plugin
+load all its rules are enabled automatically.
+
+```js
+// Activate/deactivate rules, with curring
+var md = require('markdown-it')()
+ .disable([ 'link', 'image' ])
+ .enable([ 'link' ])
+ .enable('image');
+
+// Enable everything
+md = require('markdown-it')({
+ html: true,
+ linkify: true,
+ typographer: true,
+});
+```
+
+You can find all rules in sources:
+[parser_core.js](lib/parser_core.js), [parser_block](lib/parser_block.js),
+[parser_inline](lib/parser_inline.js).
+
+
+## Benchmark
+
+Here is the result of readme parse at MB Pro Retina 2013 (2.4 GHz):
+
+```bash
+make benchmark-deps
+benchmark/benchmark.js readme
+
+Selected samples: (1 of 28)
+ > README
+
+Sample: README.md (7774 bytes)
+ > commonmark-reference x 1,222 ops/sec ±0.96% (97 runs sampled)
+ > current x 743 ops/sec ±0.84% (97 runs sampled)
+ > current-commonmark x 1,568 ops/sec ±0.84% (98 runs sampled)
+ > marked x 1,587 ops/sec ±4.31% (93 runs sampled)
+```
+
+__Note.__ CommonMark version runs with [simplified link normalizers](https://github.com/markdown-it/markdown-it/blob/master/benchmark/implementations/current-commonmark/index.js)
+for more "honest" compare. Difference is ~ 1.5x.
+
+As you can see, `markdown-it` doesn't pay with speed for it's flexibility.
+Slowdown of "full" version caused by additional features not available in
+other implementations.
+
+
+## markdown-it for enterprise
+
+Available as part of the Tidelift Subscription.
+
+The maintainers of `markdown-it` and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-markdown-it?utm_source=npm-markdown-it&utm_medium=referral&utm_campaign=enterprise&utm_term=repo)
+
+
+## Authors
+
+- Alex Kocharin [github/rlidwka](https://github.com/rlidwka)
+- Vitaly Puzrin [github/puzrin](https://github.com/puzrin)
+
+_markdown-it_ is the result of the decision of the authors who contributed to
+99% of the _Remarkable_ code to move to a project with the same authorship but
+new leadership (Vitaly and Alex). It's not a fork.
+
+## References / Thanks
+
+Big thanks to [John MacFarlane](https://github.com/jgm) for his work on the
+CommonMark spec and reference implementations. His work saved us a lot of time
+during this project's development.
+
+**Related Links:**
+
+- https://github.com/jgm/CommonMark - reference CommonMark implementations in C & JS,
+ also contains latest spec & online demo.
+- http://talk.commonmark.org - CommonMark forum, good place to collaborate
+ developers' efforts.
+
+**Ports**
+
+- [motion-markdown-it](https://github.com/digitalmoksha/motion-markdown-it) - Ruby/RubyMotion
+- [markdown-it-py](https://github.com/ExecutableBookProject/markdown-it-py)- Python
diff --git a/node_modules/markdown-it/bin/markdown-it.js b/node_modules/markdown-it/bin/markdown-it.js
new file mode 100644
index 0000000..d916635
--- /dev/null
+++ b/node_modules/markdown-it/bin/markdown-it.js
@@ -0,0 +1,117 @@
+#!/usr/bin/env node
+/*eslint no-console:0*/
+
+'use strict';
+
+
+var fs = require('fs');
+var argparse = require('argparse');
+
+
+////////////////////////////////////////////////////////////////////////////////
+
+var cli = new argparse.ArgumentParser({
+ prog: 'markdown-it',
+ add_help: true
+});
+
+cli.add_argument('-v', '--version', {
+ action: 'version',
+ version: require('../package.json').version
+});
+
+cli.add_argument('--no-html', {
+ help: 'Disable embedded HTML',
+ action: 'store_true'
+});
+
+cli.add_argument('-l', '--linkify', {
+ help: 'Autolink text',
+ action: 'store_true'
+});
+
+cli.add_argument('-t', '--typographer', {
+ help: 'Enable smartquotes and other typographic replacements',
+ action: 'store_true'
+});
+
+cli.add_argument('--trace', {
+ help: 'Show stack trace on error',
+ action: 'store_true'
+});
+
+cli.add_argument('file', {
+ help: 'File to read',
+ nargs: '?',
+ default: '-'
+});
+
+cli.add_argument('-o', '--output', {
+ help: 'File to write',
+ default: '-'
+});
+
+var options = cli.parse_args();
+
+
+function readFile(filename, encoding, callback) {
+ if (options.file === '-') {
+ // read from stdin
+ var chunks = [];
+
+ process.stdin.on('data', function (chunk) { chunks.push(chunk); });
+
+ process.stdin.on('end', function () {
+ return callback(null, Buffer.concat(chunks).toString(encoding));
+ });
+ } else {
+ fs.readFile(filename, encoding, callback);
+ }
+}
+
+
+////////////////////////////////////////////////////////////////////////////////
+
+readFile(options.file, 'utf8', function (err, input) {
+ var output, md;
+
+ if (err) {
+ if (err.code === 'ENOENT') {
+ console.error('File not found: ' + options.file);
+ process.exit(2);
+ }
+
+ console.error(
+ options.trace && err.stack ||
+ err.message ||
+ String(err));
+
+ process.exit(1);
+ }
+
+ md = require('..')({
+ html: !options.no_html,
+ xhtmlOut: false,
+ typographer: options.typographer,
+ linkify: options.linkify
+ });
+
+ try {
+ output = md.render(input);
+
+ } catch (e) {
+ console.error(
+ options.trace && e.stack ||
+ e.message ||
+ String(e));
+
+ process.exit(1);
+ }
+
+ if (options.output === '-') {
+ // write to stdout
+ process.stdout.write(output);
+ } else {
+ fs.writeFileSync(options.output, output);
+ }
+});
diff --git a/node_modules/markdown-it/dist/markdown-it.js b/node_modules/markdown-it/dist/markdown-it.js
new file mode 100644
index 0000000..1ef5530
--- /dev/null
+++ b/node_modules/markdown-it/dist/markdown-it.js
@@ -0,0 +1,8356 @@
+/*! markdown-it 12.3.2 https://github.com/markdown-it/markdown-it @license MIT */
+(function(global, factory) {
+ typeof exports === "object" && typeof module !== "undefined" ? module.exports = factory() : typeof define === "function" && define.amd ? define(factory) : (global = typeof globalThis !== "undefined" ? globalThis : global || self,
+ global.markdownit = factory());
+})(this, (function() {
+ "use strict";
+ function createCommonjsModule(fn, basedir, module) {
+ return module = {
+ path: basedir,
+ exports: {},
+ require: function(path, base) {
+ return commonjsRequire(path, base === undefined || base === null ? module.path : base);
+ }
+ }, fn(module, module.exports), module.exports;
+ }
+ function getAugmentedNamespace(n) {
+ if (n.__esModule) return n;
+ var a = Object.defineProperty({}, "__esModule", {
+ value: true
+ });
+ Object.keys(n).forEach((function(k) {
+ var d = Object.getOwnPropertyDescriptor(n, k);
+ Object.defineProperty(a, k, d.get ? d : {
+ enumerable: true,
+ get: function() {
+ return n[k];
+ }
+ });
+ }));
+ return a;
+ }
+ function commonjsRequire() {
+ throw new Error("Dynamic requires are not currently supported by @rollup/plugin-commonjs");
+ }
+ var require$$0 = {
+ Aacute: "\xc1",
+ aacute: "\xe1",
+ Abreve: "\u0102",
+ abreve: "\u0103",
+ ac: "\u223e",
+ acd: "\u223f",
+ acE: "\u223e\u0333",
+ Acirc: "\xc2",
+ acirc: "\xe2",
+ acute: "\xb4",
+ Acy: "\u0410",
+ acy: "\u0430",
+ AElig: "\xc6",
+ aelig: "\xe6",
+ af: "\u2061",
+ Afr: "\ud835\udd04",
+ afr: "\ud835\udd1e",
+ Agrave: "\xc0",
+ agrave: "\xe0",
+ alefsym: "\u2135",
+ aleph: "\u2135",
+ Alpha: "\u0391",
+ alpha: "\u03b1",
+ Amacr: "\u0100",
+ amacr: "\u0101",
+ amalg: "\u2a3f",
+ amp: "&",
+ AMP: "&",
+ andand: "\u2a55",
+ And: "\u2a53",
+ and: "\u2227",
+ andd: "\u2a5c",
+ andslope: "\u2a58",
+ andv: "\u2a5a",
+ ang: "\u2220",
+ ange: "\u29a4",
+ angle: "\u2220",
+ angmsdaa: "\u29a8",
+ angmsdab: "\u29a9",
+ angmsdac: "\u29aa",
+ angmsdad: "\u29ab",
+ angmsdae: "\u29ac",
+ angmsdaf: "\u29ad",
+ angmsdag: "\u29ae",
+ angmsdah: "\u29af",
+ angmsd: "\u2221",
+ angrt: "\u221f",
+ angrtvb: "\u22be",
+ angrtvbd: "\u299d",
+ angsph: "\u2222",
+ angst: "\xc5",
+ angzarr: "\u237c",
+ Aogon: "\u0104",
+ aogon: "\u0105",
+ Aopf: "\ud835\udd38",
+ aopf: "\ud835\udd52",
+ apacir: "\u2a6f",
+ ap: "\u2248",
+ apE: "\u2a70",
+ ape: "\u224a",
+ apid: "\u224b",
+ apos: "'",
+ ApplyFunction: "\u2061",
+ approx: "\u2248",
+ approxeq: "\u224a",
+ Aring: "\xc5",
+ aring: "\xe5",
+ Ascr: "\ud835\udc9c",
+ ascr: "\ud835\udcb6",
+ Assign: "\u2254",
+ ast: "*",
+ asymp: "\u2248",
+ asympeq: "\u224d",
+ Atilde: "\xc3",
+ atilde: "\xe3",
+ Auml: "\xc4",
+ auml: "\xe4",
+ awconint: "\u2233",
+ awint: "\u2a11",
+ backcong: "\u224c",
+ backepsilon: "\u03f6",
+ backprime: "\u2035",
+ backsim: "\u223d",
+ backsimeq: "\u22cd",
+ Backslash: "\u2216",
+ Barv: "\u2ae7",
+ barvee: "\u22bd",
+ barwed: "\u2305",
+ Barwed: "\u2306",
+ barwedge: "\u2305",
+ bbrk: "\u23b5",
+ bbrktbrk: "\u23b6",
+ bcong: "\u224c",
+ Bcy: "\u0411",
+ bcy: "\u0431",
+ bdquo: "\u201e",
+ becaus: "\u2235",
+ because: "\u2235",
+ Because: "\u2235",
+ bemptyv: "\u29b0",
+ bepsi: "\u03f6",
+ bernou: "\u212c",
+ Bernoullis: "\u212c",
+ Beta: "\u0392",
+ beta: "\u03b2",
+ beth: "\u2136",
+ between: "\u226c",
+ Bfr: "\ud835\udd05",
+ bfr: "\ud835\udd1f",
+ bigcap: "\u22c2",
+ bigcirc: "\u25ef",
+ bigcup: "\u22c3",
+ bigodot: "\u2a00",
+ bigoplus: "\u2a01",
+ bigotimes: "\u2a02",
+ bigsqcup: "\u2a06",
+ bigstar: "\u2605",
+ bigtriangledown: "\u25bd",
+ bigtriangleup: "\u25b3",
+ biguplus: "\u2a04",
+ bigvee: "\u22c1",
+ bigwedge: "\u22c0",
+ bkarow: "\u290d",
+ blacklozenge: "\u29eb",
+ blacksquare: "\u25aa",
+ blacktriangle: "\u25b4",
+ blacktriangledown: "\u25be",
+ blacktriangleleft: "\u25c2",
+ blacktriangleright: "\u25b8",
+ blank: "\u2423",
+ blk12: "\u2592",
+ blk14: "\u2591",
+ blk34: "\u2593",
+ block: "\u2588",
+ bne: "=\u20e5",
+ bnequiv: "\u2261\u20e5",
+ bNot: "\u2aed",
+ bnot: "\u2310",
+ Bopf: "\ud835\udd39",
+ bopf: "\ud835\udd53",
+ bot: "\u22a5",
+ bottom: "\u22a5",
+ bowtie: "\u22c8",
+ boxbox: "\u29c9",
+ boxdl: "\u2510",
+ boxdL: "\u2555",
+ boxDl: "\u2556",
+ boxDL: "\u2557",
+ boxdr: "\u250c",
+ boxdR: "\u2552",
+ boxDr: "\u2553",
+ boxDR: "\u2554",
+ boxh: "\u2500",
+ boxH: "\u2550",
+ boxhd: "\u252c",
+ boxHd: "\u2564",
+ boxhD: "\u2565",
+ boxHD: "\u2566",
+ boxhu: "\u2534",
+ boxHu: "\u2567",
+ boxhU: "\u2568",
+ boxHU: "\u2569",
+ boxminus: "\u229f",
+ boxplus: "\u229e",
+ boxtimes: "\u22a0",
+ boxul: "\u2518",
+ boxuL: "\u255b",
+ boxUl: "\u255c",
+ boxUL: "\u255d",
+ boxur: "\u2514",
+ boxuR: "\u2558",
+ boxUr: "\u2559",
+ boxUR: "\u255a",
+ boxv: "\u2502",
+ boxV: "\u2551",
+ boxvh: "\u253c",
+ boxvH: "\u256a",
+ boxVh: "\u256b",
+ boxVH: "\u256c",
+ boxvl: "\u2524",
+ boxvL: "\u2561",
+ boxVl: "\u2562",
+ boxVL: "\u2563",
+ boxvr: "\u251c",
+ boxvR: "\u255e",
+ boxVr: "\u255f",
+ boxVR: "\u2560",
+ bprime: "\u2035",
+ breve: "\u02d8",
+ Breve: "\u02d8",
+ brvbar: "\xa6",
+ bscr: "\ud835\udcb7",
+ Bscr: "\u212c",
+ bsemi: "\u204f",
+ bsim: "\u223d",
+ bsime: "\u22cd",
+ bsolb: "\u29c5",
+ bsol: "\\",
+ bsolhsub: "\u27c8",
+ bull: "\u2022",
+ bullet: "\u2022",
+ bump: "\u224e",
+ bumpE: "\u2aae",
+ bumpe: "\u224f",
+ Bumpeq: "\u224e",
+ bumpeq: "\u224f",
+ Cacute: "\u0106",
+ cacute: "\u0107",
+ capand: "\u2a44",
+ capbrcup: "\u2a49",
+ capcap: "\u2a4b",
+ cap: "\u2229",
+ Cap: "\u22d2",
+ capcup: "\u2a47",
+ capdot: "\u2a40",
+ CapitalDifferentialD: "\u2145",
+ caps: "\u2229\ufe00",
+ caret: "\u2041",
+ caron: "\u02c7",
+ Cayleys: "\u212d",
+ ccaps: "\u2a4d",
+ Ccaron: "\u010c",
+ ccaron: "\u010d",
+ Ccedil: "\xc7",
+ ccedil: "\xe7",
+ Ccirc: "\u0108",
+ ccirc: "\u0109",
+ Cconint: "\u2230",
+ ccups: "\u2a4c",
+ ccupssm: "\u2a50",
+ Cdot: "\u010a",
+ cdot: "\u010b",
+ cedil: "\xb8",
+ Cedilla: "\xb8",
+ cemptyv: "\u29b2",
+ cent: "\xa2",
+ centerdot: "\xb7",
+ CenterDot: "\xb7",
+ cfr: "\ud835\udd20",
+ Cfr: "\u212d",
+ CHcy: "\u0427",
+ chcy: "\u0447",
+ check: "\u2713",
+ checkmark: "\u2713",
+ Chi: "\u03a7",
+ chi: "\u03c7",
+ circ: "\u02c6",
+ circeq: "\u2257",
+ circlearrowleft: "\u21ba",
+ circlearrowright: "\u21bb",
+ circledast: "\u229b",
+ circledcirc: "\u229a",
+ circleddash: "\u229d",
+ CircleDot: "\u2299",
+ circledR: "\xae",
+ circledS: "\u24c8",
+ CircleMinus: "\u2296",
+ CirclePlus: "\u2295",
+ CircleTimes: "\u2297",
+ cir: "\u25cb",
+ cirE: "\u29c3",
+ cire: "\u2257",
+ cirfnint: "\u2a10",
+ cirmid: "\u2aef",
+ cirscir: "\u29c2",
+ ClockwiseContourIntegral: "\u2232",
+ CloseCurlyDoubleQuote: "\u201d",
+ CloseCurlyQuote: "\u2019",
+ clubs: "\u2663",
+ clubsuit: "\u2663",
+ colon: ":",
+ Colon: "\u2237",
+ Colone: "\u2a74",
+ colone: "\u2254",
+ coloneq: "\u2254",
+ comma: ",",
+ commat: "@",
+ comp: "\u2201",
+ compfn: "\u2218",
+ complement: "\u2201",
+ complexes: "\u2102",
+ cong: "\u2245",
+ congdot: "\u2a6d",
+ Congruent: "\u2261",
+ conint: "\u222e",
+ Conint: "\u222f",
+ ContourIntegral: "\u222e",
+ copf: "\ud835\udd54",
+ Copf: "\u2102",
+ coprod: "\u2210",
+ Coproduct: "\u2210",
+ copy: "\xa9",
+ COPY: "\xa9",
+ copysr: "\u2117",
+ CounterClockwiseContourIntegral: "\u2233",
+ crarr: "\u21b5",
+ cross: "\u2717",
+ Cross: "\u2a2f",
+ Cscr: "\ud835\udc9e",
+ cscr: "\ud835\udcb8",
+ csub: "\u2acf",
+ csube: "\u2ad1",
+ csup: "\u2ad0",
+ csupe: "\u2ad2",
+ ctdot: "\u22ef",
+ cudarrl: "\u2938",
+ cudarrr: "\u2935",
+ cuepr: "\u22de",
+ cuesc: "\u22df",
+ cularr: "\u21b6",
+ cularrp: "\u293d",
+ cupbrcap: "\u2a48",
+ cupcap: "\u2a46",
+ CupCap: "\u224d",
+ cup: "\u222a",
+ Cup: "\u22d3",
+ cupcup: "\u2a4a",
+ cupdot: "\u228d",
+ cupor: "\u2a45",
+ cups: "\u222a\ufe00",
+ curarr: "\u21b7",
+ curarrm: "\u293c",
+ curlyeqprec: "\u22de",
+ curlyeqsucc: "\u22df",
+ curlyvee: "\u22ce",
+ curlywedge: "\u22cf",
+ curren: "\xa4",
+ curvearrowleft: "\u21b6",
+ curvearrowright: "\u21b7",
+ cuvee: "\u22ce",
+ cuwed: "\u22cf",
+ cwconint: "\u2232",
+ cwint: "\u2231",
+ cylcty: "\u232d",
+ dagger: "\u2020",
+ Dagger: "\u2021",
+ daleth: "\u2138",
+ darr: "\u2193",
+ Darr: "\u21a1",
+ dArr: "\u21d3",
+ dash: "\u2010",
+ Dashv: "\u2ae4",
+ dashv: "\u22a3",
+ dbkarow: "\u290f",
+ dblac: "\u02dd",
+ Dcaron: "\u010e",
+ dcaron: "\u010f",
+ Dcy: "\u0414",
+ dcy: "\u0434",
+ ddagger: "\u2021",
+ ddarr: "\u21ca",
+ DD: "\u2145",
+ dd: "\u2146",
+ DDotrahd: "\u2911",
+ ddotseq: "\u2a77",
+ deg: "\xb0",
+ Del: "\u2207",
+ Delta: "\u0394",
+ delta: "\u03b4",
+ demptyv: "\u29b1",
+ dfisht: "\u297f",
+ Dfr: "\ud835\udd07",
+ dfr: "\ud835\udd21",
+ dHar: "\u2965",
+ dharl: "\u21c3",
+ dharr: "\u21c2",
+ DiacriticalAcute: "\xb4",
+ DiacriticalDot: "\u02d9",
+ DiacriticalDoubleAcute: "\u02dd",
+ DiacriticalGrave: "`",
+ DiacriticalTilde: "\u02dc",
+ diam: "\u22c4",
+ diamond: "\u22c4",
+ Diamond: "\u22c4",
+ diamondsuit: "\u2666",
+ diams: "\u2666",
+ die: "\xa8",
+ DifferentialD: "\u2146",
+ digamma: "\u03dd",
+ disin: "\u22f2",
+ div: "\xf7",
+ divide: "\xf7",
+ divideontimes: "\u22c7",
+ divonx: "\u22c7",
+ DJcy: "\u0402",
+ djcy: "\u0452",
+ dlcorn: "\u231e",
+ dlcrop: "\u230d",
+ dollar: "$",
+ Dopf: "\ud835\udd3b",
+ dopf: "\ud835\udd55",
+ Dot: "\xa8",
+ dot: "\u02d9",
+ DotDot: "\u20dc",
+ doteq: "\u2250",
+ doteqdot: "\u2251",
+ DotEqual: "\u2250",
+ dotminus: "\u2238",
+ dotplus: "\u2214",
+ dotsquare: "\u22a1",
+ doublebarwedge: "\u2306",
+ DoubleContourIntegral: "\u222f",
+ DoubleDot: "\xa8",
+ DoubleDownArrow: "\u21d3",
+ DoubleLeftArrow: "\u21d0",
+ DoubleLeftRightArrow: "\u21d4",
+ DoubleLeftTee: "\u2ae4",
+ DoubleLongLeftArrow: "\u27f8",
+ DoubleLongLeftRightArrow: "\u27fa",
+ DoubleLongRightArrow: "\u27f9",
+ DoubleRightArrow: "\u21d2",
+ DoubleRightTee: "\u22a8",
+ DoubleUpArrow: "\u21d1",
+ DoubleUpDownArrow: "\u21d5",
+ DoubleVerticalBar: "\u2225",
+ DownArrowBar: "\u2913",
+ downarrow: "\u2193",
+ DownArrow: "\u2193",
+ Downarrow: "\u21d3",
+ DownArrowUpArrow: "\u21f5",
+ DownBreve: "\u0311",
+ downdownarrows: "\u21ca",
+ downharpoonleft: "\u21c3",
+ downharpoonright: "\u21c2",
+ DownLeftRightVector: "\u2950",
+ DownLeftTeeVector: "\u295e",
+ DownLeftVectorBar: "\u2956",
+ DownLeftVector: "\u21bd",
+ DownRightTeeVector: "\u295f",
+ DownRightVectorBar: "\u2957",
+ DownRightVector: "\u21c1",
+ DownTeeArrow: "\u21a7",
+ DownTee: "\u22a4",
+ drbkarow: "\u2910",
+ drcorn: "\u231f",
+ drcrop: "\u230c",
+ Dscr: "\ud835\udc9f",
+ dscr: "\ud835\udcb9",
+ DScy: "\u0405",
+ dscy: "\u0455",
+ dsol: "\u29f6",
+ Dstrok: "\u0110",
+ dstrok: "\u0111",
+ dtdot: "\u22f1",
+ dtri: "\u25bf",
+ dtrif: "\u25be",
+ duarr: "\u21f5",
+ duhar: "\u296f",
+ dwangle: "\u29a6",
+ DZcy: "\u040f",
+ dzcy: "\u045f",
+ dzigrarr: "\u27ff",
+ Eacute: "\xc9",
+ eacute: "\xe9",
+ easter: "\u2a6e",
+ Ecaron: "\u011a",
+ ecaron: "\u011b",
+ Ecirc: "\xca",
+ ecirc: "\xea",
+ ecir: "\u2256",
+ ecolon: "\u2255",
+ Ecy: "\u042d",
+ ecy: "\u044d",
+ eDDot: "\u2a77",
+ Edot: "\u0116",
+ edot: "\u0117",
+ eDot: "\u2251",
+ ee: "\u2147",
+ efDot: "\u2252",
+ Efr: "\ud835\udd08",
+ efr: "\ud835\udd22",
+ eg: "\u2a9a",
+ Egrave: "\xc8",
+ egrave: "\xe8",
+ egs: "\u2a96",
+ egsdot: "\u2a98",
+ el: "\u2a99",
+ Element: "\u2208",
+ elinters: "\u23e7",
+ ell: "\u2113",
+ els: "\u2a95",
+ elsdot: "\u2a97",
+ Emacr: "\u0112",
+ emacr: "\u0113",
+ empty: "\u2205",
+ emptyset: "\u2205",
+ EmptySmallSquare: "\u25fb",
+ emptyv: "\u2205",
+ EmptyVerySmallSquare: "\u25ab",
+ emsp13: "\u2004",
+ emsp14: "\u2005",
+ emsp: "\u2003",
+ ENG: "\u014a",
+ eng: "\u014b",
+ ensp: "\u2002",
+ Eogon: "\u0118",
+ eogon: "\u0119",
+ Eopf: "\ud835\udd3c",
+ eopf: "\ud835\udd56",
+ epar: "\u22d5",
+ eparsl: "\u29e3",
+ eplus: "\u2a71",
+ epsi: "\u03b5",
+ Epsilon: "\u0395",
+ epsilon: "\u03b5",
+ epsiv: "\u03f5",
+ eqcirc: "\u2256",
+ eqcolon: "\u2255",
+ eqsim: "\u2242",
+ eqslantgtr: "\u2a96",
+ eqslantless: "\u2a95",
+ Equal: "\u2a75",
+ equals: "=",
+ EqualTilde: "\u2242",
+ equest: "\u225f",
+ Equilibrium: "\u21cc",
+ equiv: "\u2261",
+ equivDD: "\u2a78",
+ eqvparsl: "\u29e5",
+ erarr: "\u2971",
+ erDot: "\u2253",
+ escr: "\u212f",
+ Escr: "\u2130",
+ esdot: "\u2250",
+ Esim: "\u2a73",
+ esim: "\u2242",
+ Eta: "\u0397",
+ eta: "\u03b7",
+ ETH: "\xd0",
+ eth: "\xf0",
+ Euml: "\xcb",
+ euml: "\xeb",
+ euro: "\u20ac",
+ excl: "!",
+ exist: "\u2203",
+ Exists: "\u2203",
+ expectation: "\u2130",
+ exponentiale: "\u2147",
+ ExponentialE: "\u2147",
+ fallingdotseq: "\u2252",
+ Fcy: "\u0424",
+ fcy: "\u0444",
+ female: "\u2640",
+ ffilig: "\ufb03",
+ fflig: "\ufb00",
+ ffllig: "\ufb04",
+ Ffr: "\ud835\udd09",
+ ffr: "\ud835\udd23",
+ filig: "\ufb01",
+ FilledSmallSquare: "\u25fc",
+ FilledVerySmallSquare: "\u25aa",
+ fjlig: "fj",
+ flat: "\u266d",
+ fllig: "\ufb02",
+ fltns: "\u25b1",
+ fnof: "\u0192",
+ Fopf: "\ud835\udd3d",
+ fopf: "\ud835\udd57",
+ forall: "\u2200",
+ ForAll: "\u2200",
+ fork: "\u22d4",
+ forkv: "\u2ad9",
+ Fouriertrf: "\u2131",
+ fpartint: "\u2a0d",
+ frac12: "\xbd",
+ frac13: "\u2153",
+ frac14: "\xbc",
+ frac15: "\u2155",
+ frac16: "\u2159",
+ frac18: "\u215b",
+ frac23: "\u2154",
+ frac25: "\u2156",
+ frac34: "\xbe",
+ frac35: "\u2157",
+ frac38: "\u215c",
+ frac45: "\u2158",
+ frac56: "\u215a",
+ frac58: "\u215d",
+ frac78: "\u215e",
+ frasl: "\u2044",
+ frown: "\u2322",
+ fscr: "\ud835\udcbb",
+ Fscr: "\u2131",
+ gacute: "\u01f5",
+ Gamma: "\u0393",
+ gamma: "\u03b3",
+ Gammad: "\u03dc",
+ gammad: "\u03dd",
+ gap: "\u2a86",
+ Gbreve: "\u011e",
+ gbreve: "\u011f",
+ Gcedil: "\u0122",
+ Gcirc: "\u011c",
+ gcirc: "\u011d",
+ Gcy: "\u0413",
+ gcy: "\u0433",
+ Gdot: "\u0120",
+ gdot: "\u0121",
+ ge: "\u2265",
+ gE: "\u2267",
+ gEl: "\u2a8c",
+ gel: "\u22db",
+ geq: "\u2265",
+ geqq: "\u2267",
+ geqslant: "\u2a7e",
+ gescc: "\u2aa9",
+ ges: "\u2a7e",
+ gesdot: "\u2a80",
+ gesdoto: "\u2a82",
+ gesdotol: "\u2a84",
+ gesl: "\u22db\ufe00",
+ gesles: "\u2a94",
+ Gfr: "\ud835\udd0a",
+ gfr: "\ud835\udd24",
+ gg: "\u226b",
+ Gg: "\u22d9",
+ ggg: "\u22d9",
+ gimel: "\u2137",
+ GJcy: "\u0403",
+ gjcy: "\u0453",
+ gla: "\u2aa5",
+ gl: "\u2277",
+ glE: "\u2a92",
+ glj: "\u2aa4",
+ gnap: "\u2a8a",
+ gnapprox: "\u2a8a",
+ gne: "\u2a88",
+ gnE: "\u2269",
+ gneq: "\u2a88",
+ gneqq: "\u2269",
+ gnsim: "\u22e7",
+ Gopf: "\ud835\udd3e",
+ gopf: "\ud835\udd58",
+ grave: "`",
+ GreaterEqual: "\u2265",
+ GreaterEqualLess: "\u22db",
+ GreaterFullEqual: "\u2267",
+ GreaterGreater: "\u2aa2",
+ GreaterLess: "\u2277",
+ GreaterSlantEqual: "\u2a7e",
+ GreaterTilde: "\u2273",
+ Gscr: "\ud835\udca2",
+ gscr: "\u210a",
+ gsim: "\u2273",
+ gsime: "\u2a8e",
+ gsiml: "\u2a90",
+ gtcc: "\u2aa7",
+ gtcir: "\u2a7a",
+ gt: ">",
+ GT: ">",
+ Gt: "\u226b",
+ gtdot: "\u22d7",
+ gtlPar: "\u2995",
+ gtquest: "\u2a7c",
+ gtrapprox: "\u2a86",
+ gtrarr: "\u2978",
+ gtrdot: "\u22d7",
+ gtreqless: "\u22db",
+ gtreqqless: "\u2a8c",
+ gtrless: "\u2277",
+ gtrsim: "\u2273",
+ gvertneqq: "\u2269\ufe00",
+ gvnE: "\u2269\ufe00",
+ Hacek: "\u02c7",
+ hairsp: "\u200a",
+ half: "\xbd",
+ hamilt: "\u210b",
+ HARDcy: "\u042a",
+ hardcy: "\u044a",
+ harrcir: "\u2948",
+ harr: "\u2194",
+ hArr: "\u21d4",
+ harrw: "\u21ad",
+ Hat: "^",
+ hbar: "\u210f",
+ Hcirc: "\u0124",
+ hcirc: "\u0125",
+ hearts: "\u2665",
+ heartsuit: "\u2665",
+ hellip: "\u2026",
+ hercon: "\u22b9",
+ hfr: "\ud835\udd25",
+ Hfr: "\u210c",
+ HilbertSpace: "\u210b",
+ hksearow: "\u2925",
+ hkswarow: "\u2926",
+ hoarr: "\u21ff",
+ homtht: "\u223b",
+ hookleftarrow: "\u21a9",
+ hookrightarrow: "\u21aa",
+ hopf: "\ud835\udd59",
+ Hopf: "\u210d",
+ horbar: "\u2015",
+ HorizontalLine: "\u2500",
+ hscr: "\ud835\udcbd",
+ Hscr: "\u210b",
+ hslash: "\u210f",
+ Hstrok: "\u0126",
+ hstrok: "\u0127",
+ HumpDownHump: "\u224e",
+ HumpEqual: "\u224f",
+ hybull: "\u2043",
+ hyphen: "\u2010",
+ Iacute: "\xcd",
+ iacute: "\xed",
+ ic: "\u2063",
+ Icirc: "\xce",
+ icirc: "\xee",
+ Icy: "\u0418",
+ icy: "\u0438",
+ Idot: "\u0130",
+ IEcy: "\u0415",
+ iecy: "\u0435",
+ iexcl: "\xa1",
+ iff: "\u21d4",
+ ifr: "\ud835\udd26",
+ Ifr: "\u2111",
+ Igrave: "\xcc",
+ igrave: "\xec",
+ ii: "\u2148",
+ iiiint: "\u2a0c",
+ iiint: "\u222d",
+ iinfin: "\u29dc",
+ iiota: "\u2129",
+ IJlig: "\u0132",
+ ijlig: "\u0133",
+ Imacr: "\u012a",
+ imacr: "\u012b",
+ image: "\u2111",
+ ImaginaryI: "\u2148",
+ imagline: "\u2110",
+ imagpart: "\u2111",
+ imath: "\u0131",
+ Im: "\u2111",
+ imof: "\u22b7",
+ imped: "\u01b5",
+ Implies: "\u21d2",
+ incare: "\u2105",
+ in: "\u2208",
+ infin: "\u221e",
+ infintie: "\u29dd",
+ inodot: "\u0131",
+ intcal: "\u22ba",
+ int: "\u222b",
+ Int: "\u222c",
+ integers: "\u2124",
+ Integral: "\u222b",
+ intercal: "\u22ba",
+ Intersection: "\u22c2",
+ intlarhk: "\u2a17",
+ intprod: "\u2a3c",
+ InvisibleComma: "\u2063",
+ InvisibleTimes: "\u2062",
+ IOcy: "\u0401",
+ iocy: "\u0451",
+ Iogon: "\u012e",
+ iogon: "\u012f",
+ Iopf: "\ud835\udd40",
+ iopf: "\ud835\udd5a",
+ Iota: "\u0399",
+ iota: "\u03b9",
+ iprod: "\u2a3c",
+ iquest: "\xbf",
+ iscr: "\ud835\udcbe",
+ Iscr: "\u2110",
+ isin: "\u2208",
+ isindot: "\u22f5",
+ isinE: "\u22f9",
+ isins: "\u22f4",
+ isinsv: "\u22f3",
+ isinv: "\u2208",
+ it: "\u2062",
+ Itilde: "\u0128",
+ itilde: "\u0129",
+ Iukcy: "\u0406",
+ iukcy: "\u0456",
+ Iuml: "\xcf",
+ iuml: "\xef",
+ Jcirc: "\u0134",
+ jcirc: "\u0135",
+ Jcy: "\u0419",
+ jcy: "\u0439",
+ Jfr: "\ud835\udd0d",
+ jfr: "\ud835\udd27",
+ jmath: "\u0237",
+ Jopf: "\ud835\udd41",
+ jopf: "\ud835\udd5b",
+ Jscr: "\ud835\udca5",
+ jscr: "\ud835\udcbf",
+ Jsercy: "\u0408",
+ jsercy: "\u0458",
+ Jukcy: "\u0404",
+ jukcy: "\u0454",
+ Kappa: "\u039a",
+ kappa: "\u03ba",
+ kappav: "\u03f0",
+ Kcedil: "\u0136",
+ kcedil: "\u0137",
+ Kcy: "\u041a",
+ kcy: "\u043a",
+ Kfr: "\ud835\udd0e",
+ kfr: "\ud835\udd28",
+ kgreen: "\u0138",
+ KHcy: "\u0425",
+ khcy: "\u0445",
+ KJcy: "\u040c",
+ kjcy: "\u045c",
+ Kopf: "\ud835\udd42",
+ kopf: "\ud835\udd5c",
+ Kscr: "\ud835\udca6",
+ kscr: "\ud835\udcc0",
+ lAarr: "\u21da",
+ Lacute: "\u0139",
+ lacute: "\u013a",
+ laemptyv: "\u29b4",
+ lagran: "\u2112",
+ Lambda: "\u039b",
+ lambda: "\u03bb",
+ lang: "\u27e8",
+ Lang: "\u27ea",
+ langd: "\u2991",
+ langle: "\u27e8",
+ lap: "\u2a85",
+ Laplacetrf: "\u2112",
+ laquo: "\xab",
+ larrb: "\u21e4",
+ larrbfs: "\u291f",
+ larr: "\u2190",
+ Larr: "\u219e",
+ lArr: "\u21d0",
+ larrfs: "\u291d",
+ larrhk: "\u21a9",
+ larrlp: "\u21ab",
+ larrpl: "\u2939",
+ larrsim: "\u2973",
+ larrtl: "\u21a2",
+ latail: "\u2919",
+ lAtail: "\u291b",
+ lat: "\u2aab",
+ late: "\u2aad",
+ lates: "\u2aad\ufe00",
+ lbarr: "\u290c",
+ lBarr: "\u290e",
+ lbbrk: "\u2772",
+ lbrace: "{",
+ lbrack: "[",
+ lbrke: "\u298b",
+ lbrksld: "\u298f",
+ lbrkslu: "\u298d",
+ Lcaron: "\u013d",
+ lcaron: "\u013e",
+ Lcedil: "\u013b",
+ lcedil: "\u013c",
+ lceil: "\u2308",
+ lcub: "{",
+ Lcy: "\u041b",
+ lcy: "\u043b",
+ ldca: "\u2936",
+ ldquo: "\u201c",
+ ldquor: "\u201e",
+ ldrdhar: "\u2967",
+ ldrushar: "\u294b",
+ ldsh: "\u21b2",
+ le: "\u2264",
+ lE: "\u2266",
+ LeftAngleBracket: "\u27e8",
+ LeftArrowBar: "\u21e4",
+ leftarrow: "\u2190",
+ LeftArrow: "\u2190",
+ Leftarrow: "\u21d0",
+ LeftArrowRightArrow: "\u21c6",
+ leftarrowtail: "\u21a2",
+ LeftCeiling: "\u2308",
+ LeftDoubleBracket: "\u27e6",
+ LeftDownTeeVector: "\u2961",
+ LeftDownVectorBar: "\u2959",
+ LeftDownVector: "\u21c3",
+ LeftFloor: "\u230a",
+ leftharpoondown: "\u21bd",
+ leftharpoonup: "\u21bc",
+ leftleftarrows: "\u21c7",
+ leftrightarrow: "\u2194",
+ LeftRightArrow: "\u2194",
+ Leftrightarrow: "\u21d4",
+ leftrightarrows: "\u21c6",
+ leftrightharpoons: "\u21cb",
+ leftrightsquigarrow: "\u21ad",
+ LeftRightVector: "\u294e",
+ LeftTeeArrow: "\u21a4",
+ LeftTee: "\u22a3",
+ LeftTeeVector: "\u295a",
+ leftthreetimes: "\u22cb",
+ LeftTriangleBar: "\u29cf",
+ LeftTriangle: "\u22b2",
+ LeftTriangleEqual: "\u22b4",
+ LeftUpDownVector: "\u2951",
+ LeftUpTeeVector: "\u2960",
+ LeftUpVectorBar: "\u2958",
+ LeftUpVector: "\u21bf",
+ LeftVectorBar: "\u2952",
+ LeftVector: "\u21bc",
+ lEg: "\u2a8b",
+ leg: "\u22da",
+ leq: "\u2264",
+ leqq: "\u2266",
+ leqslant: "\u2a7d",
+ lescc: "\u2aa8",
+ les: "\u2a7d",
+ lesdot: "\u2a7f",
+ lesdoto: "\u2a81",
+ lesdotor: "\u2a83",
+ lesg: "\u22da\ufe00",
+ lesges: "\u2a93",
+ lessapprox: "\u2a85",
+ lessdot: "\u22d6",
+ lesseqgtr: "\u22da",
+ lesseqqgtr: "\u2a8b",
+ LessEqualGreater: "\u22da",
+ LessFullEqual: "\u2266",
+ LessGreater: "\u2276",
+ lessgtr: "\u2276",
+ LessLess: "\u2aa1",
+ lesssim: "\u2272",
+ LessSlantEqual: "\u2a7d",
+ LessTilde: "\u2272",
+ lfisht: "\u297c",
+ lfloor: "\u230a",
+ Lfr: "\ud835\udd0f",
+ lfr: "\ud835\udd29",
+ lg: "\u2276",
+ lgE: "\u2a91",
+ lHar: "\u2962",
+ lhard: "\u21bd",
+ lharu: "\u21bc",
+ lharul: "\u296a",
+ lhblk: "\u2584",
+ LJcy: "\u0409",
+ ljcy: "\u0459",
+ llarr: "\u21c7",
+ ll: "\u226a",
+ Ll: "\u22d8",
+ llcorner: "\u231e",
+ Lleftarrow: "\u21da",
+ llhard: "\u296b",
+ lltri: "\u25fa",
+ Lmidot: "\u013f",
+ lmidot: "\u0140",
+ lmoustache: "\u23b0",
+ lmoust: "\u23b0",
+ lnap: "\u2a89",
+ lnapprox: "\u2a89",
+ lne: "\u2a87",
+ lnE: "\u2268",
+ lneq: "\u2a87",
+ lneqq: "\u2268",
+ lnsim: "\u22e6",
+ loang: "\u27ec",
+ loarr: "\u21fd",
+ lobrk: "\u27e6",
+ longleftarrow: "\u27f5",
+ LongLeftArrow: "\u27f5",
+ Longleftarrow: "\u27f8",
+ longleftrightarrow: "\u27f7",
+ LongLeftRightArrow: "\u27f7",
+ Longleftrightarrow: "\u27fa",
+ longmapsto: "\u27fc",
+ longrightarrow: "\u27f6",
+ LongRightArrow: "\u27f6",
+ Longrightarrow: "\u27f9",
+ looparrowleft: "\u21ab",
+ looparrowright: "\u21ac",
+ lopar: "\u2985",
+ Lopf: "\ud835\udd43",
+ lopf: "\ud835\udd5d",
+ loplus: "\u2a2d",
+ lotimes: "\u2a34",
+ lowast: "\u2217",
+ lowbar: "_",
+ LowerLeftArrow: "\u2199",
+ LowerRightArrow: "\u2198",
+ loz: "\u25ca",
+ lozenge: "\u25ca",
+ lozf: "\u29eb",
+ lpar: "(",
+ lparlt: "\u2993",
+ lrarr: "\u21c6",
+ lrcorner: "\u231f",
+ lrhar: "\u21cb",
+ lrhard: "\u296d",
+ lrm: "\u200e",
+ lrtri: "\u22bf",
+ lsaquo: "\u2039",
+ lscr: "\ud835\udcc1",
+ Lscr: "\u2112",
+ lsh: "\u21b0",
+ Lsh: "\u21b0",
+ lsim: "\u2272",
+ lsime: "\u2a8d",
+ lsimg: "\u2a8f",
+ lsqb: "[",
+ lsquo: "\u2018",
+ lsquor: "\u201a",
+ Lstrok: "\u0141",
+ lstrok: "\u0142",
+ ltcc: "\u2aa6",
+ ltcir: "\u2a79",
+ lt: "<",
+ LT: "<",
+ Lt: "\u226a",
+ ltdot: "\u22d6",
+ lthree: "\u22cb",
+ ltimes: "\u22c9",
+ ltlarr: "\u2976",
+ ltquest: "\u2a7b",
+ ltri: "\u25c3",
+ ltrie: "\u22b4",
+ ltrif: "\u25c2",
+ ltrPar: "\u2996",
+ lurdshar: "\u294a",
+ luruhar: "\u2966",
+ lvertneqq: "\u2268\ufe00",
+ lvnE: "\u2268\ufe00",
+ macr: "\xaf",
+ male: "\u2642",
+ malt: "\u2720",
+ maltese: "\u2720",
+ Map: "\u2905",
+ map: "\u21a6",
+ mapsto: "\u21a6",
+ mapstodown: "\u21a7",
+ mapstoleft: "\u21a4",
+ mapstoup: "\u21a5",
+ marker: "\u25ae",
+ mcomma: "\u2a29",
+ Mcy: "\u041c",
+ mcy: "\u043c",
+ mdash: "\u2014",
+ mDDot: "\u223a",
+ measuredangle: "\u2221",
+ MediumSpace: "\u205f",
+ Mellintrf: "\u2133",
+ Mfr: "\ud835\udd10",
+ mfr: "\ud835\udd2a",
+ mho: "\u2127",
+ micro: "\xb5",
+ midast: "*",
+ midcir: "\u2af0",
+ mid: "\u2223",
+ middot: "\xb7",
+ minusb: "\u229f",
+ minus: "\u2212",
+ minusd: "\u2238",
+ minusdu: "\u2a2a",
+ MinusPlus: "\u2213",
+ mlcp: "\u2adb",
+ mldr: "\u2026",
+ mnplus: "\u2213",
+ models: "\u22a7",
+ Mopf: "\ud835\udd44",
+ mopf: "\ud835\udd5e",
+ mp: "\u2213",
+ mscr: "\ud835\udcc2",
+ Mscr: "\u2133",
+ mstpos: "\u223e",
+ Mu: "\u039c",
+ mu: "\u03bc",
+ multimap: "\u22b8",
+ mumap: "\u22b8",
+ nabla: "\u2207",
+ Nacute: "\u0143",
+ nacute: "\u0144",
+ nang: "\u2220\u20d2",
+ nap: "\u2249",
+ napE: "\u2a70\u0338",
+ napid: "\u224b\u0338",
+ napos: "\u0149",
+ napprox: "\u2249",
+ natural: "\u266e",
+ naturals: "\u2115",
+ natur: "\u266e",
+ nbsp: "\xa0",
+ nbump: "\u224e\u0338",
+ nbumpe: "\u224f\u0338",
+ ncap: "\u2a43",
+ Ncaron: "\u0147",
+ ncaron: "\u0148",
+ Ncedil: "\u0145",
+ ncedil: "\u0146",
+ ncong: "\u2247",
+ ncongdot: "\u2a6d\u0338",
+ ncup: "\u2a42",
+ Ncy: "\u041d",
+ ncy: "\u043d",
+ ndash: "\u2013",
+ nearhk: "\u2924",
+ nearr: "\u2197",
+ neArr: "\u21d7",
+ nearrow: "\u2197",
+ ne: "\u2260",
+ nedot: "\u2250\u0338",
+ NegativeMediumSpace: "\u200b",
+ NegativeThickSpace: "\u200b",
+ NegativeThinSpace: "\u200b",
+ NegativeVeryThinSpace: "\u200b",
+ nequiv: "\u2262",
+ nesear: "\u2928",
+ nesim: "\u2242\u0338",
+ NestedGreaterGreater: "\u226b",
+ NestedLessLess: "\u226a",
+ NewLine: "\n",
+ nexist: "\u2204",
+ nexists: "\u2204",
+ Nfr: "\ud835\udd11",
+ nfr: "\ud835\udd2b",
+ ngE: "\u2267\u0338",
+ nge: "\u2271",
+ ngeq: "\u2271",
+ ngeqq: "\u2267\u0338",
+ ngeqslant: "\u2a7e\u0338",
+ nges: "\u2a7e\u0338",
+ nGg: "\u22d9\u0338",
+ ngsim: "\u2275",
+ nGt: "\u226b\u20d2",
+ ngt: "\u226f",
+ ngtr: "\u226f",
+ nGtv: "\u226b\u0338",
+ nharr: "\u21ae",
+ nhArr: "\u21ce",
+ nhpar: "\u2af2",
+ ni: "\u220b",
+ nis: "\u22fc",
+ nisd: "\u22fa",
+ niv: "\u220b",
+ NJcy: "\u040a",
+ njcy: "\u045a",
+ nlarr: "\u219a",
+ nlArr: "\u21cd",
+ nldr: "\u2025",
+ nlE: "\u2266\u0338",
+ nle: "\u2270",
+ nleftarrow: "\u219a",
+ nLeftarrow: "\u21cd",
+ nleftrightarrow: "\u21ae",
+ nLeftrightarrow: "\u21ce",
+ nleq: "\u2270",
+ nleqq: "\u2266\u0338",
+ nleqslant: "\u2a7d\u0338",
+ nles: "\u2a7d\u0338",
+ nless: "\u226e",
+ nLl: "\u22d8\u0338",
+ nlsim: "\u2274",
+ nLt: "\u226a\u20d2",
+ nlt: "\u226e",
+ nltri: "\u22ea",
+ nltrie: "\u22ec",
+ nLtv: "\u226a\u0338",
+ nmid: "\u2224",
+ NoBreak: "\u2060",
+ NonBreakingSpace: "\xa0",
+ nopf: "\ud835\udd5f",
+ Nopf: "\u2115",
+ Not: "\u2aec",
+ not: "\xac",
+ NotCongruent: "\u2262",
+ NotCupCap: "\u226d",
+ NotDoubleVerticalBar: "\u2226",
+ NotElement: "\u2209",
+ NotEqual: "\u2260",
+ NotEqualTilde: "\u2242\u0338",
+ NotExists: "\u2204",
+ NotGreater: "\u226f",
+ NotGreaterEqual: "\u2271",
+ NotGreaterFullEqual: "\u2267\u0338",
+ NotGreaterGreater: "\u226b\u0338",
+ NotGreaterLess: "\u2279",
+ NotGreaterSlantEqual: "\u2a7e\u0338",
+ NotGreaterTilde: "\u2275",
+ NotHumpDownHump: "\u224e\u0338",
+ NotHumpEqual: "\u224f\u0338",
+ notin: "\u2209",
+ notindot: "\u22f5\u0338",
+ notinE: "\u22f9\u0338",
+ notinva: "\u2209",
+ notinvb: "\u22f7",
+ notinvc: "\u22f6",
+ NotLeftTriangleBar: "\u29cf\u0338",
+ NotLeftTriangle: "\u22ea",
+ NotLeftTriangleEqual: "\u22ec",
+ NotLess: "\u226e",
+ NotLessEqual: "\u2270",
+ NotLessGreater: "\u2278",
+ NotLessLess: "\u226a\u0338",
+ NotLessSlantEqual: "\u2a7d\u0338",
+ NotLessTilde: "\u2274",
+ NotNestedGreaterGreater: "\u2aa2\u0338",
+ NotNestedLessLess: "\u2aa1\u0338",
+ notni: "\u220c",
+ notniva: "\u220c",
+ notnivb: "\u22fe",
+ notnivc: "\u22fd",
+ NotPrecedes: "\u2280",
+ NotPrecedesEqual: "\u2aaf\u0338",
+ NotPrecedesSlantEqual: "\u22e0",
+ NotReverseElement: "\u220c",
+ NotRightTriangleBar: "\u29d0\u0338",
+ NotRightTriangle: "\u22eb",
+ NotRightTriangleEqual: "\u22ed",
+ NotSquareSubset: "\u228f\u0338",
+ NotSquareSubsetEqual: "\u22e2",
+ NotSquareSuperset: "\u2290\u0338",
+ NotSquareSupersetEqual: "\u22e3",
+ NotSubset: "\u2282\u20d2",
+ NotSubsetEqual: "\u2288",
+ NotSucceeds: "\u2281",
+ NotSucceedsEqual: "\u2ab0\u0338",
+ NotSucceedsSlantEqual: "\u22e1",
+ NotSucceedsTilde: "\u227f\u0338",
+ NotSuperset: "\u2283\u20d2",
+ NotSupersetEqual: "\u2289",
+ NotTilde: "\u2241",
+ NotTildeEqual: "\u2244",
+ NotTildeFullEqual: "\u2247",
+ NotTildeTilde: "\u2249",
+ NotVerticalBar: "\u2224",
+ nparallel: "\u2226",
+ npar: "\u2226",
+ nparsl: "\u2afd\u20e5",
+ npart: "\u2202\u0338",
+ npolint: "\u2a14",
+ npr: "\u2280",
+ nprcue: "\u22e0",
+ nprec: "\u2280",
+ npreceq: "\u2aaf\u0338",
+ npre: "\u2aaf\u0338",
+ nrarrc: "\u2933\u0338",
+ nrarr: "\u219b",
+ nrArr: "\u21cf",
+ nrarrw: "\u219d\u0338",
+ nrightarrow: "\u219b",
+ nRightarrow: "\u21cf",
+ nrtri: "\u22eb",
+ nrtrie: "\u22ed",
+ nsc: "\u2281",
+ nsccue: "\u22e1",
+ nsce: "\u2ab0\u0338",
+ Nscr: "\ud835\udca9",
+ nscr: "\ud835\udcc3",
+ nshortmid: "\u2224",
+ nshortparallel: "\u2226",
+ nsim: "\u2241",
+ nsime: "\u2244",
+ nsimeq: "\u2244",
+ nsmid: "\u2224",
+ nspar: "\u2226",
+ nsqsube: "\u22e2",
+ nsqsupe: "\u22e3",
+ nsub: "\u2284",
+ nsubE: "\u2ac5\u0338",
+ nsube: "\u2288",
+ nsubset: "\u2282\u20d2",
+ nsubseteq: "\u2288",
+ nsubseteqq: "\u2ac5\u0338",
+ nsucc: "\u2281",
+ nsucceq: "\u2ab0\u0338",
+ nsup: "\u2285",
+ nsupE: "\u2ac6\u0338",
+ nsupe: "\u2289",
+ nsupset: "\u2283\u20d2",
+ nsupseteq: "\u2289",
+ nsupseteqq: "\u2ac6\u0338",
+ ntgl: "\u2279",
+ Ntilde: "\xd1",
+ ntilde: "\xf1",
+ ntlg: "\u2278",
+ ntriangleleft: "\u22ea",
+ ntrianglelefteq: "\u22ec",
+ ntriangleright: "\u22eb",
+ ntrianglerighteq: "\u22ed",
+ Nu: "\u039d",
+ nu: "\u03bd",
+ num: "#",
+ numero: "\u2116",
+ numsp: "\u2007",
+ nvap: "\u224d\u20d2",
+ nvdash: "\u22ac",
+ nvDash: "\u22ad",
+ nVdash: "\u22ae",
+ nVDash: "\u22af",
+ nvge: "\u2265\u20d2",
+ nvgt: ">\u20d2",
+ nvHarr: "\u2904",
+ nvinfin: "\u29de",
+ nvlArr: "\u2902",
+ nvle: "\u2264\u20d2",
+ nvlt: "<\u20d2",
+ nvltrie: "\u22b4\u20d2",
+ nvrArr: "\u2903",
+ nvrtrie: "\u22b5\u20d2",
+ nvsim: "\u223c\u20d2",
+ nwarhk: "\u2923",
+ nwarr: "\u2196",
+ nwArr: "\u21d6",
+ nwarrow: "\u2196",
+ nwnear: "\u2927",
+ Oacute: "\xd3",
+ oacute: "\xf3",
+ oast: "\u229b",
+ Ocirc: "\xd4",
+ ocirc: "\xf4",
+ ocir: "\u229a",
+ Ocy: "\u041e",
+ ocy: "\u043e",
+ odash: "\u229d",
+ Odblac: "\u0150",
+ odblac: "\u0151",
+ odiv: "\u2a38",
+ odot: "\u2299",
+ odsold: "\u29bc",
+ OElig: "\u0152",
+ oelig: "\u0153",
+ ofcir: "\u29bf",
+ Ofr: "\ud835\udd12",
+ ofr: "\ud835\udd2c",
+ ogon: "\u02db",
+ Ograve: "\xd2",
+ ograve: "\xf2",
+ ogt: "\u29c1",
+ ohbar: "\u29b5",
+ ohm: "\u03a9",
+ oint: "\u222e",
+ olarr: "\u21ba",
+ olcir: "\u29be",
+ olcross: "\u29bb",
+ oline: "\u203e",
+ olt: "\u29c0",
+ Omacr: "\u014c",
+ omacr: "\u014d",
+ Omega: "\u03a9",
+ omega: "\u03c9",
+ Omicron: "\u039f",
+ omicron: "\u03bf",
+ omid: "\u29b6",
+ ominus: "\u2296",
+ Oopf: "\ud835\udd46",
+ oopf: "\ud835\udd60",
+ opar: "\u29b7",
+ OpenCurlyDoubleQuote: "\u201c",
+ OpenCurlyQuote: "\u2018",
+ operp: "\u29b9",
+ oplus: "\u2295",
+ orarr: "\u21bb",
+ Or: "\u2a54",
+ or: "\u2228",
+ ord: "\u2a5d",
+ order: "\u2134",
+ orderof: "\u2134",
+ ordf: "\xaa",
+ ordm: "\xba",
+ origof: "\u22b6",
+ oror: "\u2a56",
+ orslope: "\u2a57",
+ orv: "\u2a5b",
+ oS: "\u24c8",
+ Oscr: "\ud835\udcaa",
+ oscr: "\u2134",
+ Oslash: "\xd8",
+ oslash: "\xf8",
+ osol: "\u2298",
+ Otilde: "\xd5",
+ otilde: "\xf5",
+ otimesas: "\u2a36",
+ Otimes: "\u2a37",
+ otimes: "\u2297",
+ Ouml: "\xd6",
+ ouml: "\xf6",
+ ovbar: "\u233d",
+ OverBar: "\u203e",
+ OverBrace: "\u23de",
+ OverBracket: "\u23b4",
+ OverParenthesis: "\u23dc",
+ para: "\xb6",
+ parallel: "\u2225",
+ par: "\u2225",
+ parsim: "\u2af3",
+ parsl: "\u2afd",
+ part: "\u2202",
+ PartialD: "\u2202",
+ Pcy: "\u041f",
+ pcy: "\u043f",
+ percnt: "%",
+ period: ".",
+ permil: "\u2030",
+ perp: "\u22a5",
+ pertenk: "\u2031",
+ Pfr: "\ud835\udd13",
+ pfr: "\ud835\udd2d",
+ Phi: "\u03a6",
+ phi: "\u03c6",
+ phiv: "\u03d5",
+ phmmat: "\u2133",
+ phone: "\u260e",
+ Pi: "\u03a0",
+ pi: "\u03c0",
+ pitchfork: "\u22d4",
+ piv: "\u03d6",
+ planck: "\u210f",
+ planckh: "\u210e",
+ plankv: "\u210f",
+ plusacir: "\u2a23",
+ plusb: "\u229e",
+ pluscir: "\u2a22",
+ plus: "+",
+ plusdo: "\u2214",
+ plusdu: "\u2a25",
+ pluse: "\u2a72",
+ PlusMinus: "\xb1",
+ plusmn: "\xb1",
+ plussim: "\u2a26",
+ plustwo: "\u2a27",
+ pm: "\xb1",
+ Poincareplane: "\u210c",
+ pointint: "\u2a15",
+ popf: "\ud835\udd61",
+ Popf: "\u2119",
+ pound: "\xa3",
+ prap: "\u2ab7",
+ Pr: "\u2abb",
+ pr: "\u227a",
+ prcue: "\u227c",
+ precapprox: "\u2ab7",
+ prec: "\u227a",
+ preccurlyeq: "\u227c",
+ Precedes: "\u227a",
+ PrecedesEqual: "\u2aaf",
+ PrecedesSlantEqual: "\u227c",
+ PrecedesTilde: "\u227e",
+ preceq: "\u2aaf",
+ precnapprox: "\u2ab9",
+ precneqq: "\u2ab5",
+ precnsim: "\u22e8",
+ pre: "\u2aaf",
+ prE: "\u2ab3",
+ precsim: "\u227e",
+ prime: "\u2032",
+ Prime: "\u2033",
+ primes: "\u2119",
+ prnap: "\u2ab9",
+ prnE: "\u2ab5",
+ prnsim: "\u22e8",
+ prod: "\u220f",
+ Product: "\u220f",
+ profalar: "\u232e",
+ profline: "\u2312",
+ profsurf: "\u2313",
+ prop: "\u221d",
+ Proportional: "\u221d",
+ Proportion: "\u2237",
+ propto: "\u221d",
+ prsim: "\u227e",
+ prurel: "\u22b0",
+ Pscr: "\ud835\udcab",
+ pscr: "\ud835\udcc5",
+ Psi: "\u03a8",
+ psi: "\u03c8",
+ puncsp: "\u2008",
+ Qfr: "\ud835\udd14",
+ qfr: "\ud835\udd2e",
+ qint: "\u2a0c",
+ qopf: "\ud835\udd62",
+ Qopf: "\u211a",
+ qprime: "\u2057",
+ Qscr: "\ud835\udcac",
+ qscr: "\ud835\udcc6",
+ quaternions: "\u210d",
+ quatint: "\u2a16",
+ quest: "?",
+ questeq: "\u225f",
+ quot: '"',
+ QUOT: '"',
+ rAarr: "\u21db",
+ race: "\u223d\u0331",
+ Racute: "\u0154",
+ racute: "\u0155",
+ radic: "\u221a",
+ raemptyv: "\u29b3",
+ rang: "\u27e9",
+ Rang: "\u27eb",
+ rangd: "\u2992",
+ range: "\u29a5",
+ rangle: "\u27e9",
+ raquo: "\xbb",
+ rarrap: "\u2975",
+ rarrb: "\u21e5",
+ rarrbfs: "\u2920",
+ rarrc: "\u2933",
+ rarr: "\u2192",
+ Rarr: "\u21a0",
+ rArr: "\u21d2",
+ rarrfs: "\u291e",
+ rarrhk: "\u21aa",
+ rarrlp: "\u21ac",
+ rarrpl: "\u2945",
+ rarrsim: "\u2974",
+ Rarrtl: "\u2916",
+ rarrtl: "\u21a3",
+ rarrw: "\u219d",
+ ratail: "\u291a",
+ rAtail: "\u291c",
+ ratio: "\u2236",
+ rationals: "\u211a",
+ rbarr: "\u290d",
+ rBarr: "\u290f",
+ RBarr: "\u2910",
+ rbbrk: "\u2773",
+ rbrace: "}",
+ rbrack: "]",
+ rbrke: "\u298c",
+ rbrksld: "\u298e",
+ rbrkslu: "\u2990",
+ Rcaron: "\u0158",
+ rcaron: "\u0159",
+ Rcedil: "\u0156",
+ rcedil: "\u0157",
+ rceil: "\u2309",
+ rcub: "}",
+ Rcy: "\u0420",
+ rcy: "\u0440",
+ rdca: "\u2937",
+ rdldhar: "\u2969",
+ rdquo: "\u201d",
+ rdquor: "\u201d",
+ rdsh: "\u21b3",
+ real: "\u211c",
+ realine: "\u211b",
+ realpart: "\u211c",
+ reals: "\u211d",
+ Re: "\u211c",
+ rect: "\u25ad",
+ reg: "\xae",
+ REG: "\xae",
+ ReverseElement: "\u220b",
+ ReverseEquilibrium: "\u21cb",
+ ReverseUpEquilibrium: "\u296f",
+ rfisht: "\u297d",
+ rfloor: "\u230b",
+ rfr: "\ud835\udd2f",
+ Rfr: "\u211c",
+ rHar: "\u2964",
+ rhard: "\u21c1",
+ rharu: "\u21c0",
+ rharul: "\u296c",
+ Rho: "\u03a1",
+ rho: "\u03c1",
+ rhov: "\u03f1",
+ RightAngleBracket: "\u27e9",
+ RightArrowBar: "\u21e5",
+ rightarrow: "\u2192",
+ RightArrow: "\u2192",
+ Rightarrow: "\u21d2",
+ RightArrowLeftArrow: "\u21c4",
+ rightarrowtail: "\u21a3",
+ RightCeiling: "\u2309",
+ RightDoubleBracket: "\u27e7",
+ RightDownTeeVector: "\u295d",
+ RightDownVectorBar: "\u2955",
+ RightDownVector: "\u21c2",
+ RightFloor: "\u230b",
+ rightharpoondown: "\u21c1",
+ rightharpoonup: "\u21c0",
+ rightleftarrows: "\u21c4",
+ rightleftharpoons: "\u21cc",
+ rightrightarrows: "\u21c9",
+ rightsquigarrow: "\u219d",
+ RightTeeArrow: "\u21a6",
+ RightTee: "\u22a2",
+ RightTeeVector: "\u295b",
+ rightthreetimes: "\u22cc",
+ RightTriangleBar: "\u29d0",
+ RightTriangle: "\u22b3",
+ RightTriangleEqual: "\u22b5",
+ RightUpDownVector: "\u294f",
+ RightUpTeeVector: "\u295c",
+ RightUpVectorBar: "\u2954",
+ RightUpVector: "\u21be",
+ RightVectorBar: "\u2953",
+ RightVector: "\u21c0",
+ ring: "\u02da",
+ risingdotseq: "\u2253",
+ rlarr: "\u21c4",
+ rlhar: "\u21cc",
+ rlm: "\u200f",
+ rmoustache: "\u23b1",
+ rmoust: "\u23b1",
+ rnmid: "\u2aee",
+ roang: "\u27ed",
+ roarr: "\u21fe",
+ robrk: "\u27e7",
+ ropar: "\u2986",
+ ropf: "\ud835\udd63",
+ Ropf: "\u211d",
+ roplus: "\u2a2e",
+ rotimes: "\u2a35",
+ RoundImplies: "\u2970",
+ rpar: ")",
+ rpargt: "\u2994",
+ rppolint: "\u2a12",
+ rrarr: "\u21c9",
+ Rrightarrow: "\u21db",
+ rsaquo: "\u203a",
+ rscr: "\ud835\udcc7",
+ Rscr: "\u211b",
+ rsh: "\u21b1",
+ Rsh: "\u21b1",
+ rsqb: "]",
+ rsquo: "\u2019",
+ rsquor: "\u2019",
+ rthree: "\u22cc",
+ rtimes: "\u22ca",
+ rtri: "\u25b9",
+ rtrie: "\u22b5",
+ rtrif: "\u25b8",
+ rtriltri: "\u29ce",
+ RuleDelayed: "\u29f4",
+ ruluhar: "\u2968",
+ rx: "\u211e",
+ Sacute: "\u015a",
+ sacute: "\u015b",
+ sbquo: "\u201a",
+ scap: "\u2ab8",
+ Scaron: "\u0160",
+ scaron: "\u0161",
+ Sc: "\u2abc",
+ sc: "\u227b",
+ sccue: "\u227d",
+ sce: "\u2ab0",
+ scE: "\u2ab4",
+ Scedil: "\u015e",
+ scedil: "\u015f",
+ Scirc: "\u015c",
+ scirc: "\u015d",
+ scnap: "\u2aba",
+ scnE: "\u2ab6",
+ scnsim: "\u22e9",
+ scpolint: "\u2a13",
+ scsim: "\u227f",
+ Scy: "\u0421",
+ scy: "\u0441",
+ sdotb: "\u22a1",
+ sdot: "\u22c5",
+ sdote: "\u2a66",
+ searhk: "\u2925",
+ searr: "\u2198",
+ seArr: "\u21d8",
+ searrow: "\u2198",
+ sect: "\xa7",
+ semi: ";",
+ seswar: "\u2929",
+ setminus: "\u2216",
+ setmn: "\u2216",
+ sext: "\u2736",
+ Sfr: "\ud835\udd16",
+ sfr: "\ud835\udd30",
+ sfrown: "\u2322",
+ sharp: "\u266f",
+ SHCHcy: "\u0429",
+ shchcy: "\u0449",
+ SHcy: "\u0428",
+ shcy: "\u0448",
+ ShortDownArrow: "\u2193",
+ ShortLeftArrow: "\u2190",
+ shortmid: "\u2223",
+ shortparallel: "\u2225",
+ ShortRightArrow: "\u2192",
+ ShortUpArrow: "\u2191",
+ shy: "\xad",
+ Sigma: "\u03a3",
+ sigma: "\u03c3",
+ sigmaf: "\u03c2",
+ sigmav: "\u03c2",
+ sim: "\u223c",
+ simdot: "\u2a6a",
+ sime: "\u2243",
+ simeq: "\u2243",
+ simg: "\u2a9e",
+ simgE: "\u2aa0",
+ siml: "\u2a9d",
+ simlE: "\u2a9f",
+ simne: "\u2246",
+ simplus: "\u2a24",
+ simrarr: "\u2972",
+ slarr: "\u2190",
+ SmallCircle: "\u2218",
+ smallsetminus: "\u2216",
+ smashp: "\u2a33",
+ smeparsl: "\u29e4",
+ smid: "\u2223",
+ smile: "\u2323",
+ smt: "\u2aaa",
+ smte: "\u2aac",
+ smtes: "\u2aac\ufe00",
+ SOFTcy: "\u042c",
+ softcy: "\u044c",
+ solbar: "\u233f",
+ solb: "\u29c4",
+ sol: "/",
+ Sopf: "\ud835\udd4a",
+ sopf: "\ud835\udd64",
+ spades: "\u2660",
+ spadesuit: "\u2660",
+ spar: "\u2225",
+ sqcap: "\u2293",
+ sqcaps: "\u2293\ufe00",
+ sqcup: "\u2294",
+ sqcups: "\u2294\ufe00",
+ Sqrt: "\u221a",
+ sqsub: "\u228f",
+ sqsube: "\u2291",
+ sqsubset: "\u228f",
+ sqsubseteq: "\u2291",
+ sqsup: "\u2290",
+ sqsupe: "\u2292",
+ sqsupset: "\u2290",
+ sqsupseteq: "\u2292",
+ square: "\u25a1",
+ Square: "\u25a1",
+ SquareIntersection: "\u2293",
+ SquareSubset: "\u228f",
+ SquareSubsetEqual: "\u2291",
+ SquareSuperset: "\u2290",
+ SquareSupersetEqual: "\u2292",
+ SquareUnion: "\u2294",
+ squarf: "\u25aa",
+ squ: "\u25a1",
+ squf: "\u25aa",
+ srarr: "\u2192",
+ Sscr: "\ud835\udcae",
+ sscr: "\ud835\udcc8",
+ ssetmn: "\u2216",
+ ssmile: "\u2323",
+ sstarf: "\u22c6",
+ Star: "\u22c6",
+ star: "\u2606",
+ starf: "\u2605",
+ straightepsilon: "\u03f5",
+ straightphi: "\u03d5",
+ strns: "\xaf",
+ sub: "\u2282",
+ Sub: "\u22d0",
+ subdot: "\u2abd",
+ subE: "\u2ac5",
+ sube: "\u2286",
+ subedot: "\u2ac3",
+ submult: "\u2ac1",
+ subnE: "\u2acb",
+ subne: "\u228a",
+ subplus: "\u2abf",
+ subrarr: "\u2979",
+ subset: "\u2282",
+ Subset: "\u22d0",
+ subseteq: "\u2286",
+ subseteqq: "\u2ac5",
+ SubsetEqual: "\u2286",
+ subsetneq: "\u228a",
+ subsetneqq: "\u2acb",
+ subsim: "\u2ac7",
+ subsub: "\u2ad5",
+ subsup: "\u2ad3",
+ succapprox: "\u2ab8",
+ succ: "\u227b",
+ succcurlyeq: "\u227d",
+ Succeeds: "\u227b",
+ SucceedsEqual: "\u2ab0",
+ SucceedsSlantEqual: "\u227d",
+ SucceedsTilde: "\u227f",
+ succeq: "\u2ab0",
+ succnapprox: "\u2aba",
+ succneqq: "\u2ab6",
+ succnsim: "\u22e9",
+ succsim: "\u227f",
+ SuchThat: "\u220b",
+ sum: "\u2211",
+ Sum: "\u2211",
+ sung: "\u266a",
+ sup1: "\xb9",
+ sup2: "\xb2",
+ sup3: "\xb3",
+ sup: "\u2283",
+ Sup: "\u22d1",
+ supdot: "\u2abe",
+ supdsub: "\u2ad8",
+ supE: "\u2ac6",
+ supe: "\u2287",
+ supedot: "\u2ac4",
+ Superset: "\u2283",
+ SupersetEqual: "\u2287",
+ suphsol: "\u27c9",
+ suphsub: "\u2ad7",
+ suplarr: "\u297b",
+ supmult: "\u2ac2",
+ supnE: "\u2acc",
+ supne: "\u228b",
+ supplus: "\u2ac0",
+ supset: "\u2283",
+ Supset: "\u22d1",
+ supseteq: "\u2287",
+ supseteqq: "\u2ac6",
+ supsetneq: "\u228b",
+ supsetneqq: "\u2acc",
+ supsim: "\u2ac8",
+ supsub: "\u2ad4",
+ supsup: "\u2ad6",
+ swarhk: "\u2926",
+ swarr: "\u2199",
+ swArr: "\u21d9",
+ swarrow: "\u2199",
+ swnwar: "\u292a",
+ szlig: "\xdf",
+ Tab: "\t",
+ target: "\u2316",
+ Tau: "\u03a4",
+ tau: "\u03c4",
+ tbrk: "\u23b4",
+ Tcaron: "\u0164",
+ tcaron: "\u0165",
+ Tcedil: "\u0162",
+ tcedil: "\u0163",
+ Tcy: "\u0422",
+ tcy: "\u0442",
+ tdot: "\u20db",
+ telrec: "\u2315",
+ Tfr: "\ud835\udd17",
+ tfr: "\ud835\udd31",
+ there4: "\u2234",
+ therefore: "\u2234",
+ Therefore: "\u2234",
+ Theta: "\u0398",
+ theta: "\u03b8",
+ thetasym: "\u03d1",
+ thetav: "\u03d1",
+ thickapprox: "\u2248",
+ thicksim: "\u223c",
+ ThickSpace: "\u205f\u200a",
+ ThinSpace: "\u2009",
+ thinsp: "\u2009",
+ thkap: "\u2248",
+ thksim: "\u223c",
+ THORN: "\xde",
+ thorn: "\xfe",
+ tilde: "\u02dc",
+ Tilde: "\u223c",
+ TildeEqual: "\u2243",
+ TildeFullEqual: "\u2245",
+ TildeTilde: "\u2248",
+ timesbar: "\u2a31",
+ timesb: "\u22a0",
+ times: "\xd7",
+ timesd: "\u2a30",
+ tint: "\u222d",
+ toea: "\u2928",
+ topbot: "\u2336",
+ topcir: "\u2af1",
+ top: "\u22a4",
+ Topf: "\ud835\udd4b",
+ topf: "\ud835\udd65",
+ topfork: "\u2ada",
+ tosa: "\u2929",
+ tprime: "\u2034",
+ trade: "\u2122",
+ TRADE: "\u2122",
+ triangle: "\u25b5",
+ triangledown: "\u25bf",
+ triangleleft: "\u25c3",
+ trianglelefteq: "\u22b4",
+ triangleq: "\u225c",
+ triangleright: "\u25b9",
+ trianglerighteq: "\u22b5",
+ tridot: "\u25ec",
+ trie: "\u225c",
+ triminus: "\u2a3a",
+ TripleDot: "\u20db",
+ triplus: "\u2a39",
+ trisb: "\u29cd",
+ tritime: "\u2a3b",
+ trpezium: "\u23e2",
+ Tscr: "\ud835\udcaf",
+ tscr: "\ud835\udcc9",
+ TScy: "\u0426",
+ tscy: "\u0446",
+ TSHcy: "\u040b",
+ tshcy: "\u045b",
+ Tstrok: "\u0166",
+ tstrok: "\u0167",
+ twixt: "\u226c",
+ twoheadleftarrow: "\u219e",
+ twoheadrightarrow: "\u21a0",
+ Uacute: "\xda",
+ uacute: "\xfa",
+ uarr: "\u2191",
+ Uarr: "\u219f",
+ uArr: "\u21d1",
+ Uarrocir: "\u2949",
+ Ubrcy: "\u040e",
+ ubrcy: "\u045e",
+ Ubreve: "\u016c",
+ ubreve: "\u016d",
+ Ucirc: "\xdb",
+ ucirc: "\xfb",
+ Ucy: "\u0423",
+ ucy: "\u0443",
+ udarr: "\u21c5",
+ Udblac: "\u0170",
+ udblac: "\u0171",
+ udhar: "\u296e",
+ ufisht: "\u297e",
+ Ufr: "\ud835\udd18",
+ ufr: "\ud835\udd32",
+ Ugrave: "\xd9",
+ ugrave: "\xf9",
+ uHar: "\u2963",
+ uharl: "\u21bf",
+ uharr: "\u21be",
+ uhblk: "\u2580",
+ ulcorn: "\u231c",
+ ulcorner: "\u231c",
+ ulcrop: "\u230f",
+ ultri: "\u25f8",
+ Umacr: "\u016a",
+ umacr: "\u016b",
+ uml: "\xa8",
+ UnderBar: "_",
+ UnderBrace: "\u23df",
+ UnderBracket: "\u23b5",
+ UnderParenthesis: "\u23dd",
+ Union: "\u22c3",
+ UnionPlus: "\u228e",
+ Uogon: "\u0172",
+ uogon: "\u0173",
+ Uopf: "\ud835\udd4c",
+ uopf: "\ud835\udd66",
+ UpArrowBar: "\u2912",
+ uparrow: "\u2191",
+ UpArrow: "\u2191",
+ Uparrow: "\u21d1",
+ UpArrowDownArrow: "\u21c5",
+ updownarrow: "\u2195",
+ UpDownArrow: "\u2195",
+ Updownarrow: "\u21d5",
+ UpEquilibrium: "\u296e",
+ upharpoonleft: "\u21bf",
+ upharpoonright: "\u21be",
+ uplus: "\u228e",
+ UpperLeftArrow: "\u2196",
+ UpperRightArrow: "\u2197",
+ upsi: "\u03c5",
+ Upsi: "\u03d2",
+ upsih: "\u03d2",
+ Upsilon: "\u03a5",
+ upsilon: "\u03c5",
+ UpTeeArrow: "\u21a5",
+ UpTee: "\u22a5",
+ upuparrows: "\u21c8",
+ urcorn: "\u231d",
+ urcorner: "\u231d",
+ urcrop: "\u230e",
+ Uring: "\u016e",
+ uring: "\u016f",
+ urtri: "\u25f9",
+ Uscr: "\ud835\udcb0",
+ uscr: "\ud835\udcca",
+ utdot: "\u22f0",
+ Utilde: "\u0168",
+ utilde: "\u0169",
+ utri: "\u25b5",
+ utrif: "\u25b4",
+ uuarr: "\u21c8",
+ Uuml: "\xdc",
+ uuml: "\xfc",
+ uwangle: "\u29a7",
+ vangrt: "\u299c",
+ varepsilon: "\u03f5",
+ varkappa: "\u03f0",
+ varnothing: "\u2205",
+ varphi: "\u03d5",
+ varpi: "\u03d6",
+ varpropto: "\u221d",
+ varr: "\u2195",
+ vArr: "\u21d5",
+ varrho: "\u03f1",
+ varsigma: "\u03c2",
+ varsubsetneq: "\u228a\ufe00",
+ varsubsetneqq: "\u2acb\ufe00",
+ varsupsetneq: "\u228b\ufe00",
+ varsupsetneqq: "\u2acc\ufe00",
+ vartheta: "\u03d1",
+ vartriangleleft: "\u22b2",
+ vartriangleright: "\u22b3",
+ vBar: "\u2ae8",
+ Vbar: "\u2aeb",
+ vBarv: "\u2ae9",
+ Vcy: "\u0412",
+ vcy: "\u0432",
+ vdash: "\u22a2",
+ vDash: "\u22a8",
+ Vdash: "\u22a9",
+ VDash: "\u22ab",
+ Vdashl: "\u2ae6",
+ veebar: "\u22bb",
+ vee: "\u2228",
+ Vee: "\u22c1",
+ veeeq: "\u225a",
+ vellip: "\u22ee",
+ verbar: "|",
+ Verbar: "\u2016",
+ vert: "|",
+ Vert: "\u2016",
+ VerticalBar: "\u2223",
+ VerticalLine: "|",
+ VerticalSeparator: "\u2758",
+ VerticalTilde: "\u2240",
+ VeryThinSpace: "\u200a",
+ Vfr: "\ud835\udd19",
+ vfr: "\ud835\udd33",
+ vltri: "\u22b2",
+ vnsub: "\u2282\u20d2",
+ vnsup: "\u2283\u20d2",
+ Vopf: "\ud835\udd4d",
+ vopf: "\ud835\udd67",
+ vprop: "\u221d",
+ vrtri: "\u22b3",
+ Vscr: "\ud835\udcb1",
+ vscr: "\ud835\udccb",
+ vsubnE: "\u2acb\ufe00",
+ vsubne: "\u228a\ufe00",
+ vsupnE: "\u2acc\ufe00",
+ vsupne: "\u228b\ufe00",
+ Vvdash: "\u22aa",
+ vzigzag: "\u299a",
+ Wcirc: "\u0174",
+ wcirc: "\u0175",
+ wedbar: "\u2a5f",
+ wedge: "\u2227",
+ Wedge: "\u22c0",
+ wedgeq: "\u2259",
+ weierp: "\u2118",
+ Wfr: "\ud835\udd1a",
+ wfr: "\ud835\udd34",
+ Wopf: "\ud835\udd4e",
+ wopf: "\ud835\udd68",
+ wp: "\u2118",
+ wr: "\u2240",
+ wreath: "\u2240",
+ Wscr: "\ud835\udcb2",
+ wscr: "\ud835\udccc",
+ xcap: "\u22c2",
+ xcirc: "\u25ef",
+ xcup: "\u22c3",
+ xdtri: "\u25bd",
+ Xfr: "\ud835\udd1b",
+ xfr: "\ud835\udd35",
+ xharr: "\u27f7",
+ xhArr: "\u27fa",
+ Xi: "\u039e",
+ xi: "\u03be",
+ xlarr: "\u27f5",
+ xlArr: "\u27f8",
+ xmap: "\u27fc",
+ xnis: "\u22fb",
+ xodot: "\u2a00",
+ Xopf: "\ud835\udd4f",
+ xopf: "\ud835\udd69",
+ xoplus: "\u2a01",
+ xotime: "\u2a02",
+ xrarr: "\u27f6",
+ xrArr: "\u27f9",
+ Xscr: "\ud835\udcb3",
+ xscr: "\ud835\udccd",
+ xsqcup: "\u2a06",
+ xuplus: "\u2a04",
+ xutri: "\u25b3",
+ xvee: "\u22c1",
+ xwedge: "\u22c0",
+ Yacute: "\xdd",
+ yacute: "\xfd",
+ YAcy: "\u042f",
+ yacy: "\u044f",
+ Ycirc: "\u0176",
+ ycirc: "\u0177",
+ Ycy: "\u042b",
+ ycy: "\u044b",
+ yen: "\xa5",
+ Yfr: "\ud835\udd1c",
+ yfr: "\ud835\udd36",
+ YIcy: "\u0407",
+ yicy: "\u0457",
+ Yopf: "\ud835\udd50",
+ yopf: "\ud835\udd6a",
+ Yscr: "\ud835\udcb4",
+ yscr: "\ud835\udcce",
+ YUcy: "\u042e",
+ yucy: "\u044e",
+ yuml: "\xff",
+ Yuml: "\u0178",
+ Zacute: "\u0179",
+ zacute: "\u017a",
+ Zcaron: "\u017d",
+ zcaron: "\u017e",
+ Zcy: "\u0417",
+ zcy: "\u0437",
+ Zdot: "\u017b",
+ zdot: "\u017c",
+ zeetrf: "\u2128",
+ ZeroWidthSpace: "\u200b",
+ Zeta: "\u0396",
+ zeta: "\u03b6",
+ zfr: "\ud835\udd37",
+ Zfr: "\u2128",
+ ZHcy: "\u0416",
+ zhcy: "\u0436",
+ zigrarr: "\u21dd",
+ zopf: "\ud835\udd6b",
+ Zopf: "\u2124",
+ Zscr: "\ud835\udcb5",
+ zscr: "\ud835\udccf",
+ zwj: "\u200d",
+ zwnj: "\u200c"
+ };
+ /*eslint quotes:0*/ var entities = require$$0;
+ var regex$4 = /[!-#%-\*,-\/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0A76\u0AF0\u0C84\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E4E\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD803[\uDF55-\uDF59]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC8\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDC3B\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71\uDEF7\uDEF8]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD81B[\uDE97-\uDE9A]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/;
+ var encodeCache = {};
+ // Create a lookup array where anything but characters in `chars` string
+ // and alphanumeric chars is percent-encoded.
