diff options
author | Minteck <contact@minteck.org> | 2022-01-20 13:43:34 +0100 |
---|---|---|
committer | Minteck <contact@minteck.org> | 2022-01-20 13:43:34 +0100 |
commit | c2aa7bf38fb30de2d04f87f8e7780e4c768ae6b1 (patch) | |
tree | 226598e8d17d20e3721358f7c60b1cc6b851163a /node_modules | |
download | cobalt-c2aa7bf38fb30de2d04f87f8e7780e4c768ae6b1.tar.gz cobalt-c2aa7bf38fb30de2d04f87f8e7780e4c768ae6b1.tar.bz2 cobalt-c2aa7bf38fb30de2d04f87f8e7780e4c768ae6b1.zip |
Initial commit
Diffstat (limited to 'node_modules')
113 files changed, 22481 insertions, 0 deletions
diff --git a/node_modules/.bin/markdown-it b/node_modules/.bin/markdown-it new file mode 100644 index 0000000..506ff53 --- /dev/null +++ b/node_modules/.bin/markdown-it @@ -0,0 +1,12 @@ +#!/bin/sh +basedir=$(dirname "$(echo "$0" | sed -e 's,\\,/,g')") + +case `uname` in + *CYGWIN*|*MINGW*|*MSYS*) basedir=`cygpath -w "$basedir"`;; +esac + +if [ -x "$basedir/node" ]; then + exec "$basedir/node" "$basedir/../markdown-it/bin/markdown-it.js" "$@" +else + exec node "$basedir/../markdown-it/bin/markdown-it.js" "$@" +fi diff --git a/node_modules/.bin/markdown-it.cmd b/node_modules/.bin/markdown-it.cmd new file mode 100644 index 0000000..480092d --- /dev/null +++ b/node_modules/.bin/markdown-it.cmd @@ -0,0 +1,17 @@ +@ECHO off +GOTO start +:find_dp0 +SET dp0=%~dp0 +EXIT /b +:start +SETLOCAL +CALL :find_dp0 + +IF EXIST "%dp0%\node.exe" ( + SET "_prog=%dp0%\node.exe" +) ELSE ( + SET "_prog=node" + SET PATHEXT=%PATHEXT:;.JS;=;% +) + +endLocal & goto #_undefined_# 2>NUL || title %COMSPEC% & "%_prog%" "%dp0%\..\markdown-it\bin\markdown-it.js" %* diff --git a/node_modules/.bin/markdown-it.ps1 b/node_modules/.bin/markdown-it.ps1 new file mode 100644 index 0000000..7f223fc --- /dev/null +++ b/node_modules/.bin/markdown-it.ps1 @@ -0,0 +1,28 @@ +#!/usr/bin/env pwsh +$basedir=Split-Path $MyInvocation.MyCommand.Definition -Parent + +$exe="" +if ($PSVersionTable.PSVersion -lt "6.0" -or $IsWindows) { + # Fix case when both the Windows and Linux builds of Node + # are installed in the same directory + $exe=".exe" +} +$ret=0 +if (Test-Path "$basedir/node$exe") { + # Support pipeline input + if ($MyInvocation.ExpectingInput) { + $input | & "$basedir/node$exe" "$basedir/../markdown-it/bin/markdown-it.js" $args + } else { + & "$basedir/node$exe" "$basedir/../markdown-it/bin/markdown-it.js" $args + } + $ret=$LASTEXITCODE +} else { + # Support pipeline input + if ($MyInvocation.ExpectingInput) { + $input | & "node$exe" "$basedir/../markdown-it/bin/markdown-it.js" $args + } else { + & "node$exe" "$basedir/../markdown-it/bin/markdown-it.js" $args + } + $ret=$LASTEXITCODE +} +exit $ret diff --git a/node_modules/.package-lock.json b/node_modules/.package-lock.json new file mode 100644 index 0000000..81b01a5 --- /dev/null +++ b/node_modules/.package-lock.json @@ -0,0 +1,53 @@ +{ + "name": "DocCMS", + "lockfileVersion": 2, + "requires": true, + "packages": { + "node_modules/argparse": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/argparse/-/argparse-2.0.1.tgz", + "integrity": "sha512-8+9WqebbFzpX9OR+Wa6O29asIogeRMzcGtAINdpMHHyAg10f05aSFVBbcEqGf/PXw1EjAZ+q2/bEBg3DvurK3Q==" + }, + "node_modules/entities": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/entities/-/entities-2.1.0.tgz", + "integrity": "sha512-hCx1oky9PFrJ611mf0ifBLBRW8lUUVRlFolb5gWRfIELabBlbp9xZvrqZLZAs+NxFnbfQoeGd8wDkygjg7U85w==", + "funding": { + "url": "https://github.com/fb55/entities?sponsor=1" + } + }, + "node_modules/linkify-it": { + "version": "3.0.3", + "resolved": "https://registry.npmjs.org/linkify-it/-/linkify-it-3.0.3.tgz", + "integrity": "sha512-ynTsyrFSdE5oZ/O9GEf00kPngmOfVwazR5GKDq6EYfhlpFug3J2zybX56a2PRRpc9P+FuSoGNAwjlbDs9jJBPQ==", + "dependencies": { + "uc.micro": "^1.0.1" + } + }, + "node_modules/markdown-it": { + "version": "12.3.2", + "resolved": "https://registry.npmjs.org/markdown-it/-/markdown-it-12.3.2.tgz", + "integrity": "sha512-TchMembfxfNVpHkbtriWltGWc+m3xszaRD0CZup7GFFhzIgQqxIfn3eGj1yZpfuflzPvfkt611B2Q/Bsk1YnGg==", + "dependencies": { + "argparse": "^2.0.1", + "entities": "~2.1.0", + "linkify-it": "^3.0.1", + "mdurl": "^1.0.1", + "uc.micro": "^1.0.5" + }, + "bin": { + "markdown-it": "bin/markdown-it.js" + } + }, + "node_modules/mdurl": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/mdurl/-/mdurl-1.0.1.tgz", + "integrity": "sha1-/oWy7HWlkDfyrf7BAP1sYBdhFS4=" + }, + "node_modules/uc.micro": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/uc.micro/-/uc.micro-1.0.6.tgz", + "integrity": "sha512-8Y75pvTYkLJW2hWQHXxoqRgV7qb9B+9vFEtidML+7koHUFapnVJAZ6cKs+Qjz5Aw3aZWHMC6u0wJE3At+nSGwA==" + } + } +} diff --git a/node_modules/argparse/CHANGELOG.md b/node_modules/argparse/CHANGELOG.md new file mode 100644 index 0000000..dc39ed6 --- /dev/null +++ b/node_modules/argparse/CHANGELOG.md @@ -0,0 +1,216 @@ +# Changelog + +All notable changes to this project will be documented in this file. + +The format is based on [Keep a Changelog](https://keepachangelog.com/en/1.0.0/), +and this project adheres to [Semantic Versioning](https://semver.org/spec/v2.0.0.html). + + +## [2.0.1] - 2020-08-29 +### Fixed +- Fix issue with `process.argv` when used with interpreters (`coffee`, `ts-node`, etc.), #150. + + +## [2.0.0] - 2020-08-14 +### Changed +- Full rewrite. Now port from python 3.9.0 & more precise following. + See [doc](./doc) for difference and migration info. +- node.js 10+ required +- Removed most of local docs in favour of original ones. + + +## [1.0.10] - 2018-02-15 +### Fixed +- Use .concat instead of + for arrays, #122. + + +## [1.0.9] - 2016-09-29 +### Changed +- Rerelease after 1.0.8 - deps cleanup. + + +## [1.0.8] - 2016-09-29 +### Changed +- Maintenance (deps bump, fix node 6.5+ tests, coverage report). + + +## [1.0.7] - 2016-03-17 +### Changed +- Teach `addArgument` to accept string arg names. #97, @tomxtobin. + + +## [1.0.6] - 2016-02-06 +### Changed +- Maintenance: moved to eslint & updated CS. + + +## [1.0.5] - 2016-02-05 +### Changed +- Removed lodash dependency to significantly reduce install size. + Thanks to @mourner. + + +## [1.0.4] - 2016-01-17 +### Changed +- Maintenance: lodash update to 4.0.0. + + +## [1.0.3] - 2015-10-27 +### Fixed +- Fix parse `=` in args: `--examplepath="C:\myfolder\env=x64"`. #84, @CatWithApple. + + +## [1.0.2] - 2015-03-22 +### Changed +- Relaxed lodash version dependency. + + +## [1.0.1] - 2015-02-20 +### Changed +- Changed dependencies to be compatible with ancient nodejs. + + +## [1.0.0] - 2015-02-19 +### Changed +- Maintenance release. +- Replaced `underscore` with `lodash`. +- Bumped version to 1.0.0 to better reflect semver meaning. +- HISTORY.md -> CHANGELOG.md + + +## [0.1.16] - 2013-12-01 +### Changed +- Maintenance release. Updated dependencies and docs. + + +## [0.1.15] - 2013-05-13 +### Fixed +- Fixed #55, @trebor89 + + +## [0.1.14] - 2013-05-12 +### Fixed +- Fixed #62, @maxtaco + + +## [0.1.13] - 2013-04-08 +### Changed +- Added `.npmignore` to reduce package size + + +## [0.1.12] - 2013-02-10 +### Fixed +- Fixed conflictHandler (#46), @hpaulj + + +## [0.1.11] - 2013-02-07 +### Added +- Added 70+ tests (ported from python), @hpaulj +- Added conflictHandler, @applepicke +- Added fromfilePrefixChar, @hpaulj + +### Fixed +- Multiple bugfixes, @hpaulj + + +## [0.1.10] - 2012-12-30 +### Added +- Added [mutual exclusion](http://docs.python.org/dev/library/argparse.html#mutual-exclusion) + support, thanks to @hpaulj + +### Fixed +- Fixed options check for `storeConst` & `appendConst` actions, thanks to @hpaulj + + +## [0.1.9] - 2012-12-27 +### Fixed +- Fixed option dest interferens with other options (issue #23), thanks to @hpaulj +- Fixed default value behavior with `*` positionals, thanks to @hpaulj +- Improve `getDefault()` behavior, thanks to @hpaulj +- Improve negative argument parsing, thanks to @hpaulj + + +## [0.1.8] - 2012-12-01 +### Fixed +- Fixed parser parents (issue #19), thanks to @hpaulj +- Fixed negative argument parse (issue #20), thanks to @hpaulj + + +## [0.1.7] - 2012-10-14 +### Fixed +- Fixed 'choices' argument parse (issue #16) +- Fixed stderr output (issue #15) + + +## [0.1.6] - 2012-09-09 +### Fixed +- Fixed check for conflict of options (thanks to @tomxtobin) + + +## [0.1.5] - 2012-09-03 +### Fixed +- Fix parser #setDefaults method (thanks to @tomxtobin) + + +## [0.1.4] - 2012-07-30 +### Fixed +- Fixed pseudo-argument support (thanks to @CGamesPlay) +- Fixed addHelp default (should be true), if not set (thanks to @benblank) + + +## [0.1.3] - 2012-06-27 +### Fixed +- Fixed formatter api name: Formatter -> HelpFormatter + + +## [0.1.2] - 2012-05-29 +### Fixed +- Removed excess whitespace in help +- Fixed error reporting, when parcer with subcommands + called with empty arguments + +### Added +- Added basic tests + + +## [0.1.1] - 2012-05-23 +### Fixed +- Fixed line wrapping in help formatter +- Added better error reporting on invalid arguments + + +## [0.1.0] - 2012-05-16 +### Added +- First release. + + +[2.0.1]: https://github.com/nodeca/argparse/compare/2.0.0...2.0.1 +[2.0.0]: https://github.com/nodeca/argparse/compare/1.0.10...2.0.0 +[1.0.10]: https://github.com/nodeca/argparse/compare/1.0.9...1.0.10 +[1.0.9]: https://github.com/nodeca/argparse/compare/1.0.8...1.0.9 +[1.0.8]: https://github.com/nodeca/argparse/compare/1.0.7...1.0.8 +[1.0.7]: https://github.com/nodeca/argparse/compare/1.0.6...1.0.7 +[1.0.6]: https://github.com/nodeca/argparse/compare/1.0.5...1.0.6 +[1.0.5]: https://github.com/nodeca/argparse/compare/1.0.4...1.0.5 +[1.0.4]: https://github.com/nodeca/argparse/compare/1.0.3...1.0.4 +[1.0.3]: https://github.com/nodeca/argparse/compare/1.0.2...1.0.3 +[1.0.2]: https://github.com/nodeca/argparse/compare/1.0.1...1.0.2 +[1.0.1]: https://github.com/nodeca/argparse/compare/1.0.0...1.0.1 +[1.0.0]: https://github.com/nodeca/argparse/compare/0.1.16...1.0.0 +[0.1.16]: https://github.com/nodeca/argparse/compare/0.1.15...0.1.16 +[0.1.15]: https://github.com/nodeca/argparse/compare/0.1.14...0.1.15 +[0.1.14]: https://github.com/nodeca/argparse/compare/0.1.13...0.1.14 +[0.1.13]: https://github.com/nodeca/argparse/compare/0.1.12...0.1.13 +[0.1.12]: https://github.com/nodeca/argparse/compare/0.1.11...0.1.12 +[0.1.11]: https://github.com/nodeca/argparse/compare/0.1.10...0.1.11 +[0.1.10]: https://github.com/nodeca/argparse/compare/0.1.9...0.1.10 +[0.1.9]: https://github.com/nodeca/argparse/compare/0.1.8...0.1.9 +[0.1.8]: https://github.com/nodeca/argparse/compare/0.1.7...0.1.8 +[0.1.7]: https://github.com/nodeca/argparse/compare/0.1.6...0.1.7 +[0.1.6]: https://github.com/nodeca/argparse/compare/0.1.5...0.1.6 +[0.1.5]: https://github.com/nodeca/argparse/compare/0.1.4...0.1.5 +[0.1.4]: https://github.com/nodeca/argparse/compare/0.1.3...0.1.4 +[0.1.3]: https://github.com/nodeca/argparse/compare/0.1.2...0.1.3 +[0.1.2]: https://github.com/nodeca/argparse/compare/0.1.1...0.1.2 +[0.1.1]: https://github.com/nodeca/argparse/compare/0.1.0...0.1.1 +[0.1.0]: https://github.com/nodeca/argparse/releases/tag/0.1.0 diff --git a/node_modules/argparse/LICENSE b/node_modules/argparse/LICENSE new file mode 100644 index 0000000..66a3ac8 --- /dev/null +++ b/node_modules/argparse/LICENSE @@ -0,0 +1,254 @@ +A. HISTORY OF THE SOFTWARE +========================== + +Python was created in the early 1990s by Guido van Rossum at Stichting +Mathematisch Centrum (CWI, see http://www.cwi.nl) in the Netherlands +as a successor of a language called ABC. Guido remains Python's +principal author, although it includes many contributions from others. + +In 1995, Guido continued his work on Python at the Corporation for +National Research Initiatives (CNRI, see http://www.cnri.reston.va.us) +in Reston, Virginia where he released several versions of the +software. + +In May 2000, Guido and the Python core development team moved to +BeOpen.com to form the BeOpen PythonLabs team. In October of the same +year, the PythonLabs team moved to Digital Creations, which became +Zope Corporation. In 2001, the Python Software Foundation (PSF, see +https://www.python.org/psf/) was formed, a non-profit organization +created specifically to own Python-related Intellectual Property. +Zope Corporation was a sponsoring member of the PSF. + +All Python releases are Open Source (see http://www.opensource.org for +the Open Source Definition). Historically, most, but not all, Python +releases have also been GPL-compatible; the table below summarizes +the various releases. + + Release Derived Year Owner GPL- + from compatible? (1) + + 0.9.0 thru 1.2 1991-1995 CWI yes + 1.3 thru 1.5.2 1.2 1995-1999 CNRI yes + 1.6 1.5.2 2000 CNRI no + 2.0 1.6 2000 BeOpen.com no + 1.6.1 1.6 2001 CNRI yes (2) + 2.1 2.0+1.6.1 2001 PSF no + 2.0.1 2.0+1.6.1 2001 PSF yes + 2.1.1 2.1+2.0.1 2001 PSF yes + 2.1.2 2.1.1 2002 PSF yes + 2.1.3 2.1.2 2002 PSF yes + 2.2 and above 2.1.1 2001-now PSF yes + +Footnotes: + +(1) GPL-compatible doesn't mean that we're distributing Python under + the GPL. All Python licenses, unlike the GPL, let you distribute + a modified version without making your changes open source. The + GPL-compatible licenses make it possible to combine Python with + other software that is released under the GPL; the others don't. + +(2) According to Richard Stallman, 1.6.1 is not GPL-compatible, + because its license has a choice of law clause. According to + CNRI, however, Stallman's lawyer has told CNRI's lawyer that 1.6.1 + is "not incompatible" with the GPL. + +Thanks to the many outside volunteers who have worked under Guido's +direction to make these releases possible. + + +B. TERMS AND CONDITIONS FOR ACCESSING OR OTHERWISE USING PYTHON +=============================================================== + +PYTHON SOFTWARE FOUNDATION LICENSE VERSION 2 +-------------------------------------------- + +1. This LICENSE AGREEMENT is between the Python Software Foundation +("PSF"), and the Individual or Organization ("Licensee") accessing and +otherwise using this software ("Python") in source or binary form and +its associated documentation. + +2. Subject to the terms and conditions of this License Agreement, PSF hereby +grants Licensee a nonexclusive, royalty-free, world-wide license to reproduce, +analyze, test, perform and/or display publicly, prepare derivative works, +distribute, and otherwise use Python alone or in any derivative version, +provided, however, that PSF's License Agreement and PSF's notice of copyright, +i.e., "Copyright (c) 2001, 2002, 2003, 2004, 2005, 2006, 2007, 2008, 2009, 2010, +2011, 2012, 2013, 2014, 2015, 2016, 2017, 2018, 2019, 2020 Python Software Foundation; +All Rights Reserved" are retained in Python alone or in any derivative version +prepared by Licensee. + +3. In the event Licensee prepares a derivative work that is based on +or incorporates Python or any part thereof, and wants to make +the derivative work available to others as provided herein, then +Licensee hereby agrees to include in any such work a brief summary of +the changes made to Python. + +4. PSF is making Python available to Licensee on an "AS IS" +basis. PSF MAKES NO REPRESENTATIONS OR WARRANTIES, EXPRESS OR +IMPLIED. BY WAY OF EXAMPLE, BUT NOT LIMITATION, PSF MAKES NO AND +DISCLAIMS ANY REPRESENTATION OR WARRANTY OF MERCHANTABILITY OR FITNESS +FOR ANY PARTICULAR PURPOSE OR THAT THE USE OF PYTHON WILL NOT +INFRINGE ANY THIRD PARTY RIGHTS. + +5. PSF SHALL NOT BE LIABLE TO LICENSEE OR ANY OTHER USERS OF PYTHON +FOR ANY INCIDENTAL, SPECIAL, OR CONSEQUENTIAL DAMAGES OR LOSS AS +A RESULT OF MODIFYING, DISTRIBUTING, OR OTHERWISE USING PYTHON, +OR ANY DERIVATIVE THEREOF, EVEN IF ADVISED OF THE POSSIBILITY THEREOF. + +6. This License Agreement will automatically terminate upon a material +breach of its terms and conditions. + +7. Nothing in this License Agreement shall be deemed to create any +relationship of agency, partnership, or joint venture between PSF and +Licensee. This License Agreement does not grant permission to use PSF +trademarks or trade name in a trademark sense to endorse or promote +products or services of Licensee, or any third party. + +8. By copying, installing or otherwise using Python, Licensee +agrees to be bound by the terms and conditions of this License +Agreement. + + +BEOPEN.COM LICENSE AGREEMENT FOR PYTHON 2.0 +------------------------------------------- + +BEOPEN PYTHON OPEN SOURCE LICENSE AGREEMENT VERSION 1 + +1. This LICENSE AGREEMENT is between BeOpen.com ("BeOpen"), having an +office at 160 Saratoga Avenue, Santa Clara, CA 95051, and the +Individual or Organization ("Licensee") accessing and otherwise using +this software in source or binary form and its associated +documentation ("the Software"). + +2. Subject to the terms and conditions of this BeOpen Python License +Agreement, BeOpen hereby grants Licensee a non-exclusive, +royalty-free, world-wide license to reproduce, analyze, test, perform +and/or display publicly, prepare derivative works, distribute, and +otherwise use the Software alone or in any derivative version, +provided, however, that the BeOpen Python License is retained in the +Software, alone or in any derivative version prepared by Licensee. + +3. BeOpen is making the Software available to Licensee on an "AS IS" +basis. BEOPEN MAKES NO REPRESENTATIONS OR WARRANTIES, EXPRESS OR +IMPLIED. BY WAY OF EXAMPLE, BUT NOT LIMITATION, BEOPEN MAKES NO AND +DISCLAIMS ANY REPRESENTATION OR WARRANTY OF MERCHANTABILITY OR FITNESS +FOR ANY PARTICULAR PURPOSE OR THAT THE USE OF THE SOFTWARE WILL NOT +INFRINGE ANY THIRD PARTY RIGHTS. + +4. BEOPEN SHALL NOT BE LIABLE TO LICENSEE OR ANY OTHER USERS OF THE +SOFTWARE FOR ANY INCIDENTAL, SPECIAL, OR CONSEQUENTIAL DAMAGES OR LOSS +AS A RESULT OF USING, MODIFYING OR DISTRIBUTING THE SOFTWARE, OR ANY +DERIVATIVE THEREOF, EVEN IF ADVISED OF THE POSSIBILITY THEREOF. + +5. This License Agreement will automatically terminate upon a material +breach of its terms and conditions. + +6. This License Agreement shall be governed by and interpreted in all +respects by the law of the State of California, excluding conflict of +law provisions. Nothing in this License Agreement shall be deemed to +create any relationship of agency, partnership, or joint venture +between BeOpen and Licensee. This License Agreement does not grant +permission to use BeOpen trademarks or trade names in a trademark +sense to endorse or promote products or services of Licensee, or any +third party. As an exception, the "BeOpen Python" logos available at +http://www.pythonlabs.com/logos.html may be used according to the +permissions granted on that web page. + +7. By copying, installing or otherwise using the software, Licensee +agrees to be bound by the terms and conditions of this License +Agreement. + + +CNRI LICENSE AGREEMENT FOR PYTHON 1.6.1 +--------------------------------------- + +1. This LICENSE AGREEMENT is between the Corporation for National +Research Initiatives, having an office at 1895 Preston White Drive, +Reston, VA 20191 ("CNRI"), and the Individual or Organization +("Licensee") accessing and otherwise using Python 1.6.1 software in +source or binary form and its associated documentation. + +2. Subject to the terms and conditions of this License Agreement, CNRI +hereby grants Licensee a nonexclusive, royalty-free, world-wide +license to reproduce, analyze, test, perform and/or display publicly, +prepare derivative works, distribute, and otherwise use Python 1.6.1 +alone or in any derivative version, provided, however, that CNRI's +License Agreement and CNRI's notice of copyright, i.e., "Copyright (c) +1995-2001 Corporation for National Research Initiatives; All Rights +Reserved" are retained in Python 1.6.1 alone or in any derivative +version prepared by Licensee. Alternately, in lieu of CNRI's License +Agreement, Licensee may substitute the following text (omitting the +quotes): "Python 1.6.1 is made available subject to the