+
+ function getEncodeCache(exclude) {
+ var i, ch, cache = encodeCache[exclude];
+ if (cache) {
+ return cache;
+ }
+ cache = encodeCache[exclude] = [];
+ for (i = 0; i < 128; i++) {
+ ch = String.fromCharCode(i);
+ if (/^[0-9a-z]$/i.test(ch)) {
+ // always allow unencoded alphanumeric characters
+ cache.push(ch);
+ } else {
+ cache.push("%" + ("0" + i.toString(16).toUpperCase()).slice(-2));
+ }
+ }
+ for (i = 0; i < exclude.length; i++) {
+ cache[exclude.charCodeAt(i)] = exclude[i];
+ }
+ return cache;
+ }
+ // Encode unsafe characters with percent-encoding, skipping already
+ // encoded sequences.
+
+ // - string - string to encode
+ // - exclude - list of characters to ignore (in addition to a-zA-Z0-9)
+ // - keepEscaped - don't encode '%' in a correct escape sequence (default: true)
+
+ function encode$2(string, exclude, keepEscaped) {
+ var i, l, code, nextCode, cache, result = "";
+ if (typeof exclude !== "string") {
+ // encode(string, keepEscaped)
+ keepEscaped = exclude;
+ exclude = encode$2.defaultChars;
+ }
+ if (typeof keepEscaped === "undefined") {
+ keepEscaped = true;
+ }
+ cache = getEncodeCache(exclude);
+ for (i = 0, l = string.length; i < l; i++) {
+ code = string.charCodeAt(i);
+ if (keepEscaped && code === 37 /* % */ && i + 2 < l) {
+ if (/^[0-9a-f]{2}$/i.test(string.slice(i + 1, i + 3))) {
+ result += string.slice(i, i + 3);
+ i += 2;
+ continue;
+ }
+ }
+ if (code < 128) {
+ result += cache[code];
+ continue;
+ }
+ if (code >= 55296 && code <= 57343) {
+ if (code >= 55296 && code <= 56319 && i + 1 < l) {
+ nextCode = string.charCodeAt(i + 1);
+ if (nextCode >= 56320 && nextCode <= 57343) {
+ result += encodeURIComponent(string[i] + string[i + 1]);
+ i++;
+ continue;
+ }
+ }
+ result += "%EF%BF%BD";
+ continue;
+ }
+ result += encodeURIComponent(string[i]);
+ }
+ return result;
+ }
+ encode$2.defaultChars = ";/?:@&=+$,-_.!~*'()#";
+ encode$2.componentChars = "-_.!~*'()";
+ var encode_1 = encode$2;
+ /* eslint-disable no-bitwise */ var decodeCache = {};
+ function getDecodeCache(exclude) {
+ var i, ch, cache = decodeCache[exclude];
+ if (cache) {
+ return cache;
+ }
+ cache = decodeCache[exclude] = [];
+ for (i = 0; i < 128; i++) {
+ ch = String.fromCharCode(i);
+ cache.push(ch);
+ }
+ for (i = 0; i < exclude.length; i++) {
+ ch = exclude.charCodeAt(i);
+ cache[ch] = "%" + ("0" + ch.toString(16).toUpperCase()).slice(-2);
+ }
+ return cache;
+ }
+ // Decode percent-encoded string.
+
+ function decode$2(string, exclude) {
+ var cache;
+ if (typeof exclude !== "string") {
+ exclude = decode$2.defaultChars;
+ }
+ cache = getDecodeCache(exclude);
+ return string.replace(/(%[a-f0-9]{2})+/gi, (function(seq) {
+ var i, l, b1, b2, b3, b4, chr, result = "";
+ for (i = 0, l = seq.length; i < l; i += 3) {
+ b1 = parseInt(seq.slice(i + 1, i + 3), 16);
+ if (b1 < 128) {
+ result += cache[b1];
+ continue;
+ }
+ if ((b1 & 224) === 192 && i + 3 < l) {
+ // 110xxxxx 10xxxxxx
+ b2 = parseInt(seq.slice(i + 4, i + 6), 16);
+ if ((b2 & 192) === 128) {
+ chr = b1 << 6 & 1984 | b2 & 63;
+ if (chr < 128) {
+ result += "\ufffd\ufffd";
+ } else {
+ result += String.fromCharCode(chr);
+ }
+ i += 3;
+ continue;
+ }
+ }
+ if ((b1 & 240) === 224 && i + 6 < l) {
+ // 1110xxxx 10xxxxxx 10xxxxxx
+ b2 = parseInt(seq.slice(i + 4, i + 6), 16);
+ b3 = parseInt(seq.slice(i + 7, i + 9), 16);
+ if ((b2 & 192) === 128 && (b3 & 192) === 128) {
+ chr = b1 << 12 & 61440 | b2 << 6 & 4032 | b3 & 63;
+ if (chr < 2048 || chr >= 55296 && chr <= 57343) {
+ result += "\ufffd\ufffd\ufffd";
+ } else {
+ result += String.fromCharCode(chr);
+ }
+ i += 6;
+ continue;
+ }
+ }
+ if ((b1 & 248) === 240 && i + 9 < l) {
+ // 111110xx 10xxxxxx 10xxxxxx 10xxxxxx
+ b2 = parseInt(seq.slice(i + 4, i + 6), 16);
+ b3 = parseInt(seq.slice(i + 7, i + 9), 16);
+ b4 = parseInt(seq.slice(i + 10, i + 12), 16);
+ if ((b2 & 192) === 128 && (b3 & 192) === 128 && (b4 & 192) === 128) {
+ chr = b1 << 18 & 1835008 | b2 << 12 & 258048 | b3 << 6 & 4032 | b4 & 63;
+ if (chr < 65536 || chr > 1114111) {
+ result += "\ufffd\ufffd\ufffd\ufffd";
+ } else {
+ chr -= 65536;
+ result += String.fromCharCode(55296 + (chr >> 10), 56320 + (chr & 1023));
+ }
+ i += 9;
+ continue;
+ }
+ }
+ result += "\ufffd";
+ }
+ return result;
+ }));
+ }
+ decode$2.defaultChars = ";/?:@&=+$,#";
+ decode$2.componentChars = "";
+ var decode_1 = decode$2;
+ var format$1 = function format(url) {
+ var result = "";
+ result += url.protocol || "";
+ result += url.slashes ? "//" : "";
+ result += url.auth ? url.auth + "@" : "";
+ if (url.hostname && url.hostname.indexOf(":") !== -1) {
+ // ipv6 address
+ result += "[" + url.hostname + "]";
+ } else {
+ result += url.hostname || "";
+ }
+ result += url.port ? ":" + url.port : "";
+ result += url.pathname || "";
+ result += url.search || "";
+ result += url.hash || "";
+ return result;
+ };
+ // Copyright Joyent, Inc. and other Node contributors.
+
+ // Changes from joyent/node:
+
+ // 1. No leading slash in paths,
+ // e.g. in `url.parse('http://foo?bar')` pathname is ``, not `/`
+
+ // 2. Backslashes are not replaced with slashes,
+ // so `http:\\example.org\` is treated like a relative path
+
+ // 3. Trailing colon is treated like a part of the path,
+ // i.e. in `http://example.org:foo` pathname is `:foo`
+
+ // 4. Nothing is URL-encoded in the resulting object,
+ // (in joyent/node some chars in auth and paths are encoded)
+
+ // 5. `url.parse()` does not have `parseQueryString` argument
+
+ // 6. Removed extraneous result properties: `host`, `path`, `query`, etc.,
+ // which can be constructed using other parts of the url.
+
+ function Url() {
+ this.protocol = null;
+ this.slashes = null;
+ this.auth = null;
+ this.port = null;
+ this.hostname = null;
+ this.hash = null;
+ this.search = null;
+ this.pathname = null;
+ }
+ // Reference: RFC 3986, RFC 1808, RFC 2396
+ // define these here so at least they only have to be
+ // compiled once on the first module load.
+ var protocolPattern = /^([a-z0-9.+-]+:)/i, portPattern = /:[0-9]*$/,
+ // Special case for a simple path URL
+ simplePathPattern = /^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/,
+ // RFC 2396: characters reserved for delimiting URLs.
+ // We actually just auto-escape these.
+ delims = [ "<", ">", '"', "`", " ", "\r", "\n", "\t" ],
+ // RFC 2396: characters not allowed for various reasons.
+ unwise = [ "{", "}", "|", "\\", "^", "`" ].concat(delims),
+ // Allowed by RFCs, but cause of XSS attacks. Always escape these.
+ autoEscape = [ "'" ].concat(unwise),
+ // Characters that are never ever allowed in a hostname.
+ // Note that any invalid chars are also handled, but these
+ // are the ones that are *expected* to be seen, so we fast-path
+ // them.
+ nonHostChars = [ "%", "/", "?", ";", "#" ].concat(autoEscape), hostEndingChars = [ "/", "?", "#" ], hostnameMaxLen = 255, hostnamePartPattern = /^[+a-z0-9A-Z_-]{0,63}$/, hostnamePartStart = /^([+a-z0-9A-Z_-]{0,63})(.*)$/,
+ // protocols that can allow "unsafe" and "unwise" chars.
+ /* eslint-disable no-script-url */
+ // protocols that never have a hostname.
+ hostlessProtocol = {
+ javascript: true,
+ "javascript:": true
+ },
+ // protocols that always contain a // bit.
+ slashedProtocol = {
+ http: true,
+ https: true,
+ ftp: true,
+ gopher: true,
+ file: true,
+ "http:": true,
+ "https:": true,
+ "ftp:": true,
+ "gopher:": true,
+ "file:": true
+ };
+ /* eslint-enable no-script-url */ function urlParse(url, slashesDenoteHost) {
+ if (url && url instanceof Url) {
+ return url;
+ }
+ var u = new Url;
+ u.parse(url, slashesDenoteHost);
+ return u;
+ }
+ Url.prototype.parse = function(url, slashesDenoteHost) {
+ var i, l, lowerProto, hec, slashes, rest = url;
+ // trim before proceeding.
+ // This is to support parse stuff like " http://foo.com \n"
+ rest = rest.trim();
+ if (!slashesDenoteHost && url.split("#").length === 1) {
+ // Try fast path regexp
+ var simplePath = simplePathPattern.exec(rest);
+ if (simplePath) {
+ this.pathname = simplePath[1];
+ if (simplePath[2]) {
+ this.search = simplePath[2];
+ }
+ return this;
+ }
+ }
+ var proto = protocolPattern.exec(rest);
+ if (proto) {
+ proto = proto[0];
+ lowerProto = proto.toLowerCase();
+ this.protocol = proto;
+ rest = rest.substr(proto.length);
+ }
+ // figure out if it's got a host
+ // user@server is *always* interpreted as a hostname, and url
+ // resolution will treat //foo/bar as host=foo,path=bar because that's
+ // how the browser resolves relative URLs.
+ if (slashesDenoteHost || proto || rest.match(/^\/\/[^@\/]+@[^@\/]+/)) {
+ slashes = rest.substr(0, 2) === "//";
+ if (slashes && !(proto && hostlessProtocol[proto])) {
+ rest = rest.substr(2);
+ this.slashes = true;
+ }
+ }
+ if (!hostlessProtocol[proto] && (slashes || proto && !slashedProtocol[proto])) {
+ // there's a hostname.
+ // the first instance of /, ?, ;, or # ends the host.
+ // If there is an @ in the hostname, then non-host chars *are* allowed
+ // to the left of the last @ sign, unless some host-ending character
+ // comes *before* the @-sign.
+ // URLs are obnoxious.
+ // ex:
+ // http://a@b@c/ => user:a@b host:c
+ // http://a@b?@c => user:a host:c path:/?@c
+ // v0.12 TODO(isaacs): This is not quite how Chrome does things.
+ // Review our test case against browsers more comprehensively.
+ // find the first instance of any hostEndingChars
+ var hostEnd = -1;
+ for (i = 0; i < hostEndingChars.length; i++) {
+ hec = rest.indexOf(hostEndingChars[i]);
+ if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) {
+ hostEnd = hec;
+ }
+ }
+ // at this point, either we have an explicit point where the
+ // auth portion cannot go past, or the last @ char is the decider.
+ var auth, atSign;
+ if (hostEnd === -1) {
+ // atSign can be anywhere.
+ atSign = rest.lastIndexOf("@");
+ } else {
+ // atSign must be in auth portion.
+ // http://a@b/c@d => host:b auth:a path:/c@d
+ atSign = rest.lastIndexOf("@", hostEnd);
+ }
+ // Now we have a portion which is definitely the auth.
+ // Pull that off.
+ if (atSign !== -1) {
+ auth = rest.slice(0, atSign);
+ rest = rest.slice(atSign + 1);
+ this.auth = auth;
+ }
+ // the host is the remaining to the left of the first non-host char
+ hostEnd = -1;
+ for (i = 0; i < nonHostChars.length; i++) {
+ hec = rest.indexOf(nonHostChars[i]);
+ if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) {
+ hostEnd = hec;
+ }
+ }
+ // if we still have not hit it, then the entire thing is a host.
+ if (hostEnd === -1) {
+ hostEnd = rest.length;
+ }
+ if (rest[hostEnd - 1] === ":") {
+ hostEnd--;
+ }
+ var host = rest.slice(0, hostEnd);
+ rest = rest.slice(hostEnd);
+ // pull out port.
+ this.parseHost(host);
+ // we've indicated that there is a hostname,
+ // so even if it's empty, it has to be present.
+ this.hostname = this.hostname || "";
+ // if hostname begins with [ and ends with ]
+ // assume that it's an IPv6 address.
+ var ipv6Hostname = this.hostname[0] === "[" && this.hostname[this.hostname.length - 1] === "]";
+ // validate a little.
+ if (!ipv6Hostname) {
+ var hostparts = this.hostname.split(/\./);
+ for (i = 0, l = hostparts.length; i < l; i++) {
+ var part = hostparts[i];
+ if (!part) {
+ continue;
+ }
+ if (!part.match(hostnamePartPattern)) {
+ var newpart = "";
+ for (var j = 0, k = part.length; j < k; j++) {
+ if (part.charCodeAt(j) > 127) {
+ // we replace non-ASCII char with a temporary placeholder
+ // we need this to make sure size of hostname is not
+ // broken by replacing non-ASCII by nothing
+ newpart += "x";
+ } else {
+ newpart += part[j];
+ }
+ }
+ // we test again with ASCII char only
+ if (!newpart.match(hostnamePartPattern)) {
+ var validParts = hostparts.slice(0, i);
+ var notHost = hostparts.slice(i + 1);
+ var bit = part.match(hostnamePartStart);
+ if (bit) {
+ validParts.push(bit[1]);
+ notHost.unshift(bit[2]);
+ }
+ if (notHost.length) {
+ rest = notHost.join(".") + rest;
+ }
+ this.hostname = validParts.join(".");
+ break;
+ }
+ }
+ }
+ }
+ if (this.hostname.length > hostnameMaxLen) {
+ this.hostname = "";
+ }
+ // strip [ and ] from the hostname
+ // the host field still retains them, though
+ if (ipv6Hostname) {
+ this.hostname = this.hostname.substr(1, this.hostname.length - 2);
+ }
+ }
+ // chop off from the tail first.
+ var hash = rest.indexOf("#");
+ if (hash !== -1) {
+ // got a fragment string.
+ this.hash = rest.substr(hash);
+ rest = rest.slice(0, hash);
+ }
+ var qm = rest.indexOf("?");
+ if (qm !== -1) {
+ this.search = rest.substr(qm);
+ rest = rest.slice(0, qm);
+ }
+ if (rest) {
+ this.pathname = rest;
+ }
+ if (slashedProtocol[lowerProto] && this.hostname && !this.pathname) {
+ this.pathname = "";
+ }
+ return this;
+ };
+ Url.prototype.parseHost = function(host) {
+ var port = portPattern.exec(host);
+ if (port) {
+ port = port[0];
+ if (port !== ":") {
+ this.port = port.substr(1);
+ }
+ host = host.substr(0, host.length - port.length);
+ }
+ if (host) {
+ this.hostname = host;
+ }
+ };
+ var parse$1 = urlParse;
+ var encode$1 = encode_1;
+ var decode$1 = decode_1;
+ var format = format$1;
+ var parse = parse$1;
+ var mdurl = {
+ encode: encode$1,
+ decode: decode$1,
+ format: format,
+ parse: parse
+ };
+ var regex$3 = /[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/;
+ var regex$2 = /[\0-\x1F\x7F-\x9F]/;
+ var regex$1 = /[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804[\uDCBD\uDCCD]|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/;
+ var regex = /[ \xA0\u1680\u2000-\u200A\u2028\u2029\u202F\u205F\u3000]/;
+ var Any = regex$3;
+ var Cc = regex$2;
+ var Cf = regex$1;
+ var P = regex$4;
+ var Z = regex;
+ var uc_micro = {
+ Any: Any,
+ Cc: Cc,
+ Cf: Cf,
+ P: P,
+ Z: Z
+ };
+ var utils = createCommonjsModule((function(module, exports) {
+ function _class(obj) {
+ return Object.prototype.toString.call(obj);
+ }
+ function isString(obj) {
+ return _class(obj) === "[object String]";
+ }
+ var _hasOwnProperty = Object.prototype.hasOwnProperty;
+ function has(object, key) {
+ return _hasOwnProperty.call(object, key);
+ }
+ // Merge objects
+
+ function assign(obj /*from1, from2, from3, ...*/) {
+ var sources = Array.prototype.slice.call(arguments, 1);
+ sources.forEach((function(source) {
+ if (!source) {
+ return;
+ }
+ if (typeof source !== "object") {
+ throw new TypeError(source + "must be object");
+ }
+ Object.keys(source).forEach((function(key) {
+ obj[key] = source[key];
+ }));
+ }));
+ return obj;
+ }
+ // Remove element from array and put another array at those position.
+ // Useful for some operations with tokens
+ function arrayReplaceAt(src, pos, newElements) {
+ return [].concat(src.slice(0, pos), newElements, src.slice(pos + 1));
+ }
+ ////////////////////////////////////////////////////////////////////////////////
+ function isValidEntityCode(c) {
+ /*eslint no-bitwise:0*/
+ // broken sequence
+ if (c >= 55296 && c <= 57343) {
+ return false;
+ }
+ // never used
+ if (c >= 64976 && c <= 65007) {
+ return false;
+ }
+ if ((c & 65535) === 65535 || (c & 65535) === 65534) {
+ return false;
+ }
+ // control codes
+ if (c >= 0 && c <= 8) {
+ return false;
+ }
+ if (c === 11) {
+ return false;
+ }
+ if (c >= 14 && c <= 31) {
+ return false;
+ }
+ if (c >= 127 && c <= 159) {
+ return false;
+ }
+ // out of range
+ if (c > 1114111) {
+ return false;
+ }
+ return true;
+ }
+ function fromCodePoint(c) {
+ /*eslint no-bitwise:0*/
+ if (c > 65535) {
+ c -= 65536;
+ var surrogate1 = 55296 + (c >> 10), surrogate2 = 56320 + (c & 1023);
+ return String.fromCharCode(surrogate1, surrogate2);
+ }
+ return String.fromCharCode(c);
+ }
+ var UNESCAPE_MD_RE = /\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g;
+ var ENTITY_RE = /&([a-z#][a-z0-9]{1,31});/gi;
+ var UNESCAPE_ALL_RE = new RegExp(UNESCAPE_MD_RE.source + "|" + ENTITY_RE.source, "gi");
+ var DIGITAL_ENTITY_TEST_RE = /^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i;
+ function replaceEntityPattern(match, name) {
+ var code = 0;
+ if (has(entities, name)) {
+ return entities[name];
+ }
+ if (name.charCodeAt(0) === 35 /* # */ && DIGITAL_ENTITY_TEST_RE.test(name)) {
+ code = name[1].toLowerCase() === "x" ? parseInt(name.slice(2), 16) : parseInt(name.slice(1), 10);
+ if (isValidEntityCode(code)) {
+ return fromCodePoint(code);
+ }
+ }
+ return match;
+ }
+ /*function replaceEntities(str) {
+ if (str.indexOf('&') < 0) { return str; }
+
+ return str.replace(ENTITY_RE, replaceEntityPattern);
+ }*/ function unescapeMd(str) {
+ if (str.indexOf("\\") < 0) {
+ return str;
+ }
+ return str.replace(UNESCAPE_MD_RE, "$1");
+ }
+ function unescapeAll(str) {
+ if (str.indexOf("\\") < 0 && str.indexOf("&") < 0) {
+ return str;
+ }
+ return str.replace(UNESCAPE_ALL_RE, (function(match, escaped, entity) {
+ if (escaped) {
+ return escaped;
+ }
+ return replaceEntityPattern(match, entity);
+ }));
+ }
+ ////////////////////////////////////////////////////////////////////////////////
+ var HTML_ESCAPE_TEST_RE = /[&<>"]/;
+ var HTML_ESCAPE_REPLACE_RE = /[&<>"]/g;
+ var HTML_REPLACEMENTS = {
+ "&": "&amp;",
+ "<": "&lt;",
+ ">": "&gt;",
+ '"': "&quot;"
+ };
+ function replaceUnsafeChar(ch) {
+ return HTML_REPLACEMENTS[ch];
+ }
+ function escapeHtml(str) {
+ if (HTML_ESCAPE_TEST_RE.test(str)) {
+ return str.replace(HTML_ESCAPE_REPLACE_RE, replaceUnsafeChar);
+ }
+ return str;
+ }
+ ////////////////////////////////////////////////////////////////////////////////
+ var REGEXP_ESCAPE_RE = /[.?*+^$[\]\\(){}|-]/g;
+ function escapeRE(str) {
+ return str.replace(REGEXP_ESCAPE_RE, "\\$&");
+ }
+ ////////////////////////////////////////////////////////////////////////////////
+ function isSpace(code) {
+ switch (code) {
+ case 9:
+ case 32:
+ return true;
+ }
+ return false;
+ }
+ // Zs (unicode class) || [\t\f\v\r\n]
+ function isWhiteSpace(code) {
+ if (code >= 8192 && code <= 8202) {
+ return true;
+ }
+ switch (code) {
+ case 9:
+ // \t
+ case 10:
+ // \n
+ case 11:
+ // \v
+ case 12:
+ // \f
+ case 13:
+ // \r
+ case 32:
+ case 160:
+ case 5760:
+ case 8239:
+ case 8287:
+ case 12288:
+ return true;
+ }
+ return false;
+ }
+ ////////////////////////////////////////////////////////////////////////////////
+ /*eslint-disable max-len*/
+ // Currently without astral characters support.
+ function isPunctChar(ch) {
+ return regex$4.test(ch);
+ }
+ // Markdown ASCII punctuation characters.
+
+ // !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~
+ // http://spec.commonmark.org/0.15/#ascii-punctuation-character
+
+ // Don't confuse with unicode punctuation !!! It lacks some chars in ascii range.
+
+ function isMdAsciiPunct(ch) {
+ switch (ch) {
+ case 33 /* ! */ :
+ case 34 /* " */ :
+ case 35 /* # */ :
+ case 36 /* $ */ :
+ case 37 /* % */ :
+ case 38 /* & */ :
+ case 39 /* ' */ :
+ case 40 /* ( */ :
+ case 41 /* ) */ :
+ case 42 /* * */ :
+ case 43 /* + */ :
+ case 44 /* , */ :
+ case 45 /* - */ :
+ case 46 /* . */ :
+ case 47 /* / */ :
+ case 58 /* : */ :
+ case 59 /* ; */ :
+ case 60 /* < */ :
+ case 61 /* = */ :
+ case 62 /* > */ :
+ case 63 /* ? */ :
+ case 64 /* @ */ :
+ case 91 /* [ */ :
+ case 92 /* \ */ :
+ case 93 /* ] */ :
+ case 94 /* ^ */ :
+ case 95 /* _ */ :
+ case 96 /* ` */ :
+ case 123 /* { */ :
+ case 124 /* | */ :
+ case 125 /* } */ :
+ case 126 /* ~ */ :
+ return true;
+
+ default:
+ return false;
+ }
+ }
+ // Hepler to unify [reference labels].
+
+ function normalizeReference(str) {
+ // Trim and collapse whitespace
+ str = str.trim().replace(/\s+/g, " ");
+ // In node v10 'ẞ'.toLowerCase() === 'Ṿ', which is presumed to be a bug
+ // fixed in v12 (couldn't find any details).
+
+ // So treat this one as a special case
+ // (remove this when node v10 is no longer supported).
+
+ if ("\u1e9e".toLowerCase() === "\u1e7e") {
+ str = str.replace(/\u1e9e/g, "\xdf");
+ }
+ // .toLowerCase().toUpperCase() should get rid of all differences
+ // between letter variants.
+
+ // Simple .toLowerCase() doesn't normalize 125 code points correctly,
+ // and .toUpperCase doesn't normalize 6 of them (list of exceptions:
+ // İ, ϴ, ẞ, Ω, K, Å - those are already uppercased, but have differently
+ // uppercased versions).
+
+ // Here's an example showing how it happens. Lets take greek letter omega:
+ // uppercase U+0398 (Θ), U+03f4 (ϴ) and lowercase U+03b8 (θ), U+03d1 (ϑ)
+
+ // Unicode entries:
+ // 0398;GREEK CAPITAL LETTER THETA;Lu;0;L;;;;;N;;;;03B8;
+ // 03B8;GREEK SMALL LETTER THETA;Ll;0;L;;;;;N;;;0398;;0398
+ // 03D1;GREEK THETA SYMBOL;Ll;0;L;<compat> 03B8;;;;N;GREEK SMALL LETTER SCRIPT THETA;;0398;;0398
+ // 03F4;GREEK CAPITAL THETA SYMBOL;Lu;0;L;<compat> 0398;;;;N;;;;03B8;
+
+ // Case-insensitive comparison should treat all of them as equivalent.
+
+ // But .toLowerCase() doesn't change ϑ (it's already lowercase),
+ // and .toUpperCase() doesn't change ϴ (already uppercase).
+
+ // Applying first lower then upper case normalizes any character:
+ // '\u0398\u03f4\u03b8\u03d1'.toLowerCase().toUpperCase() === '\u0398\u0398\u0398\u0398'
+
+ // Note: this is equivalent to unicode case folding; unicode normalization
+ // is a different step that is not required here.
+
+ // Final result should be uppercased, because it's later stored in an object
+ // (this avoid a conflict with Object.prototype members,
+ // most notably, `__proto__`)
+
+ return str.toLowerCase().toUpperCase();
+ }
+ ////////////////////////////////////////////////////////////////////////////////
+ // Re-export libraries commonly used in both markdown-it and its plugins,
+ // so plugins won't have to depend on them explicitly, which reduces their
+ // bundled size (e.g. a browser build).
+
+ exports.lib = {};
+ exports.lib.mdurl = mdurl;
+ exports.lib.ucmicro = uc_micro;
+ exports.assign = assign;
+ exports.isString = isString;
+ exports.has = has;
+ exports.unescapeMd = unescapeMd;
+ exports.unescapeAll = unescapeAll;
+ exports.isValidEntityCode = isValidEntityCode;
+ exports.fromCodePoint = fromCodePoint;
+ // exports.replaceEntities = replaceEntities;
+ exports.escapeHtml = escapeHtml;
+ exports.arrayReplaceAt = arrayReplaceAt;
+ exports.isSpace = isSpace;
+ exports.isWhiteSpace = isWhiteSpace;
+ exports.isMdAsciiPunct = isMdAsciiPunct;
+ exports.isPunctChar = isPunctChar;
+ exports.escapeRE = escapeRE;
+ exports.normalizeReference = normalizeReference;
+ }));
+ // Parse link label
+ var parse_link_label = function parseLinkLabel(state, start, disableNested) {
+ var level, found, marker, prevPos, labelEnd = -1, max = state.posMax, oldPos = state.pos;
+ state.pos = start + 1;
+ level = 1;
+ while (state.pos < max) {
+ marker = state.src.charCodeAt(state.pos);
+ if (marker === 93 /* ] */) {
+ level--;
+ if (level === 0) {
+ found = true;
+ break;
+ }
+ }
+ prevPos = state.pos;
+ state.md.inline.skipToken(state);
+ if (marker === 91 /* [ */) {
+ if (prevPos === state.pos - 1) {
+ // increase level if we find text `[`, which is not a part of any token
+ level++;
+ } else if (disableNested) {
+ state.pos = oldPos;
+ return -1;
+ }
+ }
+ }
+ if (found) {
+ labelEnd = state.pos;
+ }
+ // restore old state
+ state.pos = oldPos;
+ return labelEnd;
+ };
+ var unescapeAll$2 = utils.unescapeAll;
+ var parse_link_destination = function parseLinkDestination(str, pos, max) {
+ var code, level, lines = 0, start = pos, result = {
+ ok: false,
+ pos: 0,
+ lines: 0,
+ str: ""
+ };
+ if (str.charCodeAt(pos) === 60 /* < */) {
+ pos++;
+ while (pos < max) {
+ code = str.charCodeAt(pos);
+ if (code === 10 /* \n */) {
+ return result;
+ }
+ if (code === 60 /* < */) {
+ return result;
+ }
+ if (code === 62 /* > */) {
+ result.pos = pos + 1;
+ result.str = unescapeAll$2(str.slice(start + 1, pos));
+ result.ok = true;
+ return result;
+ }
+ if (code === 92 /* \ */ && pos + 1 < max) {
+ pos += 2;
+ continue;
+ }
+ pos++;
+ }
+ // no closing '>'
+ return result;
+ }
+ // this should be ... } else { ... branch
+ level = 0;
+ while (pos < max) {
+ code = str.charCodeAt(pos);
+ if (code === 32) {
+ break;
+ }
+ // ascii control characters
+ if (code < 32 || code === 127) {
+ break;
+ }
+ if (code === 92 /* \ */ && pos + 1 < max) {
+ if (str.charCodeAt(pos + 1) === 32) {
+ break;
+ }
+ pos += 2;
+ continue;
+ }
+ if (code === 40 /* ( */) {
+ level++;
+ if (level > 32) {
+ return result;
+ }
+ }
+ if (code === 41 /* ) */) {
+ if (level === 0) {
+ break;
+ }
+ level--;
+ }
+ pos++;
+ }
+ if (start === pos) {
+ return result;
+ }
+ if (level !== 0) {
+ return result;
+ }
+ result.str = unescapeAll$2(str.slice(start, pos));
+ result.lines = lines;
+ result.pos = pos;
+ result.ok = true;
+ return result;
+ };
+ var unescapeAll$1 = utils.unescapeAll;
+ var parse_link_title = function parseLinkTitle(str, pos, max) {
+ var code, marker, lines = 0, start = pos, result = {
+ ok: false,
+ pos: 0,
+ lines: 0,
+ str: ""
+ };
+ if (pos >= max) {
+ return result;
+ }
+ marker = str.charCodeAt(pos);
+ if (marker !== 34 /* " */ && marker !== 39 /* ' */ && marker !== 40 /* ( */) {
+ return result;
+ }
+ pos++;
+ // if opening marker is "(", switch it to closing marker ")"
+ if (marker === 40) {
+ marker = 41;
+ }
+ while (pos < max) {
+ code = str.charCodeAt(pos);
+ if (code === marker) {
+ result.pos = pos + 1;
+ result.lines = lines;
+ result.str = unescapeAll$1(str.slice(start + 1, pos));
+ result.ok = true;
+ return result;
+ } else if (code === 40 /* ( */ && marker === 41 /* ) */) {
+ return result;
+ } else if (code === 10) {
+ lines++;
+ } else if (code === 92 /* \ */ && pos + 1 < max) {
+ pos++;
+ if (str.charCodeAt(pos) === 10) {
+ lines++;
+ }
+ }
+ pos++;
+ }
+ return result;
+ };
+ var parseLinkLabel = parse_link_label;
+ var parseLinkDestination = parse_link_destination;
+ var parseLinkTitle = parse_link_title;
+ var helpers = {
+ parseLinkLabel: parseLinkLabel,
+ parseLinkDestination: parseLinkDestination,
+ parseLinkTitle: parseLinkTitle
+ };
+ var assign$1 = utils.assign;
+ var unescapeAll = utils.unescapeAll;
+ var escapeHtml = utils.escapeHtml;
+ ////////////////////////////////////////////////////////////////////////////////
+ var default_rules = {};
+ default_rules.code_inline = function(tokens, idx, options, env, slf) {
+ var token = tokens[idx];
+ return "<code" + slf.renderAttrs(token) + ">" + escapeHtml(tokens[idx].content) + "</code>";
+ };
+ default_rules.code_block = function(tokens, idx, options, env, slf) {
+ var token = tokens[idx];
+ return "<pre" + slf.renderAttrs(token) + "><code>" + escapeHtml(tokens[idx].content) + "</code></pre>\n";
+ };
+ default_rules.fence = function(tokens, idx, options, env, slf) {
+ var token = tokens[idx], info = token.info ? unescapeAll(token.info).trim() : "", langName = "", langAttrs = "", highlighted, i, arr, tmpAttrs, tmpToken;
+ if (info) {
+ arr = info.split(/(\s+)/g);
+ langName = arr[0];
+ langAttrs = arr.slice(2).join("");
+ }
+ if (options.highlight) {
+ highlighted = options.highlight(token.content, langName, langAttrs) || escapeHtml(token.content);
+ } else {
+ highlighted = escapeHtml(token.content);
+ }
+ if (highlighted.indexOf("<pre") === 0) {
+ return highlighted + "\n";
+ }
+ // If language exists, inject class gently, without modifying original token.
+ // May be, one day we will add .deepClone() for token and simplify this part, but
+ // now we prefer to keep things local.
+ if (info) {
+ i = token.attrIndex("class");
+ tmpAttrs = token.attrs ? token.attrs.slice() : [];
+ if (i < 0) {
+ tmpAttrs.push([ "class", options.langPrefix + langName ]);
+ } else {
+ tmpAttrs[i] = tmpAttrs[i].slice();
+ tmpAttrs[i][1] += " " + options.langPrefix + langName;
+ }
+ // Fake token just to render attributes
+ tmpToken = {
+ attrs: tmpAttrs
+ };
+ return "<pre><code" + slf.renderAttrs(tmpToken) + ">" + highlighted + "</code></pre>\n";
+ }
+ return "<pre><code" + slf.renderAttrs(token) + ">" + highlighted + "</code></pre>\n";
+ };
+ default_rules.image = function(tokens, idx, options, env, slf) {
+ var token = tokens[idx];
+ // "alt" attr MUST be set, even if empty. Because it's mandatory and
+ // should be placed on proper position for tests.
+
+ // Replace content with actual value
+ token.attrs[token.attrIndex("alt")][1] = slf.renderInlineAsText(token.children, options, env);
+ return slf.renderToken(tokens, idx, options);
+ };
+ default_rules.hardbreak = function(tokens, idx, options /*, env */) {
+ return options.xhtmlOut ? "<br />\n" : "<br>\n";
+ };
+ default_rules.softbreak = function(tokens, idx, options /*, env */) {
+ return options.breaks ? options.xhtmlOut ? "<br />\n" : "<br>\n" : "\n";
+ };
+ default_rules.text = function(tokens, idx /*, options, env */) {
+ return escapeHtml(tokens[idx].content);
+ };
+ default_rules.html_block = function(tokens, idx /*, options, env */) {
+ return tokens[idx].content;
+ };
+ default_rules.html_inline = function(tokens, idx /*, options, env */) {
+ return tokens[idx].content;
+ };
+ /**
+ * new Renderer()
+ *
+ * Creates new [[Renderer]] instance and fill [[Renderer#rules]] with defaults.
+ **/ function Renderer() {
+ /**
+ * Renderer#rules -> Object
+ *
+ * Contains render rules for tokens. Can be updated and extended.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.renderer.rules.strong_open = function () { return '<b>'; };
+ * md.renderer.rules.strong_close = function () { return '</b>'; };
+ *
+ * var result = md.renderInline(...);
+ * ```
+ *
+ * Each rule is called as independent static function with fixed signature:
+ *
+ * ```javascript
+ * function my_token_render(tokens, idx, options, env, renderer) {
+ * // ...
+ * return renderedHTML;
+ * }
+ * ```
+ *
+ * See [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js)
+ * for more details and examples.
+ **/
+ this.rules = assign$1({}, default_rules);
+ }
+ /**
+ * Renderer.renderAttrs(token) -> String
+ *
+ * Render token attributes to string.
+ **/ Renderer.prototype.renderAttrs = function renderAttrs(token) {
+ var i, l, result;
+ if (!token.attrs) {
+ return "";
+ }
+ result = "";
+ for (i = 0, l = token.attrs.length; i < l; i++) {
+ result += " " + escapeHtml(token.attrs[i][0]) + '="' + escapeHtml(token.attrs[i][1]) + '"';
+ }
+ return result;
+ };
+ /**
+ * Renderer.renderToken(tokens, idx, options) -> String
+ * - tokens (Array): list of tokens
+ * - idx (Numbed): token index to render
+ * - options (Object): params of parser instance
+ *
+ * Default token renderer. Can be overriden by custom function
+ * in [[Renderer#rules]].
+ **/ Renderer.prototype.renderToken = function renderToken(tokens, idx, options) {
+ var nextToken, result = "", needLf = false, token = tokens[idx];
+ // Tight list paragraphs
+ if (token.hidden) {
+ return "";
+ }
+ // Insert a newline between hidden paragraph and subsequent opening
+ // block-level tag.
+
+ // For example, here we should insert a newline before blockquote:
+ // - a
+ // >
+
+ if (token.block && token.nesting !== -1 && idx && tokens[idx - 1].hidden) {
+ result += "\n";
+ }
+ // Add token name, e.g. `<img`
+ result += (token.nesting === -1 ? "</" : "<") + token.tag;
+ // Encode attributes, e.g. `<img src="foo"`
+ result += this.renderAttrs(token);
+ // Add a slash for self-closing tags, e.g. `<img src="foo" /`
+ if (token.nesting === 0 && options.xhtmlOut) {
+ result += " /";
+ }
+ // Check if we need to add a newline after this tag
+ if (token.block) {
+ needLf = true;
+ if (token.nesting === 1) {
+ if (idx + 1 < tokens.length) {
+ nextToken = tokens[idx + 1];
+ if (nextToken.type === "inline" || nextToken.hidden) {
+ // Block-level tag containing an inline tag.
+ needLf = false;
+ } else if (nextToken.nesting === -1 && nextToken.tag === token.tag) {
+ // Opening tag + closing tag of the same type. E.g. `<li></li>`.
+ needLf = false;
+ }
+ }
+ }
+ }
+ result += needLf ? ">\n" : ">";
+ return result;
+ };
+ /**
+ * Renderer.renderInline(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to render
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * The same as [[Renderer.render]], but for single token of `inline` type.
+ **/ Renderer.prototype.renderInline = function(tokens, options, env) {
+ var type, result = "", rules = this.rules;
+ for (var i = 0, len = tokens.length; i < len; i++) {
+ type = tokens[i].type;
+ if (typeof rules[type] !== "undefined") {
+ result += rules[type](tokens, i, options, env, this);
+ } else {
+ result += this.renderToken(tokens, i, options);
+ }
+ }
+ return result;
+ };
+ /** internal
+ * Renderer.renderInlineAsText(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to render
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * Special kludge for image `alt` attributes to conform CommonMark spec.
+ * Don't try to use it! Spec requires to show `alt` content with stripped markup,
+ * instead of simple escaping.
+ **/ Renderer.prototype.renderInlineAsText = function(tokens, options, env) {
+ var result = "";
+ for (var i = 0, len = tokens.length; i < len; i++) {
+ if (tokens[i].type === "text") {
+ result += tokens[i].content;
+ } else if (tokens[i].type === "image") {
+ result += this.renderInlineAsText(tokens[i].children, options, env);
+ } else if (tokens[i].type === "softbreak") {
+ result += "\n";
+ }
+ }
+ return result;
+ };
+ /**
+ * Renderer.render(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to render
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * Takes token stream and generates HTML. Probably, you will never need to call
+ * this method directly.
+ **/ Renderer.prototype.render = function(tokens, options, env) {
+ var i, len, type, result = "", rules = this.rules;
+ for (i = 0, len = tokens.length; i < len; i++) {
+ type = tokens[i].type;
+ if (type === "inline") {
+ result += this.renderInline(tokens[i].children, options, env);
+ } else if (typeof rules[type] !== "undefined") {
+ result += rules[tokens[i].type](tokens, i, options, env, this);
+ } else {
+ result += this.renderToken(tokens, i, options, env);
+ }
+ }
+ return result;
+ };
+ var renderer = Renderer;
+ /**
+ * class Ruler
+ *
+ * Helper class, used by [[MarkdownIt#core]], [[MarkdownIt#block]] and
+ * [[MarkdownIt#inline]] to manage sequences of functions (rules):
+ *
+ * - keep rules in defined order
+ * - assign the name to each rule
+ * - enable/disable rules
+ * - add/replace rules
+ * - allow assign rules to additional named chains (in the same)
+ * - cacheing lists of active rules
+ *
+ * You will not need use this class directly until write plugins. For simple
+ * rules control use [[MarkdownIt.disable]], [[MarkdownIt.enable]] and
+ * [[MarkdownIt.use]].
+ **/
+ /**
+ * new Ruler()
+ **/ function Ruler() {
+ // List of added rules. Each element is:
+ // {
+ // name: XXX,
+ // enabled: Boolean,
+ // fn: Function(),
+ // alt: [ name2, name3 ]
+ // }
+ this.__rules__ = [];
+ // Cached rule chains.
+
+ // First level - chain name, '' for default.
+ // Second level - diginal anchor for fast filtering by charcodes.
+
+ this.__cache__ = null;
+ }
+ ////////////////////////////////////////////////////////////////////////////////
+ // Helper methods, should not be used directly
+ // Find rule index by name
+
+ Ruler.prototype.__find__ = function(name) {
+ for (var i = 0; i < this.__rules__.length; i++) {
+ if (this.__rules__[i].name === name) {
+ return i;
+ }
+ }
+ return -1;
+ };
+ // Build rules lookup cache
+
+ Ruler.prototype.__compile__ = function() {
+ var self = this;
+ var chains = [ "" ];
+ // collect unique names
+ self.__rules__.forEach((function(rule) {
+ if (!rule.enabled) {
+ return;
+ }
+ rule.alt.forEach((function(altName) {
+ if (chains.indexOf(altName) < 0) {
+ chains.push(altName);
+ }
+ }));
+ }));
+ self.__cache__ = {};
+ chains.forEach((function(chain) {
+ self.__cache__[chain] = [];
+ self.__rules__.forEach((function(rule) {
+ if (!rule.enabled) {
+ return;
+ }
+ if (chain && rule.alt.indexOf(chain) < 0) {
+ return;
+ }
+ self.__cache__[chain].push(rule.fn);
+ }));
+ }));
+ };
+ /**
+ * Ruler.at(name, fn [, options])
+ * - name (String): rule name to replace.
+ * - fn (Function): new rule function.
+ * - options (Object): new rule options (not mandatory).
+ *
+ * Replace rule by name with new function & options. Throws error if name not
+ * found.
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * Replace existing typographer replacement rule with new one:
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.core.ruler.at('replacements', function replace(state) {
+ * //...
+ * });
+ * ```
+ **/ Ruler.prototype.at = function(name, fn, options) {
+ var index = this.__find__(name);
+ var opt = options || {};
+ if (index === -1) {
+ throw new Error("Parser rule not found: " + name);
+ }
+ this.__rules__[index].fn = fn;
+ this.__rules__[index].alt = opt.alt || [];
+ this.__cache__ = null;
+ };
+ /**
+ * Ruler.before(beforeName, ruleName, fn [, options])
+ * - beforeName (String): new rule will be added before this one.
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Add new rule to chain before one with given name. See also
+ * [[Ruler.after]], [[Ruler.push]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.block.ruler.before('paragraph', 'my_rule', function replace(state) {
+ * //...
+ * });
+ * ```
+ **/ Ruler.prototype.before = function(beforeName, ruleName, fn, options) {
+ var index = this.__find__(beforeName);
+ var opt = options || {};
+ if (index === -1) {
+ throw new Error("Parser rule not found: " + beforeName);
+ }
+ this.__rules__.splice(index, 0, {
+ name: ruleName,
+ enabled: true,
+ fn: fn,
+ alt: opt.alt || []
+ });
+ this.__cache__ = null;
+ };
+ /**
+ * Ruler.after(afterName, ruleName, fn [, options])
+ * - afterName (String): new rule will be added after this one.
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Add new rule to chain after one with given name. See also
+ * [[Ruler.before]], [[Ruler.push]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.inline.ruler.after('text', 'my_rule', function replace(state) {
+ * //...
+ * });
+ * ```
+ **/ Ruler.prototype.after = function(afterName, ruleName, fn, options) {
+ var index = this.__find__(afterName);
+ var opt = options || {};
+ if (index === -1) {
+ throw new Error("Parser rule not found: " + afterName);
+ }
+ this.__rules__.splice(index + 1, 0, {
+ name: ruleName,
+ enabled: true,
+ fn: fn,
+ alt: opt.alt || []
+ });
+ this.__cache__ = null;
+ };
+ /**
+ * Ruler.push(ruleName, fn [, options])
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Push new rule to the end of chain. See also
+ * [[Ruler.before]], [[Ruler.after]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.core.ruler.push('my_rule', function replace(state) {
+ * //...
+ * });
+ * ```
+ **/ Ruler.prototype.push = function(ruleName, fn, options) {
+ var opt = options || {};
+ this.__rules__.push({
+ name: ruleName,
+ enabled: true,
+ fn: fn,
+ alt: opt.alt || []
+ });
+ this.__cache__ = null;
+ };
+ /**
+ * Ruler.enable(list [, ignoreInvalid]) -> Array
+ * - list (String|Array): list of rule names to enable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable rules with given names. If any rule name not found - throw Error.
+ * Errors can be disabled by second param.
+ *
+ * Returns list of found rule names (if no exception happened).
+ *
+ * See also [[Ruler.disable]], [[Ruler.enableOnly]].
+ **/ Ruler.prototype.enable = function(list, ignoreInvalid) {
+ if (!Array.isArray(list)) {
+ list = [ list ];
+ }
+ var result = [];
+ // Search by name and enable
+ list.forEach((function(name) {
+ var idx = this.__find__(name);
+ if (idx < 0) {
+ if (ignoreInvalid) {
+ return;
+ }
+ throw new Error("Rules manager: invalid rule name " + name);
+ }
+ this.__rules__[idx].enabled = true;
+ result.push(name);
+ }), this);
+ this.__cache__ = null;
+ return result;
+ };
+ /**
+ * Ruler.enableOnly(list [, ignoreInvalid])
+ * - list (String|Array): list of rule names to enable (whitelist).
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable rules with given names, and disable everything else. If any rule name
+ * not found - throw Error. Errors can be disabled by second param.
+ *
+ * See also [[Ruler.disable]], [[Ruler.enable]].
+ **/ Ruler.prototype.enableOnly = function(list, ignoreInvalid) {
+ if (!Array.isArray(list)) {
+ list = [ list ];
+ }
+ this.__rules__.forEach((function(rule) {
+ rule.enabled = false;
+ }));
+ this.enable(list, ignoreInvalid);
+ };
+ /**
+ * Ruler.disable(list [, ignoreInvalid]) -> Array
+ * - list (String|Array): list of rule names to disable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Disable rules with given names. If any rule name not found - throw Error.
+ * Errors can be disabled by second param.
+ *
+ * Returns list of found rule names (if no exception happened).
+ *
+ * See also [[Ruler.enable]], [[Ruler.enableOnly]].
+ **/ Ruler.prototype.disable = function(list, ignoreInvalid) {
+ if (!Array.isArray(list)) {
+ list = [ list ];
+ }
+ var result = [];
+ // Search by name and disable
+ list.forEach((function(name) {
+ var idx = this.__find__(name);
+ if (idx < 0) {
+ if (ignoreInvalid) {
+ return;
+ }
+ throw new Error("Rules manager: invalid rule name " + name);
+ }
+ this.__rules__[idx].enabled = false;
+ result.push(name);
+ }), this);
+ this.__cache__ = null;
+ return result;
+ };
+ /**
+ * Ruler.getRules(chainName) -> Array
+ *
+ * Return array of active functions (rules) for given chain name. It analyzes
+ * rules configuration, compiles caches if not exists and returns result.
+ *
+ * Default chain name is `''` (empty string). It can't be skipped. That's
+ * done intentionally, to keep signature monomorphic for high speed.
+ **/ Ruler.prototype.getRules = function(chainName) {
+ if (this.__cache__ === null) {
+ this.__compile__();
+ }
+ // Chain can be empty, if rules disabled. But we still have to return Array.
+ return this.__cache__[chainName] || [];
+ };
+ var ruler = Ruler;
+ // Normalize input string
+ // https://spec.commonmark.org/0.29/#line-ending
+ var NEWLINES_RE = /\r\n?|\n/g;
+ var NULL_RE = /\0/g;
+ var normalize = function normalize(state) {
+ var str;
+ // Normalize newlines
+ str = state.src.replace(NEWLINES_RE, "\n");
+ // Replace NULL characters
+ str = str.replace(NULL_RE, "\ufffd");
+ state.src = str;
+ };
+ var block = function block(state) {
+ var token;
+ if (state.inlineMode) {
+ token = new state.Token("inline", "", 0);
+ token.content = state.src;
+ token.map = [ 0, 1 ];
+ token.children = [];
+ state.tokens.push(token);
+ } else {
+ state.md.block.parse(state.src, state.md, state.env, state.tokens);
+ }
+ };
+ var inline = function inline(state) {
+ var tokens = state.tokens, tok, i, l;
+ // Parse inlines
+ for (i = 0, l = tokens.length; i < l; i++) {
+ tok = tokens[i];
+ if (tok.type === "inline") {
+ state.md.inline.parse(tok.content, state.md, state.env, tok.children);
+ }
+ }
+ };
+ var arrayReplaceAt = utils.arrayReplaceAt;
+ function isLinkOpen(str) {
+ return /^<a[>\s]/i.test(str);
+ }
+ function isLinkClose(str) {
+ return /^<\/a\s*>/i.test(str);
+ }
+ var linkify = function linkify(state) {
+ var i, j, l, tokens, token, currentToken, nodes, ln, text, pos, lastPos, level, htmlLinkLevel, url, fullUrl, urlText, blockTokens = state.tokens, links;
+ if (!state.md.options.linkify) {
+ return;
+ }
+ for (j = 0, l = blockTokens.length; j < l; j++) {
+ if (blockTokens[j].type !== "inline" || !state.md.linkify.pretest(blockTokens[j].content)) {
+ continue;
+ }
+ tokens = blockTokens[j].children;
+ htmlLinkLevel = 0;
+ // We scan from the end, to keep position when new tags added.
+ // Use reversed logic in links start/end match
+ for (i = tokens.length - 1; i >= 0; i--) {
+ currentToken = tokens[i];
+ // Skip content of markdown links
+ if (currentToken.type === "link_close") {
+ i--;
+ while (tokens[i].level !== currentToken.level && tokens[i].type !== "link_open") {
+ i--;
+ }
+ continue;
+ }
+ // Skip content of html tag links
+ if (currentToken.type === "html_inline") {
+ if (isLinkOpen(currentToken.content) && htmlLinkLevel > 0) {
+ htmlLinkLevel--;
+ }
+ if (isLinkClose(currentToken.content)) {
+ htmlLinkLevel++;
+ }
+ }
+ if (htmlLinkLevel > 0) {
+ continue;
+ }
+ if (currentToken.type === "text" && state.md.linkify.test(currentToken.content)) {
+ text = currentToken.content;
+ links = state.md.linkify.match(text);
+ // Now split string to nodes
+ nodes = [];
+ level = currentToken.level;
+ lastPos = 0;
+ for (ln = 0; ln < links.length; ln++) {
+ url = links[ln].url;
+ fullUrl = state.md.normalizeLink(url);
+ if (!state.md.validateLink(fullUrl)) {
+ continue;
+ }
+ urlText = links[ln].text;
+ // Linkifier might send raw hostnames like "example.com", where url
+ // starts with domain name. So we prepend http:// in those cases,
+ // and remove it afterwards.
+
+ if (!links[ln].schema) {
+ urlText = state.md.normalizeLinkText("http://" + urlText).replace(/^http:\/\//, "");
+ } else if (links[ln].schema === "mailto:" && !/^mailto:/i.test(urlText)) {
+ urlText = state.md.normalizeLinkText("mailto:" + urlText).replace(/^mailto:/, "");
+ } else {
+ urlText = state.md.normalizeLinkText(urlText);
+ }
+ pos = links[ln].index;
+ if (pos > lastPos) {
+ token = new state.Token("text", "", 0);
+ token.content = text.slice(lastPos, pos);
+ token.level = level;
+ nodes.push(token);
+ }
+ token = new state.Token("link_open", "a", 1);
+ token.attrs = [ [ "href", fullUrl ] ];
+ token.level = level++;
+ token.markup = "linkify";
+ token.info = "auto";
+ nodes.push(token);
+ token = new state.Token("text", "", 0);
+ token.content = urlText;
+ token.level = level;
+ nodes.push(token);
+ token = new state.Token("link_close", "a", -1);
+ token.level = --level;
+ token.markup = "linkify";
+ token.info = "auto";
+ nodes.push(token);
+ lastPos = links[ln].lastIndex;
+ }
+ if (lastPos < text.length) {
+ token = new state.Token("text", "", 0);
+ token.content = text.slice(lastPos);
+ token.level = level;
+ nodes.push(token);
+ }
+ // replace current node
+ blockTokens[j].children = tokens = arrayReplaceAt(tokens, i, nodes);
+ }
+ }
+ }
+ };
+ // Simple typographic replacements
+ // TODO:
+ // - fractionals 1/2, 1/4, 3/4 -> ½, ¼, ¾
+ // - miltiplication 2 x 4 -> 2 × 4
+ var RARE_RE = /\+-|\.\.|\?\?\?\?|!!!!|,,|--/;
+ // Workaround for phantomjs - need regex without /g flag,
+ // or root check will fail every second time
+ var SCOPED_ABBR_TEST_RE = /\((c|tm|r|p)\)/i;
+ var SCOPED_ABBR_RE = /\((c|tm|r|p)\)/gi;
+ var SCOPED_ABBR = {
+ c: "\xa9",
+ r: "\xae",
+ p: "\xa7",
+ tm: "\u2122"
+ };
+ function replaceFn(match, name) {
+ return SCOPED_ABBR[name.toLowerCase()];
+ }
+ function replace_scoped(inlineTokens) {
+ var i, token, inside_autolink = 0;
+ for (i = inlineTokens.length - 1; i >= 0; i--) {
+ token = inlineTokens[i];
+ if (token.type === "text" && !inside_autolink) {
+ token.content = token.content.replace(SCOPED_ABBR_RE, replaceFn);
+ }
+ if (token.type === "link_open" && token.info === "auto") {
+ inside_autolink--;
+ }
+ if (token.type === "link_close" && token.info === "auto") {
+ inside_autolink++;
+ }
+ }
+ }
+ function replace_rare(inlineTokens) {
+ var i, token, inside_autolink = 0;
+ for (i = inlineTokens.length - 1; i >= 0; i--) {
+ token = inlineTokens[i];
+ if (token.type === "text" && !inside_autolink) {
+ if (RARE_RE.test(token.content)) {
+ token.content = token.content.replace(/\+-/g, "\xb1").replace(/\.{2,}/g, "\u2026").replace(/([?!])\u2026/g, "$1..").replace(/([?!]){4,}/g, "$1$1$1").replace(/,{2,}/g, ",").replace(/(^|[^-])---(?=[^-]|$)/gm, "$1\u2014").replace(/(^|\s)--(?=\s|$)/gm, "$1\u2013").replace(/(^|[^-\s])--(?=[^-\s]|$)/gm, "$1\u2013");
+ }
+ }
+ if (token.type === "link_open" && token.info === "auto") {
+ inside_autolink--;
+ }
+ if (token.type === "link_close" && token.info === "auto") {
+ inside_autolink++;
+ }
+ }
+ }
+ var replacements = function replace(state) {
+ var blkIdx;
+ if (!state.md.options.typographer) {
+ return;
+ }
+ for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) {
+ if (state.tokens[blkIdx].type !== "inline") {
+ continue;
+ }
+ if (SCOPED_ABBR_TEST_RE.test(state.tokens[blkIdx].content)) {
+ replace_scoped(state.tokens[blkIdx].children);
+ }
+ if (RARE_RE.test(state.tokens[blkIdx].content)) {
+ replace_rare(state.tokens[blkIdx].children);
+ }
+ }
+ };
+ var isWhiteSpace$1 = utils.isWhiteSpace;
+ var isPunctChar$1 = utils.isPunctChar;
+ var isMdAsciiPunct$1 = utils.isMdAsciiPunct;
+ var QUOTE_TEST_RE = /['"]/;
+ var QUOTE_RE = /['"]/g;
+ var APOSTROPHE = "\u2019";
+ /* ’ */ function replaceAt(str, index, ch) {
+ return str.substr(0, index) + ch + str.substr(index + 1);
+ }
+ function process_inlines(tokens, state) {
+ var i, token, text, t, pos, max, thisLevel, item, lastChar, nextChar, isLastPunctChar, isNextPunctChar, isLastWhiteSpace, isNextWhiteSpace, canOpen, canClose, j, isSingle, stack, openQuote, closeQuote;
+ stack = [];
+ for (i = 0; i < tokens.length; i++) {
+ token = tokens[i];
+ thisLevel = tokens[i].level;
+ for (j = stack.length - 1; j >= 0; j--) {
+ if (stack[j].level <= thisLevel) {
+ break;
+ }
+ }
+ stack.length = j + 1;
+ if (token.type !== "text") {
+ continue;
+ }
+ text = token.content;
+ pos = 0;
+ max = text.length;
+ /*eslint no-labels:0,block-scoped-var:0*/ OUTER: while (pos < max) {
+ QUOTE_RE.lastIndex = pos;
+ t = QUOTE_RE.exec(text);
+ if (!t) {
+ break;
+ }
+ canOpen = canClose = true;
+ pos = t.index + 1;
+ isSingle = t[0] === "'";
+ // Find previous character,
+ // default to space if it's the beginning of the line
+
+ lastChar = 32;
+ if (t.index - 1 >= 0) {
+ lastChar = text.charCodeAt(t.index - 1);
+ } else {
+ for (j = i - 1; j >= 0; j--) {
+ if (tokens[j].type === "softbreak" || tokens[j].type === "hardbreak") break;
+ // lastChar defaults to 0x20
+ if (!tokens[j].content) continue;
+ // should skip all tokens except 'text', 'html_inline' or 'code_inline'
+ lastChar = tokens[j].content.charCodeAt(tokens[j].content.length - 1);
+ break;
+ }
+ }
+ // Find next character,
+ // default to space if it's the end of the line
+
+ nextChar = 32;
+ if (pos < max) {
+ nextChar = text.charCodeAt(pos);
+ } else {
+ for (j = i + 1; j < tokens.length; j++) {
+ if (tokens[j].type === "softbreak" || tokens[j].type === "hardbreak") break;
+ // nextChar defaults to 0x20
+ if (!tokens[j].content) continue;
+ // should skip all tokens except 'text', 'html_inline' or 'code_inline'
+ nextChar = tokens[j].content.charCodeAt(0);
+ break;
+ }
+ }
+ isLastPunctChar = isMdAsciiPunct$1(lastChar) || isPunctChar$1(String.fromCharCode(lastChar));
+ isNextPunctChar = isMdAsciiPunct$1(nextChar) || isPunctChar$1(String.fromCharCode(nextChar));
+ isLastWhiteSpace = isWhiteSpace$1(lastChar);
+ isNextWhiteSpace = isWhiteSpace$1(nextChar);
+ if (isNextWhiteSpace) {
+ canOpen = false;
+ } else if (isNextPunctChar) {
+ if (!(isLastWhiteSpace || isLastPunctChar)) {
+ canOpen = false;
+ }
+ }
+ if (isLastWhiteSpace) {
+ canClose = false;
+ } else if (isLastPunctChar) {
+ if (!(isNextWhiteSpace || isNextPunctChar)) {
+ canClose = false;
+ }
+ }
+ if (nextChar === 34 /* " */ && t[0] === '"') {
+ if (lastChar >= 48 /* 0 */ && lastChar <= 57 /* 9 */) {
+ // special case: 1"" - count first quote as an inch
+ canClose = canOpen = false;
+ }
+ }
+ if (canOpen && canClose) {
+ // Replace quotes in the middle of punctuation sequence, but not
+ // in the middle of the words, i.e.:
+ // 1. foo " bar " baz - not replaced
+ // 2. foo-"-bar-"-baz - replaced
+ // 3. foo"bar"baz - not replaced
+ canOpen = isLastPunctChar;
+ canClose = isNextPunctChar;
+ }
+ if (!canOpen && !canClose) {
+ // middle of word
+ if (isSingle) {
+ token.content = replaceAt(token.content, t.index, APOSTROPHE);
+ }
+ continue;
+ }
+ if (canClose) {
+ // this could be a closing quote, rewind the stack to get a match
+ for (j = stack.length - 1; j >= 0; j--) {
+ item = stack[j];
+ if (stack[j].level < thisLevel) {
+ break;
+ }
+ if (item.single === isSingle && stack[j].level === thisLevel) {
+ item = stack[j];
+ if (isSingle) {
+ openQuote = state.md.options.quotes[2];
+ closeQuote = state.md.options.quotes[3];
+ } else {
+ openQuote = state.md.options.quotes[0];
+ closeQuote = state.md.options.quotes[1];
+ }
+ // replace token.content *before* tokens[item.token].content,
+ // because, if they are pointing at the same token, replaceAt
+ // could mess up indices when quote length != 1
+ token.content = replaceAt(token.content, t.index, closeQuote);
+ tokens[item.token].content = replaceAt(tokens[item.token].content, item.pos, openQuote);
+ pos += closeQuote.length - 1;
+ if (item.token === i) {
+ pos += openQuote.length - 1;
+ }
+ text = token.content;
+ max = text.length;
+ stack.length = j;
+ continue OUTER;
+ }
+ }
+ }
+ if (canOpen) {
+ stack.push({
+ token: i,
+ pos: t.index,
+ single: isSingle,
+ level: thisLevel
+ });
+ } else if (canClose && isSingle) {
+ token.content = replaceAt(token.content, t.index, APOSTROPHE);
+ }
+ }
+ }
+ }
+ var smartquotes = function smartquotes(state) {
+ /*eslint max-depth:0*/
+ var blkIdx;
+ if (!state.md.options.typographer) {
+ return;
+ }
+ for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) {
+ if (state.tokens[blkIdx].type !== "inline" || !QUOTE_TEST_RE.test(state.tokens[blkIdx].content)) {
+ continue;
+ }
+ process_inlines(state.tokens[blkIdx].children, state);
+ }
+ };
+ // Token class
+ /**
+ * class Token
+ **/
+ /**
+ * new Token(type, tag, nesting)
+ *
+ * Create new token and fill passed properties.
+ **/ function Token(type, tag, nesting) {
+ /**
+ * Token#type -> String
+ *
+ * Type of the token (string, e.g. "paragraph_open")
+ **/
+ this.type = type;
+ /**
+ * Token#tag -> String
+ *
+ * html tag name, e.g. "p"
+ **/ this.tag = tag;
+ /**
+ * Token#attrs -> Array
+ *
+ * Html attributes. Format: `[ [ name1, value1 ], [ name2, value2 ] ]`
+ **/ this.attrs = null;
+ /**
+ * Token#map -> Array
+ *
+ * Source map info. Format: `[ line_begin, line_end ]`
+ **/ this.map = null;
+ /**
+ * Token#nesting -> Number
+ *
+ * Level change (number in {-1, 0, 1} set), where:
+ *
+ * - `1` means the tag is opening
+ * - `0` means the tag is self-closing
+ * - `-1` means the tag is closing
+ **/ this.nesting = nesting;
+ /**
+ * Token#level -> Number
+ *
+ * nesting level, the same as `state.level`
+ **/ this.level = 0;
+ /**
+ * Token#children -> Array
+ *
+ * An array of child nodes (inline and img tokens)
+ **/ this.children = null;
+ /**
+ * Token#content -> String
+ *
+ * In a case of self-closing tag (code, html, fence, etc.),
+ * it has contents of this tag.
+ **/ this.content = "";
+ /**
+ * Token#markup -> String
+ *
+ * '*' or '_' for emphasis, fence string for fence, etc.
+ **/ this.markup = "";
+ /**
+ * Token#info -> String
+ *
+ * Additional information:
+ *
+ * - Info string for "fence" tokens
+ * - The value "auto" for autolink "link_open" and "link_close" tokens
+ * - The string value of the item marker for ordered-list "list_item_open" tokens
+ **/ this.info = "";
+ /**
+ * Token#meta -> Object
+ *
+ * A place for plugins to store an arbitrary data
+ **/ this.meta = null;
+ /**
+ * Token#block -> Boolean
+ *
+ * True for block-level tokens, false for inline tokens.
+ * Used in renderer to calculate line breaks
+ **/ this.block = false;
+ /**
+ * Token#hidden -> Boolean
+ *
+ * If it's true, ignore this element when rendering. Used for tight lists
+ * to hide paragraphs.
+ **/ this.hidden = false;
+ }
+ /**
+ * Token.attrIndex(name) -> Number
+ *
+ * Search attribute index by name.
+ **/ Token.prototype.attrIndex = function attrIndex(name) {
+ var attrs, i, len;
+ if (!this.attrs) {
+ return -1;
+ }
+ attrs = this.attrs;
+ for (i = 0, len = attrs.length; i < len; i++) {
+ if (attrs[i][0] === name) {
+ return i;
+ }
+ }
+ return -1;
+ };
+ /**
+ * Token.attrPush(attrData)
+ *
+ * Add `[ name, value ]` attribute to list. Init attrs if necessary
+ **/ Token.prototype.attrPush = function attrPush(attrData) {
+ if (this.attrs) {
+ this.attrs.push(attrData);
+ } else {
+ this.attrs = [ attrData ];
+ }
+ };
+ /**
+ * Token.attrSet(name, value)
+ *
+ * Set `name` attribute to `value`. Override old value if exists.
+ **/ Token.prototype.attrSet = function attrSet(name, value) {
+ var idx = this.attrIndex(name), attrData = [ name, value ];
+ if (idx < 0) {
+ this.attrPush(attrData);
+ } else {
+ this.attrs[idx] = attrData;
+ }
+ };
+ /**
+ * Token.attrGet(name)
+ *
+ * Get the value of attribute `name`, or null if it does not exist.
+ **/ Token.prototype.attrGet = function attrGet(name) {
+ var idx = this.attrIndex(name), value = null;
+ if (idx >= 0) {
+ value = this.attrs[idx][1];
+ }
+ return value;
+ };
+ /**
+ * Token.attrJoin(name, value)
+ *
+ * Join value to existing attribute via space. Or create new attribute if not
+ * exists. Useful to operate with token classes.
+ **/ Token.prototype.attrJoin = function attrJoin(name, value) {
+ var idx = this.attrIndex(name);
+ if (idx < 0) {
+ this.attrPush([ name, value ]);
+ } else {
+ this.attrs[idx][1] = this.attrs[idx][1] + " " + value;
+ }
+ };
+ var token = Token;
+ function StateCore(src, md, env) {
+ this.src = src;
+ this.env = env;
+ this.tokens = [];
+ this.inlineMode = false;
+ this.md = md;
+ // link to parser instance
+ }
+ // re-export Token class to use in core rules
+ StateCore.prototype.Token = token;
+ var state_core = StateCore;
+ var _rules$2 = [ [ "normalize", normalize ], [ "block", block ], [ "inline", inline ], [ "linkify", linkify ], [ "replacements", replacements ], [ "smartquotes", smartquotes ] ];
+ /**
+ * new Core()
+ **/ function Core() {
+ /**
+ * Core#ruler -> Ruler
+ *
+ * [[Ruler]] instance. Keep configuration of core rules.
+ **/
+ this.ruler = new ruler;
+ for (var i = 0; i < _rules$2.length; i++) {
+ this.ruler.push(_rules$2[i][0], _rules$2[i][1]);
+ }
+ }
+ /**
+ * Core.process(state)
+ *
+ * Executes core chain rules.
+ **/ Core.prototype.process = function(state) {
+ var i, l, rules;
+ rules = this.ruler.getRules("");
+ for (i = 0, l = rules.length; i < l; i++) {
+ rules[i](state);
+ }
+ };
+ Core.prototype.State = state_core;
+ var parser_core = Core;
+ var isSpace$a = utils.isSpace;
+ function getLine(state, line) {
+ var pos = state.bMarks[line] + state.tShift[line], max = state.eMarks[line];
+ return state.src.substr(pos, max - pos);
+ }
+ function escapedSplit(str) {
+ var result = [], pos = 0, max = str.length, ch, isEscaped = false, lastPos = 0, current = "";
+ ch = str.charCodeAt(pos);
+ while (pos < max) {
+ if (ch === 124 /* | */) {
+ if (!isEscaped) {
+ // pipe separating cells, '|'
+ result.push(current + str.substring(lastPos, pos));
+ current = "";
+ lastPos = pos + 1;
+ } else {
+ // escaped pipe, '\|'
+ current += str.substring(lastPos, pos - 1);
+ lastPos = pos;
+ }
+ }
+ isEscaped = ch === 92 /* \ */;
+ pos++;
+ ch = str.charCodeAt(pos);
+ }
+ result.push(current + str.substring(lastPos));
+ return result;
+ }
+ var table = function table(state, startLine, endLine, silent) {
+ var ch, lineText, pos, i, l, nextLine, columns, columnCount, token, aligns, t, tableLines, tbodyLines, oldParentType, terminate, terminatorRules, firstCh, secondCh;
+ // should have at least two lines
+ if (startLine + 2 > endLine) {
+ return false;
+ }
+ nextLine = startLine + 1;
+ if (state.sCount[nextLine] < state.blkIndent) {
+ return false;
+ }
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[nextLine] - state.blkIndent >= 4) {
+ return false;
+ }
+ // first character of the second line should be '|', '-', ':',
+ // and no other characters are allowed but spaces;
+ // basically, this is the equivalent of /^[-:|][-:|\s]*$/ regexp
+ pos = state.bMarks[nextLine] + state.tShift[nextLine];
+ if (pos >= state.eMarks[nextLine]) {
+ return false;
+ }
+ firstCh = state.src.charCodeAt(pos++);
+ if (firstCh !== 124 /* | */ && firstCh !== 45 /* - */ && firstCh !== 58 /* : */) {
+ return false;
+ }
+ if (pos >= state.eMarks[nextLine]) {
+ return false;
+ }
+ secondCh = state.src.charCodeAt(pos++);
+ if (secondCh !== 124 /* | */ && secondCh !== 45 /* - */ && secondCh !== 58 /* : */ && !isSpace$a(secondCh)) {
+ return false;
+ }
+ // if first character is '-', then second character must not be a space
+ // (due to parsing ambiguity with list)
+ if (firstCh === 45 /* - */ && isSpace$a(secondCh)) {
+ return false;
+ }
+ while (pos < state.eMarks[nextLine]) {
+ ch = state.src.charCodeAt(pos);
+ if (ch !== 124 /* | */ && ch !== 45 /* - */ && ch !== 58 /* : */ && !isSpace$a(ch)) {
+ return false;
+ }
+ pos++;
+ }
+ lineText = getLine(state, startLine + 1);
+ columns = lineText.split("|");
+ aligns = [];
+ for (i = 0; i < columns.length; i++) {
+ t = columns[i].trim();
+ if (!t) {
+ // allow empty columns before and after table, but not in between columns;
+ // e.g. allow ` |---| `, disallow ` ---||--- `
+ if (i === 0 || i === columns.length - 1) {
+ continue;
+ } else {
+ return false;
+ }
+ }
+ if (!/^:?-+:?$/.test(t)) {
+ return false;
+ }
+ if (t.charCodeAt(t.length - 1) === 58 /* : */) {
+ aligns.push(t.charCodeAt(0) === 58 /* : */ ? "center" : "right");
+ } else if (t.charCodeAt(0) === 58 /* : */) {
+ aligns.push("left");
+ } else {
+ aligns.push("");
+ }
+ }
+ lineText = getLine(state, startLine).trim();
+ if (lineText.indexOf("|") === -1) {
+ return false;
+ }
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false;
+ }
+ columns = escapedSplit(lineText);
+ if (columns.length && columns[0] === "") columns.shift();
+ if (columns.length && columns[columns.length - 1] === "") columns.pop();
+ // header row will define an amount of columns in the entire table,
+ // and align row should be exactly the same (the rest of the rows can differ)
+ columnCount = columns.length;
+ if (columnCount === 0 || columnCount !== aligns.length) {
+ return false;
+ }
+ if (silent) {
+ return true;
+ }
+ oldParentType = state.parentType;
+ state.parentType = "table";
+ // use 'blockquote' lists for termination because it's
+ // the most similar to tables
+ terminatorRules = state.md.block.ruler.getRules("blockquote");
+ token = state.push("table_open", "table", 1);
+ token.map = tableLines = [ startLine, 0 ];
+ token = state.push("thead_open", "thead", 1);
+ token.map = [ startLine, startLine + 1 ];
+ token = state.push("tr_open", "tr", 1);
+ token.map = [ startLine, startLine + 1 ];
+ for (i = 0; i < columns.length; i++) {
+ token = state.push("th_open", "th", 1);
+ if (aligns[i]) {
+ token.attrs = [ [ "style", "text-align:" + aligns[i] ] ];
+ }
+ token = state.push("inline", "", 0);
+ token.content = columns[i].trim();
+ token.children = [];
+ token = state.push("th_close", "th", -1);
+ }
+ token = state.push("tr_close", "tr", -1);
+ token = state.push("thead_close", "thead", -1);
+ for (nextLine = startLine + 2; nextLine < endLine; nextLine++) {
+ if (state.sCount[nextLine] < state.blkIndent) {
+ break;
+ }
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+ if (terminate) {
+ break;
+ }
+ lineText = getLine(state, nextLine).trim();
+ if (!lineText) {
+ break;
+ }
+ if (state.sCount[nextLine] - state.blkIndent >= 4) {
+ break;
+ }
+ columns = escapedSplit(lineText);
+ if (columns.length && columns[0] === "") columns.shift();
+ if (columns.length && columns[columns.length - 1] === "") columns.pop();
+ if (nextLine === startLine + 2) {
+ token = state.push("tbody_open", "tbody", 1);
+ token.map = tbodyLines = [ startLine + 2, 0 ];
+ }
+ token = state.push("tr_open", "tr", 1);
+ token.map = [ nextLine, nextLine + 1 ];
+ for (i = 0; i < columnCount; i++) {
+ token = state.push("td_open", "td", 1);
+ if (aligns[i]) {
+ token.attrs = [ [ "style", "text-align:" + aligns[i] ] ];
+ }
+ token = state.push("inline", "", 0);
+ token.content = columns[i] ? columns[i].trim() : "";
+ token.children = [];
+ token = state.push("td_close", "td", -1);
+ }
+ token = state.push("tr_close", "tr", -1);
+ }
+ if (tbodyLines) {
+ token = state.push("tbody_close", "tbody", -1);
+ tbodyLines[1] = nextLine;
+ }
+ token = state.push("table_close", "table", -1);
+ tableLines[1] = nextLine;
+ state.parentType = oldParentType;
+ state.line = nextLine;
+ return true;
+ };
+ // Code block (4 spaces padded)
+ var code = function code(state, startLine, endLine /*, silent*/) {
+ var nextLine, last, token;
+ if (state.sCount[startLine] - state.blkIndent < 4) {
+ return false;
+ }
+ last = nextLine = startLine + 1;
+ while (nextLine < endLine) {
+ if (state.isEmpty(nextLine)) {
+ nextLine++;
+ continue;
+ }
+ if (state.sCount[nextLine] - state.blkIndent >= 4) {
+ nextLine++;
+ last = nextLine;
+ continue;
+ }
+ break;
+ }
+ state.line = last;
+ token = state.push("code_block", "code", 0);
+ token.content = state.getLines(startLine, last, 4 + state.blkIndent, false) + "\n";
+ token.map = [ startLine, state.line ];
+ return true;
+ };
+ // fences (``` lang, ~~~ lang)
+ var fence = function fence(state, startLine, endLine, silent) {
+ var marker, len, params, nextLine, mem, token, markup, haveEndMarker = false, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine];
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false;
+ }
+ if (pos + 3 > max) {
+ return false;
+ }
+ marker = state.src.charCodeAt(pos);
+ if (marker !== 126 /* ~ */ && marker !== 96 /* ` */) {
+ return false;
+ }
+ // scan marker length
+ mem = pos;
+ pos = state.skipChars(pos, marker);
+ len = pos - mem;
+ if (len < 3) {
+ return false;
+ }
+ markup = state.src.slice(mem, pos);
+ params = state.src.slice(pos, max);
+ if (marker === 96 /* ` */) {
+ if (params.indexOf(String.fromCharCode(marker)) >= 0) {
+ return false;
+ }
+ }
+ // Since start is found, we can report success here in validation mode
+ if (silent) {
+ return true;
+ }
+ // search end of block
+ nextLine = startLine;
+ for (;;) {
+ nextLine++;
+ if (nextLine >= endLine) {
+ // unclosed block should be autoclosed by end of document.