terms and +conditions in CNRI's License Agreement. This Agreement together with +Python 1.6.1 may be located on the Internet using the following +unique, persistent identifier (known as a handle): 1895.22/1013. This +Agreement may also be obtained from a proxy server on the Internet +using the following URL: http://hdl.handle.net/1895.22/1013". + +3. In the event Licensee prepares a derivative work that is based on +or incorporates Python 1.6.1 or any part thereof, and wants to make +the derivative work available to others as provided herein, then +Licensee hereby agrees to include in any such work a brief summary of +the changes made to Python 1.6.1. + +4. CNRI is making Python 1.6.1 available to Licensee on an "AS IS" +basis. CNRI MAKES NO REPRESENTATIONS OR WARRANTIES, EXPRESS OR +IMPLIED. BY WAY OF EXAMPLE, BUT NOT LIMITATION, CNRI MAKES NO AND +DISCLAIMS ANY REPRESENTATION OR WARRANTY OF MERCHANTABILITY OR FITNESS +FOR ANY PARTICULAR PURPOSE OR THAT THE USE OF PYTHON 1.6.1 WILL NOT +INFRINGE ANY THIRD PARTY RIGHTS. + +5. CNRI SHALL NOT BE LIABLE TO LICENSEE OR ANY OTHER USERS OF PYTHON +1.6.1 FOR ANY INCIDENTAL, SPECIAL, OR CONSEQUENTIAL DAMAGES OR LOSS AS +A RESULT OF MODIFYING, DISTRIBUTING, OR OTHERWISE USING PYTHON 1.6.1, +OR ANY DERIVATIVE THEREOF, EVEN IF ADVISED OF THE POSSIBILITY THEREOF. + +6. This License Agreement will automatically terminate upon a material +breach of its terms and conditions. + +7. This License Agreement shall be governed by the federal +intellectual property law of the United States, including without +limitation the federal copyright law, and, to the extent such +U.S. federal law does not apply, by the law of the Commonwealth of +Virginia, excluding Virginia's conflict of law provisions. +Notwithstanding the foregoing, with regard to derivative works based +on Python 1.6.1 that incorporate non-separable material that was +previously distributed under the GNU General Public License (GPL), the +law of the Commonwealth of Virginia shall govern this License +Agreement only as to issues arising under or with respect to +Paragraphs 4, 5, and 7 of this License Agreement. Nothing in this +License Agreement shall be deemed to create any relationship of +agency, partnership, or joint venture between CNRI and Licensee. This +License Agreement does not grant permission to use CNRI trademarks or +trade name in a trademark sense to endorse or promote products or +services of Licensee, or any third party. + +8. By clicking on the "ACCEPT" button where indicated, or by copying, +installing or otherwise using Python 1.6.1, Licensee agrees to be +bound by the terms and conditions of this License Agreement. + + ACCEPT + + +CWI LICENSE AGREEMENT FOR PYTHON 0.9.0 THROUGH 1.2 +-------------------------------------------------- + +Copyright (c) 1991 - 1995, Stichting Mathematisch Centrum Amsterdam, +The Netherlands. All rights reserved. + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Stichting Mathematisch +Centrum or CWI not be used in advertising or publicity pertaining to +distribution of the software without specific, written prior +permission. + +STICHTING MATHEMATISCH CENTRUM DISCLAIMS ALL WARRANTIES WITH REGARD TO +THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS, IN NO EVENT SHALL STICHTING MATHEMATISCH CENTRUM BE LIABLE +FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT +OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. diff --git a/node_modules/argparse/README.md b/node_modules/argparse/README.md new file mode 100644 index 0000000..550b5c9 --- /dev/null +++ b/node_modules/argparse/README.md @@ -0,0 +1,84 @@ +argparse +======== + +[![Build Status](https://secure.travis-ci.org/nodeca/argparse.svg?branch=master)](http://travis-ci.org/nodeca/argparse) +[![NPM version](https://img.shields.io/npm/v/argparse.svg)](https://www.npmjs.org/package/argparse) + +CLI arguments parser for node.js, with [sub-commands](https://docs.python.org/3.9/library/argparse.html#sub-commands) support. Port of python's [argparse](http://docs.python.org/dev/library/argparse.html) (version [3.9.0](https://github.com/python/cpython/blob/v3.9.0rc1/Lib/argparse.py)). + +**Difference with original.** + +- JS has no keyword arguments support. + - Pass options instead: `new ArgumentParser({ description: 'example', add_help: true })`. +- JS has no python's types `int`, `float`, ... + - Use string-typed names: `.add_argument('-b', { type: 'int', help: 'help' })`. +- `%r` format specifier uses `require('util').inspect()`. + +More details in [doc](./doc). + + +Example +------- + +`test.js` file: + +```javascript +#!/usr/bin/env node +'use strict'; + +const { ArgumentParser } = require('argparse'); +const { version } = require('./package.json'); + +const parser = new ArgumentParser({ + description: 'Argparse example' +}); + +parser.add_argument('-v', '--version', { action: 'version', version }); +parser.add_argument('-f', '--foo', { help: 'foo bar' }); +parser.add_argument('-b', '--bar', { help: 'bar foo' }); +parser.add_argument('--baz', { help: 'baz bar' }); + +console.dir(parser.parse_args()); +``` + +Display help: + +``` +$ ./test.js -h +usage: test.js [-h] [-v] [-f FOO] [-b BAR] [--baz BAZ] + +Argparse example + +optional arguments: + -h, --help show this help message and exit + -v, --version show program's version number and exit + -f FOO, --foo FOO foo bar + -b BAR, --bar BAR bar foo + --baz BAZ baz bar +``` + +Parse arguments: + +``` +$ ./test.js -f=3 --bar=4 --baz 5 +{ foo: '3', bar: '4', baz: '5' } +``` + + +API docs +-------- + +Since this is a port with minimal divergence, there's no separate documentation. +Use original one instead, with notes about difference. + +1. [Original doc](https://docs.python.org/3.9/library/argparse.html). +2. [Original tutorial](https://docs.python.org/3.9/howto/argparse.html). +3. [Difference with python](./doc). + + +argparse for enterprise +----------------------- + +Available as part of the Tidelift Subscription + +The maintainers of argparse and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-argparse?utm_source=npm-argparse&utm_medium=referral&utm_campaign=enterprise&utm_term=repo) diff --git a/node_modules/argparse/argparse.js b/node_modules/argparse/argparse.js new file mode 100644 index 0000000..2b8c8c6 --- /dev/null +++ b/node_modules/argparse/argparse.js @@ -0,0 +1,3707 @@ +// Port of python's argparse module, version 3.9.0: +// https://github.com/python/cpython/blob/v3.9.0rc1/Lib/argparse.py + +'use strict' + +// Copyright (C) 2010-2020 Python Software Foundation. +// Copyright (C) 2020 argparse.js authors + +/* + * Command-line parsing library + * + * This module is an optparse-inspired command-line parsing library that: + * + * - handles both optional and positional arguments + * - produces highly informative usage messages + * - supports parsers that dispatch to sub-parsers + * + * The following is a simple usage example that sums integers from the + * command-line and writes the result to a file:: + * + * parser = argparse.ArgumentParser( + * description='sum the integers at the command line') + * parser.add_argument( + * 'integers', metavar='int', nargs='+', type=int, + * help='an integer to be summed') + * parser.add_argument( + * '--log', default=sys.stdout, type=argparse.FileType('w'), + * help='the file where the sum should be written') + * args = parser.parse_args() + * args.log.write('%s' % sum(args.integers)) + * args.log.close() + * + * The module contains the following public classes: + * + * - ArgumentParser -- The main entry point for command-line parsing. As the + * example above shows, the add_argument() method is used to populate + * the parser with actions for optional and positional arguments. Then + * the parse_args() method is invoked to convert the args at the + * command-line into an object with attributes. + * + * - ArgumentError -- The exception raised by ArgumentParser objects when + * there are errors with the parser's actions. Errors raised while + * parsing the command-line are caught by ArgumentParser and emitted + * as command-line messages. + * + * - FileType -- A factory for defining types of files to be created. As the + * example above shows, instances of FileType are typically passed as + * the type= argument of add_argument() calls. + * + * - Action -- The base class for parser actions. Typically actions are + * selected by passing strings like 'store_true' or 'append_const' to + * the action= argument of add_argument(). However, for greater + * customization of ArgumentParser actions, subclasses of Action may + * be defined and passed as the action= argument. + * + * - HelpFormatter, RawDescriptionHelpFormatter, RawTextHelpFormatter, + * ArgumentDefaultsHelpFormatter -- Formatter classes which + * may be passed as the formatter_class= argument to the + * ArgumentParser constructor. HelpFormatter is the default, + * RawDescriptionHelpFormatter and RawTextHelpFormatter tell the parser + * not to change the formatting for help text, and + * ArgumentDefaultsHelpFormatter adds information about argument defaults + * to the help. + * + * All other classes in this module are considered implementation details. + * (Also note that HelpFormatter and RawDescriptionHelpFormatter are only + * considered public as object names -- the API of the formatter objects is + * still considered an implementation detail.) + */ + +const SUPPRESS = '==SUPPRESS==' + +const OPTIONAL = '?' +const ZERO_OR_MORE = '*' +const ONE_OR_MORE = '+' +const PARSER = 'A...' +const REMAINDER = '...' +const _UNRECOGNIZED_ARGS_ATTR = '_unrecognized_args' + + +// ================================== +// Utility functions used for porting +// ================================== +const assert = require('assert') +const util = require('util') +const fs = require('fs') +const sub = require('./lib/sub') +const path = require('path') +const repr = util.inspect + +function get_argv() { + // omit first argument (which is assumed to be interpreter - `node`, `coffee`, `ts-node`, etc.) + return process.argv.slice(1) +} + +function get_terminal_size() { + return { + columns: +process.env.COLUMNS || process.stdout.columns || 80 + } +} + +function hasattr(object, name) { + return Object.prototype.hasOwnProperty.call(object, name) +} + +function getattr(object, name, value) { + return hasattr(object, name) ? object[name] : value +} + +function setattr(object, name, value) { + object[name] = value +} + +function setdefault(object, name, value) { + if (!hasattr(object, name)) object[name] = value + return object[name] +} + +function delattr(object, name) { + delete object[name] +} + +function range(from, to, step=1) { + // range(10) is equivalent to range(0, 10) + if (arguments.length === 1) [ to, from ] = [ from, 0 ] + if (typeof from !== 'number' || typeof to !== 'number' || typeof step !== 'number') { + throw new TypeError('argument cannot be interpreted as an integer') + } + if (step === 0) throw new TypeError('range() arg 3 must not be zero') + + let result = [] + if (step > 0) { + for (let i = from; i < to; i += step) result.push(i) + } else { + for (let i = from; i > to; i += step) result.push(i) + } + return result +} + +function splitlines(str, keepends = false) { + let result + if (!keepends) { + result = str.split(/\r\n|[\n\r\v\f\x1c\x1d\x1e\x85\u2028\u2029]/) + } else { + result = [] + let parts = str.split(/(\r\n|[\n\r\v\f\x1c\x1d\x1e\x85\u2028\u2029])/) + for (let i = 0; i < parts.length; i += 2) { + result.push(parts[i] + (i + 1 < parts.length ? parts[i + 1] : '')) + } + } + if (!result[result.length - 1]) result.pop() + return result +} + +function _string_lstrip(string, prefix_chars) { + let idx = 0 + while (idx < string.length && prefix_chars.includes(string[idx])) idx++ + return idx ? string.slice(idx) : string +} + +function _string_split(string, sep, maxsplit) { + let result = string.split(sep) + if (result.length > maxsplit) { + result = result.slice(0, maxsplit).concat([ result.slice(maxsplit).join(sep) ]) + } + return result +} + +function _array_equal(array1, array2) { + if (array1.length !== array2.length) return false + for (let i = 0; i < array1.length; i++) { + if (array1[i] !== array2[i]) return false + } + return true +} + +function _array_remove(array, item) { + let idx = array.indexOf(item) + if (idx === -1) throw new TypeError(sub('%r not in list', item)) + array.splice(idx, 1) +} + +// normalize choices to array; +// this isn't required in python because `in` and `map` operators work with anything, +// but in js dealing with multiple types here is too clunky +function _choices_to_array(choices) { + if (choices === undefined) { + return [] + } else if (Array.isArray(choices)) { + return choices + } else if (choices !== null && typeof choices[Symbol.iterator] === 'function') { + return Array.from(choices) + } else if (typeof choices === 'object' && choices !== null) { + return Object.keys(choices) + } else { + throw new Error(sub('invalid choices value: %r', choices)) + } +} + +// decorator that allows a class to be called without new +function _callable(cls) { + let result = { // object is needed for inferred class name + [cls.name]: function (...args) { + let this_class = new.target === result || !new.target + return Reflect.construct(cls, args, this_class ? cls : new.target) + } + } + result[cls.name].prototype = cls.prototype + // fix default tag for toString, e.g. [object Action] instead of [object Object] + cls.prototype[Symbol.toStringTag] = cls.name + return result[cls.name] +} + +function _alias(object, from, to) { + try { + let name = object.constructor.name + Object.defineProperty(object, from, { + value: util.deprecate(object[to], sub('%s.%s() is renamed to %s.%s()', + name, from, name, to)), + enumerable: false + }) + } catch {} +} + +// decorator that allows snake_case class methods to be called with camelCase and vice versa +function _camelcase_alias(_class) { + for (let name of Object.getOwnPropertyNames(_class.prototype)) { + let camelcase = name.replace(/\w_[a-z]/g, s => s[0] + s[2].toUpperCase()) + if (camelcase !== name) _alias(_class.prototype, camelcase, name) + } + return _class +} + +function _to_legacy_name(key) { + key = key.replace(/\w_[a-z]/g, s => s[0] + s[2].toUpperCase()) + if (key === 'default') key = 'defaultValue' + if (key === 'const') key = 'constant' + return key +} + +function _to_new_name(key) { + if (key === 'defaultValue') key = 'default' + if (key === 'constant') key = 'const' + key = key.replace(/[A-Z]/g, c => '_' + c.toLowerCase()) + return key +} + +// parse options +let no_default = Symbol('no_default_value') +function _parse_opts(args, descriptor) { + function get_name() { + let stack = new Error().stack.split('\n') + .map(x => x.match(/^ at (.*) \(.*\)$/)) + .filter(Boolean) + .map(m => m[1]) + .map(fn => fn.match(/[^ .]*$/)[0]) + + if (stack.length && stack[0] === get_name.name) stack.shift() + if (stack.length && stack[0] === _parse_opts.name) stack.shift() + return stack.length ? stack[0] : '' + } + + args = Array.from(args) + let kwargs = {} + let result = [] + let last_opt = args.length && args[args.length - 1] + + if (typeof last_opt === 'object' && last_opt !== null && !Array.isArray(last_opt) && + (!last_opt.constructor || last_opt.constructor.name === 'Object')) { + kwargs = Object.assign({}, args.pop()) + } + + // LEGACY (v1 compatibility): camelcase + let renames = [] + for (let key of Object.keys(descriptor)) { + let old_name = _to_legacy_name(key) + if (old_name !== key && (old_name in kwargs)) { + if (key in kwargs) { + // default and defaultValue specified at the same time, happens often in old tests + //throw new TypeError(sub('%s() got multiple values for argument %r', get_name(), key)) + } else { + kwargs[key] = kwargs[old_name] + } + renames.push([ old_name, key ]) + delete kwargs[old_name] + } + } + if (renames.length) { + let name = get_name() + deprecate('camelcase_' + name, sub('%s(): following options are renamed: %s', + name, renames.map(([ a, b ]) => sub('%r -> %r', a, b)))) + } + // end + + let missing_positionals = [] + let positional_count = args.length + + for (let [ key, def ] of Object.entries(descriptor)) { + if (key[0] === '*') { + if (key.length > 0 && key[1] === '*') { + // LEGACY (v1 compatibility): camelcase + let renames = [] + for (let key of Object.keys(kwargs)) { + let new_name = _to_new_name(key) + if (new_name !== key && (key in kwargs)) { + if (new_name in kwargs) { + // default and defaultValue specified at the same time, happens often in old tests + //throw new TypeError(sub('%s() got multiple values for argument %r', get_name(), new_name)) + } else { + kwargs[new_name] = kwargs[key] + } + renames.push([ key, new_name ]) + delete kwargs[key] + } + } + if (renames.length) { + let name = get_name() + deprecate('camelcase_' + name, sub('%s(): following options are renamed: %s', + name, renames.map(([ a, b ]) => sub('%r -> %r', a, b)))) + } + // end + result.push(kwargs) + kwargs = {} + } else { + result.push(args) + args = [] + } + } else if (key in kwargs && args.length > 0) { + throw new TypeError(sub('%s() got multiple values for argument %r', get_name(), key)) + } else if (key in kwargs) { + result.push(kwargs[key]) + delete kwargs[key] + } else if (args.length > 0) { + result.push(args.shift()) + } else if (def !== no_default) { + result.push(def) + } else { + missing_positionals.push(key) + } + } + + if (Object.keys(kwargs).length) { + throw new TypeError(sub('%s() got an unexpected keyword argument %r', + get_name(), Object.keys(kwargs)[0])) + } + + if (args.length) { + let from = Object.entries(descriptor).filter(([ k, v ]) => k[0] !== '*' && v !== no_default).length + let to = Object.entries(descriptor).filter(([ k ]) => k[0] !== '*').length + throw new TypeError(sub('%s() takes %s positional argument%s but %s %s given', + get_name(), + from === to ? sub('from %s to %s', from, to) : to, + from === to && to === 1 ? '' : 's', + positional_count, + positional_count === 1 ? 