+ // also block seems to be autoclosed by end of parent
+ break;
+ }
+ pos = mem = state.bMarks[nextLine] + state.tShift[nextLine];
+ max = state.eMarks[nextLine];
+ if (pos < max && state.sCount[nextLine] < state.blkIndent) {
+ // non-empty line with negative indent should stop the list:
+ // - ```
+ // test
+ break;
+ }
+ if (state.src.charCodeAt(pos) !== marker) {
+ continue;
+ }
+ if (state.sCount[nextLine] - state.blkIndent >= 4) {
+ // closing fence should be indented less than 4 spaces
+ continue;
+ }
+ pos = state.skipChars(pos, marker);
+ // closing code fence must be at least as long as the opening one
+ if (pos - mem < len) {
+ continue;
+ }
+ // make sure tail has spaces only
+ pos = state.skipSpaces(pos);
+ if (pos < max) {
+ continue;
+ }
+ haveEndMarker = true;
+ // found!
+ break;
+ }
+ // If a fence has heading spaces, they should be removed from its inner block
+ len = state.sCount[startLine];
+ state.line = nextLine + (haveEndMarker ? 1 : 0);
+ token = state.push("fence", "code", 0);
+ token.info = params;
+ token.content = state.getLines(startLine + 1, nextLine, len, true);
+ token.markup = markup;
+ token.map = [ startLine, state.line ];
+ return true;
+ };
+ var isSpace$9 = utils.isSpace;
+ var blockquote = function blockquote(state, startLine, endLine, silent) {
+ var adjustTab, ch, i, initial, l, lastLineEmpty, lines, nextLine, offset, oldBMarks, oldBSCount, oldIndent, oldParentType, oldSCount, oldTShift, spaceAfterMarker, terminate, terminatorRules, token, isOutdented, oldLineMax = state.lineMax, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine];
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false;
+ }
+ // check the block quote marker
+ if (state.src.charCodeAt(pos++) !== 62 /* > */) {
+ return false;
+ }
+ // we know that it's going to be a valid blockquote,
+ // so no point trying to find the end of it in silent mode
+ if (silent) {
+ return true;
+ }
+ // set offset past spaces and ">"
+ initial = offset = state.sCount[startLine] + 1;
+ // skip one optional space after '>'
+ if (state.src.charCodeAt(pos) === 32 /* space */) {
+ // ' > test '
+ // ^ -- position start of line here:
+ pos++;
+ initial++;
+ offset++;
+ adjustTab = false;
+ spaceAfterMarker = true;
+ } else if (state.src.charCodeAt(pos) === 9 /* tab */) {
+ spaceAfterMarker = true;
+ if ((state.bsCount[startLine] + offset) % 4 === 3) {
+ // ' >\t test '
+ // ^ -- position start of line here (tab has width===1)
+ pos++;
+ initial++;
+ offset++;
+ adjustTab = false;
+ } else {
+ // ' >\t test '
+ // ^ -- position start of line here + shift bsCount slightly
+ // to make extra space appear
+ adjustTab = true;
+ }
+ } else {
+ spaceAfterMarker = false;
+ }
+ oldBMarks = [ state.bMarks[startLine] ];
+ state.bMarks[startLine] = pos;
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos);
+ if (isSpace$9(ch)) {
+ if (ch === 9) {
+ offset += 4 - (offset + state.bsCount[startLine] + (adjustTab ? 1 : 0)) % 4;
+ } else {
+ offset++;
+ }
+ } else {
+ break;
+ }
+ pos++;
+ }
+ oldBSCount = [ state.bsCount[startLine] ];
+ state.bsCount[startLine] = state.sCount[startLine] + 1 + (spaceAfterMarker ? 1 : 0);
+ lastLineEmpty = pos >= max;
+ oldSCount = [ state.sCount[startLine] ];
+ state.sCount[startLine] = offset - initial;
+ oldTShift = [ state.tShift[startLine] ];
+ state.tShift[startLine] = pos - state.bMarks[startLine];
+ terminatorRules = state.md.block.ruler.getRules("blockquote");
+ oldParentType = state.parentType;
+ state.parentType = "blockquote";
+ // Search the end of the block
+
+ // Block ends with either:
+ // 1. an empty line outside:
+ // ```
+ // > test
+
+ // ```
+ // 2. an empty line inside:
+ // ```
+ // >
+ // test
+ // ```
+ // 3. another tag:
+ // ```
+ // > test
+ // - - -
+ // ```
+ for (nextLine = startLine + 1; nextLine < endLine; nextLine++) {
+ // check if it's outdented, i.e. it's inside list item and indented
+ // less than said list item:
+ // ```
+ // 1. anything
+ // > current blockquote
+ // 2. checking this line
+ // ```
+ isOutdented = state.sCount[nextLine] < state.blkIndent;
+ pos = state.bMarks[nextLine] + state.tShift[nextLine];
+ max = state.eMarks[nextLine];
+ if (pos >= max) {
+ // Case 1: line is not inside the blockquote, and this line is empty.
+ break;
+ }
+ if (state.src.charCodeAt(pos++) === 62 /* > */ && !isOutdented) {
+ // This line is inside the blockquote.
+ // set offset past spaces and ">"
+ initial = offset = state.sCount[nextLine] + 1;
+ // skip one optional space after '>'
+ if (state.src.charCodeAt(pos) === 32 /* space */) {
+ // ' > test '
+ // ^ -- position start of line here:
+ pos++;
+ initial++;
+ offset++;
+ adjustTab = false;
+ spaceAfterMarker = true;
+ } else if (state.src.charCodeAt(pos) === 9 /* tab */) {
+ spaceAfterMarker = true;
+ if ((state.bsCount[nextLine] + offset) % 4 === 3) {
+ // ' >\t test '
+ // ^ -- position start of line here (tab has width===1)
+ pos++;
+ initial++;
+ offset++;
+ adjustTab = false;
+ } else {
+ // ' >\t test '
+ // ^ -- position start of line here + shift bsCount slightly
+ // to make extra space appear
+ adjustTab = true;
+ }
+ } else {
+ spaceAfterMarker = false;
+ }
+ oldBMarks.push(state.bMarks[nextLine]);
+ state.bMarks[nextLine] = pos;
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos);
+ if (isSpace$9(ch)) {
+ if (ch === 9) {
+ offset += 4 - (offset + state.bsCount[nextLine] + (adjustTab ? 1 : 0)) % 4;
+ } else {
+ offset++;
+ }
+ } else {
+ break;
+ }
+ pos++;
+ }
+ lastLineEmpty = pos >= max;
+ oldBSCount.push(state.bsCount[nextLine]);
+ state.bsCount[nextLine] = state.sCount[nextLine] + 1 + (spaceAfterMarker ? 1 : 0);
+ oldSCount.push(state.sCount[nextLine]);
+ state.sCount[nextLine] = offset - initial;
+ oldTShift.push(state.tShift[nextLine]);
+ state.tShift[nextLine] = pos - state.bMarks[nextLine];
+ continue;
+ }
+ // Case 2: line is not inside the blockquote, and the last line was empty.
+ if (lastLineEmpty) {
+ break;
+ }
+ // Case 3: another tag found.
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+ if (terminate) {
+ // Quirk to enforce "hard termination mode" for paragraphs;
+ // normally if you call `tokenize(state, startLine, nextLine)`,
+ // paragraphs will look below nextLine for paragraph continuation,
+ // but if blockquote is terminated by another tag, they shouldn't
+ state.lineMax = nextLine;
+ if (state.blkIndent !== 0) {
+ // state.blkIndent was non-zero, we now set it to zero,
+ // so we need to re-calculate all offsets to appear as
+ // if indent wasn't changed
+ oldBMarks.push(state.bMarks[nextLine]);
+ oldBSCount.push(state.bsCount[nextLine]);
+ oldTShift.push(state.tShift[nextLine]);
+ oldSCount.push(state.sCount[nextLine]);
+ state.sCount[nextLine] -= state.blkIndent;
+ }
+ break;
+ }
+ oldBMarks.push(state.bMarks[nextLine]);
+ oldBSCount.push(state.bsCount[nextLine]);
+ oldTShift.push(state.tShift[nextLine]);
+ oldSCount.push(state.sCount[nextLine]);
+ // A negative indentation means that this is a paragraph continuation
+
+ state.sCount[nextLine] = -1;
+ }
+ oldIndent = state.blkIndent;
+ state.blkIndent = 0;
+ token = state.push("blockquote_open", "blockquote", 1);
+ token.markup = ">";
+ token.map = lines = [ startLine, 0 ];
+ state.md.block.tokenize(state, startLine, nextLine);
+ token = state.push("blockquote_close", "blockquote", -1);
+ token.markup = ">";
+ state.lineMax = oldLineMax;
+ state.parentType = oldParentType;
+ lines[1] = state.line;
+ // Restore original tShift; this might not be necessary since the parser
+ // has already been here, but just to make sure we can do that.
+ for (i = 0; i < oldTShift.length; i++) {
+ state.bMarks[i + startLine] = oldBMarks[i];
+ state.tShift[i + startLine] = oldTShift[i];
+ state.sCount[i + startLine] = oldSCount[i];
+ state.bsCount[i + startLine] = oldBSCount[i];
+ }
+ state.blkIndent = oldIndent;
+ return true;
+ };
+ var isSpace$8 = utils.isSpace;
+ var hr = function hr(state, startLine, endLine, silent) {
+ var marker, cnt, ch, token, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine];
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false;
+ }
+ marker = state.src.charCodeAt(pos++);
+ // Check hr marker
+ if (marker !== 42 /* * */ && marker !== 45 /* - */ && marker !== 95 /* _ */) {
+ return false;
+ }
+ // markers can be mixed with spaces, but there should be at least 3 of them
+ cnt = 1;
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos++);
+ if (ch !== marker && !isSpace$8(ch)) {
+ return false;
+ }
+ if (ch === marker) {
+ cnt++;
+ }
+ }
+ if (cnt < 3) {
+ return false;
+ }
+ if (silent) {
+ return true;
+ }
+ state.line = startLine + 1;
+ token = state.push("hr", "hr", 0);
+ token.map = [ startLine, state.line ];
+ token.markup = Array(cnt + 1).join(String.fromCharCode(marker));
+ return true;
+ };
+ var isSpace$7 = utils.isSpace;
+ // Search `[-+*][\n ]`, returns next pos after marker on success
+ // or -1 on fail.
+ function skipBulletListMarker(state, startLine) {
+ var marker, pos, max, ch;
+ pos = state.bMarks[startLine] + state.tShift[startLine];
+ max = state.eMarks[startLine];
+ marker = state.src.charCodeAt(pos++);
+ // Check bullet
+ if (marker !== 42 /* * */ && marker !== 45 /* - */ && marker !== 43 /* + */) {
+ return -1;
+ }
+ if (pos < max) {
+ ch = state.src.charCodeAt(pos);
+ if (!isSpace$7(ch)) {
+ // " -test " - is not a list item
+ return -1;
+ }
+ }
+ return pos;
+ }
+ // Search `\d+[.)][\n ]`, returns next pos after marker on success
+ // or -1 on fail.
+ function skipOrderedListMarker(state, startLine) {
+ var ch, start = state.bMarks[startLine] + state.tShift[startLine], pos = start, max = state.eMarks[startLine];
+ // List marker should have at least 2 chars (digit + dot)
+ if (pos + 1 >= max) {
+ return -1;
+ }
+ ch = state.src.charCodeAt(pos++);
+ if (ch < 48 /* 0 */ || ch > 57 /* 9 */) {
+ return -1;
+ }
+ for (;;) {
+ // EOL -> fail
+ if (pos >= max) {
+ return -1;
+ }
+ ch = state.src.charCodeAt(pos++);
+ if (ch >= 48 /* 0 */ && ch <= 57 /* 9 */) {
+ // List marker should have no more than 9 digits
+ // (prevents integer overflow in browsers)
+ if (pos - start >= 10) {
+ return -1;
+ }
+ continue;
+ }
+ // found valid marker
+ if (ch === 41 /* ) */ || ch === 46 /* . */) {
+ break;
+ }
+ return -1;
+ }
+ if (pos < max) {
+ ch = state.src.charCodeAt(pos);
+ if (!isSpace$7(ch)) {
+ // " 1.test " - is not a list item
+ return -1;
+ }
+ }
+ return pos;
+ }
+ function markTightParagraphs(state, idx) {
+ var i, l, level = state.level + 2;
+ for (i = idx + 2, l = state.tokens.length - 2; i < l; i++) {
+ if (state.tokens[i].level === level && state.tokens[i].type === "paragraph_open") {
+ state.tokens[i + 2].hidden = true;
+ state.tokens[i].hidden = true;
+ i += 2;
+ }
+ }
+ }
+ var list = function list(state, startLine, endLine, silent) {
+ var ch, contentStart, i, indent, indentAfterMarker, initial, isOrdered, itemLines, l, listLines, listTokIdx, markerCharCode, markerValue, max, nextLine, offset, oldListIndent, oldParentType, oldSCount, oldTShift, oldTight, pos, posAfterMarker, prevEmptyEnd, start, terminate, terminatorRules, token, isTerminatingParagraph = false, tight = true;
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false;
+ }
+ // Special case:
+ // - item 1
+ // - item 2
+ // - item 3
+ // - item 4
+ // - this one is a paragraph continuation
+ if (state.listIndent >= 0 && state.sCount[startLine] - state.listIndent >= 4 && state.sCount[startLine] < state.blkIndent) {
+ return false;
+ }
+ // limit conditions when list can interrupt
+ // a paragraph (validation mode only)
+ if (silent && state.parentType === "paragraph") {
+ // Next list item should still terminate previous list item;
+ // This code can fail if plugins use blkIndent as well as lists,
+ // but I hope the spec gets fixed long before that happens.
+ if (state.sCount[startLine] >= state.blkIndent) {
+ isTerminatingParagraph = true;
+ }
+ }
+ // Detect list type and position after marker
+ if ((posAfterMarker = skipOrderedListMarker(state, startLine)) >= 0) {
+ isOrdered = true;
+ start = state.bMarks[startLine] + state.tShift[startLine];
+ markerValue = Number(state.src.slice(start, posAfterMarker - 1));
+ // If we're starting a new ordered list right after
+ // a paragraph, it should start with 1.
+ if (isTerminatingParagraph && markerValue !== 1) return false;
+ } else if ((posAfterMarker = skipBulletListMarker(state, startLine)) >= 0) {
+ isOrdered = false;
+ } else {
+ return false;
+ }
+ // If we're starting a new unordered list right after
+ // a paragraph, first line should not be empty.
+ if (isTerminatingParagraph) {
+ if (state.skipSpaces(posAfterMarker) >= state.eMarks[startLine]) return false;
+ }
+ // We should terminate list on style change. Remember first one to compare.
+ markerCharCode = state.src.charCodeAt(posAfterMarker - 1);
+ // For validation mode we can terminate immediately
+ if (silent) {
+ return true;
+ }
+ // Start list
+ listTokIdx = state.tokens.length;
+ if (isOrdered) {
+ token = state.push("ordered_list_open", "ol", 1);
+ if (markerValue !== 1) {
+ token.attrs = [ [ "start", markerValue ] ];
+ }
+ } else {
+ token = state.push("bullet_list_open", "ul", 1);
+ }
+ token.map = listLines = [ startLine, 0 ];
+ token.markup = String.fromCharCode(markerCharCode);
+
+ // Iterate list items
+
+ nextLine = startLine;
+ prevEmptyEnd = false;
+ terminatorRules = state.md.block.ruler.getRules("list");
+ oldParentType = state.parentType;
+ state.parentType = "list";
+ while (nextLine < endLine) {
+ pos = posAfterMarker;
+ max = state.eMarks[nextLine];
+ initial = offset = state.sCount[nextLine] + posAfterMarker - (state.bMarks[startLine] + state.tShift[startLine]);
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos);
+ if (ch === 9) {
+ offset += 4 - (offset + state.bsCount[nextLine]) % 4;
+ } else if (ch === 32) {
+ offset++;
+ } else {
+ break;
+ }
+ pos++;
+ }
+ contentStart = pos;
+ if (contentStart >= max) {
+ // trimming space in "- \n 3" case, indent is 1 here
+ indentAfterMarker = 1;
+ } else {
+ indentAfterMarker = offset - initial;
+ }
+ // If we have more than 4 spaces, the indent is 1
+ // (the rest is just indented code block)
+ if (indentAfterMarker > 4) {
+ indentAfterMarker = 1;
+ }
+ // " - test"
+ // ^^^^^ - calculating total length of this thing
+ indent = initial + indentAfterMarker;
+ // Run subparser & write tokens
+ token = state.push("list_item_open", "li", 1);
+ token.markup = String.fromCharCode(markerCharCode);
+ token.map = itemLines = [ startLine, 0 ];
+ if (isOrdered) {
+ token.info = state.src.slice(start, posAfterMarker - 1);
+ }
+ // change current state, then restore it after parser subcall
+ oldTight = state.tight;
+ oldTShift = state.tShift[startLine];
+ oldSCount = state.sCount[startLine];
+ // - example list
+ // ^ listIndent position will be here
+ // ^ blkIndent position will be here
+
+ oldListIndent = state.listIndent;
+ state.listIndent = state.blkIndent;
+ state.blkIndent = indent;
+ state.tight = true;
+ state.tShift[startLine] = contentStart - state.bMarks[startLine];
+ state.sCount[startLine] = offset;
+ if (contentStart >= max && state.isEmpty(startLine + 1)) {
+ // workaround for this case
+ // (list item is empty, list terminates before "foo"):
+ // ~~~~~~~~
+ // -
+ // foo
+ // ~~~~~~~~
+ state.line = Math.min(state.line + 2, endLine);
+ } else {
+ state.md.block.tokenize(state, startLine, endLine, true);
+ }
+ // If any of list item is tight, mark list as tight
+ if (!state.tight || prevEmptyEnd) {
+ tight = false;
+ }
+ // Item become loose if finish with empty line,
+ // but we should filter last element, because it means list finish
+ prevEmptyEnd = state.line - startLine > 1 && state.isEmpty(state.line - 1);
+ state.blkIndent = state.listIndent;
+ state.listIndent = oldListIndent;
+ state.tShift[startLine] = oldTShift;
+ state.sCount[startLine] = oldSCount;
+ state.tight = oldTight;
+ token = state.push("list_item_close", "li", -1);
+ token.markup = String.fromCharCode(markerCharCode);
+ nextLine = startLine = state.line;
+ itemLines[1] = nextLine;
+ contentStart = state.bMarks[startLine];
+ if (nextLine >= endLine) {
+ break;
+ }
+
+ // Try to check if list is terminated or continued.
+
+ if (state.sCount[nextLine] < state.blkIndent) {
+ break;
+ }
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ break;
+ }
+ // fail if terminating block found
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+ if (terminate) {
+ break;
+ }
+ // fail if list has another type
+ if (isOrdered) {
+ posAfterMarker = skipOrderedListMarker(state, nextLine);
+ if (posAfterMarker < 0) {
+ break;
+ }
+ start = state.bMarks[nextLine] + state.tShift[nextLine];
+ } else {
+ posAfterMarker = skipBulletListMarker(state, nextLine);
+ if (posAfterMarker < 0) {
+ break;
+ }
+ }
+ if (markerCharCode !== state.src.charCodeAt(posAfterMarker - 1)) {
+ break;
+ }
+ }
+ // Finalize list
+ if (isOrdered) {
+ token = state.push("ordered_list_close", "ol", -1);
+ } else {
+ token = state.push("bullet_list_close", "ul", -1);
+ }
+ token.markup = String.fromCharCode(markerCharCode);
+ listLines[1] = nextLine;
+ state.line = nextLine;
+ state.parentType = oldParentType;
+ // mark paragraphs tight if needed
+ if (tight) {
+ markTightParagraphs(state, listTokIdx);
+ }
+ return true;
+ };
+ var normalizeReference$2 = utils.normalizeReference;
+ var isSpace$6 = utils.isSpace;
+ var reference = function reference(state, startLine, _endLine, silent) {
+ var ch, destEndPos, destEndLineNo, endLine, href, i, l, label, labelEnd, oldParentType, res, start, str, terminate, terminatorRules, title, lines = 0, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine], nextLine = startLine + 1;
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false;
+ }
+ if (state.src.charCodeAt(pos) !== 91 /* [ */) {
+ return false;
+ }
+ // Simple check to quickly interrupt scan on [link](url) at the start of line.
+ // Can be useful on practice: https://github.com/markdown-it/markdown-it/issues/54
+ while (++pos < max) {
+ if (state.src.charCodeAt(pos) === 93 /* ] */ && state.src.charCodeAt(pos - 1) !== 92 /* \ */) {
+ if (pos + 1 === max) {
+ return false;
+ }
+ if (state.src.charCodeAt(pos + 1) !== 58 /* : */) {
+ return false;
+ }
+ break;
+ }
+ }
+ endLine = state.lineMax;
+ // jump line-by-line until empty one or EOF
+ terminatorRules = state.md.block.ruler.getRules("reference");
+ oldParentType = state.parentType;
+ state.parentType = "reference";
+ for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+ // this would be a code block normally, but after paragraph
+ // it's considered a lazy continuation regardless of what's there
+ if (state.sCount[nextLine] - state.blkIndent > 3) {
+ continue;
+ }
+ // quirk for blockquotes, this line should already be checked by that rule
+ if (state.sCount[nextLine] < 0) {
+ continue;
+ }
+ // Some tags can terminate paragraph without empty line.
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+ if (terminate) {
+ break;
+ }
+ }
+ str = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+ max = str.length;
+ for (pos = 1; pos < max; pos++) {
+ ch = str.charCodeAt(pos);
+ if (ch === 91 /* [ */) {
+ return false;
+ } else if (ch === 93 /* ] */) {
+ labelEnd = pos;
+ break;
+ } else if (ch === 10 /* \n */) {
+ lines++;
+ } else if (ch === 92 /* \ */) {
+ pos++;
+ if (pos < max && str.charCodeAt(pos) === 10) {
+ lines++;
+ }
+ }
+ }
+ if (labelEnd < 0 || str.charCodeAt(labelEnd + 1) !== 58 /* : */) {
+ return false;
+ }
+ // [label]: destination 'title'
+ // ^^^ skip optional whitespace here
+ for (pos = labelEnd + 2; pos < max; pos++) {
+ ch = str.charCodeAt(pos);
+ if (ch === 10) {
+ lines++;
+ } else if (isSpace$6(ch)) ; else {
+ break;
+ }
+ }
+ // [label]: destination 'title'
+ // ^^^^^^^^^^^ parse this
+ res = state.md.helpers.parseLinkDestination(str, pos, max);
+ if (!res.ok) {
+ return false;
+ }
+ href = state.md.normalizeLink(res.str);
+ if (!state.md.validateLink(href)) {
+ return false;
+ }
+ pos = res.pos;
+ lines += res.lines;
+ // save cursor state, we could require to rollback later
+ destEndPos = pos;
+ destEndLineNo = lines;
+ // [label]: destination 'title'
+ // ^^^ skipping those spaces
+ start = pos;
+ for (;pos < max; pos++) {
+ ch = str.charCodeAt(pos);
+ if (ch === 10) {
+ lines++;
+ } else if (isSpace$6(ch)) ; else {
+ break;
+ }
+ }
+ // [label]: destination 'title'
+ // ^^^^^^^ parse this
+ res = state.md.helpers.parseLinkTitle(str, pos, max);
+ if (pos < max && start !== pos && res.ok) {
+ title = res.str;
+ pos = res.pos;
+ lines += res.lines;
+ } else {
+ title = "";
+ pos = destEndPos;
+ lines = destEndLineNo;
+ }
+ // skip trailing spaces until the rest of the line
+ while (pos < max) {
+ ch = str.charCodeAt(pos);
+ if (!isSpace$6(ch)) {
+ break;
+ }
+ pos++;
+ }
+ if (pos < max && str.charCodeAt(pos) !== 10) {
+ if (title) {
+ // garbage at the end of the line after title,
+ // but it could still be a valid reference if we roll back
+ title = "";
+ pos = destEndPos;
+ lines = destEndLineNo;
+ while (pos < max) {
+ ch = str.charCodeAt(pos);
+ if (!isSpace$6(ch)) {
+ break;
+ }
+ pos++;
+ }
+ }
+ }
+ if (pos < max && str.charCodeAt(pos) !== 10) {
+ // garbage at the end of the line
+ return false;
+ }
+ label = normalizeReference$2(str.slice(1, labelEnd));
+ if (!label) {
+ // CommonMark 0.20 disallows empty labels
+ return false;
+ }
+ // Reference can not terminate anything. This check is for safety only.
+ /*istanbul ignore if*/ if (silent) {
+ return true;
+ }
+ if (typeof state.env.references === "undefined") {
+ state.env.references = {};
+ }
+ if (typeof state.env.references[label] === "undefined") {
+ state.env.references[label] = {
+ title: title,
+ href: href
+ };
+ }
+ state.parentType = oldParentType;
+ state.line = startLine + lines + 1;
+ return true;
+ };
+ // List of valid html blocks names, accorting to commonmark spec
+ var html_blocks = [ "address", "article", "aside", "base", "basefont", "blockquote", "body", "caption", "center", "col", "colgroup", "dd", "details", "dialog", "dir", "div", "dl", "dt", "fieldset", "figcaption", "figure", "footer", "form", "frame", "frameset", "h1", "h2", "h3", "h4", "h5", "h6", "head", "header", "hr", "html", "iframe", "legend", "li", "link", "main", "menu", "menuitem", "nav", "noframes", "ol", "optgroup", "option", "p", "param", "section", "source", "summary", "table", "tbody", "td", "tfoot", "th", "thead", "title", "tr", "track", "ul" ];
+ // Regexps to match html elements
+ var attr_name = "[a-zA-Z_:][a-zA-Z0-9:._-]*";
+ var unquoted = "[^\"'=<>`\\x00-\\x20]+";
+ var single_quoted = "'[^']*'";
+ var double_quoted = '"[^"]*"';
+ var attr_value = "(?:" + unquoted + "|" + single_quoted + "|" + double_quoted + ")";
+ var attribute = "(?:\\s+" + attr_name + "(?:\\s*=\\s*" + attr_value + ")?)";
+ var open_tag = "<[A-Za-z][A-Za-z0-9\\-]*" + attribute + "*\\s*\\/?>";
+ var close_tag = "<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>";
+ var comment = "\x3c!----\x3e|\x3c!--(?:-?[^>-])(?:-?[^-])*--\x3e";
+ var processing = "<[?][\\s\\S]*?[?]>";
+ var declaration = "<![A-Z]+\\s+[^>]*>";
+ var cdata = "<!\\[CDATA\\[[\\s\\S]*?\\]\\]>";
+ var HTML_TAG_RE$1 = new RegExp("^(?:" + open_tag + "|" + close_tag + "|" + comment + "|" + processing + "|" + declaration + "|" + cdata + ")");
+ var HTML_OPEN_CLOSE_TAG_RE$1 = new RegExp("^(?:" + open_tag + "|" + close_tag + ")");
+ var HTML_TAG_RE_1 = HTML_TAG_RE$1;
+ var HTML_OPEN_CLOSE_TAG_RE_1 = HTML_OPEN_CLOSE_TAG_RE$1;
+ var html_re = {
+ HTML_TAG_RE: HTML_TAG_RE_1,
+ HTML_OPEN_CLOSE_TAG_RE: HTML_OPEN_CLOSE_TAG_RE_1
+ };
+ var HTML_OPEN_CLOSE_TAG_RE = html_re.HTML_OPEN_CLOSE_TAG_RE;
+ // An array of opening and corresponding closing sequences for html tags,
+ // last argument defines whether it can terminate a paragraph or not
+
+ var HTML_SEQUENCES = [ [ /^<(script|pre|style|textarea)(?=(\s|>|$))/i, /<\/(script|pre|style|textarea)>/i, true ], [ /^<!--/, /-->/, true ], [ /^<\?/, /\?>/, true ], [ /^<![A-Z]/, />/, true ], [ /^<!\[CDATA\[/, /\]\]>/, true ], [ new RegExp("^</?(" + html_blocks.join("|") + ")(?=(\\s|/?>|$))", "i"), /^$/, true ], [ new RegExp(HTML_OPEN_CLOSE_TAG_RE.source + "\\s*$"), /^$/, false ] ];
+ var html_block = function html_block(state, startLine, endLine, silent) {
+ var i, nextLine, token, lineText, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine];
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false;
+ }
+ if (!state.md.options.html) {
+ return false;
+ }
+ if (state.src.charCodeAt(pos) !== 60 /* < */) {
+ return false;
+ }
+ lineText = state.src.slice(pos, max);
+ for (i = 0; i < HTML_SEQUENCES.length; i++) {
+ if (HTML_SEQUENCES[i][0].test(lineText)) {
+ break;
+ }
+ }
+ if (i === HTML_SEQUENCES.length) {
+ return false;
+ }
+ if (silent) {
+ // true if this sequence can be a terminator, false otherwise
+ return HTML_SEQUENCES[i][2];
+ }
+ nextLine = startLine + 1;
+ // If we are here - we detected HTML block.
+ // Let's roll down till block end.
+ if (!HTML_SEQUENCES[i][1].test(lineText)) {
+ for (;nextLine < endLine; nextLine++) {
+ if (state.sCount[nextLine] < state.blkIndent) {
+ break;
+ }
+ pos = state.bMarks[nextLine] + state.tShift[nextLine];
+ max = state.eMarks[nextLine];
+ lineText = state.src.slice(pos, max);
+ if (HTML_SEQUENCES[i][1].test(lineText)) {
+ if (lineText.length !== 0) {
+ nextLine++;
+ }
+ break;
+ }
+ }
+ }
+ state.line = nextLine;
+ token = state.push("html_block", "", 0);
+ token.map = [ startLine, nextLine ];
+ token.content = state.getLines(startLine, nextLine, state.blkIndent, true);
+ return true;
+ };
+ var isSpace$5 = utils.isSpace;
+ var heading = function heading(state, startLine, endLine, silent) {
+ var ch, level, tmp, token, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine];
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false;
+ }
+ ch = state.src.charCodeAt(pos);
+ if (ch !== 35 /* # */ || pos >= max) {
+ return false;
+ }
+ // count heading level
+ level = 1;
+ ch = state.src.charCodeAt(++pos);
+ while (ch === 35 /* # */ && pos < max && level <= 6) {
+ level++;
+ ch = state.src.charCodeAt(++pos);
+ }
+ if (level > 6 || pos < max && !isSpace$5(ch)) {
+ return false;
+ }
+ if (silent) {
+ return true;
+ }
+ // Let's cut tails like ' ### ' from the end of string
+ max = state.skipSpacesBack(max, pos);
+ tmp = state.skipCharsBack(max, 35, pos);
+ // #
+ if (tmp > pos && isSpace$5(state.src.charCodeAt(tmp - 1))) {
+ max = tmp;
+ }
+ state.line = startLine + 1;
+ token = state.push("heading_open", "h" + String(level), 1);
+ token.markup = "########".slice(0, level);
+ token.map = [ startLine, state.line ];
+ token = state.push("inline", "", 0);
+ token.content = state.src.slice(pos, max).trim();
+ token.map = [ startLine, state.line ];
+ token.children = [];
+ token = state.push("heading_close", "h" + String(level), -1);
+ token.markup = "########".slice(0, level);
+ return true;
+ };
+ // lheading (---, ===)
+ var lheading = function lheading(state, startLine, endLine /*, silent*/) {
+ var content, terminate, i, l, token, pos, max, level, marker, nextLine = startLine + 1, oldParentType, terminatorRules = state.md.block.ruler.getRules("paragraph");
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) {
+ return false;
+ }
+ oldParentType = state.parentType;
+ state.parentType = "paragraph";
+ // use paragraph to match terminatorRules
+ // jump line-by-line until empty one or EOF
+ for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+ // this would be a code block normally, but after paragraph
+ // it's considered a lazy continuation regardless of what's there
+ if (state.sCount[nextLine] - state.blkIndent > 3) {
+ continue;
+ }
+
+ // Check for underline in setext header
+
+ if (state.sCount[nextLine] >= state.blkIndent) {
+ pos = state.bMarks[nextLine] + state.tShift[nextLine];
+ max = state.eMarks[nextLine];
+ if (pos < max) {
+ marker = state.src.charCodeAt(pos);
+ if (marker === 45 /* - */ || marker === 61 /* = */) {
+ pos = state.skipChars(pos, marker);
+ pos = state.skipSpaces(pos);
+ if (pos >= max) {
+ level = marker === 61 /* = */ ? 1 : 2;
+ break;
+ }
+ }
+ }
+ }
+ // quirk for blockquotes, this line should already be checked by that rule
+ if (state.sCount[nextLine] < 0) {
+ continue;
+ }
+ // Some tags can terminate paragraph without empty line.
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+ if (terminate) {
+ break;
+ }
+ }
+ if (!level) {
+ // Didn't find valid underline
+ return false;
+ }
+ content = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+ state.line = nextLine + 1;
+ token = state.push("heading_open", "h" + String(level), 1);
+ token.markup = String.fromCharCode(marker);
+ token.map = [ startLine, state.line ];
+ token = state.push("inline", "", 0);
+ token.content = content;
+ token.map = [ startLine, state.line - 1 ];
+ token.children = [];
+ token = state.push("heading_close", "h" + String(level), -1);
+ token.markup = String.fromCharCode(marker);
+ state.parentType = oldParentType;
+ return true;
+ };
+ // Paragraph
+ var paragraph = function paragraph(state, startLine /*, endLine*/) {
+ var content, terminate, i, l, token, oldParentType, nextLine = startLine + 1, terminatorRules = state.md.block.ruler.getRules("paragraph"), endLine = state.lineMax;
+ oldParentType = state.parentType;
+ state.parentType = "paragraph";
+ // jump line-by-line until empty one or EOF
+ for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+ // this would be a code block normally, but after paragraph
+ // it's considered a lazy continuation regardless of what's there
+ if (state.sCount[nextLine] - state.blkIndent > 3) {
+ continue;
+ }
+ // quirk for blockquotes, this line should already be checked by that rule
+ if (state.sCount[nextLine] < 0) {
+ continue;
+ }
+ // Some tags can terminate paragraph without empty line.
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+ if (terminate) {
+ break;
+ }
+ }
+ content = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+ state.line = nextLine;
+ token = state.push("paragraph_open", "p", 1);
+ token.map = [ startLine, state.line ];
+ token = state.push("inline", "", 0);
+ token.content = content;
+ token.map = [ startLine, state.line ];
+ token.children = [];
+ token = state.push("paragraph_close", "p", -1);
+ state.parentType = oldParentType;
+ return true;
+ };
+ var isSpace$4 = utils.isSpace;
+ function StateBlock(src, md, env, tokens) {
+ var ch, s, start, pos, len, indent, offset, indent_found;
+ this.src = src;
+ // link to parser instance
+ this.md = md;
+ this.env = env;
+
+ // Internal state vartiables
+
+ this.tokens = tokens;
+ this.bMarks = [];
+ // line begin offsets for fast jumps
+ this.eMarks = [];
+ // line end offsets for fast jumps
+ this.tShift = [];
+ // offsets of the first non-space characters (tabs not expanded)
+ this.sCount = [];
+ // indents for each line (tabs expanded)
+ // An amount of virtual spaces (tabs expanded) between beginning
+ // of each line (bMarks) and real beginning of that line.
+
+ // It exists only as a hack because blockquotes override bMarks
+ // losing information in the process.
+
+ // It's used only when expanding tabs, you can think about it as
+ // an initial tab length, e.g. bsCount=21 applied to string `\t123`
+ // means first tab should be expanded to 4-21%4 === 3 spaces.
+
+ this.bsCount = [];
+ // block parser variables
+ this.blkIndent = 0;
+ // required block content indent (for example, if we are
+ // inside a list, it would be positioned after list marker)
+ this.line = 0;
+ // line index in src
+ this.lineMax = 0;
+ // lines count
+ this.tight = false;
+ // loose/tight mode for lists
+ this.ddIndent = -1;
+ // indent of the current dd block (-1 if there isn't any)
+ this.listIndent = -1;
+ // indent of the current list block (-1 if there isn't any)
+ // can be 'blockquote', 'list', 'root', 'paragraph' or 'reference'
+ // used in lists to determine if they interrupt a paragraph
+ this.parentType = "root";
+ this.level = 0;
+ // renderer
+ this.result = "";
+ // Create caches
+ // Generate markers.
+ s = this.src;
+ indent_found = false;
+ for (start = pos = indent = offset = 0, len = s.length; pos < len; pos++) {
+ ch = s.charCodeAt(pos);
+ if (!indent_found) {
+ if (isSpace$4(ch)) {
+ indent++;
+ if (ch === 9) {
+ offset += 4 - offset % 4;
+ } else {
+ offset++;
+ }
+ continue;
+ } else {
+ indent_found = true;
+ }
+ }
+ if (ch === 10 || pos === len - 1) {
+ if (ch !== 10) {
+ pos++;
+ }
+ this.bMarks.push(start);
+ this.eMarks.push(pos);
+ this.tShift.push(indent);
+ this.sCount.push(offset);
+ this.bsCount.push(0);
+ indent_found = false;
+ indent = 0;
+ offset = 0;
+ start = pos + 1;
+ }
+ }
+ // Push fake entry to simplify cache bounds checks
+ this.bMarks.push(s.length);
+ this.eMarks.push(s.length);
+ this.tShift.push(0);
+ this.sCount.push(0);
+ this.bsCount.push(0);
+ this.lineMax = this.bMarks.length - 1;
+ // don't count last fake line
+ }
+ // Push new token to "stream".
+
+ StateBlock.prototype.push = function(type, tag, nesting) {
+ var token$1 = new token(type, tag, nesting);
+ token$1.block = true;
+ if (nesting < 0) this.level--;
+ // closing tag
+ token$1.level = this.level;
+ if (nesting > 0) this.level++;
+ // opening tag
+ this.tokens.push(token$1);
+ return token$1;
+ };
+ StateBlock.prototype.isEmpty = function isEmpty(line) {
+ return this.bMarks[line] + this.tShift[line] >= this.eMarks[line];
+ };
+ StateBlock.prototype.skipEmptyLines = function skipEmptyLines(from) {
+ for (var max = this.lineMax; from < max; from++) {
+ if (this.bMarks[from] + this.tShift[from] < this.eMarks[from]) {
+ break;
+ }
+ }
+ return from;
+ };
+ // Skip spaces from given position.
+ StateBlock.prototype.skipSpaces = function skipSpaces(pos) {
+ var ch;
+ for (var max = this.src.length; pos < max; pos++) {
+ ch = this.src.charCodeAt(pos);
+ if (!isSpace$4(ch)) {
+ break;
+ }
+ }
+ return pos;
+ };
+ // Skip spaces from given position in reverse.
+ StateBlock.prototype.skipSpacesBack = function skipSpacesBack(pos, min) {
+ if (pos <= min) {
+ return pos;
+ }
+ while (pos > min) {
+ if (!isSpace$4(this.src.charCodeAt(--pos))) {
+ return pos + 1;
+ }
+ }
+ return pos;
+ };
+ // Skip char codes from given position
+ StateBlock.prototype.skipChars = function skipChars(pos, code) {
+ for (var max = this.src.length; pos < max; pos++) {
+ if (this.src.charCodeAt(pos) !== code) {
+ break;
+ }
+ }
+ return pos;
+ };
+ // Skip char codes reverse from given position - 1
+ StateBlock.prototype.skipCharsBack = function skipCharsBack(pos, code, min) {
+ if (pos <= min) {
+ return pos;
+ }
+ while (pos > min) {
+ if (code !== this.src.charCodeAt(--pos)) {
+ return pos + 1;
+ }
+ }
+ return pos;
+ };
+ // cut lines range from source.
+ StateBlock.prototype.getLines = function getLines(begin, end, indent, keepLastLF) {
+ var i, lineIndent, ch, first, last, queue, lineStart, line = begin;
+ if (begin >= end) {
+ return "";
+ }
+ queue = new Array(end - begin);
+ for (i = 0; line < end; line++, i++) {
+ lineIndent = 0;
+ lineStart = first = this.bMarks[line];
+ if (line + 1 < end || keepLastLF) {
+ // No need for bounds check because we have fake entry on tail.
+ last = this.eMarks[line] + 1;
+ } else {
+ last = this.eMarks[line];
+ }
+ while (first < last && lineIndent < indent) {
+ ch = this.src.charCodeAt(first);
+ if (isSpace$4(ch)) {
+ if (ch === 9) {
+ lineIndent += 4 - (lineIndent + this.bsCount[line]) % 4;
+ } else {
+ lineIndent++;
+ }
+ } else if (first - lineStart < this.tShift[line]) {
+ // patched tShift masked characters to look like spaces (blockquotes, list markers)
+ lineIndent++;
+ } else {
+ break;
+ }
+ first++;
+ }
+ if (lineIndent > indent) {
+ // partially expanding tabs in code blocks, e.g '\t\tfoobar'
+ // with indent=2 becomes ' \tfoobar'
+ queue[i] = new Array(lineIndent - indent + 1).join(" ") + this.src.slice(first, last);
+ } else {
+ queue[i] = this.src.slice(first, last);
+ }
+ }
+ return queue.join("");
+ };
+ // re-export Token class to use in block rules
+ StateBlock.prototype.Token = token;
+ var state_block = StateBlock;
+ var _rules$1 = [
+ // First 2 params - rule name & source. Secondary array - list of rules,
+ // which can be terminated by this one.
+ [ "table", table, [ "paragraph", "reference" ] ], [ "code", code ], [ "fence", fence, [ "paragraph", "reference", "blockquote", "list" ] ], [ "blockquote", blockquote, [ "paragraph", "reference", "blockquote", "list" ] ], [ "hr", hr, [ "paragraph", "reference", "blockquote", "list" ] ], [ "list", list, [ "paragraph", "reference", "blockquote" ] ], [ "reference", reference ], [ "html_block", html_block, [ "paragraph", "reference", "blockquote" ] ], [ "heading", heading, [ "paragraph", "reference", "blockquote" ] ], [ "lheading", lheading ], [ "paragraph", paragraph ] ];
+ /**
+ * new ParserBlock()
+ **/ function ParserBlock() {
+ /**
+ * ParserBlock#ruler -> Ruler
+ *
+ * [[Ruler]] instance. Keep configuration of block rules.
+ **/
+ this.ruler = new ruler;
+ for (var i = 0; i < _rules$1.length; i++) {
+ this.ruler.push(_rules$1[i][0], _rules$1[i][1], {
+ alt: (_rules$1[i][2] || []).slice()
+ });
+ }
+ }
+ // Generate tokens for input range
+
+ ParserBlock.prototype.tokenize = function(state, startLine, endLine) {
+ var ok, i, rules = this.ruler.getRules(""), len = rules.length, line = startLine, hasEmptyLines = false, maxNesting = state.md.options.maxNesting;
+ while (line < endLine) {
+ state.line = line = state.skipEmptyLines(line);
+ if (line >= endLine) {
+ break;
+ }
+ // Termination condition for nested calls.
+ // Nested calls currently used for blockquotes & lists
+ if (state.sCount[line] < state.blkIndent) {
+ break;
+ }
+ // If nesting level exceeded - skip tail to the end. That's not ordinary
+ // situation and we should not care about content.
+ if (state.level >= maxNesting) {
+ state.line = endLine;
+ break;
+ }
+ // Try all possible rules.
+ // On success, rule should:
+
+ // - update `state.line`
+ // - update `state.tokens`
+ // - return true
+ for (i = 0; i < len; i++) {
+ ok = rules[i](state, line, endLine, false);
+ if (ok) {
+ break;
+ }
+ }
+ // set state.tight if we had an empty line before current tag
+ // i.e. latest empty line should not count
+ state.tight = !hasEmptyLines;
+ // paragraph might "eat" one newline after it in nested lists
+ if (state.isEmpty(state.line - 1)) {
+ hasEmptyLines = true;
+ }
+ line = state.line;
+ if (line < endLine && state.isEmpty(line)) {
+ hasEmptyLines = true;
+ line++;
+ state.line = line;
+ }
+ }
+ };
+ /**
+ * ParserBlock.parse(str, md, env, outTokens)
+ *
+ * Process input string and push block tokens into `outTokens`
+ **/ ParserBlock.prototype.parse = function(src, md, env, outTokens) {
+ var state;
+ if (!src) {
+ return;
+ }
+ state = new this.State(src, md, env, outTokens);
+ this.tokenize(state, state.line, state.lineMax);
+ };
+ ParserBlock.prototype.State = state_block;
+ var parser_block = ParserBlock;
+ // Skip text characters for text token, place those to pending buffer
+ // Rule to skip pure text
+ // '{}$%@~+=:' reserved for extentions
+ // !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~
+ // !!!! Don't confuse with "Markdown ASCII Punctuation" chars
+ // http://spec.commonmark.org/0.15/#ascii-punctuation-character
+ function isTerminatorChar(ch) {
+ switch (ch) {
+ case 10 /* \n */ :
+ case 33 /* ! */ :
+ case 35 /* # */ :
+ case 36 /* $ */ :
+ case 37 /* % */ :
+ case 38 /* & */ :
+ case 42 /* * */ :
+ case 43 /* + */ :
+ case 45 /* - */ :
+ case 58 /* : */ :
+ case 60 /* < */ :
+ case 61 /* = */ :
+ case 62 /* > */ :
+ case 64 /* @ */ :
+ case 91 /* [ */ :
+ case 92 /* \ */ :
+ case 93 /* ] */ :
+ case 94 /* ^ */ :
+ case 95 /* _ */ :
+ case 96 /* ` */ :
+ case 123 /* { */ :
+ case 125 /* } */ :
+ case 126 /* ~ */ :
+ return true;
+
+ default:
+ return false;
+ }
+ }
+ var text = function text(state, silent) {
+ var pos = state.pos;
+ while (pos < state.posMax && !isTerminatorChar(state.src.charCodeAt(pos))) {
+ pos++;
+ }
+ if (pos === state.pos) {
+ return false;
+ }
+ if (!silent) {
+ state.pending += state.src.slice(state.pos, pos);
+ }
+ state.pos = pos;
+ return true;
+ };
+ var isSpace$3 = utils.isSpace;
+ var newline = function newline(state, silent) {
+ var pmax, max, ws, pos = state.pos;
+ if (state.src.charCodeAt(pos) !== 10 /* \n */) {
+ return false;
+ }
+ pmax = state.pending.length - 1;
+ max = state.posMax;
+ // ' \n' -> hardbreak
+ // Lookup in pending chars is bad practice! Don't copy to other rules!
+ // Pending string is stored in concat mode, indexed lookups will cause
+ // convertion to flat mode.
+ if (!silent) {
+ if (pmax >= 0 && state.pending.charCodeAt(pmax) === 32) {
+ if (pmax >= 1 && state.pending.charCodeAt(pmax - 1) === 32) {
+ // Find whitespaces tail of pending chars.
+ ws = pmax - 1;
+ while (ws >= 1 && state.pending.charCodeAt(ws - 1) === 32) ws--;
+ state.pending = state.pending.slice(0, ws);
+ state.push("hardbreak", "br", 0);
+ } else {
+ state.pending = state.pending.slice(0, -1);
+ state.push("softbreak", "br", 0);
+ }
+ } else {
+ state.push("softbreak", "br", 0);
+ }
+ }
+ pos++;
+ // skip heading spaces for next line
+ while (pos < max && isSpace$3(state.src.charCodeAt(pos))) {
+ pos++;
+ }
+ state.pos = pos;
+ return true;
+ };
+ var isSpace$2 = utils.isSpace;
+ var ESCAPED = [];
+ for (var i = 0; i < 256; i++) {
+ ESCAPED.push(0);
+ }
+ "\\!\"#$%&'()*+,./:;<=>?@[]^_`{|}~-".split("").forEach((function(ch) {
+ ESCAPED[ch.charCodeAt(0)] = 1;
+ }));
+ var _escape = function escape(state, silent) {
+ var ch, pos = state.pos, max = state.posMax;
+ if (state.src.charCodeAt(pos) !== 92 /* \ */) {
+ return false;
+ }
+ pos++;
+ if (pos < max) {
+ ch = state.src.charCodeAt(pos);
+ if (ch < 256 && ESCAPED[ch] !== 0) {
+ if (!silent) {
+ state.pending += state.src[pos];
+ }
+ state.pos += 2;
+ return true;
+ }
+ if (ch === 10) {
+ if (!silent) {
+ state.push("hardbreak", "br", 0);
+ }
+ pos++;
+ // skip leading whitespaces from next line
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos);
+ if (!isSpace$2(ch)) {
+ break;
+ }
+ pos++;
+ }
+ state.pos = pos;
+ return true;
+ }
+ }
+ if (!silent) {
+ state.pending += "\\";
+ }
+ state.pos++;
+ return true;
+ };
+ // Parse backticks
+ var backticks = function backtick(state, silent) {
+ var start, max, marker, token, matchStart, matchEnd, openerLength, closerLength, pos = state.pos, ch = state.src.charCodeAt(pos);
+ if (ch !== 96 /* ` */) {
+ return false;
+ }
+ start = pos;
+ pos++;
+ max = state.posMax;
+ // scan marker length
+ while (pos < max && state.src.charCodeAt(pos) === 96 /* ` */) {
+ pos++;
+ }
+ marker = state.src.slice(start, pos);
+ openerLength = marker.length;
+ if (state.backticksScanned && (state.backticks[openerLength] || 0) <= start) {
+ if (!silent) state.pending += marker;
+ state.pos += openerLength;
+ return true;
+ }
+ matchStart = matchEnd = pos;
+ // Nothing found in the cache, scan until the end of the line (or until marker is found)
+ while ((matchStart = state.src.indexOf("`", matchEnd)) !== -1) {
+ matchEnd = matchStart + 1;
+ // scan marker length
+ while (matchEnd < max && state.src.charCodeAt(matchEnd) === 96 /* ` */) {
+ matchEnd++;
+ }
+ closerLength = matchEnd - matchStart;
+ if (closerLength === openerLength) {
+ // Found matching closer length.
+ if (!silent) {
+ token = state.push("code_inline", "code", 0);
+ token.markup = marker;
+ token.content = state.src.slice(pos, matchStart).replace(/\n/g, " ").replace(/^ (.+) $/, "$1");
+ }
+ state.pos = matchEnd;
+ return true;
+ }
+ // Some different length found, put it in cache as upper limit of where closer can be found
+ state.backticks[closerLength] = matchStart;
+ }
+ // Scanned through the end, didn't find anything
+ state.backticksScanned = true;
+ if (!silent) state.pending += marker;
+ state.pos += openerLength;
+ return true;
+ };
+ // ~~strike through~~
+ // Insert each marker as a separate text token, and add it to delimiter list
+
+ var tokenize$1 = function strikethrough(state, silent) {
+ var i, scanned, token, len, ch, start = state.pos, marker = state.src.charCodeAt(start);
+ if (silent) {
+ return false;
+ }
+ if (marker !== 126 /* ~ */) {
+ return false;
+ }
+ scanned = state.scanDelims(state.pos, true);
+ len = scanned.length;
+ ch = String.fromCharCode(marker);
+ if (len < 2) {
+ return false;
+ }
+ if (len % 2) {
+ token = state.push("text", "", 0);
+ token.content = ch;
+ len--;
+ }
+ for (i = 0; i < len; i += 2) {
+ token = state.push("text", "", 0);
+ token.content = ch + ch;
+ state.delimiters.push({
+ marker: marker,
+ length: 0,
+ // disable "rule of 3" length checks meant for emphasis
+ token: state.tokens.length - 1,
+ end: -1,
+ open: scanned.can_open,
+ close: scanned.can_close
+ });
+ }
+ state.pos += scanned.length;
+ return true;
+ };
+ function postProcess$1(state, delimiters) {
+ var i, j, startDelim, endDelim, token, loneMarkers = [], max = delimiters.length;
+ for (i = 0; i < max; i++) {
+ startDelim = delimiters[i];
+ if (startDelim.marker !== 126 /* ~ */) {
+ continue;
+ }
+ if (startDelim.end === -1) {
+ continue;
+ }
+ endDelim = delimiters[startDelim.end];
+ token = state.tokens[startDelim.token];
+ token.type = "s_open";
+ token.tag = "s";
+ token.nesting = 1;
+ token.markup = "~~";
+ token.content = "";
+ token = state.tokens[endDelim.token];
+ token.type = "s_close";
+ token.tag = "s";
+ token.nesting = -1;
+ token.markup = "~~";
+ token.content = "";
+ if (state.tokens[endDelim.token - 1].type === "text" && state.tokens[endDelim.token - 1].content === "~") {
+ loneMarkers.push(endDelim.token - 1);
+ }
+ }
+ // If a marker sequence has an odd number of characters, it's splitted
+ // like this: `~~~~~` -> `~` + `~~` + `~~`, leaving one marker at the
+ // start of the sequence.
+
+ // So, we have to move all those markers after subsequent s_close tags.
+
+ while (loneMarkers.length) {
+ i = loneMarkers.pop();
+ j = i + 1;
+ while (j < state.tokens.length && state.tokens[j].type === "s_close") {
+ j++;
+ }
+ j--;
+ if (i !== j) {
+ token = state.tokens[j];
+ state.tokens[j] = state.tokens[i];
+ state.tokens[i] = token;
+ }
+ }
+ }
+ // Walk through delimiter list and replace text tokens with tags
+
+ var postProcess_1$1 = function strikethrough(state) {
+ var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length;
+ postProcess$1(state, state.delimiters);
+ for (curr = 0; curr < max; curr++) {
+ if (tokens_meta[curr] && tokens_meta[curr].delimiters) {
+ postProcess$1(state, tokens_meta[curr].delimiters);
+ }
+ }
+ };
+ var strikethrough = {
+ tokenize: tokenize$1,
+ postProcess: postProcess_1$1
+ };
+ // Process *this* and _that_
+ // Insert each marker as a separate text token, and add it to delimiter list
+
+ var tokenize = function emphasis(state, silent) {
+ var i, scanned, token, start = state.pos, marker = state.src.charCodeAt(start);
+ if (silent) {
+ return false;
+ }
+ if (marker !== 95 /* _ */ && marker !== 42 /* * */) {
+ return false;
+ }
+ scanned = state.scanDelims(state.pos, marker === 42);
+ for (i = 0; i < scanned.length; i++) {
+ token = state.push("text", "", 0);
+ token.content = String.fromCharCode(marker);
+ state.delimiters.push({
+ // Char code of the starting marker (number).
+ marker: marker,
+ // Total length of these series of delimiters.
+ length: scanned.length,
+ // A position of the token this delimiter corresponds to.
+ token: state.tokens.length - 1,
+ // If this delimiter is matched as a valid opener, `end` will be
+ // equal to its position, otherwise it's `-1`.
+ end: -1,
+ // Boolean flags that determine if this delimiter could open or close
+ // an emphasis.
+ open: scanned.can_open,
+ close: scanned.can_close
+ });
+ }
+ state.pos += scanned.length;
+ return true;
+ };
+ function postProcess(state, delimiters) {
+ var i, startDelim, endDelim, token, ch, isStrong, max = delimiters.length;
+ for (i = max - 1; i >= 0; i--) {
+ startDelim = delimiters[i];
+ if (startDelim.marker !== 95 /* _ */ && startDelim.marker !== 42 /* * */) {
+ continue;
+ }
+ // Process only opening markers
+ if (startDelim.end === -1) {
+ continue;
+ }
+ endDelim = delimiters[startDelim.end];
+ // If the previous delimiter has the same marker and is adjacent to this one,
+ // merge those into one strong delimiter.
+
+ // `<em><em>whatever</em></em>` -> `<strong>whatever</strong>`
+
+ isStrong = i > 0 && delimiters[i - 1].end === startDelim.end + 1 &&
+ // check that first two markers match and adjacent
+ delimiters[i - 1].marker === startDelim.marker && delimiters[i - 1].token === startDelim.token - 1 &&
+ // check that last two markers are adjacent (we can safely assume they match)
+ delimiters[startDelim.end + 1].token === endDelim.token + 1;
+ ch = String.fromCharCode(startDelim.marker);
+ token = state.tokens[startDelim.token];
+ token.type = isStrong ? "strong_open" : "em_open";
+ token.tag = isStrong ? "strong" : "em";
+ token.nesting = 1;
+ token.markup = isStrong ? ch + ch : ch;
+ token.content = "";
+ token = state.tokens[endDelim.token];
+ token.type = isStrong ? "strong_close" : "em_close";
+ token.tag = isStrong ? "strong" : "em";
+ token.nesting = -1;
+ token.markup = isStrong ? ch + ch : ch;
+ token.content = "";
+ if (isStrong) {
+ state.tokens[delimiters[i - 1].token].content = "";
+ state.tokens[delimiters[startDelim.end + 1].token].content = "";
+ i--;
+ }
+ }
+ }
+ // Walk through delimiter list and replace text tokens with tags
+
+ var postProcess_1 = function emphasis(state) {
+ var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length;
+ postProcess(state, state.delimiters);
+ for (curr = 0; curr < max; curr++) {
+ if (tokens_meta[curr] && tokens_meta[curr].delimiters) {
+ postProcess(state, tokens_meta[curr].delimiters);
+ }
+ }
+ };
+ var emphasis = {
+ tokenize: tokenize,
+ postProcess: postProcess_1
+ };
+ var normalizeReference$1 = utils.normalizeReference;
+ var isSpace$1 = utils.isSpace;
+ var link = function link(state, silent) {
+ var attrs, code, label, labelEnd, labelStart, pos, res, ref, token, href = "", title = "", oldPos = state.pos, max = state.posMax, start = state.pos, parseReference = true;
+ if (state.src.charCodeAt(state.pos) !== 91 /* [ */) {
+ return false;
+ }
+ labelStart = state.pos + 1;
+ labelEnd = state.md.helpers.parseLinkLabel(state, state.pos, true);
+ // parser failed to find ']', so it's not a valid link
+ if (labelEnd < 0) {
+ return false;
+ }
+ pos = labelEnd + 1;
+ if (pos < max && state.src.charCodeAt(pos) === 40 /* ( */) {
+ // Inline link
+ // might have found a valid shortcut link, disable reference parsing
+ parseReference = false;
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ pos++;
+ for (;pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace$1(code) && code !== 10) {
+ break;
+ }
+ }
+ if (pos >= max) {
+ return false;
+ }
+ // [link]( <href> "title" )
+ // ^^^^^^ parsing link destination
+ start = pos;
+ res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax);
+ if (res.ok) {
+ href = state.md.normalizeLink(res.str);
+ if (state.md.validateLink(href)) {
+ pos = res.pos;
+ } else {
+ href = "";
+ }
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ start = pos;
+ for (;pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace$1(code) && code !== 10) {
+ break;
+ }
+ }
+ // [link]( <href> "title" )
+ // ^^^^^^^ parsing link title
+ res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax);
+ if (pos < max && start !== pos && res.ok) {
+ title = res.str;
+ pos = res.pos;
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ for (;pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace$1(code) && code !== 10) {
+ break;
+ }
+ }
+ }
+ }
+ if (pos >= max || state.src.charCodeAt(pos) !== 41 /* ) */) {
+ // parsing a valid shortcut link failed, fallback to reference
+ parseReference = true;
+ }
+ pos++;
+ }
+ if (parseReference) {
+ // Link reference
+ if (typeof state.env.references === "undefined") {
+ return false;
+ }
+ if (pos < max && state.src.charCodeAt(pos) === 91 /* [ */) {
+ start = pos + 1;
+ pos = state.md.helpers.parseLinkLabel(state, pos);
+ if (pos >= 0) {
+ label = state.src.slice(start, pos++);
+ } else {
+ pos = labelEnd + 1;
+ }
+ } else {
+ pos = labelEnd + 1;
+ }
+ // covers label === '' and label === undefined
+ // (collapsed reference link and shortcut reference link respectively)
+ if (!label) {
+ label = state.src.slice(labelStart, labelEnd);
+ }
+ ref = state.env.references[normalizeReference$1(label)];
+ if (!ref) {
+ state.pos = oldPos;
+ return false;
+ }
+ href = ref.href;
+ title = ref.title;
+ }
+
+ // We found the end of the link, and know for a fact it's a valid link;
+ // so all that's left to do is to call tokenizer.
+
+ if (!silent) {
+ state.pos = labelStart;
+ state.posMax = labelEnd;
+ token = state.push("link_open", "a", 1);
+ token.attrs = attrs = [ [ "href", href ] ];
+ if (title) {
+ attrs.push([ "title", title ]);
+ }
+ state.md.inline.tokenize(state);
+ token = state.push("link_close", "a", -1);
+ }
+ state.pos = pos;
+ state.posMax = max;
+ return true;
+ };
+ var normalizeReference = utils.normalizeReference;
+ var isSpace = utils.isSpace;
+ var image = function image(state, silent) {
+ var attrs, code, content, label, labelEnd, labelStart, pos, ref, res, title, token, tokens, start, href = "", oldPos = state.pos, max = state.posMax;
+ if (state.src.charCodeAt(state.pos) !== 33 /* ! */) {
+ return false;
+ }
+ if (state.src.charCodeAt(state.pos + 1) !== 91 /* [ */) {
+ return false;
+ }
+ labelStart = state.pos + 2;
+ labelEnd = state.md.helpers.parseLinkLabel(state, state.pos + 1, false);
+ // parser failed to find ']', so it's not a valid link
+ if (labelEnd < 0) {
+ return false;
+ }
+ pos = labelEnd + 1;
+ if (pos < max && state.src.charCodeAt(pos) === 40 /* ( */) {
+ // Inline link
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ pos++;
+ for (;pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace(code) && code !== 10) {
+ break;
+ }
+ }
+ if (pos >= max) {
+ return false;
+ }
+ // [link]( <href> "title" )
+ // ^^^^^^ parsing link destination
+ start = pos;
+ res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax);
+ if (res.ok) {
+ href = state.md.normalizeLink(res.str);
+ if (state.md.validateLink(href)) {
+ pos = res.pos;
+ } else {
+ href = "";
+ }
+ }
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ start = pos;
+ for (;pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace(code) && code !== 10) {
+ break;
+ }
+ }
+ // [link]( <href> "title" )
+ // ^^^^^^^ parsing link title
+ res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax);
+ if (pos < max && start !== pos && res.ok) {
+ title = res.str;
+ pos = res.pos;
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ for (;pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace(code) && code !== 10) {
+ break;
+ }
+ }
+ } else {
+ title = "";
+ }
+ if (pos >= max || state.src.charCodeAt(pos) !== 41 /* ) */) {
+ state.pos = oldPos;
+ return false;
+ }
+ pos++;
+ } else {
+ // Link reference
+ if (typeof state.env.references === "undefined") {
+ return false;
+ }
+ if (pos < max && state.src.charCodeAt(pos) === 91 /* [ */) {
+ start = pos + 1;
+ pos = state.md.helpers.parseLinkLabel(state, pos);
+ if (pos >= 0) {
+ label = state.src.slice(start, pos++);
+ } else {
+ pos = labelEnd + 1;
+ }
+ } else {
+ pos = labelEnd + 1;
+ }
+ // covers label === '' and label === undefined
+ // (collapsed reference link and shortcut reference link respectively)
+ if (!label) {
+ label = state.src.slice(labelStart, labelEnd);
+ }
+ ref = state.env.references[normalizeReference(label)];
+ if (!ref) {
+ state.pos = oldPos;
+ return false;
+ }
+ href = ref.href;
+ title = ref.title;
+ }
+
+ // We found the end of the link, and know for a fact it's a valid link;
+ // so all that's left to do is to call tokenizer.
+
+ if (!silent) {
+ content = state.src.slice(labelStart, labelEnd);
+ state.md.inline.parse(content, state.md, state.env, tokens = []);
+ token = state.push("image", "img", 0);
+ token.attrs = attrs = [ [ "src", href ], [ "alt", "" ] ];
+ token.children = tokens;
+ token.content = content;
+ if (title) {
+ attrs.push([ "title", title ]);
+ }
+ }
+ state.pos = pos;
+ state.posMax = max;
+ return true;
+ };
+ // Process autolinks '<protocol:...>'
+ /*eslint max-len:0*/ var EMAIL_RE = /^([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)$/;
+ var AUTOLINK_RE = /^([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)$/;
+ var autolink = function autolink(state, silent) {
+ var url, fullUrl, token, ch, start, max, pos = state.pos;
+ if (state.src.charCodeAt(pos) !== 60 /* < */) {
+ return false;
+ }
+ start = state.pos;
+ max = state.posMax;
+ for (;;) {
+ if (++pos >= max) return false;
+ ch = state.src.charCodeAt(pos);
+ if (ch === 60 /* < */) return false;
+ if (ch === 62 /* > */) break;
+ }
+ url = state.src.slice(start + 1, pos);
+ if (AUTOLINK_RE.test(url)) {
+ fullUrl = state.md.normalizeLink(url);
+ if (!state.md.validateLink(fullUrl)) {
+ return false;
+ }
+ if (!silent) {
+ token = state.push("link_open", "a", 1);
+ token.attrs = [ [ "href", fullUrl ] ];
+ token.markup = "autolink";
+ token.info = "auto";
+ token = state.push("text", "", 0);
+ token.content = state.md.normalizeLinkText(url);
+ token = state.push("link_close", "a", -1);
+ token.markup = "autolink";
+ token.info = "auto";
+ }
+ state.pos += url.length + 2;
+ return true;
+ }
+ if (EMAIL_RE.test(url)) {
+ fullUrl = state.md.normalizeLink("mailto:" + url);
+ if (!state.md.validateLink(fullUrl)) {
+ return false;
+ }
+ if (!silent) {
+ token = state.push("link_open", "a", 1);
+ token.attrs = [ [ "href", fullUrl ] ];
+ token.markup = "autolink";
+ token.info = "auto";
+ token = state.push("text", "", 0);
+ token.content = state.md.normalizeLinkText(url);
+ token = state.push("link_close", "a", -1);
+ token.markup = "autolink";
+ token.info = "auto";
+ }
+ state.pos += url.length + 2;
+ return true;
+ }
+ return false;
+ };
+ var HTML_TAG_RE = html_re.HTML_TAG_RE;
+ function isLetter(ch) {
+ /*eslint no-bitwise:0*/
+ var lc = ch | 32;
+ // to lower case
+ return lc >= 97 /* a */ && lc <= 122 /* z */;
+ }
+ var html_inline = function html_inline(state, silent) {
+ var ch, match, max, token, pos = state.pos;
+ if (!state.md.options.html) {
+ return false;
+ }
+ // Check start
+ max = state.posMax;
+ if (state.src.charCodeAt(pos) !== 60 /* < */ || pos + 2 >= max) {
+ return false;
+ }
+ // Quick fail on second char
+ ch = state.src.charCodeAt(pos + 1);
+ if (ch !== 33 /* ! */ && ch !== 63 /* ? */ && ch !== 47 /* / */ && !isLetter(ch)) {
+ return false;
+ }
+ match = state.src.slice(pos).match(HTML_TAG_RE);
+ if (!match) {
+ return false;
+ }
+ if (!silent) {
+ token = state.push("html_inline", "", 0);
+ token.content = state.src.slice(pos, pos + match[0].length);
+ }
+ state.pos += match[0].length;
+ return true;
+ };
+ var has = utils.has;
+ var isValidEntityCode = utils.isValidEntityCode;
+ var fromCodePoint = utils.fromCodePoint;
+ var DIGITAL_RE = /^&#((?:x[a-f0-9]{1,6}|[0-9]{1,7}));/i;
+ var NAMED_RE = /^&([a-z][a-z0-9]{1,31});/i;
+ var entity = function entity(state, silent) {
+ var ch, code, match, pos = state.pos, max = state.posMax;
+ if (state.src.charCodeAt(pos) !== 38 /* & */) {
+ return false;
+ }
+ if (pos + 1 < max) {
+ ch = state.src.charCodeAt(pos + 1);
+ if (ch === 35 /* # */) {
+ match = state.src.slice(pos).match(DIGITAL_RE);
+ if (match) {
+ if (!silent) {
+ code = match[1][0].toLowerCase() === "x" ? parseInt(match[1].slice(1), 16) : parseInt(match[1], 10);
+ state.pending += isValidEntityCode(code) ? fromCodePoint(code) : fromCodePoint(65533);
+ }
+ state.pos += match[0].length;
+ return true;
+ }
+ } else {
+ match = state.src.slice(pos).match(NAMED_RE);
+ if (match) {
+ if (has(entities, match[1])) {
+ if (!silent) {
+ state.pending += entities[match[1]];
+ }
+ state.pos += match[0].length;
+ return true;
+ }
+ }
+ }
+ }
+ if (!silent) {
+ state.pending += "&";
+ }
+ state.pos++;
+ return true;
+ };
+ // For each opening emphasis-like marker find a matching closing one
+ function processDelimiters(state, delimiters) {
+ var closerIdx, openerIdx, closer, opener, minOpenerIdx, newMinOpenerIdx, isOddMatch, lastJump, openersBottom = {}, max = delimiters.length;
+ if (!max) return;
+ // headerIdx is the first delimiter of the current (where closer is) delimiter run
+ var headerIdx = 0;
+ var lastTokenIdx = -2;
+ // needs any value lower than -1
+ var jumps = [];
+ for (closerIdx = 0; closerIdx < max; closerIdx++) {
+ closer = delimiters[closerIdx];
+ jumps.push(0);
+ // markers belong to same delimiter run if:
+ // - they have adjacent tokens
+ // - AND markers are the same
+
+ if (delimiters[headerIdx].marker !== closer.marker || lastTokenIdx !== closer.token - 1) {
+ headerIdx = closerIdx;
+ }
+ lastTokenIdx = closer.token;
+ // Length is only used for emphasis-specific "rule of 3",
+ // if it's not defined (in strikethrough or 3rd party plugins),
+ // we can default it to 0 to disable those checks.
+
+ closer.length = closer.length || 0;
+ if (!closer.close) continue;
+ // Previously calculated lower bounds (previous fails)
+ // for each marker, each delimiter length modulo 3,
+ // and for whether this closer can be an opener;
+ // https://github.com/commonmark/cmark/commit/34250e12ccebdc6372b8b49c44fab57c72443460
+ if (!openersBottom.hasOwnProperty(closer.marker)) {
+ openersBottom[closer.marker] = [ -1, -1, -1, -1, -1, -1 ];
+ }
+ minOpenerIdx = openersBottom[closer.marker][(closer.open ? 3 : 0) + closer.length % 3];
+ openerIdx = headerIdx - jumps[headerIdx] - 1;
+ newMinOpenerIdx = openerIdx;
+ for (;openerIdx > minOpenerIdx; openerIdx -= jumps[openerIdx] + 1) {
+ opener = delimiters[openerIdx];
+ if (opener.marker !== closer.marker) continue;
+ if (opener.open && opener.end < 0) {
+ isOddMatch = false;
+ // from spec:
+
+ // If one of the delimiters can both open and close emphasis, then the
+ // sum of the lengths of the delimiter runs containing the opening and
+ // closing delimiters must not be a multiple of 3 unless both lengths
+ // are multiples of 3.
+
+ if (opener.close || closer.open) {
+ if ((opener.length + closer.length) % 3 === 0) {
+ if (opener.length % 3 !== 0 || closer.length % 3 !== 0) {
+ isOddMatch = true;
+ }
+ }
+ }
+ if (!isOddMatch) {
+ // If previous delimiter cannot be an opener, we can safely skip
+ // the entire sequence in future checks. This is required to make
+ // sure algorithm has linear complexity (see *_*_*_*_*_... case).
+ lastJump = openerIdx > 0 && !delimiters[openerIdx - 1].open ? jumps[openerIdx - 1] + 1 : 0;
+ jumps[closerIdx] = closerIdx - openerIdx + lastJump;
+ jumps[openerIdx] = lastJump;
+ closer.open = false;
+ opener.end = closerIdx;
+ opener.close = false;
+ newMinOpenerIdx = -1;
+ // treat next token as start of run,
+ // it optimizes skips in **<...>**a**<...>** pathological case
+ lastTokenIdx = -2;
+ break;
+ }
+ }
+ }
+ if (newMinOpenerIdx !== -1) {
+ // If match for this delimiter run failed, we want to set lower bound for
+ // future lookups. This is required to make sure algorithm has linear
+ // complexity.
+ // See details here:
+ // https://github.com/commonmark/cmark/issues/178#issuecomment-270417442
+ openersBottom[closer.marker][(closer.open ? 3 : 0) + (closer.length || 0) % 3] = newMinOpenerIdx;
+ }
+ }
+ }
+ var balance_pairs = function link_pairs(state) {
+ var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length;
+ processDelimiters(state, state.delimiters);
+ for (curr = 0; curr < max; curr++) {
+ if (tokens_meta[curr] && tokens_meta[curr].delimiters) {
+ processDelimiters(state, tokens_meta[curr].delimiters);
+ }
+ }
+ };
+ // Clean up tokens after emphasis and strikethrough postprocessing:
+ var text_collapse = function text_collapse(state) {
+ var curr, last, level = 0, tokens = state.tokens, max = state.tokens.length;
+ for (curr = last = 0; curr < max; curr++) {
+ // re-calculate levels after emphasis/strikethrough turns some text nodes
+ // into opening/closing tags
+ if (tokens[curr].nesting < 0) level--;
+ // closing tag
+ tokens[curr].level = level;
+ if (tokens[curr].nesting > 0) level++;
+ // opening tag
+ if (tokens[curr].type === "text" && curr + 1 < max && tokens[curr + 1].type === "text") {
+ // collapse two adjacent text nodes
+ tokens[curr + 1].content = tokens[curr].content + tokens[curr + 1].content;
+ } else {
+ if (curr !== last) {
+ tokens[last] = tokens[curr];
+ }
+ last++;
+ }
+ }
+ if (curr !== last) {
+ tokens.length = last;
+ }
+ };
+ var isWhiteSpace = utils.isWhiteSpace;
+ var isPunctChar = utils.isPunctChar;
+ var isMdAsciiPunct = utils.isMdAsciiPunct;
+ function StateInline(src, md, env, outTokens) {
+ this.src = src;
+ this.env = env;
+ this.md = md;
+ this.tokens = outTokens;
+ this.tokens_meta = Array(outTokens.length);
+ this.pos = 0;
+ this.posMax = this.src.length;
+ this.level = 0;
+ this.pending = "";
+ this.pendingLevel = 0;
+ // Stores { start: end } pairs. Useful for backtrack
+ // optimization of pairs parse (emphasis, strikes).
+ this.cache = {};
+ // List of emphasis-like delimiters for current tag
+ this.delimiters = [];
+ // Stack of delimiter lists for upper level tags
+ this._prev_delimiters = [];
+ // backtick length => last seen position
+ this.backticks = {};
+ this.backticksScanned = false;
+ }
+ // Flush pending text
+
+ StateInline.prototype.pushPending = function() {
+ var token$1 = new token("text", "", 0);
+ token$1.content = this.pending;
+ token$1.level = this.pendingLevel;
+ this.tokens.push(token$1);
+ this.pending = "";
+ return token$1;
+ };
+ // Push new token to "stream".
+ // If pending text exists - flush it as text token
+
+ StateInline.prototype.push = function(type, tag, nesting) {
+ if (this.pending) {
+ this.pushPending();
+ }
+ var token$1 = new token(type, tag, nesting);
+ var token_meta = null;
+ if (nesting < 0) {
+ // closing tag
+ this.level--;
+ this.delimiters = this._prev_delimiters.pop();
+ }
+ token$1.level = this.level;
+ if (nesting > 0) {
+ // opening tag
+ this.level++;
+ this._prev_delimiters.push(this.delimiters);
+ this.delimiters = [];
+ token_meta = {
+ delimiters: this.delimiters
+ };
+ }
+ this.pendingLevel = this.level;
+ this.tokens.push(token$1);
+ this.tokens_meta.push(token_meta);
+ return token$1;
+ };
+ // Scan a sequence of emphasis-like markers, and determine whether
+ // it can start an emphasis sequence or end an emphasis sequence.
+
+ // - start - position to scan from (it should point at a valid marker);
+ // - canSplitWord - determine if these markers can be found inside a word
+
+ StateInline.prototype.scanDelims = function(start, canSplitWord) {
+ var pos = start, lastChar, nextChar, count, can_open, can_close, isLastWhiteSpace, isLastPunctChar, isNextWhiteSpace, isNextPunctChar, left_flanking = true, right_flanking = true, max = this.posMax, marker = this.src.charCodeAt(start);
+ // treat beginning of the line as a whitespace
+ lastChar = start > 0 ? this.src.charCodeAt(start - 1) : 32;
+ while (pos < max && this.src.charCodeAt(pos) === marker) {
+ pos++;
+ }
+ count = pos - start;
+ // treat end of the line as a whitespace
+ nextChar = pos < max ? this.src.charCodeAt(pos) : 32;
+ isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar));
+ isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar));
+ isLastWhiteSpace = isWhiteSpace(lastChar);
+ isNextWhiteSpace = isWhiteSpace(nextChar);
+ if (isNextWhiteSpace) {
+ left_flanking = false;
+ } else if (isNextPunctChar) {
+ if (!(isLastWhiteSpace || isLastPunctChar)) {
+ left_flanking = false;
+ }
+ }
+ if (isLastWhiteSpace) {
+ right_flanking = false;
+ } else if (isLastPunctChar) {
+ if (!(isNextWhiteSpace || isNextPunctChar)) {
+ right_flanking = false;
+ }
+ }
+ if (!canSplitWord) {
+ can_open = left_flanking && (!right_flanking || isLastPunctChar);
+ can_close = right_flanking && (!left_flanking || isNextPunctChar);
+ } else {
+ can_open = left_flanking;
+ can_close = right_flanking;
+ }
+ return {
+ can_open: can_open,
+ can_close: can_close,
+ length: count
+ };
+ };
+ // re-export Token class to use in block rules
+ StateInline.prototype.Token = token;
+ var state_inline = StateInline;
+ ////////////////////////////////////////////////////////////////////////////////
+ // Parser rules
+ var _rules = [ [ "text", text ], [ "newline", newline ], [ "escape", _escape ], [ "backticks", backticks ], [ "strikethrough", strikethrough.tokenize ], [ "emphasis", emphasis.tokenize ], [ "link", link ], [ "image", image ], [ "autolink", autolink ], [ "html_inline", html_inline ], [ "entity", entity ] ];
+ var _rules2 = [ [ "balance_pairs", balance_pairs ], [ "strikethrough", strikethrough.postProcess ], [ "emphasis", emphasis.postProcess ], [ "text_collapse", text_collapse ] ];
+ /**
+ * new ParserInline()
+ **/ function ParserInline() {
+ var i;
+ /**
+ * ParserInline#ruler -> Ruler
+ *
+ * [[Ruler]] instance. Keep configuration of inline rules.
+ **/ this.ruler = new ruler;
+ for (i = 0; i < _rules.length; i++) {
+ this.ruler.push(_rules[i][0], _rules[i][1]);
+ }
+ /**
+ * ParserInline#ruler2 -> Ruler
+ *
+ * [[Ruler]] instance. Second ruler used for post-processing
+ * (e.g. in emphasis-like rules).