'was' : 'were')) + } + + if (missing_positionals.length) { + let strs = missing_positionals.map(repr) + if (strs.length > 1) strs[strs.length - 1] = 'and ' + strs[strs.length - 1] + let str_joined = strs.join(strs.length === 2 ? '' : ', ') + throw new TypeError(sub('%s() missing %i required positional argument%s: %s', + get_name(), strs.length, strs.length === 1 ? '' : 's', str_joined)) + } + + return result +} + +let _deprecations = {} +function deprecate(id, string) { + _deprecations[id] = _deprecations[id] || util.deprecate(() => {}, string) + _deprecations[id]() +} + + +// ============================= +// Utility functions and classes +// ============================= +function _AttributeHolder(cls = Object) { + /* + * Abstract base class that provides __repr__. + * + * The __repr__ method returns a string in the format:: + * ClassName(attr=name, attr=name, ...) + * The attributes are determined either by a class-level attribute, + * '_kwarg_names', or by inspecting the instance __dict__. + */ + + return class _AttributeHolder extends cls { + [util.inspect.custom]() { + let type_name = this.constructor.name + let arg_strings = [] + let star_args = {} + for (let arg of this._get_args()) { + arg_strings.push(repr(arg)) + } + for (let [ name, value ] of this._get_kwargs()) { + if (/^[a-z_][a-z0-9_$]*$/i.test(name)) { + arg_strings.push(sub('%s=%r', name, value)) + } else { + star_args[name] = value + } + } + if (Object.keys(star_args).length) { + arg_strings.push(sub('**%s', repr(star_args))) + } + return sub('%s(%s)', type_name, arg_strings.join(', ')) + } + + toString() { + return this[util.inspect.custom]() + } + + _get_kwargs() { + return Object.entries(this) + } + + _get_args() { + return [] + } + } +} + + +function _copy_items(items) { + if (items === undefined) { + return [] + } + return items.slice(0) +} + + +// =============== +// Formatting Help +// =============== +const HelpFormatter = _camelcase_alias(_callable(class HelpFormatter { + /* + * Formatter for generating usage messages and argument help strings. + * + * Only the name of this class is considered a public API. All the methods + * provided by the class are considered an implementation detail. + */ + + constructor() { + let [ + prog, + indent_increment, + max_help_position, + width + ] = _parse_opts(arguments, { + prog: no_default, + indent_increment: 2, + max_help_position: 24, + width: undefined + }) + + // default setting for width + if (width === undefined) { + width = get_terminal_size().columns + width -= 2 + } + + this._prog = prog + this._indent_increment = indent_increment + this._max_help_position = Math.min(max_help_position, + Math.max(width - 20, indent_increment * 2)) + this._width = width + + this._current_indent = 0 + this._level = 0 + this._action_max_length = 0 + + this._root_section = this._Section(this, undefined) + this._current_section = this._root_section + + this._whitespace_matcher = /[ \t\n\r\f\v]+/g // equivalent to python /\s+/ with ASCII flag + this._long_break_matcher = /\n\n\n+/g + } + + // =============================== + // Section and indentation methods + // =============================== + _indent() { + this._current_indent += this._indent_increment + this._level += 1 + } + + _dedent() { + this._current_indent -= this._indent_increment + assert(this._current_indent >= 0, 'Indent decreased below 0.') + this._level -= 1 + } + + _add_item(func, args) { + this._current_section.items.push([ func, args ]) + } + + // ======================== + // Message building methods + // ======================== + start_section(heading) { + this._indent() + let section = this._Section(this, this._current_section, heading) + this._add_item(section.format_help.bind(section), []) + this._current_section = section + } + + end_section() { + this._current_section = this._current_section.parent + this._dedent() + } + + add_text(text) { + if (text !== SUPPRESS && text !== undefined) { + this._add_item(this._format_text.bind(this), [text]) + } + } + + add_usage(usage, actions, groups, prefix = undefined) { + if (usage !== SUPPRESS) { + let args = [ usage, actions, groups, prefix ] + this._add_item(this._format_usage.bind(this), args) + } + } + + add_argument(action) { + if (action.help !== SUPPRESS) { + + // find all invocations + let invocations = [this._format_action_invocation(action)] + for (let subaction of this._iter_indented_subactions(action)) { + invocations.push(this._format_action_invocation(subaction)) + } + + // update the maximum item length + let invocation_length = Math.max(...invocations.map(invocation => invocation.length)) + let action_length = invocation_length + this._current_indent + this._action_max_length = Math.max(this._action_max_length, + action_length) + + // add the item to the list + this._add_item(this._format_action.bind(this), [action]) + } + } + + add_arguments(actions) { + for (let action of actions) { + this.add_argument(action) + } + } + + // ======================= + // Help-formatting methods + // ======================= + format_help() { + let help = this._root_section.format_help() + if (help) { + help = help.replace(this._long_break_matcher, '\n\n') + help = help.replace(/^\n+|\n+$/g, '') + '\n' + } + return help + } + + _join_parts(part_strings) { + return part_strings.filter(part => part && part !== SUPPRESS).join('') + } + + _format_usage(usage, actions, groups, prefix) { + if (prefix === undefined) { + prefix = 'usage: ' + } + + // if usage is specified, use that + if (usage !== undefined) { + usage = sub(usage, { prog: this._prog }) + + // if no optionals or positionals are available, usage is just prog + } else if (usage === undefined && !actions.length) { + usage = sub('%(prog)s', { prog: this._prog }) + + // if optionals and positionals are available, calculate usage + } else if (usage === undefined) { + let prog = sub('%(prog)s', { prog: this._prog }) + + // split optionals from positionals + let optionals = [] + let positionals = [] + for (let action of actions) { + if (action.option_strings.length) { + optionals.push(action) + } else { + positionals.push(action) + } + } + + // build full usage string + let action_usage = this._format_actions_usage([].concat(optionals).concat(positionals), groups) + usage = [ prog, action_usage ].map(String).join(' ') + + // wrap the usage parts if it's too long + let text_width = this._width - this._current_indent + if (prefix.length + usage.length > text_width) { + + // break usage into wrappable parts + let part_regexp = /\(.*?\)+(?=\s|$)|\[.*?\]+(?=\s|$)|\S+/g + let opt_usage = this._format_actions_usage(optionals, groups) + let pos_usage = this._format_actions_usage(positionals, groups) + let opt_parts = opt_usage.match(part_regexp) || [] + let pos_parts = pos_usage.match(part_regexp) || [] + assert(opt_parts.join(' ') === opt_usage) + assert(pos_parts.join(' ') === pos_usage) + + // helper for wrapping lines + let get_lines = (parts, indent, prefix = undefined) => { + let lines = [] + let line = [] + let line_len + if (prefix !== undefined) { + line_len = prefix.length - 1 + } else { + line_len = indent.length - 1 + } + for (let part of parts) { + if (line_len + 1 + part.length > text_width && line) { + lines.push(indent + line.join(' ')) + line = [] + line_len = indent.length - 1 + } + line.push(part) + line_len += part.length + 1 + } + if (line.length) { + lines.push(indent + line.join(' ')) + } + if (prefix !== undefined) { + lines[0] = lines[0].slice(indent.length) + } + return lines + } + + let lines + + // if prog is short, follow it with optionals or positionals + if (prefix.length + prog.length <= 0.75 * text_width) { + let indent = ' '.repeat(prefix.length + prog.length + 1) + if (opt_parts.length) { + lines = get_lines([prog].concat(opt_parts), indent, prefix) + lines = lines.concat(get_lines(pos_parts, indent)) + } else if (pos_parts.length) { + lines = get_lines([prog].concat(pos_parts), indent, prefix) + } else { + lines = [prog] + } + + // if prog is long, put it on its own line + } else { + let indent = ' '.repeat(prefix.length) + let parts = [].concat(opt_parts).concat(pos_parts) + lines = get_lines(parts, indent) + if (lines.length > 1) { + lines = [] + lines = lines.concat(get_lines(opt_parts, indent)) + lines = lines.concat(get_lines(pos_parts, indent)) + } + lines = [prog].concat(lines) + } + + // join lines into usage + usage = lines.join('\n') + } + } + + // prefix with 'usage:' + return sub('%s%s\n\n', prefix, usage) + } + + _format_actions_usage(actions, groups) { + // find group indices and identify actions in groups + let group_actions = new Set() + let inserts = {} + for (let group of groups) { + let start = actions.indexOf(group._group_actions[0]) + if (start === -1) { + continue + } else { + let end = start + group._group_actions.length + if (_array_equal(actions.slice(start, end), group._group_actions)) { + for (let action of group._group_actions) { + group_actions.add(action) + } + if (!group.required) { + if (start in inserts) { + inserts[start] += ' [' + } else { + inserts[start] = '[' + } + if (end in inserts) { + inserts[end] += ']' + } else { + inserts[end] = ']' + } + } else { + if (start in inserts) { + inserts[start] += ' (' + } else { + inserts[start] = '(' + } + if (end in inserts) { + inserts[end] += ')' + } else { + inserts[end] = ')' + } + } + for (let i of range(start + 1, end)) { + inserts[i] = '|' + } + } + } + } + + // collect all actions format strings + let parts = [] + for (let [ i, action ] of Object.entries(actions)) { + + // suppressed arguments are marked with None + // remove | separators for suppressed arguments + if (action.help === SUPPRESS) { + parts.push(undefined) + if (inserts[+i] === '|') { + delete inserts[+i] + } else if (inserts[+i + 1] === '|') { + delete inserts[+i + 1] + } + + // produce all arg strings + } else if (!action.option_strings.length) { + let default_value = this._get_default_metavar_for_positional(action) + let part = this._format_args(action, default_value) + + // if it's in a group, strip the outer [] + if (group_actions.has(action)) { + if (part[0] === '[' && part[part.length - 1] === ']') { + part = part.slice(1, -1) + } + } + + // add the action string to the list + parts.push(part) + + // produce the first way to invoke the option in brackets + } else { + let option_string = action.option_strings[0] + let part + + // if the Optional doesn't take a value, format is: + // -s or --long + if (action.nargs === 0) { + part = action.format_usage() + + // if the Optional takes a value, format is: + // -s ARGS or --long ARGS + } else { + let default_value = this._get_default_metavar_for_optional(action) + let args_string = this._format_args(action, default_value) + part = sub('%s %s', option_string, args_string) + } + + // make it look optional if it's not required or in a group + if (!action.required && !group_actions.has(action)) { + part = sub('[%s]', part) + } + + // add the action string to the list + parts.push(part) + } + } + + // insert things at the necessary indices + for (let i of Object.keys(inserts).map(Number).sort((a, b) => b - a)) { + parts.splice(+i, 0, inserts[+i]) + } + + // join all the action items with spaces + let text = parts.filter(Boolean).join(' ') + + // clean up separators for mutually exclusive groups + text = text.replace(/([\[(]) /g, '$1') + text = text.replace(/ ([\])])/g, '$1') + text = text.replace(/[\[(] *[\])]/g, '') + text = text.replace(/\(([^|]*)\)/g, '$1', text) + text = text.trim() + + // return the text + return text + } + + _format_text(text) { + if (text.includes('%(prog)')) { + text = sub(text, { prog: this._prog }) + } + let text_width = Math.max(this._width - this._current_indent, 11) + let indent = ' '.repeat(this._current_indent) + return this._fill_text(text, text_width, indent) + '\n\n' + } + + _format_action(action) { + // determine the required width and the entry label + let help_position = Math.min(this._action_max_length + 2, + this._max_help_position) + let help_width = Math.max(this._width - help_position, 11) + let action_width = help_position - this._current_indent - 2 + let action_header = this._format_action_invocation(action) + let indent_first + + // no help; start on same line and add a final newline + if (!action.help) { + let tup = [ this._current_indent, '', action_header ] + action_header = sub('%*s%s\n', ...tup) + + // short action name; start on the same line and pad two spaces + } else if (action_header.length <= action_width) { + let tup = [ this._current_indent, '', action_width, action_header ] + action_header = sub('%*s%-*s ', ...tup) + indent_first = 0 + + // long action name; start on the next line + } else { + let tup = [ this._current_indent, '', action_header ] + action_header = sub('%*s%s\n', ...tup) + indent_first = help_position + } + + // collect the pieces of the action help + let parts = [action_header] + + // if there was help for the action, add lines of help text + if (action.help) { + let help_text = this._expand_help(action) + let help_lines = this._split_lines(help_text, help_width) + parts.push(sub('%*s%s\n', indent_first, '', help_lines[0])) + for (let line of help_lines.slice(1)) { + parts.push(sub('%*s%s\n', help_position, '', line)) + } + + // or add a newline if the description doesn't end with one + } else if (!action_header.endsWith('\n')) { + parts.push('\n') + } + + // if there are any sub-actions, add their help as well + for (let subaction of this._iter_indented_subactions(action)) { + parts.push(this._format_action(subaction)) + } + + // return a single string + return this._join_parts(parts) + } + + _format_action_invocation(action) { + if (!action.option_strings.length) { + let default_value = this._get_default_metavar_for_positional(action) + let metavar = this._metavar_formatter(action, default_value)(1)[0] + return metavar + + } else { + let parts = [] + + // if the Optional doesn't take a value, format is: + // -s, --long + if (action.nargs === 0) { + parts = parts.concat(action.option_strings) + + // if the Optional takes a value, format is: + // -s ARGS, --long ARGS + } else { + let default_value = this._get_default_metavar_for_optional(action) + let args_string = this._format_args(action, default_value) + for (let option_string of action.option_strings) { + parts.push(sub('%s %s', option_string, args_string)) + } + } + + return parts.join(', ') + } + } + + _metavar_formatter(action, default_metavar) { + let result + if (action.metavar !== undefined) { + result = action.metavar + } else if (action.choices !== undefined) { + let choice_strs = _choices_to_array(action.choices).map(String) + result = sub('{%s}', choice_strs.join(',')) + } else { + result = default_metavar + } + + function format(tuple_size) { + if (Array.isArray(result)) { + return result + } else { + return Array(tuple_size).fill(result) + } + } + return format + } + + _format_args(action, default_metavar) { + let get_metavar = this._metavar_formatter(action, default_metavar) + let result + if (action.nargs === undefined) { + result = sub('%s', ...get_metavar(1)) + } else if (action.nargs === OPTIONAL) { + result = sub('[%s]', ...get_metavar(1)) + } else if (action.nargs === ZERO_OR_MORE) { + let metavar = get_metavar(1) + if (metavar.length === 2) { + result = sub('[%s [%s ...]]', ...metavar) + } else { + result = sub('[%s ...]', ...metavar) + } + } else if (action.nargs === ONE_OR_MORE) { + result = sub('%s [%s ...]', ...get_metavar(2)) + } else if (action.nargs === REMAINDER) { + result = '...' + } else if (action.nargs === PARSER) { + result = sub('%s ...', ...get_metavar(1)) + } else if (action.nargs === SUPPRESS) { + result = '' + } else { + let formats + try { + formats = range(action.nargs).map(() => '%s') + } catch (err) { + throw new TypeError('invalid nargs value') + } + result = sub(formats.join(' '), ...get_metavar(action.nargs)) + } + return result + } + + _expand_help(action) { + let params = Object.assign({ prog: this._prog }, action) + for (let name of Object.keys(params)) { + if (params[name] === SUPPRESS) { + delete params[name] + } + } + for (let name of Object.keys(params)) { + if (params[name] && params[name].name) { + params[name] = params[name].name + } + } + if (params.choices !== undefined) { + let choices_str = _choices_to_array(params.choices).map(String).join(', ') + params.choices = choices_str + } + // LEGACY (v1 compatibility): camelcase + for (let key of Object.keys(params)) { + let old_name = _to_legacy_name(key) + if (old_name !== key) { + params[old_name] = params[key] + } + } + // end + return sub(this._get_help_string(action), params) + } + + * _iter_indented_subactions(action) { + if (typeof action._get_subactions === 'function') { + this._indent() + yield* action._get_subactions() + this._dedent() + } + } + + _split_lines(text, width) { + text = text.replace(this._whitespace_matcher, ' ').trim() + // The textwrap module is used only for formatting help. + // Delay its import for speeding up the common usage of argparse. + let textwrap = require('./lib/textwrap') + return textwrap.wrap(text, { width }) + } + + _fill_text(text, width, indent) { + text = text.replace(this._whitespace_matcher, ' ').trim() + let textwrap = require('./lib/textwrap') + return textwrap.fill(text, { width, + initial_indent: indent, + subsequent_indent: indent }) + } + + _get_help_string(action) { + return action.help + } + + _get_default_metavar_for_optional(action) { + return action.dest.toUpperCase() + } + + _get_default_metavar_for_positional(action) { + return action.dest + } +})) + +HelpFormatter.prototype._Section = _callable(class _Section { + + constructor(formatter, parent, heading = undefined) { + this.formatter = formatter + this.parent = parent + this.heading = heading + this.items = [] + } + + format_help() { + // format the indented section + if (this.parent !== undefined) { + this.formatter._indent() + } + let item_help = this.formatter._join_parts(this.items.map(([ func, args ]) => func.apply(null, args))) + if (this.parent !== undefined) { + this.formatter._dedent() + } + + // return nothing if the section was empty + if (!item_help) { + return '' + } + + // add the heading if the section was non-empty + let heading + if (this.heading !== SUPPRESS && this.heading !== undefined) { + let current_indent = this.formatter._current_indent + heading = sub('%*s%s:\n', current_indent, '', this.heading) + } else { + heading = '' + } + + // join the section-initial newline, the heading and the help + return this.formatter._join_parts(['\n', heading, item_help, '\n']) + } +}) + + +const RawDescriptionHelpFormatter = _camelcase_alias(_callable(class RawDescriptionHelpFormatter extends HelpFormatter { + /* + * Help message formatter which retains any formatting in descriptions. + * + * Only the name of this class is considered a public API. All the methods + * provided by the class are considered an implementation detail. + */ + + _fill_text(text, width, indent) { + return splitlines(text, true).map(line => indent + line).join('') + } +})) + + +const RawTextHelpFormatter = _camelcase_alias(_callable(class RawTextHelpFormatter extends RawDescriptionHelpFormatter { + /* + * Help message formatter which retains formatting of all help text. + * + * Only the name of this class is considered a public API. All the methods + * provided by the class are considered an implementation detail. + */ + + _split_lines(text/*, width*/) { + return splitlines(text) + } +})) + + +const ArgumentDefaultsHelpFormatter = _camelcase_alias(_callable(class ArgumentDefaultsHelpFormatter extends HelpFormatter { + /* + * Help message formatter which adds default values to argument help. + * + * Only the name of this class is considered a public API. All the methods + * provided by the class are considered an implementation detail. + */ + + _get_help_string(action) { + let help = action.help + // LEGACY (v1 compatibility): additional check for defaultValue needed + if (!action.help.includes('%(default)') && !action.help.includes('%(defaultValue)')) { + if (action.default !