+ **/ this.ruler2 = new ruler;
+ for (i = 0; i < _rules2.length; i++) {
+ this.ruler2.push(_rules2[i][0], _rules2[i][1]);
+ }
+ }
+ // Skip single token by running all rules in validation mode;
+ // returns `true` if any rule reported success
+
+ ParserInline.prototype.skipToken = function(state) {
+ var ok, i, pos = state.pos, rules = this.ruler.getRules(""), len = rules.length, maxNesting = state.md.options.maxNesting, cache = state.cache;
+ if (typeof cache[pos] !== "undefined") {
+ state.pos = cache[pos];
+ return;
+ }
+ if (state.level < maxNesting) {
+ for (i = 0; i < len; i++) {
+ // Increment state.level and decrement it later to limit recursion.
+ // It's harmless to do here, because no tokens are created. But ideally,
+ // we'd need a separate private state variable for this purpose.
+ state.level++;
+ ok = rules[i](state, true);
+ state.level--;
+ if (ok) {
+ break;
+ }
+ }
+ } else {
+ // Too much nesting, just skip until the end of the paragraph.
+ // NOTE: this will cause links to behave incorrectly in the following case,
+ // when an amount of `[` is exactly equal to `maxNesting + 1`:
+ // [[[[[[[[[[[[[[[[[[[[[foo]()
+ // TODO: remove this workaround when CM standard will allow nested links
+ // (we can replace it by preventing links from being parsed in
+ // validation mode)
+ state.pos = state.posMax;
+ }
+ if (!ok) {
+ state.pos++;
+ }
+ cache[pos] = state.pos;
+ };
+ // Generate tokens for input range
+
+ ParserInline.prototype.tokenize = function(state) {
+ var ok, i, rules = this.ruler.getRules(""), len = rules.length, end = state.posMax, maxNesting = state.md.options.maxNesting;
+ while (state.pos < end) {
+ // Try all possible rules.
+ // On success, rule should:
+ // - update `state.pos`
+ // - update `state.tokens`
+ // - return true
+ if (state.level < maxNesting) {
+ for (i = 0; i < len; i++) {
+ ok = rules[i](state, false);
+ if (ok) {
+ break;
+ }
+ }
+ }
+ if (ok) {
+ if (state.pos >= end) {
+ break;
+ }
+ continue;
+ }
+ state.pending += state.src[state.pos++];
+ }
+ if (state.pending) {
+ state.pushPending();
+ }
+ };
+ /**
+ * ParserInline.parse(str, md, env, outTokens)
+ *
+ * Process input string and push inline tokens into `outTokens`
+ **/ ParserInline.prototype.parse = function(str, md, env, outTokens) {
+ var i, rules, len;
+ var state = new this.State(str, md, env, outTokens);
+ this.tokenize(state);
+ rules = this.ruler2.getRules("");
+ len = rules.length;
+ for (i = 0; i < len; i++) {
+ rules[i](state);
+ }
+ };
+ ParserInline.prototype.State = state_inline;
+ var parser_inline = ParserInline;
+ var re = function(opts) {
+ var re = {};
+ // Use direct extract instead of `regenerate` to reduse browserified size
+ re.src_Any = regex$3.source;
+ re.src_Cc = regex$2.source;
+ re.src_Z = regex.source;
+ re.src_P = regex$4.source;
+ // \p{\Z\P\Cc\CF} (white spaces + control + format + punctuation)
+ re.src_ZPCc = [ re.src_Z, re.src_P, re.src_Cc ].join("|");
+ // \p{\Z\Cc} (white spaces + control)
+ re.src_ZCc = [ re.src_Z, re.src_Cc ].join("|");
+ // Experimental. List of chars, completely prohibited in links
+ // because can separate it from other part of text
+ var text_separators = "[><\uff5c]";
+ // All possible word characters (everything without punctuation, spaces & controls)
+ // Defined via punctuation & spaces to save space
+ // Should be something like \p{\L\N\S\M} (\w but without `_`)
+ re.src_pseudo_letter = "(?:(?!" + text_separators + "|" + re.src_ZPCc + ")" + re.src_Any + ")";
+ // The same as abothe but without [0-9]
+ // var src_pseudo_letter_non_d = '(?:(?![0-9]|' + src_ZPCc + ')' + src_Any + ')';
+ ////////////////////////////////////////////////////////////////////////////////
+ re.src_ip4 = "(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)";
+ // Prohibit any of "@/[]()" in user/pass to avoid wrong domain fetch.
+ re.src_auth = "(?:(?:(?!" + re.src_ZCc + "|[@/\\[\\]()]).)+@)?";
+ re.src_port = "(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?";
+ re.src_host_terminator = "(?=$|" + text_separators + "|" + re.src_ZPCc + ")(?!-|_|:\\d|\\.-|\\.(?!$|" + re.src_ZPCc + "))";
+ re.src_path = "(?:" + "[/?#]" + "(?:" + "(?!" + re.src_ZCc + "|" + text_separators + "|[()[\\]{}.,\"'?!\\-;]).|" + "\\[(?:(?!" + re.src_ZCc + "|\\]).)*\\]|" + "\\((?:(?!" + re.src_ZCc + "|[)]).)*\\)|" + "\\{(?:(?!" + re.src_ZCc + "|[}]).)*\\}|" + '\\"(?:(?!' + re.src_ZCc + '|["]).)+\\"|' + "\\'(?:(?!" + re.src_ZCc + "|[']).)+\\'|" + "\\'(?=" + re.src_pseudo_letter + "|[-]).|" + // allow `I'm_king` if no pair found
+ "\\.{2,}[a-zA-Z0-9%/&]|" + // google has many dots in "google search" links (#66, #81).
+ // github has ... in commit range links,
+ // Restrict to
+ // - english
+ // - percent-encoded
+ // - parts of file path
+ // - params separator
+ // until more examples found.
+ "\\.(?!" + re.src_ZCc + "|[.]).|" + (opts && opts["---"] ? "\\-(?!--(?:[^-]|$))(?:-*)|" : "\\-+|") + ",(?!" + re.src_ZCc + ").|" + // allow `,,,` in paths
+ ";(?!" + re.src_ZCc + ").|" + // allow `;` if not followed by space-like char
+ "\\!+(?!" + re.src_ZCc + "|[!]).|" + // allow `!!!` in paths, but not at the end
+ "\\?(?!" + re.src_ZCc + "|[?])." + ")+" + "|\\/" + ")?";
+ // Allow anything in markdown spec, forbid quote (") at the first position
+ // because emails enclosed in quotes are far more common
+ re.src_email_name = '[\\-;:&=\\+\\$,\\.a-zA-Z0-9_][\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]*';
+ re.src_xn = "xn--[a-z0-9\\-]{1,59}";
+ // More to read about domain names
+ // http://serverfault.com/questions/638260/
+ re.src_domain_root =
+ // Allow letters & digits (http://test1)
+ "(?:" + re.src_xn + "|" + re.src_pseudo_letter + "{1,63}" + ")";
+ re.src_domain = "(?:" + re.src_xn + "|" + "(?:" + re.src_pseudo_letter + ")" + "|" + "(?:" + re.src_pseudo_letter + "(?:-|" + re.src_pseudo_letter + "){0,61}" + re.src_pseudo_letter + ")" + ")";
+ re.src_host = "(?:" +
+ // Don't need IP check, because digits are already allowed in normal domain names
+ // src_ip4 +
+ // '|' +
+ "(?:(?:(?:" + re.src_domain + ")\\.)*" + re.src_domain /*_root*/ + ")" + ")";
+ re.tpl_host_fuzzy = "(?:" + re.src_ip4 + "|" + "(?:(?:(?:" + re.src_domain + ")\\.)+(?:%TLDS%))" + ")";
+ re.tpl_host_no_ip_fuzzy = "(?:(?:(?:" + re.src_domain + ")\\.)+(?:%TLDS%))";
+ re.src_host_strict = re.src_host + re.src_host_terminator;
+ re.tpl_host_fuzzy_strict = re.tpl_host_fuzzy + re.src_host_terminator;
+ re.src_host_port_strict = re.src_host + re.src_port + re.src_host_terminator;
+ re.tpl_host_port_fuzzy_strict = re.tpl_host_fuzzy + re.src_port + re.src_host_terminator;
+ re.tpl_host_port_no_ip_fuzzy_strict = re.tpl_host_no_ip_fuzzy + re.src_port + re.src_host_terminator;
+ ////////////////////////////////////////////////////////////////////////////////
+ // Main rules
+ // Rude test fuzzy links by host, for quick deny
+ re.tpl_host_fuzzy_test = "localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:" + re.src_ZPCc + "|>|$))";
+ re.tpl_email_fuzzy = "(^|" + text_separators + '|"|\\(|' + re.src_ZCc + ")" + "(" + re.src_email_name + "@" + re.tpl_host_fuzzy_strict + ")";
+ re.tpl_link_fuzzy =
+ // Fuzzy link can't be prepended with .:/\- and non punctuation.
+ // but can start with > (markdown blockquote)
+ "(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|" + re.src_ZPCc + "))" + "((?![$+<=>^`|\uff5c])" + re.tpl_host_port_fuzzy_strict + re.src_path + ")";
+ re.tpl_link_no_ip_fuzzy =
+ // Fuzzy link can't be prepended with .:/\- and non punctuation.
+ // but can start with > (markdown blockquote)
+ "(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|" + re.src_ZPCc + "))" + "((?![$+<=>^`|\uff5c])" + re.tpl_host_port_no_ip_fuzzy_strict + re.src_path + ")";
+ return re;
+ };
+ ////////////////////////////////////////////////////////////////////////////////
+ // Helpers
+ // Merge objects
+
+ function assign(obj /*from1, from2, from3, ...*/) {
+ var sources = Array.prototype.slice.call(arguments, 1);
+ sources.forEach((function(source) {
+ if (!source) {
+ return;
+ }
+ Object.keys(source).forEach((function(key) {
+ obj[key] = source[key];
+ }));
+ }));
+ return obj;
+ }
+ function _class(obj) {
+ return Object.prototype.toString.call(obj);
+ }
+ function isString(obj) {
+ return _class(obj) === "[object String]";
+ }
+ function isObject(obj) {
+ return _class(obj) === "[object Object]";
+ }
+ function isRegExp(obj) {
+ return _class(obj) === "[object RegExp]";
+ }
+ function isFunction(obj) {
+ return _class(obj) === "[object Function]";
+ }
+ function escapeRE(str) {
+ return str.replace(/[.?*+^$[\]\\(){}|-]/g, "\\$&");
+ }
+ ////////////////////////////////////////////////////////////////////////////////
+ var defaultOptions = {
+ fuzzyLink: true,
+ fuzzyEmail: true,
+ fuzzyIP: false
+ };
+ function isOptionsObj(obj) {
+ return Object.keys(obj || {}).reduce((function(acc, k) {
+ return acc || defaultOptions.hasOwnProperty(k);
+ }), false);
+ }
+ var defaultSchemas = {
+ "http:": {
+ validate: function(text, pos, self) {
+ var tail = text.slice(pos);
+ if (!self.re.http) {
+ // compile lazily, because "host"-containing variables can change on tlds update.
+ self.re.http = new RegExp("^\\/\\/" + self.re.src_auth + self.re.src_host_port_strict + self.re.src_path, "i");
+ }
+ if (self.re.http.test(tail)) {
+ return tail.match(self.re.http)[0].length;
+ }
+ return 0;
+ }
+ },
+ "https:": "http:",
+ "ftp:": "http:",
+ "//": {
+ validate: function(text, pos, self) {
+ var tail = text.slice(pos);
+ if (!self.re.no_http) {
+ // compile lazily, because "host"-containing variables can change on tlds update.
+ self.re.no_http = new RegExp("^" + self.re.src_auth +
+ // Don't allow single-level domains, because of false positives like '//test'
+ // with code comments
+ "(?:localhost|(?:(?:" + self.re.src_domain + ")\\.)+" + self.re.src_domain_root + ")" + self.re.src_port + self.re.src_host_terminator + self.re.src_path, "i");
+ }
+ if (self.re.no_http.test(tail)) {
+ // should not be `://` & `///`, that protects from errors in protocol name
+ if (pos >= 3 && text[pos - 3] === ":") {
+ return 0;
+ }
+ if (pos >= 3 && text[pos - 3] === "/") {
+ return 0;
+ }
+ return tail.match(self.re.no_http)[0].length;
+ }
+ return 0;
+ }
+ },
+ "mailto:": {
+ validate: function(text, pos, self) {
+ var tail = text.slice(pos);
+ if (!self.re.mailto) {
+ self.re.mailto = new RegExp("^" + self.re.src_email_name + "@" + self.re.src_host_strict, "i");
+ }
+ if (self.re.mailto.test(tail)) {
+ return tail.match(self.re.mailto)[0].length;
+ }
+ return 0;
+ }
+ }
+ };
+ /*eslint-disable max-len*/
+ // RE pattern for 2-character tlds (autogenerated by ./support/tlds_2char_gen.js)
+ var tlds_2ch_src_re = "a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]";
+ // DON'T try to make PRs with changes. Extend TLDs with LinkifyIt.tlds() instead
+ var tlds_default = "biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|\u0440\u0444".split("|");
+ /*eslint-enable max-len*/
+ ////////////////////////////////////////////////////////////////////////////////
+ function resetScanCache(self) {
+ self.__index__ = -1;
+ self.__text_cache__ = "";
+ }
+ function createValidator(re) {
+ return function(text, pos) {
+ var tail = text.slice(pos);
+ if (re.test(tail)) {
+ return tail.match(re)[0].length;
+ }
+ return 0;
+ };
+ }
+ function createNormalizer() {
+ return function(match, self) {
+ self.normalize(match);
+ };
+ }
+ // Schemas compiler. Build regexps.
+
+ function compile(self) {
+ // Load & clone RE patterns.
+ var re$1 = self.re = re(self.__opts__);
+ // Define dynamic patterns
+ var tlds = self.__tlds__.slice();
+ self.onCompile();
+ if (!self.__tlds_replaced__) {
+ tlds.push(tlds_2ch_src_re);
+ }
+ tlds.push(re$1.src_xn);
+ re$1.src_tlds = tlds.join("|");
+ function untpl(tpl) {
+ return tpl.replace("%TLDS%", re$1.src_tlds);
+ }
+ re$1.email_fuzzy = RegExp(untpl(re$1.tpl_email_fuzzy), "i");
+ re$1.link_fuzzy = RegExp(untpl(re$1.tpl_link_fuzzy), "i");
+ re$1.link_no_ip_fuzzy = RegExp(untpl(re$1.tpl_link_no_ip_fuzzy), "i");
+ re$1.host_fuzzy_test = RegExp(untpl(re$1.tpl_host_fuzzy_test), "i");
+
+ // Compile each schema
+
+ var aliases = [];
+ self.__compiled__ = {};
+ // Reset compiled data
+ function schemaError(name, val) {
+ throw new Error('(LinkifyIt) Invalid schema "' + name + '": ' + val);
+ }
+ Object.keys(self.__schemas__).forEach((function(name) {
+ var val = self.__schemas__[name];
+ // skip disabled methods
+ if (val === null) {
+ return;
+ }
+ var compiled = {
+ validate: null,
+ link: null
+ };
+ self.__compiled__[name] = compiled;
+ if (isObject(val)) {
+ if (isRegExp(val.validate)) {
+ compiled.validate = createValidator(val.validate);
+ } else if (isFunction(val.validate)) {
+ compiled.validate = val.validate;
+ } else {
+ schemaError(name, val);
+ }
+ if (isFunction(val.normalize)) {
+ compiled.normalize = val.normalize;
+ } else if (!val.normalize) {
+ compiled.normalize = createNormalizer();
+ } else {
+ schemaError(name, val);
+ }
+ return;
+ }
+ if (isString(val)) {
+ aliases.push(name);
+ return;
+ }
+ schemaError(name, val);
+ }));
+
+ // Compile postponed aliases
+
+ aliases.forEach((function(alias) {
+ if (!self.__compiled__[self.__schemas__[alias]]) {
+ // Silently fail on missed schemas to avoid errons on disable.
+ // schemaError(alias, self.__schemas__[alias]);
+ return;
+ }
+ self.__compiled__[alias].validate = self.__compiled__[self.__schemas__[alias]].validate;
+ self.__compiled__[alias].normalize = self.__compiled__[self.__schemas__[alias]].normalize;
+ }));
+
+ // Fake record for guessed links
+
+ self.__compiled__[""] = {
+ validate: null,
+ normalize: createNormalizer()
+ };
+
+ // Build schema condition
+
+ var slist = Object.keys(self.__compiled__).filter((function(name) {
+ // Filter disabled & fake schemas
+ return name.length > 0 && self.__compiled__[name];
+ })).map(escapeRE).join("|");
+ // (?!_) cause 1.5x slowdown
+ self.re.schema_test = RegExp("(^|(?!_)(?:[><\uff5c]|" + re$1.src_ZPCc + "))(" + slist + ")", "i");
+ self.re.schema_search = RegExp("(^|(?!_)(?:[><\uff5c]|" + re$1.src_ZPCc + "))(" + slist + ")", "ig");
+ self.re.pretest = RegExp("(" + self.re.schema_test.source + ")|(" + self.re.host_fuzzy_test.source + ")|@", "i");
+
+ // Cleanup
+
+ resetScanCache(self);
+ }
+ /**
+ * class Match
+ *
+ * Match result. Single element of array, returned by [[LinkifyIt#match]]
+ **/ function Match(self, shift) {
+ var start = self.__index__, end = self.__last_index__, text = self.__text_cache__.slice(start, end);
+ /**
+ * Match#schema -> String
+ *
+ * Prefix (protocol) for matched string.
+ **/ this.schema = self.__schema__.toLowerCase();
+ /**
+ * Match#index -> Number
+ *
+ * First position of matched string.
+ **/ this.index = start + shift;
+ /**
+ * Match#lastIndex -> Number
+ *
+ * Next position after matched string.
+ **/ this.lastIndex = end + shift;
+ /**
+ * Match#raw -> String
+ *
+ * Matched string.
+ **/ this.raw = text;
+ /**
+ * Match#text -> String
+ *
+ * Notmalized text of matched string.
+ **/ this.text = text;
+ /**
+ * Match#url -> String
+ *
+ * Normalized url of matched string.
+ **/ this.url = text;
+ }
+ function createMatch(self, shift) {
+ var match = new Match(self, shift);
+ self.__compiled__[match.schema].normalize(match, self);
+ return match;
+ }
+ /**
+ * class LinkifyIt
+ **/
+ /**
+ * new LinkifyIt(schemas, options)
+ * - schemas (Object): Optional. Additional schemas to validate (prefix/validator)
+ * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false }
+ *
+ * Creates new linkifier instance with optional additional schemas.
+ * Can be called without `new` keyword for convenience.
+ *
+ * By default understands:
+ *
+ * - `http(s)://...` , `ftp://...`, `mailto:...` & `//...` links
+ * - "fuzzy" links and emails (example.com, foo@bar.com).
+ *
+ * `schemas` is an object, where each key/value describes protocol/rule:
+ *
+ * - __key__ - link prefix (usually, protocol name with `:` at the end, `skype:`
+ * for example). `linkify-it` makes shure that prefix is not preceeded with
+ * alphanumeric char and symbols. Only whitespaces and punctuation allowed.
+ * - __value__ - rule to check tail after link prefix
+ * - _String_ - just alias to existing rule
+ * - _Object_
+ * - _validate_ - validator function (should return matched length on success),
+ * or `RegExp`.
+ * - _normalize_ - optional function to normalize text & url of matched result
+ * (for example, for @twitter mentions).
+ *
+ * `options`:
+ *
+ * - __fuzzyLink__ - recognige URL-s without `http(s):` prefix. Default `true`.
+ * - __fuzzyIP__ - allow IPs in fuzzy links above. Can conflict with some texts
+ * like version numbers. Default `false`.
+ * - __fuzzyEmail__ - recognize emails without `mailto:` prefix.
+ *
+ **/ function LinkifyIt(schemas, options) {
+ if (!(this instanceof LinkifyIt)) {
+ return new LinkifyIt(schemas, options);
+ }
+ if (!options) {
+ if (isOptionsObj(schemas)) {
+ options = schemas;
+ schemas = {};
+ }
+ }
+ this.__opts__ = assign({}, defaultOptions, options);
+ // Cache last tested result. Used to skip repeating steps on next `match` call.
+ this.__index__ = -1;
+ this.__last_index__ = -1;
+ // Next scan position
+ this.__schema__ = "";
+ this.__text_cache__ = "";
+ this.__schemas__ = assign({}, defaultSchemas, schemas);
+ this.__compiled__ = {};
+ this.__tlds__ = tlds_default;
+ this.__tlds_replaced__ = false;
+ this.re = {};
+ compile(this);
+ }
+ /** chainable
+ * LinkifyIt#add(schema, definition)
+ * - schema (String): rule name (fixed pattern prefix)
+ * - definition (String|RegExp|Object): schema definition
+ *
+ * Add new rule definition. See constructor description for details.
+ **/ LinkifyIt.prototype.add = function add(schema, definition) {
+ this.__schemas__[schema] = definition;
+ compile(this);
+ return this;
+ };
+ /** chainable
+ * LinkifyIt#set(options)
+ * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false }
+ *
+ * Set recognition options for links without schema.
+ **/ LinkifyIt.prototype.set = function set(options) {
+ this.__opts__ = assign(this.__opts__, options);
+ return this;
+ };
+ /**
+ * LinkifyIt#test(text) -> Boolean
+ *
+ * Searches linkifiable pattern and returns `true` on success or `false` on fail.
+ **/ LinkifyIt.prototype.test = function test(text) {
+ // Reset scan cache
+ this.__text_cache__ = text;
+ this.__index__ = -1;
+ if (!text.length) {
+ return false;
+ }
+ var m, ml, me, len, shift, next, re, tld_pos, at_pos;
+ // try to scan for link with schema - that's the most simple rule
+ if (this.re.schema_test.test(text)) {
+ re = this.re.schema_search;
+ re.lastIndex = 0;
+ while ((m = re.exec(text)) !== null) {
+ len = this.testSchemaAt(text, m[2], re.lastIndex);
+ if (len) {
+ this.__schema__ = m[2];
+ this.__index__ = m.index + m[1].length;
+ this.__last_index__ = m.index + m[0].length + len;
+ break;
+ }
+ }
+ }
+ if (this.__opts__.fuzzyLink && this.__compiled__["http:"]) {
+ // guess schemaless links
+ tld_pos = text.search(this.re.host_fuzzy_test);
+ if (tld_pos >= 0) {
+ // if tld is located after found link - no need to check fuzzy pattern
+ if (this.__index__ < 0 || tld_pos < this.__index__) {
+ if ((ml = text.match(this.__opts__.fuzzyIP ? this.re.link_fuzzy : this.re.link_no_ip_fuzzy)) !== null) {
+ shift = ml.index + ml[1].length;
+ if (this.__index__ < 0 || shift < this.__index__) {
+ this.__schema__ = "";
+ this.__index__ = shift;
+ this.__last_index__ = ml.index + ml[0].length;
+ }
+ }
+ }
+ }
+ }
+ if (this.__opts__.fuzzyEmail && this.__compiled__["mailto:"]) {
+ // guess schemaless emails
+ at_pos = text.indexOf("@");
+ if (at_pos >= 0) {
+ // We can't skip this check, because this cases are possible:
+ // 192.168.1.1@gmail.com, my.in@example.com
+ if ((me = text.match(this.re.email_fuzzy)) !== null) {
+ shift = me.index + me[1].length;
+ next = me.index + me[0].length;
+ if (this.__index__ < 0 || shift < this.__index__ || shift === this.__index__ && next > this.__last_index__) {
+ this.__schema__ = "mailto:";
+ this.__index__ = shift;
+ this.__last_index__ = next;
+ }
+ }
+ }
+ }
+ return this.__index__ >= 0;
+ };
+ /**
+ * LinkifyIt#pretest(text) -> Boolean
+ *
+ * Very quick check, that can give false positives. Returns true if link MAY BE
+ * can exists. Can be used for speed optimization, when you need to check that
+ * link NOT exists.
+ **/ LinkifyIt.prototype.pretest = function pretest(text) {
+ return this.re.pretest.test(text);
+ };
+ /**
+ * LinkifyIt#testSchemaAt(text, name, position) -> Number
+ * - text (String): text to scan
+ * - name (String): rule (schema) name
+ * - position (Number): text offset to check from
+ *
+ * Similar to [[LinkifyIt#test]] but checks only specific protocol tail exactly
+ * at given position. Returns length of found pattern (0 on fail).
+ **/ LinkifyIt.prototype.testSchemaAt = function testSchemaAt(text, schema, pos) {
+ // If not supported schema check requested - terminate
+ if (!this.__compiled__[schema.toLowerCase()]) {
+ return 0;
+ }
+ return this.__compiled__[schema.toLowerCase()].validate(text, pos, this);
+ };
+ /**
+ * LinkifyIt#match(text) -> Array|null
+ *
+ * Returns array of found link descriptions or `null` on fail. We strongly
+ * recommend to use [[LinkifyIt#test]] first, for best speed.
+ *
+ * ##### Result match description
+ *
+ * - __schema__ - link schema, can be empty for fuzzy links, or `//` for
+ * protocol-neutral links.
+ * - __index__ - offset of matched text
+ * - __lastIndex__ - index of next char after mathch end
+ * - __raw__ - matched text
+ * - __text__ - normalized text
+ * - __url__ - link, generated from matched text
+ **/ LinkifyIt.prototype.match = function match(text) {
+ var shift = 0, result = [];
+ // Try to take previous element from cache, if .test() called before
+ if (this.__index__ >= 0 && this.__text_cache__ === text) {
+ result.push(createMatch(this, shift));
+ shift = this.__last_index__;
+ }
+ // Cut head if cache was used
+ var tail = shift ? text.slice(shift) : text;
+ // Scan string until end reached
+ while (this.test(tail)) {
+ result.push(createMatch(this, shift));
+ tail = tail.slice(this.__last_index__);
+ shift += this.__last_index__;
+ }
+ if (result.length) {
+ return result;
+ }
+ return null;
+ };
+ /** chainable
+ * LinkifyIt#tlds(list [, keepOld]) -> this
+ * - list (Array): list of tlds
+ * - keepOld (Boolean): merge with current list if `true` (`false` by default)
+ *
+ * Load (or merge) new tlds list. Those are user for fuzzy links (without prefix)
+ * to avoid false positives. By default this algorythm used:
+ *
+ * - hostname with any 2-letter root zones are ok.
+ * - biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|рф
+ * are ok.
+ * - encoded (`xn--...`) root zones are ok.
+ *
+ * If list is replaced, then exact match for 2-chars root zones will be checked.
+ **/ LinkifyIt.prototype.tlds = function tlds(list, keepOld) {
+ list = Array.isArray(list) ? list : [ list ];
+ if (!keepOld) {
+ this.__tlds__ = list.slice();
+ this.__tlds_replaced__ = true;
+ compile(this);
+ return this;
+ }
+ this.__tlds__ = this.__tlds__.concat(list).sort().filter((function(el, idx, arr) {
+ return el !== arr[idx - 1];
+ })).reverse();
+ compile(this);
+ return this;
+ };
+ /**
+ * LinkifyIt#normalize(match)
+ *
+ * Default normalizer (if schema does not define it's own).
+ **/ LinkifyIt.prototype.normalize = function normalize(match) {
+ // Do minimal possible changes by default. Need to collect feedback prior
+ // to move forward https://github.com/markdown-it/linkify-it/issues/1
+ if (!match.schema) {
+ match.url = "http://" + match.url;
+ }
+ if (match.schema === "mailto:" && !/^mailto:/i.test(match.url)) {
+ match.url = "mailto:" + match.url;
+ }
+ };
+ /**
+ * LinkifyIt#onCompile()
+ *
+ * Override to modify basic RegExp-s.
+ **/ LinkifyIt.prototype.onCompile = function onCompile() {};
+ var linkifyIt = LinkifyIt;
+ /*! https://mths.be/punycode v1.4.1 by @mathias */
+ /** Highest positive signed 32-bit float value */ var maxInt = 2147483647;
+ // aka. 0x7FFFFFFF or 2^31-1
+ /** Bootstring parameters */ var base = 36;
+ var tMin = 1;
+ var tMax = 26;
+ var skew = 38;
+ var damp = 700;
+ var initialBias = 72;
+ var initialN = 128;
+ // 0x80
+ var delimiter = "-";
+ // '\x2D'
+ /** Regular expressions */ var regexPunycode = /^xn--/;
+ var regexNonASCII = /[^\x20-\x7E]/;
+ // unprintable ASCII chars + non-ASCII chars
+ var regexSeparators = /[\x2E\u3002\uFF0E\uFF61]/g;
+ // RFC 3490 separators
+ /** Error messages */ var errors = {
+ overflow: "Overflow: input needs wider integers to process",
+ "not-basic": "Illegal input >= 0x80 (not a basic code point)",
+ "invalid-input": "Invalid input"
+ };
+ /** Convenience shortcuts */ var baseMinusTMin = base - tMin;
+ var floor = Math.floor;
+ var stringFromCharCode = String.fromCharCode;
+ /*--------------------------------------------------------------------------*/
+ /**
+ * A generic error utility function.
+ * @private
+ * @param {String} type The error type.
+ * @returns {Error} Throws a `RangeError` with the applicable error message.
+ */ function error(type) {
+ throw new RangeError(errors[type]);
+ }
+ /**
+ * A generic `Array#map` utility function.
+ * @private
+ * @param {Array} array The array to iterate over.
+ * @param {Function} callback The function that gets called for every array
+ * item.
+ * @returns {Array} A new array of values returned by the callback function.
+ */ function map(array, fn) {
+ var length = array.length;
+ var result = [];
+ while (length--) {
+ result[length] = fn(array[length]);
+ }
+ return result;
+ }
+ /**
+ * A simple `Array#map`-like wrapper to work with domain name strings or email
+ * addresses.
+ * @private
+ * @param {String} domain The domain name or email address.
+ * @param {Function} callback The function that gets called for every
+ * character.
+ * @returns {Array} A new string of characters returned by the callback
+ * function.
+ */ function mapDomain(string, fn) {
+ var parts = string.split("@");
+ var result = "";
+ if (parts.length > 1) {
+ // In email addresses, only the domain name should be punycoded. Leave
+ // the local part (i.e. everything up to `@`) intact.
+ result = parts[0] + "@";
+ string = parts[1];
+ }
+ // Avoid `split(regex)` for IE8 compatibility. See #17.
+ string = string.replace(regexSeparators, ".");
+ var labels = string.split(".");
+ var encoded = map(labels, fn).join(".");
+ return result + encoded;
+ }
+ /**
+ * Creates an array containing the numeric code points of each Unicode
+ * character in the string. While JavaScript uses UCS-2 internally,
+ * this function will convert a pair of surrogate halves (each of which
+ * UCS-2 exposes as separate characters) into a single code point,
+ * matching UTF-16.
+ * @see `punycode.ucs2.encode`
+ * @see <https://mathiasbynens.be/notes/javascript-encoding>
+ * @memberOf punycode.ucs2
+ * @name decode
+ * @param {String} string The Unicode input string (UCS-2).
+ * @returns {Array} The new array of code points.
+ */ function ucs2decode(string) {
+ var output = [], counter = 0, length = string.length, value, extra;
+ while (counter < length) {
+ value = string.charCodeAt(counter++);
+ if (value >= 55296 && value <= 56319 && counter < length) {
+ // high surrogate, and there is a next character
+ extra = string.charCodeAt(counter++);
+ if ((extra & 64512) == 56320) {
+ // low surrogate
+ output.push(((value & 1023) << 10) + (extra & 1023) + 65536);
+ } else {
+ // unmatched surrogate; only append this code unit, in case the next
+ // code unit is the high surrogate of a surrogate pair
+ output.push(value);
+ counter--;
+ }
+ } else {
+ output.push(value);
+ }
+ }
+ return output;
+ }
+ /**
+ * Creates a string based on an array of numeric code points.
+ * @see `punycode.ucs2.decode`
+ * @memberOf punycode.ucs2
+ * @name encode
+ * @param {Array} codePoints The array of numeric code points.
+ * @returns {String} The new Unicode string (UCS-2).
+ */ function ucs2encode(array) {
+ return map(array, (function(value) {
+ var output = "";
+ if (value > 65535) {
+ value -= 65536;
+ output += stringFromCharCode(value >>> 10 & 1023 | 55296);
+ value = 56320 | value & 1023;
+ }
+ output += stringFromCharCode(value);
+ return output;
+ })).join("");
+ }
+ /**
+ * Converts a basic code point into a digit/integer.
+ * @see `digitToBasic()`
+ * @private
+ * @param {Number} codePoint The basic numeric code point value.
+ * @returns {Number} The numeric value of a basic code point (for use in
+ * representing integers) in the range `0` to `base - 1`, or `base` if
+ * the code point does not represent a value.
+ */ function basicToDigit(codePoint) {
+ if (codePoint - 48 < 10) {
+ return codePoint - 22;
+ }
+ if (codePoint - 65 < 26) {
+ return codePoint - 65;
+ }
+ if (codePoint - 97 < 26) {
+ return codePoint - 97;
+ }
+ return base;
+ }
+ /**
+ * Converts a digit/integer into a basic code point.
+ * @see `basicToDigit()`
+ * @private
+ * @param {Number} digit The numeric value of a basic code point.
+ * @returns {Number} The basic code point whose value (when used for
+ * representing integers) is `digit`, which needs to be in the range
+ * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is
+ * used; else, the lowercase form is used. The behavior is undefined
+ * if `flag` is non-zero and `digit` has no uppercase form.
+ */ function digitToBasic(digit, flag) {
+ // 0..25 map to ASCII a..z or A..Z
+ // 26..35 map to ASCII 0..9
+ return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5);
+ }
+ /**
+ * Bias adaptation function as per section 3.4 of RFC 3492.
+ * https://tools.ietf.org/html/rfc3492#section-3.4
+ * @private
+ */ function adapt(delta, numPoints, firstTime) {
+ var k = 0;
+ delta = firstTime ? floor(delta / damp) : delta >> 1;
+ delta += floor(delta / numPoints);
+ for (;delta > baseMinusTMin * tMax >> 1; k += base) {
+ delta = floor(delta / baseMinusTMin);
+ }
+ return floor(k + (baseMinusTMin + 1) * delta / (delta + skew));
+ }
+ /**
+ * Converts a Punycode string of ASCII-only symbols to a string of Unicode
+ * symbols.
+ * @memberOf punycode
+ * @param {String} input The Punycode string of ASCII-only symbols.
+ * @returns {String} The resulting string of Unicode symbols.
+ */ function decode(input) {
+ // Don't use UCS-2
+ var output = [], inputLength = input.length, out, i = 0, n = initialN, bias = initialBias, basic, j, index, oldi, w, k, digit, t,
+ /** Cached calculation results */
+ baseMinusT;
+ // Handle the basic code points: let `basic` be the number of input code
+ // points before the last delimiter, or `0` if there is none, then copy
+ // the first basic code points to the output.
+ basic = input.lastIndexOf(delimiter);
+ if (basic < 0) {
+ basic = 0;
+ }
+ for (j = 0; j < basic; ++j) {
+ // if it's not a basic code point
+ if (input.charCodeAt(j) >= 128) {
+ error("not-basic");
+ }
+ output.push(input.charCodeAt(j));
+ }
+ // Main decoding loop: start just after the last delimiter if any basic code
+ // points were copied; start at the beginning otherwise.
+ for (index = basic > 0 ? basic + 1 : 0; index < inputLength; ) {
+ // `index` is the index of the next character to be consumed.
+ // Decode a generalized variable-length integer into `delta`,
+ // which gets added to `i`. The overflow checking is easier
+ // if we increase `i` as we go, then subtract off its starting
+ // value at the end to obtain `delta`.
+ for (oldi = i, w = 1, k = base; ;k += base) {
+ if (index >= inputLength) {
+ error("invalid-input");
+ }
+ digit = basicToDigit(input.charCodeAt(index++));
+ if (digit >= base || digit > floor((maxInt - i) / w)) {
+ error("overflow");
+ }
+ i += digit * w;
+ t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias;
+ if (digit < t) {
+ break;
+ }
+ baseMinusT = base - t;
+ if (w > floor(maxInt / baseMinusT)) {
+ error("overflow");
+ }
+ w *= baseMinusT;
+ }
+ out = output.length + 1;
+ bias = adapt(i - oldi, out, oldi == 0);
+ // `i` was supposed to wrap around from `out` to `0`,
+ // incrementing `n` each time, so we'll fix that now:
+ if (floor(i / out) > maxInt - n) {
+ error("overflow");
+ }
+ n += floor(i / out);
+ i %= out;
+ // Insert `n` at position `i` of the output
+ output.splice(i++, 0, n);
+ }
+ return ucs2encode(output);
+ }
+ /**
+ * Converts a string of Unicode symbols (e.g. a domain name label) to a
+ * Punycode string of ASCII-only symbols.
+ * @memberOf punycode
+ * @param {String} input The string of Unicode symbols.
+ * @returns {String} The resulting Punycode string of ASCII-only symbols.
+ */ function encode(input) {
+ var n, delta, handledCPCount, basicLength, bias, j, m, q, k, t, currentValue, output = [],
+ /** `inputLength` will hold the number of code points in `input`. */
+ inputLength,
+ /** Cached calculation results */
+ handledCPCountPlusOne, baseMinusT, qMinusT;
+ // Convert the input in UCS-2 to Unicode
+ input = ucs2decode(input);
+ // Cache the length
+ inputLength = input.length;
+ // Initialize the state
+ n = initialN;
+ delta = 0;
+ bias = initialBias;
+ // Handle the basic code points
+ for (j = 0; j < inputLength; ++j) {
+ currentValue = input[j];
+ if (currentValue < 128) {
+ output.push(stringFromCharCode(currentValue));
+ }
+ }
+ handledCPCount = basicLength = output.length;
+ // `handledCPCount` is the number of code points that have been handled;
+ // `basicLength` is the number of basic code points.
+ // Finish the basic string - if it is not empty - with a delimiter
+ if (basicLength) {
+ output.push(delimiter);
+ }
+ // Main encoding loop:
+ while (handledCPCount < inputLength) {
+ // All non-basic code points < n have been handled already. Find the next
+ // larger one:
+ for (m = maxInt, j = 0; j < inputLength; ++j) {
+ currentValue = input[j];
+ if (currentValue >= n && currentValue < m) {
+ m = currentValue;
+ }
+ }
+ // Increase `delta` enough to advance the decoder's <n,i> state to <m,0>,
+ // but guard against overflow
+ handledCPCountPlusOne = handledCPCount + 1;
+ if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) {
+ error("overflow");
+ }
+ delta += (m - n) * handledCPCountPlusOne;
+ n = m;
+ for (j = 0; j < inputLength; ++j) {
+ currentValue = input[j];
+ if (currentValue < n && ++delta > maxInt) {
+ error("overflow");
+ }
+ if (currentValue == n) {
+ // Represent delta as a generalized variable-length integer
+ for (q = delta, k = base; ;k += base) {
+ t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias;
+ if (q < t) {
+ break;
+ }
+ qMinusT = q - t;
+ baseMinusT = base - t;
+ output.push(stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0)));
+ q = floor(qMinusT / baseMinusT);
+ }
+ output.push(stringFromCharCode(digitToBasic(q, 0)));
+ bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength);
+ delta = 0;
+ ++handledCPCount;
+ }
+ }
+ ++delta;
+ ++n;
+ }
+ return output.join("");
+ }
+ /**
+ * Converts a Punycode string representing a domain name or an email address
+ * to Unicode. Only the Punycoded parts of the input will be converted, i.e.
+ * it doesn't matter if you call it on a string that has already been
+ * converted to Unicode.
+ * @memberOf punycode
+ * @param {String} input The Punycoded domain name or email address to
+ * convert to Unicode.
+ * @returns {String} The Unicode representation of the given Punycode
+ * string.
+ */ function toUnicode(input) {
+ return mapDomain(input, (function(string) {
+ return regexPunycode.test(string) ? decode(string.slice(4).toLowerCase()) : string;
+ }));
+ }
+ /**
+ * Converts a Unicode string representing a domain name or an email address to
+ * Punycode. Only the non-ASCII parts of the domain name will be converted,
+ * i.e. it doesn't matter if you call it with a domain that's already in
+ * ASCII.
+ * @memberOf punycode
+ * @param {String} input The domain name or email address to convert, as a
+ * Unicode string.
+ * @returns {String} The Punycode representation of the given domain name or
+ * email address.
+ */ function toASCII(input) {
+ return mapDomain(input, (function(string) {
+ return regexNonASCII.test(string) ? "xn--" + encode(string) : string;
+ }));
+ }
+ var version = "1.4.1";
+ /**
+ * An object of methods to convert from JavaScript's internal character
+ * representation (UCS-2) to Unicode code points, and back.
+ * @see <https://mathiasbynens.be/notes/javascript-encoding>
+ * @memberOf punycode
+ * @type Object
+ */ var ucs2 = {
+ decode: ucs2decode,
+ encode: ucs2encode
+ };
+ var punycode$1 = {
+ version: version,
+ ucs2: ucs2,
+ toASCII: toASCII,
+ toUnicode: toUnicode,
+ encode: encode,
+ decode: decode
+ };
+ var punycode$2 = Object.freeze({
+ __proto__: null,
+ decode: decode,
+ encode: encode,
+ toUnicode: toUnicode,
+ toASCII: toASCII,
+ version: version,
+ ucs2: ucs2,
+ default: punycode$1
+ });
+ // markdown-it default options
+ var _default = {
+ options: {
+ html: false,
+ // Enable HTML tags in source
+ xhtmlOut: false,
+ // Use '/' to close single tags (<br />)
+ breaks: false,
+ // Convert '\n' in paragraphs into <br>
+ langPrefix: "language-",
+ // CSS language prefix for fenced blocks
+ linkify: false,
+ // autoconvert URL-like texts to links
+ // Enable some language-neutral replacements + quotes beautification
+ typographer: false,
+ // Double + single quotes replacement pairs, when typographer enabled,
+ // and smartquotes on. Could be either a String or an Array.
+ // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+ // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+ quotes: "\u201c\u201d\u2018\u2019",
+ /* “”‘’ */
+ // Highlighter function. Should return escaped HTML,
+ // or '' if the source string is not changed and should be escaped externaly.
+ // If result starts with <pre... internal wrapper is skipped.
+ // function (/*str, lang*/) { return ''; }
+ highlight: null,
+ maxNesting: 100
+ },
+ components: {
+ core: {},
+ block: {},
+ inline: {}
+ }
+ };
+ // "Zero" preset, with nothing enabled. Useful for manual configuring of simple
+ var zero = {
+ options: {
+ html: false,
+ // Enable HTML tags in source
+ xhtmlOut: false,
+ // Use '/' to close single tags (<br />)
+ breaks: false,
+ // Convert '\n' in paragraphs into <br>
+ langPrefix: "language-",
+ // CSS language prefix for fenced blocks
+ linkify: false,
+ // autoconvert URL-like texts to links
+ // Enable some language-neutral replacements + quotes beautification
+ typographer: false,
+ // Double + single quotes replacement pairs, when typographer enabled,
+ // and smartquotes on. Could be either a String or an Array.
+ // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+ // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+ quotes: "\u201c\u201d\u2018\u2019",
+ /* “”‘’ */
+ // Highlighter function. Should return escaped HTML,
+ // or '' if the source string is not changed and should be escaped externaly.
+ // If result starts with <pre... internal wrapper is skipped.
+ // function (/*str, lang*/) { return ''; }
+ highlight: null,
+ maxNesting: 20
+ },
+ components: {
+ core: {
+ rules: [ "normalize", "block", "inline" ]
+ },
+ block: {
+ rules: [ "paragraph" ]
+ },
+ inline: {
+ rules: [ "text" ],
+ rules2: [ "balance_pairs", "text_collapse" ]
+ }
+ }
+ };
+ // Commonmark default options
+ var commonmark = {
+ options: {
+ html: true,
+ // Enable HTML tags in source
+ xhtmlOut: true,
+ // Use '/' to close single tags (<br />)
+ breaks: false,
+ // Convert '\n' in paragraphs into <br>
+ langPrefix: "language-",
+ // CSS language prefix for fenced blocks
+ linkify: false,
+ // autoconvert URL-like texts to links
+ // Enable some language-neutral replacements + quotes beautification
+ typographer: false,
+ // Double + single quotes replacement pairs, when typographer enabled,
+ // and smartquotes on. Could be either a String or an Array.
+ // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+ // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+ quotes: "\u201c\u201d\u2018\u2019",
+ /* “”‘’ */
+ // Highlighter function. Should return escaped HTML,
+ // or '' if the source string is not changed and should be escaped externaly.
+ // If result starts with <pre... internal wrapper is skipped.
+ // function (/*str, lang*/) { return ''; }
+ highlight: null,
+ maxNesting: 20
+ },
+ components: {
+ core: {
+ rules: [ "normalize", "block", "inline" ]
+ },
+ block: {
+ rules: [ "blockquote", "code", "fence", "heading", "hr", "html_block", "lheading", "list", "reference", "paragraph" ]
+ },
+ inline: {
+ rules: [ "autolink", "backticks", "emphasis", "entity", "escape", "html_inline", "image", "link", "newline", "text" ],
+ rules2: [ "balance_pairs", "emphasis", "text_collapse" ]
+ }
+ }
+ };
+ var punycode = getAugmentedNamespace(punycode$2);
+ var config = {
+ default: _default,
+ zero: zero,
+ commonmark: commonmark
+ };
+ ////////////////////////////////////////////////////////////////////////////////
+
+ // This validator can prohibit more than really needed to prevent XSS. It's a
+ // tradeoff to keep code simple and to be secure by default.
+
+ // If you need different setup - override validator method as you wish. Or
+ // replace it with dummy function and use external sanitizer.
+
+ var BAD_PROTO_RE = /^(vbscript|javascript|file|data):/;
+ var GOOD_DATA_RE = /^data:image\/(gif|png|jpeg|webp);/;
+ function validateLink(url) {
+ // url should be normalized at this point, and existing entities are decoded
+ var str = url.trim().toLowerCase();
+ return BAD_PROTO_RE.test(str) ? GOOD_DATA_RE.test(str) ? true : false : true;
+ }
+ ////////////////////////////////////////////////////////////////////////////////
+ var RECODE_HOSTNAME_FOR = [ "http:", "https:", "mailto:" ];
+ function normalizeLink(url) {
+ var parsed = mdurl.parse(url, true);
+ if (parsed.hostname) {
+ // Encode hostnames in urls like:
+ // `http://host/`, `https://host/`, `mailto:user@host`, `//host/`
+ // We don't encode unknown schemas, because it's likely that we encode
+ // something we shouldn't (e.g. `skype:name` treated as `skype:host`)
+ if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) {
+ try {
+ parsed.hostname = punycode.toASCII(parsed.hostname);
+ } catch (er) {}
+ }
+ }
+ return mdurl.encode(mdurl.format(parsed));
+ }
+ function normalizeLinkText(url) {
+ var parsed = mdurl.parse(url, true);
+ if (parsed.hostname) {
+ // Encode hostnames in urls like:
+ // `http://host/`, `https://host/`, `mailto:user@host`, `//host/`
+ // We don't encode unknown schemas, because it's likely that we encode
+ // something we shouldn't (e.g. `skype:name` treated as `skype:host`)
+ if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) {
+ try {
+ parsed.hostname = punycode.toUnicode(parsed.hostname);
+ } catch (er) {}
+ }
+ }
+ // add '%' to exclude list because of https://github.com/markdown-it/markdown-it/issues/720
+ return mdurl.decode(mdurl.format(parsed), mdurl.decode.defaultChars + "%");
+ }
+ /**
+ * class MarkdownIt
+ *
+ * Main parser/renderer class.
+ *
+ * ##### Usage
+ *
+ * ```javascript
+ * // node.js, "classic" way:
+ * var MarkdownIt = require('markdown-it'),
+ * md = new MarkdownIt();
+ * var result = md.render('# markdown-it rulezz!');
+ *
+ * // node.js, the same, but with sugar:
+ * var md = require('markdown-it')();
+ * var result = md.render('# markdown-it rulezz!');
+ *
+ * // browser without AMD, added to "window" on script load
+ * // Note, there are no dash.
+ * var md = window.markdownit();
+ * var result = md.render('# markdown-it rulezz!');
+ * ```
+ *
+ * Single line rendering, without paragraph wrap:
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ * var result = md.renderInline('__markdown-it__ rulezz!');
+ * ```
+ **/
+ /**
+ * new MarkdownIt([presetName, options])
+ * - presetName (String): optional, `commonmark` / `zero`
+ * - options (Object)
+ *
+ * Creates parser instanse with given config. Can be called without `new`.
+ *
+ * ##### presetName
+ *
+ * MarkdownIt provides named presets as a convenience to quickly
+ * enable/disable active syntax rules and options for common use cases.
+ *
+ * - ["commonmark"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/commonmark.js) -
+ * configures parser to strict [CommonMark](http://commonmark.org/) mode.
+ * - [default](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/default.js) -
+ * similar to GFM, used when no preset name given. Enables all available rules,
+ * but still without html, typographer & autolinker.
+ * - ["zero"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/zero.js) -
+ * all rules disabled. Useful to quickly setup your config via `.enable()`.
+ * For example, when you need only `bold` and `italic` markup and nothing else.
+ *
+ * ##### options:
+ *
+ * - __html__ - `false`. Set `true` to enable HTML tags in source. Be careful!
+ * That's not safe! You may need external sanitizer to protect output from XSS.
+ * It's better to extend features via plugins, instead of enabling HTML.
+ * - __xhtmlOut__ - `false`. Set `true` to add '/' when closing single tags
+ * (`<br />`). This is needed only for full CommonMark compatibility. In real
+ * world you will need HTML output.
+ * - __breaks__ - `false`. Set `true` to convert `\n` in paragraphs into `<br>`.
+ * - __langPrefix__ - `language-`. CSS language class prefix for fenced blocks.
+ * Can be useful for external highlighters.
+ * - __linkify__ - `false`. Set `true` to autoconvert URL-like text to links.
+ * - __typographer__ - `false`. Set `true` to enable [some language-neutral
+ * replacement](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js) +
+ * quotes beautification (smartquotes).
+ * - __quotes__ - `“”‘’`, String or Array. Double + single quotes replacement
+ * pairs, when typographer enabled and smartquotes on. For example, you can
+ * use `'«»„“'` for Russian, `'„“‚‘'` for German, and
+ * `['«\xA0', '\xA0»', '‹\xA0', '\xA0›']` for French (including nbsp).
+ * - __highlight__ - `null`. Highlighter function for fenced code blocks.
+ * Highlighter `function (str, lang)` should return escaped HTML. It can also
+ * return empty string if the source was not changed and should be escaped
+ * externaly. If result starts with <pre... internal wrapper is skipped.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * // commonmark mode
+ * var md = require('markdown-it')('commonmark');
+ *
+ * // default mode
+ * var md = require('markdown-it')();
+ *
+ * // enable everything
+ * var md = require('markdown-it')({
+ * html: true,
+ * linkify: true,
+ * typographer: true
+ * });
+ * ```
+ *
+ * ##### Syntax highlighting
+ *
+ * ```js
+ * var hljs = require('highlight.js') // https://highlightjs.org/
+ *
+ * var md = require('markdown-it')({
+ * highlight: function (str, lang) {
+ * if (lang && hljs.getLanguage(lang)) {
+ * try {
+ * return hljs.highlight(str, { language: lang, ignoreIllegals: true }).value;
+ * } catch (__) {}
+ * }
+ *
+ * return ''; // use external default escaping
+ * }
+ * });
+ * ```
+ *
+ * Or with full wrapper override (if you need assign class to `<pre>`):
+ *
+ * ```javascript
+ * var hljs = require('highlight.js') // https://highlightjs.org/
+ *
+ * // Actual default values
+ * var md = require('markdown-it')({
+ * highlight: function (str, lang) {
+ * if (lang && hljs.getLanguage(lang)) {
+ * try {
+ * return '<pre class="hljs"><code>' +
+ * hljs.highlight(str, { language: lang, ignoreIllegals: true }).value +
+ * '</code></pre>';
+ * } catch (__) {}
+ * }
+ *
+ * return '<pre class="hljs"><code>' + md.utils.escapeHtml(str) + '</code></pre>';
+ * }
+ * });
+ * ```
+ *
+ **/ function MarkdownIt(presetName, options) {
+ if (!(this instanceof MarkdownIt)) {
+ return new MarkdownIt(presetName, options);
+ }
+ if (!options) {
+ if (!utils.isString(presetName)) {
+ options = presetName || {};
+ presetName = "default";
+ }
+ }
+ /**
+ * MarkdownIt#inline -> ParserInline
+ *
+ * Instance of [[ParserInline]]. You may need it to add new rules when
+ * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+ * [[MarkdownIt.enable]].
+ **/ this.inline = new parser_inline;
+ /**
+ * MarkdownIt#block -> ParserBlock
+ *
+ * Instance of [[ParserBlock]]. You may need it to add new rules when
+ * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+ * [[MarkdownIt.enable]].
+ **/ this.block = new parser_block;
+ /**
+ * MarkdownIt#core -> Core
+ *
+ * Instance of [[Core]] chain executor. You may need it to add new rules when
+ * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+ * [[MarkdownIt.enable]].
+ **/ this.core = new parser_core;
+ /**
+ * MarkdownIt#renderer -> Renderer
+ *
+ * Instance of [[Renderer]]. Use it to modify output look. Or to add rendering
+ * rules for new token types, generated by plugins.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * function myToken(tokens, idx, options, env, self) {
+ * //...
+ * return result;
+ * };
+ *
+ * md.renderer.rules['my_token'] = myToken
+ * ```
+ *
+ * See [[Renderer]] docs and [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js).
+ **/ this.renderer = new renderer;
+ /**
+ * MarkdownIt#linkify -> LinkifyIt
+ *
+ * [linkify-it](https://github.com/markdown-it/linkify-it) instance.
+ * Used by [linkify](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/linkify.js)
+ * rule.
+ **/ this.linkify = new linkifyIt;
+ /**
+ * MarkdownIt#validateLink(url) -> Boolean
+ *
+ * Link validation function. CommonMark allows too much in links. By default
+ * we disable `javascript:`, `vbscript:`, `file:` schemas, and almost all `data:...` schemas
+ * except some embedded image types.
+ *
+ * You can change this behaviour:
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ * // enable everything
+ * md.validateLink = function () { return true; }
+ * ```
+ **/ this.validateLink = validateLink;
+ /**
+ * MarkdownIt#normalizeLink(url) -> String
+ *
+ * Function used to encode link url to a machine-readable format,
+ * which includes url-encoding, punycode, etc.
+ **/ this.normalizeLink = normalizeLink;
+ /**
+ * MarkdownIt#normalizeLinkText(url) -> String
+ *
+ * Function used to decode link url to a human-readable format`
+ **/ this.normalizeLinkText = normalizeLinkText;
+ // Expose utils & helpers for easy acces from plugins
+ /**
+ * MarkdownIt#utils -> utils
+ *
+ * Assorted utility functions, useful to write plugins. See details
+ * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/common/utils.js).
+ **/ this.utils = utils;
+ /**
+ * MarkdownIt#helpers -> helpers
+ *
+ * Link components parser functions, useful to write plugins. See details
+ * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/helpers).
+ **/ this.helpers = utils.assign({}, helpers);
+ this.options = {};
+ this.configure(presetName);
+ if (options) {
+ this.set(options);
+ }
+ }
+ /** chainable
+ * MarkdownIt.set(options)
+ *
+ * Set parser options (in the same format as in constructor). Probably, you
+ * will never need it, but you can change options after constructor call.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')()
+ * .set({ html: true, breaks: true })
+ * .set({ typographer, true });
+ * ```
+ *
+ * __Note:__ To achieve the best possible performance, don't modify a
+ * `markdown-it` instance options on the fly. If you need multiple configurations
+ * it's best to create multiple instances and initialize each with separate
+ * config.
+ **/ MarkdownIt.prototype.set = function(options) {
+ utils.assign(this.options, options);
+ return this;
+ };
+ /** chainable, internal
+ * MarkdownIt.configure(presets)
+ *
+ * Batch load of all options and compenent settings. This is internal method,
+ * and you probably will not need it. But if you will - see available presets
+ * and data structure [here](https://github.com/markdown-it/markdown-it/tree/master/lib/presets)
+ *
+ * We strongly recommend to use presets instead of direct config loads. That
+ * will give better compatibility with next versions.
+ **/ MarkdownIt.prototype.configure = function(presets) {
+ var self = this, presetName;
+ if (utils.isString(presets)) {
+ presetName = presets;
+ presets = config[presetName];
+ if (!presets) {
+ throw new Error('Wrong `markdown-it` preset "' + presetName + '", check name');
+ }
+ }
+ if (!presets) {
+ throw new Error("Wrong `markdown-it` preset, can't be empty");
+ }
+ if (presets.options) {
+ self.set(presets.options);
+ }
+ if (presets.components) {
+ Object.keys(presets.components).forEach((function(name) {
+ if (presets.components[name].rules) {
+ self[name].ruler.enableOnly(presets.components[name].rules);
+ }
+ if (presets.components[name].rules2) {
+ self[name].ruler2.enableOnly(presets.components[name].rules2);
+ }
+ }));
+ }
+ return this;
+ };
+ /** chainable
+ * MarkdownIt.enable(list, ignoreInvalid)
+ * - list (String|Array): rule name or list of rule names to enable
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable list or rules. It will automatically find appropriate components,
+ * containing rules with given names. If rule not found, and `ignoreInvalid`
+ * not set - throws exception.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')()
+ * .enable(['sub', 'sup'])
+ * .disable('smartquotes');
+ * ```
+ **/ MarkdownIt.prototype.enable = function(list, ignoreInvalid) {
+ var result = [];
+ if (!Array.isArray(list)) {
+ list = [ list ];
+ }
+ [ "core", "block", "inline" ].forEach((function(chain) {
+ result = result.concat(this[chain].ruler.enable(list, true));
+ }), this);
+ result = result.concat(this.inline.ruler2.enable(list, true));
+ var missed = list.filter((function(name) {
+ return result.indexOf(name) < 0;
+ }));
+ if (missed.length && !ignoreInvalid) {
+ throw new Error("MarkdownIt. Failed to enable unknown rule(s): " + missed);
+ }
+ return this;
+ };
+ /** chainable
+ * MarkdownIt.disable(list, ignoreInvalid)
+ * - list (String|Array): rule name or list of rule names to disable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * The same as [[MarkdownIt.enable]], but turn specified rules off.
+ **/ MarkdownIt.prototype.disable = function(list, ignoreInvalid) {
+ var result = [];
+ if (!Array.isArray(list)) {
+ list = [ list ];
+ }
+ [ "core", "block", "inline" ].forEach((function(chain) {
+ result = result.concat(this[chain].ruler.disable(list, true));
+ }), this);
+ result = result.concat(this.inline.ruler2.disable(list, true));
+ var missed = list.filter((function(name) {
+ return result.indexOf(name) < 0;
+ }));
+ if (missed.length && !ignoreInvalid) {
+ throw new Error("MarkdownIt. Failed to disable unknown rule(s): " + missed);
+ }
+ return this;
+ };
+ /** chainable
+ * MarkdownIt.use(plugin, params)
+ *
+ * Load specified plugin with given params into current parser instance.
+ * It's just a sugar to call `plugin(md, params)` with curring.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var iterator = require('markdown-it-for-inline');
+ * var md = require('markdown-it')()
+ * .use(iterator, 'foo_replace', 'text', function (tokens, idx) {
+ * tokens[idx].content = tokens[idx].content.replace(/foo/g, 'bar');
+ * });
+ * ```
+ **/ MarkdownIt.prototype.use = function(plugin /*, params, ... */) {
+ var args = [ this ].concat(Array.prototype.slice.call(arguments, 1));
+ plugin.apply(plugin, args);
+ return this;
+ };
+ /** internal
+ * MarkdownIt.parse(src, env) -> Array
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Parse input string and return list of block tokens (special token type
+ * "inline" will contain list of inline tokens). You should not call this
+ * method directly, until you write custom renderer (for example, to produce
+ * AST).
+ *
+ * `env` is used to pass data between "distributed" rules and return additional
+ * metadata like reference info, needed for the renderer. It also can be used to
+ * inject data in specific cases. Usually, you will be ok to pass `{}`,
+ * and then pass updated object to renderer.
+ **/ MarkdownIt.prototype.parse = function(src, env) {
+ if (typeof src !== "string") {
+ throw new Error("Input data should be a String");
+ }
+ var state = new this.core.State(src, this, env);
+ this.core.process(state);
+ return state.tokens;
+ };
+ /**
+ * MarkdownIt.render(src [, env]) -> String
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Render markdown string into html. It does all magic for you :).
+ *
+ * `env` can be used to inject additional metadata (`{}` by default).
+ * But you will not need it with high probability. See also comment
+ * in [[MarkdownIt.parse]].
+ **/ MarkdownIt.prototype.render = function(src, env) {
+ env = env || {};
+ return this.renderer.render(this.parse(src, env), this.options, env);
+ };
+ /** internal
+ * MarkdownIt.parseInline(src, env) -> Array
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * The same as [[MarkdownIt.parse]] but skip all block rules. It returns the
+ * block tokens list with the single `inline` element, containing parsed inline
+ * tokens in `children` property. Also updates `env` object.
+ **/ MarkdownIt.prototype.parseInline = function(src, env) {
+ var state = new this.core.State(src, this, env);
+ state.inlineMode = true;
+ this.core.process(state);
+ return state.tokens;
+ };
+ /**
+ * MarkdownIt.renderInline(src [, env]) -> String
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Similar to [[MarkdownIt.render]] but for single paragraph content. Result
+ * will NOT be wrapped into `<p>` tags.
+ **/ MarkdownIt.prototype.renderInline = function(src, env) {
+ env = env || {};
+ return this.renderer.render(this.parseInline(src, env), this.options, env);
+ };
+ var lib = MarkdownIt;
+ var markdownIt = lib;
+ return markdownIt;
+}));
diff --git a/node_modules/markdown-it/dist/markdown-it.min.js b/node_modules/markdown-it/dist/markdown-it.min.js
new file mode 100644
index 0000000..5df7d1b
--- /dev/null
+++ b/node_modules/markdown-it/dist/markdown-it.min.js
@@ -0,0 +1,3 @@
+/*! markdown-it 12.3.2 https://github.com/markdown-it/markdown-it @license MIT */
+!function(e,r){"object"==typeof exports&&"undefined"!=typeof module?module.exports=r():"function"==typeof define&&define.amd?define(r):(e="undefined"!=typeof globalThis?globalThis:e||self).markdownit=r()}(this,(function(){"use strict";function e(e){if(e.__esModule)return e;var r=Object.defineProperty({},"__esModule",{value:!0});return Object.keys(e).forEach((function(t){var n=Object.getOwnPropertyDescriptor(e,t);Object.defineProperty(r,t,n.get?n:{enumerable:!0,get:function(){return e[t]}})})),r}var r={Aacute:"\xc1",aacute:"\xe1",Abreve:"\u0102",abreve:"\u0103",ac:"\u223e",acd:"\u223f",acE:"\u223e\u0333",Acirc:"\xc2",acirc:"\xe2",acute:"\xb4",Acy:"\u0410",acy:"\u0430",AElig:"\xc6",aelig:"\xe6",af:"\u2061",Afr:"\ud835\udd04",afr:"\ud835\udd1e",Agrave:"\xc0",agrave:"\xe0",alefsym:"\u2135",aleph:"\u2135",Alpha:"\u0391",alpha:"\u03b1",Amacr:"\u0100",amacr:"\u0101",amalg:"\u2a3f",amp:"&",AMP:"&",andand:"\u2a55",And:"\u2a53",and:"\u2227",andd:"\u2a5c",andslope:"\u2a58",andv:"\u2a5a",ang:"\u2220",ange:"\u29a4",angle:"\u2220",angmsdaa:"\u29a8",angmsdab:"\u29a9",angmsdac:"\u29aa",angmsdad:"\u29ab",angmsdae:"\u29ac",angmsdaf:"\u29ad",angmsdag:"\u29ae",angmsdah:"\u29af",angmsd:"\u2221",angrt:"\u221f",angrtvb:"\u22be",angrtvbd:"\u299d",angsph:"\u2222",angst:"\xc5",angzarr:"\u237c",Aogon:"\u0104",aogon:"\u0105",Aopf:"\ud835\udd38",aopf:"\ud835\udd52",apacir:"\u2a6f",ap:"\u2248",apE:"\u2a70",ape:"\u224a",apid:"\u224b",apos:"'",ApplyFunction:"\u2061",approx:"\u2248",approxeq:"\u224a",Aring:"\xc5",aring:"\xe5",Ascr:"\ud835\udc9c",ascr:"\ud835\udcb6",Assign:"\u2254",ast:"*",asymp:"\u2248",asympeq:"\u224d",Atilde:"\xc3",atilde:"\xe3",Auml:"\xc4",auml:"\xe4",awconint:"\u2233",awint:"\u2a11",backcong:"\u224c",backepsilon:"\u03f6",backprime:"\u2035",backsim:"\u223d",backsimeq:"\u22cd",Backslash:"\u2216",Barv:"\u2ae7",barvee:"\u22bd",barwed:"\u2305",Barwed:"\u2306",barwedge:"\u2305",bbrk:"\u23b5",bbrktbrk:"\u23b6",bcong:"\u224c",Bcy:"\u0411",bcy:"\u0431",bdquo:"\u201e",becaus:"\u2235",because:"\u2235",Because:"\u2235",bemptyv:"\u29b0",bepsi:"\u03f6",bernou:"\u212c",Bernoullis:"\u212c",Beta:"\u0392",beta:"\u03b2",beth:"\u2136",between:"\u226c",Bfr:"\ud835\udd05",bfr:"\ud835\udd1f",bigcap:"\u22c2",bigcirc:"\u25ef",bigcup:"\u22c3",bigodot:"\u2a00",bigoplus:"\u2a01",bigotimes:"\u2a02",bigsqcup:"\u2a06",bigstar:"\u2605",bigtriangledown:"\u25bd",bigtriangleup:"\u25b3",biguplus:"\u2a04",bigvee:"\u22c1",bigwedge:"\u22c0",bkarow:"\u290d",blacklozenge:"\u29eb",blacksquare:"\u25aa",blacktriangle:"\u25b4",blacktriangledown:"\u25be",blacktriangleleft:"\u25c2",blacktriangleright:"\u25b8",blank:"\u2423",blk12:"\u2592",blk14:"\u2591",blk34:"\u2593",block:"\u2588",bne:"=\u20e5",bnequiv:"\u2261\u20e5",bNot:"\u2aed",bnot:"\u2310",Bopf:"\ud835\udd39",bopf:"\ud835\udd53",bot:"\u22a5",bottom:"\u22a5",bowtie:"\u22c8",boxbox:"\u29c9",boxdl:"\u2510",boxdL:"\u2555",boxDl:"\u2556",boxDL:"\u2557",boxdr:"\u250c",boxdR:"\u2552",boxDr:"\u2553",boxDR:"\u2554",boxh:"\u2500",boxH:"\u2550",boxhd:"\u252c",boxHd:"\u2564",boxhD:"\u2565",boxHD:"\u2566",boxhu:"\u2534",boxHu:"\u2567",boxhU:"\u2568",boxHU:"\u2569",boxminus:"\u229f",boxplus:"\u229e",boxtimes:"\u22a0",boxul:"\u2518",boxuL:"\u255b",boxUl:"\u255c",boxUL:"\u255d",boxur:"\u2514",boxuR:"\u2558",boxUr:"\u2559",boxUR:"\u255a",boxv:"\u2502",boxV:"\u2551",boxvh:"\u253c",boxvH:"\u256a",boxVh:"\u256b",boxVH:"\u256c",boxvl:"\u2524",boxvL:"\u2561",boxVl:"\u2562",boxVL:"\u2563",boxvr:"\u251c",boxvR:"\u255e",boxVr:"\u255f",boxVR:"\u2560",bprime:"\u2035",breve:"\u02d8",Breve:"\u02d8",brvbar:"\xa6",bscr:"\ud835\udcb7",Bscr:"\u212c",bsemi:"\u204f",bsim:"\u223d",bsime:"\u22cd",bsolb:"\u29c5",bsol:"\\",bsolhsub:"\u27c8",bull:"\u2022",bullet:"\u2022",bump:"\u224e",bumpE:"\u2aae",bumpe:"\u224f",Bumpeq:"\u224e",bumpeq:"\u224f",Cacute:"\u0106",cacute:"\u0107",capand:"\u2a44",capbrcup:"\u2a49",capcap:"\u2a4b",cap:"\u2229",Cap:"\u22d2",capcup:"\u2a47",capdot:"\u2a40",CapitalDifferentialD:"\u2145",caps:"\u2229\ufe00",caret:"\u2041",caron:"\u02c7",Cayleys:"\u212d",ccaps:"\u2a4d",Ccaron:"\u010c",ccaron:"\u010d",Ccedil:"\xc7",ccedil:"\xe7",Ccirc:"\u0108",ccirc:"\u0109",Cconint:"\u2230",ccups:"\u2a4c",ccupssm:"\u2a50",Cdot:"\u010a",cdot:"\u010b",cedil:"\xb8",Cedilla:"\xb8",cemptyv:"\u29b2",cent:"\xa2",centerdot:"\xb7",CenterDot:"\xb7",cfr:"\ud835\udd20",Cfr:"\u212d",CHcy:"\u0427",chcy:"\u0447",check:"\u2713",checkmark:"\u2713",Chi:"\u03a7",chi:"\u03c7",circ:"\u02c6",circeq:"\u2257",circlearrowleft:"\u21ba",circlearrowright:"\u21bb",circledast:"\u229b",circledcirc:"\u229a",circleddash:"\u229d",CircleDot:"\u2299",circledR:"\xae",circledS:"\u24c8",CircleMinus:"\u2296",CirclePlus:"\u2295",CircleTimes:"\u2297",cir:"\u25cb",cirE:"\u29c3",cire:"\u2257",cirfnint:"\u2a10",cirmid:"\u2aef",cirscir:"\u29c2",ClockwiseContourIntegral:"\u2232",CloseCurlyDoubleQuote:"\u201d",CloseCurlyQuote:"\u2019",clubs:"\u2663",clubsuit:"\u2663",colon:":",Colon:"\u2237",Colone:"\u2a74",colone:"\u2254",coloneq:"\u2254",comma:",",commat:"@",comp:"\u2201",compfn:"\u2218",complement:"\u2201",complexes:"\u2102",cong:"\u2245",congdot:"\u2a6d",Congruent:"\u2261",conint:"\u222e",Conint:"\u222f",ContourIntegral:"\u222e",copf:"\ud835\udd54",Copf:"\u2102",coprod:"\u2210",Coproduct:"\u2210",copy:"\xa9",COPY:"\xa9",copysr:"\u2117",CounterClockwiseContourIntegral:"\u2233",crarr:"\u21b5",cross:"\u2717",Cross:"\u2a2f",Cscr:"\ud835\udc9e",cscr:"\ud835\udcb8",csub:"\u2acf",csube:"\u2ad1",csup:"\u2ad0",csupe:"\u2ad2",ctdot:"\u22ef",cudarrl:"\u2938",cudarrr:"\u2935",cuepr:"\u22de",cuesc:"\u22df",cularr:"\u21b6",cularrp:"\u293d",cupbrcap:"\u2a48",cupcap:"\u2a46",CupCap:"\u224d",cup:"\u222a",Cup:"\u22d3",cupcup:"\u2a4a",cupdot:"\u228d",cupor:"\u2a45",cups:"\u222a\ufe00",curarr:"\u21b7",curarrm:"\u293c",curlyeqprec:"\u22de",curlyeqsucc:"\u22df",curlyvee:"\u22ce",curlywedge:"\u22cf",curren:"\xa4",curvearrowleft:"\u21b6",curvearrowright:"\u21b7",cuvee:"\u22ce",cuwed:"\u22cf",cwconint:"\u2232",cwint:"\u2231",cylcty:"\u232d",dagger:"\u2020",Dagger:"\u2021",daleth:"\u2138",darr:"\u2193",Darr:"\u21a1",dArr:"\u21d3",dash:"\u2010",Dashv:"\u2ae4",dashv:"\u22a3",dbkarow:"\u290f",dblac:"\u02dd",Dcaron:"\u010e",dcaron:"\u010f",Dcy:"\u0414",dcy:"\u0434",ddagger:"\u2021",ddarr:"\u21ca",DD:"\u2145",dd:"\u2146",DDotrahd:"\u2911",ddotseq:"\u2a77",deg:"\xb0",Del:"\u2207",Delta:"\u0394",delta:"\u03b4",demptyv:"\u29b1",dfisht:"\u297f",Dfr:"\ud835\udd07",dfr:"\ud835\udd21",dHar:"\u2965",dharl:"\u21c3",dharr:"\u21c2",DiacriticalAcute:"\xb4",DiacriticalDot:"\u02d9",DiacriticalDoubleAcute:"\u02dd",DiacriticalGrave:"`",DiacriticalTilde:"\u02dc",diam:"\u22c4",diamond:"\u22c4",Diamond:"\u22c4",diamondsuit:"\u2666",diams:"\u2666",die:"\xa8",DifferentialD:"\u2146",digamma:"\u03dd",disin:"\u22f2",div:"\xf7",divide:"\xf7",divideontimes:"\u22c7",divonx:"\u22c7",DJcy:"\u0402",djcy:"\u0452",dlcorn:"\u231e",dlcrop:"\u230d",dollar:"$",Dopf:"\ud835\udd3b",dopf:"\ud835\udd55",Dot:"\xa8",dot:"\u02d9",DotDot:"\u20dc",doteq:"\u2250",doteqdot:"\u2251",DotEqual:"\u2250",dotminus:"\u2238",dotplus:"\u2214",dotsquare:"\u22a1",doublebarwedge:"\u2306",DoubleContourIntegral:"\u222f",DoubleDot:"\xa8",DoubleDownArrow:"\u21d3",DoubleLeftArrow:"\u21d0",DoubleLeftRightArrow:"\u21d4",DoubleLeftTee:"\u2ae4",DoubleLongLeftArrow:"\u27f8",DoubleLongLeftRightArrow:"\u27fa",DoubleLongRightArrow:"\u27f9",DoubleRightArrow:"\u21d2",DoubleRightTee:"\u22a8",DoubleUpArrow:"\u21d1",DoubleUpDownArrow:"\u21d5",DoubleVerticalBar:"\u2225",DownArrowBar:"\u2913",downarrow:"\u2193",DownArrow:"\u2193",Downarrow:"\u21d3",DownArrowUpArrow:"\u21f5",DownBreve:"\u0311",downdownarrows:"\u21ca",downharpoonleft:"\u21c3",downharpoonright:"\u21c2",DownLeftRightVector:"\u2950",DownLeftTeeVector:"\u295e",DownLeftVectorBar:"\u2956",DownLeftVector:"\u21bd",DownRightTeeVector:"\u295f",DownRightVectorBar:"\u2957",DownRightVector:"\u21c1",DownTeeArrow:"\u21a7",DownTee:"\u22a4",drbkarow:"\u2910",drcorn:"\u231f",drcrop:"\u230c",Dscr:"\ud835\udc9f",dscr:"\ud835\udcb9",DScy:"\u0405",dscy:"\u0455",dsol:"\u29f6",Dstrok:"\u0110",dstrok:"\u0111",dtdot:"\u22f1",dtri:"\u25bf",dtrif:"\u25be",duarr:"\u21f5",duhar:"\u296f",dwangle:"\u29a6",DZcy:"\u040f",dzcy:"\u045f",dzigrarr:"\u27ff",Eacute:"\xc9",eacute:"\xe9",easter:"\u2a6e",Ecaron:"\u011a",ecaron:"\u011b",Ecirc:"\xca",ecirc:"\xea",ecir:"\u2256",ecolon:"\u2255",Ecy:"\u042d",ecy:"\u044d",eDDot:"\u2a77",Edot:"\u0116",edot:"\u0117",eDot:"\u2251",ee:"\u2147",efDot:"\u2252",Efr:"\ud835\udd08",efr:"\ud835\udd22",eg:"\u2a9a",Egrave:"\xc8",egrave:"\xe8",egs:"\u2a96",egsdot:"\u2a98",el:"\u2a99",Element:"\u2208",elinters:"\u23e7",ell:"\u2113",els:"\u2a95",elsdot:"\u2a97",Emacr:"\u0112",emacr:"\u0113",empty:"\u2205",emptyset:"\u2205",EmptySmallSquare:"\u25fb",emptyv:"\u2205",EmptyVerySmallSquare:"\u25ab",emsp13:"\u2004",emsp14:"\u2005",emsp:"\u2003",ENG:"\u014a",eng:"\u014b",ensp:"\u2002",Eogon:"\u0118",eogon:"\u0119",Eopf:"\ud835\udd3c",eopf:"\ud835\udd56",epar:"\u22d5",eparsl:"\u29e3",eplus:"\u2a71",epsi:"\u03b5",Epsilon:"\u0395",epsilon:"\u03b5",epsiv:"\u03f5",eqcirc:"\u2256",eqcolon:"\u2255",eqsim:"\u2242",eqslantgtr:"\u2a96",eqslantless:"\u2a95",Equal:"\u2a75",equals:"=",EqualTilde:"\u2242",equest:"\u225f",Equilibrium:"\u21cc",equiv:"\u2261",equivDD:"\u2a78",eqvparsl:"\u29e5",erarr:"\u2971",erDot:"\u2253",escr:"\u212f",Escr:"\u2130",esdot:"\u2250",Esim:"\u2a73",esim:"\u2242",Eta:"\u0397",eta:"\u03b7",ETH:"\xd0",eth:"\xf0",Euml:"\xcb",euml:"\xeb",euro:"\u20ac",excl:"!",exist:"\u2203",Exists:"\u2203",expectation:"\u2130",exponentiale:"\u2147",ExponentialE:"\u2147",fallingdotseq:"\u2252",Fcy:"\u0424",fcy:"\u0444",female:"\u2640",ffilig:"\ufb03",fflig:"\ufb00",ffllig:"\ufb04",Ffr:"\ud835\udd09",ffr:"\ud835\udd23",filig:"\ufb01",FilledSmallSquare:"\u25fc",FilledVerySmallSquare:"\u25aa",fjlig:"fj",flat:"\u266d",fllig:"\ufb02",fltns:"\u25b1",fnof:"\u0192",Fopf:"\ud835\udd3d",fopf:"\ud835\udd57",forall:"\u2200",ForAll:"\u2200",fork:"\u22d4",forkv:"\u2ad9",Fouriertrf:"\u2131",fpartint:"\u2a0d",frac12:"\xbd",frac13:"\u2153",frac14:"\xbc",frac15:"\u2155",frac16:"\u2159",frac18:"\u215b",frac23:"\u2154",frac25:"\u2156",frac34:"\xbe",frac35:"\u2157",frac38:"\u215c",frac45:"\u2158",frac56:"\u215a",frac58:"\u215d",frac78:"\u215e",frasl:"\u2044",frown:"\u2322",fscr:"\ud835\udcbb",Fscr:"\u2131",gacute:"\u01f5",Gamma:"\u0393",gamma:"\u03b3",Gammad:"\u03dc",gammad:"\u03dd",gap:"\u2a86",Gbreve:"\u011e",gbreve:"\u011f",Gcedil:"\u0122",Gcirc:"\u011c",gcirc:"\u011d",Gcy:"\u0413",gcy:"\u0433",Gdot:"\u0120",gdot:"\u0121",ge:"\u2265",gE:"\u2267",gEl:"\u2a8c",gel:"\u22db",geq:"\u2265",geqq:"\u2267",geqslant:"\u2a7e",gescc:"\u2aa9",ges:"\u2a7e",gesdot:"\u2a80",gesdoto:"\u2a82",gesdotol:"\u2a84",gesl:"\u22db\ufe00",gesles:"\u2a94",Gfr:"\ud835\udd0a",gfr:"\ud835\udd24",gg:"\u226b",Gg:"\u22d9",ggg:"\u22d9",gimel:"\u2137",GJcy:"\u0403",gjcy:"\u0453",gla:"\u2aa5",gl:"\u2277",glE:"\u2a92",glj:"\u2aa4",gnap:"\u2a8a",gnapprox:"\u2a8a",gne:"\u2a88",gnE:"\u2269",gneq:"\u2a88",gneqq:"\u2269",gnsim:"\u22e7",Gopf:"\ud835\udd3e",gopf:"\ud835\udd58",grave:"`",GreaterEqual:"\u2265",GreaterEqualLess:"\u22db",GreaterFullEqual:"\u2267",GreaterGreater:"\u2aa2",GreaterLess:"\u2277",GreaterSlantEqual:"\u2a7e",GreaterTilde:"\u2273",Gscr:"\ud835\udca2",gscr:"\u210a",gsim:"\u2273",gsime:"\u2a8e",gsiml:"\u2a90",gtcc:"\u2aa7",gtcir:"\u2a7a",gt:">",GT:">",Gt:"\u226b",gtdot:"\u22d7",gtlPar:"\u2995",gtquest:"\u2a7c",gtrapprox:"\u2a86",gtrarr:"\u2978",gtrdot:"\u22d7",gtreqless:"\u22db",gtreqqless:"\u2a8c",gtrless:"\u2277",gtrsim:"\u2273",gvertneqq:"\u2269\ufe00",gvnE:"\u2269\ufe00",Hacek:"\u02c7",hairsp:"\u200a",half:"\xbd",hamilt:"\u210b",HARDcy:"\u042a",hardcy:"\u044a",harrcir:"\u2948",harr:"\u2194",hArr:"\u21d4",harrw:"\u21ad",Hat:"^",hbar:"\u210f",Hcirc:"\u0124",hcirc:"\u0125",hearts:"\u2665",heartsuit:"\u2665",hellip:"\u2026",hercon:"\u22b9",hfr:"\ud835\udd25",Hfr:"\u210c",HilbertSpace:"\u210b",hksearow:"\u2925",hkswarow:"\u2926",hoarr:"\u21ff",homtht:"\u223b",hookleftarrow:"\u21a9",hookrightarrow:"\u21aa",hopf:"\ud835\udd59",Hopf:"\u210d",horbar:"\u2015",HorizontalLine:"\u2500",hscr:"\ud835\udcbd",Hscr:"\u210b",hslash:"\u210f",Hstrok:"\u0126",hstrok:"\u0127",HumpDownHump:"\u224e",HumpEqual:"\u224f",hybull:"\u2043",hyphen:"\u2010",Iacute:"\xcd",iacute:"\xed",ic:"\u2063",Icirc:"\xce",icirc:"\xee",Icy:"\u0418",icy:"\u0438",Idot:"\u0130",IEcy:"\u0415",iecy:"\u0435",iexcl:"\xa1",iff:"\u21d4",ifr:"\ud835\udd26",Ifr:"\u2111",Igrave:"\xcc",igrave:"\xec",ii:"\u2148",iiiint:"\u2a0c",iiint:"\u222d",iinfin:"\u29dc",iiota:"\u2129",IJlig:"\u0132",ijlig:"\u0133",Imacr:"\u012a",imacr:"\u012b",image:"\u2111",ImaginaryI:"\u2148",imagline:"\u2110",imagpart:"\u2111",imath:"\u0131",Im:"\u2111",imof:"\u22b7",imped:"\u01b5",Implies:"\u21d2",incare:"\u2105",in:"\u2208",infin:"\u221e",infintie:"\u29dd",inodot:"\u0131",intcal:"\u22ba",int:"\u222b",Int:"\u222c",integers:"\u2124",Integral:"\u222b",intercal:"\u22ba",Intersection:"\u22c2",intlarhk:"\u2a17",intprod:"\u2a3c",InvisibleComma:"\u2063",InvisibleTimes:"\u2062",IOcy:"\u0401",iocy:"\u0451",Iogon:"\u012e",iogon:"\u012f",Iopf:"\ud835\udd40",iopf:"\ud835\udd5a",Iota:"\u0399",iota:"\u03b9",iprod:"\u2a3c",iquest:"\xbf",iscr:"\ud835\udcbe",Iscr:"\u2110",isin:"\u2208",isindot:"\u22f5",isinE:"\u22f9",isins:"\u22f4",isinsv:"\u22f3",isinv:"\u2208",it:"\u2062",Itilde:"\u0128",itilde:"\u0129",Iukcy:"\u0406",iukcy:"\u0456",Iuml:"\xcf",iuml:"\xef",Jcirc:"\u0134",jcirc:"\u0135",Jcy:"\u0419",jcy:"\u0439",Jfr:"\ud835\udd0d",jfr:"\ud835\udd27",jmath:"\u0237",Jopf:"\ud835\udd41",jopf:"\ud835\udd5b",Jscr:"\ud835\udca5",jscr:"\ud835\udcbf",Jsercy:"\u0408",jsercy:"\u0458",Jukcy:"\u0404",jukcy:"\u0454",Kappa:"\u039a",kappa:"\u03ba",kappav:"\u03f0",Kcedil:"\u0136",kcedil:"\u0137",Kcy:"\u041a",kcy:"\u043a",Kfr:"\ud835\udd0e",kfr:"\ud835\udd28",kgreen:"\u0138",KHcy:"\u0425",khcy:"\u0445",KJcy:"\u040c",kjcy:"\u045c",Kopf:"\ud835\udd42",kopf:"\ud835\udd5c",Kscr:"\ud835\udca6",kscr:"\ud835\udcc0",lAarr:"\u21da",Lacute:"\u0139",lacute:"\u013a",laemptyv:"\u29b4",lagran:"\u2112",Lambda:"\u039b",lambda:"\u03bb",lang:"\u27e8",Lang:"\u27ea",langd:"\u2991",langle:"\u27e8",lap:"\u2a85",Laplacetrf:"\u2112",laquo:"\xab",larrb:"\u21e4",larrbfs:"\u291f",larr:"\u2190",Larr:"\u219e",lArr:"\u21d0",larrfs:"\u291d",larrhk:"\u21a9",larrlp:"\u21ab",larrpl:"\u2939",larrsim:"\u2973",larrtl:"\u21a2",latail:"\u2919",lAtail:"\u291b",lat:"\u2aab",late:"\u2aad",lates:"\u2aad\ufe00",lbarr:"\u290c",lBarr:"\u290e",lbbrk:"\u2772",lbrace:"{",lbrack:"[",lbrke:"\u298b",lbrksld:"\u298f",lbrkslu:"\u298d",Lcaron:"\u013d",lcaron:"\u013e",Lcedil:"\u013b",lcedil:"\u013c",lceil:"\u2308",lcub:"{",Lcy:"\u041b",lcy:"\u043b",ldca:"\u2936",ldquo:"\u201c",ldquor:"\u201e",ldrdhar:"\u2967",ldrushar:"\u294b",ldsh:"\u21b2",le:"\u2264",lE:"\u2266",LeftAngleBracket:"\u27e8",LeftArrowBar:"\u21e4",leftarrow:"\u2190",LeftArrow:"\u2190",Leftarrow:"\u21d0",LeftArrowRightArrow:"\u21c6",leftarrowtail:"\u21a2",LeftCeiling:"\u2308",LeftDoubleBracket:"\u27e6",LeftDownTeeVector:"\u2961",LeftDownVectorBar:"\u2959",LeftDownVector:"\u21c3",LeftFloor:"\u230a",leftharpoondown:"\u21bd",leftharpoonup:"\u21bc",leftleftarrows:"\u21c7",leftrightarrow:"\u2194",LeftRightArrow:"\u2194",Leftrightarrow:"\u21d4",leftrightarrows:"\u21c6",leftrightharpoons:"\u21cb",leftrightsquigarrow:"\u21ad",LeftRightVector:"\u294e",LeftTeeArrow:"\u21a4",LeftTee:"\u22a3",LeftTeeVector:"\u295a",leftthreetimes:"\u22cb",LeftTriangleBar:"\u29cf",LeftTriangle:"\u22b2",LeftTriangleEqual:"\u22b4",LeftUpDownVector:"\u2951",LeftUpTeeVector:"\u2960",LeftUpVectorBar:"\u2958",LeftUpVector:"\u21bf",LeftVectorBar:"\u2952",LeftVector:"\u21bc",lEg:"\u2a8b",leg:"\u22da",leq:"\u2264",leqq:"\u2266",leqslant:"\u2a7d",lescc:"\u2aa8",les:"\u2a7d",lesdot:"\u2a7f",lesdoto:"\u2a81",lesdotor:"\u2a83",lesg:"\u22da\ufe00",lesges:"\u2a93",lessapprox:"\u2a85",lessdot:"\u22d6",lesseqgtr:"\u22da",lesseqqgtr:"\u2a8b",LessEqualGreater:"\u22da",LessFullEqual:"\u2266",LessGreater:"\u2276",lessgtr:"\u2276",LessLess:"\u2aa1",lesssim:"\u2272",LessSlantEqual:"\u2a7d",LessTilde:"\u2272",lfisht:"\u297c",lfloor:"\u230a",Lfr:"\ud835\udd0f",lfr:"\ud835\udd29",lg:"\u2276",lgE:"\u2a91",lHar:"\u2962",lhard:"\u21bd",lharu:"\u21bc",lharul:"\u296a",lhblk:"\u2584",LJcy:"\u0409",ljcy:"\u0459",llarr:"\u21c7",ll:"\u226a",Ll:"\u22d8",llcorner:"\u231e",Lleftarrow:"\u21da",llhard:"\u296b",lltri:"\u25fa",Lmidot:"\u013f",lmidot:"\u0140",lmoustache:"\u23b0",lmoust:"\u23b0",lnap:"\u2a89",lnapprox:"\u2a89",lne:"\u2a87",lnE:"\u2268",lneq:"\u2a87",lneqq:"\u2268",lnsim:"\u22e6",loang:"\u27ec",loarr:"\u21fd",lobrk:"\u27e6",longleftarrow:"\u27f5",LongLeftArrow:"\u27f5",Longleftarrow:"\u27f8",longleftrightarrow:"\u27f7",LongLeftRightArrow:"\u27f7",Longleftrightarrow:"\u27fa",longmapsto:"\u27fc",longrightarrow:"\u27f6",LongRightArrow:"\u27f6",Longrightarrow:"\u27f9",looparrowleft:"\u21ab",looparrowright:"\u21ac",lopar:"\u2985",Lopf:"\ud835\udd43",lopf:"\ud835\udd5d",loplus:"\u2a2d",lotimes:"\u2a34",lowast:"\u2217",lowbar:"_",LowerLeftArrow:"\u2199",LowerRightArrow:"\u2198",loz:"\u25ca",lozenge:"\u25ca",lozf:"\u29eb",lpar:"(",lparlt:"\u2993",lrarr:"\u21c6",lrcorner:"\u231f",lrhar:"\u21cb",lrhard:"\u296d",lrm:"\u200e",lrtri:"\u22bf",lsaquo:"\u2039",lscr:"\ud835\udcc1",Lscr:"\u2112",lsh:"\u21b0",Lsh:"\u21b0",lsim:"\u2272",lsime:"\u2a8d",lsimg:"\u2a8f",lsqb:"[",lsquo:"\u2018",lsquor:"\u201a",Lstrok:"\u0141",lstrok:"\u0142",ltcc:"\u2aa6",ltcir:"\u2a79",lt:"<",LT:"<",Lt:"\u226a",ltdot:"\u22d6",lthree:"\u22cb",ltimes:"\u22c9",ltlarr:"\u2976",ltquest:"\u2a7b",ltri:"\u25c3",ltrie:"\u22b4",ltrif:"\u25c2",ltrPar:"\u2996",lurdshar:"\u294a",luruhar:"\u2966",lvertneqq:"\u2268\ufe00",lvnE:"\u2268\ufe00",macr:"\xaf",male:"\u2642",malt:"\u2720",maltese:"\u2720",Map:"\u2905",map:"\u21a6",mapsto:"\u21a6",mapstodown:"\u21a7",mapstoleft:"\u21a4",mapstoup:"\u21a5",marker:"\u25ae",mcomma:"\u2a29",Mcy:"\u041c",mcy:"\u043c",mdash:"\u2014",mDDot:"\u223a",measuredangle:"\u2221",MediumSpace:"\u205f",Mellintrf:"\u2133",Mfr:"\ud835\udd10",mfr:"\ud835\udd2a",mho:"\u2127",micro:"\xb5",midast:"*",midcir:"\u2af0",mid:"\u2223",middot:"\xb7",minusb:"\u229f",minus:"\u2212",minusd:"\u2238",minusdu:"\u2a2a",MinusPlus:"\u2213",mlcp:"\u2adb",mldr:"\u2026",mnplus:"\u2213",models:"\u22a7",Mopf:"\ud835\udd44",mopf:"\ud835\udd5e",mp:"\u2213",mscr:"\ud835\udcc2",Mscr:"\u2133",mstpos:"\u223e",Mu:"\u039c",mu:"\u03bc",multimap:"\u22b8",mumap:"\u22b8",nabla:"\u2207",Nacute:"\u0143",nacute:"\u0144",nang:"\u2220\u20d2",nap:"\u2249",napE:"\u2a70\u0338",napid:"\u224b\u0338",napos:"\u0149",napprox:"\u2249",natural:"\u266e",naturals:"\u2115",natur:"\u266e",nbsp:"\xa0",nbump:"\u224e\u0338",nbumpe:"\u224f\u0338",ncap:"\u2a43",Ncaron:"\u0147",ncaron:"\u0148",Ncedil:"\u0145",ncedil:"\u0146",ncong:"\u2247",ncongdot:"\u2a6d\u0338",ncup:"\u2a42",Ncy:"\u041d",ncy:"\u043d",ndash:"\u2013",nearhk:"\u2924",nearr:"\u2197",neArr:"\u21d7",nearrow:"\u2197",ne:"\u2260",nedot:"\u2250\u0338",NegativeMediumSpace:"\u200b",NegativeThickSpace:"\u200b",NegativeThinSpace:"\u200b",NegativeVeryThinSpace:"\u200b",nequiv:"\u2262",nesear:"\u2928",nesim:"\u2242\u0338",NestedGreaterGreater:"\u226b",NestedLessLess:"\u226a",NewLine:"\n",nexist:"\u2204",nexists:"\u2204",Nfr:"\ud835\udd11",nfr:"\ud835\udd2b",ngE:"\u2267\u0338",nge:"\u2271",ngeq:"\u2271",ngeqq:"\u2267\u0338",ngeqslant:"\u2a7e\u0338",nges:"\u2a7e\u0338",nGg:"\u22d9\u0338",ngsim:"\u2275",nGt:"\u226b\u20d2",ngt:"\u226f",ngtr:"\u226f",nGtv:"\u226b\u0338",nharr:"\u21ae",nhArr:"\u21ce",nhpar:"\u2af2",ni:"\u220b",nis:"\u22fc",nisd:"\u22fa",niv:"\u220b",NJcy:"\u040a",njcy:"\u045a",nlarr:"\u219a",nlArr:"\u21cd",nldr:"\u2025",nlE:"\u2266\u0338",nle:"\u2270",nleftarrow:"\u219a",nLeftarrow:"\u21cd",nleftrightarrow:"\u21ae",nLeftrightarrow:"\u21ce",nleq:"\u2270",nleqq:"\u2266\u0338",nleqslant:"\u2a7d\u0338",nles:"\u2a7d\u0338",nless:"\u226e",nLl:"\u22d8\u0338",nlsim:"\u2274",nLt:"\u226a\u20d2",nlt:"\u226e",nltri:"\u22ea",nltrie:"\u22ec",nLtv:"\u226a\u0338",nmid:"\u2224",NoBreak:"\u2060",NonBreakingSpace:"\xa0",nopf:"\ud835\udd5f",Nopf:"\u2115",Not:"\u2aec",not:"\xac",NotCongruent:"\u2262",NotCupCap:"\u226d",NotDoubleVerticalBar:"\u2226",NotElement:"\u2209",NotEqual:"\u2260",NotEqualTilde:"\u2242\u0338",NotExists:"\u2204",NotGreater:"\u226f",NotGreaterEqual:"\u2271",NotGreaterFullEqual:"\u2267\u0338",NotGreaterGreater:"\u226b\u0338",NotGreaterLess:"\u2279",NotGreaterSlantEqual:"\u2a7e\u0338",NotGreaterTilde:"\u2275",NotHumpDownHump:"\u224e\u0338",NotHumpEqual:"\u224f\u0338",notin:"\u2209",notindot:"\u22f5\u0338",notinE:"\u22f9\u0338",notinva:"\u2209",notinvb:"\u22f7",notinvc:"\u22f6",NotLeftTriangleBar:"\u29cf\u0338",NotLeftTriangle:"\u22ea",NotLeftTriangleEqual:"\u22ec",NotLess:"\u226e",NotLessEqual:"\u2270",NotLessGreater:"\u2278",NotLessLess:"\u226a\u0338",NotLessSlantEqual:"\u2a7d\u0338",NotLessTilde:"\u2274",NotNestedGreaterGreater:"\u2aa2\u0338",NotNestedLessLess:"\u2aa1\u0338",notni:"\u220c",notniva:"\u220c",notnivb:"\u22fe",notnivc:"\u22fd",NotPrecedes:"\u2280",NotPrecedesEqual:"\u2aaf\u0338",NotPrecedesSlantEqual:"\u22e0",NotReverseElement:"\u220c",NotRightTriangleBar:"\u29d0\u0338",NotRightTriangle:"\u22eb",NotRightTriangleEqual:"\u22ed",NotSquareSubset:"\u228f\u0338",NotSquareSubsetEqual:"\u22e2",NotSquareSuperset:"\u2290\u0338",NotSquareSupersetEqual:"\u22e3",NotSubset:"\u2282\u20d2",NotSubsetEqual:"\u2288",NotSucceeds:"\u2281",NotSucceedsEqual:"\u2ab0\u0338",NotSucceedsSlantEqual:"\u22e1",NotSucceedsTilde:"\u227f\u0338",NotSuperset:"\u2283\u20d2",NotSupersetEqual:"\u2289",NotTilde:"\u2241",NotTildeEqual:"\u2244",NotTildeFullEqual:"\u2247",NotTildeTilde:"\u2249",NotVerticalBar:"\u2224",nparallel:"\u2226",npar:"\u2226",nparsl:"\u2afd\u20e5",npart:"\u2202\u0338",npolint:"\u2a14",npr:"\u2280",nprcue:"\u22e0",nprec:"\u2280",npreceq:"\u2aaf\u0338",npre:"\u2aaf\u0338",nrarrc:"\u2933\u0338",nrarr:"\u219b",nrArr:"\u21cf",nrarrw:"\u219d\u0338",nrightarrow:"\u219b",nRightarrow:"\u21cf",nrtri:"\u22eb",nrtrie:"\u22ed",nsc:"\u2281",nsccue:"\u22e1",nsce:"\u2ab0\u0338",Nscr:"\ud835\udca9",nscr:"\ud835\udcc3",nshortmid:"\u2224",nshortparallel:"\u2226",nsim:"\u2241",nsime:"\u2244",nsimeq:"\u2244",nsmid:"\u2224",nspar:"\u2226",nsqsube:"\u22e2",nsqsupe:"\u22e3",nsub:"\u2284",nsubE:"\u2ac5\u0338",nsube:"\u2288",nsubset:"\u2282\u20d2",nsubseteq:"\u2288",nsubseteqq:"\u2ac5\u0338",nsucc:"\u2281",nsucceq:"\u2ab0\u0338",nsup:"\u2285",nsupE:"\u2ac6\u0338",nsupe:"\u2289",nsupset:"\u2283\u20d2",nsupseteq:"\u2289",nsupseteqq:"\u2ac6\u0338",ntgl:"\u2279",Ntilde:"\xd1",ntilde:"\xf1",ntlg:"\u2278",ntriangleleft:"\u22ea",ntrianglelefteq:"\u22ec",ntriangleright:"\u22eb",ntrianglerighteq:"\u22ed",Nu:"\u039d",nu:"\u03bd",num:"#",numero:"\u2116",numsp:"\u2007",nvap:"\u224d\u20d2",nvdash:"\u22ac",nvDash:"\u22ad",nVdash:"\u22ae",nVDash:"\u22af",nvge:"\u2265\u20d2",nvgt:">\u20d2",nvHarr:"\u2904",nvinfin:"\u29de",nvlArr:"\u2902",nvle:"\u2264\u20d2",nvlt:"<\u20d2",nvltrie:"\u22b4\u20d2",nvrArr:"\u2903",nvrtrie:"\u22b5\u20d2",nvsim:"\u223c\u20d2",nwarhk:"\u2923",nwarr:"\u2196",nwArr:"\u21d6",nwarrow:"\u2196",nwnear:"\u2927",Oacute:"\xd3",oacute:"\xf3",oast:"\u229b",Ocirc:"\xd4",ocirc:"\xf4",ocir:"\u229a",Ocy:"\u041e",ocy:"\u043e",odash:"\u229d",Odblac:"\u0150",odblac:"\u0151",odiv:"\u2a38",odot:"\u2299",odsold:"\u29bc",OElig:"\u0152",oelig:"\u0153",ofcir:"\u29bf",Ofr:"\ud835\udd12",ofr:"\ud835\udd2c",ogon:"\u02db",Ograve:"\xd2",ograve:"\xf2",ogt:"\u29c1",ohbar:"\u29b5",ohm:"\u03a9",oint:"\u222e",olarr:"\u21ba",olcir:"\u29be",olcross:"\u29bb",oline:"\u203e",olt:"\u29c0",Omacr:"\u014c",omacr:"\u014d",Omega:"\u03a9",omega:"\u03c9",Omicron:"\u039f",omicron:"\u03bf",omid:"\u29b6",ominus:"\u2296",Oopf:"\ud835\udd46",oopf:"\ud835\udd60",opar:"\u29b7",OpenCurlyDoubleQuote:"\u201c",OpenCurlyQuote:"\u2018",operp:"\u29b9",oplus:"\u2295",orarr:"\u21bb",Or:"\u2a54",or:"\u2228",ord:"\u2a5d",order:"\u2134",orderof:"\u2134",ordf:"\xaa",ordm:"\xba",origof:"\u22b6",oror:"\u2a56",orslope:"\u2a57",orv:"\u2a5b",oS:"\u24c8",Oscr:"\ud835\udcaa",oscr:"\u2134",Oslash:"\xd8",oslash:"\xf8",osol:"\u2298",Otilde:"\xd5",otilde:"\xf5",otimesas:"\u2a36",Otimes:"\u2a37",otimes:"\u2297",Ouml:"\xd6",ouml:"\xf6",ovbar:"\u233d",OverBar:"\u203e",OverBrace:"\u23de",OverBracket:"\u23b4",OverParenthesis:"\u23dc",para:"\xb6",parallel:"\u2225",par:"\u2225",parsim:"\u2af3",parsl:"\u2afd",part:"\u2202",PartialD:"\u2202",Pcy:"\u041f",pcy:"\u043f",percnt:"%",period:".",permil:"\u2030",perp:"\u22a5",pertenk:"\u2031",Pfr:"\ud835\udd13",pfr:"\ud835\udd2d",Phi:"\u03a6",phi:"\u03c6",phiv:"\u03d5",phmmat:"\u2133",phone:"\u260e",Pi:"\u03a0",pi:"\u03c0",pitchfork:"\u22d4",piv:"\u03d6",planck:"\u210f",planckh:"\u210e",plankv:"\u210f",plusacir:"\u2a23",plusb:"\u229e",pluscir:"\u2a22",plus:"+",plusdo:"\u2214",plusdu:"\u2a25",pluse:"\u2a72",PlusMinus:"\xb1",plusmn:"\xb1",plussim:"\u2a26",plustwo:"\u2a27",pm:"\xb1",Poincareplane:"\u210c",pointint:"\u2a15",popf:"\ud835\udd61",Popf:"\u2119",pound:"\xa3",prap:"\u2ab7",Pr:"\u2abb",pr:"\u227a",prcue:"\u227c",precapprox:"\u2ab7",prec:"\u227a",preccurlyeq:"\u227c",Precedes:"\u227a",PrecedesEqual:"\u2aaf",PrecedesSlantEqual:"\u227c",PrecedesTilde:"\u227e",preceq:"\u2aaf",precnapprox:"\u2ab9",precneqq:"\u2ab5",precnsim:"\u22e8",pre:"\u2aaf",prE:"\u2ab3",precsim:"\u227e",prime:"\u2032",Prime:"\u2033",primes:"\u2119",prnap:"\u2ab9",prnE:"\u2ab5",prnsim:"\u22e8",prod:"\u220f",Product:"\u220f",profalar:"\u232e",profline:"\u2312",profsurf:"\u2313",prop:"\u221d",Proportional:"\u221d",Proportion:"\u2237",propto:"\u221d",prsim:"\u227e",prurel:"\u22b0",Pscr:"\ud835\udcab",pscr:"\ud835\udcc5",Psi:"\u03a8",psi:"\u03c8",puncsp:"\u2008",Qfr:"\ud835\udd14",qfr:"\ud835\udd2e",qint:"\u2a0c",qopf:"\ud835\udd62",Qopf:"\u211a",qprime:"\u2057",Qscr:"\ud835\udcac",qscr:"\ud835\udcc6",quaternions:"\u210d",quatint:"\u2a16",quest:"?",questeq:"\u225f",quot:'"',QUOT:'"',rAarr:"\u21db",race:"\u223d\u0331",Racute:"\u0154",racute:"\u0155",radic:"\u221a",raemptyv:"\u29b3",rang:"\u27e9",Rang:"\u27eb",rangd:"\u2992",range:"\u29a5",rangle:"\u27e9",raquo:"\xbb",rarrap:"\u2975",rarrb:"\u21e5",rarrbfs:"\u2920",rarrc:"\u2933",rarr:"\u2192",Rarr:"\u21a0",rArr:"\u21d2",rarrfs:"\u291e",rarrhk:"\u21aa",rarrlp:"\u21ac",rarrpl:"\u2945",rarrsim:"\u2974",Rarrtl:"\u2916",rarrtl:"\u21a3",rarrw:"\u219d",ratail:"\u291a",rAtail:"\u291c",ratio:"\u2236",rationals:"\u211a",rbarr:"\u290d",rBarr:"\u290f",RBarr:"\u2910",rbbrk:"\u2773",rbrace:"}",rbrack:"]",rbrke:"\u298c",rbrksld:"\u298e",rbrkslu:"\u2990",Rcaron:"\u0158",rcaron:"\u0159",Rcedil:"\u0156",rcedil:"\u0157",rceil:"\u2309",rcub:"}",Rcy:"\u0420",rcy:"\u0440",rdca:"\u2937",rdldhar:"\u2969",rdquo:"\u201d",rdquor:"\u201d",rdsh:"\u21b3",real:"\u211c",realine:"\u211b",realpart:"\u211c",reals:"\u211d",Re:"\u211c",rect:"\u25ad",reg:"\xae",REG:"\xae",ReverseElement:"\u220b",ReverseEquilibrium:"\u21cb",ReverseUpEquilibrium:"\u296f",rfisht:"\u297d",rfloor:"\u230b",rfr:"\ud835\udd2f",Rfr:"\u211c",rHar:"\u2964",rhard:"\u21c1",rharu:"\u21c0",rharul:"\u296c",Rho:"\u03a1",rho:"\u03c1",rhov:"\u03f1",RightAngleBracket:"\u27e9",RightArrowBar:"\u21e5",rightarrow:"\u2192",RightArrow:"\u2192",Rightarrow:"\u21d2",RightArrowLeftArrow:"\u21c4",rightarrowtail:"\u21a3",RightCeiling:"\u2309",RightDoubleBracket:"\u27e7",RightDownTeeVector:"\u295d",RightDownVectorBar:"\u2955",RightDownVector:"\u21c2",RightFloor:"\u230b",rightharpoondown:"\u21c1",rightharpoonup:"\u21c0",rightleftarrows:"\u21c4",rightleftharpoons:"\u21cc",rightrightarrows:"\u21c9",rightsquigarrow:"\u219d",RightTeeArrow:"\u21a6",RightTee:"\u22a2",RightTeeVector:"\u295b",rightthreetimes:"\u22cc",RightTriangleBar:"\u29d0",RightTriangle:"\u22b3",RightTriangleEqual:"\u22b5",RightUpDownVector:"\u294f",RightUpTeeVector:"\u295c",RightUpVectorBar:"\u2954",RightUpVector:"\u21be",RightVectorBar:"\u2953",RightVector:"\u21c0",ring:"\u02da",risingdotseq:"\u2253",rlarr:"\u21c4",rlhar:"\u21cc",rlm:"\u200f",rmoustache:"\u23b1",rmoust:"\u23b1",rnmid:"\u2aee",roang:"\u27ed",roarr:"\u21fe",robrk:"\u27e7",ropar:"\u2986",ropf:"\ud835\udd63",Ropf:"\u211d",roplus:"\u2a2e",rotimes:"\u2a35",RoundImplies:"\u2970",rpar:")",rpargt:"\u2994",rppolint:"\u2a12",rrarr:"\u21c9",Rrightarrow:"\u21db",rsaquo:"\u203a",rscr:"\ud835\udcc7",Rscr:"\u211b",rsh:"\u21b1",Rsh:"\u21b1",rsqb:"]",rsquo:"\u2019",rsquor:"\u2019",rthree:"\u22cc",rtimes:"\u22ca",rtri:"\u25b9",rtrie:"\u22b5",rtrif:"\u25b8",rtriltri:"\u29ce",RuleDelayed:"\u29f4",ruluhar:"\u2968",rx:"\u211e",Sacute:"\u015a",sacute:"\u015b",sbquo:"\u201a",scap:"\u2ab8",Scaron:"\u0160",scaron:"\u0161",Sc:"\u2abc",sc:"\u227b",sccue:"\u227d",sce:"\u2ab0",scE:"\u2ab4",Scedil:"\u015e",scedil:"\u015f",Scirc:"\u015c",scirc:"\u015d",scnap:"\u2aba",scnE:"\u2ab6",scnsim:"\u22e9",scpolint:"\u2a13",scsim:"\u227f",Scy:"\u0421",scy:"\u0441",sdotb:"\u22a1",sdot:"\u22c5",sdote:"\u2a66",searhk:"\u2925",searr:"\u2198",seArr:"\u21d8",searrow:"\u2198",sect:"\xa7",semi:";",seswar:"\u2929",setminus:"\u2216",setmn:"\u2216",sext:"\u2736",Sfr:"\ud835\udd16",sfr:"\ud835\udd30",sfrown:"\u2322",sharp:"\u266f",SHCHcy:"\u0429",shchcy:"\u0449",SHcy:"\u0428",shcy:"\u0448",ShortDownArrow:"\u2193",ShortLeftArrow:"\u2190",shortmid:"\u2223",shortparallel:"\u2225",ShortRightArrow:"\u2192",ShortUpArrow:"\u2191",shy:"\xad",Sigma:"\u03a3",sigma:"\u03c3",sigmaf:"\u03c2",sigmav:"\u03c2",sim:"\u223c",simdot:"\u2a6a",sime:"\u2243",simeq:"\u2243",simg:"\u2a9e",simgE:"\u2aa0",siml:"\u2a9d",simlE:"\u2a9f",simne:"\u2246",simplus:"\u2a24",simrarr:"\u2972",slarr:"\u2190",SmallCircle:"\u2218",smallsetminus:"\u2216",smashp:"\u2a33",smeparsl:"\u29e4",smid:"\u2223",smile:"\u2323",smt:"\u2aaa",smte:"\u2aac",smtes:"\u2aac\ufe00",SOFTcy:"\u042c",softcy:"\u044c",solbar:"\u233f",solb:"\u29c4",sol:"/",Sopf:"\ud835\udd4a",sopf:"\ud835\udd64",spades:"\u2660",spadesuit:"\u2660",spar:"\u2225",sqcap:"\u2293",sqcaps:"\u2293\ufe00",sqcup:"\u2294",sqcups:"\u2294\ufe00",Sqrt:"\u221a",sqsub:"\u228f",sqsube:"\u2291",sqsubset:"\u228f",sqsubseteq:"\u2291",sqsup:"\u2290",sqsupe:"\u2292",sqsupset:"\u2290",sqsupseteq:"\u2292",square:"\u25a1",Square:"\u25a1",SquareIntersection:"\u2293",SquareSubset:"\u228f",SquareSubsetEqual:"\u2291",SquareSuperset:"\u2290",SquareSupersetEqual:"\u2292",SquareUnion:"\u2294",squarf:"\u25aa",squ:"\u25a1",squf:"\u25aa",srarr:"\u2192",Sscr:"\ud835\udcae",sscr:"\ud835\udcc8",ssetmn:"\u2216",ssmile:"\u2323",sstarf:"\u22c6",Star:"\u22c6",star:"\u2606",starf:"\u2605",straightepsilon:"\u03f5",straightphi:"\u03d5",strns:"\xaf",sub:"\u2282",Sub:"\u22d0",subdot:"\u2abd",subE:"\u2ac5",sube:"\u2286",subedot:"\u2ac3",submult:"\u2ac1",subnE:"\u2acb",subne:"\u228a",subplus:"\u2abf",subrarr:"\u2979",subset:"\u2282",Subset:"\u22d0",subseteq:"\u2286",subseteqq:"\u2ac5",SubsetEqual:"\u2286",subsetneq:"\u228a",subsetneqq:"\u2acb",subsim:"\u2ac7",subsub:"\u2ad5",subsup:"\u2ad3",succapprox:"\u2ab8",succ:"\u227b",succcurlyeq:"\u227d",Succeeds:"\u227b",SucceedsEqual:"\u2ab0",SucceedsSlantEqual:"\u227d",SucceedsTilde:"\u227f",succeq:"\u2ab0",succnapprox:"\u2aba",succneqq:"\u2ab6",succnsim:"\u22e9",succsim:"\u227f",SuchThat:"\u220b",sum:"\u2211",Sum:"\u2211",sung:"\u266a",sup1:"\xb9",sup2:"\xb2",sup3:"\xb3",sup:"\u2283",Sup:"\u22d1",supdot:"\u2abe",supdsub:"\u2ad8",supE:"\u2ac6",supe:"\u2287",supedot:"\u2ac4",Superset:"\u2283",SupersetEqual:"\u2287",suphsol:"\u27c9",suphsub:"\u2ad7",suplarr:"\u297b",supmult:"\u2ac2",supnE:"\u2acc",supne:"\u228b",supplus:"\u2ac0",supset:"\u2283",Supset:"\u22d1",supseteq:"\u2287",supseteqq:"\u2ac6",supsetneq:"\u228b",supsetneqq:"\u2acc",supsim:"\u2ac8",supsub:"\u2ad4",supsup:"\u2ad6",swarhk:"\u2926",swarr:"\u2199",swArr:"\u21d9",swarrow:"\u2199",swnwar:"\u292a",szlig:"\xdf",Tab:"\t",target:"\u2316",Tau:"\u03a4",tau:"\u03c4",tbrk:"\u23b4",Tcaron:"\u0164",tcaron:"\u0165",Tcedil:"\u0162",tcedil:"\u0163",Tcy:"\u0422",tcy:"\u0442",tdot:"\u20db",telrec:"\u2315",Tfr:"\ud835\udd17",tfr:"\ud835\udd31",there4:"\u2234",therefore:"\u2234",Therefore:"\u2234",Theta:"\u0398",theta:"\u03b8",thetasym:"\u03d1",thetav:"\u03d1",thickapprox:"\u2248",thicksim:"\u223c",ThickSpace:"\u205f\u200a",ThinSpace:"\u2009",thinsp:"\u2009",thkap:"\u2248",thksim:"\u223c",THORN:"\xde",thorn:"\xfe",tilde:"\u02dc",Tilde:"\u223c",TildeEqual:"\u2243",TildeFullEqual:"\u2245",TildeTilde:"\u2248",timesbar:"\u2a31",timesb:"\u22a0",times:"\xd7",timesd:"\u2a30",tint:"\u222d",toea:"\u2928",topbot:"\u2336",topcir:"\u2af1",top:"\u22a4",Topf:"\ud835\udd4b",topf:"\ud835\udd65",topfork:"\u2ada",tosa:"\u2929",tprime:"\u2034",trade:"\u2122",TRADE:"\u2122",triangle:"\u25b5",triangledown:"\u25bf",triangleleft:"\u25c3",trianglelefteq:"\u22b4",triangleq:"\u225c",triangleright:"\u25b9",trianglerighteq:"\u22b5",tridot:"\u25ec",trie:"\u225c",triminus:"\u2a3a",TripleDot:"\u20db",triplus:"\u2a39",trisb:"\u29cd",tritime:"\u2a3b",trpezium:"\u23e2",Tscr:"\ud835\udcaf",tscr:"\ud835\udcc9",TScy:"\u0426",tscy:"\u0446",TSHcy:"\u040b",tshcy:"\u045b",Tstrok:"\u0166",tstrok:"\u0167",twixt:"\u226c",twoheadleftarrow:"\u219e",twoheadrightarrow:"\u21a0",Uacute:"\xda",uacute:"\xfa",uarr:"\u2191",Uarr:"\u219f",uArr:"\u21d1",Uarrocir:"\u2949",Ubrcy:"\u040e",ubrcy:"\u045e",Ubreve:"\u016c",ubreve:"\u016d",Ucirc:"\xdb",ucirc:"\xfb",Ucy:"\u0423",ucy:"\u0443",udarr:"\u21c5",Udblac:"\u0170",udblac:"\u0171",udhar:"\u296e",ufisht:"\u297e",Ufr:"\ud835\udd18",ufr:"\ud835\udd32",Ugrave:"\xd9",ugrave:"\xf9",uHar:"\u2963",uharl:"\u21bf",uharr:"\u21be",uhblk:"\u2580",ulcorn:"\u231c",ulcorner:"\u231c",ulcrop:"\u230f",ultri:"\u25f8",Umacr:"\u016a",umacr:"\u016b",uml:"\xa8",UnderBar:"_",UnderBrace:"\u23df",UnderBracket:"\u23b5",UnderParenthesis:"\u23dd",Union:"\u22c3",UnionPlus:"\u228e",Uogon:"\u0172",uogon:"\u0173",Uopf:"\ud835\udd4c",uopf:"\ud835\udd66",UpArrowBar:"\u2912",uparrow:"\u2191",UpArrow:"\u2191",Uparrow:"\u21d1",UpArrowDownArrow:"\u21c5",updownarrow:"\u2195",UpDownArrow:"\u2195",Updownarrow:"\u21d5",UpEquilibrium:"\u296e",upharpoonleft:"\u21bf",upharpoonright:"\u21be",uplus:"\u228e",UpperLeftArrow:"\u2196",UpperRightArrow:"\u2197",upsi:"\u03c5",Upsi:"\u03d2",upsih:"\u03d2",Upsilon:"\u03a5",upsilon:"\u03c5",UpTeeArrow:"\u21a5",UpTee:"\u22a5",upuparrows:"\u21c8",urcorn:"\u231d",urcorner:"\u231d",urcrop:"\u230e",Uring:"\u016e",uring:"\u016f",urtri:"\u25f9",Uscr:"\ud835\udcb0",uscr:"\ud835\udcca",utdot:"\u22f0",Utilde:"\u0168",utilde:"\u0169",utri:"\u25b5",utrif:"\u25b4",uuarr:"\u21c8",Uuml:"\xdc",uuml:"\xfc",uwangle:"\u29a7",vangrt:"\u299c",varepsilon:"\u03f5",varkappa:"\u03f0",varnothing:"\u2205",varphi:"\u03d5",varpi:"\u03d6",varpropto:"\u221d",varr:"\u2195",vArr:"\u21d5",varrho:"\u03f1",varsigma:"\u03c2",varsubsetneq:"\u228a\ufe00",varsubsetneqq:"\u2acb\ufe00",varsupsetneq:"\u228b\ufe00",varsupsetneqq:"\u2acc\ufe00",vartheta:"\u03d1",vartriangleleft:"\u22b2",vartriangleright:"\u22b3",vBar:"\u2ae8",Vbar:"\u2aeb",vBarv:"\u2ae9",Vcy:"\u0412",vcy:"\u0432",vdash:"\u22a2",vDash:"\u22a8",Vdash:"\u22a9",VDash:"\u22ab",Vdashl:"\u2ae6",veebar:"\u22bb",vee:"\u2228",Vee:"\u22c1",veeeq:"\u225a",vellip:"\u22ee",verbar:"|",Verbar:"\u2016",vert:"|",Vert:"\u2016",VerticalBar:"\u2223",VerticalLine:"|",VerticalSeparator:"\u2758",VerticalTilde:"\u2240",VeryThinSpace:"\u200a",Vfr:"\ud835\udd19",vfr:"\ud835\udd33",vltri:"\u22b2",vnsub:"\u2282\u20d2",vnsup:"\u2283\u20d2",Vopf:"\ud835\udd4d",vopf:"\ud835\udd67",vprop:"\u221d",vrtri:"\u22b3",Vscr:"\ud835\udcb1",vscr:"\ud835\udccb",vsubnE:"\u2acb\ufe00",vsubne:"\u228a\ufe00",vsupnE:"\u2acc\ufe00",vsupne:"\u228b\ufe00",Vvdash:"\u22aa",vzigzag:"\u299a",Wcirc:"\u0174",wcirc:"\u0175",wedbar:"\u2a5f",wedge:"\u2227",Wedge:"\u22c0",wedgeq:"\u2259",weierp:"\u2118",Wfr:"\ud835\udd1a",wfr:"\ud835\udd34",Wopf:"\ud835\udd4e",wopf:"\ud835\udd68",wp:"\u2118",wr:"\u2240",wreath:"\u2240",Wscr:"\ud835\udcb2",wscr:"\ud835\udccc",xcap:"\u22c2",xcirc:"\u25ef",xcup:"\u22c3",xdtri:"\u25bd",Xfr:"\ud835\udd1b",xfr:"\ud835\udd35",xharr:"\u27f7",xhArr:"\u27fa",Xi:"\u039e",xi:"\u03be",xlarr:"\u27f5",xlArr:"\u27f8",xmap:"\u27fc",xnis:"\u22fb",xodot:"\u2a00",Xopf:"\ud835\udd4f",xopf:"\ud835\udd69",xoplus:"\u2a01",xotime:"\u2a02",xrarr:"\u27f6",xrArr:"\u27f9",Xscr:"\ud835\udcb3",xscr:"\ud835\udccd",xsqcup:"\u2a06",xuplus:"\u2a04",xutri:"\u25b3",xvee:"\u22c1",xwedge:"\u22c0",Yacute:"\xdd",yacute:"\xfd",YAcy:"\u042f",yacy:"\u044f",Ycirc:"\u0176",ycirc:"\u0177",Ycy:"\u042b",ycy:"\u044b",yen:"\xa5",Yfr:"\ud835\udd1c",yfr:"\ud835\udd36",YIcy:"\u0407",yicy:"\u0457",Yopf:"\ud835\udd50",yopf:"\ud835\udd6a",Yscr:"\ud835\udcb4",yscr:"\ud835\udcce",YUcy:"\u042e",yucy:"\u044e",yuml:"\xff",Yuml:"\u0178",Zacute:"\u0179",zacute:"\u017a",Zcaron:"\u017d",zcaron:"\u017e",Zcy:"\u0417",zcy:"\u0437",Zdot:"\u017b",zdot:"\u017c",zeetrf:"\u2128",ZeroWidthSpace:"\u200b",Zeta:"\u0396",zeta:"\u03b6",zfr:"\ud835\udd37",Zfr:"\u2128",ZHcy:"\u0416",zhcy:"\u0436",zigrarr:"\u21dd",zopf:"\ud835\udd6b",Zopf:"\u2124",Zscr:"\ud835\udcb5",zscr:"\ud835\udccf",zwj:"\u200d",zwnj:"\u200c"},t=/[!-#%-\*,-\/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0A76\u0AF0\u0C84\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E4E\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD803[\uDF55-\uDF59]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC8\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDC3B\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71\uDEF7\uDEF8]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD81B[\uDE97-\uDE9A]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/,n={};function s(e,r,t){var o,i,a,c,l,u="";for("string"!=typeof r&&(t=r,r=s.defaultChars),void 0===t&&(t=!0),l=function(e){var r,t,s=n[e];if(s)return s;for(s=n[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),/^[0-9a-z]$/i.test(t)?s.push(t):s.push("%"+("0"+r.toString(16).toUpperCase()).slice(-2));for(r=0;r<e.length;r++)s[e.charCodeAt(r)]=e[r];return s}(r),o=0,i=e.length;o<i;o++)if(a=e.charCodeAt(o),t&&37===a&&o+2<i&&/^[0-9a-f]{2}$/i.test(e.slice(o+1,o+3)))u+=e.slice(o,o+3),o+=2;else if(a<128)u+=l[a];else if(a>=55296&&a<=57343){if(a>=55296&&a<=56319&&o+1<i&&(c=e.charCodeAt(o+1))>=56320&&c<=57343){u+=encodeURIComponent(e[o]+e[o+1]),o++;continue}u+="%EF%BF%BD"}else u+=encodeURIComponent(e[o]);return u}s.defaultChars=";/?:@&=+$,-_.!~*'()#",s.componentChars="-_.!~*'()";var o=s,i={};function a(e,r){var t;return"string"!=typeof r&&(r=a.defaultChars),t=function(e){var r,t,n=i[e];if(n)return n;for(n=i[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),n.push(t);for(r=0;r<e.length;r++)n[t=e.charCodeAt(r)]="%"+("0"+t.toString(16).toUpperCase()).slice(-2);return n}(r),e.replace(/(%[a-f0-9]{2})+/gi,(function(e){var r,n,s,o,i,a,c,l="";for(r=0,n=e.length;r<n;r+=3)(s=parseInt(e.slice(r+1,r+3),16))<128?l+=t[s]:192==(224&s)&&r+3<n&&128==(192&(o=parseInt(e.slice(r+4,r+6),16)))?(l+=(c=s<<6&1984|63&o)<128?"\ufffd\ufffd":String.fromCharCode(c),r+=3):224==(240&s)&&r+6<n&&(o=parseInt(e.slice(r+4,r+6),16),i=parseInt(e.slice(r+7,r+9),16),128==(192&o)&&128==(192&i))?(l+=(c=s<<12&61440|o<<6&4032|63&i)<2048||c>=55296&&c<=57343?"\ufffd\ufffd\ufffd":String.fromCharCode(c),r+=6):240==(248&s)&&r+9<n&&(o=parseInt(e.slice(r+4,r+6),16),i=parseInt(e.slice(r+7,r+9),16),a=parseInt(e.slice(r+10,r+12),16),128==(192&o)&&128==(192&i)&&128==(192&a))?((c=s<<18&1835008|o<<12&258048|i<<6&4032|63&a)<65536||c>1114111?l+="\ufffd\ufffd\ufffd\ufffd":(c-=65536,l+=String.fromCharCode(55296+(c>>10),56320+(1023&c))),r+=9):l+="\ufffd";return l}))}a.defaultChars=";/?:@&=+$,#",a.componentChars="";var c=a;function l(){this.protocol=null,this.slashes=null,this.auth=null,this.port=null,this.hostname=null,this.hash=null,this.search=null,this.pathname=null}var u=/^([a-z0-9.+-]+:)/i,p=/:[0-9]*$/,h=/^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/,f=["{","}","|","\\","^","`"].concat(["<",">",'"',"`"," ","\r","\n","\t"]),d=["'"].concat(f),m=["%","/","?",";","#"].concat(d),g=["/","?","#"],_=/^[+a-z0-9A-Z_-]{0,63}$/,k=/^([+a-z0-9A-Z_-]{0,63})(.*)$/,b={javascript:!0,"javascript:":!0},v={http:!0,https:!0,ftp:!0,gopher:!0,file:!0,"http:":!0,"https:":!0,"ftp:":!0,"gopher:":!0,"file:":!0};l.prototype.parse=function(e,r){var t,n,s,o,i,a=e;if(a=a.trim(),!r&&1===e.split("#").length){var c=h.exec(a);if(c)return this.pathname=c[1],c[2]&&(this.search=c[2]),this}var l=u.exec(a);if(l&&(s=(l=l[0]).toLowerCase(),this.protocol=l,a=a.substr(l.length)),(r||l||a.match(/^\/\/[^@\/]+@[^@\/]+/))&&(!(i="//"===a.substr(0,2))||l&&b[l]||(a=a.substr(2),this.slashes=!0)),!b[l]&&(i||l&&!v[l])){var p,f,d=-1;for(t=0;t<g.length;t++)-1!==(o=a.indexOf(g[t]))&&(-1===d||o<d)&&(d=o);for(-1!==(f=-1===d?a.lastIndexOf("@"):a.lastIndexOf("@",d))&&(p=a.slice(0,f),a=a.slice(f+1),this.auth=p),d=-1,t=0;t<m.length;t++)-1!==(o=a.indexOf(m[t]))&&(-1===d||o<d)&&(d=o);-1===d&&(d=a.length),":"===a[d-1]&&d--;var C=a.slice(0,d);a=a.slice(d),this.parseHost(C),this.hostname=this.hostname||"";var y="["===this.hostname[0]&&"]"===this.hostname[this.hostname.length-1];if(!y){var A=this.hostname.split(/\./);for(t=0,n=A.length;t<n;t++){var x=A[t];if(x&&!x.match(_)){for(var D="",w=0,E=x.length;w<E;w++)x.charCodeAt(w)>127?D+="x":D+=x[w];if(!D.match(_)){var q=A.slice(0,t),S=A.slice(t+1),F=x.match(k);F&&(q.push(F[1]),S.unshift(F[2])),S.length&&(a=S.join(".")+a),this.hostname=q.join(".");break}}}}this.hostname.length>255&&(this.hostname=""),y&&(this.hostname=this.hostname.substr(1,this.hostname.length-2))}var L=a.indexOf("#");-1!==L&&(this.hash=a.substr(L),a=a.slice(0,L));var z=a.indexOf("?");return-1!==z&&(this.search=a.substr(z),a=a.slice(0,z)),a&&(this.pathname=a),v[s]&&this.hostname&&!this.pathname&&(this.pathname=""),this},l.prototype.parseHost=function(e){var r=p.exec(e);r&&(":"!==(r=r[0])&&(this.port=r.substr(1)),e=e.substr(0,e.length-r.length)),e&&(this.hostname=e)};var C={encode:o,decode:c,format:function(e){var r="";return r+=e.protocol||"",r+=e.slashes?"//":"",r+=e.auth?e.auth+"@":"",e.hostname&&-1!==e.hostname.indexOf(":")?r+="["+e.hostname+"]":r+=e.hostname||"",r+=e.port?":"+e.port:"",r+=e.pathname||"",r+=e.search||"",r+=e.hash||""},parse:function(e,r){if(e&&e instanceof l)return e;var t=new l;return t.parse(e,r),t}},y=/[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/,A=/[\0-\x1F\x7F-\x9F]/,x=/[ \xA0\u1680\u2000-\u200A\u2028\u2029\u202F\u205F\u3000]/,D={Any:y,Cc:A,Cf:/[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804[\uDCBD\uDCCD]|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/,P:t,Z:x},w=function(e,r,t){return t={path:r,exports:{},require:function(e,r){return function(){throw new Error("Dynamic requires are not currently supported by @rollup/plugin-commonjs")}(null==r&&t.path)}},e(t,t.exports),t.exports}((function(e,n){var s=Object.prototype.hasOwnProperty;function o(e,r){return s.call(e,r)}function i(e){return!(e>=55296&&e<=57343)&&(!(e>=64976&&e<=65007)&&(65535!=(65535&e)&&65534!=(65535&e)&&(!(e>=0&&e<=8)&&(11!==e&&(!(e>=14&&e<=31)&&(!(e>=127&&e<=159)&&!(e>1114111)))))))}function a(e){if(e>65535){var r=55296+((e-=65536)>>10),t=56320+(1023&e);return String.fromCharCode(r,t)}return String.fromCharCode(e)}var c=/\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g,l=new RegExp(c.source+"|"+/&([a-z#][a-z0-9]{1,31});/gi.source,"gi"),u=/^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i;var p=/[&<>"]/,h=/[&<>"]/g,f={"&":"&amp;","<":"&lt;",">":"&gt;",'"':"&quot;"};function d(e){return f[e]}var m=/[.?*+^$[\]\\(){}|-]/g;n.lib={},n.lib.mdurl=C,n.lib.ucmicro=D,n.assign=function(e){var r=Array.prototype.slice.call(arguments,1);return r.forEach((function(r){if(r){if("object"!=typeof r)throw new TypeError(r+"must be object");Object.keys(r).forEach((function(t){e[t]=r[t]}))}})),e},n.isString=function(e){return"[object String]"===function(e){return Object.prototype.toString.call(e)}(e)},n.has=o,n.unescapeMd=function(e){return e.indexOf("\\")<0?e:e.replace(c,"$1")},n.unescapeAll=function(e){return e.indexOf("\\")<0&&e.indexOf("&")<0?e:e.replace(l,(function(e,t,n){return t||function(e,t){var n=0;return o(r,t)?r[t]:35===t.charCodeAt(0)&&u.test(t)&&i(n="x"===t[1].toLowerCase()?parseInt(t.slice(2),16):parseInt(t.slice(1),10))?a(n):e}(e,n)}))},n.isValidEntityCode=i,n.fromCodePoint=a,n.escapeHtml=function(e){return p.test(e)?e.replace(h,d):e},n.arrayReplaceAt=function(e,r,t){return[].concat(e.slice(0,r),t,e.slice(r+1))},n.isSpace=function(e){switch(e){case 9:case 32:return!0}return!1},n.isWhiteSpace=function(e){if(e>=8192&&e<=8202)return!0;switch(e){case 9:case 10:case 11:case 12:case 13:case 32:case 160:case 5760:case 8239:case 8287:case 12288:return!0}return!1},n.isMdAsciiPunct=function(e){switch(e){case 33:case 34:case 35:case 36:case 37:case 38:case 39:case 40:case 41:case 42:case 43:case 44:case 45:case 46:case 47:case 58:case 59:case 60:case 61:case 62:case 63:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 124:case 125:case 126:return!0;default:return!1}},n.isPunctChar=function(e){return t.test(e)},n.escapeRE=function(e){return e.replace(m,"\\$&")},n.normalizeReference=function(e){return e=e.trim().replace(/\s+/g," "),"\u1e7e"==="\u1e9e".toLowerCase()&&(e=e.replace(/\u1e9e/g,"\xdf")),e.toLowerCase().toUpperCase()}})),E=w.unescapeAll,q=w.unescapeAll,S=function(e,r,t){var n,s,o=r,i={ok:!1,pos:0,lines:0,str:""};if(60===e.charCodeAt(r)){for(r++;r<t;){if(10===(n=e.charCodeAt(r)))return i;if(60===n)return i;if(62===n)return i.pos=r+1,i.str=E(e.slice(o+1,r)),i.ok=!0,i;92===n&&r+1<t?r+=2:r++}return i}for(s=0;r<t&&32!==(n=e.charCodeAt(r))&&!(n<32||127===n);)if(92===n&&r+1<t){if(32===e.charCodeAt(r+1))break;r+=2}else{if(40===n&&++s>32)return i;if(41===n){if(0===s)break;s--}r++}return o===r||0!==s||(i.str=E(e.slice(o,r)),i.lines=0,i.pos=r,i.ok=!0),i},F=function(e,r,t){var n,s,o=0,i=r,a={ok:!1,pos:0,lines:0,str:""};if(r>=t)return a;if(34!==(s=e.charCodeAt(r))&&39!==s&&40!==s)return a;for(r++,40===s&&(s=41);r<t;){if((n=e.charCodeAt(r))===s)return a.pos=r+1,a.lines=o,a.str=q(e.slice(i+1,r)),a.ok=!0,a;if(40===n&&41===s)return a;10===n?o++:92===n&&r+1<t&&(r++,10===e.charCodeAt(r)&&o++),r++}return a},L={parseLinkLabel:function(e,r,t){var n,s,o,i,a=-1,c=e.posMax,l=e.pos;for(e.pos=r+1,n=1;e.pos<c;){if(93===(o=e.src.charCodeAt(e.pos))&&0===--n){s=!0;break}if(i=e.pos,e.md.inline.skipToken(e),91===o)if(i===e.pos-1)n++;else if(t)return e.pos=l,-1}return s&&(a=e.pos),e.pos=l,a},parseLinkDestination:S,parseLinkTitle:F},z=w.assign,T=w.unescapeAll,I=w.escapeHtml,M={};function R(){this.rules=z({},M)}M.code_inline=function(e,r,t,n,s){var o=e[r];return"<code"+s.renderAttrs(o)+">"+I(e[r].content)+"</code>"},M.code_block=function(e,r,t,n,s){var o=e[r];return"<pre"+s.renderAttrs(o)+"><code>"+I(e[r].content)+"</code></pre>\n"},M.fence=function(e,r,t,n,s){var o,i,a,c,l,u=e[r],p=u.info?T(u.info).trim():"",h="",f="";return p&&(h=(a=p.split(/(\s+)/g))[0],f=a.slice(2).join("")),0===(o=t.highlight&&t.highlight(u.content,h,f)||I(u.content)).indexOf("<pre")?o+"\n":p?(i=u.attrIndex("class"),c=u.attrs?u.attrs.slice():[],i<0?c.push(["class",t.langPrefix+h]):(c[i]=c[i].slice(),c[i][1]+=" "+t.langPrefix+h),l={attrs:c},"<pre><code"+s.renderAttrs(l)+">"+o+"</code></pre>\n"):"<pre><code"+s.renderAttrs(u)+">"+o+"</code></pre>\n"},M.image=function(e,r,t,n,s){var o=e[r];return o.attrs[o.attrIndex("alt")][1]=s.renderInlineAsText(o.children,t,n),s.renderToken(e,r,t)},M.hardbreak=function(e,r,t){return t.xhtmlOut?"<br />\n":"<br>\n"},M.softbreak=function(e,r,t){return t.breaks?t.xhtmlOut?"<br />\n":"<br>\n":"\n"},M.text=function(e,r){return I(e[r].content)},M.html_block=function(e,r){return e[r].content},M.html_inline=function(e,r){return e[r].content},R.prototype.renderAttrs=function(e){var r,t,n;if(!e.attrs)return"";for(n="",r=0,t=e.attrs.length;r<t;r++)n+=" "+I(e.attrs[r][0])+'="'+I(e.attrs[r][1])+'"';return n},R.prototype.renderToken=function(e,r,t){var n,s="",o=!1,i=e[r];return i.hidden?"":(i.block&&-1!==i.nesting&&r&&e[r-1].hidden&&(s+="\n"),s+=(-1===i.nesting?"</":"<")+i.tag,s+=this.renderAttrs(i),0===i.nesting&&t.xhtmlOut&&(s+=" /"),i.block&&(o=!0,1===i.nesting&&r+1<e.length&&("inline"===(n=e[r+1]).type||n.hidden||-1===n.nesting&&n.tag===i.tag)&&(o=!1)),s+=o?">\n":">")},R.prototype.renderInline=function(e,r,t){for(var n,s="",o=this.rules,i=0,a=e.length;i<a;i++)void 0!==o[n=e[i].type]?s+=o[n](e,i,r,t,this):s+=this.renderToken(e,i,r);return s},R.prototype.renderInlineAsText=function(e,r,t){for(var n="",s=0,o=e.length;s<o;s++)"text"===e[s].type?n+=e[s].content:"image"===e[s].type?n+=this.renderInlineAsText(e[s].children,r,t):"softbreak"===e[s].type&&(n+="\n");return n},R.prototype.render=function(e,r,t){var n,s,o,i="",a=this.rules;for(n=0,s=e.length;n<s;n++)"inline"===(o=e[n].type)?i+=this.renderInline(e[n].children,r,t):void 0!==a[o]?i+=a[e[n].type](e,n,r,t,this):i+=this.renderToken(e,n,r,t);return i};var B=R;function N(){this.__rules__=[],this.__cache__=null}N.prototype.__find__=function(e){for(var r=0;r<this.__rules__.length;r++)if(this.__rules__[r].name===e)return r;return-1},N.prototype.__compile__=function(){var e=this,r=[""];e.__rules__.forEach((function(e){e.enabled&&e.alt.forEach((function(e){r.indexOf(e)<0&&r.push(e)}))})),e.__cache__={},r.forEach((function(r){e.__cache__[r]=[],e.__rules__.forEach((function(t){t.enabled&&(r&&t.alt.indexOf(r)<0||e.__cache__[r].push(t.fn))}))}))},N.prototype.at=function(e,r,t){var n=this.__find__(e),s=t||{};if(-1===n)throw new Error("Parser rule not found: "+e);this.__rules__[n].fn=r,this.__rules__[n].alt=s.alt||[],this.__cache__=null},N.prototype.before=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},N.prototype.after=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s+1,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},N.prototype.push=function(e,r,t){var n=t||{};this.__rules__.push({name:e,enabled:!0,fn:r,alt:n.alt||[]}),this.__cache__=null},N.prototype.enable=function(e,r){Array.isArray(e)||(e=[e]);var t=[];return e.forEach((function(e){var n=this.__find__(e);if(n<0){if(r)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[n].enabled=!0,t.push(e)}),this),this.__cache__=null,t},N.prototype.enableOnly=function(e,r){Array.isArray(e)||(e=[e]),this.__rules__.forEach((function(e){e.enabled=!1})),this.enable(e,r)},N.prototype.disable=function(e,r){Array.isArray(e)||(e=[e]);var t=[];return e.forEach((function(e){var n=this.__find__(e);if(n<0){if(r)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[n].enabled=!1,t.push(e)}),this),this.__cache__=null,t},N.prototype.getRules=function(e){return null===this.__cache__&&this.__compile__(),this.__cache__[e]||[]};var O=N,P=/\r\n?|\n/g,j=/\0/g,U=w.arrayReplaceAt;function V(e){return/^<\/a\s*>/i.test(e)}var Z=/\+-|\.\.|\?\?\?\?|!!!!|,,|--/,G=/\((c|tm|r|p)\)/i,$=/\((c|tm|r|p)\)/gi,H={c:"\xa9",r:"\xae",p:"\xa7",tm:"\u2122"};function J(e,r){return H[r.toLowerCase()]}function W(e){var r,t,n=0;for(r=e.length-1;r>=0;r--)"text"!==(t=e[r]).type||n||(t.content=t.content.replace($,J)),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}function Y(e){var r,t,n=0;for(r=e.length-1;r>=0;r--)"text"!==(t=e[r]).type||n||Z.test(t.content)&&(t.content=t.content.replace(/\+-/g,"\xb1").replace(/\.{2,}/g,"\u2026").replace(/([?!])\u2026/g,"$1..").replace(/([?!]){4,}/g,"$1$1$1").replace(/,{2,}/g,",").replace(/(^|[^-])---(?=[^-]|$)/gm,"$1\u2014").replace(/(^|\s)--(?=\s|$)/gm,"$1\u2013").replace(/(^|[^-\s])--(?=[^-\s]|$)/gm,"$1\u2013")),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}var K=w.isWhiteSpace,Q=w.isPunctChar,X=w.isMdAsciiPunct,ee=/['"]/,re=/['"]/g;function te(e,r,t){return e.substr(0,r)+t+e.substr(r+1)}function ne(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C,y;for(v=[],t=0;t<e.length;t++){for(n=e[t],c=e[t].level,k=v.length-1;k>=0&&!(v[k].level<=c);k--);if(v.length=k+1,"text"===n.type){i=0,a=(s=n.content).length;e:for(;i<a&&(re.lastIndex=i,o=re.exec(s));){if(g=_=!0,i=o.index+1,b="'"===o[0],u=32,o.index-1>=0)u=s.charCodeAt(o.index-1);else for(k=t-1;k>=0&&("softbreak"!==e[k].type&&"hardbreak"!==e[k].type);k--)if(e[k].content){u=e[k].content.charCodeAt(e[k].content.length-1);break}if(p=32,i<a)p=s.charCodeAt(i);else for(k=t+1;k<e.length&&("softbreak"!==e[k].type&&"hardbreak"!==e[k].type);k++)if(e[k].content){p=e[k].content.charCodeAt(0);break}if(h=X(u)||Q(String.fromCharCode(u)),f=X(p)||Q(String.fromCharCode(p)),d=K(u),(m=K(p))?g=!1:f&&(d||h||(g=!1)),d?_=!1:h&&(m||f||(_=!1)),34===p&&'"'===o[0]&&u>=48&&u<=57&&(_=g=!1),g&&_&&(g=h,_=f),g||_){if(_)for(k=v.length-1;k>=0&&(l=v[k],!(v[k].level<c));k--)if(l.single===b&&v[k].level===c){l=v[k],b?(C=r.md.options.quotes[2],y=r.md.options.quotes[3]):(C=r.md.options.quotes[0],y=r.md.options.quotes[1]),n.content=te(n.content,o.index,y),e[l.token].content=te(e[l.token].content,l.pos,C),i+=y.length-1,l.token===t&&(i+=C.length-1),a=(s=n.content).length,v.length=k;continue e}g?v.push({token:t,pos:o.index,single:b,level:c}):_&&b&&(n.content=te(n.content,o.index,"\u2019"))}else b&&(n.content=te(n.content,o.index,"\u2019"))}}}}function se(e,r,t){this.type=e,this.tag=r,this.attrs=null,this.map=null,this.nesting=t,this.level=0,this.children=null,this.content="",this.markup="",this.info="",this.meta=null,this.block=!1,this.hidden=!1}se.prototype.attrIndex=function(e){var r,t,n;if(!this.attrs)return-1;for(t=0,n=(r=this.attrs).length;t<n;t++)if(r[t][0]===e)return t;return-1},se.prototype.attrPush=function(e){this.attrs?this.attrs.push(e):this.attrs=[e]},se.prototype.attrSet=function(e,r){var t=this.attrIndex(e),n=[e,r];t<0?this.attrPush(n):this.attrs[t]=n},se.prototype.attrGet=function(e){var r=this.attrIndex(e),t=null;return r>=0&&(t=this.attrs[r][1]),t},se.prototype.attrJoin=function(e,r){var t=this.attrIndex(e);t<0?this.attrPush([e,r]):this.attrs[t][1]=this.attrs[t][1]+" "+r};var oe=se;function ie(e,r,t){this.src=e,this.env=t,this.tokens=[],this.inlineMode=!1,this.md=r}ie.prototype.Token=oe;var ae=ie,ce=[["normalize",function(e){var r;r=(r=e.src.replace(P,"\n")).replace(j,"\ufffd"),e.src=r}],["block",function(e){var r;e.inlineMode?((r=new e.Token("inline","",0)).content=e.src,r.map=[0,1],r.children=[],e.tokens.push(r)):e.md.block.parse(e.src,e.md,e.env,e.tokens)}],["inline",function(e){var r,t,n,s=e.tokens;for(t=0,n=s.length;t<n;t++)"inline"===(r=s[t]).type&&e.md.inline.parse(r.content,e.md,e.env,r.children)}],["linkify",function(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b=e.tokens;if(e.md.options.linkify)for(t=0,n=b.length;t<n;t++)if("inline"===b[t].type&&e.md.linkify.pretest(b[t].content))for(f=0,r=(s=b[t].children).length-1;r>=0;r--)if("link_close"!==(i=s[r]).type){if("html_inline"===i.type&&(k=i.content,/^<a[>\s]/i.test(k)&&f>0&&f--,V(i.content)&&f++),!(f>0)&&"text"===i.type&&e.md.linkify.test(i.content)){for(l=i.content,_=e.md.linkify.match(l),a=[],h=i.level,p=0,c=0;c<_.length;c++)d=_[c].url,m=e.md.normalizeLink(d),e.md.validateLink(m)&&(g=_[c].text,g=_[c].schema?"mailto:"!==_[c].schema||/^mailto:/i.test(g)?e.md.normalizeLinkText(g):e.md.normalizeLinkText("mailto:"+g).replace(/^mailto:/,""):e.md.normalizeLinkText("http://"+g).replace(/^http:\/\//,""),(u=_[c].index)>p&&((o=new e.Token("text","",0)).content=l.slice(p,u),o.level=h,a.push(o)),(o=new e.Token("link_open","a",1)).attrs=[["href",m]],o.level=h++,o.markup="linkify",o.info="auto",a.push(o),(o=new e.Token("text","",0)).content=g,o.level=h,a.push(o),(o=new e.Token("link_close","a",-1)).level=--h,o.markup="linkify",o.info="auto",a.push(o),p=_[c].lastIndex);p<l.length&&((o=new e.Token("text","",0)).content=l.slice(p),o.level=h,a.push(o)),b[t].children=s=U(s,r,a)}}else for(r--;s[r].level!==i.level&&"link_open"!==s[r].type;)r--}],["replacements",function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;r>=0;r--)"inline"===e.tokens[r].type&&(G.test(e.tokens[r].content)&&W(e.tokens[r].children),Z.test(e.tokens[r].content)&&Y(e.tokens[r].children))}],["smartquotes",function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;r>=0;r--)"inline"===e.tokens[r].type&&ee.test(e.tokens[r].content)&&ne(e.tokens[r].children,e)}]];function le(){this.ruler=new O;for(var e=0;e<ce.length;e++)this.ruler.push(ce[e][0],ce[e][1])}le.prototype.process=function(e){var r,t,n;for(r=0,t=(n=this.ruler.getRules("")).length;r<t;r++)n[r](e)},le.prototype.State=ae;var ue=le,pe=w.isSpace;function he(e,r){var t=e.bMarks[r]+e.tShift[r],n=e.eMarks[r];return e.src.substr(t,n-t)}function fe(e){var r,t=[],n=0,s=e.length,o=!1,i=0,a="";for(r=e.charCodeAt(n);n<s;)124===r&&(o?(a+=e.substring(i,n-1),i=n):(t.push(a+e.substring(i,n)),a="",i=n+1)),o=92===r,n++,r=e.charCodeAt(n);return t.push(a+e.substring(i)),t}var de=w.isSpace,me=w.isSpace,ge=w.isSpace;function _e(e,r){var t,n,s,o;return n=e.bMarks[r]+e.tShift[r],s=e.eMarks[r],42!==(t=e.src.charCodeAt(n++))&&45!==t&&43!==t||n<s&&(o=e.src.charCodeAt(n),!ge(o))?-1:n}function ke(e,r){var t,n=e.bMarks[r]+e.tShift[r],s=n,o=e.eMarks[r];if(s+1>=o)return-1;if((t=e.src.charCodeAt(s++))<48||t>57)return-1;for(;;){if(s>=o)return-1;if(!((t=e.src.charCodeAt(s++))>=48&&t<=57)){if(41===t||46===t)break;return-1}if(s-n>=10)return-1}return s<o&&(t=e.src.charCodeAt(s),!ge(t))?-1:s}var be=w.normalizeReference,ve=w.isSpace,Ce="<[A-Za-z][A-Za-z0-9\\-]*(?:\\s+[a-zA-Z_:][a-zA-Z0-9:._-]*(?:\\s*=\\s*(?:[^\"'=<>`\\x00-\\x20]+|'[^']*'|\"[^\"]*\"))?)*\\s*\\/?>",ye="<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>",Ae={HTML_TAG_RE:new RegExp("^(?:"+Ce+"|"+ye+"|\x3c!----\x3e|\x3c!--(?:-?[^>-])(?:-?[^-])*--\x3e|<[?][\\s\\S]*?[?]>|<![A-Z]+\\s+[^>]*>|<!\\[CDATA\\[[\\s\\S]*?\\]\\]>)"),HTML_OPEN_CLOSE_TAG_RE:new RegExp("^(?:"+Ce+"|"+ye+")")},xe=Ae.HTML_OPEN_CLOSE_TAG_RE,De=[[/^<(script|pre|style|textarea)(?=(\s|>|$))/i,/<\/(script|pre|style|textarea)>/i,!0],[/^<!--/,/-->/,!0],[/^<\?/,/\?>/,!0],[/^<![A-Z]/,/>/,!0],[/^<!\[CDATA\[/,/\]\]>/,!0],[new RegExp("^</?("+["address","article","aside","base","basefont","blockquote","body","caption","center","col","colgroup","dd","details","dialog","dir","div","dl","dt","fieldset","figcaption","figure","footer","form","frame","frameset","h1","h2","h3","h4","h5","h6","head","header","hr","html","iframe","legend","li","link","main","menu","menuitem","nav","noframes","ol","optgroup","option","p","param","section","source","summary","table","tbody","td","tfoot","th","thead","title","tr","track","ul"].join("|")+")(?=(\\s|/?>|$))","i"),/^$/,!0],[new RegExp(xe.source+"\\s*$"),/^$/,!1]],we=w.isSpace,Ee=w.isSpace;function qe(e,r,t,n){var s,o,i,a,c,l,u,p;for(this.src=e,this.md=r,this.env=t,this.tokens=n,this.bMarks=[],this.eMarks=[],this.tShift=[],this.sCount=[],this.bsCount=[],this.blkIndent=0,this.line=0,this.lineMax=0,this.tight=!1,this.ddIndent=-1,this.listIndent=-1,this.parentType="root",this.level=0,this.result="",p=!1,i=a=l=u=0,c=(o=this.src).length;a<c;a++){if(s=o.charCodeAt(a),!p){if(Ee(s)){l++,9===s?u+=4-u%4:u++;continue}p=!0}10!==s&&a!==c-1||(10!==s&&a++,this.bMarks.push(i),this.eMarks.push(a),this.tShift.push(l),this.sCount.push(u),this.bsCount.push(0),p=!1,l=0,u=0,i=a+1)}this.bMarks.push(o.length),this.eMarks.push(o.length),this.tShift.push(0),this.sCount.push(0),this.bsCount.push(0),this.lineMax=this.bMarks.length-1}qe.prototype.push=function(e,r,t){var n=new oe(e,r,t);return n.block=!0,t<0&&this.level--,n.level=this.level,t>0&&this.level++,this.tokens.push(n),n},qe.prototype.isEmpty=function(e){return this.bMarks[e]+this.tShift[e]>=this.eMarks[e]},qe.prototype.skipEmptyLines=function(e){for(var r=this.lineMax;e<r&&!(this.bMarks[e]+this.tShift[e]<this.eMarks[e]);e++);return e},qe.prototype.skipSpaces=function(e){for(var r,t=this.src.length;e<t&&(r=this.src.charCodeAt(e),Ee(r));e++);return e},qe.prototype.skipSpacesBack=function(e,r){if(e<=r)return e;for(;e>r;)if(!Ee(this.src.charCodeAt(--e)))return e+1;return e},qe.prototype.skipChars=function(e,r){for(var t=this.src.length;e<t&&this.src.charCodeAt(e)===r;e++);return e},qe.prototype.skipCharsBack=function(e,r,t){if(e<=t)return e;for(;e>t;)if(r!==this.src.charCodeAt(--e))return e+1;return e},qe.prototype.getLines=function(e,r,t,n){var s,o,i,a,c,l,u,p=e;if(e>=r)return"";for(l=new Array(r-e),s=0;p<r;p++,s++){for(o=0,u=a=this.bMarks[p],c=p+1<r||n?this.eMarks[p]+1:this.eMarks[p];a<c&&o<t;){if(i=this.src.charCodeAt(a),Ee(i))9===i?o+=4-(o+this.bsCount[p])%4:o++;else{if(!(a-u<this.tShift[p]))break;o++}a++}l[s]=o>t?new Array(o-t+1).join(" ")+this.src.slice(a,c):this.src.slice(a,c)}return l.join("")},qe.prototype.Token=oe;var Se=qe,Fe=[["table",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C;if(r+2>t)return!1;if(l=r+1,e.sCount[l]<e.blkIndent)return!1;if(e.sCount[l]-e.blkIndent>=4)return!1;if((i=e.bMarks[l]+e.tShift[l])>=e.eMarks[l])return!1;if(124!==(v=e.src.charCodeAt(i++))&&45!==v&&58!==v)return!1;if(i>=e.eMarks[l])return!1;if(124!==(C=e.src.charCodeAt(i++))&&45!==C&&58!==C&&!pe(C))return!1;if(45===v&&pe(C))return!1;for(;i<e.eMarks[l];){if(124!==(s=e.src.charCodeAt(i))&&45!==s&&58!==s&&!pe(s))return!1;i++}for(u=(o=he(e,r+1)).split("|"),f=[],a=0;a<u.length;a++){if(!(d=u[a].trim())){if(0===a||a===u.length-1)continue;return!1}if(!/^:?-+:?$/.test(d))return!1;58===d.charCodeAt(d.length-1)?f.push(58===d.charCodeAt(0)?"center":"right"):58===d.charCodeAt(0)?f.push("left"):f.push("")}if(-1===(o=he(e,r).trim()).indexOf("|"))return!1;if(e.sCount[r]-e.blkIndent>=4)return!1;if((u=fe(o)).length&&""===u[0]&&u.shift(),u.length&&""===u[u.length-1]&&u.pop(),0===(p=u.length)||p!==f.length)return!1;if(n)return!0;for(_=e.parentType,e.parentType="table",b=e.md.block.ruler.getRules("blockquote"),(h=e.push("table_open","table",1)).map=m=[r,0],(h=e.push("thead_open","thead",1)).map=[r,r+1],(h=e.push("tr_open","tr",1)).map=[r,r+1],a=0;a<u.length;a++)h=e.push("th_open","th",1),f[a]&&(h.attrs=[["style","text-align:"+f[a]]]),(h=e.push("inline","",0)).content=u[a].trim(),h.children=[],h=e.push("th_close","th",-1);for(h=e.push("tr_close","tr",-1),h=e.push("thead_close","thead",-1),l=r+2;l<t&&!(e.sCount[l]<e.blkIndent);l++){for(k=!1,a=0,c=b.length;a<c;a++)if(b[a](e,l,t,!0)){k=!0;break}if(k)break;if(!(o=he(e,l).trim()))break;if(e.sCount[l]-e.blkIndent>=4)break;for((u=fe(o)).length&&""===u[0]&&u.shift(),u.length&&""===u[u.length-1]&&u.pop(),l===r+2&&((h=e.push("tbody_open","tbody",1)).map=g=[r+2,0]),(h=e.push("tr_open","tr",1)).map=[l,l+1],a=0;a<p;a++)h=e.push("td_open","td",1),f[a]&&(h.attrs=[["style","text-align:"+f[a]]]),(h=e.push("inline","",0)).content=u[a]?u[a].trim():"",h.children=[],h=e.push("td_close","td",-1);h=e.push("tr_close","tr",-1)}return g&&(h=e.push("tbody_close","tbody",-1),g[1]=l),h=e.push("table_close","table",-1),m[1]=l,e.parentType=_,e.line=l,!0},["paragraph","reference"]],["code",function(e,r,t){var n,s,o;if(e.sCount[r]-e.blkIndent<4)return!1;for(s=n=r+1;n<t;)if(e.isEmpty(n))n++;else{if(!