== SUPPRESS) { + let defaulting_nargs = [OPTIONAL, ZERO_OR_MORE] + if (action.option_strings.length || defaulting_nargs.includes(action.nargs)) { + help += ' (default: %(default)s)' + } + } + } + return help + } +})) + + +const MetavarTypeHelpFormatter = _camelcase_alias(_callable(class MetavarTypeHelpFormatter extends HelpFormatter { + /* + * Help message formatter which uses the argument 'type' as the default + * metavar value (instead of the argument 'dest') + * + * Only the name of this class is considered a public API. All the methods + * provided by the class are considered an implementation detail. + */ + + _get_default_metavar_for_optional(action) { + return typeof action.type === 'function' ? action.type.name : action.type + } + + _get_default_metavar_for_positional(action) { + return typeof action.type === 'function' ? action.type.name : action.type + } +})) + + +// ===================== +// Options and Arguments +// ===================== +function _get_action_name(argument) { + if (argument === undefined) { + return undefined + } else if (argument.option_strings.length) { + return argument.option_strings.join('/') + } else if (![ undefined, SUPPRESS ].includes(argument.metavar)) { + return argument.metavar + } else if (![ undefined, SUPPRESS ].includes(argument.dest)) { + return argument.dest + } else { + return undefined + } +} + + +const ArgumentError = _callable(class ArgumentError extends Error { + /* + * An error from creating or using an argument (optional or positional). + * + * The string value of this exception is the message, augmented with + * information about the argument that caused it. + */ + + constructor(argument, message) { + super() + this.name = 'ArgumentError' + this._argument_name = _get_action_name(argument) + this._message = message + this.message = this.str() + } + + str() { + let format + if (this._argument_name === undefined) { + format = '%(message)s' + } else { + format = 'argument %(argument_name)s: %(message)s' + } + return sub(format, { message: this._message, + argument_name: this._argument_name }) + } +}) + + +const ArgumentTypeError = _callable(class ArgumentTypeError extends Error { + /* + * An error from trying to convert a command line string to a type. + */ + + constructor(message) { + super(message) + this.name = 'ArgumentTypeError' + } +}) + + +// ============== +// Action classes +// ============== +const Action = _camelcase_alias(_callable(class Action extends _AttributeHolder(Function) { + /* + * Information about how to convert command line strings to Python objects. + * + * Action objects are used by an ArgumentParser to represent the information + * needed to parse a single argument from one or more strings from the + * command line. The keyword arguments to the Action constructor are also + * all attributes of Action instances. + * + * Keyword Arguments: + * + * - option_strings -- A list of command-line option strings which + * should be associated with this action. + * + * - dest -- The name of the attribute to hold the created object(s) + * + * - nargs -- The number of command-line arguments that should be + * consumed. By default, one argument will be consumed and a single + * value will be produced. Other values include: + * - N (an integer) consumes N arguments (and produces a list) + * - '?' consumes zero or one arguments + * - '*' consumes zero or more arguments (and produces a list) + * - '+' consumes one or more arguments (and produces a list) + * Note that the difference between the default and nargs=1 is that + * with the default, a single value will be produced, while with + * nargs=1, a list containing a single value will be produced. + * + * - const -- The value to be produced if the option is specified and the + * option uses an action that takes no values. + * + * - default -- The value to be produced if the option is not specified. + * + * - type -- A callable that accepts a single string argument, and + * returns the converted value. The standard Python types str, int, + * float, and complex are useful examples of such callables. If None, + * str is used. + * + * - choices -- A container of values that should be allowed. If not None, + * after a command-line argument has been converted to the appropriate + * type, an exception will be raised if it is not a member of this + * collection. + * + * - required -- True if the action must always be specified at the + * command line. This is only meaningful for optional command-line + * arguments. + * + * - help -- The help string describing the argument. + * + * - metavar -- The name to be used for the option's argument with the + * help string. If None, the 'dest' value will be used as the name. + */ + + constructor() { + let [ + option_strings, + dest, + nargs, + const_value, + default_value, + type, + choices, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + nargs: undefined, + const: undefined, + default: undefined, + type: undefined, + choices: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + // when this class is called as a function, redirect it to .call() method of itself + super('return arguments.callee.call.apply(arguments.callee, arguments)') + + this.option_strings = option_strings + this.dest = dest + this.nargs = nargs + this.const = const_value + this.default = default_value + this.type = type + this.choices = choices + this.required = required + this.help = help + this.metavar = metavar + } + + _get_kwargs() { + let names = [ + 'option_strings', + 'dest', + 'nargs', + 'const', + 'default', + 'type', + 'choices', + 'help', + 'metavar' + ] + return names.map(name => [ name, getattr(this, name) ]) + } + + format_usage() { + return this.option_strings[0] + } + + call(/*parser, namespace, values, option_string = undefined*/) { + throw new Error('.call() not defined') + } +})) + + +const BooleanOptionalAction = _camelcase_alias(_callable(class BooleanOptionalAction extends Action { + + constructor() { + let [ + option_strings, + dest, + default_value, + type, + choices, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + default: undefined, + type: undefined, + choices: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + let _option_strings = [] + for (let option_string of option_strings) { + _option_strings.push(option_string) + + if (option_string.startsWith('--')) { + option_string = '--no-' + option_string.slice(2) + _option_strings.push(option_string) + } + } + + if (help !== undefined && default_value !== undefined) { + help += ` (default: ${default_value})` + } + + super({ + option_strings: _option_strings, + dest, + nargs: 0, + default: default_value, + type, + choices, + required, + help, + metavar + }) + } + + call(parser, namespace, values, option_string = undefined) { + if (this.option_strings.includes(option_string)) { + setattr(namespace, this.dest, !option_string.startsWith('--no-')) + } + } + + format_usage() { + return this.option_strings.join(' | ') + } +})) + + +const _StoreAction = _callable(class _StoreAction extends Action { + + constructor() { + let [ + option_strings, + dest, + nargs, + const_value, + default_value, + type, + choices, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + nargs: undefined, + const: undefined, + default: undefined, + type: undefined, + choices: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + if (nargs === 0) { + throw new TypeError('nargs for store actions must be != 0; if you ' + + 'have nothing to store, actions such as store ' + + 'true or store const may be more appropriate') + } + if (const_value !== undefined && nargs !== OPTIONAL) { + throw new TypeError(sub('nargs must be %r to supply const', OPTIONAL)) + } + super({ + option_strings, + dest, + nargs, + const: const_value, + default: default_value, + type, + choices, + required, + help, + metavar + }) + } + + call(parser, namespace, values/*, option_string = undefined*/) { + setattr(namespace, this.dest, values) + } +}) + + +const _StoreConstAction = _callable(class _StoreConstAction extends Action { + + constructor() { + let [ + option_strings, + dest, + const_value, + default_value, + required, + help + //, metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + const: no_default, + default: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + super({ + option_strings, + dest, + nargs: 0, + const: const_value, + default: default_value, + required, + help + }) + } + + call(parser, namespace/*, values, option_string = undefined*/) { + setattr(namespace, this.dest, this.const) + } +}) + + +const _StoreTrueAction = _callable(class _StoreTrueAction extends _StoreConstAction { + + constructor() { + let [ + option_strings, + dest, + default_value, + required, + help + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + default: false, + required: false, + help: undefined + }) + + super({ + option_strings, + dest, + const: true, + default: default_value, + required, + help + }) + } +}) + + +const _StoreFalseAction = _callable(class _StoreFalseAction extends _StoreConstAction { + + constructor() { + let [ + option_strings, + dest, + default_value, + required, + help + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + default: true, + required: false, + help: undefined + }) + + super({ + option_strings, + dest, + const: false, + default: default_value, + required, + help + }) + } +}) + + +const _AppendAction = _callable(class _AppendAction extends Action { + + constructor() { + let [ + option_strings, + dest, + nargs, + const_value, + default_value, + type, + choices, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + nargs: undefined, + const: undefined, + default: undefined, + type: undefined, + choices: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + if (nargs === 0) { + throw new TypeError('nargs for append actions must be != 0; if arg ' + + 'strings are not supplying the value to append, ' + + 'the append const action may be more appropriate') + } + if (const_value !== undefined && nargs !== OPTIONAL) { + throw new TypeError(sub('nargs must be %r to supply const', OPTIONAL)) + } + super({ + option_strings, + dest, + nargs, + const: const_value, + default: default_value, + type, + choices, + required, + help, + metavar + }) + } + + call(parser, namespace, values/*, option_string = undefined*/) { + let items = getattr(namespace, this.dest, undefined) + items = _copy_items(items) + items.push(values) + setattr(namespace, this.dest, items) + } +}) + + +const _AppendConstAction = _callable(class _AppendConstAction extends Action { + + constructor() { + let [ + option_strings, + dest, + const_value, + default_value, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + const: no_default, + default: undefined, + required: false, + help: undefined, + metavar: undefined + }) + + super({ + option_strings, + dest, + nargs: 0, + const: const_value, + default: default_value, + required, + help, + metavar + }) + } + + call(parser, namespace/*, values, option_string = undefined*/) { + let items = getattr(namespace, this.dest, undefined) + items = _copy_items(items) + items.push(this.const) + setattr(namespace, this.dest, items) + } +}) + + +const _CountAction = _callable(class _CountAction extends Action { + + constructor() { + let [ + option_strings, + dest, + default_value, + required, + help + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: no_default, + default: undefined, + required: false, + help: undefined + }) + + super({ + option_strings, + dest, + nargs: 0, + default: default_value, + required, + help + }) + } + + call(parser, namespace/*, values, option_string = undefined*/) { + let count = getattr(namespace, this.dest, undefined) + if (count === undefined) { + count = 0 + } + setattr(namespace, this.dest, count + 1) + } +}) + + +const _HelpAction = _callable(class _HelpAction extends Action { + + constructor() { + let [ + option_strings, + dest, + default_value, + help + ] = _parse_opts(arguments, { + option_strings: no_default, + dest: SUPPRESS, + default: SUPPRESS, + help: undefined + }) + + super({ + option_strings, + dest, + default: default_value, + nargs: 0, + help + }) + } + + call(parser/*, namespace, values, option_string = undefined*/) { + parser.print_help() + parser.exit() + } +}) + + +const _VersionAction = _callable(class _VersionAction extends Action { + + constructor() { + let [ + option_strings, + version, + dest, + default_value, + help + ] = _parse_opts(arguments, { + option_strings: no_default, + version: undefined, + dest: SUPPRESS, + default: SUPPRESS, + help: "show program's version number and exit" + }) + + super({ + option_strings, + dest, + default: default_value, + nargs: 0, + help + }) + this.version = version + } + + call(parser/*, namespace, values, option_string = undefined*/) { + let version = this.version + if (version === undefined) { + version = parser.version + } + let formatter = parser._get_formatter() + formatter.add_text(version) + parser._print_message(formatter.format_help(), process.stdout) + parser.exit() + } +}) + + +const _SubParsersAction = _camelcase_alias(_callable(class _SubParsersAction extends Action { + + constructor() { + let [ + option_strings, + prog, + parser_class, + dest, + required, + help, + metavar + ] = _parse_opts(arguments, { + option_strings: no_default, + prog: no_default, + parser_class: no_default, + dest: SUPPRESS, + required: false, + help: undefined, + metavar: undefined + }) + + let name_parser_map = {} + + super({ + option_strings, + dest, + nargs: PARSER, + choices: name_parser_map, + required, + help, + metavar + }) + + this._prog_prefix = prog + this._parser_class = parser_class + this._name_parser_map = name_parser_map + this._choices_actions = [] + } + + add_parser() { + let [ + name, + kwargs + ] = _parse_opts(arguments, { + name: no_default, + '**kwargs': no_default + }) + + // set prog from the existing prefix + if (kwargs.prog === undefined) { + kwargs.prog = sub('%s %s', this._prog_prefix, name) + } + + let aliases = getattr(kwargs, 'aliases', []) + delete kwargs.aliases + + // create a pseudo-action to hold the choice help + if ('help' in kwargs) { + let help = kwargs.help + delete kwargs.help + let choice_action = this._ChoicesPseudoAction(name, aliases, help) + this._choices_actions.push(choice_action) + } + + // create the parser and add it to the map + let parser = new this._parser_class(kwargs) + this._name_parser_map[name] = parser + + // make parser available under aliases also + for (let alias of aliases) { + this._name_parser_map[alias] = parser + } + + return parser + } + + _get_subactions() { + return this._choices_actions + } + + call(parser, namespace, values/*, option_string = undefined*/) { + let parser_name = values[0] + let arg_strings = values.slice(1) + + // set the parser name if requested + if (this.dest !== SUPPRESS) { + setattr(namespace, this.dest, parser_name) + } + + // select the parser + if (hasattr(this._name_parser_map, parser_name)) { + parser = this._name_parser_map[parser_name] + } else { + let args = {parser_name, + choices: this._name_parser_map.join(', ')} + let msg = sub('unknown parser %(parser_name)r (choices: %(choices)s)', args) + throw new ArgumentError(this, msg) + } + + // parse all the remaining options into the namespace + // store any unrecognized options on the object, so that the top + // level parser can decide what to do with them + + // In case this subparser defines new defaults, we parse them + // in a new namespace object and then update the original + // namespace for the relevant parts. + let subnamespace + [ subnamespace, arg_strings ] = parser.parse_known_args(arg_strings, undefined) + for (let [ key, value ] of Object.entries(subnamespace)) { + setattr(namespace, key, value) + } + + if (arg_strings.length) { + setdefault(namespace, _UNRECOGNIZED_ARGS_ATTR, []) + getattr(namespace, _UNRECOGNIZED_ARGS_ATTR).push(...arg_strings) + } + } +})) + + +_SubParsersAction.prototype._ChoicesPseudoAction = _callable(class _ChoicesPseudoAction extends Action { + constructor(name, aliases, help) { + let metavar = name, dest = name + if (aliases.length) { + metavar += sub(' (%s)', aliases.join(', ')) + } + super({ option_strings: [], dest, help, metavar }) + } +}) + + +const _ExtendAction = _callable(class _ExtendAction extends _AppendAction { + call(parser, namespace, values/*, option_string = undefined*/) { + let items = getattr(namespace, this.dest, undefined) + items = _copy_items(items) + items = items.concat(values) + setattr(namespace, this.dest, items) + } +}) + + +// ============== +// Type classes +// ============== +const FileType = _callable(class FileType extends Function { + /* + * Factory for creating file object types + * + * Instances of FileType are typically passed as type= arguments to the + * ArgumentParser add_argument() method. + * + * Keyword Arguments: + * - mode -- A string indicating how the file is to be opened. Accepts the + * same values as the builtin open() function. + * - bufsize -- The file's desired buffer size. Accepts the same values as + * the builtin open() function. + * - encoding -- The file's encoding. Accepts the same values as the + * builtin open() function. + * - errors -- A string indicating how encoding and decoding errors are to + * be handled. Accepts the same value as the builtin open() function. + */ + + constructor() { + let [ + flags, + encoding, + mode, + autoClose, + emitClose, + start, + end, + highWaterMark, + fs + ] = _parse_opts(arguments, { + flags: 'r', + encoding: undefined, + mode: undefined, // 0o666 + autoClose: undefined, // true + emitClose: undefined, // false + start: undefined, // 0 + end: undefined, // Infinity + highWaterMark: undefined, // 64 * 1024 + fs: undefined + }) + + // when this class is called as a function, redirect it to .call() method of itself + super('return arguments.callee.call.apply(arguments.callee, arguments)') + + Object.defineProperty(this, 'name', { + get() { + return sub('FileType(%r)', flags) + } + }) + this._flags = flags + this._options = {} + if (encoding !== undefined) this._options.encoding = encoding + if (mode !== undefined) this._options.mode = mode + if (autoClose !== undefined) this._options.autoClose = autoClose + if (emitClose !== undefined) this._options.emitClose = emitClose + if (start !== undefined) this._options.start = start + if (end !== undefined) this._options.end = end + if (highWaterMark !== undefined) this._options.highWaterMark = highWaterMark + if (fs !== undefined) this._options.fs = fs + } + + call(string) { + // the special argument "-" means sys.std{in,out} + if (string === '-') { + if (this._flags.includes('r')) { + return process.stdin + } else if (this._flags.includes('w')) { + return process.stdout + } else { + let msg = sub('argument "-" with mode %r', this._flags) + throw new TypeError(msg) + } + } + + // all other arguments are used as file names + let fd + try { + fd = fs.openSync(string, this._flags, this._options.mode) + } catch (e) { + let args = { filename: string, error: e.message } + let message = "can't open '%(filename)s': %(error)s" + throw new ArgumentTypeError(sub(message, args)) + } + + let options = Object.assign({ fd, flags: this._flags }, this._options) + if (this._flags.includes('r')) { + return fs.createReadStream(undefined, options) + } else if (this._flags.includes('w')) { + return fs.createWriteStream(undefined, options) + } else { + let msg = sub('argument "%s" with mode %r', string, this._flags) + throw new TypeError(msg) + } + } + + [util.inspect.custom]() { + let args = [ this._flags ] + let kwargs = Object.entries(this._options).map(([ k, v ]) => { + if (k === 'mode') v = { value: v, [util.inspect.custom]() { return '0o' + this.value.toString(8) } } + return [ k, v ] + }) + let args_str = [] + .concat(args.filter(arg => arg !== -1).map(repr)) + .concat(kwargs.filter(([/*kw*/, arg]) => arg !== undefined) + .map(([kw, arg]) => sub('%s=%r', kw, arg))) + .join(', ') + return sub('%s(%s)', this.constructor.name, args_str) + } + + toString() { + return this[util.inspect.custom]() + } +}) + +// =========================== +// Optional and Positional Parsing +// =========================== +const Namespace = _callable(class Namespace extends _AttributeHolder() { + /* + * Simple object for storing attributes. + * + * Implements equality by attribute names and values, and provides a simple + * string representation. + */ + + constructor(options = {}) { + super() + Object.assign(this, options) + } +}) + +// unset string tag to mimic plain object +Namespace.prototype[Symbol.toStringTag] = undefined + + +const _ActionsContainer = _camelcase_alias(_callable(class _ActionsContainer { + + constructor() { + let [ + description, + prefix_chars, + argument_default, + conflict_handler + ] = _parse_opts(arguments, { + description: no_default, + prefix_chars: no_default, + argument_default: no_default, + conflict_handler: no_default + }) + + this.description = description + this.argument_default = argument_default + this.prefix_chars = prefix_chars + this.conflict_handler = conflict_handler + + // set up registries + this._registries = {} + + // register actions + this.register('action', undefined, _StoreAction) + this.register('action', 'store', _StoreAction) + this.register('action', 'store_const', _StoreConstAction) + this.register('action', 'store_true', _StoreTrueAction) + this.register('action', 'store_false', _StoreFalseAction) + this.register('action', 'append', _AppendAction) + this.register('action', 'append_const', _AppendConstAction) + this.register('action', 'count', _CountAction) + this.register('action', 'help', _HelpAction) + this.register('action', 'version', _VersionAction) + this.register('action', 'parsers', _SubParsersAction) + this.register('action', 'extend', _ExtendAction) + // LEGACY (v1 compatibility): camelcase variants + ;[ 'storeConst', 'storeTrue', 'storeFalse', 'appendConst' ].forEach(old_name => { + let new_name = _to_new_name(old_name) + this.register('action', old_name, util.deprecate(this._registry_get('action', new_name), + sub('{action: "%s"} is renamed to {action: "%s"}', old_name, new_name))) + }) + // end + + // raise an exception if the conflict handler is invalid + this._get_handler() + + // action storage + this._actions = [] + this._option_string_actions = {} + + // groups + this._action_groups = [] + this._mutually_exclusive_groups = [] + + // defaults storage + this._defaults = {} + + // determines whether an "option" looks like a negative number + this._negative_number_matcher = /^-\d+$|^-\d*\.\d+$/ + + // whether or not there are any optionals that look like negative + // numbers -- uses a list so it can be shared and edited + this._has_negative_number_optionals = [] + } + + // ==================== + // Registration methods + // ==================== + register(registry_name, value, object) { + let registry = setdefault(this._registries, registry_name, {}) + registry[value] = object + } + + _registry_get(registry_name, value, default_value = undefined) { + return getattr(this._registries[registry_name], value, default_value) + } + + // ================================== + // Namespace default accessor methods + // ================================== + set_defaults(kwargs) { + Object.assign(this._defaults, kwargs) + + // if these defaults match any existing arguments, replace + // the previous default on the object with the new one + for (let action of this._actions) { + if (action.dest in kwargs) { + action.default = kwargs[action.dest] + } + } + } + + get_default(dest) { + for (let action of this._actions) { + if (action.dest === dest && action.default !== undefined) { + return action.default + } + } + return this._defaults[dest] + } + + + // ======================= + // Adding argument actions + // ======================= + add_argument() { + /* + * add_argument(dest, ..., name=value, ...) + * add_argument(option_string, option_string, ..., name=value, ...) + */ + let [ + args, + kwargs + ] = _parse_opts(arguments, { + '*args': no_default, + '**kwargs': no_default + }) + // LEGACY (v1 compatibility), old-style add_argument([ args ], { options }) + if (args.length === 1 && Array.isArray(args[0])) { + args = args[0] + deprecate('argument-array', + sub('use add_argument(%(args)s, {...}) instead of add_argument([ %(args)s ], { ... })', { + args: args.map(repr).join(', ') + })) + } + // end + + // if no positional args are supplied or only one is supplied and + // it doesn't look like an option string, parse a positional + // argument + let chars = this.prefix_chars + if (!args.length || args.length === 1 && !chars.includes(args[0][0])) { + if (args.length && 'dest' in kwargs) { + throw new TypeError('dest supplied twice for positional argument') + } + kwargs = this._get_positional_kwargs(...args, kwargs) + + // otherwise, we're adding an optional argument + } else { + kwargs = this._get_optional_kwargs(...args, kwargs) + } + + // if no default was supplied, use the parser-level default + if (!('default' in kwargs)) { + let dest = kwargs.dest + if (dest in this._defaults) { + kwargs.default = this._defaults[dest] + } else if (this.argument_default !== undefined) { + kwargs.default = this.argument_default + } + } + + // create the action object, and add it to the parser + let action_class = this._pop_action_class(kwargs) + if (typeof action_class !== 'function') { + throw new TypeError(sub('unknown action "%s"', action_class)) + } + // eslint-disable-next-line new-cap + let action = new action_class(kwargs) + + // raise an error if the action type is not callable + let type_func = this._registry_get('type', action.type, action.type) + if (typeof type_func !== 'function') { + throw new TypeError(sub('%r is not callable', type_func)) + } + + if (type_func === FileType) { + throw new TypeError(sub('%r is a FileType class object, instance of it' + + ' must be passed', type_func)) + } + + // raise an error if the metavar does not match the type + if ('_get_formatter' in this) { + try { + this._get_formatter()._format_args(action, undefined) + } catch (err) { + // check for 'invalid nargs value' is an artifact of TypeError and ValueError in js being the same + if (err instanceof TypeError && err.message !== 'invalid nargs value') { + throw new TypeError('length of metavar tuple does not match nargs') + } else { + throw err + } + } + } + + return this._add_action(action) + } + + add_argument_group() { + let group = _ArgumentGroup(this, ...arguments) + this._action_groups.push(group) + return group + } + + add_mutually_exclusive_group() { + // eslint-disable-next-line no-use-before-define + let group = _MutuallyExclusiveGroup(this, ...arguments) + this._mutually_exclusive_groups.push(group) + return group + } + + _add_action(action) { + // resolve any conflicts + this._check_conflict(action) + + // add to actions list + this._actions.push(action) + action.container = this + + // index the action by any option strings it has + for (let option_string of action.option_strings) { + this._option_string_actions[option_string] = action + } + + // set the flag if any option strings look like negative numbers + for (let option_string of action.option_strings) { + if (this._negative_number_matcher.test(option_string)) { + if (!this._has_negative_number_optionals.length) { + this._has_negative_number_optionals.push(true) + } + } + } + + // return the created action + return action + } + + _remove_action(action) { + _array_remove(this._actions, action) + } + + _add_container_actions(container) { + // collect groups by titles + let title_group_map = {} + for (let group of this._action_groups) { + if (group.title in title_group_map) { + let msg = 'cannot merge actions - two groups are named %r' + throw new TypeError(sub(msg, group.title)) + } + title_group_map[group.title] = group + } + + // map each action to its group + let group_map = new Map() + for (let group of container._action_groups) { + + // if a group with the title exists, use that, otherwise + // create a new group matching the container's group + if (!(group.title in title_group_map)) { + title_group_map[group.title] = this.add_argument_group({ + title: group.title, + description: group.description, + conflict_handler: group.conflict_handler + }) + } + + // map the actions to their new group + for (let action of group._group_actions) { + group_map.set(action, title_group_map[group.title]) + } + } + + // add container's mutually exclusive groups + // NOTE: if add_mutually_exclusive_group ever gains title= and + // description= then this code will need to be expanded as above + for (let group of container._mutually_exclusive_groups) { + let mutex_group = this.add_mutually_exclusive_group({ + required: group.required + }) + + // map the actions to their new mutex group + for (let action of group._group_actions) { + group_map.set(action, mutex_group) + } + } + + // add all actions to this container or their group + for (let action of container._actions) { + group_map.get(action)._add_action(action) + } + } + + _get_positional_kwargs() { + let [ + dest, + kwargs + ] = _parse_opts(arguments, { + dest: no_default, + '**kwargs': no_default + }) + + // make sure required is not specified + if ('required' in kwargs) { + let msg = "'required' is an invalid argument for positionals" + throw new TypeError(msg) + } + + // mark positional arguments as required if at least one is + // always required + if (![OPTIONAL, ZERO_OR_MORE].includes(kwargs.nargs)) { + kwargs.required = true + } + if (kwargs.nargs === ZERO_OR_MORE && !('default' in kwargs)) { + kwargs.required = true + } + + // return the keyword arguments with no option strings + return Object.assign(kwargs, { dest, option_strings: [] }) + } + + _get_optional_kwargs() { + let [ + args, + kwargs + ] = _parse_opts(arguments, { + '*args': no_default, + '**kwargs': no_default + }) + + // determine short and long option strings + let option_strings = [] + let long_option_strings = [] + let option_string + for (option_string of args) { + // error on strings that don't start with an appropriate prefix + if (!this.prefix_chars.includes(option_string[0])) { + let args = {option: option_string, + prefix_chars: this.prefix_chars} + let msg = 'invalid option string %(option)r: ' + + 'must start with a character %(prefix_chars)r' + throw new TypeError(sub(msg, args)) + } + + // strings starting with two prefix characters are long options + option_strings.push(option_string) + if (option_string.length > 1 && this.prefix_chars.includes(option_string[1])) { + long_option_strings.push(option_string) + } + } + + // infer destination, '--foo-bar' -> 'foo_bar' and '-x' -> 'x' + let dest = kwargs.dest + delete kwargs.dest + if (dest === undefined) { + let dest_option_string + if (long_option_strings.length) { + dest_option_string = long_option_strings[0] + } else { + dest_option_string = option_strings[0] + } + dest = _string_lstrip(dest_option_string, this.prefix_chars) + if (!dest) { + let msg = 'dest= is required for options like %r' + throw new TypeError(sub(msg, option_string)) + } + dest = dest.replace(/-/g, '_') + } + + // return the updated keyword arguments + return Object.assign(kwargs, { dest, option_strings }) + } + + _pop_action_class(kwargs, default_value = undefined) { + let action = getattr(kwargs, 'action', default_value) + delete kwargs.action + return this._registry_get('action', action, action) + } + + _get_handler() { + // determine function from conflict handler string + let handler_func_name = sub('_handle_conflict_%s', this.conflict_handler) + if (typeof this[handler_func_name] === 'function') { + return this[handler_func_name] + } else { + let msg = 'invalid conflict_resolution value: %r' + throw new TypeError(sub(msg, this.conflict_handler)) + } + } + + _check_conflict(action) { + + // find all options that conflict with this option + let confl_optionals = [] + for (let option_string of action.option_strings) { + if (hasattr(this._option_string_actions, option_string)) { + let confl_optional = this._option_string_actions[option_string] + confl_optionals.push([ option_string, confl_optional ]) + } + } + + // resolve any conflicts + if (confl_optionals.length) { + let conflict_handler = this._get_handler() + conflict_handler.call(this, action, confl_optionals) + } + } + + _handle_conflict_error(action, conflicting_actions) { + let message = conflicting_actions.length === 1 ? + 'conflicting option string: %s' : + 'conflicting option strings: %s' + let conflict_string = conflicting_actions.map(([ option_string/*, action*/ ]) => option_string).join(', ') + throw new ArgumentError(action, sub(message, conflict_string)) + } + + _handle_conflict_resolve(action, conflicting_actions) { + + // remove all conflicting options + for (let [ option_string, action ] of conflicting_actions) { + + // remove the conflicting option + _array_remove(action.option_strings, option_string) + delete this._option_string_actions[option_string] + + // if the option now has no option string, remove it from the + // container holding it + if (!action.option_strings.length) { + action.container._remove_action(action) + } + } + } +})) + + +const _ArgumentGroup = _callable(class _ArgumentGroup extends _ActionsContainer { + + constructor() { + let [ + container, + title, + description, + kwargs + ] = _parse_opts(arguments, { + container: no_default, + title: undefined, + description: undefined, + '**kwargs': no_default + }) + + // add any missing keyword arguments by checking the container + setdefault(kwargs, 'conflict_handler', container.conflict_handler) + setdefault(kwargs, 'prefix_chars', container.prefix_chars) + setdefault(kwargs, 'argument_default', container.argument_default) + super(Object.assign({ description }, kwargs)) + + // group attributes + this.title = title + this._group_actions = [] + + // share most attributes with the container + this._registries = container._registries + this._actions = container._actions + this._option_string_actions = container._option_string_actions + this._defaults = container._defaults + this._has_negative_number_optionals = + container._has_negative_number_optionals + this._mutually_exclusive_groups = container._mutually_exclusive_groups + } + + _add_action(action) { + action = super._add_action(action) + this._group_actions.push(action) + return action + } + + _remove_action(action) { + super._remove_action(action) + _array_remove(this._group_actions, action) + } +}) + + +const _MutuallyExclusiveGroup = _callable(class _MutuallyExclusiveGroup extends _ArgumentGroup { + + constructor() { + let [ + container, + required + ] = _parse_opts(arguments, { + container: no_default, + required: false + }) + + super(container) + this.required = required + this._container = container + } + + _add_action(action) { + if (action.required) { + let msg = 'mutually exclusive arguments must be optional' + throw new TypeError(msg) + } + action = this._container._add_action(action) + this._group_actions.push(action) + return action + } + + _remove_action(action) { + this._container._remove_action(action) + _array_remove(this._group_actions, action) + } +}) + + +const ArgumentParser = _camelcase_alias(_callable(class ArgumentParser extends _AttributeHolder(_ActionsContainer) { + /* + * Object for parsing command line strings into Python objects. + * + * Keyword Arguments: + * - prog -- The name of the program (default: sys.argv[0]) + * - usage -- A usage message (default: auto-generated from arguments) + * - description -- A description of what the program does + * - epilog -- Text following the argument descriptions + * - parents -- Parsers whose arguments should be copied into this one + * - formatter_class -- HelpFormatter class for printing help messages + * - prefix_chars -- Characters that prefix optional arguments + * - fromfile_prefix_chars -- Characters that prefix files containing + * additional arguments + * - argument_default -- The default value for all arguments + * - conflict_handler -- String indicating how to handle conflicts + * - add_help -- Add a -h/-help option + * - allow_abbrev -- Allow long options to be abbreviated unambiguously + * - exit_on_error -- Determines whether or not ArgumentParser exits with + * error info when an error occurs + */ + + constructor() { + let [ + prog, + usage, + description, + epilog, + parents, + formatter_class, + prefix_chars, + fromfile_prefix_chars, + argument_default, + conflict_handler, + add_help, + allow_abbrev, + exit_on_error, + debug, // LEGACY (v1 compatibility), debug mode + version // LEGACY (v1 compatibility), version + ] = _parse_opts(arguments, { + prog: undefined, + usage: undefined, + description: undefined, + epilog: undefined, + parents: [], + formatter_class: HelpFormatter, + prefix_chars: '-', + fromfile_prefix_chars: undefined, + argument_default: undefined, + conflict_handler: 'error', + add_help: true, + allow_abbrev: true, + exit_on_error: true, + debug: undefined, // LEGACY (v1 compatibility), debug mode + version: undefined // LEGACY (v1 compatibility), version + }) + + // LEGACY (v1 compatibility) + if (debug !== undefined) { + deprecate('debug', + 'The "debug" argument to ArgumentParser is deprecated. Please ' + + 'override ArgumentParser.exit function instead.' + ) + } + + if (version !== undefined) { + deprecate('version', + 'The "version" argument to ArgumentParser is deprecated. Please use ' + + "add_argument(..., { action: 'version', version: 'N', ... }) instead." + ) + } + // end + + super({ + description, + prefix_chars, + argument_default, + conflict_handler + }) + + // default setting for prog + if (prog === undefined) { + prog = path.basename(get_argv()[0] || '') + } + + this.prog = prog + this.usage = usage + this.epilog = epilog + this.formatter_class = formatter_class + this.fromfile_prefix_chars = fromfile_prefix_chars + this.add_help = add_help + this.allow_abbrev = allow_abbrev + this.exit_on_error = exit_on_error + // LEGACY (v1 compatibility), debug mode + this.debug = debug + // end + + this._positionals = this.add_argument_group('positional arguments') + this._optionals = this.add_argument_group('optional arguments') + this._subparsers = undefined + + // register types + function identity(string) { + return string + } + this.register('type', undefined, identity) + this.register('type', null, identity) + this.register('type', 'auto', identity) + this.register('type', 'int', function (x) { + let result = Number(x) + if (!Number.isInteger(result)) { + throw new TypeError(sub('could not convert string to int: %r', x)) + } + return result + }) + this.register('type', 'float', function (x) { + let result = Number(x) + if (isNaN(result)) { + throw new TypeError(sub('could not convert string to float: %r', x)) + } + return result + }) + this.register('type', 'str', String) + // LEGACY (v1 compatibility): custom types + this.register('type', 'string', + util.deprecate(String, 'use {type:"str"} or {type:String} instead of {type:"string"}')) + // end + + // add help argument if necessary + // (using explicit default to override global argument_default) + let default_prefix = prefix_chars.includes('-') ? '-' : prefix_chars[0] + if (this.add_help) { + this.add_argument( + default_prefix + 'h', + default_prefix.repeat(2) + 'help', + { + action: 'help', + default: SUPPRESS, + help: 'show this help message and exit' + } + ) + } + // LEGACY (v1 compatibility), version + if (version) { + this.add_argument( + default_prefix + 'v', + default_prefix.repeat(2) + 'version', + { + action: 'version', + default: SUPPRESS, + version: this.version, + help: "show program's version number and exit" + } + ) + } + // end + + // add parent arguments and defaults + for (let parent of parents) { + this._add_container_actions(parent) + Object.assign(this._defaults, parent._defaults) + } + } + + // ======================= + // Pretty __repr__ methods + // ======================= + _get_kwargs() { + let names = [ + 'prog', + 'usage', + 'description', + 'formatter_class', + 'conflict_handler', + 'add_help' + ] + return names.map(name => [ name, getattr(this, name) ]) + } + + // ================================== + // Optional/Positional adding methods + // ================================== + add_subparsers() { + let [ + kwargs + ] = _parse_opts(arguments, { + '**kwargs': no_default + }) + + if (this._subparsers !