(e.sCount[n]-e.blkIndent>=4))break;s=++n}return e.line=s,(o=e.push("code_block","code",0)).content=e.getLines(r,s,4+e.blkIndent,!1)+"\n",o.map=[r,e.line],!0}],["fence",function(e,r,t,n){var s,o,i,a,c,l,u,p=!1,h=e.bMarks[r]+e.tShift[r],f=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(h+3>f)return!1;if(126!==(s=e.src.charCodeAt(h))&&96!==s)return!1;if(c=h,(o=(h=e.skipChars(h,s))-c)<3)return!1;if(u=e.src.slice(c,h),i=e.src.slice(h,f),96===s&&i.indexOf(String.fromCharCode(s))>=0)return!1;if(n)return!0;for(a=r;!(++a>=t)&&!((h=c=e.bMarks[a]+e.tShift[a])<(f=e.eMarks[a])&&e.sCount[a]<e.blkIndent);)if(e.src.charCodeAt(h)===s&&!(e.sCount[a]-e.blkIndent>=4||(h=e.skipChars(h,s))-c<o||(h=e.skipSpaces(h))<f)){p=!0;break}return o=e.sCount[r],e.line=a+(p?1:0),(l=e.push("fence","code",0)).info=i,l.content=e.getLines(r+1,a,o,!0),l.markup=u,l.map=[r,e.line],!0},["paragraph","reference","blockquote","list"]],["blockquote",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C,y,A,x=e.lineMax,D=e.bMarks[r]+e.tShift[r],w=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(62!==e.src.charCodeAt(D++))return!1;if(n)return!0;for(a=h=e.sCount[r]+1,32===e.src.charCodeAt(D)?(D++,a++,h++,s=!1,b=!0):9===e.src.charCodeAt(D)?(b=!0,(e.bsCount[r]+h)%4==3?(D++,a++,h++,s=!1):s=!0):b=!1,f=[e.bMarks[r]],e.bMarks[r]=D;D<w&&(o=e.src.charCodeAt(D),de(o));)9===o?h+=4-(h+e.bsCount[r]+(s?1:0))%4:h++,D++;for(d=[e.bsCount[r]],e.bsCount[r]=e.sCount[r]+1+(b?1:0),l=D>=w,_=[e.sCount[r]],e.sCount[r]=h-a,k=[e.tShift[r]],e.tShift[r]=D-e.bMarks[r],C=e.md.block.ruler.getRules("blockquote"),g=e.parentType,e.parentType="blockquote",p=r+1;p<t&&(A=e.sCount[p]<e.blkIndent,!((D=e.bMarks[p]+e.tShift[p])>=(w=e.eMarks[p])));p++)if(62!==e.src.charCodeAt(D++)||A){if(l)break;for(v=!1,i=0,c=C.length;i<c;i++)if(C[i](e,p,t,!0)){v=!0;break}if(v){e.lineMax=p,0!==e.blkIndent&&(f.push(e.bMarks[p]),d.push(e.bsCount[p]),k.push(e.tShift[p]),_.push(e.sCount[p]),e.sCount[p]-=e.blkIndent);break}f.push(e.bMarks[p]),d.push(e.bsCount[p]),k.push(e.tShift[p]),_.push(e.sCount[p]),e.sCount[p]=-1}else{for(a=h=e.sCount[p]+1,32===e.src.charCodeAt(D)?(D++,a++,h++,s=!1,b=!0):9===e.src.charCodeAt(D)?(b=!0,(e.bsCount[p]+h)%4==3?(D++,a++,h++,s=!1):s=!0):b=!1,f.push(e.bMarks[p]),e.bMarks[p]=D;D<w&&(o=e.src.charCodeAt(D),de(o));)9===o?h+=4-(h+e.bsCount[p]+(s?1:0))%4:h++,D++;l=D>=w,d.push(e.bsCount[p]),e.bsCount[p]=e.sCount[p]+1+(b?1:0),_.push(e.sCount[p]),e.sCount[p]=h-a,k.push(e.tShift[p]),e.tShift[p]=D-e.bMarks[p]}for(m=e.blkIndent,e.blkIndent=0,(y=e.push("blockquote_open","blockquote",1)).markup=">",y.map=u=[r,0],e.md.block.tokenize(e,r,p),(y=e.push("blockquote_close","blockquote",-1)).markup=">",e.lineMax=x,e.parentType=g,u[1]=e.line,i=0;i<k.length;i++)e.bMarks[i+r]=f[i],e.tShift[i+r]=k[i],e.sCount[i+r]=_[i],e.bsCount[i+r]=d[i];return e.blkIndent=m,!0},["paragraph","reference","blockquote","list"]],["hr",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(42!==(s=e.src.charCodeAt(c++))&&45!==s&&95!==s)return!1;for(o=1;c<l;){if((i=e.src.charCodeAt(c++))!==s&&!me(i))return!1;i===s&&o++}return!(o<3)&&(n||(e.line=r+1,(a=e.push("hr","hr",0)).map=[r,e.line],a.markup=Array(o+1).join(String.fromCharCode(s))),!0)},["paragraph","reference","blockquote","list"]],["list",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C,y,A,x,D,w,E,q,S,F,L,z=!1,T=!0;if(e.sCount[r]-e.blkIndent>=4)return!1;if(e.listIndent>=0&&e.sCount[r]-e.listIndent>=4&&e.sCount[r]<e.blkIndent)return!1;if(n&&"paragraph"===e.parentType&&e.sCount[r]>=e.blkIndent&&(z=!0),(w=ke(e,r))>=0){if(u=!0,q=e.bMarks[r]+e.tShift[r],g=Number(e.src.slice(q,w-1)),z&&1!==g)return!1}else{if(!((w=_e(e,r))>=0))return!1;u=!1}if(z&&e.skipSpaces(w)>=e.eMarks[r])return!1;if(m=e.src.charCodeAt(w-1),n)return!0;for(d=e.tokens.length,u?(L=e.push("ordered_list_open","ol",1),1!==g&&(L.attrs=[["start",g]])):L=e.push("bullet_list_open","ul",1),L.map=f=[r,0],L.markup=String.fromCharCode(m),k=r,E=!1,F=e.md.block.ruler.getRules("list"),C=e.parentType,e.parentType="list";k<t;){for(D=w,_=e.eMarks[k],l=b=e.sCount[k]+w-(e.bMarks[r]+e.tShift[r]);D<_;){if(9===(s=e.src.charCodeAt(D)))b+=4-(b+e.bsCount[k])%4;else{if(32!==s)break;b++}D++}if((c=(o=D)>=_?1:b-l)>4&&(c=1),a=l+c,(L=e.push("list_item_open","li",1)).markup=String.fromCharCode(m),L.map=p=[r,0],u&&(L.info=e.src.slice(q,w-1)),x=e.tight,A=e.tShift[r],y=e.sCount[r],v=e.listIndent,e.listIndent=e.blkIndent,e.blkIndent=a,e.tight=!0,e.tShift[r]=o-e.bMarks[r],e.sCount[r]=b,o>=_&&e.isEmpty(r+1)?e.line=Math.min(e.line+2,t):e.md.block.tokenize(e,r,t,!0),e.tight&&!E||(T=!1),E=e.line-r>1&&e.isEmpty(e.line-1),e.blkIndent=e.listIndent,e.listIndent=v,e.tShift[r]=A,e.sCount[r]=y,e.tight=x,(L=e.push("list_item_close","li",-1)).markup=String.fromCharCode(m),k=r=e.line,p[1]=k,o=e.bMarks[r],k>=t)break;if(e.sCount[k]<e.blkIndent)break;if(e.sCount[r]-e.blkIndent>=4)break;for(S=!1,i=0,h=F.length;i<h;i++)if(F[i](e,k,t,!0)){S=!0;break}if(S)break;if(u){if((w=ke(e,k))<0)break;q=e.bMarks[k]+e.tShift[k]}else if((w=_e(e,k))<0)break;if(m!==e.src.charCodeAt(w-1))break}return(L=u?e.push("ordered_list_close","ol",-1):e.push("bullet_list_close","ul",-1)).markup=String.fromCharCode(m),f[1]=k,e.line=k,e.parentType=C,T&&function(e,r){var t,n,s=e.level+2;for(t=r+2,n=e.tokens.length-2;t<n;t++)e.tokens[t].level===s&&"paragraph_open"===e.tokens[t].type&&(e.tokens[t+2].hidden=!0,e.tokens[t].hidden=!0,t+=2)}(e,d),!0},["paragraph","reference","blockquote"]],["reference",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v=0,C=e.bMarks[r]+e.tShift[r],y=e.eMarks[r],A=r+1;if(e.sCount[r]-e.blkIndent>=4)return!1;if(91!==e.src.charCodeAt(C))return!1;for(;++C<y;)if(93===e.src.charCodeAt(C)&&92!==e.src.charCodeAt(C-1)){if(C+1===y)return!1;if(58!==e.src.charCodeAt(C+1))return!1;break}for(a=e.lineMax,k=e.md.block.ruler.getRules("reference"),f=e.parentType,e.parentType="reference";A<a&&!e.isEmpty(A);A++)if(!(e.sCount[A]-e.blkIndent>3||e.sCount[A]<0)){for(_=!1,l=0,u=k.length;l<u;l++)if(k[l](e,A,a,!0)){_=!0;break}if(_)break}for(y=(g=e.getLines(r,A,e.blkIndent,!1).trim()).length,C=1;C<y;C++){if(91===(s=g.charCodeAt(C)))return!1;if(93===s){h=C;break}(10===s||92===s&&++C<y&&10===g.charCodeAt(C))&&v++}if(h<0||58!==g.charCodeAt(h+1))return!1;for(C=h+2;C<y;C++)if(10===(s=g.charCodeAt(C)))v++;else if(!ve(s))break;if(!(d=e.md.helpers.parseLinkDestination(g,C,y)).ok)return!1;if(c=e.md.normalizeLink(d.str),!e.md.validateLink(c))return!1;for(o=C=d.pos,i=v+=d.lines,m=C;C<y;C++)if(10===(s=g.charCodeAt(C)))v++;else if(!ve(s))break;for(d=e.md.helpers.parseLinkTitle(g,C,y),C<y&&m!==C&&d.ok?(b=d.str,C=d.pos,v+=d.lines):(b="",C=o,v=i);C<y&&(s=g.charCodeAt(C),ve(s));)C++;if(C<y&&10!==g.charCodeAt(C)&&b)for(b="",C=o,v=i;C<y&&(s=g.charCodeAt(C),ve(s));)C++;return!(C<y&&10!==g.charCodeAt(C))&&(!!(p=be(g.slice(1,h)))&&(n||(void 0===e.env.references&&(e.env.references={}),void 0===e.env.references[p]&&(e.env.references[p]={title:b,href:c}),e.parentType=f,e.line=r+v+1),!0))}],["html_block",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(!e.md.options.html)return!1;if(60!==e.src.charCodeAt(c))return!1;for(a=e.src.slice(c,l),s=0;s<De.length&&!De[s][0].test(a);s++);if(s===De.length)return!1;if(n)return De[s][2];if(o=r+1,!De[s][1].test(a))for(;o<t&&!(e.sCount[o]<e.blkIndent);o++)if(c=e.bMarks[o]+e.tShift[o],l=e.eMarks[o],a=e.src.slice(c,l),De[s][1].test(a)){0!==a.length&&o++;break}return e.line=o,(i=e.push("html_block","",0)).map=[r,o],i.content=e.getLines(r,o,e.blkIndent,!0),!0},["paragraph","reference","blockquote"]],["heading",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(35!==(s=e.src.charCodeAt(c))||c>=l)return!1;for(o=1,s=e.src.charCodeAt(++c);35===s&&c<l&&o<=6;)o++,s=e.src.charCodeAt(++c);return!(o>6||c<l&&!we(s))&&(n||(l=e.skipSpacesBack(l,c),(i=e.skipCharsBack(l,35,c))>c&&we(e.src.charCodeAt(i-1))&&(l=i),e.line=r+1,(a=e.push("heading_open","h"+String(o),1)).markup="########".slice(0,o),a.map=[r,e.line],(a=e.push("inline","",0)).content=e.src.slice(c,l).trim(),a.map=[r,e.line],a.children=[],(a=e.push("heading_close","h"+String(o),-1)).markup="########".slice(0,o)),!0)},["paragraph","reference","blockquote"]],["lheading",function(e,r,t){var n,s,o,i,a,c,l,u,p,h,f=r+1,d=e.md.block.ruler.getRules("paragraph");if(e.sCount[r]-e.blkIndent>=4)return!1;for(h=e.parentType,e.parentType="paragraph";f<t&&!e.isEmpty(f);f++)if(!(e.sCount[f]-e.blkIndent>3)){if(e.sCount[f]>=e.blkIndent&&(c=e.bMarks[f]+e.tShift[f])<(l=e.eMarks[f])&&(45===(p=e.src.charCodeAt(c))||61===p)&&(c=e.skipChars(c,p),(c=e.skipSpaces(c))>=l)){u=61===p?1:2;break}if(!(e.sCount[f]<0)){for(s=!1,o=0,i=d.length;o<i;o++)if(d[o](e,f,t,!0)){s=!0;break}if(s)break}}return!!u&&(n=e.getLines(r,f,e.blkIndent,!1).trim(),e.line=f+1,(a=e.push("heading_open","h"+String(u),1)).markup=String.fromCharCode(p),a.map=[r,e.line],(a=e.push("inline","",0)).content=n,a.map=[r,e.line-1],a.children=[],(a=e.push("heading_close","h"+String(u),-1)).markup=String.fromCharCode(p),e.parentType=h,!0)}],["paragraph",function(e,r){var t,n,s,o,i,a,c=r+1,l=e.md.block.ruler.getRules("paragraph"),u=e.lineMax;for(a=e.parentType,e.parentType="paragraph";c<u&&!e.isEmpty(c);c++)if(!(e.sCount[c]-e.blkIndent>3||e.sCount[c]<0)){for(n=!1,s=0,o=l.length;s<o;s++)if(l[s](e,c,u,!0)){n=!0;break}if(n)break}return t=e.getLines(r,c,e.blkIndent,!1).trim(),e.line=c,(i=e.push("paragraph_open","p",1)).map=[r,e.line],(i=e.push("inline","",0)).content=t,i.map=[r,e.line],i.children=[],i=e.push("paragraph_close","p",-1),e.parentType=a,!0}]];function Le(){this.ruler=new O;for(var e=0;e<Fe.length;e++)this.ruler.push(Fe[e][0],Fe[e][1],{alt:(Fe[e][2]||[]).slice()})}Le.prototype.tokenize=function(e,r,t){for(var n,s=this.ruler.getRules(""),o=s.length,i=r,a=!1,c=e.md.options.maxNesting;i<t&&(e.line=i=e.skipEmptyLines(i),!(i>=t))&&!(e.sCount[i]<e.blkIndent);){if(e.level>=c){e.line=t;break}for(n=0;n<o&&!s[n](e,i,t,!1);n++);e.tight=!a,e.isEmpty(e.line-1)&&(a=!0),(i=e.line)<t&&e.isEmpty(i)&&(a=!0,i++,e.line=i)}},Le.prototype.parse=function(e,r,t,n){var s;e&&(s=new this.State(e,r,t,n),this.tokenize(s,s.line,s.lineMax))},Le.prototype.State=Se;var ze=Le;function Te(e){switch(e){case 10:case 33:case 35:case 36:case 37:case 38:case 42:case 43:case 45:case 58:case 60:case 61:case 62:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 125:case 126:return!0;default:return!1}}for(var Ie=w.isSpace,Me=w.isSpace,Re=[],Be=0;Be<256;Be++)Re.push(0);"\\!\"#$%&'()*+,./:;<=>?@[]^_`{|}~-".split("").forEach((function(e){Re[e.charCodeAt(0)]=1}));function Ne(e,r){var t,n,s,o,i,a=[],c=r.length;for(t=0;t<c;t++)126===(s=r[t]).marker&&-1!==s.end&&(o=r[s.end],(i=e.tokens[s.token]).type="s_open",i.tag="s",i.nesting=1,i.markup="~~",i.content="",(i=e.tokens[o.token]).type="s_close",i.tag="s",i.nesting=-1,i.markup="~~",i.content="","text"===e.tokens[o.token-1].type&&"~"===e.tokens[o.token-1].content&&a.push(o.token-1));for(;a.length;){for(n=(t=a.pop())+1;n<e.tokens.length&&"s_close"===e.tokens[n].type;)n++;t!==--n&&(i=e.tokens[n],e.tokens[n]=e.tokens[t],e.tokens[t]=i)}}var Oe={tokenize:function(e,r){var t,n,s,o,i=e.pos,a=e.src.charCodeAt(i);if(r)return!1;if(126!==a)return!1;if(s=(n=e.scanDelims(e.pos,!0)).length,o=String.fromCharCode(a),s<2)return!1;for(s%2&&(e.push("text","",0).content=o,s--),t=0;t<s;t+=2)e.push("text","",0).content=o+o,e.delimiters.push({marker:a,length:0,token:e.tokens.length-1,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},postProcess:function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Ne(e,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Ne(e,t[r].delimiters)}};function Pe(e,r){var t,n,s,o,i,a;for(t=r.length-1;t>=0;t--)95!==(n=r[t]).marker&&42!==n.marker||-1!==n.end&&(s=r[n.end],a=t>0&&r[t-1].end===n.end+1&&r[t-1].marker===n.marker&&r[t-1].token===n.token-1&&r[n.end+1].token===s.token+1,i=String.fromCharCode(n.marker),(o=e.tokens[n.token]).type=a?"strong_open":"em_open",o.tag=a?"strong":"em",o.nesting=1,o.markup=a?i+i:i,o.content="",(o=e.tokens[s.token]).type=a?"strong_close":"em_close",o.tag=a?"strong":"em",o.nesting=-1,o.markup=a?i+i:i,o.content="",a&&(e.tokens[r[t-1].token].content="",e.tokens[r[n.end+1].token].content="",t--))}var je={tokenize:function(e,r){var t,n,s=e.pos,o=e.src.charCodeAt(s);if(r)return!1;if(95!==o&&42!==o)return!1;for(n=e.scanDelims(e.pos,42===o),t=0;t<n.length;t++)e.push("text","",0).content=String.fromCharCode(o),e.delimiters.push({marker:o,length:n.length,token:e.tokens.length-1,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},postProcess:function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Pe(e,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Pe(e,t[r].delimiters)}},Ue=w.normalizeReference,Ve=w.isSpace,Ze=w.normalizeReference,Ge=w.isSpace,$e=/^([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)$/,He=/^([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)$/,Je=Ae.HTML_TAG_RE;var We=w.has,Ye=w.isValidEntityCode,Ke=w.fromCodePoint,Qe=/^&#((?:x[a-f0-9]{1,6}|[0-9]{1,7}));/i,Xe=/^&([a-z][a-z0-9]{1,31});/i;function er(e,r){var t,n,s,o,i,a,c,l,u={},p=r.length;if(p){var h=0,f=-2,d=[];for(t=0;t<p;t++)if(s=r[t],d.push(0),r[h].marker===s.marker&&f===s.token-1||(h=t),f=s.token,s.length=s.length||0,s.close){for(u.hasOwnProperty(s.marker)||(u[s.marker]=[-1,-1,-1,-1,-1,-1]),i=u[s.marker][(s.open?3:0)+s.length%3],a=n=h-d[h]-1;n>i;n-=d[n]+1)if((o=r[n]).marker===s.marker&&o.open&&o.end<0&&(c=!1,(o.close||s.open)&&(o.length+s.length)%3==0&&(o.length%3==0&&s.length%3==0||(c=!0)),!c)){l=n>0&&!r[n-1].open?d[n-1]+1:0,d[t]=t-n+l,d[n]=l,s.open=!1,o.end=t,o.close=!1,a=-1,f=-2;break}-1!==a&&(u[s.marker][(s.open?3:0)+(s.length||0)%3]=a)}}}var rr=w.isWhiteSpace,tr=w.isPunctChar,nr=w.isMdAsciiPunct;function sr(e,r,t,n){this.src=e,this.env=t,this.md=r,this.tokens=n,this.tokens_meta=Array(n.length),this.pos=0,this.posMax=this.src.length,this.level=0,this.pending="",this.pendingLevel=0,this.cache={},this.delimiters=[],this._prev_delimiters=[],this.backticks={},this.backticksScanned=!1}sr.prototype.pushPending=function(){var e=new oe("text","",0);return e.content=this.pending,e.level=this.pendingLevel,this.tokens.push(e),this.pending="",e},sr.prototype.push=function(e,r,t){this.pending&&this.pushPending();var n=new oe(e,r,t),s=null;return t<0&&(this.level--,this.delimiters=this._prev_delimiters.pop()),n.level=this.level,t>0&&(this.level++,this._prev_delimiters.push(this.delimiters),this.delimiters=[],s={delimiters:this.delimiters}),this.pendingLevel=this.level,this.tokens.push(n),this.tokens_meta.push(s),n},sr.prototype.scanDelims=function(e,r){var t,n,s,o,i,a,c,l,u,p=e,h=!0,f=!0,d=this.posMax,m=this.src.charCodeAt(e);for(t=e>0?this.src.charCodeAt(e-1):32;p<d&&this.src.charCodeAt(p)===m;)p++;return s=p-e,n=p<d?this.src.charCodeAt(p):32,c=nr(t)||tr(String.fromCharCode(t)),u=nr(n)||tr(String.fromCharCode(n)),a=rr(t),(l=rr(n))?h=!1:u&&(a||c||(h=!1)),a?f=!1:c&&(l||u||(f=!1)),r?(o=h,i=f):(o=h&&(!f||c),i=f&&(!h||u)),{can_open:o,can_close:i,length:s}},sr.prototype.Token=oe;var or=sr,ir=[["text",function(e,r){for(var t=e.pos;t<e.posMax&&!Te(e.src.charCodeAt(t));)t++;return t!==e.pos&&(r||(e.pending+=e.src.slice(e.pos,t)),e.pos=t,!0)}],["newline",function(e,r){var t,n,s,o=e.pos;if(10!==e.src.charCodeAt(o))return!1;if(t=e.pending.length-1,n=e.posMax,!r)if(t>=0&&32===e.pending.charCodeAt(t))if(t>=1&&32===e.pending.charCodeAt(t-1)){for(s=t-1;s>=1&&32===e.pending.charCodeAt(s-1);)s--;e.pending=e.pending.slice(0,s),e.push("hardbreak","br",0)}else e.pending=e.pending.slice(0,-1),e.push("softbreak","br",0);else e.push("softbreak","br",0);for(o++;o<n&&Ie(e.src.charCodeAt(o));)o++;return e.pos=o,!0}],["escape",function(e,r){var t,n=e.pos,s=e.posMax;if(92!==e.src.charCodeAt(n))return!1;if(++n<s){if((t=e.src.charCodeAt(n))<256&&0!==Re[t])return r||(e.pending+=e.src[n]),e.pos+=2,!0;if(10===t){for(r||e.push("hardbreak","br",0),n++;n<s&&(t=e.src.charCodeAt(n),Me(t));)n++;return e.pos=n,!0}}return r||(e.pending+="\\"),e.pos++,!0}],["backticks",function(e,r){var t,n,s,o,i,a,c,l,u=e.pos;if(96!==e.src.charCodeAt(u))return!1;for(t=u,u++,n=e.posMax;u<n&&96===e.src.charCodeAt(u);)u++;if(c=(s=e.src.slice(t,u)).length,e.backticksScanned&&(e.backticks[c]||0)<=t)return r||(e.pending+=s),e.pos+=c,!0;for(i=a=u;-1!==(i=e.src.indexOf("`",a));){for(a=i+1;a<n&&96===e.src.charCodeAt(a);)a++;if((l=a-i)===c)return r||((o=e.push("code_inline","code",0)).markup=s,o.content=e.src.slice(u,i).replace(/\n/g," ").replace(/^ (.+) $/,"$1")),e.pos=a,!0;e.backticks[l]=i}return e.backticksScanned=!0,r||(e.pending+=s),e.pos+=c,!0}],["strikethrough",Oe.tokenize],["emphasis",je.tokenize],["link",function(e,r){var t,n,s,o,i,a,c,l,u="",p="",h=e.pos,f=e.posMax,d=e.pos,m=!0;if(91!==e.src.charCodeAt(e.pos))return!1;if(i=e.pos+1,(o=e.md.helpers.parseLinkLabel(e,e.pos,!0))<0)return!1;if((a=o+1)<f&&40===e.src.charCodeAt(a)){for(m=!1,a++;a<f&&(n=e.src.charCodeAt(a),Ve(n)||10===n);a++);if(a>=f)return!1;if(d=a,(c=e.md.helpers.parseLinkDestination(e.src,a,e.posMax)).ok){for(u=e.md.normalizeLink(c.str),e.md.validateLink(u)?a=c.pos:u="",d=a;a<f&&(n=e.src.charCodeAt(a),Ve(n)||10===n);a++);if(c=e.md.helpers.parseLinkTitle(e.src,a,e.posMax),a<f&&d!==a&&c.ok)for(p=c.str,a=c.pos;a<f&&(n=e.src.charCodeAt(a),Ve(n)||10===n);a++);}(a>=f||41!==e.src.charCodeAt(a))&&(m=!0),a++}if(m){if(void 0===e.env.references)return!1;if(a<f&&91===e.src.charCodeAt(a)?(d=a+1,(a=e.md.helpers.parseLinkLabel(e,a))>=0?s=e.src.slice(d,a++):a=o+1):a=o+1,s||(s=e.src.slice(i,o)),!(l=e.env.references[Ue(s)]))return e.pos=h,!1;u=l.href,p=l.title}return r||(e.pos=i,e.posMax=o,e.push("link_open","a",1).attrs=t=[["href",u]],p&&t.push(["title",p]),e.md.inline.tokenize(e),e.push("link_close","a",-1)),e.pos=a,e.posMax=f,!0}],["image",function(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m="",g=e.pos,_=e.posMax;if(33!==e.src.charCodeAt(e.pos))return!1;if(91!==e.src.charCodeAt(e.pos+1))return!1;if(a=e.pos+2,(i=e.md.helpers.parseLinkLabel(e,e.pos+1,!1))<0)return!1;if((c=i+1)<_&&40===e.src.charCodeAt(c)){for(c++;c<_&&(n=e.src.charCodeAt(c),Ge(n)||10===n);c++);if(c>=_)return!1;for(d=c,(u=e.md.helpers.parseLinkDestination(e.src,c,e.posMax)).ok&&(m=e.md.normalizeLink(u.str),e.md.validateLink(m)?c=u.pos:m=""),d=c;c<_&&(n=e.src.charCodeAt(c),Ge(n)||10===n);c++);if(u=e.md.helpers.parseLinkTitle(e.src,c,e.posMax),c<_&&d!==c&&u.ok)for(p=u.str,c=u.pos;c<_&&(n=e.src.charCodeAt(c),Ge(n)||10===n);c++);else p="";if(c>=_||41!==e.src.charCodeAt(c))return e.pos=g,!1;c++}else{if(void 0===e.env.references)return!1;if(c<_&&91===e.src.charCodeAt(c)?(d=c+1,(c=e.md.helpers.parseLinkLabel(e,c))>=0?o=e.src.slice(d,c++):c=i+1):c=i+1,o||(o=e.src.slice(a,i)),!(l=e.env.references[Ze(o)]))return e.pos=g,!1;m=l.href,p=l.title}return r||(s=e.src.slice(a,i),e.md.inline.parse(s,e.md,e.env,f=[]),(h=e.push("image","img",0)).attrs=t=[["src",m],["alt",""]],h.children=f,h.content=s,p&&t.push(["title",p])),e.pos=c,e.posMax=_,!0}],["autolink",function(e,r){var t,n,s,o,i,a,c=e.pos;if(60!==e.src.charCodeAt(c))return!1;for(i=e.pos,a=e.posMax;;){if(++c>=a)return!1;if(60===(o=e.src.charCodeAt(c)))return!1;if(62===o)break}return t=e.src.slice(i+1,c),He.test(t)?(n=e.md.normalizeLink(t),!!e.md.validateLink(n)&&(r||((s=e.push("link_open","a",1)).attrs=[["href",n]],s.markup="autolink",s.info="auto",(s=e.push("text","",0)).content=e.md.normalizeLinkText(t),(s=e.push("link_close","a",-1)).markup="autolink",s.info="auto"),e.pos+=t.length+2,!0)):!!$e.test(t)&&(n=e.md.normalizeLink("mailto:"+t),!!e.md.validateLink(n)&&(r||((s=e.push("link_open","a",1)).attrs=[["href",n]],s.markup="autolink",s.info="auto",(s=e.push("text","",0)).content=e.md.normalizeLinkText(t),(s=e.push("link_close","a",-1)).markup="autolink",s.info="auto"),e.pos+=t.length+2,!0))}],["html_inline",function(e,r){var t,n,s,o=e.pos;return!!e.md.options.html&&(s=e.posMax,!(60!==e.src.charCodeAt(o)||o+2>=s)&&(!(33!==(t=e.src.charCodeAt(o+1))&&63!==t&&47!==t&&!function(e){var r=32|e;return r>=97&&r<=122}(t))&&(!!(n=e.src.slice(o).match(Je))&&(r||(e.push("html_inline","",0).content=e.src.slice(o,o+n[0].length)),e.pos+=n[0].length,!0))))}],["entity",function(e,t){var n,s,o=e.pos,i=e.posMax;if(38!==e.src.charCodeAt(o))return!1;if(o+1<i)if(35===e.src.charCodeAt(o+1)){if(s=e.src.slice(o).match(Qe))return t||(n="x"===s[1][0].toLowerCase()?parseInt(s[1].slice(1),16):parseInt(s[1],10),e.pending+=Ye(n)?Ke(n):Ke(65533)),e.pos+=s[0].length,!0}else if((s=e.src.slice(o).match(Xe))&&We(r,s[1]))return t||(e.pending+=r[s[1]]),e.pos+=s[0].length,!0;return t||(e.pending+="&"),e.pos++,!0}]],ar=[["balance_pairs",function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(er(0,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&er(0,t[r].delimiters)}],["strikethrough",Oe.postProcess],["emphasis",je.postProcess],["text_collapse",function(e){var r,t,n=0,s=e.tokens,o=e.tokens.length;for(r=t=0;r<o;r++)s[r].nesting<0&&n--,s[r].level=n,s[r].nesting>0&&n++,"text"===s[r].type&&r+1<o&&"text"===s[r+1].type?s[r+1].content=s[r].content+s[r+1].content:(r!==t&&(s[t]=s[r]),t++);r!==t&&(s.length=t)}]];function cr(){var e;for(this.ruler=new O,e=0;e<ir.length;e++)this.ruler.push(ir[e][0],ir[e][1]);for(this.ruler2=new O,e=0;e<ar.length;e++)this.ruler2.push(ar[e][0],ar[e][1])}cr.prototype.skipToken=function(e){var r,t,n=e.pos,s=this.ruler.getRules(""),o=s.length,i=e.md.options.maxNesting,a=e.cache;if(void 0===a[n]){if(e.level<i)for(t=0;t<o&&(e.level++,r=s[t](e,!0),e.level--,!r);t++);else e.pos=e.posMax;r||e.pos++,a[n]=e.pos}else e.pos=a[n]},cr.prototype.tokenize=function(e){for(var r,t,n=this.ruler.getRules(""),s=n.length,o=e.posMax,i=e.md.options.maxNesting;e.pos<o;){if(e.level<i)for(t=0;t<s&&!(r=n[t](e,!1));t++);if(r){if(e.pos>=o)break}else e.pending+=e.src[e.pos++]}e.pending&&e.pushPending()},cr.prototype.parse=function(e,r,t,n){var s,o,i,a=new this.State(e,r,t,n);for(this.tokenize(a),i=(o=this.ruler2.getRules("")).length,s=0;s<i;s++)o[s](a)},cr.prototype.State=or;var lr=cr;function ur(e){var r=Array.prototype.slice.call(arguments,1);return r.forEach((function(r){r&&Object.keys(r).forEach((function(t){e[t]=r[t]}))})),e}function pr(e){return Object.prototype.toString.call(e)}function hr(e){return"[object Function]"===pr(e)}function fr(e){return e.replace(/[.?*+^$[\]\\(){}|-]/g,"\\$&")}var dr={fuzzyLink:!0,fuzzyEmail:!0,fuzzyIP:!1};var mr={"http:":{validate:function(e,r,t){var n=e.slice(r);return t.re.http||(t.re.http=new RegExp("^\\/\\/"+t.re.src_auth+t.re.src_host_port_strict+t.re.src_path,"i")),t.re.http.test(n)?n.match(t.re.http)[0].length:0}},"https:":"http:","ftp:":"http:","//":{validate:function(e,r,t){var n=e.slice(r);return t.re.no_http||(t.re.no_http=new RegExp("^"+t.re.src_auth+"(?:localhost|(?:(?:"+t.re.src_domain+")\\.)+"+t.re.src_domain_root+")"+t.re.src_port+t.re.src_host_terminator+t.re.src_path,"i")),t.re.no_http.test(n)?r>=3&&":"===e[r-3]||r>=3&&"/"===e[r-3]?0:n.match(t.re.no_http)[0].length:0}},"mailto:":{validate:function(e,r,t){var n=e.slice(r);return t.re.mailto||(t.re.mailto=new RegExp("^"+t.re.src_email_name+"@"+t.re.src_host_strict,"i")),t.re.mailto.test(n)?n.match(t.re.mailto)[0].length:0}}},gr="biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|\u0440\u0444".split("|");function _r(e){var r=e.re=function(e){var r={};return r.src_Any=y.source,r.src_Cc=A.source,r.src_Z=x.source,r.src_P=t.source,r.src_ZPCc=[r.src_Z,r.src_P,r.src_Cc].join("|"),r.src_ZCc=[r.src_Z,r.src_Cc].join("|"),r.src_pseudo_letter="(?:(?![><\uff5c]|"+r.src_ZPCc+")"+r.src_Any+")",r.src_ip4="(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)",r.src_auth="(?:(?:(?!"+r.src_ZCc+"|[@/\\[\\]()]).)+@)?",r.src_port="(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?",r.src_host_terminator="(?=$|[><\uff5c]|"+r.src_ZPCc+")(?!-|_|:\\d|\\.-|\\.(?!$|"+r.src_ZPCc+"))",r.src_path="(?:[/?#](?:(?!"+r.src_ZCc+"|[><\uff5c]|[()[\\]{}.,\"'?!\\-;]).|\\[(?:(?!"+r.src_ZCc+"|\\]).)*\\]|\\((?:(?!"+r.src_ZCc+"|[)]).)*\\)|\\{(?:(?!"+r.src_ZCc+'|[}]).)*\\}|\\"(?:(?!'+r.src_ZCc+'|["]).)+\\"|\\\'(?:(?!'+r.src_ZCc+"|[']).)+\\'|\\'(?="+r.src_pseudo_letter+"|[-]).|\\.{2,}[a-zA-Z0-9%/&]|\\.(?!"+r.src_ZCc+"|[.]).|"+(e&&e["---"]?"\\-(?!--(?:[^-]|$))(?:-*)|":"\\-+|")+",(?!"+r.src_ZCc+").|;(?!"+r.src_ZCc+").|\\!+(?!"+r.src_ZCc+"|[!]).|\\?(?!"+r.src_ZCc+"|[?]).)+|\\/)?",r.src_email_name='[\\-;:&=\\+\\$,\\.a-zA-Z0-9_][\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]*',r.src_xn="xn--[a-z0-9\\-]{1,59}",r.src_domain_root="(?:"+r.src_xn+"|"+r.src_pseudo_letter+"{1,63})",r.src_domain="(?:"+r.src_xn+"|(?:"+r.src_pseudo_letter+")|(?:"+r.src_pseudo_letter+"(?:-|"+r.src_pseudo_letter+"){0,61}"+r.src_pseudo_letter+"))",r.src_host="(?:(?:(?:(?:"+r.src_domain+")\\.)*"+r.src_domain+"))",r.tpl_host_fuzzy="(?:"+r.src_ip4+"|(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%)))",r.tpl_host_no_ip_fuzzy="(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%))",r.src_host_strict=r.src_host+r.src_host_terminator,r.tpl_host_fuzzy_strict=r.tpl_host_fuzzy+r.src_host_terminator,r.src_host_port_strict=r.src_host+r.src_port+r.src_host_terminator,r.tpl_host_port_fuzzy_strict=r.tpl_host_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_port_no_ip_fuzzy_strict=r.tpl_host_no_ip_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_fuzzy_test="localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:"+r.src_ZPCc+"|>|$))",r.tpl_email_fuzzy='(^|[><\uff5c]|"|\\(|'+r.src_ZCc+")("+r.src_email_name+"@"+r.tpl_host_fuzzy_strict+")",r.tpl_link_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_fuzzy_strict+r.src_path+")",r.tpl_link_no_ip_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_no_ip_fuzzy_strict+r.src_path+")",r}(e.__opts__),n=e.__tlds__.slice();function s(e){return e.replace("%TLDS%",r.src_tlds)}e.onCompile(),e.__tlds_replaced__||n.push("a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]"),n.push(r.src_xn),r.src_tlds=n.join("|"),r.email_fuzzy=RegExp(s(r.tpl_email_fuzzy),"i"),r.link_fuzzy=RegExp(s(r.tpl_link_fuzzy),"i"),r.link_no_ip_fuzzy=RegExp(s(r.tpl_link_no_ip_fuzzy),"i"),r.host_fuzzy_test=RegExp(s(r.tpl_host_fuzzy_test),"i");var o=[];function i(e,r){throw new Error('(LinkifyIt) Invalid schema "'+e+'": '+r)}e.__compiled__={},Object.keys(e.__schemas__).forEach((function(r){var t=e.__schemas__[r];if(null!==t){var n={validate:null,link:null};if(e.__compiled__[r]=n,"[object Object]"===pr(t))return!function(e){return"[object RegExp]"===pr(e)}(t.validate)?hr(t.validate)?n.validate=t.validate:i(r,t):n.validate=function(e){return function(r,t){var n=r.slice(t);return e.test(n)?n.match(e)[0].length:0}}(t.validate),void(hr(t.normalize)?n.normalize=t.normalize:t.normalize?i(r,t):n.normalize=function(e,r){r.normalize(e)});!function(e){return"[object String]"===pr(e)}(t)?i(r,t):o.push(r)}})),o.forEach((function(r){e.__compiled__[e.__schemas__[r]]&&(e.__compiled__[r].validate=e.__compiled__[e.__schemas__[r]].validate,e.__compiled__[r].normalize=e.__compiled__[e.__schemas__[r]].normalize)})),e.__compiled__[""]={validate:null,normalize:function(e,r){r.normalize(e)}};var a=Object.keys(e.__compiled__).filter((function(r){return r.length>0&&e.__compiled__[r]})).map(fr).join("|");e.re.schema_test=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","i"),e.re.schema_search=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","ig"),e.re.pretest=RegExp("("+e.re.schema_test.source+")|("+e.re.host_fuzzy_test.source+")|@","i"),function(e){e.__index__=-1,e.__text_cache__=""}(e)}function kr(e,r){var t=e.__index__,n=e.__last_index__,s=e.__text_cache__.slice(t,n);this.schema=e.__schema__.toLowerCase(),this.index=t+r,this.lastIndex=n+r,this.raw=s,this.text=s,this.url=s}function br(e,r){var t=new kr(e,r);return e.__compiled__[t.schema].normalize(t,e),t}function vr(e,r){if(!(this instanceof vr))return new vr(e,r);var t;r||(t=e,Object.keys(t||{}).reduce((function(e,r){return e||dr.hasOwnProperty(r)}),!1)&&(r=e,e={})),this.__opts__=ur({},dr,r),this.__index__=-1,this.__last_index__=-1,this.__schema__="",this.__text_cache__="",this.__schemas__=ur({},mr,e),this.__compiled__={},this.__tlds__=gr,this.__tlds_replaced__=!1,this.re={},_r(this)}vr.prototype.add=function(e,r){return this.__schemas__[e]=r,_r(this),this},vr.prototype.set=function(e){return this.__opts__=ur(this.__opts__,e),this},vr.prototype.test=function(e){if(this.__text_cache__=e,this.__index__=-1,!e.length)return!1;var r,t,n,s,o,i,a,c;if(this.re.schema_test.test(e))for((a=this.re.schema_search).lastIndex=0;null!==(r=a.exec(e));)if(s=this.testSchemaAt(e,r[2],a.lastIndex)){this.__schema__=r[2],this.__index__=r.index+r[1].length,this.__last_index__=r.index+r[0].length+s;break}return this.__opts__.fuzzyLink&&this.__compiled__["http:"]&&(c=e.search(this.re.host_fuzzy_test))>=0&&(this.__index__<0||c<this.__index__)&&null!==(t=e.match(this.__opts__.fuzzyIP?this.re.link_fuzzy:this.re.link_no_ip_fuzzy))&&(o=t.index+t[1].length,(this.__index__<0||o<this.__index__)&&(this.__schema__="",this.__index__=o,this.__last_index__=t.index+t[0].length)),this.__opts__.fuzzyEmail&&this.__compiled__["mailto:"]&&e.indexOf("@")>=0&&null!==(n=e.match(this.re.email_fuzzy))&&(o=n.index+n[1].length,i=n.index+n[0].length,(this.__index__<0||o<this.__index__||o===this.__index__&&i>this.__last_index__)&&(this.__schema__="mailto:",this.__index__=o,this.__last_index__=i)),this.__index__>=0},vr.prototype.pretest=function(e){return this.re.pretest.test(e)},vr.prototype.testSchemaAt=function(e,r,t){return this.__compiled__[r.toLowerCase()]?this.__compiled__[r.toLowerCase()].validate(e,t,this):0},vr.prototype.match=function(e){var r=0,t=[];this.__index__>=0&&this.__text_cache__===e&&(t.push(br(this,r)),r=this.__last_index__);for(var n=r?e.slice(r):e;this.test(n);)t.push(br(this,r)),n=n.slice(this.__last_index__),r+=this.__last_index__;return t.length?t:null},vr.prototype.tlds=function(e,r){return e=Array.isArray(e)?e:[e],r?(this.__tlds__=this.__tlds__.concat(e).sort().filter((function(e,r,t){return e!==t[r-1]})).reverse(),_r(this),this):(this.__tlds__=e.slice(),this.__tlds_replaced__=!0,_r(this),this)},vr.prototype.normalize=function(e){e.schema||(e.url="http://"+e.url),"mailto:"!==e.schema||/^mailto:/i.test(e.url)||(e.url="mailto:"+e.url)},vr.prototype.onCompile=function(){};var Cr=vr,yr=2147483647,Ar=36,xr=/^xn--/,Dr=/[^\x20-\x7E]/,wr=/[\x2E\u3002\uFF0E\uFF61]/g,Er={overflow:"Overflow: input needs wider integers to process","not-basic":"Illegal input >= 0x80 (not a basic code point)","invalid-input":"Invalid input"},qr=Math.floor,Sr=String.fromCharCode;
+/*! https://mths.be/punycode v1.4.1 by @mathias */function Fr(e){throw new RangeError(Er[e])}function Lr(e,r){for(var t=e.length,n=[];t--;)n[t]=r(e[t]);return n}function zr(e,r){var t=e.split("@"),n="";return t.length>1&&(n=t[0]+"@",e=t[1]),n+Lr((e=e.replace(wr,".")).split("."),r).join(".")}function Tr(e){for(var r,t,n=[],s=0,o=e.length;s<o;)(r=e.charCodeAt(s++))>=55296&&r<=56319&&s<o?56320==(64512&(t=e.charCodeAt(s++)))?n.push(((1023&r)<<10)+(1023&t)+65536):(n.push(r),s--):n.push(r);return n}function Ir(e){return Lr(e,(function(e){var r="";return e>65535&&(r+=Sr((e-=65536)>>>10&1023|55296),e=56320|1023&e),r+=Sr(e)})).join("")}function Mr(e,r){return e+22+75*(e<26)-((0!=r)<<5)}function Rr(e,r,t){var n=0;for(e=t?qr(e/700):e>>1,e+=qr(e/r);e>455;n+=Ar)e=qr(e/35);return qr(n+36*e/(e+38))}function Br(e){var r,t,n,s,o,i,a,c,l,u,p,h=[],f=e.length,d=0,m=128,g=72;for((t=e.lastIndexOf("-"))<0&&(t=0),n=0;n<t;++n)e.charCodeAt(n)>=128&&Fr("not-basic"),h.push(e.charCodeAt(n));for(s=t>0?t+1:0;s<f;){for(o=d,i=1,a=Ar;s>=f&&Fr("invalid-input"),((c=(p=e.charCodeAt(s++))-48<10?p-22:p-65<26?p-65:p-97<26?p-97:Ar)>=Ar||c>qr((yr-d)/i))&&Fr("overflow"),d+=c*i,!(c<(l=a<=g?1:a>=g+26?26:a-g));a+=Ar)i>qr(yr/(u=Ar-l))&&Fr("overflow"),i*=u;g=Rr(d-o,r=h.length+1,0==o),qr(d/r)>yr-m&&Fr("overflow"),m+=qr(d/r),d%=r,h.splice(d++,0,m)}return Ir(h)}function Nr(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,g=[];for(h=(e=Tr(e)).length,r=128,t=0,o=72,i=0;i<h;++i)(p=e[i])<128&&g.push(Sr(p));for(n=s=g.length,s&&g.push("-");n<h;){for(a=yr,i=0;i<h;++i)(p=e[i])>=r&&p<a&&(a=p);for(a-r>qr((yr-t)/(f=n+1))&&Fr("overflow"),t+=(a-r)*f,r=a,i=0;i<h;++i)if((p=e[i])<r&&++t>yr&&Fr("overflow"),p==r){for(c=t,l=Ar;!(c<(u=l<=o?1:l>=o+26?26:l-o));l+=Ar)m=c-u,d=Ar-u,g.push(Sr(Mr(u+m%d,0))),c=qr(m/d);g.push(Sr(Mr(c,0))),o=Rr(t,f,n==s),t=0,++n}++t,++r}return g.join("")}function Or(e){return zr(e,(function(e){return xr.test(e)?Br(e.slice(4).toLowerCase()):e}))}function Pr(e){return zr(e,(function(e){return Dr.test(e)?"xn--"+Nr(e):e}))}var jr="1.4.1",Ur={decode:Tr,encode:Ir},Vr={version:jr,ucs2:Ur,toASCII:Pr,toUnicode:Or,encode:Nr,decode:Br},Zr=e(Object.freeze({__proto__:null,decode:Br,encode:Nr,toUnicode:Or,toASCII:Pr,version:jr,ucs2:Ur,default:Vr})),Gr={default:{options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:100},components:{core:{},block:{},inline:{}}},zero:{options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["paragraph"]},inline:{rules:["text"],rules2:["balance_pairs","text_collapse"]}}},commonmark:{options:{html:!0,xhtmlOut:!0,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["blockquote","code","fence","heading","hr","html_block","lheading","list","reference","paragraph"]},inline:{rules:["autolink","backticks","emphasis","entity","escape","html_inline","image","link","newline","text"],rules2:["balance_pairs","emphasis","text_collapse"]}}}},$r=/^(vbscript|javascript|file|data):/,Hr=/^data:image\/(gif|png|jpeg|webp);/;function Jr(e){var r=e.trim().toLowerCase();return!$r.test(r)||!!Hr.test(r)}var Wr=["http:","https:","mailto:"];function Yr(e){var r=C.parse(e,!0);if(r.hostname&&(!r.protocol||Wr.indexOf(r.protocol)>=0))try{r.hostname=Zr.toASCII(r.hostname)}catch(e){}return C.encode(C.format(r))}function Kr(e){var r=C.parse(e,!0);if(r.hostname&&(!r.protocol||Wr.indexOf(r.protocol)>=0))try{r.hostname=Zr.toUnicode(r.hostname)}catch(e){}return C.decode(C.format(r),C.decode.defaultChars+"%")}function Qr(e,r){if(!(this instanceof Qr))return new Qr(e,r);r||w.isString(e)||(r=e||{},e="default"),this.inline=new lr,this.block=new ze,this.core=new ue,this.renderer=new B,this.linkify=new Cr,this.validateLink=Jr,this.normalizeLink=Yr,this.normalizeLinkText=Kr,this.utils=w,this.helpers=w.assign({},L),this.options={},this.configure(e),r&&this.set(r)}return Qr.prototype.set=function(e){return w.assign(this.options,e),this},Qr.prototype.configure=function(e){var r,t=this;if(w.isString(e)&&!(e=Gr[r=e]))throw new Error('Wrong `markdown-it` preset "'+r+'", check name');if(!e)throw new Error("Wrong `markdown-it` preset, can't be empty");return e.options&&t.set(e.options),e.components&&Object.keys(e.components).forEach((function(r){e.components[r].rules&&t[r].ruler.enableOnly(e.components[r].rules),e.components[r].rules2&&t[r].ruler2.enableOnly(e.components[r].rules2)})),this},Qr.prototype.enable=function(e,r){var t=[];Array.isArray(e)||(e=[e]),["core","block","inline"].forEach((function(r){t=t.concat(this[r].ruler.enable(e,!0))}),this),t=t.concat(this.inline.ruler2.enable(e,!0));var n=e.filter((function(e){return t.indexOf(e)<0}));if(n.length&&!r)throw new Error("MarkdownIt. Failed to enable unknown rule(s): "+n);return this},Qr.prototype.disable=function(e,r){var t=[];Array.isArray(e)||(e=[e]),["core","block","inline"].forEach((function(r){t=t.concat(this[r].ruler.disable(e,!0))}),this),t=t.concat(this.inline.ruler2.disable(e,!0));var n=e.filter((function(e){return t.indexOf(e)<0}));if(n.length&&!r)throw new Error("MarkdownIt. Failed to disable unknown rule(s): "+n);return this},Qr.prototype.use=function(e){var r=[this].concat(Array.prototype.slice.call(arguments,1));return e.apply(e,r),this},Qr.prototype.parse=function(e,r){if("string"!=typeof e)throw new Error("Input data should be a String");var t=new this.core.State(e,this,r);return this.core.process(t),t.tokens},Qr.prototype.render=function(e,r){return r=r||{},this.renderer.render(this.parse(e,r),this.options,r)},Qr.prototype.parseInline=function(e,r){var t=new this.core.State(e,this,r);return t.inlineMode=!0,this.core.process(t),t.tokens},Qr.prototype.renderInline=function(e,r){return r=r||{},this.renderer.render(this.parseInline(e,r),this.options,r)},Qr}));
diff --git a/node_modules/markdown-it/index.js b/node_modules/markdown-it/index.js
new file mode 100644
index 0000000..f71477e
--- /dev/null
+++ b/node_modules/markdown-it/index.js
@@ -0,0 +1,4 @@
+'use strict';
+
+
+module.exports = require('./lib/');
diff --git a/node_modules/markdown-it/lib/common/entities.js b/node_modules/markdown-it/lib/common/entities.js
new file mode 100644
index 0000000..c2e23e9
--- /dev/null
+++ b/node_modules/markdown-it/lib/common/entities.js
@@ -0,0 +1,6 @@
+// HTML5 entities map: { name -> utf16string }
+//
+'use strict';
+
+/*eslint quotes:0*/
+module.exports = require('entities/lib/maps/entities.json');
diff --git a/node_modules/markdown-it/lib/common/html_blocks.js b/node_modules/markdown-it/lib/common/html_blocks.js
new file mode 100644
index 0000000..daa6b46
--- /dev/null
+++ b/node_modules/markdown-it/lib/common/html_blocks.js
@@ -0,0 +1,70 @@
+// List of valid html blocks names, accorting to commonmark spec
+// http://jgm.github.io/CommonMark/spec.html#html-blocks
+
+'use strict';
+
+
+module.exports = [
+ 'address',
+ 'article',
+ 'aside',
+ 'base',
+ 'basefont',
+ 'blockquote',
+ 'body',
+ 'caption',
+ 'center',
+ 'col',
+ 'colgroup',
+ 'dd',
+ 'details',
+ 'dialog',
+ 'dir',
+ 'div',
+ 'dl',
+ 'dt',
+ 'fieldset',
+ 'figcaption',
+ 'figure',
+ 'footer',
+ 'form',
+ 'frame',
+ 'frameset',
+ 'h1',
+ 'h2',
+ 'h3',
+ 'h4',
+ 'h5',
+ 'h6',
+ 'head',
+ 'header',
+ 'hr',
+ 'html',
+ 'iframe',
+ 'legend',
+ 'li',
+ 'link',
+ 'main',
+ 'menu',
+ 'menuitem',
+ 'nav',
+ 'noframes',
+ 'ol',
+ 'optgroup',
+ 'option',
+ 'p',
+ 'param',
+ 'section',
+ 'source',
+ 'summary',
+ 'table',
+ 'tbody',
+ 'td',
+ 'tfoot',
+ 'th',
+ 'thead',
+ 'title',
+ 'tr',
+ 'track',
+ 'ul'
+];
diff --git a/node_modules/markdown-it/lib/common/html_re.js b/node_modules/markdown-it/lib/common/html_re.js
new file mode 100644
index 0000000..df81906
--- /dev/null
+++ b/node_modules/markdown-it/lib/common/html_re.js
@@ -0,0 +1,28 @@
+// Regexps to match html elements
+
+'use strict';
+
+var attr_name = '[a-zA-Z_:][a-zA-Z0-9:._-]*';
+
+var unquoted = '[^"\'=<>`\\x00-\\x20]+';
+var single_quoted = "'[^']*'";
+var double_quoted = '"[^"]*"';
+
+var attr_value = '(?:' + unquoted + '|' + single_quoted + '|' + double_quoted + ')';
+
+var attribute = '(?:\\s+' + attr_name + '(?:\\s*=\\s*' + attr_value + ')?)';
+
+var open_tag = '<[A-Za-z][A-Za-z0-9\\-]*' + attribute + '*\\s*\\/?>';
+
+var close_tag = '<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>';
+var comment = '<!---->|<!--(?:-?[^>-])(?:-?[^-])*-->';
+var processing = '<[?][\\s\\S]*?[?]>';
+var declaration = '<![A-Z]+\\s+[^>]*>';
+var cdata = '<!\\[CDATA\\[[\\s\\S]*?\\]\\]>';
+
+var HTML_TAG_RE = new RegExp('^(?:' + open_tag + '|' + close_tag + '|' + comment +
+ '|' + processing + '|' + declaration + '|' + cdata + ')');
+var HTML_OPEN_CLOSE_TAG_RE = new RegExp('^(?:' + open_tag + '|' + close_tag + ')');
+
+module.exports.HTML_TAG_RE = HTML_TAG_RE;
+module.exports.HTML_OPEN_CLOSE_TAG_RE = HTML_OPEN_CLOSE_TAG_RE;
diff --git a/node_modules/markdown-it/lib/common/utils.js b/node_modules/markdown-it/lib/common/utils.js
new file mode 100644
index 0000000..712cd29
--- /dev/null
+++ b/node_modules/markdown-it/lib/common/utils.js
@@ -0,0 +1,317 @@
+// Utilities
+//
+'use strict';
+
+
+function _class(obj) { return Object.prototype.toString.call(obj); }
+
+function isString(obj) { return _class(obj) === '[object String]'; }
+
+var _hasOwnProperty = Object.prototype.hasOwnProperty;
+
+function has(object, key) {
+ return _hasOwnProperty.call(object, key);
+}
+
+// Merge objects
+//
+function assign(obj /*from1, from2, from3, ...*/) {
+ var sources = Array.prototype.slice.call(arguments, 1);
+
+ sources.forEach(function (source) {
+ if (!source) { return; }
+
+ if (typeof source !== 'object') {
+ throw new TypeError(source + 'must be object');
+ }
+
+ Object.keys(source).forEach(function (key) {
+ obj[key] = source[key];
+ });
+ });
+
+ return obj;
+}
+
+// Remove element from array and put another array at those position.
+// Useful for some operations with tokens
+function arrayReplaceAt(src, pos, newElements) {
+ return [].concat(src.slice(0, pos), newElements, src.slice(pos + 1));
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+function isValidEntityCode(c) {
+ /*eslint no-bitwise:0*/
+ // broken sequence
+ if (c >= 0xD800 && c <= 0xDFFF) { return false; }
+ // never used
+ if (c >= 0xFDD0 && c <= 0xFDEF) { return false; }
+ if ((c & 0xFFFF) === 0xFFFF || (c & 0xFFFF) === 0xFFFE) { return false; }
+ // control codes
+ if (c >= 0x00 && c <= 0x08) { return false; }
+ if (c === 0x0B) { return false; }
+ if (c >= 0x0E && c <= 0x1F) { return false; }
+ if (c >= 0x7F && c <= 0x9F) { return false; }
+ // out of range
+ if (c > 0x10FFFF) { return false; }
+ return true;
+}
+
+function fromCodePoint(c) {
+ /*eslint no-bitwise:0*/
+ if (c > 0xffff) {
+ c -= 0x10000;
+ var surrogate1 = 0xd800 + (c >> 10),
+ surrogate2 = 0xdc00 + (c & 0x3ff);
+
+ return String.fromCharCode(surrogate1, surrogate2);
+ }
+ return String.fromCharCode(c);
+}
+
+
+var UNESCAPE_MD_RE = /\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g;
+var ENTITY_RE = /&([a-z#][a-z0-9]{1,31});/gi;
+var UNESCAPE_ALL_RE = new RegExp(UNESCAPE_MD_RE.source + '|' + ENTITY_RE.source, 'gi');
+
+var DIGITAL_ENTITY_TEST_RE = /^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i;
+
+var entities = require('./entities');
+
+function replaceEntityPattern(match, name) {
+ var code = 0;
+
+ if (has(entities, name)) {
+ return entities[name];
+ }
+
+ if (name.charCodeAt(0) === 0x23/* # */ && DIGITAL_ENTITY_TEST_RE.test(name)) {
+ code = name[1].toLowerCase() === 'x' ?
+ parseInt(name.slice(2), 16) : parseInt(name.slice(1), 10);
+
+ if (isValidEntityCode(code)) {
+ return fromCodePoint(code);
+ }
+ }
+
+ return match;
+}
+
+/*function replaceEntities(str) {
+ if (str.indexOf('&') < 0) { return str; }
+
+ return str.replace(ENTITY_RE, replaceEntityPattern);
+}*/
+
+function unescapeMd(str) {
+ if (str.indexOf('\\') < 0) { return str; }
+ return str.replace(UNESCAPE_MD_RE, '$1');
+}
+
+function unescapeAll(str) {
+ if (str.indexOf('\\') < 0 && str.indexOf('&') < 0) { return str; }
+
+ return str.replace(UNESCAPE_ALL_RE, function (match, escaped, entity) {
+ if (escaped) { return escaped; }
+ return replaceEntityPattern(match, entity);
+ });
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+var HTML_ESCAPE_TEST_RE = /[&<>"]/;
+var HTML_ESCAPE_REPLACE_RE = /[&<>"]/g;
+var HTML_REPLACEMENTS = {
+ '&': '&amp;',
+ '<': '&lt;',
+ '>': '&gt;',
+ '"': '&quot;'
+};
+
+function replaceUnsafeChar(ch) {
+ return HTML_REPLACEMENTS[ch];
+}
+
+function escapeHtml(str) {
+ if (HTML_ESCAPE_TEST_RE.test(str)) {
+ return str.replace(HTML_ESCAPE_REPLACE_RE, replaceUnsafeChar);
+ }
+ return str;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+var REGEXP_ESCAPE_RE = /[.?*+^$[\]\\(){}|-]/g;
+
+function escapeRE(str) {
+ return str.replace(REGEXP_ESCAPE_RE, '\\$&');
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+function isSpace(code) {
+ switch (code) {
+ case 0x09:
+ case 0x20:
+ return true;
+ }
+ return false;
+}
+
+// Zs (unicode class) || [\t\f\v\r\n]
+function isWhiteSpace(code) {
+ if (code >= 0x2000 && code <= 0x200A) { return true; }
+ switch (code) {
+ case 0x09: // \t
+ case 0x0A: // \n
+ case 0x0B: // \v
+ case 0x0C: // \f
+ case 0x0D: // \r
+ case 0x20:
+ case 0xA0:
+ case 0x1680:
+ case 0x202F:
+ case 0x205F:
+ case 0x3000:
+ return true;
+ }
+ return false;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+/*eslint-disable max-len*/
+var UNICODE_PUNCT_RE = require('uc.micro/categories/P/regex');
+
+// Currently without astral characters support.
+function isPunctChar(ch) {
+ return UNICODE_PUNCT_RE.test(ch);
+}
+
+
+// Markdown ASCII punctuation characters.
+//
+// !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~
+// http://spec.commonmark.org/0.15/#ascii-punctuation-character
+//
+// Don't confuse with unicode punctuation !!! It lacks some chars in ascii range.
+//
+function isMdAsciiPunct(ch) {
+ switch (ch) {
+ case 0x21/* ! */:
+ case 0x22/* " */:
+ case 0x23/* # */:
+ case 0x24/* $ */:
+ case 0x25/* % */:
+ case 0x26/* & */:
+ case 0x27/* ' */:
+ case 0x28/* ( */:
+ case 0x29/* ) */:
+ case 0x2A/* * */:
+ case 0x2B/* + */:
+ case 0x2C/* , */:
+ case 0x2D/* - */:
+ case 0x2E/* . */:
+ case 0x2F/* / */:
+ case 0x3A/* : */:
+ case 0x3B/* ; */:
+ case 0x3C/* < */:
+ case 0x3D/* = */:
+ case 0x3E/* > */:
+ case 0x3F/* ? */:
+ case 0x40/* @ */:
+ case 0x5B/* [ */:
+ case 0x5C/* \ */:
+ case 0x5D/* ] */:
+ case 0x5E/* ^ */:
+ case 0x5F/* _ */:
+ case 0x60/* ` */:
+ case 0x7B/* { */:
+ case 0x7C/* | */:
+ case 0x7D/* } */:
+ case 0x7E/* ~ */:
+ return true;
+ default:
+ return false;
+ }
+}
+
+// Hepler to unify [reference labels].
+//
+function normalizeReference(str) {
+ // Trim and collapse whitespace
+ //
+ str = str.trim().replace(/\s+/g, ' ');
+
+ // In node v10 'ẞ'.toLowerCase() === 'Ṿ', which is presumed to be a bug
+ // fixed in v12 (couldn't find any details).
+ //
+ // So treat this one as a special case
+ // (remove this when node v10 is no longer supported).
+ //
+ if ('ẞ'.toLowerCase() === 'Ṿ') {
+ str = str.replace(/ẞ/g, 'ß');
+ }
+
+ // .toLowerCase().toUpperCase() should get rid of all differences
+ // between letter variants.
+ //
+ // Simple .toLowerCase() doesn't normalize 125 code points correctly,
+ // and .toUpperCase doesn't normalize 6 of them (list of exceptions:
+ // İ, ϴ, ẞ, Ω, K, Å - those are already uppercased, but have differently
+ // uppercased versions).
+ //
+ // Here's an example showing how it happens. Lets take greek letter omega:
+ // uppercase U+0398 (Θ), U+03f4 (ϴ) and lowercase U+03b8 (θ), U+03d1 (ϑ)
+ //
+ // Unicode entries:
+ // 0398;GREEK CAPITAL LETTER THETA;Lu;0;L;;;;;N;;;;03B8;
+ // 03B8;GREEK SMALL LETTER THETA;Ll;0;L;;;;;N;;;0398;;0398
+ // 03D1;GREEK THETA SYMBOL;Ll;0;L;<compat> 03B8;;;;N;GREEK SMALL LETTER SCRIPT THETA;;0398;;0398
+ // 03F4;GREEK CAPITAL THETA SYMBOL;Lu;0;L;<compat> 0398;;;;N;;;;03B8;
+ //
+ // Case-insensitive comparison should treat all of them as equivalent.
+ //
+ // But .toLowerCase() doesn't change ϑ (it's already lowercase),
+ // and .toUpperCase() doesn't change ϴ (already uppercase).
+ //
+ // Applying first lower then upper case normalizes any character:
+ // '\u0398\u03f4\u03b8\u03d1'.toLowerCase().toUpperCase() === '\u0398\u0398\u0398\u0398'
+ //
+ // Note: this is equivalent to unicode case folding; unicode normalization
+ // is a different step that is not required here.
+ //
+ // Final result should be uppercased, because it's later stored in an object
+ // (this avoid a conflict with Object.prototype members,
+ // most notably, `__proto__`)
+ //
+ return str.toLowerCase().toUpperCase();
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+// Re-export libraries commonly used in both markdown-it and its plugins,
+// so plugins won't have to depend on them explicitly, which reduces their
+// bundled size (e.g. a browser build).
+//
+exports.lib = {};
+exports.lib.mdurl = require('mdurl');
+exports.lib.ucmicro = require('uc.micro');
+
+exports.assign = assign;
+exports.isString = isString;
+exports.has = has;
+exports.unescapeMd = unescapeMd;
+exports.unescapeAll = unescapeAll;
+exports.isValidEntityCode = isValidEntityCode;
+exports.fromCodePoint = fromCodePoint;
+// exports.replaceEntities = replaceEntities;
+exports.escapeHtml = escapeHtml;
+exports.arrayReplaceAt = arrayReplaceAt;
+exports.isSpace = isSpace;
+exports.isWhiteSpace = isWhiteSpace;
+exports.isMdAsciiPunct = isMdAsciiPunct;
+exports.isPunctChar = isPunctChar;
+exports.escapeRE = escapeRE;
+exports.normalizeReference = normalizeReference;
diff --git a/node_modules/markdown-it/lib/helpers/index.js b/node_modules/markdown-it/lib/helpers/index.js
new file mode 100644
index 0000000..bfdbfa2
--- /dev/null
+++ b/node_modules/markdown-it/lib/helpers/index.js
@@ -0,0 +1,7 @@
+// Just a shortcut for bulk export
+'use strict';
+
+
+exports.parseLinkLabel = require('./parse_link_label');
+exports.parseLinkDestination = require('./parse_link_destination');
+exports.parseLinkTitle = require('./parse_link_title');
diff --git a/node_modules/markdown-it/lib/helpers/parse_link_destination.js b/node_modules/markdown-it/lib/helpers/parse_link_destination.js
new file mode 100644
index 0000000..637f1f4
--- /dev/null
+++ b/node_modules/markdown-it/lib/helpers/parse_link_destination.js
@@ -0,0 +1,82 @@
+// Parse link destination
+//
+'use strict';
+
+
+var unescapeAll = require('../common/utils').unescapeAll;
+
+
+module.exports = function parseLinkDestination(str, pos, max) {
+ var code, level,
+ lines = 0,
+ start = pos,
+ result = {
+ ok: false,
+ pos: 0,
+ lines: 0,
+ str: ''
+ };
+
+ if (str.charCodeAt(pos) === 0x3C /* < */) {
+ pos++;
+ while (pos < max) {
+ code = str.charCodeAt(pos);
+ if (code === 0x0A /* \n */) { return result; }
+ if (code === 0x3C /* < */) { return result; }
+ if (code === 0x3E /* > */) {
+ result.pos = pos + 1;
+ result.str = unescapeAll(str.slice(start + 1, pos));
+ result.ok = true;
+ return result;
+ }
+ if (code === 0x5C /* \ */ && pos + 1 < max) {
+ pos += 2;
+ continue;
+ }
+
+ pos++;
+ }
+
+ // no closing '>'
+ return result;
+ }
+
+ // this should be ... } else { ... branch
+
+ level = 0;
+ while (pos < max) {
+ code = str.charCodeAt(pos);
+
+ if (code === 0x20) { break; }
+
+ // ascii control characters
+ if (code < 0x20 || code === 0x7F) { break; }
+
+ if (code === 0x5C /* \ */ && pos + 1 < max) {
+ if (str.charCodeAt(pos + 1) === 0x20) { break; }
+ pos += 2;
+ continue;
+ }
+
+ if (code === 0x28 /* ( */) {
+ level++;
+ if (level > 32) { return result; }
+ }
+
+ if (code === 0x29 /* ) */) {
+ if (level === 0) { break; }
+ level--;
+ }
+
+ pos++;
+ }
+
+ if (start === pos) { return result; }
+ if (level !== 0) { return result; }
+
+ result.str = unescapeAll(str.slice(start, pos));
+ result.lines = lines;
+ result.pos = pos;
+ result.ok = true;
+ return result;
+};
diff --git a/node_modules/markdown-it/lib/helpers/parse_link_label.js b/node_modules/markdown-it/lib/helpers/parse_link_label.js
new file mode 100644
index 0000000..5a450fd
--- /dev/null
+++ b/node_modules/markdown-it/lib/helpers/parse_link_label.js
@@ -0,0 +1,48 @@
+// Parse link label
+//
+// this function assumes that first character ("[") already matches;
+// returns the end of the label
+//
+'use strict';
+
+module.exports = function parseLinkLabel(state, start, disableNested) {
+ var level, found, marker, prevPos,
+ labelEnd = -1,
+ max = state.posMax,
+ oldPos = state.pos;
+
+ state.pos = start + 1;
+ level = 1;
+
+ while (state.pos < max) {
+ marker = state.src.charCodeAt(state.pos);
+ if (marker === 0x5D /* ] */) {
+ level--;
+ if (level === 0) {
+ found = true;
+ break;
+ }
+ }
+
+ prevPos = state.pos;
+ state.md.inline.skipToken(state);
+ if (marker === 0x5B /* [ */) {
+ if (prevPos === state.pos - 1) {
+ // increase level if we find text `[`, which is not a part of any token
+ level++;
+ } else if (disableNested) {
+ state.pos = oldPos;
+ return -1;
+ }
+ }
+ }
+
+ if (found) {
+ labelEnd = state.pos;
+ }
+
+ // restore old state
+ state.pos = oldPos;
+
+ return labelEnd;
+};
diff --git a/node_modules/markdown-it/lib/helpers/parse_link_title.js b/node_modules/markdown-it/lib/helpers/parse_link_title.js
new file mode 100644
index 0000000..051d6f4
--- /dev/null
+++ b/node_modules/markdown-it/lib/helpers/parse_link_title.js
@@ -0,0 +1,55 @@
+// Parse link title
+//
+'use strict';
+
+
+var unescapeAll = require('../common/utils').unescapeAll;
+
+
+module.exports = function parseLinkTitle(str, pos, max) {
+ var code,
+ marker,
+ lines = 0,
+ start = pos,
+ result = {
+ ok: false,
+ pos: 0,
+ lines: 0,
+ str: ''
+ };
+
+ if (pos >= max) { return result; }
+
+ marker = str.charCodeAt(pos);
+
+ if (marker !== 0x22 /* " */ && marker !== 0x27 /* ' */ && marker !== 0x28 /* ( */) { return result; }
+
+ pos++;
+
+ // if opening marker is "(", switch it to closing marker ")"
+ if (marker === 0x28) { marker = 0x29; }
+
+ while (pos < max) {
+ code = str.charCodeAt(pos);
+ if (code === marker) {
+ result.pos = pos + 1;
+ result.lines = lines;
+ result.str = unescapeAll(str.slice(start + 1, pos));
+ result.ok = true;
+ return result;
+ } else if (code === 0x28 /* ( */ && marker === 0x29 /* ) */) {
+ return result;
+ } else if (code === 0x0A) {
+ lines++;
+ } else if (code === 0x5C /* \ */ && pos + 1 < max) {
+ pos++;
+ if (str.charCodeAt(pos) === 0x0A) {
+ lines++;
+ }
+ }
+
+ pos++;
+ }
+
+ return result;
+};
diff --git a/node_modules/markdown-it/lib/index.js b/node_modules/markdown-it/lib/index.js
new file mode 100644
index 0000000..afec8d8
--- /dev/null
+++ b/node_modules/markdown-it/lib/index.js
@@ -0,0 +1,582 @@
+// Main parser class
+
+'use strict';
+
+
+var utils = require('./common/utils');
+var helpers = require('./helpers');
+var Renderer = require('./renderer');
+var ParserCore = require('./parser_core');
+var ParserBlock = require('./parser_block');
+var ParserInline = require('./parser_inline');
+var LinkifyIt = require('linkify-it');
+var mdurl = require('mdurl');
+var punycode = require('punycode');
+
+
+var config = {
+ default: require('./presets/default'),
+ zero: require('./presets/zero'),
+ commonmark: require('./presets/commonmark')
+};
+
+////////////////////////////////////////////////////////////////////////////////
+//
+// This validator can prohibit more than really needed to prevent XSS. It's a
+// tradeoff to keep code simple and to be secure by default.
+//
+// If you need different setup - override validator method as you wish. Or
+// replace it with dummy function and use external sanitizer.
+//
+
+var BAD_PROTO_RE = /^(vbscript|javascript|file|data):/;
+var GOOD_DATA_RE = /^data:image\/(gif|png|jpeg|webp);/;
+
+function validateLink(url) {
+ // url should be normalized at this point, and existing entities are decoded
+ var str = url.trim().toLowerCase();
+
+ return BAD_PROTO_RE.test(str) ? (GOOD_DATA_RE.test(str) ? true : false) : true;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+
+
+var RECODE_HOSTNAME_FOR = [ 'http:', 'https:', 'mailto:' ];
+
+function normalizeLink(url) {
+ var parsed = mdurl.parse(url, true);
+
+ if (parsed.hostname) {
+ // Encode hostnames in urls like:
+ // `http://host/`, `https://host/`, `mailto:user@host`, `//host/`
+ //
+ // We don't encode unknown schemas, because it's likely that we encode
+ // something we shouldn't (e.g. `skype:name` treated as `skype:host`)
+ //
+ if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) {
+ try {
+ parsed.hostname = punycode.toASCII(parsed.hostname);
+ } catch (er) { /**/ }
+ }
+ }
+
+ return mdurl.encode(mdurl.format(parsed));
+}
+
+function normalizeLinkText(url) {
+ var parsed = mdurl.parse(url, true);
+
+ if (parsed.hostname) {
+ // Encode hostnames in urls like:
+ // `http://host/`, `https://host/`, `mailto:user@host`, `//host/`
+ //
+ // We don't encode unknown schemas, because it's likely that we encode
+ // something we shouldn't (e.g. `skype:name` treated as `skype:host`)
+ //
+ if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) {
+ try {
+ parsed.hostname = punycode.toUnicode(parsed.hostname);
+ } catch (er) { /**/ }
+ }
+ }
+
+ // add '%' to exclude list because of https://github.com/markdown-it/markdown-it/issues/720
+ return mdurl.decode(mdurl.format(parsed), mdurl.decode.defaultChars + '%');
+}
+
+
+/**
+ * class MarkdownIt
+ *
+ * Main parser/renderer class.
+ *
+ * ##### Usage
+ *
+ * ```javascript
+ * // node.js, "classic" way:
+ * var MarkdownIt = require('markdown-it'),
+ * md = new MarkdownIt();
+ * var result = md.render('# markdown-it rulezz!');
+ *
+ * // node.js, the same, but with sugar:
+ * var md = require('markdown-it')();
+ * var result = md.render('# markdown-it rulezz!');
+ *
+ * // browser without AMD, added to "window" on script load
+ * // Note, there are no dash.
+ * var md = window.markdownit();
+ * var result = md.render('# markdown-it rulezz!');
+ * ```
+ *
+ * Single line rendering, without paragraph wrap:
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ * var result = md.renderInline('__markdown-it__ rulezz!');
+ * ```
+ **/
+
+/**
+ * new MarkdownIt([presetName, options])
+ * - presetName (String): optional, `commonmark` / `zero`
+ * - options (Object)
+ *
+ * Creates parser instanse with given config. Can be called without `new`.
+ *
+ * ##### presetName
+ *
+ * MarkdownIt provides named presets as a convenience to quickly
+ * enable/disable active syntax rules and options for common use cases.
+ *
+ * - ["commonmark"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/commonmark.js) -
+ * configures parser to strict [CommonMark](http://commonmark.org/) mode.
+ * - [default](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/default.js) -
+ * similar to GFM, used when no preset name given. Enables all available rules,
+ * but still without html, typographer & autolinker.
+ * - ["zero"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/zero.js) -
+ * all rules disabled. Useful to quickly setup your config via `.enable()`.
+ * For example, when you need only `bold` and `italic` markup and nothing else.
+ *
+ * ##### options:
+ *
+ * - __html__ - `false`. Set `true` to enable HTML tags in source. Be careful!
+ * That's not safe! You may need external sanitizer to protect output from XSS.
+ * It's better to extend features via plugins, instead of enabling HTML.
+ * - __xhtmlOut__ - `false`. Set `true` to add '/' when closing single tags
+ * (`<br />`). This is needed only for full CommonMark compatibility. In real
+ * world you will need HTML output.
+ * - __breaks__ - `false`. Set `true` to convert `\n` in paragraphs into `<br>`.
+ * - __langPrefix__ - `language-`. CSS language class prefix for fenced blocks.
+ * Can be useful for external highlighters.
+ * - __linkify__ - `false`. Set `true` to autoconvert URL-like text to links.
+ * - __typographer__ - `false`. Set `true` to enable [some language-neutral
+ * replacement](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js) +
+ * quotes beautification (smartquotes).
+ * - __quotes__ - `“”‘’`, String or Array. Double + single quotes replacement
+ * pairs, when typographer enabled and smartquotes on. For example, you can
+ * use `'«»„“'` for Russian, `'„“‚‘'` for German, and
+ * `['«\xA0', '\xA0»', '‹\xA0', '\xA0›']` for French (including nbsp).
+ * - __highlight__ - `null`. Highlighter function for fenced code blocks.
+ * Highlighter `function (str, lang)` should return escaped HTML. It can also
+ * return empty string if the source was not changed and should be escaped
+ * externaly. If result starts with <pre... internal wrapper is skipped.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * // commonmark mode
+ * var md = require('markdown-it')('commonmark');
+ *
+ * // default mode
+ * var md = require('markdown-it')();
+ *
+ * // enable everything
+ * var md = require('markdown-it')({
+ * html: true,
+ * linkify: true,
+ * typographer: true
+ * });
+ * ```
+ *
+ * ##### Syntax highlighting
+ *
+ * ```js
+ * var hljs = require('highlight.js') // https://highlightjs.org/
+ *
+ * var md = require('markdown-it')({
+ * highlight: function (str, lang) {
+ * if (lang && hljs.getLanguage(lang)) {
+ * try {
+ * return hljs.highlight(str, { language: lang, ignoreIllegals: true }).value;
+ * } catch (__) {}
+ * }
+ *
+ * return ''; // use external default escaping
+ * }
+ * });
+ * ```
+ *
+ * Or with full wrapper override (if you need assign class to `<pre>`):
+ *
+ * ```javascript
+ * var hljs = require('highlight.js') // https://highlightjs.org/
+ *
+ * // Actual default values
+ * var md = require('markdown-it')({
+ * highlight: function (str, lang) {
+ * if (lang && hljs.getLanguage(lang)) {
+ * try {
+ * return '<pre class="hljs"><code>' +
+ * hljs.highlight(str, { language: lang, ignoreIllegals: true }).value +
+ * '</code></pre>';
+ * } catch (__) {}
+ * }
+ *
+ * return '<pre class="hljs"><code>' + md.utils.escapeHtml(str) + '</code></pre>';
+ * }
+ * });
+ * ```
+ *
+ **/
+function MarkdownIt(presetName, options) {
+ if (!(this instanceof MarkdownIt)) {
+ return new MarkdownIt(presetName, options);
+ }
+
+ if (!options) {
+ if (!utils.isString(presetName)) {
+ options = presetName || {};
+ presetName = 'default';
+ }
+ }
+
+ /**
+ * MarkdownIt#inline -> ParserInline
+ *
+ * Instance of [[ParserInline]]. You may need it to add new rules when
+ * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+ * [[MarkdownIt.enable]].
+ **/
+ this.inline = new ParserInline();
+
+ /**
+ * MarkdownIt#block -> ParserBlock
+ *
+ * Instance of [[ParserBlock]]. You may need it to add new rules when
+ * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+ * [[MarkdownIt.enable]].
+ **/
+ this.block = new ParserBlock();
+
+ /**
+ * MarkdownIt#core -> Core
+ *
+ * Instance of [[Core]] chain executor. You may need it to add new rules when
+ * writing plugins. For simple rules control use [[MarkdownIt.disable]] and
+ * [[MarkdownIt.enable]].
+ **/
+ this.core = new ParserCore();
+
+ /**
+ * MarkdownIt#renderer -> Renderer
+ *
+ * Instance of [[Renderer]]. Use it to modify output look. Or to add rendering
+ * rules for new token types, generated by plugins.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * function myToken(tokens, idx, options, env, self) {
+ * //...
+ * return result;
+ * };
+ *
+ * md.renderer.rules['my_token'] = myToken
+ * ```
+ *
+ * See [[Renderer]] docs and [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js).
+ **/
+ this.renderer = new Renderer();
+
+ /**
+ * MarkdownIt#linkify -> LinkifyIt
+ *
+ * [linkify-it](https://github.com/markdown-it/linkify-it) instance.
+ * Used by [linkify](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/linkify.js)
+ * rule.
+ **/
+ this.linkify = new LinkifyIt();
+
+ /**
+ * MarkdownIt#validateLink(url) -> Boolean
+ *
+ * Link validation function. CommonMark allows too much in links. By default
+ * we disable `javascript:`, `vbscript:`, `file:` schemas, and almost all `data:...` schemas
+ * except some embedded image types.
+ *
+ * You can change this behaviour:
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ * // enable everything
+ * md.validateLink = function () { return true; }
+ * ```
+ **/
+ this.validateLink = validateLink;
+
+ /**
+ * MarkdownIt#normalizeLink(url) -> String
+ *
+ * Function used to encode link url to a machine-readable format,
+ * which includes url-encoding, punycode, etc.