== undefined) { + this.error('cannot have multiple subparser arguments') + } + + // add the parser class to the arguments if it's not present + setdefault(kwargs, 'parser_class', this.constructor) + + if ('title' in kwargs || 'description' in kwargs) { + let title = getattr(kwargs, 'title', 'subcommands') + let description = getattr(kwargs, 'description', undefined) + delete kwargs.title + delete kwargs.description + this._subparsers = this.add_argument_group(title, description) + } else { + this._subparsers = this._positionals + } + + // prog defaults to the usage message of this parser, skipping + // optional arguments and with no "usage:" prefix + if (kwargs.prog === undefined) { + let formatter = this._get_formatter() + let positionals = this._get_positional_actions() + let groups = this._mutually_exclusive_groups + formatter.add_usage(this.usage, positionals, groups, '') + kwargs.prog = formatter.format_help().trim() + } + + // create the parsers action and add it to the positionals list + let parsers_class = this._pop_action_class(kwargs, 'parsers') + // eslint-disable-next-line new-cap + let action = new parsers_class(Object.assign({ option_strings: [] }, kwargs)) + this._subparsers._add_action(action) + + // return the created parsers action + return action + } + + _add_action(action) { + if (action.option_strings.length) { + this._optionals._add_action(action) + } else { + this._positionals._add_action(action) + } + return action + } + + _get_optional_actions() { + return this._actions.filter(action => action.option_strings.length) + } + + _get_positional_actions() { + return this._actions.filter(action => !action.option_strings.length) + } + + // ===================================== + // Command line argument parsing methods + // ===================================== + parse_args(args = undefined, namespace = undefined) { + let argv + [ args, argv ] = this.parse_known_args(args, namespace) + if (argv && argv.length > 0) { + let msg = 'unrecognized arguments: %s' + this.error(sub(msg, argv.join(' '))) + } + return args + } + + parse_known_args(args = undefined, namespace = undefined) { + if (args === undefined) { + args = get_argv().slice(1) + } + + // default Namespace built from parser defaults + if (namespace === undefined) { + namespace = new Namespace() + } + + // add any action defaults that aren't present + for (let action of this._actions) { + if (action.dest !== SUPPRESS) { + if (!hasattr(namespace, action.dest)) { + if (action.default !== SUPPRESS) { + setattr(namespace, action.dest, action.default) + } + } + } + } + + // add any parser defaults that aren't present + for (let dest of Object.keys(this._defaults)) { + if (!hasattr(namespace, dest)) { + setattr(namespace, dest, this._defaults[dest]) + } + } + + // parse the arguments and exit if there are any errors + if (this.exit_on_error) { + try { + [ namespace, args ] = this._parse_known_args(args, namespace) + } catch (err) { + if (err instanceof ArgumentError) { + this.error(err.message) + } else { + throw err + } + } + } else { + [ namespace, args ] = this._parse_known_args(args, namespace) + } + + if (hasattr(namespace, _UNRECOGNIZED_ARGS_ATTR)) { + args = args.concat(getattr(namespace, _UNRECOGNIZED_ARGS_ATTR)) + delattr(namespace, _UNRECOGNIZED_ARGS_ATTR) + } + + return [ namespace, args ] + } + + _parse_known_args(arg_strings, namespace) { + // replace arg strings that are file references + if (this.fromfile_prefix_chars !== undefined) { + arg_strings = this._read_args_from_files(arg_strings) + } + + // map all mutually exclusive arguments to the other arguments + // they can't occur with + let action_conflicts = new Map() + for (let mutex_group of this._mutually_exclusive_groups) { + let group_actions = mutex_group._group_actions + for (let [ i, mutex_action ] of Object.entries(mutex_group._group_actions)) { + let conflicts = action_conflicts.get(mutex_action) || [] + conflicts = conflicts.concat(group_actions.slice(0, +i)) + conflicts = conflicts.concat(group_actions.slice(+i + 1)) + action_conflicts.set(mutex_action, conflicts) + } + } + + // find all option indices, and determine the arg_string_pattern + // which has an 'O' if there is an option at an index, + // an 'A' if there is an argument, or a '-' if there is a '--' + let option_string_indices = {} + let arg_string_pattern_parts = [] + let arg_strings_iter = Object.entries(arg_strings)[Symbol.iterator]() + for (let [ i, arg_string ] of arg_strings_iter) { + + // all args after -- are non-options + if (arg_string === '--') { + arg_string_pattern_parts.push('-') + for ([ i, arg_string ] of arg_strings_iter) { + arg_string_pattern_parts.push('A') + } + + // otherwise, add the arg to the arg strings + // and note the index if it was an option + } else { + let option_tuple = this._parse_optional(arg_string) + let pattern + if (option_tuple === undefined) { + pattern = 'A' + } else { + option_string_indices[i] = option_tuple + pattern = 'O' + } + arg_string_pattern_parts.push(pattern) + } + } + + // join the pieces together to form the pattern + let arg_strings_pattern = arg_string_pattern_parts.join('') + + // converts arg strings to the appropriate and then takes the action + let seen_actions = new Set() + let seen_non_default_actions = new Set() + let extras + + let take_action = (action, argument_strings, option_string = undefined) => { + seen_actions.add(action) + let argument_values = this._get_values(action, argument_strings) + + // error if this argument is not allowed with other previously + // seen arguments, assuming that actions that use the default + // value don't really count as "present" + if (argument_values !== action.default) { + seen_non_default_actions.add(action) + for (let conflict_action of action_conflicts.get(action) || []) { + if (seen_non_default_actions.has(conflict_action)) { + let msg = 'not allowed with argument %s' + let action_name = _get_action_name(conflict_action) + throw new ArgumentError(action, sub(msg, action_name)) + } + } + } + + // take the action if we didn't receive a SUPPRESS value + // (e.g. from a default) + if (argument_values !== SUPPRESS) { + action(this, namespace, argument_values, option_string) + } + } + + // function to convert arg_strings into an optional action + let consume_optional = start_index => { + + // get the optional identified at this index + let option_tuple = option_string_indices[start_index] + let [ action, option_string, explicit_arg ] = option_tuple + + // identify additional optionals in the same arg string + // (e.g. -xyz is the same as -x -y -z if no args are required) + let action_tuples = [] + let stop + for (;;) { + + // if we found no optional action, skip it + if (action === undefined) { + extras.push(arg_strings[start_index]) + return start_index + 1 + } + + // if there is an explicit argument, try to match the + // optional's string arguments to only this + if (explicit_arg !== undefined) { + let arg_count = this._match_argument(action, 'A') + + // if the action is a single-dash option and takes no + // arguments, try to parse more single-dash options out + // of the tail of the option string + let chars = this.prefix_chars + if (arg_count === 0 && !chars.includes(option_string[1])) { + action_tuples.push([ action, [], option_string ]) + let char = option_string[0] + option_string = char + explicit_arg[0] + let new_explicit_arg = explicit_arg.slice(1) || undefined + let optionals_map = this._option_string_actions + if (hasattr(optionals_map, option_string)) { + action = optionals_map[option_string] + explicit_arg = new_explicit_arg + } else { + let msg = 'ignored explicit argument %r' + throw new ArgumentError(action, sub(msg, explicit_arg)) + } + + // if the action expect exactly one argument, we've + // successfully matched the option; exit the loop + } else if (arg_count === 1) { + stop = start_index + 1 + let args = [ explicit_arg ] + action_tuples.push([ action, args, option_string ]) + break + + // error if a double-dash option did not use the + // explicit argument + } else { + let msg = 'ignored explicit argument %r' + throw new ArgumentError(action, sub(msg, explicit_arg)) + } + + // if there is no explicit argument, try to match the + // optional's string arguments with the following strings + // if successful, exit the loop + } else { + let start = start_index + 1 + let selected_patterns = arg_strings_pattern.slice(start) + let arg_count = this._match_argument(action, selected_patterns) + stop = start + arg_count + let args = arg_strings.slice(start, stop) + action_tuples.push([ action, args, option_string ]) + break + } + } + + // add the Optional to the list and return the index at which + // the Optional's string args stopped + assert(action_tuples.length) + for (let [ action, args, option_string ] of action_tuples) { + take_action(action, args, option_string) + } + return stop + } + + // the list of Positionals left to be parsed; this is modified + // by consume_positionals() + let positionals = this._get_positional_actions() + + // function to convert arg_strings into positional actions + let consume_positionals = start_index => { + // match as many Positionals as possible + let selected_pattern = arg_strings_pattern.slice(start_index) + let arg_counts = this._match_arguments_partial(positionals, selected_pattern) + + // slice off the appropriate arg strings for each Positional + // and add the Positional and its args to the list + for (let i = 0; i < positionals.length && i < arg_counts.length; i++) { + let action = positionals[i] + let arg_count = arg_counts[i] + let args = arg_strings.slice(start_index, start_index + arg_count) + start_index += arg_count + take_action(action, args) + } + + // slice off the Positionals that we just parsed and return the + // index at which the Positionals' string args stopped + positionals = positionals.slice(arg_counts.length) + return start_index + } + + // consume Positionals and Optionals alternately, until we have + // passed the last option string + extras = [] + let start_index = 0 + let max_option_string_index = Math.max(-1, ...Object.keys(option_string_indices).map(Number)) + while (start_index <= max_option_string_index) { + + // consume any Positionals preceding the next option + let next_option_string_index = Math.min( + // eslint-disable-next-line no-loop-func + ...Object.keys(option_string_indices).map(Number).filter(index => index >= start_index) + ) + if (start_index !== next_option_string_index) { + let positionals_end_index = consume_positionals(start_index) + + // only try to parse the next optional if we didn't consume + // the option string during the positionals parsing + if (positionals_end_index > start_index) { + start_index = positionals_end_index + continue + } else { + start_index = positionals_end_index + } + } + + // if we consumed all the positionals we could and we're not + // at the index of an option string, there were extra arguments + if (!(start_index in option_string_indices)) { + let strings = arg_strings.slice(start_index, next_option_string_index) + extras = extras.concat(strings) + start_index = next_option_string_index + } + + // consume the next optional and any arguments for it + start_index = consume_optional(start_index) + } + + // consume any positionals following the last Optional + let stop_index = consume_positionals(start_index) + + // if we didn't consume all the argument strings, there were extras + extras = extras.concat(arg_strings.slice(stop_index)) + + // make sure all required actions were present and also convert + // action defaults which were not given as arguments + let required_actions = [] + for (let action of this._actions) { + if (!seen_actions.has(action)) { + if (action.required) { + required_actions.push(_get_action_name(action)) + } else { + // Convert action default now instead of doing it before + // parsing arguments to avoid calling convert functions + // twice (which may fail) if the argument was given, but + // only if it was defined already in the namespace + if (action.default !== undefined && + typeof action.default === 'string' && + hasattr(namespace, action.dest) && + action.default === getattr(namespace, action.dest)) { + setattr(namespace, action.dest, + this._get_value(action, action.default)) + } + } + } + } + + if (required_actions.length) { + this.error(sub('the following arguments are required: %s', + required_actions.join(', '))) + } + + // make sure all required groups had one option present + for (let group of this._mutually_exclusive_groups) { + if (group.required) { + let no_actions_used = true + for (let action of group._group_actions) { + if (seen_non_default_actions.has(action)) { + no_actions_used = false + break + } + } + + // if no actions were used, report the error + if (no_actions_used) { + let names = group._group_actions + .filter(action => action.help !== SUPPRESS) + .map(action => _get_action_name(action)) + let msg = 'one of the arguments %s is required' + this.error(sub(msg, names.join(' '))) + } + } + } + + // return the updated namespace and the extra arguments + return [ namespace, extras ] + } + + _read_args_from_files(arg_strings) { + // expand arguments referencing files + let new_arg_strings = [] + for (let arg_string of arg_strings) { + + // for regular arguments, just add them back into the list + if (!arg_string || !this.fromfile_prefix_chars.includes(arg_string[0])) { + new_arg_strings.push(arg_string) + + // replace arguments referencing files with the file content + } else { + try { + let args_file = fs.readFileSync(arg_string.slice(1), 'utf8') + let arg_strings = [] + for (let arg_line of splitlines(args_file)) { + for (let arg of this.convert_arg_line_to_args(arg_line)) { + arg_strings.push(arg) + } + } + arg_strings = this._read_args_from_files(arg_strings) + new_arg_strings = new_arg_strings.concat(arg_strings) + } catch (err) { + this.error(err.message) + } + } + } + + // return the modified argument list + return new_arg_strings + } + + convert_arg_line_to_args(arg_line) { + return [arg_line] + } + + _match_argument(action, arg_strings_pattern) { + // match the pattern for this action to the arg strings + let nargs_pattern = this._get_nargs_pattern(action) + let match = arg_strings_pattern.match(new RegExp('^' + nargs_pattern)) + + // raise an exception if we weren't able to find a match + if (match === null) { + let nargs_errors = { + undefined: 'expected one argument', + [OPTIONAL]: 'expected at most one argument', + [ONE_OR_MORE]: 'expected at least one argument' + } + let msg = nargs_errors[action.nargs] + if (msg === undefined) { + msg = sub(action.nargs === 1 ? 'expected %s argument' : 'expected %s arguments', action.nargs) + } + throw new ArgumentError(action, msg) + } + + // return the number of arguments matched + return match[1].length + } + + _match_arguments_partial(actions, arg_strings_pattern) { + // progressively shorten the actions list by slicing off the + // final actions until we find a match + let result = [] + for (let i of range(actions.length, 0, -1)) { + let actions_slice = actions.slice(0, i) + let pattern = actions_slice.map(action => this._get_nargs_pattern(action)).join('') + let match = arg_strings_pattern.match(new RegExp('^' + pattern)) + if (match !== null) { + result = result.concat(match.slice(1).map(string => string.length)) + break + } + } + + // return the list of arg string counts + return result + } + + _parse_optional(arg_string) { + // if it's an empty string, it was meant to be a positional + if (!arg_string) { + return undefined + } + + // if it doesn't start with a prefix, it was meant to be positional + if (!this.prefix_chars.includes(arg_string[0])) { + return undefined + } + + // if the option string is present in the parser, return the action + if (arg_string in this._option_string_actions) { + let action = this._option_string_actions[arg_string] + return [ action, arg_string, undefined ] + } + + // if it's just a single character, it was meant to be positional + if (arg_string.length === 1) { + return undefined + } + + // if the option string before the "=" is present, return the action + if (arg_string.includes('=')) { + let [ option_string, explicit_arg ] = _string_split(arg_string, '=', 1) + if (option_string in this._option_string_actions) { + let action = this._option_string_actions[option_string] + return [ action, option_string, explicit_arg ] + } + } + + // search through all possible prefixes of the option string + // and all actions in the parser for possible interpretations + let option_tuples = this._get_option_tuples(arg_string) + + // if multiple actions match, the option string was ambiguous + if (option_tuples.length > 1) { + let options = option_tuples.map(([ /*action*/, option_string/*, explicit_arg*/ ]) => option_string).join(', ') + let args = {option: arg_string, matches: options} + let msg = 'ambiguous option: %(option)s could match %(matches)s' + this.error(sub(msg, args)) + + // if exactly one action matched, this segmentation is good, + // so return the parsed action + } else if (option_tuples.length === 1) { + let [ option_tuple ] = option_tuples + return option_tuple + } + + // if it was not found as an option, but it looks like a negative + // number, it was meant to be positional + // unless there are negative-number-like options + if (this._negative_number_matcher.test(arg_string)) { + if (!this._has_negative_number_optionals.length) { + return undefined + } + } + + // if it contains a space, it was meant to be a positional + if (arg_string.includes(' ')) { + return undefined + } + + // it was meant to be an optional but there is no such option + // in this parser (though it might be a valid option in a subparser) + return [ undefined, arg_string, undefined ] + } + + _get_option_tuples(option_string) { + let result = [] + + // option strings starting with two prefix characters are only + // split at the '=' + let chars = this.prefix_chars + if (chars.includes(option_string[0]) && chars.includes(option_string[1])) { + if (this.allow_abbrev) { + let option_prefix, explicit_arg + if (option_string.includes('=')) { + [ option_prefix, explicit_arg ] = _string_split(option_string, '=', 1) + } else { + option_prefix = option_string + explicit_arg = undefined + } + for (let option_string of Object.keys(this._option_string_actions)) { + if (option_string.startsWith(option_prefix)) { + let action = this._option_string_actions[option_string] + let tup = [ action, option_string, explicit_arg ] + result.push(tup) + } + } + } + + // single character options can be concatenated with their arguments + // but multiple character options always have to have their argument + // separate + } else if (chars.includes(option_string[0]) && !chars.includes(option_string[1])) { + let option_prefix = option_string + let explicit_arg = undefined + let short_option_prefix = option_string.slice(0, 2) + let short_explicit_arg = option_string.slice(2) + + for (let option_string of Object.keys(this._option_string_actions)) { + if (option_string === short_option_prefix) { + let action = this._option_string_actions[option_string] + let tup = [ action, option_string, short_explicit_arg ] + result.push(tup) + } else if (option_string.startsWith(option_prefix)) { + let action = this._option_string_actions[option_string] + let tup = [ action, option_string, explicit_arg ] + result.push(tup) + } + } + + // shouldn't ever get here + } else { + this.error(sub('unexpected option string: %s', option_string)) + } + + // return the collected option tuples + return result + } + + _get_nargs_pattern(action) { + // in all examples below, we have to allow for '--' args + // which are represented as '-' in the pattern + let nargs = action.nargs + let nargs_pattern + + // the default (None) is assumed to be a single argument + if (nargs === undefined) { + nargs_pattern = '(-*A-*)' + + // allow zero or one arguments + } else if (nargs === OPTIONAL) { + nargs_pattern = '(-*A?-*)' + + // allow zero or more arguments + } else if (nargs === ZERO_OR_MORE) { + nargs_pattern = '(-*[A-]*)' + + // allow one or more arguments + } else if (nargs === ONE_OR_MORE) { + nargs_pattern = '(-*A[A-]*)' + + // allow any number of options or arguments + } else if (nargs === REMAINDER) { + nargs_pattern = '([-AO]*)' + + // allow one argument followed by any number of options or arguments + } else if (nargs === PARSER) { + nargs_pattern = '(-*A[-AO]*)' + + // suppress action, like nargs=0 + } else if (nargs === SUPPRESS) { + nargs_pattern = '(-*-*)' + + // all others should be integers + } else { + nargs_pattern = sub('(-*%s-*)', 'A'.repeat(nargs).split('').join('-*')) + } + + // if this is an optional action, -- is not allowed + if (action.option_strings.length) { + nargs_pattern = nargs_pattern.replace(/-\*/g, '') + nargs_pattern = nargs_pattern.replace(/-/g, '') + } + + // return the pattern + return nargs_pattern + } + + // ======================== + // Alt command line argument parsing, allowing free intermix + // ======================== + + parse_intermixed_args(args = undefined, namespace = undefined) { + let argv + [ args, argv ] = this.parse_known_intermixed_args(args, namespace) + if (argv.length) { + let msg = 'unrecognized arguments: %s' + this.error(sub(msg, argv.join(' '))) + } + return args + } + + parse_known_intermixed_args(args = undefined, namespace = undefined) { + // returns a namespace and list of extras + // + // positional can be freely intermixed with optionals. optionals are + // first parsed with all positional arguments deactivated. The 'extras' + // are then parsed. If the parser definition is incompatible with the + // intermixed assumptions (e.g. use of REMAINDER, subparsers) a + // TypeError is raised. + // + // positionals are 'deactivated' by setting nargs and default to + // SUPPRESS. This blocks the addition of that positional to the + // namespace + + let extras + let positionals = this._get_positional_actions() + let a = positionals.filter(action => [ PARSER, REMAINDER ].includes(action.nargs)) + if (a.length) { + throw new TypeError(sub('parse_intermixed_args: positional arg' + + ' with nargs=%s', a[0].nargs)) + } + + for (let group of this._mutually_exclusive_groups) { + for (let action of group._group_actions) { + if (positionals.includes(action)) { + throw new TypeError('parse_intermixed_args: positional in' + + ' mutuallyExclusiveGroup') + } + } + } + + let save_usage + try { + save_usage = this.usage + let remaining_args + try { + if (this.usage === undefined) { + // capture the full usage for use in error messages + this.usage = this.format_usage().slice(7) + } + for (let action of positionals) { + // deactivate positionals + action.save_nargs = action.nargs + // action.nargs = 0 + action.nargs = SUPPRESS + action.save_default = action.default + action.default = SUPPRESS + } + [ namespace, remaining_args ] = this.parse_known_args(args, + namespace) + for (let action of positionals) { + // remove the empty positional values from namespace + let attr = getattr(namespace, action.dest) + if (Array.isArray(attr) && attr.length === 0) { + // eslint-disable-next-line no-console + console.warn(sub('Do not expect %s in %s', action.dest, namespace)) + delattr(namespace, action.dest) + } + } + } finally { + // restore nargs and usage before exiting + for (let action of positionals) { + action.nargs = action.save_nargs + action.default = action.save_default + } + } + let optionals = this._get_optional_actions() + try { + // parse positionals. optionals aren't normally required, but + // they could be, so make sure they aren't. + for (let action of optionals) { + action.save_required = action.required + action.required = false + } + for (let group of this._mutually_exclusive_groups) { + group.save_required = group.required + group.required = false + } + [ namespace, extras ] = this.parse_known_args(remaining_args, + namespace) + } finally { + // restore parser values before exiting + for (let action of optionals) { + action.required = action.save_required + } + for (let group of this._mutually_exclusive_groups) { + group.required = group.save_required + } + } + } finally { + this.usage = save_usage + } + return [ namespace, extras ] + } + + // ======================== + // Value conversion methods + // ======================== + _get_values(action, arg_strings) { + // for everything but PARSER, REMAINDER args, strip out first '--' + if (![PARSER, REMAINDER].includes(action.nargs)) { + try { + _array_remove(arg_strings, '--') + } catch (err) {} + } + + let value + // optional argument produces a default when not present + if (!arg_strings.length && action.nargs === OPTIONAL) { + if (action.option_strings.length) { + value = action.const + } else { + value = action.default + } + if (typeof value === 'string') { + value = this._get_value(action, value) + this._check_value(action, value) + } + + // when nargs='*' on a positional, if there were no command-line + // args, use the default if it is anything other than None + } else if (!arg_strings.length && action.nargs === ZERO_OR_MORE && + !action.option_strings.length) { + if (action.default !== undefined) { + value = action.default + } else { + value = arg_strings + } + this._check_value(action, value) + + // single argument or optional argument produces a single value + } else if (arg_strings.length === 1 && [undefined, OPTIONAL].includes(action.nargs)) { + let arg_string = arg_strings[0] + value = this._get_value(action, arg_string) + this._check_value(action, value) + + // REMAINDER arguments convert all values, checking none + } else if (action.nargs === REMAINDER) { + value = arg_strings.map(v => this._get_value(action, v)) + + // PARSER arguments convert all values, but check only the first + } else if (action.nargs === PARSER) { + value = arg_strings.map(v => this._get_value(action, v)) + this._check_value(action, value[0]) + + // SUPPRESS argument does not put anything in the namespace + } else if (action.nargs === SUPPRESS) { + value = SUPPRESS + + // all other types of nargs produce a list + } else { + value = arg_strings.map(v => this._get_value(action, v)) + for (let v of value) { + this._check_value(action, v) + } + } + + // return the converted value + return value + } + + _get_value(action, arg_string) { + let type_func = this._registry_get('type', action.type, action.type) + if (typeof type_func !== 'function') { + let msg = '%r is not callable' + throw new ArgumentError(action, sub(msg, type_func)) + } + + // convert the value to the appropriate type + let result + try { + try { + result = type_func(arg_string) + } catch (err) { + // Dear TC39, why would you ever consider making es6 classes not callable? + // We had one universal interface, [[Call]], which worked for anything + // (with familiar this-instanceof guard for classes). Now we have two. + if (err instanceof TypeError && + /Class constructor .* cannot be invoked without 'new'/.test(err.message)) { + // eslint-disable-next-line new-cap + result = new type_func(arg_string) + } else { + throw err + } + } + + } catch (err) { + // ArgumentTypeErrors indicate errors + if (err instanceof ArgumentTypeError) { + //let name = getattr(action.type, 'name', repr(action.type)) + let msg = err.message + throw new ArgumentError(action, msg) + + // TypeErrors or ValueErrors also indicate errors + } else if (err instanceof TypeError) { + let name = getattr(action.type, 'name', repr(action.type)) + let args = {type: name, value: arg_string} + let msg = 'invalid %(type)s value: %(value)r' + throw new ArgumentError(action, sub(msg, args)) + } else { + throw err + } + } + + // return the converted value + return result + } + + _check_value(action, value) { + // converted value must be one of the choices (if specified) + if (action.choices !== undefined && !_choices_to_array(action.choices).includes(value)) { + let args = {value, + choices: _choices_to_array(action.choices).map(repr).join(', ')} + let msg = 'invalid choice: %(value)r (choose from %(choices)s)' + throw new ArgumentError(action, sub(msg, args)) + } + } + + // ======================= + // Help-formatting methods + // ======================= + format_usage() { + let formatter = this._get_formatter() + formatter.add_usage(this.usage, this._actions, + this._mutually_exclusive_groups) + return formatter.format_help() + } + + format_help() { + let formatter = this._get_formatter() + + // usage + formatter.add_usage(this.usage, this._actions, + this._mutually_exclusive_groups) + + // description + formatter.add_text(this.description) + + // positionals, optionals and user-defined groups + for (let action_group of this._action_groups) { + formatter.start_section(action_group.title) + formatter.add_text(action_group.description) + formatter.add_arguments(action_group._group_actions) + formatter.end_section() + } + + // epilog + formatter.add_text(this.epilog) + + // determine help from format above + return formatter.format_help() + } + + _get_formatter() { + // eslint-disable-next-line new-cap + return new this.formatter_class({ prog: this.prog }) + } + + // ===================== + // Help-printing methods + // ===================== + print_usage(file = undefined) { + if (file === undefined) file = process.stdout + this._print_message(this.format_usage(), file) + } + + print_help(file = undefined) { + if (file === undefined) file = process.stdout + this._print_message(this.format_help(), file) + } + + _print_message(message, file = undefined) { + if (message) { + if (file === undefined) file = process.stderr + file.write(message) + } + } + + // =============== + // Exiting methods + // =============== + exit(status = 0, message = undefined) { + if (message) { + this._print_message(message, process.stderr) + } + process.exit(status) + } + + error(message) { + /* + * error(message: string) + * + * Prints a usage message incorporating the message to stderr and + * exits. + * + * If you override this in a subclass, it should not return -- it + * should either exit or raise an exception. + */ + + // LEGACY (v1 compatibility), debug mode + if (this.debug === true) throw new Error(message) + // end + this.print_usage(process.stderr) + let args = {prog: this.prog, message: message} + this.exit(2, sub('%(prog)s: error: %(message)s\n', args)) + } +})) + + +module.exports = { + ArgumentParser, + ArgumentError, + ArgumentTypeError, + BooleanOptionalAction, + FileType, + HelpFormatter, + ArgumentDefaultsHelpFormatter, + RawDescriptionHelpFormatter, + RawTextHelpFormatter, + MetavarTypeHelpFormatter, + Namespace, + Action, + ONE_OR_MORE, + OPTIONAL, + PARSER, + REMAINDER, + SUPPRESS, + ZERO_OR_MORE +} + +// LEGACY (v1 compatibility), Const alias +Object.defineProperty(module.exports, 'Const', { + get() { + let result = {} + Object.entries({ ONE_OR_MORE, OPTIONAL, PARSER, REMAINDER, SUPPRESS, ZERO_OR_MORE }).forEach(([ n, v ]) => { + Object.defineProperty(result, n, { + get() { + deprecate(n, sub('use argparse.%s instead of argparse.Const.%s', n, n)) + return v + } + }) + }) + Object.entries({ _UNRECOGNIZED_ARGS_ATTR }).forEach(([ n, v ]) => { + Object.defineProperty(result, n, { + get() { + deprecate(n, sub('argparse.Const.%s is an internal symbol and will no longer be available', n)) + return v + } + }) + }) + return result + }, + enumerable: false +}) +// end diff --git a/node_modules/argparse/lib/sub.js b/node_modules/argparse/lib/sub.js new file mode 100644 index 0000000..e3eb321 --- /dev/null +++ b/node_modules/argparse/lib/sub.js @@ -0,0 +1,67 @@ +// Limited implementation of python % string operator, supports only %s and %r for now +// (other formats are not used here, but may appear in custom templates) + +'use strict' + +const { inspect } = require('util') + + +module.exports = function sub(pattern, ...values) { + let regex = /%(?:(%)|(-)?(\*)?(?:\((\w+)\))?([A-Za-z]))/g + + let result = pattern.replace(regex, function (_, is_literal, is_left_align, is_padded, name, format) { + if (is_literal) return '%' + + let padded_count = 0 + if (is_padded) { + if (values.length === 0) throw new TypeError('not enough arguments for format string') + padded_count = values.shift() + if (!Number.isInteger(padded_count)) throw new TypeError('* wants int') + } + + let str + if (name !== undefined) { + let dict = values[0] + if (typeof dict !== 'object' || dict === null) throw new TypeError('format requires a mapping') + if (!(name in dict)) throw new TypeError(`no such key: '${name}'`) + str = dict[name] + } else { + if (values.length === 0) throw new TypeError('not enough arguments for format string') + str = values.shift() + } + + switch (format) { + case 's': + str = String(str) + break + case 'r': + str = inspect(str) + break + case 'd': + case 'i': + if (typeof str !== 'number') { + throw new TypeError(`%${format} format: a number is required, not ${typeof str}`) + } + str = String(str.toFixed(0)) + break + default: + throw new TypeError(`unsupported format character '${format}'`) + } + + if (padded_count > 0) { + return is_left_align ? str.padEnd(padded_count) : str.padStart(padded_count) + } else { + return str + } + }) + + if (values.length) { + if (values.length === 1 && typeof values[0] === 'object' && values[0] !== null) { + // mapping + } else { + throw new TypeError('not all arguments converted during string formatting') + } + } + + return result +} diff --git a/node_modules/argparse/lib/textwrap.js b/node_modules/argparse/lib/textwrap.js new file mode 100644 index 0000000..23d51cd --- /dev/null +++ b/node_modules/argparse/lib/textwrap.js @@ -0,0 +1,440 @@ +// Partial port of python's argparse module, version 3.9.0 (only wrap and fill functions): +// https://github.com/python/cpython/blob/v3.9.0b4/Lib/textwrap.py + +'use strict' + +/* + * Text wrapping and filling. + */ + +// Copyright (C) 1999-2001 Gregory P. Ward. +// Copyright (C) 2002, 2003 Python Software Foundation. +// Copyright (C) 2020 argparse.js authors +// Originally written by Greg Ward <gward@python.net> + +// Hardcode the recognized whitespace characters to the US-ASCII +// whitespace characters. The main reason for doing this is that +// some Unicode spaces (like \u00a0) are non-breaking whitespaces. +// +// This less funky little regex just split on recognized spaces. E.g. +// "Hello there -- you goof-ball, use the -b option!" +// splits into +// Hello/ /there/ /--/ /you/ /goof-ball,/ /use/ /the/ /-b/ /option!/ +const wordsep_simple_re = /([\t\n\x0b\x0c\r ]+)/ + +class TextWrapper { + /* + * Object for wrapping/filling text. The public interface consists of + * the wrap() and fill() methods; the other methods are just there for + * subclasses to override in order to tweak the default behaviour. + * If you want to completely replace the main wrapping algorithm, + * you'll probably have to override _wrap_chunks(). + * + * Several instance attributes control various aspects of wrapping: + * width (default: 70) + * the maximum width of wrapped lines (unless break_long_words + * is false) + * initial_indent (default: "") + * string that will be prepended to the first line of wrapped + * output. Counts towards the line's width. + * subsequent_indent (default: "") + * string that will be prepended to all lines save the first + * of wrapped output; also counts towards each line's width. + * expand_tabs (default: true) + * Expand tabs in input text to spaces before further processing. + * Each tab will become 0 .. 'tabsize' spaces, depending on its position + * in its line. If false, each tab is treated as a single character. + * tabsize (default: 8) + * Expand tabs in input text to 0 .. 'tabsize' spaces, unless + * 'expand_tabs' is false. + * replace_whitespace (default: true) + * Replace all whitespace characters in the input text by spaces + * after tab expansion. Note that if expand_tabs is false and + * replace_whitespace is true, every tab will be converted to a + * single space! + * fix_sentence_endings (default: false) + * Ensure that sentence-ending punctuation is always followed + * by two spaces. Off by default because the algorithm is + * (unavoidably) imperfect. + * break_long_words (default: true) + * Break words longer than 'width'. If false, those words will not + * be broken, and some lines might be longer than 'width'. + * break_on_hyphens (default: true) + * Allow breaking hyphenated words. If true, wrapping will occur + * preferably on whitespaces and right after hyphens part of + * compound words. + * drop_whitespace (default: true) + * Drop leading and trailing whitespace from lines. + * max_lines (default: None) + * Truncate wrapped lines. + * placeholder (default: ' [...]') + * Append to the last line of truncated text. + */ + + constructor(options = {}) { + let { + width = 70, + initial_indent = '', + subsequent_indent = '', + expand_tabs = true, + replace_whitespace = true, + fix_sentence_endings = false, + break_long_words = true, + drop_whitespace = true, + break_on_hyphens = true, + tabsize = 8, + max_lines = undefined, + placeholder=' [...]' + } = options + + this.width = width + this.initial_indent = initial_indent + this.subsequent_indent = subsequent_indent + this.expand_tabs = expand_tabs + this.replace_whitespace = replace_whitespace + this.fix_sentence_endings = fix_sentence_endings + this.break_long_words = break_long_words + this.drop_whitespace = drop_whitespace + this.break_on_hyphens = break_on_hyphens + this.tabsize = tabsize + this.max_lines = max_lines + this.placeholder = placeholder + } + + + // -- Private methods ----------------------------------------------- + // (possibly useful for subclasses to override) + + _munge_whitespace(text) { + /* + * _munge_whitespace(text : string) -> string + * + * Munge whitespace in text: expand tabs and convert all other + * whitespace characters to spaces. Eg. " foo\\tbar\\n\\nbaz" + * becomes " foo bar baz". + */ + if (this.expand_tabs) { + text = text.replace(/\t/g, ' '.repeat(this.tabsize)) // not strictly correct in js + } + if (this.replace_whitespace) { + text = text.replace(/[\t\n\x0b\x0c\r]/g, ' ') + } + return text + } + + _split(text) { + /* + * _split(text : string) -> [string] + * + * Split the text to wrap into indivisible chunks. Chunks are + * not quite the same as words; see _wrap_chunks() for full + * details. As an example, the text + * Look, goof-ball -- use the -b option! + * breaks into the following chunks: + * 'Look,', ' ', 'goof-', 'ball', ' ', '--', ' ', + * 'use', ' ', 'the', ' ', '-b', ' ', 'option!' + * if break_on_hyphens is True, or in: + * 'Look,', ' ', 'goof-ball', ' ', '--', ' ', + * 'use', ' ', 'the', ' ', '-b', ' ', option!' + * otherwise. + */ + let chunks = text.split(wordsep_simple_re) + chunks = chunks.filter(Boolean) + return chunks + } + + _handle_long_word(reversed_chunks, cur_line, cur_len, width) { + /* + * _handle_long_word(chunks : [string], + * cur_line : [string], + * cur_len : int, width : int) + * + * Handle a chunk of text (most likely a word, not whitespace) that + * is too long to fit in any line. + */ + // Figure out when indent is larger than the specified width, and make + // sure at least one character is stripped off on every pass + let space_left + if (width < 1) { + space_left = 1 + } else { + space_left = width - cur_len + } + + // If we're allowed to break long words, then do so: put as much + // of the next chunk onto the current line as will fit. + if (this.break_long_words) { + cur_line.push(reversed_chunks[reversed_chunks.length - 1].slice(0, space_left)) + reversed_chunks[reversed_chunks.length - 1] = reversed_chunks[reversed_chunks.length - 1].slice(space_left) + + // Otherwise, we have to preserve the long word intact. Only add + // it to the current line if there's nothing already there -- + // that minimizes how much we violate the width constraint. + } else if (!cur_line) { + cur_line.push(...reversed_chunks.pop()) + } + + // If we're not allowed to break long words, and there's already + // text on the current line, do nothing. Next time through the + // main loop of _wrap_chunks(), we'll wind up here again, but + // cur_len will be zero, so the next line will be entirely + // devoted to the long word that we can't handle right now. + } + + _wrap_chunks(chunks) { + /* + * _wrap_chunks(chunks : [string]) -> [string] + * + * Wrap a sequence of text chunks and return a list of lines of + * length 'self.width' or less. (If 'break_long_words' is false, + * some lines may be longer than this.) Chunks correspond roughly + * to words and the whitespace between them: each chunk is + * indivisible (modulo 'break_long_words'), but a line break can + * come between any two chunks. Chunks should not have internal + * whitespace; ie. a chunk is either all whitespace or a "word". + * Whitespace chunks will be removed from the beginning and end of + * lines, but apart from that whitespace is preserved. + */ + let lines = [] + let indent + if (this.width <= 0) { + throw Error(`invalid width ${this.width} (must be > 0)`) + } + if (this.max_lines !