+ **/
+ this.normalizeLink = normalizeLink;
+
+ /**
+ * MarkdownIt#normalizeLinkText(url) -> String
+ *
+ * Function used to decode link url to a human-readable format`
+ **/
+ this.normalizeLinkText = normalizeLinkText;
+
+
+ // Expose utils & helpers for easy acces from plugins
+
+ /**
+ * MarkdownIt#utils -> utils
+ *
+ * Assorted utility functions, useful to write plugins. See details
+ * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/common/utils.js).
+ **/
+ this.utils = utils;
+
+ /**
+ * MarkdownIt#helpers -> helpers
+ *
+ * Link components parser functions, useful to write plugins. See details
+ * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/helpers).
+ **/
+ this.helpers = utils.assign({}, helpers);
+
+
+ this.options = {};
+ this.configure(presetName);
+
+ if (options) { this.set(options); }
+}
+
+
+/** chainable
+ * MarkdownIt.set(options)
+ *
+ * Set parser options (in the same format as in constructor). Probably, you
+ * will never need it, but you can change options after constructor call.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')()
+ * .set({ html: true, breaks: true })
+ * .set({ typographer, true });
+ * ```
+ *
+ * __Note:__ To achieve the best possible performance, don't modify a
+ * `markdown-it` instance options on the fly. If you need multiple configurations
+ * it's best to create multiple instances and initialize each with separate
+ * config.
+ **/
+MarkdownIt.prototype.set = function (options) {
+ utils.assign(this.options, options);
+ return this;
+};
+
+
+/** chainable, internal
+ * MarkdownIt.configure(presets)
+ *
+ * Batch load of all options and compenent settings. This is internal method,
+ * and you probably will not need it. But if you will - see available presets
+ * and data structure [here](https://github.com/markdown-it/markdown-it/tree/master/lib/presets)
+ *
+ * We strongly recommend to use presets instead of direct config loads. That
+ * will give better compatibility with next versions.
+ **/
+MarkdownIt.prototype.configure = function (presets) {
+ var self = this, presetName;
+
+ if (utils.isString(presets)) {
+ presetName = presets;
+ presets = config[presetName];
+ if (!presets) { throw new Error('Wrong `markdown-it` preset "' + presetName + '", check name'); }
+ }
+
+ if (!presets) { throw new Error('Wrong `markdown-it` preset, can\'t be empty'); }
+
+ if (presets.options) { self.set(presets.options); }
+
+ if (presets.components) {
+ Object.keys(presets.components).forEach(function (name) {
+ if (presets.components[name].rules) {
+ self[name].ruler.enableOnly(presets.components[name].rules);
+ }
+ if (presets.components[name].rules2) {
+ self[name].ruler2.enableOnly(presets.components[name].rules2);
+ }
+ });
+ }
+ return this;
+};
+
+
+/** chainable
+ * MarkdownIt.enable(list, ignoreInvalid)
+ * - list (String|Array): rule name or list of rule names to enable
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable list or rules. It will automatically find appropriate components,
+ * containing rules with given names. If rule not found, and `ignoreInvalid`
+ * not set - throws exception.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')()
+ * .enable(['sub', 'sup'])
+ * .disable('smartquotes');
+ * ```
+ **/
+MarkdownIt.prototype.enable = function (list, ignoreInvalid) {
+ var result = [];
+
+ if (!Array.isArray(list)) { list = [ list ]; }
+
+ [ 'core', 'block', 'inline' ].forEach(function (chain) {
+ result = result.concat(this[chain].ruler.enable(list, true));
+ }, this);
+
+ result = result.concat(this.inline.ruler2.enable(list, true));
+
+ var missed = list.filter(function (name) { return result.indexOf(name) < 0; });
+
+ if (missed.length && !ignoreInvalid) {
+ throw new Error('MarkdownIt. Failed to enable unknown rule(s): ' + missed);
+ }
+
+ return this;
+};
+
+
+/** chainable
+ * MarkdownIt.disable(list, ignoreInvalid)
+ * - list (String|Array): rule name or list of rule names to disable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * The same as [[MarkdownIt.enable]], but turn specified rules off.
+ **/
+MarkdownIt.prototype.disable = function (list, ignoreInvalid) {
+ var result = [];
+
+ if (!Array.isArray(list)) { list = [ list ]; }
+
+ [ 'core', 'block', 'inline' ].forEach(function (chain) {
+ result = result.concat(this[chain].ruler.disable(list, true));
+ }, this);
+
+ result = result.concat(this.inline.ruler2.disable(list, true));
+
+ var missed = list.filter(function (name) { return result.indexOf(name) < 0; });
+
+ if (missed.length && !ignoreInvalid) {
+ throw new Error('MarkdownIt. Failed to disable unknown rule(s): ' + missed);
+ }
+ return this;
+};
+
+
+/** chainable
+ * MarkdownIt.use(plugin, params)
+ *
+ * Load specified plugin with given params into current parser instance.
+ * It's just a sugar to call `plugin(md, params)` with curring.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var iterator = require('markdown-it-for-inline');
+ * var md = require('markdown-it')()
+ * .use(iterator, 'foo_replace', 'text', function (tokens, idx) {
+ * tokens[idx].content = tokens[idx].content.replace(/foo/g, 'bar');
+ * });
+ * ```
+ **/
+MarkdownIt.prototype.use = function (plugin /*, params, ... */) {
+ var args = [ this ].concat(Array.prototype.slice.call(arguments, 1));
+ plugin.apply(plugin, args);
+ return this;
+};
+
+
+/** internal
+ * MarkdownIt.parse(src, env) -> Array
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Parse input string and return list of block tokens (special token type
+ * "inline" will contain list of inline tokens). You should not call this
+ * method directly, until you write custom renderer (for example, to produce
+ * AST).
+ *
+ * `env` is used to pass data between "distributed" rules and return additional
+ * metadata like reference info, needed for the renderer. It also can be used to
+ * inject data in specific cases. Usually, you will be ok to pass `{}`,
+ * and then pass updated object to renderer.
+ **/
+MarkdownIt.prototype.parse = function (src, env) {
+ if (typeof src !== 'string') {
+ throw new Error('Input data should be a String');
+ }
+
+ var state = new this.core.State(src, this, env);
+
+ this.core.process(state);
+
+ return state.tokens;
+};
+
+
+/**
+ * MarkdownIt.render(src [, env]) -> String
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Render markdown string into html. It does all magic for you :).
+ *
+ * `env` can be used to inject additional metadata (`{}` by default).
+ * But you will not need it with high probability. See also comment
+ * in [[MarkdownIt.parse]].
+ **/
+MarkdownIt.prototype.render = function (src, env) {
+ env = env || {};
+
+ return this.renderer.render(this.parse(src, env), this.options, env);
+};
+
+
+/** internal
+ * MarkdownIt.parseInline(src, env) -> Array
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * The same as [[MarkdownIt.parse]] but skip all block rules. It returns the
+ * block tokens list with the single `inline` element, containing parsed inline
+ * tokens in `children` property. Also updates `env` object.
+ **/
+MarkdownIt.prototype.parseInline = function (src, env) {
+ var state = new this.core.State(src, this, env);
+
+ state.inlineMode = true;
+ this.core.process(state);
+
+ return state.tokens;
+};
+
+
+/**
+ * MarkdownIt.renderInline(src [, env]) -> String
+ * - src (String): source string
+ * - env (Object): environment sandbox
+ *
+ * Similar to [[MarkdownIt.render]] but for single paragraph content. Result
+ * will NOT be wrapped into `<p>` tags.
+ **/
+MarkdownIt.prototype.renderInline = function (src, env) {
+ env = env || {};
+
+ return this.renderer.render(this.parseInline(src, env), this.options, env);
+};
+
+
+module.exports = MarkdownIt;
diff --git a/node_modules/markdown-it/lib/parser_block.js b/node_modules/markdown-it/lib/parser_block.js
new file mode 100644
index 0000000..5450c2a
--- /dev/null
+++ b/node_modules/markdown-it/lib/parser_block.js
@@ -0,0 +1,122 @@
+/** internal
+ * class ParserBlock
+ *
+ * Block-level tokenizer.
+ **/
+'use strict';
+
+
+var Ruler = require('./ruler');
+
+
+var _rules = [
+ // First 2 params - rule name & source. Secondary array - list of rules,
+ // which can be terminated by this one.
+ [ 'table', require('./rules_block/table'), [ 'paragraph', 'reference' ] ],
+ [ 'code', require('./rules_block/code') ],
+ [ 'fence', require('./rules_block/fence'), [ 'paragraph', 'reference', 'blockquote', 'list' ] ],
+ [ 'blockquote', require('./rules_block/blockquote'), [ 'paragraph', 'reference', 'blockquote', 'list' ] ],
+ [ 'hr', require('./rules_block/hr'), [ 'paragraph', 'reference', 'blockquote', 'list' ] ],
+ [ 'list', require('./rules_block/list'), [ 'paragraph', 'reference', 'blockquote' ] ],
+ [ 'reference', require('./rules_block/reference') ],
+ [ 'html_block', require('./rules_block/html_block'), [ 'paragraph', 'reference', 'blockquote' ] ],
+ [ 'heading', require('./rules_block/heading'), [ 'paragraph', 'reference', 'blockquote' ] ],
+ [ 'lheading', require('./rules_block/lheading') ],
+ [ 'paragraph', require('./rules_block/paragraph') ]
+];
+
+
+/**
+ * new ParserBlock()
+ **/
+function ParserBlock() {
+ /**
+ * ParserBlock#ruler -> Ruler
+ *
+ * [[Ruler]] instance. Keep configuration of block rules.
+ **/
+ this.ruler = new Ruler();
+
+ for (var i = 0; i < _rules.length; i++) {
+ this.ruler.push(_rules[i][0], _rules[i][1], { alt: (_rules[i][2] || []).slice() });
+ }
+}
+
+
+// Generate tokens for input range
+//
+ParserBlock.prototype.tokenize = function (state, startLine, endLine) {
+ var ok, i,
+ rules = this.ruler.getRules(''),
+ len = rules.length,
+ line = startLine,
+ hasEmptyLines = false,
+ maxNesting = state.md.options.maxNesting;
+
+ while (line < endLine) {
+ state.line = line = state.skipEmptyLines(line);
+ if (line >= endLine) { break; }
+
+ // Termination condition for nested calls.
+ // Nested calls currently used for blockquotes & lists
+ if (state.sCount[line] < state.blkIndent) { break; }
+
+ // If nesting level exceeded - skip tail to the end. That's not ordinary
+ // situation and we should not care about content.
+ if (state.level >= maxNesting) {
+ state.line = endLine;
+ break;
+ }
+
+ // Try all possible rules.
+ // On success, rule should:
+ //
+ // - update `state.line`
+ // - update `state.tokens`
+ // - return true
+
+ for (i = 0; i < len; i++) {
+ ok = rules[i](state, line, endLine, false);
+ if (ok) { break; }
+ }
+
+ // set state.tight if we had an empty line before current tag
+ // i.e. latest empty line should not count
+ state.tight = !hasEmptyLines;
+
+ // paragraph might "eat" one newline after it in nested lists
+ if (state.isEmpty(state.line - 1)) {
+ hasEmptyLines = true;
+ }
+
+ line = state.line;
+
+ if (line < endLine && state.isEmpty(line)) {
+ hasEmptyLines = true;
+ line++;
+ state.line = line;
+ }
+ }
+};
+
+
+/**
+ * ParserBlock.parse(str, md, env, outTokens)
+ *
+ * Process input string and push block tokens into `outTokens`
+ **/
+ParserBlock.prototype.parse = function (src, md, env, outTokens) {
+ var state;
+
+ if (!src) { return; }
+
+ state = new this.State(src, md, env, outTokens);
+
+ this.tokenize(state, state.line, state.lineMax);
+};
+
+
+ParserBlock.prototype.State = require('./rules_block/state_block');
+
+
+module.exports = ParserBlock;
diff --git a/node_modules/markdown-it/lib/parser_core.js b/node_modules/markdown-it/lib/parser_core.js
new file mode 100644
index 0000000..1eaa2b0
--- /dev/null
+++ b/node_modules/markdown-it/lib/parser_core.js
@@ -0,0 +1,58 @@
+/** internal
+ * class Core
+ *
+ * Top-level rules executor. Glues block/inline parsers and does intermediate
+ * transformations.
+ **/
+'use strict';
+
+
+var Ruler = require('./ruler');
+
+
+var _rules = [
+ [ 'normalize', require('./rules_core/normalize') ],
+ [ 'block', require('./rules_core/block') ],
+ [ 'inline', require('./rules_core/inline') ],
+ [ 'linkify', require('./rules_core/linkify') ],
+ [ 'replacements', require('./rules_core/replacements') ],
+ [ 'smartquotes', require('./rules_core/smartquotes') ]
+];
+
+
+/**
+ * new Core()
+ **/
+function Core() {
+ /**
+ * Core#ruler -> Ruler
+ *
+ * [[Ruler]] instance. Keep configuration of core rules.
+ **/
+ this.ruler = new Ruler();
+
+ for (var i = 0; i < _rules.length; i++) {
+ this.ruler.push(_rules[i][0], _rules[i][1]);
+ }
+}
+
+
+/**
+ * Core.process(state)
+ *
+ * Executes core chain rules.
+ **/
+Core.prototype.process = function (state) {
+ var i, l, rules;
+
+ rules = this.ruler.getRules('');
+
+ for (i = 0, l = rules.length; i < l; i++) {
+ rules[i](state);
+ }
+};
+
+Core.prototype.State = require('./rules_core/state_core');
+
+
+module.exports = Core;
diff --git a/node_modules/markdown-it/lib/parser_inline.js b/node_modules/markdown-it/lib/parser_inline.js
new file mode 100644
index 0000000..c8e66d3
--- /dev/null
+++ b/node_modules/markdown-it/lib/parser_inline.js
@@ -0,0 +1,177 @@
+/** internal
+ * class ParserInline
+ *
+ * Tokenizes paragraph content.
+ **/
+'use strict';
+
+
+var Ruler = require('./ruler');
+
+
+////////////////////////////////////////////////////////////////////////////////
+// Parser rules
+
+var _rules = [
+ [ 'text', require('./rules_inline/text') ],
+ [ 'newline', require('./rules_inline/newline') ],
+ [ 'escape', require('./rules_inline/escape') ],
+ [ 'backticks', require('./rules_inline/backticks') ],
+ [ 'strikethrough', require('./rules_inline/strikethrough').tokenize ],
+ [ 'emphasis', require('./rules_inline/emphasis').tokenize ],
+ [ 'link', require('./rules_inline/link') ],
+ [ 'image', require('./rules_inline/image') ],
+ [ 'autolink', require('./rules_inline/autolink') ],
+ [ 'html_inline', require('./rules_inline/html_inline') ],
+ [ 'entity', require('./rules_inline/entity') ]
+];
+
+var _rules2 = [
+ [ 'balance_pairs', require('./rules_inline/balance_pairs') ],
+ [ 'strikethrough', require('./rules_inline/strikethrough').postProcess ],
+ [ 'emphasis', require('./rules_inline/emphasis').postProcess ],
+ [ 'text_collapse', require('./rules_inline/text_collapse') ]
+];
+
+
+/**
+ * new ParserInline()
+ **/
+function ParserInline() {
+ var i;
+
+ /**
+ * ParserInline#ruler -> Ruler
+ *
+ * [[Ruler]] instance. Keep configuration of inline rules.
+ **/
+ this.ruler = new Ruler();
+
+ for (i = 0; i < _rules.length; i++) {
+ this.ruler.push(_rules[i][0], _rules[i][1]);
+ }
+
+ /**
+ * ParserInline#ruler2 -> Ruler
+ *
+ * [[Ruler]] instance. Second ruler used for post-processing
+ * (e.g. in emphasis-like rules).
+ **/
+ this.ruler2 = new Ruler();
+
+ for (i = 0; i < _rules2.length; i++) {
+ this.ruler2.push(_rules2[i][0], _rules2[i][1]);
+ }
+}
+
+
+// Skip single token by running all rules in validation mode;
+// returns `true` if any rule reported success
+//
+ParserInline.prototype.skipToken = function (state) {
+ var ok, i, pos = state.pos,
+ rules = this.ruler.getRules(''),
+ len = rules.length,
+ maxNesting = state.md.options.maxNesting,
+ cache = state.cache;
+
+
+ if (typeof cache[pos] !== 'undefined') {
+ state.pos = cache[pos];
+ return;
+ }
+
+ if (state.level < maxNesting) {
+ for (i = 0; i < len; i++) {
+ // Increment state.level and decrement it later to limit recursion.
+ // It's harmless to do here, because no tokens are created. But ideally,
+ // we'd need a separate private state variable for this purpose.
+ //
+ state.level++;
+ ok = rules[i](state, true);
+ state.level--;
+
+ if (ok) { break; }
+ }
+ } else {
+ // Too much nesting, just skip until the end of the paragraph.
+ //
+ // NOTE: this will cause links to behave incorrectly in the following case,
+ // when an amount of `[` is exactly equal to `maxNesting + 1`:
+ //
+ // [[[[[[[[[[[[[[[[[[[[[foo]()
+ //
+ // TODO: remove this workaround when CM standard will allow nested links
+ // (we can replace it by preventing links from being parsed in
+ // validation mode)
+ //
+ state.pos = state.posMax;
+ }
+
+ if (!ok) { state.pos++; }
+ cache[pos] = state.pos;
+};
+
+
+// Generate tokens for input range
+//
+ParserInline.prototype.tokenize = function (state) {
+ var ok, i,
+ rules = this.ruler.getRules(''),
+ len = rules.length,
+ end = state.posMax,
+ maxNesting = state.md.options.maxNesting;
+
+ while (state.pos < end) {
+ // Try all possible rules.
+ // On success, rule should:
+ //
+ // - update `state.pos`
+ // - update `state.tokens`
+ // - return true
+
+ if (state.level < maxNesting) {
+ for (i = 0; i < len; i++) {
+ ok = rules[i](state, false);
+ if (ok) { break; }
+ }
+ }
+
+ if (ok) {
+ if (state.pos >= end) { break; }
+ continue;
+ }
+
+ state.pending += state.src[state.pos++];
+ }
+
+ if (state.pending) {
+ state.pushPending();
+ }
+};
+
+
+/**
+ * ParserInline.parse(str, md, env, outTokens)
+ *
+ * Process input string and push inline tokens into `outTokens`
+ **/
+ParserInline.prototype.parse = function (str, md, env, outTokens) {
+ var i, rules, len;
+ var state = new this.State(str, md, env, outTokens);
+
+ this.tokenize(state);
+
+ rules = this.ruler2.getRules('');
+ len = rules.length;
+
+ for (i = 0; i < len; i++) {
+ rules[i](state);
+ }
+};
+
+
+ParserInline.prototype.State = require('./rules_inline/state_inline');
+
+
+module.exports = ParserInline;
diff --git a/node_modules/markdown-it/lib/presets/commonmark.js b/node_modules/markdown-it/lib/presets/commonmark.js
new file mode 100644
index 0000000..7066553
--- /dev/null
+++ b/node_modules/markdown-it/lib/presets/commonmark.js
@@ -0,0 +1,80 @@
+// Commonmark default options
+
+'use strict';
+
+
+module.exports = {
+ options: {
+ html: true, // Enable HTML tags in source
+ xhtmlOut: true, // Use '/' to close single tags (<br />)
+ breaks: false, // Convert '\n' in paragraphs into <br>
+ langPrefix: 'language-', // CSS language prefix for fenced blocks
+ linkify: false, // autoconvert URL-like texts to links
+
+ // Enable some language-neutral replacements + quotes beautification
+ typographer: false,
+
+ // Double + single quotes replacement pairs, when typographer enabled,
+ // and smartquotes on. Could be either a String or an Array.
+ //
+ // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+ // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+ quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
+
+ // Highlighter function. Should return escaped HTML,
+ // or '' if the source string is not changed and should be escaped externaly.
+ // If result starts with <pre... internal wrapper is skipped.
+ //
+ // function (/*str, lang*/) { return ''; }
+ //
+ highlight: null,
+
+ maxNesting: 20 // Internal protection, recursion limit
+ },
+
+ components: {
+
+ core: {
+ rules: [
+ 'normalize',
+ 'block',
+ 'inline'
+ ]
+ },
+
+ block: {
+ rules: [
+ 'blockquote',
+ 'code',
+ 'fence',
+ 'heading',
+ 'hr',
+ 'html_block',
+ 'lheading',
+ 'list',
+ 'reference',
+ 'paragraph'
+ ]
+ },
+
+ inline: {
+ rules: [
+ 'autolink',
+ 'backticks',
+ 'emphasis',
+ 'entity',
+ 'escape',
+ 'html_inline',
+ 'image',
+ 'link',
+ 'newline',
+ 'text'
+ ],
+ rules2: [
+ 'balance_pairs',
+ 'emphasis',
+ 'text_collapse'
+ ]
+ }
+ }
+};
diff --git a/node_modules/markdown-it/lib/presets/default.js b/node_modules/markdown-it/lib/presets/default.js
new file mode 100644
index 0000000..17ecef2
--- /dev/null
+++ b/node_modules/markdown-it/lib/presets/default.js
@@ -0,0 +1,41 @@
+// markdown-it default options
+
+'use strict';
+
+
+module.exports = {
+ options: {
+ html: false, // Enable HTML tags in source
+ xhtmlOut: false, // Use '/' to close single tags (<br />)
+ breaks: false, // Convert '\n' in paragraphs into <br>
+ langPrefix: 'language-', // CSS language prefix for fenced blocks
+ linkify: false, // autoconvert URL-like texts to links
+
+ // Enable some language-neutral replacements + quotes beautification
+ typographer: false,
+
+ // Double + single quotes replacement pairs, when typographer enabled,
+ // and smartquotes on. Could be either a String or an Array.
+ //
+ // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+ // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+ quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
+
+ // Highlighter function. Should return escaped HTML,
+ // or '' if the source string is not changed and should be escaped externaly.
+ // If result starts with <pre... internal wrapper is skipped.
+ //
+ // function (/*str, lang*/) { return ''; }
+ //
+ highlight: null,
+
+ maxNesting: 100 // Internal protection, recursion limit
+ },
+
+ components: {
+
+ core: {},
+ block: {},
+ inline: {}
+ }
+};
diff --git a/node_modules/markdown-it/lib/presets/zero.js b/node_modules/markdown-it/lib/presets/zero.js
new file mode 100644
index 0000000..5da413c
--- /dev/null
+++ b/node_modules/markdown-it/lib/presets/zero.js
@@ -0,0 +1,62 @@
+// "Zero" preset, with nothing enabled. Useful for manual configuring of simple
+// modes. For example, to parse bold/italic only.
+
+'use strict';
+
+
+module.exports = {
+ options: {
+ html: false, // Enable HTML tags in source
+ xhtmlOut: false, // Use '/' to close single tags (<br />)
+ breaks: false, // Convert '\n' in paragraphs into <br>
+ langPrefix: 'language-', // CSS language prefix for fenced blocks
+ linkify: false, // autoconvert URL-like texts to links
+
+ // Enable some language-neutral replacements + quotes beautification
+ typographer: false,
+
+ // Double + single quotes replacement pairs, when typographer enabled,
+ // and smartquotes on. Could be either a String or an Array.
+ //
+ // For example, you can use '«»„“' for Russian, '„“‚‘' for German,
+ // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp).
+ quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */
+
+ // Highlighter function. Should return escaped HTML,
+ // or '' if the source string is not changed and should be escaped externaly.
+ // If result starts with <pre... internal wrapper is skipped.
+ //
+ // function (/*str, lang*/) { return ''; }
+ //
+ highlight: null,
+
+ maxNesting: 20 // Internal protection, recursion limit
+ },
+
+ components: {
+
+ core: {
+ rules: [
+ 'normalize',
+ 'block',
+ 'inline'
+ ]
+ },
+
+ block: {
+ rules: [
+ 'paragraph'
+ ]
+ },
+
+ inline: {
+ rules: [
+ 'text'
+ ],
+ rules2: [
+ 'balance_pairs',
+ 'text_collapse'
+ ]
+ }
+ }
+};
diff --git a/node_modules/markdown-it/lib/renderer.js b/node_modules/markdown-it/lib/renderer.js
new file mode 100644
index 0000000..08eacf3
--- /dev/null
+++ b/node_modules/markdown-it/lib/renderer.js
@@ -0,0 +1,341 @@
+/**
+ * class Renderer
+ *
+ * Generates HTML from parsed token stream. Each instance has independent
+ * copy of rules. Those can be rewritten with ease. Also, you can add new
+ * rules if you create plugin and adds new token types.
+ **/
+'use strict';
+
+
+var assign = require('./common/utils').assign;
+var unescapeAll = require('./common/utils').unescapeAll;
+var escapeHtml = require('./common/utils').escapeHtml;
+
+
+////////////////////////////////////////////////////////////////////////////////
+
+var default_rules = {};
+
+
+default_rules.code_inline = function (tokens, idx, options, env, slf) {
+ var token = tokens[idx];
+
+ return '<code' + slf.renderAttrs(token) + '>' +
+ escapeHtml(tokens[idx].content) +
+ '</code>';
+};
+
+
+default_rules.code_block = function (tokens, idx, options, env, slf) {
+ var token = tokens[idx];
+
+ return '<pre' + slf.renderAttrs(token) + '><code>' +
+ escapeHtml(tokens[idx].content) +
+ '</code></pre>\n';
+};
+
+
+default_rules.fence = function (tokens, idx, options, env, slf) {
+ var token = tokens[idx],
+ info = token.info ? unescapeAll(token.info).trim() : '',
+ langName = '',
+ langAttrs = '',
+ highlighted, i, arr, tmpAttrs, tmpToken;
+
+ if (info) {
+ arr = info.split(/(\s+)/g);
+ langName = arr[0];
+ langAttrs = arr.slice(2).join('');
+ }
+
+ if (options.highlight) {
+ highlighted = options.highlight(token.content, langName, langAttrs) || escapeHtml(token.content);
+ } else {
+ highlighted = escapeHtml(token.content);
+ }
+
+ if (highlighted.indexOf('<pre') === 0) {
+ return highlighted + '\n';
+ }
+
+ // If language exists, inject class gently, without modifying original token.
+ // May be, one day we will add .deepClone() for token and simplify this part, but
+ // now we prefer to keep things local.
+ if (info) {
+ i = token.attrIndex('class');
+ tmpAttrs = token.attrs ? token.attrs.slice() : [];
+
+ if (i < 0) {
+ tmpAttrs.push([ 'class', options.langPrefix + langName ]);
+ } else {
+ tmpAttrs[i] = tmpAttrs[i].slice();
+ tmpAttrs[i][1] += ' ' + options.langPrefix + langName;
+ }
+
+ // Fake token just to render attributes
+ tmpToken = {
+ attrs: tmpAttrs
+ };
+
+ return '<pre><code' + slf.renderAttrs(tmpToken) + '>'
+ + highlighted
+ + '</code></pre>\n';
+ }
+
+
+ return '<pre><code' + slf.renderAttrs(token) + '>'
+ + highlighted
+ + '</code></pre>\n';
+};
+
+
+default_rules.image = function (tokens, idx, options, env, slf) {
+ var token = tokens[idx];
+
+ // "alt" attr MUST be set, even if empty. Because it's mandatory and
+ // should be placed on proper position for tests.
+ //
+ // Replace content with actual value
+
+ token.attrs[token.attrIndex('alt')][1] =
+ slf.renderInlineAsText(token.children, options, env);
+
+ return slf.renderToken(tokens, idx, options);
+};
+
+
+default_rules.hardbreak = function (tokens, idx, options /*, env */) {
+ return options.xhtmlOut ? '<br />\n' : '<br>\n';
+};
+default_rules.softbreak = function (tokens, idx, options /*, env */) {
+ return options.breaks ? (options.xhtmlOut ? '<br />\n' : '<br>\n') : '\n';
+};
+
+
+default_rules.text = function (tokens, idx /*, options, env */) {
+ return escapeHtml(tokens[idx].content);
+};
+
+
+default_rules.html_block = function (tokens, idx /*, options, env */) {
+ return tokens[idx].content;
+};
+default_rules.html_inline = function (tokens, idx /*, options, env */) {
+ return tokens[idx].content;
+};
+
+
+/**
+ * new Renderer()
+ *
+ * Creates new [[Renderer]] instance and fill [[Renderer#rules]] with defaults.
+ **/
+function Renderer() {
+
+ /**
+ * Renderer#rules -> Object
+ *
+ * Contains render rules for tokens. Can be updated and extended.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.renderer.rules.strong_open = function () { return '<b>'; };
+ * md.renderer.rules.strong_close = function () { return '</b>'; };
+ *
+ * var result = md.renderInline(...);
+ * ```
+ *
+ * Each rule is called as independent static function with fixed signature:
+ *
+ * ```javascript
+ * function my_token_render(tokens, idx, options, env, renderer) {
+ * // ...
+ * return renderedHTML;
+ * }
+ * ```
+ *
+ * See [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js)
+ * for more details and examples.
+ **/
+ this.rules = assign({}, default_rules);
+}
+
+
+/**
+ * Renderer.renderAttrs(token) -> String
+ *
+ * Render token attributes to string.
+ **/
+Renderer.prototype.renderAttrs = function renderAttrs(token) {
+ var i, l, result;
+
+ if (!token.attrs) { return ''; }
+
+ result = '';
+
+ for (i = 0, l = token.attrs.length; i < l; i++) {
+ result += ' ' + escapeHtml(token.attrs[i][0]) + '="' + escapeHtml(token.attrs[i][1]) + '"';
+ }
+
+ return result;
+};
+
+
+/**
+ * Renderer.renderToken(tokens, idx, options) -> String
+ * - tokens (Array): list of tokens
+ * - idx (Numbed): token index to render
+ * - options (Object): params of parser instance
+ *
+ * Default token renderer. Can be overriden by custom function
+ * in [[Renderer#rules]].
+ **/
+Renderer.prototype.renderToken = function renderToken(tokens, idx, options) {
+ var nextToken,
+ result = '',
+ needLf = false,
+ token = tokens[idx];
+
+ // Tight list paragraphs
+ if (token.hidden) {
+ return '';
+ }
+
+ // Insert a newline between hidden paragraph and subsequent opening
+ // block-level tag.
+ //
+ // For example, here we should insert a newline before blockquote:
+ // - a
+ // >
+ //
+ if (token.block && token.nesting !== -1 && idx && tokens[idx - 1].hidden) {
+ result += '\n';
+ }
+
+ // Add token name, e.g. `<img`
+ result += (token.nesting === -1 ? '</' : '<') + token.tag;
+
+ // Encode attributes, e.g. `<img src="foo"`
+ result += this.renderAttrs(token);
+
+ // Add a slash for self-closing tags, e.g. `<img src="foo" /`
+ if (token.nesting === 0 && options.xhtmlOut) {
+ result += ' /';
+ }
+
+ // Check if we need to add a newline after this tag
+ if (token.block) {
+ needLf = true;
+
+ if (token.nesting === 1) {
+ if (idx + 1 < tokens.length) {
+ nextToken = tokens[idx + 1];
+
+ if (nextToken.type === 'inline' || nextToken.hidden) {
+ // Block-level tag containing an inline tag.
+ //
+ needLf = false;
+
+ } else if (nextToken.nesting === -1 && nextToken.tag === token.tag) {
+ // Opening tag + closing tag of the same type. E.g. `<li></li>`.
+ //
+ needLf = false;
+ }
+ }
+ }
+ }
+
+ result += needLf ? '>\n' : '>';
+
+ return result;
+};
+
+
+/**
+ * Renderer.renderInline(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to render
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * The same as [[Renderer.render]], but for single token of `inline` type.
+ **/
+Renderer.prototype.renderInline = function (tokens, options, env) {
+ var type,
+ result = '',
+ rules = this.rules;
+
+ for (var i = 0, len = tokens.length; i < len; i++) {
+ type = tokens[i].type;
+
+ if (typeof rules[type] !== 'undefined') {
+ result += rules[type](tokens, i, options, env, this);
+ } else {
+ result += this.renderToken(tokens, i, options);
+ }
+ }
+
+ return result;
+};
+
+
+/** internal
+ * Renderer.renderInlineAsText(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to render
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * Special kludge for image `alt` attributes to conform CommonMark spec.
+ * Don't try to use it! Spec requires to show `alt` content with stripped markup,
+ * instead of simple escaping.
+ **/
+Renderer.prototype.renderInlineAsText = function (tokens, options, env) {
+ var result = '';
+
+ for (var i = 0, len = tokens.length; i < len; i++) {
+ if (tokens[i].type === 'text') {
+ result += tokens[i].content;
+ } else if (tokens[i].type === 'image') {
+ result += this.renderInlineAsText(tokens[i].children, options, env);
+ } else if (tokens[i].type === 'softbreak') {
+ result += '\n';
+ }
+ }
+
+ return result;
+};
+
+
+/**
+ * Renderer.render(tokens, options, env) -> String
+ * - tokens (Array): list on block tokens to render
+ * - options (Object): params of parser instance
+ * - env (Object): additional data from parsed input (references, for example)
+ *
+ * Takes token stream and generates HTML. Probably, you will never need to call
+ * this method directly.
+ **/
+Renderer.prototype.render = function (tokens, options, env) {
+ var i, len, type,
+ result = '',
+ rules = this.rules;
+
+ for (i = 0, len = tokens.length; i < len; i++) {
+ type = tokens[i].type;
+
+ if (type === 'inline') {
+ result += this.renderInline(tokens[i].children, options, env);
+ } else if (typeof rules[type] !== 'undefined') {
+ result += rules[tokens[i].type](tokens, i, options, env, this);
+ } else {
+ result += this.renderToken(tokens, i, options, env);
+ }
+ }
+
+ return result;
+};
+
+module.exports = Renderer;
diff --git a/node_modules/markdown-it/lib/ruler.js b/node_modules/markdown-it/lib/ruler.js
new file mode 100644
index 0000000..9ad5da4
--- /dev/null
+++ b/node_modules/markdown-it/lib/ruler.js
@@ -0,0 +1,352 @@
+/**
+ * class Ruler
+ *
+ * Helper class, used by [[MarkdownIt#core]], [[MarkdownIt#block]] and
+ * [[MarkdownIt#inline]] to manage sequences of functions (rules):
+ *
+ * - keep rules in defined order
+ * - assign the name to each rule
+ * - enable/disable rules
+ * - add/replace rules
+ * - allow assign rules to additional named chains (in the same)
+ * - cacheing lists of active rules
+ *
+ * You will not need use this class directly until write plugins. For simple
+ * rules control use [[MarkdownIt.disable]], [[MarkdownIt.enable]] and
+ * [[MarkdownIt.use]].
+ **/
+'use strict';
+
+
+/**
+ * new Ruler()
+ **/
+function Ruler() {
+ // List of added rules. Each element is:
+ //
+ // {
+ // name: XXX,
+ // enabled: Boolean,
+ // fn: Function(),
+ // alt: [ name2, name3 ]
+ // }
+ //
+ this.__rules__ = [];
+
+ // Cached rule chains.
+ //
+ // First level - chain name, '' for default.
+ // Second level - diginal anchor for fast filtering by charcodes.
+ //
+ this.__cache__ = null;
+}
+
+////////////////////////////////////////////////////////////////////////////////
+// Helper methods, should not be used directly
+
+
+// Find rule index by name
+//
+Ruler.prototype.__find__ = function (name) {
+ for (var i = 0; i < this.__rules__.length; i++) {
+ if (this.__rules__[i].name === name) {
+ return i;
+ }
+ }
+ return -1;
+};
+
+
+// Build rules lookup cache
+//
+Ruler.prototype.__compile__ = function () {
+ var self = this;
+ var chains = [ '' ];
+
+ // collect unique names
+ self.__rules__.forEach(function (rule) {
+ if (!rule.enabled) { return; }
+
+ rule.alt.forEach(function (altName) {
+ if (chains.indexOf(altName) < 0) {
+ chains.push(altName);
+ }
+ });
+ });
+
+ self.__cache__ = {};
+
+ chains.forEach(function (chain) {
+ self.__cache__[chain] = [];
+ self.__rules__.forEach(function (rule) {
+ if (!rule.enabled) { return; }
+
+ if (chain && rule.alt.indexOf(chain) < 0) { return; }
+
+ self.__cache__[chain].push(rule.fn);
+ });
+ });
+};
+
+
+/**
+ * Ruler.at(name, fn [, options])
+ * - name (String): rule name to replace.
+ * - fn (Function): new rule function.
+ * - options (Object): new rule options (not mandatory).
+ *
+ * Replace rule by name with new function & options. Throws error if name not
+ * found.
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * Replace existing typographer replacement rule with new one:
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.core.ruler.at('replacements', function replace(state) {
+ * //...
+ * });
+ * ```
+ **/
+Ruler.prototype.at = function (name, fn, options) {
+ var index = this.__find__(name);
+ var opt = options || {};
+
+ if (index === -1) { throw new Error('Parser rule not found: ' + name); }
+
+ this.__rules__[index].fn = fn;
+ this.__rules__[index].alt = opt.alt || [];
+ this.__cache__ = null;
+};
+
+
+/**
+ * Ruler.before(beforeName, ruleName, fn [, options])
+ * - beforeName (String): new rule will be added before this one.
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Add new rule to chain before one with given name. See also
+ * [[Ruler.after]], [[Ruler.push]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.block.ruler.before('paragraph', 'my_rule', function replace(state) {
+ * //...
+ * });
+ * ```
+ **/
+Ruler.prototype.before = function (beforeName, ruleName, fn, options) {
+ var index = this.__find__(beforeName);
+ var opt = options || {};
+
+ if (index === -1) { throw new Error('Parser rule not found: ' + beforeName); }
+
+ this.__rules__.splice(index, 0, {
+ name: ruleName,
+ enabled: true,
+ fn: fn,
+ alt: opt.alt || []
+ });
+
+ this.__cache__ = null;
+};
+
+
+/**
+ * Ruler.after(afterName, ruleName, fn [, options])
+ * - afterName (String): new rule will be added after this one.
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Add new rule to chain after one with given name. See also
+ * [[Ruler.before]], [[Ruler.push]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.inline.ruler.after('text', 'my_rule', function replace(state) {
+ * //...
+ * });
+ * ```
+ **/
+Ruler.prototype.after = function (afterName, ruleName, fn, options) {
+ var index = this.__find__(afterName);
+ var opt = options || {};
+
+ if (index === -1) { throw new Error('Parser rule not found: ' + afterName); }
+
+ this.__rules__.splice(index + 1, 0, {
+ name: ruleName,
+ enabled: true,
+ fn: fn,
+ alt: opt.alt || []
+ });
+
+ this.__cache__ = null;
+};
+
+/**
+ * Ruler.push(ruleName, fn [, options])
+ * - ruleName (String): name of added rule.
+ * - fn (Function): rule function.
+ * - options (Object): rule options (not mandatory).
+ *
+ * Push new rule to the end of chain. See also
+ * [[Ruler.before]], [[Ruler.after]].
+ *
+ * ##### Options:
+ *
+ * - __alt__ - array with names of "alternate" chains.
+ *
+ * ##### Example
+ *
+ * ```javascript
+ * var md = require('markdown-it')();
+ *
+ * md.core.ruler.push('my_rule', function replace(state) {
+ * //...
+ * });
+ * ```
+ **/
+Ruler.prototype.push = function (ruleName, fn, options) {
+ var opt = options || {};
+
+ this.__rules__.push({
+ name: ruleName,
+ enabled: true,
+ fn: fn,
+ alt: opt.alt || []
+ });
+
+ this.__cache__ = null;
+};
+
+
+/**
+ * Ruler.enable(list [, ignoreInvalid]) -> Array
+ * - list (String|Array): list of rule names to enable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable rules with given names. If any rule name not found - throw Error.
+ * Errors can be disabled by second param.
+ *
+ * Returns list of found rule names (if no exception happened).
+ *
+ * See also [[Ruler.disable]], [[Ruler.enableOnly]].
+ **/
+Ruler.prototype.enable = function (list, ignoreInvalid) {
+ if (!Array.isArray(list)) { list = [ list ]; }
+
+ var result = [];
+
+ // Search by name and enable
+ list.forEach(function (name) {
+ var idx = this.__find__(name);
+
+ if (idx < 0) {
+ if (ignoreInvalid) { return; }
+ throw new Error('Rules manager: invalid rule name ' + name);
+ }
+ this.__rules__[idx].enabled = true;
+ result.push(name);
+ }, this);
+
+ this.__cache__ = null;
+ return result;
+};
+
+
+/**
+ * Ruler.enableOnly(list [, ignoreInvalid])
+ * - list (String|Array): list of rule names to enable (whitelist).
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Enable rules with given names, and disable everything else. If any rule name
+ * not found - throw Error. Errors can be disabled by second param.
+ *
+ * See also [[Ruler.disable]], [[Ruler.enable]].
+ **/
+Ruler.prototype.enableOnly = function (list, ignoreInvalid) {
+ if (!Array.isArray(list)) { list = [ list ]; }
+
+ this.__rules__.forEach(function (rule) { rule.enabled = false; });
+
+ this.enable(list, ignoreInvalid);
+};
+
+
+/**
+ * Ruler.disable(list [, ignoreInvalid]) -> Array
+ * - list (String|Array): list of rule names to disable.
+ * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found.
+ *
+ * Disable rules with given names. If any rule name not found - throw Error.
+ * Errors can be disabled by second param.
+ *
+ * Returns list of found rule names (if no exception happened).
+ *
+ * See also [[Ruler.enable]], [[Ruler.enableOnly]].
+ **/
+Ruler.prototype.disable = function (list, ignoreInvalid) {
+ if (!Array.isArray(list)) { list = [ list ]; }
+
+ var result = [];
+
+ // Search by name and disable
+ list.forEach(function (name) {
+ var idx = this.__find__(name);
+
+ if (idx < 0) {
+ if (ignoreInvalid) { return; }
+ throw new Error('Rules manager: invalid rule name ' + name);
+ }
+ this.__rules__[idx].enabled = false;
+ result.push(name);
+ }, this);
+
+ this.__cache__ = null;
+ return result;
+};
+
+
+/**
+ * Ruler.getRules(chainName) -> Array
+ *
+ * Return array of active functions (rules) for given chain name. It analyzes
+ * rules configuration, compiles caches if not exists and returns result.
+ *
+ * Default chain name is `''` (empty string). It can't be skipped. That's
+ * done intentionally, to keep signature monomorphic for high speed.
+ **/
+Ruler.prototype.getRules = function (chainName) {
+ if (this.__cache__ === null) {
+ this.__compile__();
+ }
+
+ // Chain can be empty, if rules disabled. But we still have to return Array.
+ return this.__cache__[chainName] || [];
+};
+
+module.exports = Ruler;
diff --git a/node_modules/markdown-it/lib/rules_block/blockquote.js b/node_modules/markdown-it/lib/rules_block/blockquote.js
new file mode 100644
index 0000000..a02699a
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/blockquote.js
@@ -0,0 +1,284 @@
+// Block quotes
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function blockquote(state, startLine, endLine, silent) {
+ var adjustTab,
+ ch,
+ i,
+ initial,
+ l,
+ lastLineEmpty,
+ lines,
+ nextLine,
+ offset,
+ oldBMarks,
+ oldBSCount,
+ oldIndent,
+ oldParentType,
+ oldSCount,
+ oldTShift,
+ spaceAfterMarker,
+ terminate,
+ terminatorRules,
+ token,
+ isOutdented,
+ oldLineMax = state.lineMax,
+ pos = state.bMarks[startLine] + state.tShift[startLine],
+ max = state.eMarks[startLine];
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+ // check the block quote marker
+ if (state.src.charCodeAt(pos++) !== 0x3E/* > */) { return false; }
+
+ // we know that it's going to be a valid blockquote,
+ // so no point trying to find the end of it in silent mode
+ if (silent) { return true; }
+
+ // set offset past spaces and ">"
+ initial = offset = state.sCount[startLine] + 1;
+
+ // skip one optional space after '>'
+ if (state.src.charCodeAt(pos) === 0x20 /* space */) {
+ // ' > test '
+ // ^ -- position start of line here:
+ pos++;
+ initial++;
+ offset++;
+ adjustTab = false;
+ spaceAfterMarker = true;
+ } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) {
+ spaceAfterMarker = true;
+
+ if ((state.bsCount[startLine] + offset) % 4 === 3) {
+ // ' >\t test '
+ // ^ -- position start of line here (tab has width===1)
+ pos++;
+ initial++;
+ offset++;
+ adjustTab = false;
+ } else {
+ // ' >\t test '
+ // ^ -- position start of line here + shift bsCount slightly
+ // to make extra space appear
+ adjustTab = true;
+ }
+ } else {
+ spaceAfterMarker = false;
+ }
+
+ oldBMarks = [ state.bMarks[startLine] ];
+ state.bMarks[startLine] = pos;
+
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos);
+
+ if (isSpace(ch)) {
+ if (ch === 0x09) {
+ offset += 4 - (offset + state.bsCount[startLine] + (adjustTab ? 1 : 0)) % 4;
+ } else {
+ offset++;
+ }
+ } else {
+ break;
+ }
+
+ pos++;
+ }
+
+ oldBSCount = [ state.bsCount[startLine] ];
+ state.bsCount[startLine] = state.sCount[startLine] + 1 + (spaceAfterMarker ? 1 : 0);
+
+ lastLineEmpty = pos >= max;
+
+ oldSCount = [ state.sCount[startLine] ];
+ state.sCount[startLine] = offset - initial;
+
+ oldTShift = [ state.tShift[startLine] ];
+ state.tShift[startLine] = pos - state.bMarks[startLine];
+
+ terminatorRules = state.md.block.ruler.getRules('blockquote');
+
+ oldParentType = state.parentType;
+ state.parentType = 'blockquote';
+
+ // Search the end of the block
+ //
+ // Block ends with either:
+ // 1. an empty line outside:
+ // ```
+ // > test
+ //
+ // ```
+ // 2. an empty line inside:
+ // ```
+ // >
+ // test
+ // ```
+ // 3. another tag:
+ // ```
+ // > test
+ // - - -
+ // ```
+ for (nextLine = startLine + 1; nextLine < endLine; nextLine++) {
+ // check if it's outdented, i.e. it's inside list item and indented
+ // less than said list item:
+ //
+ // ```
+ // 1. anything
+ // > current blockquote
+ // 2. checking this line
+ // ```
+ isOutdented = state.sCount[nextLine] < state.blkIndent;
+
+ pos = state.bMarks[nextLine] + state.tShift[nextLine];
+ max = state.eMarks[nextLine];
+
+ if (pos >= max) {
+ // Case 1: line is not inside the blockquote, and this line is empty.
+ break;
+ }
+
+ if (state.src.charCodeAt(pos++) === 0x3E/* > */ && !isOutdented) {
+ // This line is inside the blockquote.
+
+ // set offset past spaces and ">"
+ initial = offset = state.sCount[nextLine] + 1;
+
+ // skip one optional space after '>'
+ if (state.src.charCodeAt(pos) === 0x20 /* space */) {
+ // ' > test '
+ // ^ -- position start of line here:
+ pos++;
+ initial++;
+ offset++;
+ adjustTab = false;
+ spaceAfterMarker = true;
+ } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) {
+ spaceAfterMarker = true;
+
+ if ((state.bsCount[nextLine] + offset) % 4 === 3) {
+ // ' >\t test '
+ // ^ -- position start of line here (tab has width===1)
+ pos++;
+ initial++;
+ offset++;
+ adjustTab = false;
+ } else {
+ // ' >\t test '
+ // ^ -- position start of line here + shift bsCount slightly
+ // to make extra space appear
+ adjustTab = true;
+ }
+ } else {
+ spaceAfterMarker = false;
+ }
+
+ oldBMarks.push(state.bMarks[nextLine]);
+ state.bMarks[nextLine] = pos;
+
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos);
+
+ if (isSpace(ch)) {
+ if (ch === 0x09) {
+ offset += 4 - (offset + state.bsCount[nextLine] + (adjustTab ? 1 : 0)) % 4;
+ } else {
+ offset++;
+ }
+ } else {
+ break;
+ }
+
+ pos++;
+ }
+
+ lastLineEmpty = pos >= max;
+
+ oldBSCount.push(state.bsCount[nextLine]);
+ state.bsCount[nextLine] = state.sCount[nextLine] + 1 + (spaceAfterMarker ? 1 : 0);
+
+ oldSCount.push(state.sCount[nextLine]);
+ state.sCount[nextLine] = offset - initial;
+
+ oldTShift.push(state.tShift[nextLine]);
+ state.tShift[nextLine] = pos - state.bMarks[nextLine];
+ continue;
+ }
+
+ // Case 2: line is not inside the blockquote, and the last line was empty.
+ if (lastLineEmpty) { break; }
+
+ // Case 3: another tag found.
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+
+ if (terminate) {
+ // Quirk to enforce "hard termination mode" for paragraphs;
+ // normally if you call `tokenize(state, startLine, nextLine)`,
+ // paragraphs will look below nextLine for paragraph continuation,
+ // but if blockquote is terminated by another tag, they shouldn't
+ state.lineMax = nextLine;
+
+ if (state.blkIndent !== 0) {
+ // state.blkIndent was non-zero, we now set it to zero,
+ // so we need to re-calculate all offsets to appear as
+ // if indent wasn't changed
+ oldBMarks.push(state.bMarks[nextLine]);
+ oldBSCount.push(state.bsCount[nextLine]);
+ oldTShift.push(state.tShift[nextLine]);
+ oldSCount.push(state.sCount[nextLine]);
+ state.sCount[nextLine] -= state.blkIndent;
+ }
+
+ break;
+ }
+
+ oldBMarks.push(state.bMarks[nextLine]);
+ oldBSCount.push(state.bsCount[nextLine]);
+ oldTShift.push(state.tShift[nextLine]);
+ oldSCount.push(state.sCount[nextLine]);
+
+ // A negative indentation means that this is a paragraph continuation
+ //
+ state.sCount[nextLine] = -1;
+ }
+
+ oldIndent = state.blkIndent;
+ state.blkIndent = 0;
+
+ token = state.push('blockquote_open', 'blockquote', 1);
+ token.markup = '>';
+ token.map = lines = [ startLine, 0 ];
+
+ state.md.block.tokenize(state, startLine, nextLine);
+
+ token = state.push('blockquote_close', 'blockquote', -1);
+ token.markup = '>';
+
+ state.lineMax = oldLineMax;
+ state.parentType = oldParentType;
+ lines[1] = state.line;
+
+ // Restore original tShift; this might not be necessary since the parser
+ // has already been here, but just to make sure we can do that.
+ for (i = 0; i < oldTShift.length; i++) {
+ state.bMarks[i + startLine] = oldBMarks[i];
+ state.tShift[i + startLine] = oldTShift[i];
+ state.sCount[i + startLine] = oldSCount[i];
+ state.bsCount[i + startLine] = oldBSCount[i];
+ }
+ state.blkIndent = oldIndent;
+
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/code.js b/node_modules/markdown-it/lib/rules_block/code.js
new file mode 100644
index 0000000..018e019
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/code.js
@@ -0,0 +1,34 @@
+// Code block (4 spaces padded)
+
+'use strict';
+
+
+module.exports = function code(state, startLine, endLine/*, silent*/) {
+ var nextLine, last, token;
+
+ if (state.sCount[startLine] - state.blkIndent < 4) { return false; }
+
+ last = nextLine = startLine + 1;
+
+ while (nextLine < endLine) {
+ if (state.isEmpty(nextLine)) {
+ nextLine++;
+ continue;
+ }
+
+ if (state.sCount[nextLine] - state.blkIndent >= 4) {
+ nextLine++;
+ last = nextLine;
+ continue;
+ }
+ break;
+ }
+
+ state.line = last;
+
+ token = state.push('code_block', 'code', 0);
+ token.content = state.getLines(startLine, last, 4 + state.blkIndent, false) + '\n';
+ token.map = [ startLine, state.line ];
+
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/fence.js b/node_modules/markdown-it/lib/rules_block/fence.js
new file mode 100644
index 0000000..44f1538
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/fence.js
@@ -0,0 +1,98 @@
+// fences (``` lang, ~~~ lang)
+
+'use strict';
+
+
+module.exports = function fence(state, startLine, endLine, silent) {
+ var marker, len, params, nextLine, mem, token, markup,
+ haveEndMarker = false,
+ pos = state.bMarks[startLine] + state.tShift[startLine],
+ max = state.eMarks[startLine];
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+ if (pos + 3 > max) { return false; }
+
+ marker = state.src.charCodeAt(pos);
+
+ if (marker !== 0x7E/* ~ */ && marker !== 0x60 /* ` */) {
+ return false;
+ }
+
+ // scan marker length
+ mem = pos;
+ pos = state.skipChars(pos, marker);
+
+ len = pos - mem;
+
+ if (len < 3) { return false; }
+
+ markup = state.src.slice(mem, pos);
+ params = state.src.slice(pos, max);
+
+ if (marker === 0x60 /* ` */) {
+ if (params.indexOf(String.fromCharCode(marker)) >= 0) {
+ return false;
+ }
+ }
+
+ // Since start is found, we can report success here in validation mode
+ if (silent) { return true; }
+
+ // search end of block
+ nextLine = startLine;
+
+ for (;;) {
+ nextLine++;
+ if (nextLine >= endLine) {
+ // unclosed block should be autoclosed by end of document.
+ // also block seems to be autoclosed by end of parent
+ break;
+ }
+
+ pos = mem = state.bMarks[nextLine] + state.tShift[nextLine];
+ max = state.eMarks[nextLine];
+
+ if (pos < max && state.sCount[nextLine] < state.blkIndent) {
+ // non-empty line with negative indent should stop the list:
+ // - ```
+ // test
+ break;
+ }
+
+ if (state.src.charCodeAt(pos) !== marker) { continue; }
+
+ if (state.sCount[nextLine] - state.blkIndent >= 4) {
+ // closing fence should be indented less than 4 spaces
+ continue;
+ }
+
+ pos = state.skipChars(pos, marker);
+
+ // closing code fence must be at least as long as the opening one
+ if (pos - mem < len) { continue; }
+
+ // make sure tail has spaces only
+ pos = state.skipSpaces(pos);
+
+ if (pos < max) { continue; }
+
+ haveEndMarker = true;
+ // found!
+ break;
+ }
+
+ // If a fence has heading spaces, they should be removed from its inner block
+ len = state.sCount[startLine];
+
+ state.line = nextLine + (haveEndMarker ? 1 : 0);
+
+ token = state.push('fence', 'code', 0);
+ token.info = params;
+ token.content = state.getLines(startLine + 1, nextLine, len, true);
+ token.markup = markup;
+ token.map = [ startLine, state.line ];
+
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/heading.js b/node_modules/markdown-it/lib/rules_block/heading.js
new file mode 100644
index 0000000..9863f48
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/heading.js
@@ -0,0 +1,55 @@
+// heading (#, ##, ...)
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function heading(state, startLine, endLine, silent) {
+ var ch, level, tmp, token,
+ pos = state.bMarks[startLine] + state.tShift[startLine],
+ max = state.eMarks[startLine];
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+ ch = state.src.charCodeAt(pos);
+
+ if (ch !== 0x23/* # */ || pos >= max) { return false; }
+
+ // count heading level
+ level = 1;
+ ch = state.src.charCodeAt(++pos);
+ while (ch === 0x23/* # */ && pos < max && level <= 6) {
+ level++;
+ ch = state.src.charCodeAt(++pos);
+ }
+
+ if (level > 6 || (pos < max && !isSpace(ch))) { return false; }
+
+ if (silent) { return true; }
+
+ // Let's cut tails like ' ### ' from the end of string
+
+ max = state.skipSpacesBack(max, pos);
+ tmp = state.skipCharsBack(max, 0x23, pos); // #
+ if (tmp > pos && isSpace(state.src.charCodeAt(tmp - 1))) {
+ max = tmp;
+ }
+
+ state.line = startLine + 1;
+
+ token = state.push('heading_open', 'h' + String(level), 1);
+ token.markup = '########'.slice(0, level);
+ token.map = [ startLine, state.line ];
+
+ token = state.push('inline', '', 0);
+ token.content = state.src.slice(pos, max).trim();
+ token.map = [ startLine, state.line ];
+ token.children = [];
+
+ token = state.push('heading_close', 'h' + String(level), -1);
+ token.markup = '########'.slice(0, level);
+
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/hr.js b/node_modules/markdown-it/lib/rules_block/hr.js
new file mode 100644
index 0000000..a3bb14e
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/hr.js
@@ -0,0 +1,45 @@
+// Horizontal rule
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function hr(state, startLine, endLine, silent) {
+ var marker, cnt, ch, token,
+ pos = state.bMarks[startLine] + state.tShift[startLine],
+ max = state.eMarks[startLine];
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+ marker = state.src.charCodeAt(pos++);
+
+ // Check hr marker
+ if (marker !== 0x2A/* * */ &&
+ marker !== 0x2D/* - */ &&
+ marker !== 0x5F/* _ */) {
+ return false;
+ }
+
+ // markers can be mixed with spaces, but there should be at least 3 of them
+
+ cnt = 1;
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos++);
+ if (ch !== marker && !isSpace(ch)) { return false; }
+ if (ch === marker) { cnt++; }
+ }
+
+ if (cnt < 3) { return false; }
+
+ if (silent) { return true; }
+
+ state.line = startLine + 1;
+
+ token = state.push('hr', 'hr', 0);
+ token.map = [ startLine, state.line ];
+ token.markup = Array(cnt + 1).join(String.fromCharCode(marker));
+
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/html_block.js b/node_modules/markdown-it/lib/rules_block/html_block.js
new file mode 100644
index 0000000..2f17675
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/html_block.js
@@ -0,0 +1,74 @@
+// HTML block
+
+'use strict';
+
+
+var block_names = require('../common/html_blocks');
+var HTML_OPEN_CLOSE_TAG_RE = require('../common/html_re').HTML_OPEN_CLOSE_TAG_RE;
+
+// An array of opening and corresponding closing sequences for html tags,
+// last argument defines whether it can terminate a paragraph or not
+//
+var HTML_SEQUENCES = [
+ [ /^<(script|pre|style|textarea)(?=(\s|>|$))/i, /<\/(script|pre|style|textarea)>/i, true ],
+ [ /^<!--/, /-->/, true ],
+ [ /^<\?/, /\?>/, true ],
+ [ /^<![A-Z]/, />/, true ],
+ [ /^<!\[CDATA\[/, /\]\]>/, true ],
+ [ new RegExp('^</?(' + block_names.join('|') + ')(?=(\\s|/?>|$))', 'i'), /^$/, true ],
+ [ new RegExp(HTML_OPEN_CLOSE_TAG_RE.source + '\\s*$'), /^$/, false ]
+];
+
+
+module.exports = function html_block(state, startLine, endLine, silent) {
+ var i, nextLine, token, lineText,
+ pos = state.bMarks[startLine] + state.tShift[startLine],
+ max = state.eMarks[startLine];
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+ if (!state.md.options.html) { return false; }
+
+ if (state.src.charCodeAt(pos) !== 0x3C/* < */) { return false; }
+
+ lineText = state.src.slice(pos, max);
+
+ for (i = 0; i < HTML_SEQUENCES.length; i++) {
+ if (HTML_SEQUENCES[i][0].test(lineText)) { break; }
+ }
+
+ if (i === HTML_SEQUENCES.length) { return false; }
+
+ if (silent) {
+ // true if this sequence can be a terminator, false otherwise
+ return HTML_SEQUENCES[i][2];
+ }
+
+ nextLine = startLine + 1;
+
+ // If we are here - we detected HTML block.
+ // Let's roll down till block end.
+ if (!HTML_SEQUENCES[i][1].test(lineText)) {
+ for (; nextLine < endLine; nextLine++) {
+ if (state.sCount[nextLine] < state.blkIndent) { break; }
+
+ pos = state.bMarks[nextLine] + state.tShift[nextLine];
+ max = state.eMarks[nextLine];
+ lineText = state.src.slice(pos, max);
+
+ if (HTML_SEQUENCES[i][1].test(lineText)) {
+ if (lineText.length !== 0) { nextLine++; }
+ break;
+ }
+ }
+ }
+
+ state.line = nextLine;
+
+ token = state.push('html_block', '', 0);
+ token.map = [ startLine, nextLine ];
+ token.content = state.getLines(startLine, nextLine, state.blkIndent, true);
+
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/lheading.js b/node_modules/markdown-it/lib/rules_block/lheading.js
new file mode 100644
index 0000000..19bdc39
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/lheading.js
@@ -0,0 +1,83 @@
+// lheading (---, ===)
+
+'use strict';
+
+
+module.exports = function lheading(state, startLine, endLine/*, silent*/) {
+ var content, terminate, i, l, token, pos, max, level, marker,
+ nextLine = startLine + 1, oldParentType,
+ terminatorRules = state.md.block.ruler.getRules('paragraph');
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+ oldParentType = state.parentType;
+ state.parentType = 'paragraph'; // use paragraph to match terminatorRules
+
+ // jump line-by-line until empty one or EOF
+ for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+ // this would be a code block normally, but after paragraph
+ // it's considered a lazy continuation regardless of what's there
+ if (state.sCount[nextLine] - state.blkIndent > 3) { continue; }
+
+ //
+ // Check for underline in setext header
+ //
+ if (state.sCount[nextLine] >= state.blkIndent) {
+ pos = state.bMarks[nextLine] + state.tShift[nextLine];
+ max = state.eMarks[nextLine];
+
+ if (pos < max) {
+ marker = state.src.charCodeAt(pos);
+
+ if (marker === 0x2D/* - */ || marker === 0x3D/* = */) {
+ pos = state.skipChars(pos, marker);
+ pos = state.skipSpaces(pos);
+
+ if (pos >= max) {
+ level = (marker === 0x3D/* = */ ? 1 : 2);
+ break;
+ }
+ }
+ }
+ }
+
+ // quirk for blockquotes, this line should already be checked by that rule
+ if (state.sCount[nextLine] < 0) { continue; }
+
+ // Some tags can terminate paragraph without empty line.
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+ if (terminate) { break; }
+ }
+
+ if (!level) {
+ // Didn't find valid underline
+ return false;
+ }
+
+ content = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+
+ state.line = nextLine + 1;
+
+ token = state.push('heading_open', 'h' + String(level), 1);
+ token.markup = String.fromCharCode(marker);
+ token.map = [ startLine, state.line ];
+
+ token = state.push('inline', '', 0);
+ token.content = content;
+ token.map = [ startLine, state.line - 1 ];
+ token.children = [];
+
+ token = state.push('heading_close', 'h' + String(level), -1);
+ token.markup = String.fromCharCode(marker);
+
+ state.parentType = oldParentType;
+
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/list.js b/node_modules/markdown-it/lib/rules_block/list.js
new file mode 100644
index 0000000..1e5e87b
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/list.js
@@ -0,0 +1,364 @@
+// Lists
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+// Search `[-+*][\n ]`, returns next pos after marker on success
+// or -1 on fail.
+function skipBulletListMarker(state, startLine) {
+ var marker, pos, max, ch;
+
+ pos = state.bMarks[startLine] + state.tShift[startLine];
+ max = state.eMarks[startLine];
+
+ marker = state.src.charCodeAt(pos++);
+ // Check bullet
+ if (marker !== 0x2A/* * */ &&
+ marker !== 0x2D/* - */ &&
+ marker !== 0x2B/* + */) {
+ return -1;
+ }
+
+ if (pos < max) {
+ ch = state.src.charCodeAt(pos);
+
+ if (!isSpace(ch)) {
+ // " -test " - is not a list item
+ return -1;
+ }
+ }
+
+ return pos;
+}
+
+// Search `\d+[.)][\n ]`, returns next pos after marker on success
+// or -1 on fail.
+function skipOrderedListMarker(state, startLine) {
+ var ch,
+ start = state.bMarks[startLine] + state.tShift[startLine],
+ pos = start,
+ max = state.eMarks[startLine];
+
+ // List marker should have at least 2 chars (digit + dot)
+ if (pos + 1 >= max) { return -1; }
+
+ ch = state.src.charCodeAt(pos++);
+
+ if (ch < 0x30/* 0 */ || ch > 0x39/* 9 */) { return -1; }
+
+ for (;;) {
+ // EOL -> fail
+ if (pos >= max) { return -1; }
+
+ ch = state.src.charCodeAt(pos++);
+
+ if (ch >= 0x30/* 0 */ && ch <= 0x39/* 9 */) {
+
+ // List marker should have no more than 9 digits
+ // (prevents integer overflow in browsers)
+ if (pos - start >= 10) { return -1; }
+
+ continue;
+ }
+
+ // found valid marker
+ if (ch === 0x29/* ) */ || ch === 0x2e/* . */) {
+ break;
+ }
+
+ return -1;
+ }
+
+
+ if (pos < max) {
+ ch = state.src.charCodeAt(pos);
+
+ if (!isSpace(ch)) {
+ // " 1.test " - is not a list item
+ return -1;
+ }
+ }
+ return pos;
+}
+
+function markTightParagraphs(state, idx) {
+ var i, l,
+ level = state.level + 2;
+
+ for (i = idx + 2, l = state.tokens.length - 2; i < l; i++) {
+ if (state.tokens[i].level === level && state.tokens[i].type === 'paragraph_open') {
+ state.tokens[i + 2].hidden = true;
+ state.tokens[i].hidden = true;
+ i += 2;
+ }
+ }
+}
+
+
+module.exports = function list(state, startLine, endLine, silent) {
+ var ch,
+ contentStart,
+ i,
+ indent,
+ indentAfterMarker,
+ initial,
+ isOrdered,
+ itemLines,
+ l,
+ listLines,
+ listTokIdx,
+ markerCharCode,
+ markerValue,
+ max,
+ nextLine,
+ offset,
+ oldListIndent,
+ oldParentType,
+ oldSCount,
+ oldTShift,
+ oldTight,
+ pos,
+ posAfterMarker,
+ prevEmptyEnd,
+ start,
+ terminate,
+ terminatorRules,
+ token,
+ isTerminatingParagraph = false,
+ tight = true;
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+ // Special case:
+ // - item 1
+ // - item 2
+ // - item 3
+ // - item 4
+ // - this one is a paragraph continuation
+ if (state.listIndent >= 0 &&
+ state.sCount[startLine] - state.listIndent >= 4 &&
+ state.sCount[startLine] < state.blkIndent) {
+ return false;
+ }
+
+ // limit conditions when list can interrupt
+ // a paragraph (validation mode only)
+ if (silent && state.parentType === 'paragraph') {
+ // Next list item should still terminate previous list item;
+ //
+ // This code can fail if plugins use blkIndent as well as lists,
+ // but I hope the spec gets fixed long before that happens.
+ //
+ if (state.sCount[startLine] >= state.blkIndent) {
+ isTerminatingParagraph = true;
+ }
+ }
+
+ // Detect list type and position after marker
+ if ((posAfterMarker = skipOrderedListMarker(state, startLine)) >= 0) {
+ isOrdered = true;
+ start = state.bMarks[startLine] + state.tShift[startLine];
+ markerValue = Number(state.src.slice(start, posAfterMarker - 1));
+
+ // If we're starting a new ordered list right after
+ // a paragraph, it should start with 1.
+ if (isTerminatingParagraph && markerValue !== 1) return false;
+
+ } else if ((posAfterMarker = skipBulletListMarker(state, startLine)) >= 0) {
+ isOrdered = false;
+
+ } else {
+ return false;
+ }
+
+ // If we're starting a new unordered list right after
+ // a paragraph, first line should not be empty.
+ if (isTerminatingParagraph) {
+ if (state.skipSpaces(posAfterMarker) >= state.eMarks[startLine]) return false;
+ }
+
+ // We should terminate list on style change. Remember first one to compare.
+ markerCharCode = state.src.charCodeAt(posAfterMarker - 1);
+
+ // For validation mode we can terminate immediately
+ if (silent) { return true; }
+
+ // Start list
+ listTokIdx = state.tokens.length;
+
+ if (isOrdered) {
+ token = state.push('ordered_list_open', 'ol', 1);
+ if (markerValue !== 1) {
+ token.attrs = [ [ 'start', markerValue ] ];
+ }
+
+ } else {
+ token = state.push('bullet_list_open', 'ul', 1);
+ }
+
+ token.map = listLines = [ startLine, 0 ];
+ token.markup = String.fromCharCode(markerCharCode);
+
+ //
+ // Iterate list items
+ //
+
+ nextLine = startLine;
+ prevEmptyEnd = false;
+ terminatorRules = state.md.block.ruler.getRules('list');
+
+ oldParentType = state.parentType;
+ state.parentType = 'list';
+
+ while (nextLine < endLine) {
+ pos = posAfterMarker;
+ max = state.eMarks[nextLine];
+
+ initial = offset = state.sCount[nextLine] + posAfterMarker - (state.bMarks[startLine] + state.tShift[startLine]);
+
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos);
+
+ if (ch === 0x09) {
+ offset += 4 - (offset + state.bsCount[nextLine]) % 4;
+ } else if (ch === 0x20) {
+ offset++;
+ } else {
+ break;
+ }
+
+ pos++;
+ }
+
+ contentStart = pos;
+
+ if (contentStart >= max) {
+ // trimming space in "- \n 3" case, indent is 1 here
+ indentAfterMarker = 1;
+ } else {
+ indentAfterMarker = offset - initial;
+ }
+
+ // If we have more than 4 spaces, the indent is 1
+ // (the rest is just indented code block)
+ if (indentAfterMarker > 4) { indentAfterMarker = 1; }
+
+ // " - test"
+ // ^^^^^ - calculating total length of this thing
+ indent = initial + indentAfterMarker;
+
+ // Run subparser & write tokens
+ token = state.push('list_item_open', 'li', 1);
+ token.markup = String.fromCharCode(markerCharCode);
+ token.map = itemLines = [ startLine, 0 ];
+ if (isOrdered) {
+ token.info = state.src.slice(start, posAfterMarker - 1);
+ }
+
+ // change current state, then restore it after parser subcall
+ oldTight = state.tight;
+ oldTShift = state.tShift[startLine];
+ oldSCount = state.sCount[startLine];
+
+ // - example list
+ // ^ listIndent position will be here
+ // ^ blkIndent position will be here
+ //
+ oldListIndent = state.listIndent;
+ state.listIndent = state.blkIndent;
+ state.blkIndent = indent;
+
+ state.tight = true;
+ state.tShift[startLine] = contentStart - state.bMarks[startLine];
+ state.sCount[startLine] = offset;
+
+ if (contentStart >= max && state.isEmpty(startLine + 1)) {
+ // workaround for this case
+ // (list item is empty, list terminates before "foo"):
+ // ~~~~~~~~
+ // -
+ //
+ // foo
+ // ~~~~~~~~
+ state.line = Math.min(state.line + 2, endLine);
+ } else {
+ state.md.block.tokenize(state, startLine, endLine, true);
+ }
+
+ // If any of list item is tight, mark list as tight
+ if (!state.tight || prevEmptyEnd) {
+ tight = false;
+ }
+ // Item become loose if finish with empty line,
+ // but we should filter last element, because it means list finish
+ prevEmptyEnd = (state.line - startLine) > 1 && state.isEmpty(state.line - 1);
+
+ state.blkIndent = state.listIndent;
+ state.listIndent = oldListIndent;
+ state.tShift[startLine] = oldTShift;
+ state.sCount[startLine] = oldSCount;
+ state.tight = oldTight;
+
+ token = state.push('list_item_close', 'li', -1);
+ token.markup = String.fromCharCode(markerCharCode);
+
+ nextLine = startLine = state.line;
+ itemLines[1] = nextLine;
+ contentStart = state.bMarks[startLine];
+
+ if (nextLine >= endLine) { break; }
+
+ //
+ // Try to check if list is terminated or continued.
+ //
+ if (state.sCount[nextLine] < state.blkIndent) { break; }
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) { break; }
+
+ // fail if terminating block found
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+ if (terminate) { break; }
+
+ // fail if list has another type
+ if (isOrdered) {
+ posAfterMarker = skipOrderedListMarker(state, nextLine);
+ if (posAfterMarker < 0) { break; }
+ start = state.bMarks[nextLine] + state.tShift[nextLine];
+ } else {
+ posAfterMarker = skipBulletListMarker(state, nextLine);
+ if (posAfterMarker < 0) { break; }
+ }
+
+ if (markerCharCode !== state.src.charCodeAt(posAfterMarker - 1)) { break; }
+ }
+
+ // Finalize list
+ if (isOrdered) {
+ token = state.push('ordered_list_close', 'ol', -1);
+ } else {
+ token = state.push('bullet_list_close', 'ul', -1);
+ }
+ token.markup = String.fromCharCode(markerCharCode);
+
+ listLines[1] = nextLine;
+ state.line = nextLine;
+
+ state.parentType = oldParentType;
+
+ // mark paragraphs tight if needed
+ if (tight) {
+ markTightParagraphs(state, listTokIdx);
+ }
+
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/paragraph.js b/node_modules/markdown-it/lib/rules_block/paragraph.js
new file mode 100644
index 0000000..f0c6872
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/paragraph.js
@@ -0,0 +1,52 @@
+// Paragraph
+
+'use strict';
+
+
+module.exports = function paragraph(state, startLine/*, endLine*/) {
+ var content, terminate, i, l, token, oldParentType,
+ nextLine = startLine + 1,
+ terminatorRules = state.md.block.ruler.getRules('paragraph'),
+ endLine = state.lineMax;
+
+ oldParentType = state.parentType;
+ state.parentType = 'paragraph';
+
+ // jump line-by-line until empty one or EOF
+ for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+ // this would be a code block normally, but after paragraph
+ // it's considered a lazy continuation regardless of what's there
+ if (state.sCount[nextLine] - state.blkIndent > 3) { continue; }
+
+ // quirk for blockquotes, this line should already be checked by that rule
+ if (state.sCount[nextLine] < 0) { continue; }
+
+ // Some tags can terminate paragraph without empty line.
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+ if (terminate) { break; }
+ }
+
+ content = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+
+ state.line = nextLine;
+
+ token = state.push('paragraph_open', 'p', 1);
+ token.map = [ startLine, state.line ];
+
+ token = state.push('inline', '', 0);
+ token.content = content;
+ token.map = [ startLine, state.line ];
+ token.children = [];
+
+ token = state.push('paragraph_close', 'p', -1);
+
+ state.parentType = oldParentType;
+
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/reference.js b/node_modules/markdown-it/lib/rules_block/reference.js
new file mode 100644
index 0000000..78daa26
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/reference.js
@@ -0,0 +1,198 @@
+'use strict';
+
+
+var normalizeReference = require('../common/utils').normalizeReference;
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function reference(state, startLine, _endLine, silent) {
+ var ch,
+ destEndPos,
+ destEndLineNo,
+ endLine,
+ href,
+ i,
+ l,
+ label,
+ labelEnd,
+ oldParentType,
+ res,
+ start,
+ str,
+ terminate,
+ terminatorRules,
+ title,
+ lines = 0,
+ pos = state.bMarks[startLine] + state.tShift[startLine],
+ max = state.eMarks[startLine],
+ nextLine = startLine + 1;
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+
+ if (state.src.charCodeAt(pos) !== 0x5B/* [ */) { return false; }
+
+ // Simple check to quickly interrupt scan on [link](url) at the start of line.
+ // Can be useful on practice: https://github.com/markdown-it/markdown-it/issues/54
+ while (++pos < max) {
+ if (state.src.charCodeAt(pos) === 0x5D /* ] */ &&
+ state.src.charCodeAt(pos - 1) !== 0x5C/* \ */) {
+ if (pos + 1 === max) { return false; }
+ if (state.src.charCodeAt(pos + 1) !== 0x3A/* : */) { return false; }
+ break;
+ }
+ }
+
+ endLine = state.lineMax;
+
+ // jump line-by-line until empty one or EOF
+ terminatorRules = state.md.block.ruler.getRules('reference');
+
+ oldParentType = state.parentType;
+ state.parentType = 'reference';
+
+ for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) {
+ // this would be a code block normally, but after paragraph
+ // it's considered a lazy continuation regardless of what's there
+ if (state.sCount[nextLine] - state.blkIndent > 3) { continue; }
+
+ // quirk for blockquotes, this line should already be checked by that rule
+ if (state.sCount[nextLine] < 0) { continue; }
+
+ // Some tags can terminate paragraph without empty line.
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+ if (terminate) { break; }
+ }
+
+ str = state.getLines(startLine, nextLine, state.blkIndent, false).trim();
+ max = str.length;
+
+ for (pos = 1; pos < max; pos++) {
+ ch = str.charCodeAt(pos);
+ if (ch === 0x5B /* [ */) {
+ return false;
+ } else if (ch === 0x5D /* ] */) {
+ labelEnd = pos;
+ break;
+ } else if (ch === 0x0A /* \n */) {
+ lines++;
+ } else if (ch === 0x5C /* \ */) {
+ pos++;
+ if (pos < max && str.charCodeAt(pos) === 0x0A) {
+ lines++;
+ }
+ }
+ }
+
+ if (labelEnd < 0 || str.charCodeAt(labelEnd + 1) !== 0x3A/* : */) { return false; }
+
+ // [label]: destination 'title'
+ // ^^^ skip optional whitespace here
+ for (pos = labelEnd + 2; pos < max; pos++) {
+ ch = str.charCodeAt(pos);
+ if (ch === 0x0A) {
+ lines++;
+ } else if (isSpace(ch)) {
+ /*eslint no-empty:0*/
+ } else {
+ break;
+ }
+ }
+
+ // [label]: destination 'title'
+ // ^^^^^^^^^^^ parse this
+ res = state.md.helpers.parseLinkDestination(str, pos, max);
+ if (!res.ok) { return false; }
+
+ href = state.md.normalizeLink(res.str);
+ if (!state.md.validateLink(href)) { return false; }
+
+ pos = res.pos;
+ lines += res.lines;
+
+ // save cursor state, we could require to rollback later
+ destEndPos = pos;
+ destEndLineNo = lines;
+
+ // [label]: destination 'title'
+ // ^^^ skipping those spaces
+ start = pos;
+ for (; pos < max; pos++) {
+ ch = str.charCodeAt(pos);
+ if (ch === 0x0A) {
+ lines++;
+ } else if (isSpace(ch)) {
+ /*eslint no-empty:0*/
+ } else {
+ break;
+ }
+ }
+
+ // [label]: destination 'title'
+ // ^^^^^^^ parse this
+ res = state.md.helpers.parseLinkTitle(str, pos, max);
+ if (pos < max && start !== pos && res.ok) {
+ title = res.str;
+ pos = res.pos;
+ lines += res.lines;
+ } else {
+ title = '';
+ pos = destEndPos;
+ lines = destEndLineNo;
+ }
+
+ // skip trailing spaces until the rest of the line
+ while (pos < max) {
+ ch = str.charCodeAt(pos);
+ if (!isSpace(ch)) { break; }
+ pos++;
+ }
+
+ if (pos < max && str.charCodeAt(pos) !== 0x0A) {
+ if (title) {
+ // garbage at the end of the line after title,
+ // but it could still be a valid reference if we roll back
+ title = '';
+ pos = destEndPos;
+ lines = destEndLineNo;
+ while (pos < max) {
+ ch = str.charCodeAt(pos);
+ if (!isSpace(ch)) { break; }
+ pos++;
+ }
+ }
+ }
+
+ if (pos < max && str.charCodeAt(pos) !== 0x0A) {
+ // garbage at the end of the line
+ return false;
+ }
+
+ label = normalizeReference(str.slice(1, labelEnd));
+ if (!label) {
+ // CommonMark 0.20 disallows empty labels
+ return false;
+ }
+
+ // Reference can not terminate anything. This check is for safety only.
+ /*istanbul ignore if*/
+ if (silent) { return true; }
+
+ if (typeof state.env.references === 'undefined') {
+ state.env.references = {};
+ }
+ if (typeof state.env.references[label] === 'undefined') {
+ state.env.references[label] = { title: title, href: href };
+ }
+
+ state.parentType = oldParentType;
+
+ state.line = startLine + lines + 1;
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_block/state_block.js b/node_modules/markdown-it/lib/rules_block/state_block.js
new file mode 100644
index 0000000..e42cb4b
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/state_block.js
@@ -0,0 +1,231 @@
+// Parser state class
+
+'use strict';
+
+var Token = require('../token');
+var isSpace = require('../common/utils').isSpace;
+
+
+function StateBlock(src, md, env, tokens) {
+ var ch, s, start, pos, len, indent, offset, indent_found;
+
+ this.src = src;
+
+ // link to parser instance
+ this.md = md;
+
+ this.env = env;
+
+ //
+ // Internal state vartiables
+ //
+
+ this.tokens = tokens;
+
+ this.bMarks = []; // line begin offsets for fast jumps
+ this.eMarks = []; // line end offsets for fast jumps
+ this.tShift = []; // offsets of the first non-space characters (tabs not expanded)
+ this.sCount = []; // indents for each line (tabs expanded)
+
+ // An amount of virtual spaces (tabs expanded) between beginning
+ // of each line (bMarks) and real beginning of that line.
+ //
+ // It exists only as a hack because blockquotes override bMarks
+ // losing information in the process.
+ //
+ // It's used only when expanding tabs, you can think about it as
+ // an initial tab length, e.g. bsCount=21 applied to string `\t123`
+ // means first tab should be expanded to 4-21%4 === 3 spaces.
+ //
+ this.bsCount = [];
+
+ // block parser variables
+ this.blkIndent = 0; // required block content indent (for example, if we are
+ // inside a list, it would be positioned after list marker)
+ this.line = 0; // line index in src
+ this.lineMax = 0; // lines count
+ this.tight = false; // loose/tight mode for lists
+ this.ddIndent = -1; // indent of the current dd block (-1 if there isn't any)
+ this.listIndent = -1; // indent of the current list block (-1 if there isn't any)
+
+ // can be 'blockquote', 'list', 'root', 'paragraph' or 'reference'
+ // used in lists to determine if they interrupt a paragraph
+ this.parentType = 'root';
+
+ this.level = 0;
+
+ // renderer
+ this.result = '';
+
+ // Create caches
+ // Generate markers.
+ s = this.src;
+ indent_found = false;
+
+ for (start = pos = indent = offset = 0, len = s.length; pos < len; pos++) {
+ ch = s.charCodeAt(pos);
+
+ if (!indent_found) {
+ if (isSpace(ch)) {
+ indent++;
+
+ if (ch === 0x09) {
+ offset += 4 - offset % 4;
+ } else {
+ offset++;
+ }
+ continue;
+ } else {
+ indent_found = true;
+ }
+ }
+
+ if (ch === 0x0A || pos === len - 1) {
+ if (ch !== 0x0A) { pos++; }
+ this.bMarks.push(start);
+ this.eMarks.push(pos);
+ this.tShift.push(indent);
+ this.sCount.push(offset);
+ this.bsCount.push(0);
+
+ indent_found = false;
+ indent = 0;
+ offset = 0;
+ start = pos + 1;
+ }
+ }
+
+ // Push fake entry to simplify cache bounds checks
+ this.bMarks.push(s.length);
+ this.eMarks.push(s.length);
+ this.tShift.push(0);
+ this.sCount.push(0);
+ this.bsCount.push(0);
+
+ this.lineMax = this.bMarks.length - 1; // don't count last fake line
+}
+
+// Push new token to "stream".
+//
+StateBlock.prototype.push = function (type, tag, nesting) {
+ var token = new Token(type, tag, nesting);
+ token.block = true;
+
+ if (nesting < 0) this.level--; // closing tag
+ token.level = this.level;
+ if (nesting > 0) this.level++; // opening tag
+
+ this.tokens.push(token);
+ return token;
+};
+
+StateBlock.prototype.isEmpty = function isEmpty(line) {
+ return this.bMarks[line] + this.tShift[line] >= this.eMarks[line];
+};
+
+StateBlock.prototype.skipEmptyLines = function skipEmptyLines(from) {
+ for (var max = this.lineMax; from < max; from++) {
+ if (this.bMarks[from] + this.tShift[from] < this.eMarks[from]) {
+ break;
+ }
+ }
+ return from;
+};
+
+// Skip spaces from given position.
+StateBlock.prototype.skipSpaces = function skipSpaces(pos) {
+ var ch;
+
+ for (var max = this.src.length; pos < max; pos++) {
+ ch = this.src.charCodeAt(pos);
+ if (!isSpace(ch)) { break; }
+ }
+ return pos;
+};
+
+// Skip spaces from given position in reverse.
+StateBlock.prototype.skipSpacesBack = function skipSpacesBack(pos, min) {
+ if (pos <= min) { return pos; }
+
+ while (pos > min) {
+ if (!isSpace(this.src.charCodeAt(--pos))) { return pos + 1; }
+ }
+ return pos;
+};
+
+// Skip char codes from given position
+StateBlock.prototype.skipChars = function skipChars(pos, code) {
+ for (var max = this.src.length; pos < max; pos++) {
+ if (this.src.charCodeAt(pos) !== code) { break; }
+ }
+ return pos;
+};
+
+// Skip char codes reverse from given position - 1
+StateBlock.prototype.skipCharsBack = function skipCharsBack(pos, code, min) {
+ if (pos <= min) { return pos; }
+
+ while (pos > min) {
+ if (code !== this.src.charCodeAt(--pos)) { return pos + 1; }
+ }
+ return pos;
+};
+
+// cut lines range from source.
+StateBlock.prototype.getLines = function getLines(begin, end, indent, keepLastLF) {
+ var i, lineIndent, ch, first, last, queue, lineStart,
+ line = begin;
+
+ if (begin >= end) {
+ return '';
+ }
+
+ queue = new Array(end - begin);
+
+ for (i = 0; line < end; line++, i++) {
+ lineIndent = 0;
+ lineStart = first = this.bMarks[line];
+
+ if (line + 1 < end || keepLastLF) {
+ // No need for bounds check because we have fake entry on tail.
+ last = this.eMarks[line] + 1;
+ } else {
+ last = this.eMarks[line];
+ }
+
+ while (first < last && lineIndent < indent) {
+ ch = this.src.charCodeAt(first);
+
+ if (isSpace(ch)) {
+ if (ch === 0x09) {
+ lineIndent += 4 - (lineIndent + this.bsCount[line]) % 4;
+ } else {
+ lineIndent++;
+ }
+ } else if (first - lineStart < this.tShift[line]) {
+ // patched tShift masked characters to look like spaces (blockquotes, list markers)
+ lineIndent++;
+ } else {
+ break;
+ }
+
+ first++;
+ }
+
+ if (lineIndent > indent) {
+ // partially expanding tabs in code blocks, e.g '\t\tfoobar'
+ // with indent=2 becomes ' \tfoobar'
+ queue[i] = new Array(lineIndent - indent + 1).join(' ') + this.src.slice(first, last);
+ } else {
+ queue[i] = this.src.slice(first, last);
+ }
+ }
+
+ return queue.join('');
+};
+
+// re-export Token class to use in block rules
+StateBlock.prototype.Token = Token;
+
+
+module.exports = StateBlock;
diff --git a/node_modules/markdown-it/lib/rules_block/table.js b/node_modules/markdown-it/lib/rules_block/table.js
new file mode 100644
index 0000000..7d9208f
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_block/table.js
@@ -0,0 +1,221 @@
+// GFM table, https://github.github.com/gfm/#tables-extension-
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+function getLine(state, line) {
+ var pos = state.bMarks[line] + state.tShift[line],
+ max = state.eMarks[line];
+
+ return state.src.substr(pos, max - pos);
+}
+
+function escapedSplit(str) {
+ var result = [],
+ pos = 0,
+ max = str.length,
+ ch,
+ isEscaped = false,
+ lastPos = 0,
+ current = '';
+
+ ch = str.charCodeAt(pos);
+
+ while (pos < max) {
+ if (ch === 0x7c/* | */) {
+ if (!isEscaped) {
+ // pipe separating cells, '|'
+ result.push(current + str.substring(lastPos, pos));
+ current = '';
+ lastPos = pos + 1;
+ } else {
+ // escaped pipe, '\|'
+ current += str.substring(lastPos, pos - 1);
+ lastPos = pos;
+ }
+ }
+
+ isEscaped = (ch === 0x5c/* \ */);
+ pos++;
+
+ ch = str.charCodeAt(pos);
+ }
+
+ result.push(current + str.substring(lastPos));
+
+ return result;
+}
+
+
+module.exports = function table(state, startLine, endLine, silent) {
+ var ch, lineText, pos, i, l, nextLine, columns, columnCount, token,
+ aligns, t, tableLines, tbodyLines, oldParentType, terminate,
+ terminatorRules, firstCh, secondCh;
+
+ // should have at least two lines
+ if (startLine + 2 > endLine) { return false; }
+
+ nextLine = startLine + 1;
+
+ if (state.sCount[nextLine] < state.blkIndent) { return false; }
+
+ // if it's indented more than 3 spaces, it should be a code block
+ if (state.sCount[nextLine] - state.blkIndent >= 4) { return false; }
+
+ // first character of the second line should be '|', '-', ':',
+ // and no other characters are allowed but spaces;
+ // basically, this is the equivalent of /^[-:|][-:|\s]*$/ regexp
+
+ pos = state.bMarks[nextLine] + state.tShift[nextLine];
+ if (pos >= state.eMarks[nextLine]) { return false; }
+
+ firstCh = state.src.charCodeAt(pos++);
+ if (firstCh !== 0x7C/* | */ && firstCh !== 0x2D/* - */ && firstCh !== 0x3A/* : */) { return false; }
+
+ if (pos >= state.eMarks[nextLine]) { return false; }
+
+ secondCh = state.src.charCodeAt(pos++);
+ if (secondCh !== 0x7C/* | */ && secondCh !== 0x2D/* - */ && secondCh !== 0x3A/* : */ && !isSpace(secondCh)) {
+ return false;
+ }
+
+ // if first character is '-', then second character must not be a space
+ // (due to parsing ambiguity with list)
+ if (firstCh === 0x2D/* - */ && isSpace(secondCh)) { return false; }
+
+ while (pos < state.eMarks[nextLine]) {
+ ch = state.src.charCodeAt(pos);
+
+ if (ch !== 0x7C/* | */ && ch !== 0x2D/* - */ && ch !== 0x3A/* : */ && !isSpace(ch)) { return false; }
+
+ pos++;
+ }
+
+ lineText = getLine(state, startLine + 1);
+
+ columns = lineText.split('|');
+ aligns = [];
+ for (i = 0; i < columns.length; i++) {
+ t = columns[i].trim();
+ if (!t) {
+ // allow empty columns before and after table, but not in between columns;
+ // e.g. allow ` |---| `, disallow ` ---||--- `
+ if (i === 0 || i === columns.length - 1) {
+ continue;
+ } else {
+ return false;
+ }
+ }
+
+ if (!/^:?-+:?$/.test(t)) { return false; }
+ if (t.charCodeAt(t.length - 1) === 0x3A/* : */) {
+ aligns.push(t.charCodeAt(0) === 0x3A/* : */ ? 'center' : 'right');
+ } else if (t.charCodeAt(0) === 0x3A/* : */) {
+ aligns.push('left');
+ } else {
+ aligns.push('');
+ }
+ }
+
+ lineText = getLine(state, startLine).trim();
+ if (lineText.indexOf('|') === -1) { return false; }
+ if (state.sCount[startLine] - state.blkIndent >= 4) { return false; }
+ columns = escapedSplit(lineText);
+ if (columns.length && columns[0] === '') columns.shift();
+ if (columns.length && columns[columns.length - 1] === '') columns.pop();
+
+ // header row will define an amount of columns in the entire table,
+ // and align row should be exactly the same (the rest of the rows can differ)
+ columnCount = columns.length;
+ if (columnCount === 0 || columnCount !== aligns.length) { return false; }
+
+ if (silent) { return true; }
+
+ oldParentType = state.parentType;
+ state.parentType = 'table';
+
+ // use 'blockquote' lists for termination because it's
+ // the most similar to tables
+ terminatorRules = state.md.block.ruler.getRules('blockquote');
+
+ token = state.push('table_open', 'table', 1);
+ token.map = tableLines = [ startLine, 0 ];
+
+ token = state.push('thead_open', 'thead', 1);
+ token.map = [ startLine, startLine + 1 ];
+
+ token = state.push('tr_open', 'tr', 1);
+ token.map = [ startLine, startLine + 1 ];
+
+ for (i = 0; i < columns.length; i++) {
+ token = state.push('th_open', 'th', 1);
+ if (aligns[i]) {
+ token.attrs = [ [ 'style', 'text-align:' + aligns[i] ] ];
+ }
+
+ token = state.push('inline', '', 0);
+ token.content = columns[i].trim();
+ token.children = [];
+
+ token = state.push('th_close', 'th', -1);
+ }
+
+ token = state.push('tr_close', 'tr', -1);
+ token = state.push('thead_close', 'thead', -1);
+
+ for (nextLine = startLine + 2; nextLine < endLine; nextLine++) {
+ if (state.sCount[nextLine] < state.blkIndent) { break; }
+
+ terminate = false;
+ for (i = 0, l = terminatorRules.length; i < l; i++) {
+ if (terminatorRules[i](state, nextLine, endLine, true)) {
+ terminate = true;
+ break;
+ }
+ }
+
+ if (terminate) { break; }
+ lineText = getLine(state, nextLine).trim();
+ if (!lineText) { break; }
+ if (state.sCount[nextLine] - state.blkIndent >= 4) { break; }
+ columns = escapedSplit(lineText);
+ if (columns.length && columns[0] === '') columns.shift();
+ if (columns.length && columns[columns.length - 1] === '') columns.pop();
+
+ if (nextLine === startLine + 2) {
+ token = state.push('tbody_open', 'tbody', 1);
+ token.map = tbodyLines = [ startLine + 2, 0 ];
+ }
+
+ token = state.push('tr_open', 'tr', 1);
+ token.map = [ nextLine, nextLine + 1 ];
+
+ for (i = 0; i < columnCount; i++) {
+ token = state.push('td_open', 'td', 1);
+ if (aligns[i]) {
+ token.attrs = [ [ 'style', 'text-align:' + aligns[i] ] ];
+ }
+
+ token = state.push('inline', '', 0);
+ token.content = columns[i] ? columns[i].trim() : '';
+ token.children = [];
+
+ token = state.push('td_close', 'td', -1);
+ }
+ token = state.push('tr_close', 'tr', -1);
+ }
+
+ if (tbodyLines) {
+ token = state.push('tbody_close', 'tbody', -1);
+ tbodyLines[1] = nextLine;
+ }
+
+ token = state.push('table_close', 'table', -1);
+ tableLines[1] = nextLine;
+
+ state.parentType = oldParentType;
+ state.line = nextLine;
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_core/block.js b/node_modules/markdown-it/lib/rules_core/block.js
new file mode 100644
index 0000000..2a365fa
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/block.js
@@ -0,0 +1,16 @@
+'use strict';
+
+
+module.exports = function block(state) {
+ var token;
+
+ if (state.inlineMode) {
+ token = new state.Token('inline', '', 0);
+ token.content = state.src;
+ token.map = [ 0, 1 ];
+ token.children = [];
+ state.tokens.push(token);
+ } else {
+ state.md.block.parse(state.src, state.md, state.env, state.tokens);
+ }
+};
diff --git a/node_modules/markdown-it/lib/rules_core/inline.js b/node_modules/markdown-it/lib/rules_core/inline.js
new file mode 100644
index 0000000..4c33d0d
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/inline.js
@@ -0,0 +1,13 @@
+'use strict';
+
+module.exports = function inline(state) {
+ var tokens = state.tokens, tok, i, l;
+
+ // Parse inlines
+ for (i = 0, l = tokens.length; i < l; i++) {
+ tok = tokens[i];
+ if (tok.type === 'inline') {
+ state.md.inline.parse(tok.content, state.md, state.env, tok.children);
+ }
+ }
+};
diff --git a/node_modules/markdown-it/lib/rules_core/linkify.js b/node_modules/markdown-it/lib/rules_core/linkify.js
new file mode 100644
index 0000000..7c3ffc8
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/linkify.js
@@ -0,0 +1,133 @@
+// Replace link-like texts with link nodes.
+//
+// Currently restricted by `md.validateLink()` to http/https/ftp
+//
+'use strict';
+
+
+var arrayReplaceAt = require('../common/utils').arrayReplaceAt;
+
+
+function isLinkOpen(str) {
+ return /^<a[>\s]/i.test(str);
+}
+function isLinkClose(str) {
+ return /^<\/a\s*>/i.test(str);
+}
+
+
+module.exports = function linkify(state) {
+ var i, j, l, tokens, token, currentToken, nodes, ln, text, pos, lastPos,
+ level, htmlLinkLevel, url, fullUrl, urlText,
+ blockTokens = state.tokens,
+ links;
+
+ if (!state.md.options.linkify) { return; }
+
+ for (j = 0, l = blockTokens.length; j < l; j++) {
+ if (blockTokens[j].type !== 'inline' ||
+ !state.md.linkify.pretest(blockTokens[j].content)) {
+ continue;
+ }
+
+ tokens = blockTokens[j].children;
+
+ htmlLinkLevel = 0;
+
+ // We scan from the end, to keep position when new tags added.
+ // Use reversed logic in links start/end match
+ for (i = tokens.length - 1; i >= 0; i--) {
+ currentToken = tokens[i];
+
+ // Skip content of markdown links
+ if (currentToken.type === 'link_close') {
+ i--;
+ while (tokens[i].level !== currentToken.level && tokens[i].type !== 'link_open') {
+ i--;
+ }
+ continue;
+ }
+
+ // Skip content of html tag links
+ if (currentToken.type === 'html_inline') {
+ if (isLinkOpen(currentToken.content) && htmlLinkLevel > 0) {
+ htmlLinkLevel--;
+ }
+ if (isLinkClose(currentToken.content)) {
+ htmlLinkLevel++;
+ }
+ }
+ if (htmlLinkLevel > 0) { continue; }
+
+ if (currentToken.type === 'text' && state.md.linkify.test(currentToken.content)) {
+
+ text = currentToken.content;
+ links = state.md.linkify.match(text);
+
+ // Now split string to nodes
+ nodes = [];
+ level = currentToken.level;
+ lastPos = 0;
+
+ for (ln = 0; ln < links.length; ln++) {
+
+ url = links[ln].url;
+ fullUrl = state.md.normalizeLink(url);
+ if (!state.md.validateLink(fullUrl)) { continue; }
+
+ urlText = links[ln].text;
+
+ // Linkifier might send raw hostnames like "example.com", where url
+ // starts with domain name. So we prepend http:// in those cases,
+ // and remove it afterwards.
+ //
+ if (!links[ln].schema) {
+ urlText = state.md.normalizeLinkText('http://' + urlText).replace(/^http:\/\//, '');
+ } else if (links[ln].schema === 'mailto:' && !/^mailto:/i.test(urlText)) {
+ urlText = state.md.normalizeLinkText('mailto:' + urlText).replace(/^mailto:/, '');
+ } else {
+ urlText = state.md.normalizeLinkText(urlText);
+ }
+
+ pos = links[ln].index;
+
+ if (pos > lastPos) {
+ token = new state.Token('text', '', 0);
+ token.content = text.slice(lastPos, pos);
+ token.level = level;
+ nodes.push(token);
+ }
+
+ token = new state.Token('link_open', 'a', 1);
+ token.attrs = [ [ 'href', fullUrl ] ];
+ token.level = level++;
+ token.markup = 'linkify';
+ token.info = 'auto';
+ nodes.push(token);
+
+ token = new state.Token('text', '', 0);
+ token.content = urlText;
+ token.level = level;
+ nodes.push(token);
+
+ token = new state.Token('link_close', 'a', -1);
+ token.level = --level;
+ token.markup = 'linkify';
+ token.info = 'auto';
+ nodes.push(token);
+
+ lastPos = links[ln].lastIndex;
+ }
+ if (lastPos < text.length) {
+ token = new state.Token('text', '', 0);
+ token.content = text.slice(lastPos);
+ token.level = level;
+ nodes.push(token);
+ }
+
+ // replace current node
+ blockTokens[j].children = tokens = arrayReplaceAt(tokens, i, nodes);
+ }
+ }
+ }
+};
diff --git a/node_modules/markdown-it/lib/rules_core/normalize.js b/node_modules/markdown-it/lib/rules_core/normalize.js
new file mode 100644
index 0000000..ad196cd
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/normalize.js
@@ -0,0 +1,21 @@
+// Normalize input string
+
+'use strict';
+
+
+// https://spec.commonmark.org/0.29/#line-ending
+var NEWLINES_RE = /\r\n?|\n/g;
+var NULL_RE = /\0/g;
+
+
+module.exports = function normalize(state) {
+ var str;
+
+ // Normalize newlines
+ str = state.src.replace(NEWLINES_RE, '\n');
+
+ // Replace NULL characters
+ str = str.replace(NULL_RE, '\uFFFD');
+
+ state.src = str;
+};
diff --git a/node_modules/markdown-it/lib/rules_core/replacements.js b/node_modules/markdown-it/lib/rules_core/replacements.js
new file mode 100644
index 0000000..533496f
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/replacements.js
@@ -0,0 +1,107 @@
+// Simple typographic replacements
+//
+// (c) (C) → ©
+// (tm) (TM) → ™
+// (r) (R) → ®
+// +- → ±
+// (p) (P) -> §
+// ... → … (also ?.... → ?.., !.... → !..)
+// ???????? → ???, !!!!! → !!!, `,,` → `,`
+// -- → &ndash;, --- → &mdash;
+//
+'use strict';
+
+// TODO:
+// - fractionals 1/2, 1/4, 3/4 -> ½, ¼, ¾
+// - miltiplication 2 x 4 -> 2 × 4
+
+var RARE_RE = /\+-|\.\.|\?\?\?\?|!!!!|,,|--/;
+
+// Workaround for phantomjs - need regex without /g flag,
+// or root check will fail every second time
+var SCOPED_ABBR_TEST_RE = /\((c|tm|r|p)\)/i;
+
+var SCOPED_ABBR_RE = /\((c|tm|r|p)\)/ig;
+var SCOPED_ABBR = {
+ c: '©',
+ r: '®',
+ p: '§',
+ tm: '™'
+};
+
+function replaceFn(match, name) {
+ return SCOPED_ABBR[name.toLowerCase()];
+}
+
+function replace_scoped(inlineTokens) {
+ var i, token, inside_autolink = 0;
+
+ for (i = inlineTokens.length - 1; i >= 0; i--) {
+ token = inlineTokens[i];
+
+ if (token.type === 'text' && !inside_autolink) {
+ token.content = token.content.replace(SCOPED_ABBR_RE, replaceFn);
+ }
+
+ if (token.type === 'link_open' && token.info === 'auto') {
+ inside_autolink--;
+ }
+
+ if (token.type === 'link_close' && token.info === 'auto') {
+ inside_autolink++;
+ }
+ }
+}
+
+function replace_rare(inlineTokens) {
+ var i, token, inside_autolink = 0;
+
+ for (i = inlineTokens.length - 1; i >= 0; i--) {
+ token = inlineTokens[i];
+
+ if (token.type === 'text' && !inside_autolink) {
+ if (RARE_RE.test(token.content)) {
+ token.content = token.content
+ .replace(/\+-/g, '±')
+ // .., ..., ....... -> …
+ // but ?..... & !..... -> ?.. & !..
+ .replace(/\.{2,}/g, '…').replace(/([?!])…/g, '$1..')
+ .replace(/([?!]){4,}/g, '$1$1$1').replace(/,{2,}/g, ',')
+ // em-dash
+ .replace(/(^|[^-])---(?=[^-]|$)/mg, '$1\u2014')
+ // en-dash
+ .replace(/(^|\s)--(?=\s|$)/mg, '$1\u2013')
+ .replace(/(^|[^-\s])--(?=[^-\s]|$)/mg, '$1\u2013');
+ }
+ }
+
+ if (token.type === 'link_open' && token.info === 'auto') {
+ inside_autolink--;
+ }
+
+ if (token.type === 'link_close' && token.info === 'auto') {
+ inside_autolink++;
+ }
+ }
+}
+
+
+module.exports = function replace(state) {
+ var blkIdx;
+
+ if (!state.md.options.typographer) { return; }
+
+ for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) {
+
+ if (state.tokens[blkIdx].type !== 'inline') { continue; }
+
+ if (SCOPED_ABBR_TEST_RE.test(state.tokens[blkIdx].content)) {
+ replace_scoped(state.tokens[blkIdx].children);
+ }
+
+ if (RARE_RE.test(state.tokens[blkIdx].content)) {
+ replace_rare(state.tokens[blkIdx].children);
+ }
+
+ }
+};
diff --git a/node_modules/markdown-it/lib/rules_core/smartquotes.js b/node_modules/markdown-it/lib/rules_core/smartquotes.js
new file mode 100644
index 0000000..e96fc71
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/smartquotes.js
@@ -0,0 +1,201 @@
+// Convert straight quotation marks to typographic ones
+//
+'use strict';
+
+
+var isWhiteSpace = require('../common/utils').isWhiteSpace;
+var isPunctChar = require('../common/utils').isPunctChar;
+var isMdAsciiPunct = require('../common/utils').isMdAsciiPunct;
+
+var QUOTE_TEST_RE = /['"]/;
+var QUOTE_RE = /['"]/g;
+var APOSTROPHE = '\u2019'; /* ’ */
+
+
+function replaceAt(str, index, ch) {
+ return str.substr(0, index) + ch + str.substr(index + 1);
+}
+
+function process_inlines(tokens, state) {
+ var i, token, text, t, pos, max, thisLevel, item, lastChar, nextChar,
+ isLastPunctChar, isNextPunctChar, isLastWhiteSpace, isNextWhiteSpace,
+ canOpen, canClose, j, isSingle, stack, openQuote, closeQuote;
+
+ stack = [];
+
+ for (i = 0; i < tokens.length; i++) {
+ token = tokens[i];
+
+ thisLevel = tokens[i].level;
+
+ for (j = stack.length - 1; j >= 0; j--) {
+ if (stack[j].level <= thisLevel) { break; }
+ }
+ stack.length = j + 1;
+
+ if (token.type !== 'text') { continue; }
+
+ text = token.content;
+ pos = 0;
+ max = text.length;
+
+ /*eslint no-labels:0,block-scoped-var:0*/
+ OUTER:
+ while (pos < max) {
+ QUOTE_RE.lastIndex = pos;
+ t = QUOTE_RE.exec(text);
+ if (!t) { break; }
+
+ canOpen = canClose = true;
+ pos = t.index + 1;
+ isSingle = (t[0] === "'");
+
+ // Find previous character,
+ // default to space if it's the beginning of the line
+ //
+ lastChar = 0x20;
+
+ if (t.index - 1 >= 0) {
+ lastChar = text.charCodeAt(t.index - 1);
+ } else {
+ for (j = i - 1; j >= 0; j--) {
+ if (tokens[j].type === 'softbreak' || tokens[j].type === 'hardbreak') break; // lastChar defaults to 0x20
+ if (!tokens[j].content) continue; // should skip all tokens except 'text', 'html_inline' or 'code_inline'
+
+ lastChar = tokens[j].content.charCodeAt(tokens[j].content.length - 1);
+ break;
+ }
+ }
+
+ // Find next character,
+ // default to space if it's the end of the line
+ //
+ nextChar = 0x20;
+
+ if (pos < max) {
+ nextChar = text.charCodeAt(pos);
+ } else {
+ for (j = i + 1; j < tokens.length; j++) {
+ if (tokens[j].type === 'softbreak' || tokens[j].type === 'hardbreak') break; // nextChar defaults to 0x20
+ if (!tokens[j].content) continue; // should skip all tokens except 'text', 'html_inline' or 'code_inline'
+
+ nextChar = tokens[j].content.charCodeAt(0);
+ break;
+ }
+ }
+
+ isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar));
+ isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar));
+
+ isLastWhiteSpace = isWhiteSpace(lastChar);
+ isNextWhiteSpace = isWhiteSpace(nextChar);
+
+ if (isNextWhiteSpace) {
+ canOpen = false;
+ } else if (isNextPunctChar) {
+ if (!(isLastWhiteSpace || isLastPunctChar)) {
+ canOpen = false;
+ }
+ }
+
+ if (isLastWhiteSpace) {
+ canClose = false;
+ } else if (isLastPunctChar) {
+ if (!(isNextWhiteSpace || isNextPunctChar)) {
+ canClose = false;
+ }
+ }
+
+ if (nextChar === 0x22 /* " */ && t[0] === '"') {
+ if (lastChar >= 0x30 /* 0 */ && lastChar <= 0x39 /* 9 */) {
+ // special case: 1"" - count first quote as an inch
+ canClose = canOpen = false;
+ }
+ }
+
+ if (canOpen && canClose) {
+ // Replace quotes in the middle of punctuation sequence, but not
+ // in the middle of the words, i.e.:
+ //
+ // 1. foo " bar " baz - not replaced
+ // 2. foo-"-bar-"-baz - replaced
+ // 3. foo"bar"baz - not replaced
+ //
+ canOpen = isLastPunctChar;
+ canClose = isNextPunctChar;
+ }
+
+ if (!canOpen && !canClose) {
+ // middle of word
+ if (isSingle) {
+ token.content = replaceAt(token.content, t.index, APOSTROPHE);
+ }
+ continue;
+ }
+
+ if (canClose) {
+ // this could be a closing quote, rewind the stack to get a match
+ for (j = stack.length - 1; j >= 0; j--) {
+ item = stack[j];
+ if (stack[j].level < thisLevel) { break; }
+ if (item.single === isSingle && stack[j].level === thisLevel) {
+ item = stack[j];
+
+ if (isSingle) {
+ openQuote = state.md.options.quotes[2];
+ closeQuote = state.md.options.quotes[3];
+ } else {
+ openQuote = state.md.options.quotes[0];
+ closeQuote = state.md.options.quotes[1];
+ }
+
+ // replace token.content *before* tokens[item.token].content,
+ // because, if they are pointing at the same token, replaceAt
+ // could mess up indices when quote length != 1
+ token.content = replaceAt(token.content, t.index, closeQuote);
+ tokens[item.token].content = replaceAt(
+ tokens[item.token].content, item.pos, openQuote);
+
+ pos += closeQuote.length - 1;
+ if (item.token === i) { pos += openQuote.length - 1; }
+
+ text = token.content;
+ max = text.length;
+
+ stack.length = j;
+ continue OUTER;
+ }
+ }
+ }
+
+ if (canOpen) {
+ stack.push({
+ token: i,
+ pos: t.index,
+ single: isSingle,
+ level: thisLevel
+ });
+ } else if (canClose && isSingle) {
+ token.content = replaceAt(token.content, t.index, APOSTROPHE);
+ }
+ }
+ }
+}
+
+
+module.exports = function smartquotes(state) {
+ /*eslint max-depth:0*/
+ var blkIdx;
+
+ if (!state.md.options.typographer) { return; }
+
+ for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) {
+
+ if (state.tokens[blkIdx].type !== 'inline' ||
+ !QUOTE_TEST_RE.test(state.tokens[blkIdx].content)) {
+ continue;
+ }
+
+ process_inlines(state.tokens[blkIdx].children, state);
+ }
+};
diff --git a/node_modules/markdown-it/lib/rules_core/state_core.js b/node_modules/markdown-it/lib/rules_core/state_core.js
new file mode 100644
index 0000000..87cfd85
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_core/state_core.js
@@ -0,0 +1,20 @@
+// Core state object
+//
+'use strict';
+
+var Token = require('../token');
+
+
+function StateCore(src, md, env) {
+ this.src = src;
+ this.env = env;
+ this.tokens = [];
+ this.inlineMode = false;
+ this.md = md; // link to parser instance
+}
+
+// re-export Token class to use in core rules
+StateCore.prototype.Token = Token;
+
+
+module.exports = StateCore;
diff --git a/node_modules/markdown-it/lib/rules_inline/autolink.js b/node_modules/markdown-it/lib/rules_inline/autolink.js
new file mode 100644
index 0000000..66deb90
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/autolink.js
@@ -0,0 +1,76 @@
+// Process autolinks '<protocol:...>'
+
+'use strict';
+
+
+/*eslint max-len:0*/
+var EMAIL_RE = /^([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)$/;
+var AUTOLINK_RE = /^([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)$/;
+
+
+module.exports = function autolink(state, silent) {
+ var url, fullUrl, token, ch, start, max,
+ pos = state.pos;
+
+ if (state.src.charCodeAt(pos) !== 0x3C/* < */) { return false; }
+
+ start = state.pos;
+ max = state.posMax;
+
+ for (;;) {
+ if (++pos >= max) return false;
+
+ ch = state.src.charCodeAt(pos);
+
+ if (ch === 0x3C /* < */) return false;
+ if (ch === 0x3E /* > */) break;
+ }
+
+ url = state.src.slice(start + 1, pos);
+
+ if (AUTOLINK_RE.test(url)) {
+ fullUrl = state.md.normalizeLink(url);
+ if (!state.md.validateLink(fullUrl)) { return false; }
+
+ if (!silent) {
+ token = state.push('link_open', 'a', 1);
+ token.attrs = [ [ 'href', fullUrl ] ];
+ token.markup = 'autolink';
+ token.info = 'auto';
+
+ token = state.push('text', '', 0);
+ token.content = state.md.normalizeLinkText(url);
+
+ token = state.push('link_close', 'a', -1);
+ token.markup = 'autolink';
+ token.info = 'auto';
+ }
+
+ state.pos += url.length + 2;
+ return true;
+ }
+
+ if (EMAIL_RE.test(url)) {
+ fullUrl = state.md.normalizeLink('mailto:' + url);
+ if (!state.md.validateLink(fullUrl)) { return false; }
+
+ if (!silent) {
+ token = state.push('link_open', 'a', 1);
+ token.attrs = [ [ 'href', fullUrl ] ];
+ token.markup = 'autolink';
+ token.info = 'auto';
+
+ token = state.push('text', '', 0);
+ token.content = state.md.normalizeLinkText(url);
+
+ token = state.push('link_close', 'a', -1);
+ token.markup = 'autolink';
+ token.info = 'auto';
+ }
+
+ state.pos += url.length + 2;
+ return true;
+ }
+
+ return false;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/backticks.js b/node_modules/markdown-it/lib/rules_inline/backticks.js
new file mode 100644
index 0000000..b9c9ddb
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/backticks.js
@@ -0,0 +1,63 @@
+// Parse backticks
+
+'use strict';
+
+
+module.exports = function backtick(state, silent) {
+ var start, max, marker, token, matchStart, matchEnd, openerLength, closerLength,
+ pos = state.pos,
+ ch = state.src.charCodeAt(pos);
+
+ if (ch !== 0x60/* ` */) { return false; }
+
+ start = pos;
+ pos++;
+ max = state.posMax;
+
+ // scan marker length
+ while (pos < max && state.src.charCodeAt(pos) === 0x60/* ` */) { pos++; }
+
+ marker = state.src.slice(start, pos);
+ openerLength = marker.length;
+
+ if (state.backticksScanned && (state.backticks[openerLength] || 0) <= start) {
+ if (!silent) state.pending += marker;
+ state.pos += openerLength;
+ return true;
+ }
+
+ matchStart = matchEnd = pos;
+
+ // Nothing found in the cache, scan until the end of the line (or until marker is found)
+ while ((matchStart = state.src.indexOf('`', matchEnd)) !== -1) {
+ matchEnd = matchStart + 1;
+
+ // scan marker length
+ while (matchEnd < max && state.src.charCodeAt(matchEnd) === 0x60/* ` */) { matchEnd++; }
+
+ closerLength = matchEnd - matchStart;
+
+ if (closerLength === openerLength) {
+ // Found matching closer length.
+ if (!silent) {
+ token = state.push('code_inline', 'code', 0);
+ token.markup = marker;
+ token.content = state.src.slice(pos, matchStart)
+ .replace(/\n/g, ' ')
+ .replace(/^ (.+) $/, '$1');
+ }
+ state.pos = matchEnd;
+ return true;
+ }
+
+ // Some different length found, put it in cache as upper limit of where closer can be found
+ state.backticks[closerLength] = matchStart;
+ }
+
+ // Scanned through the end, didn't find anything
+ state.backticksScanned = true;
+
+ if (!silent) state.pending += marker;
+ state.pos += openerLength;
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/balance_pairs.js b/node_modules/markdown-it/lib/rules_inline/balance_pairs.js
new file mode 100644
index 0000000..4faad90
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/balance_pairs.js
@@ -0,0 +1,130 @@
+// For each opening emphasis-like marker find a matching closing one
+//
+'use strict';
+
+
+function processDelimiters(state, delimiters) {
+ var closerIdx, openerIdx, closer, opener, minOpenerIdx, newMinOpenerIdx,
+ isOddMatch, lastJump,
+ openersBottom = {},
+ max = delimiters.length;
+
+ if (!max) return;
+
+ // headerIdx is the first delimiter of the current (where closer is) delimiter run
+ var headerIdx = 0;
+ var lastTokenIdx = -2; // needs any value lower than -1
+ var jumps = [];
+
+ for (closerIdx = 0; closerIdx < max; closerIdx++) {
+ closer = delimiters[closerIdx];
+
+ jumps.push(0);
+
+ // markers belong to same delimiter run if:
+ // - they have adjacent tokens
+ // - AND markers are the same
+ //
+ if (delimiters[headerIdx].marker !== closer.marker || lastTokenIdx !== closer.token - 1) {
+ headerIdx = closerIdx;
+ }
+
+ lastTokenIdx = closer.token;
+
+ // Length is only used for emphasis-specific "rule of 3",
+ // if it's not defined (in strikethrough or 3rd party plugins),
+ // we can default it to 0 to disable those checks.
+ //
+ closer.length = closer.length || 0;
+
+ if (!closer.close) continue;
+
+ // Previously calculated lower bounds (previous fails)
+ // for each marker, each delimiter length modulo 3,
+ // and for whether this closer can be an opener;
+ // https://github.com/commonmark/cmark/commit/34250e12ccebdc6372b8b49c44fab57c72443460
+ if (!openersBottom.hasOwnProperty(closer.marker)) {
+ openersBottom[closer.marker] = [ -1, -1, -1, -1, -1, -1 ];
+ }
+
+ minOpenerIdx = openersBottom[closer.marker][(closer.open ? 3 : 0) + (closer.length % 3)];
+
+ openerIdx = headerIdx - jumps[headerIdx] - 1;
+
+ newMinOpenerIdx = openerIdx;
+
+ for (; openerIdx > minOpenerIdx; openerIdx -= jumps[openerIdx] + 1) {
+ opener = delimiters[openerIdx];
+
+ if (opener.marker !== closer.marker) continue;
+
+ if (opener.open && opener.end < 0) {
+
+ isOddMatch = false;
+
+ // from spec:
+ //
+ // If one of the delimiters can both open and close emphasis, then the
+ // sum of the lengths of the delimiter runs containing the opening and
+ // closing delimiters must not be a multiple of 3 unless both lengths
+ // are multiples of 3.
+ //
+ if (opener.close || closer.open) {
+ if ((opener.length + closer.length) % 3 === 0) {
+ if (opener.length % 3 !== 0 || closer.length % 3 !== 0) {
+ isOddMatch = true;
+ }
+ }
+ }
+
+ if (!isOddMatch) {
+ // If previous delimiter cannot be an opener, we can safely skip
+ // the entire sequence in future checks. This is required to make
+ // sure algorithm has linear complexity (see *_*_*_*_*_... case).
+ //
+ lastJump = openerIdx > 0 && !delimiters[openerIdx - 1].open ?
+ jumps[openerIdx - 1] + 1 :
+ 0;
+
+ jumps[closerIdx] = closerIdx - openerIdx + lastJump;
+ jumps[openerIdx] = lastJump;
+
+ closer.open = false;
+ opener.end = closerIdx;
+ opener.close = false;
+ newMinOpenerIdx = -1;
+ // treat next token as start of run,
+ // it optimizes skips in **<...>**a**<...>** pathological case
+ lastTokenIdx = -2;
+ break;
+ }
+ }
+ }
+
+ if (newMinOpenerIdx !== -1) {
+ // If match for this delimiter run failed, we want to set lower bound for
+ // future lookups. This is required to make sure algorithm has linear
+ // complexity.
+ //
+ // See details here:
+ // https://github.com/commonmark/cmark/issues/178#issuecomment-270417442
+ //
+ openersBottom[closer.marker][(closer.open ? 3 : 0) + ((closer.length || 0) % 3)] = newMinOpenerIdx;
+ }
+ }
+}
+
+
+module.exports = function link_pairs(state) {
+ var curr,
+ tokens_meta = state.tokens_meta,
+ max = state.tokens_meta.length;
+
+ processDelimiters(state, state.delimiters);
+
+ for (curr = 0; curr < max; curr++) {
+ if (tokens_meta[curr] && tokens_meta[curr].delimiters) {
+ processDelimiters(state, tokens_meta[curr].delimiters);
+ }
+ }
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/emphasis.js b/node_modules/markdown-it/lib/rules_inline/emphasis.js
new file mode 100644
index 0000000..7e8ab4c
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/emphasis.js
@@ -0,0 +1,130 @@
+// Process *this* and _that_
+//
+'use strict';
+
+
+// Insert each marker as a separate text token, and add it to delimiter list
+//
+module.exports.tokenize = function emphasis(state, silent) {
+ var i, scanned, token,
+ start = state.pos,
+ marker = state.src.charCodeAt(start);
+
+ if (silent) { return false; }
+
+ if (marker !== 0x5F /* _ */ && marker !== 0x2A /* * */) { return false; }
+
+ scanned = state.scanDelims(state.pos, marker === 0x2A);
+
+ for (i = 0; i < scanned.length; i++) {
+ token = state.push('text', '', 0);
+ token.content = String.fromCharCode(marker);
+
+ state.delimiters.push({
+ // Char code of the starting marker (number).
+ //
+ marker: marker,
+
+ // Total length of these series of delimiters.
+ //
+ length: scanned.length,
+
+ // A position of the token this delimiter corresponds to.
+ //
+ token: state.tokens.length - 1,
+
+ // If this delimiter is matched as a valid opener, `end` will be
+ // equal to its position, otherwise it's `-1`.
+ //
+ end: -1,
+
+ // Boolean flags that determine if this delimiter could open or close
+ // an emphasis.
+ //
+ open: scanned.can_open,
+ close: scanned.can_close
+ });
+ }
+
+ state.pos += scanned.length;
+
+ return true;
+};
+
+
+function postProcess(state, delimiters) {
+ var i,
+ startDelim,
+ endDelim,
+ token,
+ ch,
+ isStrong,
+ max = delimiters.length;
+
+ for (i = max - 1; i >= 0; i--) {
+ startDelim = delimiters[i];
+
+ if (startDelim.marker !== 0x5F/* _ */ && startDelim.marker !== 0x2A/* * */) {
+ continue;
+ }
+
+ // Process only opening markers
+ if (startDelim.end === -1) {
+ continue;
+ }
+
+ endDelim = delimiters[startDelim.end];
+
+ // If the previous delimiter has the same marker and is adjacent to this one,
+ // merge those into one strong delimiter.
+ //
+ // `<em><em>whatever</em></em>` -> `<strong>whatever</strong>`
+ //
+ isStrong = i > 0 &&
+ delimiters[i - 1].end === startDelim.end + 1 &&
+ // check that first two markers match and adjacent
+ delimiters[i - 1].marker === startDelim.marker &&
+ delimiters[i - 1].token === startDelim.token - 1 &&
+ // check that last two markers are adjacent (we can safely assume they match)
+ delimiters[startDelim.end + 1].token === endDelim.token + 1;
+
+ ch = String.fromCharCode(startDelim.marker);
+
+ token = state.tokens[startDelim.token];
+ token.type = isStrong ? 'strong_open' : 'em_open';
+ token.tag = isStrong ? 'strong' : 'em';
+ token.nesting = 1;
+ token.markup = isStrong ? ch + ch : ch;
+ token.content = '';
+
+ token = state.tokens[endDelim.token];
+ token.type = isStrong ? 'strong_close' : 'em_close';
+ token.tag = isStrong ? 'strong' : 'em';
+ token.nesting = -1;
+ token.markup = isStrong ? ch + ch : ch;
+ token.content = '';
+
+ if (isStrong) {
+ state.tokens[delimiters[i - 1].token].content = '';
+ state.tokens[delimiters[startDelim.end + 1].token].content = '';
+ i--;
+ }
+ }
+}
+
+
+// Walk through delimiter list and replace text tokens with tags
+//
+module.exports.postProcess = function emphasis(state) {
+ var curr,
+ tokens_meta = state.tokens_meta,
+ max = state.tokens_meta.length;
+
+ postProcess(state, state.delimiters);
+
+ for (curr = 0; curr < max; curr++) {
+ if (tokens_meta[curr] && tokens_meta[curr].delimiters) {
+ postProcess(state, tokens_meta[curr].delimiters);
+ }
+ }
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/entity.js b/node_modules/markdown-it/lib/rules_inline/entity.js
new file mode 100644
index 0000000..6fcc889
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/entity.js
@@ -0,0 +1,48 @@
+// Process html entity - &#123;, &#xAF;, &quot;, ...
+
+'use strict';
+
+var entities = require('../common/entities');
+var has = require('../common/utils').has;
+var isValidEntityCode = require('../common/utils').isValidEntityCode;
+var fromCodePoint = require('../common/utils').fromCodePoint;
+
+
+var DIGITAL_RE = /^&#((?:x[a-f0-9]{1,6}|[0-9]{1,7}));/i;
+var NAMED_RE = /^&([a-z][a-z0-9]{1,31});/i;
+
+
+module.exports = function entity(state, silent) {
+ var ch, code, match, pos = state.pos, max = state.posMax;
+
+ if (state.src.charCodeAt(pos) !== 0x26/* & */) { return false; }
+
+ if (pos + 1 < max) {
+ ch = state.src.charCodeAt(pos + 1);
+
+ if (ch === 0x23 /* # */) {
+ match = state.src.slice(pos).match(DIGITAL_RE);
+ if (match) {
+ if (!silent) {
+ code = match[1][0].toLowerCase() === 'x' ? parseInt(match[1].slice(1), 16) : parseInt(match[1], 10);
+ state.pending += isValidEntityCode(code) ? fromCodePoint(code) : fromCodePoint(0xFFFD);
+ }
+ state.pos += match[0].length;
+ return true;
+ }
+ } else {
+ match = state.src.slice(pos).match(NAMED_RE);
+ if (match) {
+ if (has(entities, match[1])) {
+ if (!silent) { state.pending += entities[match[1]]; }
+ state.pos += match[0].length;
+ return true;
+ }
+ }
+ }
+ }
+
+ if (!silent) { state.pending += '&'; }
+ state.pos++;
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/escape.js b/node_modules/markdown-it/lib/rules_inline/escape.js
new file mode 100644
index 0000000..229ead0
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/escape.js
@@ -0,0 +1,52 @@
+// Process escaped chars and hardbreaks
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+var ESCAPED = [];
+
+for (var i = 0; i < 256; i++) { ESCAPED.push(0); }
+
+'\\!"#$%&\'()*+,./:;<=>?@[]^_`{|}~-'
+ .split('').forEach(function (ch) { ESCAPED[ch.charCodeAt(0)] = 1; });
+
+
+module.exports = function escape(state, silent) {
+ var ch, pos = state.pos, max = state.posMax;
+
+ if (state.src.charCodeAt(pos) !== 0x5C/* \ */) { return false; }
+
+ pos++;
+
+ if (pos < max) {
+ ch = state.src.charCodeAt(pos);
+
+ if (ch < 256 && ESCAPED[ch] !== 0) {
+ if (!silent) { state.pending += state.src[pos]; }
+ state.pos += 2;
+ return true;
+ }
+
+ if (ch === 0x0A) {
+ if (!silent) {
+ state.push('hardbreak', 'br', 0);
+ }
+
+ pos++;
+ // skip leading whitespaces from next line
+ while (pos < max) {
+ ch = state.src.charCodeAt(pos);
+ if (!isSpace(ch)) { break; }
+ pos++;
+ }
+
+ state.pos = pos;
+ return true;
+ }
+ }
+
+ if (!silent) { state.pending += '\\'; }
+ state.pos++;
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/html_inline.js b/node_modules/markdown-it/lib/rules_inline/html_inline.js
new file mode 100644
index 0000000..28c7980
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/html_inline.js
@@ -0,0 +1,47 @@
+// Process html tags
+
+'use strict';
+
+
+var HTML_TAG_RE = require('../common/html_re').HTML_TAG_RE;
+
+
+function isLetter(ch) {
+ /*eslint no-bitwise:0*/
+ var lc = ch | 0x20; // to lower case
+ return (lc >= 0x61/* a */) && (lc <= 0x7a/* z */);
+}
+
+
+module.exports = function html_inline(state, silent) {
+ var ch, match, max, token,
+ pos = state.pos;
+
+ if (!state.md.options.html) { return false; }
+
+ // Check start
+ max = state.posMax;
+ if (state.src.charCodeAt(pos) !== 0x3C/* < */ ||
+ pos + 2 >= max) {
+ return false;
+ }
+
+ // Quick fail on second char
+ ch = state.src.charCodeAt(pos + 1);
+ if (ch !== 0x21/* ! */ &&
+ ch !== 0x3F/* ? */ &&
+ ch !== 0x2F/* / */ &&
+ !isLetter(ch)) {
+ return false;
+ }
+
+ match = state.src.slice(pos).match(HTML_TAG_RE);
+ if (!match) { return false; }
+
+ if (!silent) {
+ token = state.push('html_inline', '', 0);
+ token.content = state.src.slice(pos, pos + match[0].length);
+ }
+ state.pos += match[0].length;
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/image.js b/node_modules/markdown-it/lib/rules_inline/image.js
new file mode 100644
index 0000000..53edd32
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/image.js
@@ -0,0 +1,152 @@
+// Process ![image](<src> "title")
+
+'use strict';
+
+var normalizeReference = require('../common/utils').normalizeReference;
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function image(state, silent) {
+ var attrs,
+ code,
+ content,
+ label,
+ labelEnd,
+ labelStart,
+ pos,
+ ref,
+ res,
+ title,
+ token,
+ tokens,
+ start,
+ href = '',
+ oldPos = state.pos,
+ max = state.posMax;
+
+ if (state.src.charCodeAt(state.pos) !== 0x21/* ! */) { return false; }
+ if (state.src.charCodeAt(state.pos + 1) !== 0x5B/* [ */) { return false; }
+
+ labelStart = state.pos + 2;
+ labelEnd = state.md.helpers.parseLinkLabel(state, state.pos + 1, false);
+
+ // parser failed to find ']', so it's not a valid link
+ if (labelEnd < 0) { return false; }
+
+ pos = labelEnd + 1;
+ if (pos < max && state.src.charCodeAt(pos) === 0x28/* ( */) {
+ //
+ // Inline link
+ //
+
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ pos++;
+ for (; pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace(code) && code !== 0x0A) { break; }
+ }
+ if (pos >= max) { return false; }
+
+ // [link]( <href> "title" )
+ // ^^^^^^ parsing link destination
+ start = pos;
+ res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax);
+ if (res.ok) {
+ href = state.md.normalizeLink(res.str);
+ if (state.md.validateLink(href)) {
+ pos = res.pos;
+ } else {
+ href = '';
+ }
+ }
+
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ start = pos;
+ for (; pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace(code) && code !== 0x0A) { break; }
+ }
+
+ // [link]( <href> "title" )
+ // ^^^^^^^ parsing link title
+ res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax);
+ if (pos < max && start !== pos && res.ok) {
+ title = res.str;
+ pos = res.pos;
+
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ for (; pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace(code) && code !== 0x0A) { break; }
+ }
+ } else {
+ title = '';
+ }
+
+ if (pos >= max || state.src.charCodeAt(pos) !== 0x29/* ) */) {
+ state.pos = oldPos;
+ return false;
+ }
+ pos++;
+ } else {
+ //
+ // Link reference
+ //
+ if (typeof state.env.references === 'undefined') { return false; }
+
+ if (pos < max && state.src.charCodeAt(pos) === 0x5B/* [ */) {
+ start = pos + 1;
+ pos = state.md.helpers.parseLinkLabel(state, pos);
+ if (pos >= 0) {
+ label = state.src.slice(start, pos++);
+ } else {
+ pos = labelEnd + 1;
+ }
+ } else {
+ pos = labelEnd + 1;
+ }
+
+ // covers label === '' and label === undefined
+ // (collapsed reference link and shortcut reference link respectively)
+ if (!label) { label = state.src.slice(labelStart, labelEnd); }
+
+ ref = state.env.references[normalizeReference(label)];
+ if (!ref) {
+ state.pos = oldPos;
+ return false;
+ }
+ href = ref.href;
+ title = ref.title;
+ }
+
+ //
+ // We found the end of the link, and know for a fact it's a valid link;
+ // so all that's left to do is to call tokenizer.
+ //
+ if (!silent) {
+ content = state.src.slice(labelStart, labelEnd);
+
+ state.md.inline.parse(
+ content,
+ state.md,
+ state.env,
+ tokens = []
+ );
+
+ token = state.push('image', 'img', 0);
+ token.attrs = attrs = [ [ 'src', href ], [ 'alt', '' ] ];
+ token.children = tokens;
+ token.content = content;
+
+ if (title) {
+ attrs.push([ 'title', title ]);
+ }
+ }
+
+ state.pos = pos;
+ state.posMax = max;
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/link.js b/node_modules/markdown-it/lib/rules_inline/link.js
new file mode 100644
index 0000000..1d242bf
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/link.js
@@ -0,0 +1,148 @@
+// Process [link](<to> "stuff")
+
+'use strict';
+
+var normalizeReference = require('../common/utils').normalizeReference;
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function link(state, silent) {
+ var attrs,
+ code,
+ label,
+ labelEnd,
+ labelStart,
+ pos,
+ res,
+ ref,
+ token,
+ href = '',
+ title = '',
+ oldPos = state.pos,
+ max = state.posMax,
+ start = state.pos,
+ parseReference = true;
+
+ if (state.src.charCodeAt(state.pos) !== 0x5B/* [ */) { return false; }
+
+ labelStart = state.pos + 1;
+ labelEnd = state.md.helpers.parseLinkLabel(state, state.pos, true);
+
+ // parser failed to find ']', so it's not a valid link
+ if (labelEnd < 0) { return false; }
+
+ pos = labelEnd + 1;
+ if (pos < max && state.src.charCodeAt(pos) === 0x28/* ( */) {
+ //
+ // Inline link
+ //
+
+ // might have found a valid shortcut link, disable reference parsing
+ parseReference = false;
+
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ pos++;
+ for (; pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace(code) && code !== 0x0A) { break; }
+ }
+ if (pos >= max) { return false; }
+
+ // [link]( <href> "title" )
+ // ^^^^^^ parsing link destination
+ start = pos;
+ res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax);
+ if (res.ok) {
+ href = state.md.normalizeLink(res.str);
+ if (state.md.validateLink(href)) {
+ pos = res.pos;
+ } else {
+ href = '';
+ }
+
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ start = pos;
+ for (; pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace(code) && code !== 0x0A) { break; }
+ }
+
+ // [link]( <href> "title" )
+ // ^^^^^^^ parsing link title
+ res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax);
+ if (pos < max && start !== pos && res.ok) {
+ title = res.str;
+ pos = res.pos;
+
+ // [link]( <href> "title" )
+ // ^^ skipping these spaces
+ for (; pos < max; pos++) {
+ code = state.src.charCodeAt(pos);
+ if (!isSpace(code) && code !== 0x0A) { break; }
+ }
+ }
+ }
+
+ if (pos >= max || state.src.charCodeAt(pos) !== 0x29/* ) */) {
+ // parsing a valid shortcut link failed, fallback to reference
+ parseReference = true;
+ }
+ pos++;
+ }
+
+ if (parseReference) {
+ //
+ // Link reference
+ //
+ if (typeof state.env.references === 'undefined') { return false; }
+
+ if (pos < max && state.src.charCodeAt(pos) === 0x5B/* [ */) {
+ start = pos + 1;
+ pos = state.md.helpers.parseLinkLabel(state, pos);
+ if (pos >= 0) {
+ label = state.src.slice(start, pos++);
+ } else {
+ pos = labelEnd + 1;
+ }
+ } else {
+ pos = labelEnd + 1;
+ }
+
+ // covers label === '' and label === undefined
+ // (collapsed reference link and shortcut reference link respectively)
+ if (!label) { label = state.src.slice(labelStart, labelEnd); }
+
+ ref = state.env.references[normalizeReference(label)];
+ if (!ref) {
+ state.pos = oldPos;
+ return false;
+ }
+ href = ref.href;
+ title = ref.title;
+ }
+
+ //
+ // We found the end of the link, and know for a fact it's a valid link;
+ // so all that's left to do is to call tokenizer.
+ //
+ if (!silent) {
+ state.pos = labelStart;
+ state.posMax = labelEnd;
+
+ token = state.push('link_open', 'a', 1);
+ token.attrs = attrs = [ [ 'href', href ] ];
+ if (title) {
+ attrs.push([ 'title', title ]);
+ }
+
+ state.md.inline.tokenize(state);
+
+ token = state.push('link_close', 'a', -1);
+ }
+
+ state.pos = pos;
+ state.posMax = max;
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/newline.js b/node_modules/markdown-it/lib/rules_inline/newline.js
new file mode 100644
index 0000000..9eeead4
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/newline.js
@@ -0,0 +1,46 @@
+// Proceess '\n'
+
+'use strict';
+
+var isSpace = require('../common/utils').isSpace;
+
+
+module.exports = function newline(state, silent) {
+ var pmax, max, ws, pos = state.pos;
+
+ if (state.src.charCodeAt(pos) !== 0x0A/* \n */) { return false; }
+
+ pmax = state.pending.length - 1;
+ max = state.posMax;
+
+ // ' \n' -> hardbreak
+ // Lookup in pending chars is bad practice! Don't copy to other rules!
+ // Pending string is stored in concat mode, indexed lookups will cause
+ // convertion to flat mode.
+ if (!silent) {
+ if (pmax >= 0 && state.pending.charCodeAt(pmax) === 0x20) {
+ if (pmax >= 1 && state.pending.charCodeAt(pmax - 1) === 0x20) {
+ // Find whitespaces tail of pending chars.
+ ws = pmax - 1;
+ while (ws >= 1 && state.pending.charCodeAt(ws - 1) === 0x20) ws--;
+
+ state.pending = state.pending.slice(0, ws);
+ state.push('hardbreak', 'br', 0);
+ } else {
+ state.pending = state.pending.slice(0, -1);
+ state.push('softbreak', 'br', 0);
+ }
+
+ } else {
+ state.push('softbreak', 'br', 0);
+ }
+ }
+
+ pos++;
+
+ // skip heading spaces for next line
+ while (pos < max && isSpace(state.src.charCodeAt(pos))) { pos++; }
+
+ state.pos = pos;
+ return true;
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/state_inline.js b/node_modules/markdown-it/lib/rules_inline/state_inline.js
new file mode 100644
index 0000000..efbf9bd
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/state_inline.js
@@ -0,0 +1,154 @@
+// Inline parser state
+
+'use strict';
+
+
+var Token = require('../token');
+var isWhiteSpace = require('../common/utils').isWhiteSpace;
+var isPunctChar = require('../common/utils').isPunctChar;
+var isMdAsciiPunct = require('../common/utils').isMdAsciiPunct;
+
+
+function StateInline(src, md, env, outTokens) {
+ this.src = src;
+ this.env = env;
+ this.md = md;
+ this.tokens = outTokens;
+ this.tokens_meta = Array(outTokens.length);
+
+ this.pos = 0;
+ this.posMax = this.src.length;
+ this.level = 0;
+ this.pending = '';
+ this.pendingLevel = 0;
+
+ // Stores { start: end } pairs. Useful for backtrack
+ // optimization of pairs parse (emphasis, strikes).
+ this.cache = {};
+
+ // List of emphasis-like delimiters for current tag
+ this.delimiters = [];
+
+ // Stack of delimiter lists for upper level tags
+ this._prev_delimiters = [];
+
+ // backtick length => last seen position
+ this.backticks = {};
+ this.backticksScanned = false;
+}
+
+
+// Flush pending text
+//
+StateInline.prototype.pushPending = function () {
+ var token = new Token('text', '', 0);
+ token.content = this.pending;
+ token.level = this.pendingLevel;
+ this.tokens.push(token);
+ this.pending = '';
+ return token;
+};
+
+
+// Push new token to "stream".
+// If pending text exists - flush it as text token
+//
+StateInline.prototype.push = function (type, tag, nesting) {
+ if (this.pending) {
+ this.pushPending();
+ }
+
+ var token = new Token(type, tag, nesting);
+ var token_meta = null;
+
+ if (nesting < 0) {
+ // closing tag
+ this.level--;
+ this.delimiters = this._prev_delimiters.pop();
+ }
+
+ token.level = this.level;
+
+ if (nesting > 0) {
+ // opening tag
+ this.level++;
+ this._prev_delimiters.push(this.delimiters);
+ this.delimiters = [];
+ token_meta = { delimiters: this.delimiters };
+ }
+
+ this.pendingLevel = this.level;
+ this.tokens.push(token);
+ this.tokens_meta.push(token_meta);
+ return token;
+};
+
+
+// Scan a sequence of emphasis-like markers, and determine whether
+// it can start an emphasis sequence or end an emphasis sequence.
+//
+// - start - position to scan from (it should point at a valid marker);
+// - canSplitWord - determine if these markers can be found inside a word
+//
+StateInline.prototype.scanDelims = function (start, canSplitWord) {
+ var pos = start, lastChar, nextChar, count, can_open, can_close,
+ isLastWhiteSpace, isLastPunctChar,
+ isNextWhiteSpace, isNextPunctChar,
+ left_flanking = true,
+ right_flanking = true,
+ max = this.posMax,
+ marker = this.src.charCodeAt(start);
+
+ // treat beginning of the line as a whitespace
+ lastChar = start > 0 ? this.src.charCodeAt(start - 1) : 0x20;
+
+ while (pos < max && this.src.charCodeAt(pos) === marker) { pos++; }
+
+ count = pos - start;
+
+ // treat end of the line as a whitespace
+ nextChar = pos < max ? this.src.charCodeAt(pos) : 0x20;
+
+ isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar));
+ isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar));
+
+ isLastWhiteSpace = isWhiteSpace(lastChar);
+ isNextWhiteSpace = isWhiteSpace(nextChar);
+
+ if (isNextWhiteSpace) {
+ left_flanking = false;
+ } else if (isNextPunctChar) {
+ if (!(isLastWhiteSpace || isLastPunctChar)) {
+ left_flanking = false;
+ }
+ }
+
+ if (isLastWhiteSpace) {
+ right_flanking = false;
+ } else if (isLastPunctChar) {
+ if (!(isNextWhiteSpace || isNextPunctChar)) {
+ right_flanking = false;
+ }
+ }
+
+ if (!canSplitWord) {
+ can_open = left_flanking && (!right_flanking || isLastPunctChar);
+ can_close = right_flanking && (!left_flanking || isNextPunctChar);
+ } else {
+ can_open = left_flanking;
+ can_close = right_flanking;
+ }
+
+ return {
+ can_open: can_open,
+ can_close: can_close,
+ length: count
+ };
+};
+
+
+// re-export Token class to use in block rules
+StateInline.prototype.Token = Token;
+
+
+module.exports = StateInline;
diff --git a/node_modules/markdown-it/lib/rules_inline/strikethrough.js b/node_modules/markdown-it/lib/rules_inline/strikethrough.js
new file mode 100644
index 0000000..3c35adf
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/strikethrough.js
@@ -0,0 +1,130 @@
+// ~~strike through~~
+//
+'use strict';
+
+
+// Insert each marker as a separate text token, and add it to delimiter list
+//
+module.exports.tokenize = function strikethrough(state, silent) {
+ var i, scanned, token, len, ch,
+ start = state.pos,
+ marker = state.src.charCodeAt(start);
+
+ if (silent) { return false; }
+
+ if (marker !== 0x7E/* ~ */) { return false; }
+
+ scanned = state.scanDelims(state.pos, true);
+ len = scanned.length;
+ ch = String.fromCharCode(marker);
+
+ if (len < 2) { return false; }
+
+ if (len % 2) {
+ token = state.push('text', '', 0);
+ token.content = ch;
+ len--;
+ }
+
+ for (i = 0; i < len; i += 2) {
+ token = state.push('text', '', 0);
+ token.content = ch + ch;
+
+ state.delimiters.push({
+ marker: marker,
+ length: 0, // disable "rule of 3" length checks meant for emphasis
+ token: state.tokens.length - 1,
+ end: -1,
+ open: scanned.can_open,
+ close: scanned.can_close
+ });
+ }
+
+ state.pos += scanned.length;
+
+ return true;
+};
+
+
+function postProcess(state, delimiters) {
+ var i, j,
+ startDelim,
+ endDelim,
+ token,
+ loneMarkers = [],
+ max = delimiters.length;
+
+ for (i = 0; i < max; i++) {
+ startDelim = delimiters[i];
+
+ if (startDelim.marker !== 0x7E/* ~ */) {
+ continue;
+ }
+
+ if (startDelim.end === -1) {
+ continue;
+ }
+
+ endDelim = delimiters[startDelim.end];
+
+ token = state.tokens[startDelim.token];
+ token.type = 's_open';
+ token.tag = 's';
+ token.nesting = 1;
+ token.markup = '~~';
+ token.content = '';
+
+ token = state.tokens[endDelim.token];
+ token.type = 's_close';
+ token.tag = 's';
+ token.nesting = -1;
+ token.markup = '~~';
+ token.content = '';
+
+ if (state.tokens[endDelim.token - 1].type === 'text' &&
+ state.tokens[endDelim.token - 1].content === '~') {
+
+ loneMarkers.push(endDelim.token - 1);
+ }
+ }
+
+ // If a marker sequence has an odd number of characters, it's splitted
+ // like this: `~~~~~` -> `~` + `~~` + `~~`, leaving one marker at the
+ // start of the sequence.
+ //
+ // So, we have to move all those markers after subsequent s_close tags.
+ //
+ while (loneMarkers.length) {
+ i = loneMarkers.pop();
+ j = i + 1;
+
+ while (j < state.tokens.length && state.tokens[j].type === 's_close') {
+ j++;
+ }
+
+ j--;
+
+ if (i !== j) {
+ token = state.tokens[j];
+ state.tokens[j] = state.tokens[i];
+ state.tokens[i] = token;
+ }
+ }
+}
+
+
+// Walk through delimiter list and replace text tokens with tags
+//
+module.exports.postProcess = function strikethrough(state) {
+ var curr,
+ tokens_meta = state.tokens_meta,
+ max = state.tokens_meta.length;
+
+ postProcess(state, state.delimiters);
+
+ for (curr = 0; curr < max; curr++) {
+ if (tokens_meta[curr] && tokens_meta[curr].delimiters) {
+ postProcess(state, tokens_meta[curr].delimiters);
+ }
+ }
+};
diff --git a/node_modules/markdown-it/lib/rules_inline/text.js b/node_modules/markdown-it/lib/rules_inline/text.js
new file mode 100644
index 0000000..b19591e
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/text.js
@@ -0,0 +1,89 @@
+// Skip text characters for text token, place those to pending buffer
+// and increment current pos
+
+'use strict';
+
+
+// Rule to skip pure text
+// '{}$%@~+=:' reserved for extentions
+
+// !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~
+
+// !!!! Don't confuse with "Markdown ASCII Punctuation" chars
+// http://spec.commonmark.org/0.15/#ascii-punctuation-character
+function isTerminatorChar(ch) {
+ switch (ch) {
+ case 0x0A/* \n */:
+ case 0x21/* ! */:
+ case 0x23/* # */:
+ case 0x24/* $ */:
+ case 0x25/* % */:
+ case 0x26/* & */:
+ case 0x2A/* * */:
+ case 0x2B/* + */:
+ case 0x2D/* - */:
+ case 0x3A/* : */:
+ case 0x3C/* < */:
+ case 0x3D/* = */:
+ case 0x3E/* > */:
+ case 0x40/* @ */:
+ case 0x5B/* [ */:
+ case 0x5C/* \ */:
+ case 0x5D/* ] */:
+ case 0x5E/* ^ */:
+ case 0x5F/* _ */:
+ case 0x60/* ` */:
+ case 0x7B/* { */:
+ case 0x7D/* } */:
+ case 0x7E/* ~ */:
+ return true;
+ default:
+ return false;
+ }
+}
+
+module.exports = function text(state, silent) {
+ var pos = state.pos;
+
+ while (pos < state.posMax && !isTerminatorChar(state.src.charCodeAt(pos))) {
+ pos++;
+ }
+
+ if (pos === state.pos) { return false; }
+
+ if (!silent) { state.pending += state.src.slice(state.pos, pos); }
+
+ state.pos = pos;
+
+ return true;
+};
+
+// Alternative implementation, for memory.
+//
+// It costs 10% of performance, but allows extend terminators list, if place it
+// to `ParcerInline` property. Probably, will switch to it sometime, such
+// flexibility required.
+
+/*
+var TERMINATOR_RE = /[\n!#$%&*+\-:<=>@[\\\]^_`{}~]/;
+
+module.exports = function text(state, silent) {
+ var pos = state.pos,
+ idx = state.src.slice(pos).search(TERMINATOR_RE);
+
+ // first char is terminator -> empty text
+ if (idx === 0) { return false; }
+
+ // no terminator -> text till end of string
+ if (idx < 0) {
+ if (!silent) { state.pending += state.src.slice(pos); }
+ state.pos = state.src.length;
+ return true;
+ }
+
+ if (!silent) { state.pending += state.src.slice(pos, pos + idx); }
+
+ state.pos += idx;
+
+ return true;
+};*/
diff --git a/node_modules/markdown-it/lib/rules_inline/text_collapse.js b/node_modules/markdown-it/lib/rules_inline/text_collapse.js
new file mode 100644
index 0000000..390b0fe
--- /dev/null
+++ b/node_modules/markdown-it/lib/rules_inline/text_collapse.js
@@ -0,0 +1,41 @@
+// Clean up tokens after emphasis and strikethrough postprocessing:
+// merge adjacent text nodes into one and re-calculate all token levels
+//
+// This is necessary because initially emphasis delimiter markers (*, _, ~)
+// are treated as their own separate text tokens. Then emphasis rule either
+// leaves them as text (needed to merge with adjacent text) or turns them
+// into opening/closing tags (which messes up levels inside).
+//
+'use strict';
+
+
+module.exports = function text_collapse(state) {
+ var curr, last,
+ level = 0,
+ tokens = state.tokens,
+ max = state.tokens.length;
+
+ for (curr = last = 0; curr < max; curr++) {
+ // re-calculate levels after emphasis/strikethrough turns some text nodes
+ // into opening/closing tags
+ if (tokens[curr].nesting < 0) level--; // closing tag
+ tokens[curr].level = level;
+ if (tokens[curr].nesting > 0) level++; // opening tag
+
+ if (tokens[curr].type === 'text' &&
+ curr + 1 < max &&
+ tokens[curr + 1].type === 'text') {
+
+ // collapse two adjacent text nodes
+ tokens[curr + 1].content = tokens[curr].content + tokens[curr + 1].content;
+ } else {
+ if (curr !== last) { tokens[last] = tokens[curr]; }
+
+ last++;
+ }
+ }
+
+ if (curr !== last) {
+ tokens.length = last;
+ }
+};
diff --git a/node_modules/markdown-it/lib/token.js b/node_modules/markdown-it/lib/token.js
new file mode 100644
index 0000000..c5fd271
--- /dev/null
+++ b/node_modules/markdown-it/lib/token.js
@@ -0,0 +1,201 @@
+// Token class
+
+'use strict';
+
+
+/**
+ * class Token
+ **/
+
+/**
+ * new Token(type, tag, nesting)
+ *
+ * Create new token and fill passed properties.
+ **/
+function Token(type, tag, nesting) {
+ /**
+ * Token#type -> String
+ *
+ * Type of the token (string, e.g. "paragraph_open")
+ **/
+ this.type = type;
+
+ /**
+ * Token#tag -> String
+ *
+ * html tag name, e.g. "p"
+ **/
+ this.tag = tag;
+
+ /**
+ * Token#attrs -> Array
+ *
+ * Html attributes. Format: `[ [ name1, value1 ], [ name2, value2 ] ]`
+ **/
+ this.attrs = null;
+
+ /**
+ * Token#map -> Array
+ *
+ * Source map info. Format: `[ line_begin, line_end ]`
+ **/
+ this.map = null;
+
+ /**
+ * Token#nesting -> Number
+ *
+ * Level change (number in {-1, 0, 1} set), where:
+ *
+ * - `1` means the tag is opening
+ * - `0` means the tag is self-closing
+ * - `-1` means the tag is closing
+ **/
+ this.nesting = nesting;
+
+ /**
+ * Token#level -> Number
+ *
+ * nesting level, the same as `state.level`
+ **/
+ this.level = 0;
+
+ /**
+ * Token#children -> Array
+ *
+ * An array of child nodes (inline and img tokens)
+ **/
+ this.children = null;
+
+ /**
+ * Token#content -> String
+ *
+ * In a case of self-closing tag (code, html, fence, etc.),
+ * it has contents of this tag.
+ **/
+ this.content = '';
+
+ /**
+ * Token#markup -> String
+ *
+ * '*' or '_' for emphasis, fence string for fence, etc.
+ **/
+ this.markup = '';
+
+ /**
+ * Token#info -> String
+ *
+ * Additional information:
+ *
+ * - Info string for "fence" tokens
+ * - The value "auto" for autolink "link_open" and "link_close" tokens
+ * - The string value of the item marker for ordered-list "list_item_open" tokens
+ **/
+ this.info = '';
+
+ /**
+ * Token#meta -> Object
+ *
+ * A place for plugins to store an arbitrary data
+ **/
+ this.meta = null;
+
+ /**
+ * Token#block -> Boolean
+ *
+ * True for block-level tokens, false for inline tokens.
+ * Used in renderer to calculate line breaks
+ **/
+ this.block = false;
+
+ /**
+ * Token#hidden -> Boolean
+ *
+ * If it's true, ignore this element when rendering. Used for tight lists
+ * to hide paragraphs.
+ **/
+ this.hidden = false;
+}
+
+
+/**
+ * Token.attrIndex(name) -> Number
+ *
+ * Search attribute index by name.
+ **/
+Token.prototype.attrIndex = function attrIndex(name) {
+ var attrs, i, len;
+
+ if (!this.attrs) { return -1; }
+
+ attrs = this.attrs;
+
+ for (i = 0, len = attrs.length; i < len; i++) {
+ if (attrs[i][0] === name) { return i; }
+ }
+ return -1;
+};
+
+
+/**
+ * Token.attrPush(attrData)
+ *
+ * Add `[ name, value ]` attribute to list. Init attrs if necessary
+ **/
+Token.prototype.attrPush = function attrPush(attrData) {
+ if (this.attrs) {
+ this.attrs.push(attrData);
+ } else {
+ this.attrs = [ attrData ];
+ }
+};
+
+
+/**
+ * Token.attrSet(name, value)
+ *
+ * Set `name` attribute to `value`. Override old value if exists.
+ **/
+Token.prototype.attrSet = function attrSet(name, value) {
+ var idx = this.attrIndex(name),
+ attrData = [ name, value ];
+
+ if (idx < 0) {
+ this.attrPush(attrData);
+ } else {
+ this.attrs[idx] = attrData;
+ }
+};
+
+
+/**
+ * Token.attrGet(name)
+ *
+ * Get the value of attribute `name`, or null if it does not exist.
+ **/
+Token.prototype.attrGet = function attrGet(name) {
+ var idx = this.attrIndex(name), value = null;
+ if (idx >= 0) {
+ value = this.attrs[idx][1];
+ }
+ return value;
+};
+
+
+/**
+ * Token.attrJoin(name, value)
+ *
+ * Join value to existing attribute via space. Or create new attribute if not
+ * exists. Useful to operate with token classes.
+ **/
+Token.prototype.attrJoin = function attrJoin(name, value) {
+ var idx = this.attrIndex(name);
+
+ if (idx < 0) {
+ this.attrPush([ name, value ]);
+ } else {
+ this.attrs[idx][1] = this.attrs[idx][1] + ' ' + value;
+ }
+};
+
+
+module.exports = Token;
diff --git a/node_modules/markdown-it/package.json b/node_modules/markdown-it/package.json
new file mode 100644
index 0000000..32a3aff
--- /dev/null
+++ b/node_modules/markdown-it/package.json
@@ -0,0 +1,87 @@
+{
+ "name": "markdown-it",
+ "version": "12.3.2",
+ "description": "Markdown-it - modern pluggable markdown parser.",
+ "keywords": [
+ "markdown",
+ "parser",
+ "commonmark",
+ "markdown-it",
+ "markdown-it-plugin"
+ ],
+ "repository": "markdown-it/markdown-it",
+ "license": "MIT",
+ "main": "index.js",
+ "bin": {
+ "markdown-it": "bin/markdown-it.js"
+ },
+ "scripts": {
+ "lint": "eslint .",
+ "test": "npm run lint && nyc mocha && node support/specsplit.js",
+ "coverage": "npm run test && nyc report --reporter html",
+ "report-coveralls": "nyc --reporter=lcov mocha",
+ "doc": "node support/build_doc.js",
+ "gh-doc": "npm run doc && gh-pages -d apidoc -f",
+ "demo": "npm run lint && node support/build_demo.js",
+ "gh-demo": "npm run demo && gh-pages -d demo -f -b master -r git@github.com:markdown-it/markdown-it.github.io.git",
+ "browserify": "rollup -c support/rollup.config.js",
+ "benchmark-deps": "npm install --prefix benchmark/extra/ -g marked@0.3.6 commonmark@0.26.0 markdown-it/markdown-it.git#2.2.1",
+ "specsplit": "support/specsplit.js good -o test/fixtures/commonmark/good.txt && support/specsplit.js bad -o test/fixtures/commonmark/bad.txt && support/specsplit.js",
+ "todo": "grep 'TODO' -n -r ./lib 2>/dev/null",
+ "prepublishOnly": "npm run gh-demo && npm run gh-doc"
+ },
+ "files": [
+ "index.js",
+ "bin/",
+ "lib/",
+ "dist/"
+ ],
+ "dependencies": {
+ "argparse": "^2.0.1",
+ "entities": "~2.1.0",
+ "linkify-it": "^3.0.1",
+ "mdurl": "^1.0.1",
+ "uc.micro": "^1.0.5"
+ },
+ "devDependencies": {
+ "@rollup/plugin-commonjs": "^16.0.0",
+ "@rollup/plugin-json": "^4.1.0",
+ "@rollup/plugin-node-resolve": "^10.0.0",
+ "ansi": "^0.3.0",
+ "autoprefixer-stylus": "^1.0.0",
+ "benchmark": "~2.1.0",
+ "chai": "^4.2.0",
+ "coveralls": "^3.0.4",
+ "eslint": "^8.4.1",
+ "express": "^4.14.0",
+ "gh-pages": "^3.1.0",
+ "highlight.js": "^10.7.2",
+ "jest-worker": "^26.6.2",
+ "markdown-it-abbr": "^1.0.4",
+ "markdown-it-container": "^3.0.0",
+ "markdown-it-deflist": "^2.0.0",
+ "markdown-it-emoji": "^2.0.0",
+ "markdown-it-footnote": "^3.0.1",
+ "markdown-it-for-inline": "^0.1.0",
+ "markdown-it-ins": "^3.0.0",
+ "markdown-it-mark": "^3.0.0",
+ "markdown-it-sub": "^1.0.0",
+ "markdown-it-sup": "^1.0.0",
+ "markdown-it-testgen": "^0.1.3",
+ "mocha": "^9.1.3",
+ "ndoc": "^6.0.0",
+ "needle": "^3.0.0",
+ "nyc": "^15.0.1",
+ "pug-cli": "^1.0.0-alpha6",
+ "rollup": "^2.29.0",
+ "rollup-plugin-node-polyfills": "^0.2.1",
+ "rollup-plugin-terser": "^7.0.2",
+ "shelljs": "^0.8.4",
+ "stylus": "^0.55.0",
+ "supertest": "^6.0.1"
+ },
+ "mocha": {
+ "inline-diffs": true,
+ "timeout": 60000
+ }
+}