== undefined) { + if (this.max_lines > 1) { + indent = this.subsequent_indent + } else { + indent = this.initial_indent + } + if (indent.length + this.placeholder.trimStart().length > this.width) { + throw Error('placeholder too large for max width') + } + } + + // Arrange in reverse order so items can be efficiently popped + // from a stack of chucks. + chunks = chunks.reverse() + + while (chunks.length > 0) { + + // Start the list of chunks that will make up the current line. + // cur_len is just the length of all the chunks in cur_line. + let cur_line = [] + let cur_len = 0 + + // Figure out which static string will prefix this line. + let indent + if (lines) { + indent = this.subsequent_indent + } else { + indent = this.initial_indent + } + + // Maximum width for this line. + let width = this.width - indent.length + + // First chunk on line is whitespace -- drop it, unless this + // is the very beginning of the text (ie. no lines started yet). + if (this.drop_whitespace && chunks[chunks.length - 1].trim() === '' && lines.length > 0) { + chunks.pop() + } + + while (chunks.length > 0) { + let l = chunks[chunks.length - 1].length + + // Can at least squeeze this chunk onto the current line. + if (cur_len + l <= width) { + cur_line.push(chunks.pop()) + cur_len += l + + // Nope, this line is full. + } else { + break + } + } + + // The current line is full, and the next chunk is too big to + // fit on *any* line (not just this one). + if (chunks.length && chunks[chunks.length - 1].length > width) { + this._handle_long_word(chunks, cur_line, cur_len, width) + cur_len = cur_line.map(l => l.length).reduce((a, b) => a + b, 0) + } + + // If the last chunk on this line is all whitespace, drop it. + if (this.drop_whitespace && cur_line.length > 0 && cur_line[cur_line.length - 1].trim() === '') { + cur_len -= cur_line[cur_line.length - 1].length + cur_line.pop() + } + + if (cur_line) { + if (this.max_lines === undefined || + lines.length + 1 < this.max_lines || + (chunks.length === 0 || + this.drop_whitespace && + chunks.length === 1 && + !chunks[0].trim()) && cur_len <= width) { + // Convert current line back to a string and store it in + // list of all lines (return value). + lines.push(indent + cur_line.join('')) + } else { + let had_break = false + while (cur_line) { + if (cur_line[cur_line.length - 1].trim() && + cur_len + this.placeholder.length <= width) { + cur_line.push(this.placeholder) + lines.push(indent + cur_line.join('')) + had_break = true + break + } + cur_len -= cur_line[-1].length + cur_line.pop() + } + if (!had_break) { + if (lines) { + let prev_line = lines[lines.length - 1].trimEnd() + if (prev_line.length + this.placeholder.length <= + this.width) { + lines[lines.length - 1] = prev_line + this.placeholder + break + } + } + lines.push(indent + this.placeholder.lstrip()) + } + break + } + } + } + + return lines + } + + _split_chunks(text) { + text = this._munge_whitespace(text) + return this._split(text) + } + + // -- Public interface ---------------------------------------------- + + wrap(text) { + /* + * wrap(text : string) -> [string] + * + * Reformat the single paragraph in 'text' so it fits in lines of + * no more than 'self.width' columns, and return a list of wrapped + * lines. Tabs in 'text' are expanded with string.expandtabs(), + * and all other whitespace characters (including newline) are + * converted to space. + */ + let chunks = this._split_chunks(text) + // not implemented in js + //if (this.fix_sentence_endings) { + // this._fix_sentence_endings(chunks) + //} + return this._wrap_chunks(chunks) + } + + fill(text) { + /* + * fill(text : string) -> string + * + * Reformat the single paragraph in 'text' to fit in lines of no + * more than 'self.width' columns, and return a new string + * containing the entire wrapped paragraph. + */ + return this.wrap(text).join('\n') + } +} + + +// -- Convenience interface --------------------------------------------- + +function wrap(text, options = {}) { + /* + * Wrap a single paragraph of text, returning a list of wrapped lines. + * + * Reformat the single paragraph in 'text' so it fits in lines of no + * more than 'width' columns, and return a list of wrapped lines. By + * default, tabs in 'text' are expanded with string.expandtabs(), and + * all other whitespace characters (including newline) are converted to + * space. See TextWrapper class for available keyword args to customize + * wrapping behaviour. + */ + let { width = 70, ...kwargs } = options + let w = new TextWrapper(Object.assign({ width }, kwargs)) + return w.wrap(text) +} + +function fill(text, options = {}) { + /* + * Fill a single paragraph of text, returning a new string. + * + * Reformat the single paragraph in 'text' to fit in lines of no more + * than 'width' columns, and return a new string containing the entire + * wrapped paragraph. As with wrap(), tabs are expanded and other + * whitespace characters converted to space. See TextWrapper class for + * available keyword args to customize wrapping behaviour. + */ + let { width = 70, ...kwargs } = options + let w = new TextWrapper(Object.assign({ width }, kwargs)) + return w.fill(text) +} + +// -- Loosely related functionality ------------------------------------- + +let _whitespace_only_re = /^[ \t]+$/mg +let _leading_whitespace_re = /(^[ \t]*)(?:[^ \t\n])/mg + +function dedent(text) { + /* + * Remove any common leading whitespace from every line in `text`. + * + * This can be used to make triple-quoted strings line up with the left + * edge of the display, while still presenting them in the source code + * in indented form. + * + * Note that tabs and spaces are both treated as whitespace, but they + * are not equal: the lines " hello" and "\\thello" are + * considered to have no common leading whitespace. + * + * Entirely blank lines are normalized to a newline character. + */ + // Look for the longest leading string of spaces and tabs common to + // all lines. + let margin = undefined + text = text.replace(_whitespace_only_re, '') + let indents = text.match(_leading_whitespace_re) || [] + for (let indent of indents) { + indent = indent.slice(0, -1) + + if (margin === undefined) { + margin = indent + + // Current line more deeply indented than previous winner: + // no change (previous winner is still on top). + } else if (indent.startsWith(margin)) { + // pass + + // Current line consistent with and no deeper than previous winner: + // it's the new winner. + } else if (margin.startsWith(indent)) { + margin = indent + + // Find the largest common whitespace between current line and previous + // winner. + } else { + for (let i = 0; i < margin.length && i < indent.length; i++) { + if (margin[i] !== indent[i]) { + margin = margin.slice(0, i) + break + } + } + } + } + + if (margin) { + text = text.replace(new RegExp('^' + margin, 'mg'), '') + } + return text +} + +module.exports = { wrap, fill, dedent } diff --git a/node_modules/argparse/package.json b/node_modules/argparse/package.json new file mode 100644 index 0000000..647d2af --- /dev/null +++ b/node_modules/argparse/package.json @@ -0,0 +1,31 @@ +{ + "name": "argparse", + "description": "CLI arguments parser. Native port of python's argparse.", + "version": "2.0.1", + "keywords": [ + "cli", + "parser", + "argparse", + "option", + "args" + ], + "main": "argparse.js", + "files": [ + "argparse.js", + "lib/" + ], + "license": "Python-2.0", + "repository": "nodeca/argparse", + "scripts": { + "lint": "eslint .", + "test": "npm run lint && nyc mocha", + "coverage": "npm run test && nyc report --reporter html" + }, + "devDependencies": { + "@babel/eslint-parser": "^7.11.0", + "@babel/plugin-syntax-class-properties": "^7.10.4", + "eslint": "^7.5.0", + "mocha": "^8.0.1", + "nyc": "^15.1.0" + } +} diff --git a/node_modules/entities/LICENSE b/node_modules/entities/LICENSE new file mode 100644 index 0000000..c464f86 --- /dev/null +++ b/node_modules/entities/LICENSE @@ -0,0 +1,11 @@ +Copyright (c) Felix Böhm +All rights reserved. + +Redistribution and use in source and binary forms, with or without modification, are permitted provided that the following conditions are met: + +Redistributions of source code must retain the above copyright notice, this list of conditions and the following disclaimer. + +Redistributions in binary form must reproduce the above copyright notice, this list of conditions and the following disclaimer in the documentation and/or other materials provided with the distribution. + +THIS IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS, +EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/entities/lib/decode.d.ts b/node_modules/entities/lib/decode.d.ts new file mode 100644 index 0000000..0988b73 --- /dev/null +++ b/node_modules/entities/lib/decode.d.ts @@ -0,0 +1,7 @@ +export declare const decodeXML: (str: string) => string; +export declare const decodeHTMLStrict: (str: string) => string; +export interface MapType { + [key: string]: string; +} +export declare const decodeHTML: (str: string) => string; +//# sourceMappingURL=decode.d.ts.map
\ No newline at end of file diff --git a/node_modules/entities/lib/decode.d.ts.map b/node_modules/entities/lib/decode.d.ts.map new file mode 100644 index 0000000..9699adb --- /dev/null +++ b/node_modules/entities/lib/decode.d.ts.map @@ -0,0 +1 @@ +{"version":3,"file":"decode.d.ts","sourceRoot":"","sources":["../src/decode.ts"],"names":[],"mappings":"AAKA,eAAO,MAAM,SAAS,QAeL,MAAM,WAf0B,CAAC;AAClD,eAAO,MAAM,gBAAgB,QAcZ,MAAM,WAdoC,CAAC;AAE5D,MAAM,WAAW,OAAO;IACpB,CAAC,GAAG,EAAE,MAAM,GAAG,MAAM,CAAC;CACzB;AAeD,eAAO,MAAM,UAAU,QAyBN,MAAM,WACnB,CAAC"}
\ No newline at end of file diff --git a/node_modules/entities/lib/decode.js b/node_modules/entities/lib/decode.js new file mode 100644 index 0000000..650b9e9 --- /dev/null +++ b/node_modules/entities/lib/decode.js @@ -0,0 +1,54 @@ +"use strict"; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +exports.decodeHTML = exports.decodeHTMLStrict = exports.decodeXML = void 0; +var entities_json_1 = __importDefault(require("./maps/entities.json")); +var legacy_json_1 = __importDefault(require("./maps/legacy.json")); +var xml_json_1 = __importDefault(require("./maps/xml.json")); +var decode_codepoint_1 = __importDefault(require("./decode_codepoint")); +exports.decodeXML = getStrictDecoder(xml_json_1.default); +exports.decodeHTMLStrict = getStrictDecoder(entities_json_1.default); +function getStrictDecoder(map) { + var keys = Object.keys(map).join("|"); + var replace = getReplacer(map); + keys += "|#[xX][\\da-fA-F]+|#\\d+"; + var re = new RegExp("&(?:" + keys + ");", "g"); + return function (str) { return String(str).replace(re, replace); }; +} +var sorter = function (a, b) { return (a < b ? 1 : -1); }; +exports.decodeHTML = (function () { + var legacy = Object.keys(legacy_json_1.default).sort(sorter); + var keys = Object.keys(entities_json_1.default).sort(sorter); + for (var i = 0, j = 0; i < keys.length; i++) { + if (legacy[j] === keys[i]) { + keys[i] += ";?"; + j++; + } + else { + keys[i] += ";"; + } + } + var re = new RegExp("&(?:" + keys.join("|") + "|#[xX][\\da-fA-F]+;?|#\\d+;?)", "g"); + var replace = getReplacer(entities_json_1.default); + function replacer(str) { + if (str.substr(-1) !== ";") + str += ";"; + return replace(str); + } + // TODO consider creating a merged map + return function (str) { return String(str).replace(re, replacer); }; +})(); +function getReplacer(map) { + return function replace(str) { + if (str.charAt(1) === "#") { + var secondChar = str.charAt(2); + if (secondChar === "X" || secondChar === "x") { + return decode_codepoint_1.default(parseInt(str.substr(3), 16)); + } + return decode_codepoint_1.default(parseInt(str.substr(2), 10)); + } + return map[str.slice(1, -1)]; + }; +} diff --git a/node_modules/entities/lib/decode_codepoint.d.ts b/node_modules/entities/lib/decode_codepoint.d.ts new file mode 100644 index 0000000..6b72eaa --- /dev/null +++ b/node_modules/entities/lib/decode_codepoint.d.ts @@ -0,0 +1,2 @@ +export default function decodeCodePoint(codePoint: number): string; +//# sourceMappingURL=decode_codepoint.d.ts.map
\ No newline at end of file diff --git a/node_modules/entities/lib/decode_codepoint.d.ts.map b/node_modules/entities/lib/decode_codepoint.d.ts.map new file mode 100644 index 0000000..1b41c88 --- /dev/null +++ b/node_modules/entities/lib/decode_codepoint.d.ts.map @@ -0,0 +1 @@ +{"version":3,"file":"decode_codepoint.d.ts","sourceRoot":"","sources":["../src/decode_codepoint.ts"],"names":[],"mappings":"AAGA,MAAM,CAAC,OAAO,UAAU,eAAe,CAAC,SAAS,EAAE,MAAM,GAAG,MAAM,CAmBjE"}
\ No newline at end of file diff --git a/node_modules/entities/lib/decode_codepoint.js b/node_modules/entities/lib/decode_codepoint.js new file mode 100644 index 0000000..11a1f39 --- /dev/null +++ b/node_modules/entities/lib/decode_codepoint.js @@ -0,0 +1,24 @@ +"use strict"; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +var decode_json_1 = __importDefault(require("./maps/decode.json")); +// Modified version of https://github.com/mathiasbynens/he/blob/master/src/he.js#L94-L119 +function decodeCodePoint(codePoint) { + if ((codePoint >= 0xd800 && codePoint <= 0xdfff) || codePoint > 0x10ffff) { + return "\uFFFD"; + } + if (codePoint in decode_json_1.default) { + codePoint = decode_json_1.default[codePoint]; + } + var output = ""; + if (codePoint > 0xffff) { + codePoint -= 0x10000; + output += String.fromCharCode(((codePoint >>> 10) & 0x3ff) | 0xd800); + codePoint = 0xdc00 | (codePoint & 0x3ff); + } + output += String.fromCharCode(codePoint); + return output; +} +exports.default = decodeCodePoint; diff --git a/node_modules/entities/lib/encode.d.ts b/node_modules/entities/lib/encode.d.ts new file mode 100644 index 0000000..613c30e --- /dev/null +++ b/node_modules/entities/lib/encode.d.ts @@ -0,0 +1,4 @@ +export declare const encodeXML: (data: string) => string; +export declare const encodeHTML: (data: string) => string; +export declare function escape(data: string): string; +//# sourceMappingURL=encode.d.ts.map
\ No newline at end of file diff --git a/node_modules/entities/lib/encode.d.ts.map b/node_modules/entities/lib/encode.d.ts.map new file mode 100644 index 0000000..2142fdd --- /dev/null +++ b/node_modules/entities/lib/encode.d.ts.map @@ -0,0 +1 @@ +{"version":3,"file":"encode.d.ts","sourceRoot":"","sources":["../src/encode.ts"],"names":[],"mappings":"AAKA,eAAO,MAAM,SAAS,SAmEJ,MAAM,WAnEoC,CAAC;AAO7D,eAAO,MAAM,UAAU,SA4DL,MAAM,WA5DuC,CAAC;AAoEhE,wBAAgB,MAAM,CAAC,IAAI,EAAE,MAAM,GAAG,MAAM,CAI3C"}
\ No newline at end of file diff --git a/node_modules/entities/lib/encode.js b/node_modules/entities/lib/encode.js new file mode 100644 index 0000000..f19310a --- /dev/null +++ b/node_modules/entities/lib/encode.js @@ -0,0 +1,73 @@ +"use strict"; +var __importDefault = (this && this.__importDefault) || function (mod) { + return (mod && mod.__esModule) ? mod : { "default": mod }; +}; +Object.defineProperty(exports, "__esModule", { value: true }); +exports.escape = exports.encodeHTML = exports.encodeXML = void 0; +var xml_json_1 = __importDefault(require("./maps/xml.json")); +var inverseXML = getInverseObj(xml_json_1.default); +var xmlReplacer = getInverseReplacer(inverseXML); +exports.encodeXML = getInverse(inverseXML, xmlReplacer); +var entities_json_1 = __importDefault(require("./maps/entities.json")); +var inverseHTML = getInverseObj(entities_json_1.default); +var htmlReplacer = getInverseReplacer(inverseHTML); +exports.encodeHTML = getInverse(inverseHTML, htmlReplacer); +function getInverseObj(obj) { + return Object.keys(obj) + .sort() + .reduce(function (inverse, name) { + inverse[obj[name]] = "&" + name + ";"; + return inverse; + }, {}); +} +function getInverseReplacer(inverse) { + var single = []; + var multiple = []; + for (var _i = 0, _a = Object.keys(inverse); _i < _a.length; _i++) { + var k = _a[_i]; + if (k.length === 1) { + // Add value to single array + single.push("\\" + k); + } + else { + // Add value to multiple array + multiple.push(k); + } + } + // Add ranges to single characters. + single.sort(); + for (var start = 0; start < single.length - 1; start++) { + // Find the end of a run of characters + var end = start; + while (end < single.length - 1 && + single[end].charCodeAt(1) + 1 === single[end + 1].charCodeAt(1)) { + end += 1; + } + var count = 1 + end - start; + // We want to replace at least three characters + if (count < 3) + continue; + single.splice(start, count, single[start] + "-" + single[end]); + } + multiple.unshift("[" + single.join("") + "]"); + return new RegExp(multiple.join("|"), "g"); +} +var reNonASCII = /(?:[\x80-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])/g; +function singleCharReplacer(c) { + // eslint-disable-next-line @typescript-eslint/no-non-null-assertion + return "&#x" + c.codePointAt(0).toString(16).toUpperCase() + ";"; +} +function getInverse(inverse, re) { + return function (data) { + return data + .replace(re, function (name) { return inverse[name]; }) + .replace(reNonASCII, singleCharReplacer); + }; +} +var reXmlChars = getInverseReplacer(inverseXML); +function escape(data) { + return data + .replace(reXmlChars, singleCharReplacer) + .replace(reNonASCII, singleCharReplacer); +} +exports.escape = escape; diff --git a/node_modules/entities/lib/index.d.ts b/node_modules/entities/lib/index.d.ts new file mode 100644 index 0000000..4ec8a82 --- /dev/null +++ b/node_modules/entities/lib/index.d.ts @@ -0,0 +1,24 @@ +/** + * Decodes a string with entities. + * + * @param data String to decode. + * @param level Optional level to decode at. 0 = XML, 1 = HTML. Default is 0. + */ +export declare function decode(data: string, level?: number): string; +/** + * Decodes a string with entities. Does not allow missing trailing semicolons for entities. + * + * @param data String to decode. + * @param level Optional level to decode at. 0 = XML, 1 = HTML. Default is 0. + */ +export declare function decodeStrict(data: string, level?: number): string; +/** + * Encodes a string with entities. + * + * @param data String to encode. + * @param level Optional level to encode at. 0 = XML, 1 = HTML. Default is 0. + */ +export declare function encode(data: string, level?: number): string; +export { encodeXML, encodeHTML, escape, encodeHTML as encodeHTML4, encodeHTML as encodeHTML5, } from "./encode"; +export { decodeXML, decodeHTML, decodeHTMLStrict, decodeHTML as decodeHTML4, decodeHTML as decodeHTML5, decodeHTMLStrict as decodeHTML4Strict, decodeHTMLStrict as decodeHTML5Strict, decodeXML as decodeXMLStrict, } from "./decode"; +//# sourceMappingURL=index.d.ts.map
\ No newline at end of file diff --git a/node_modules/entities/lib/index.d.ts.map b/node_modules/entities/lib/index.d.ts.map new file mode 100644 index 0000000..f764d69 --- /dev/null +++ b/node_modules/entities/lib/index.d.ts.map @@ -0,0 +1 @@ +{"version":3,"file":"index.d.ts","sourceRoot":"","sources":["../src/index.ts"],"names":[],"mappings":"AAGA;;;;;GAKG;AACH,wBAAgB,MAAM,CAAC,IAAI,EAAE,MAAM,EAAE,KAAK,CAAC,EAAE,MAAM,GAAG,MAAM,CAE3D;AAED;;;;;GAKG;AACH,wBAAgB,YAAY,CAAC,IAAI,EAAE,MAAM,EAAE,KAAK,CAAC,EAAE,MAAM,GAAG,MAAM,CAEjE;AAED;;;;;GAKG;AACH,wBAAgB,MAAM,CAAC,IAAI,EAAE,MAAM,EAAE,KAAK,CAAC,EAAE,MAAM,GAAG,MAAM,CAE3D;AAED,OAAO,EACH,SAAS,EACT,UAAU,EACV,MAAM,EAEN,UAAU,IAAI,WAAW,EACzB,UAAU,IAAI,WAAW,GAC5B,MAAM,UAAU,CAAC;AAElB,OAAO,EACH,SAAS,EACT,UAAU,EACV,gBAAgB,EAEhB,UAAU,IAAI,WAAW,EACzB,UAAU,IAAI,WAAW,EACzB,gBAAgB,IAAI,iBAAiB,EACrC,gBAAgB,IAAI,iBAAiB,EACrC,SAAS,IAAI,eAAe,GAC/B,MAAM,UAAU,CAAC"}
\ No newline at end of file diff --git a/node_modules/entities/lib/index.js b/node_modules/entities/lib/index.js new file mode 100644 index 0000000..e5cecc4 --- /dev/null +++ b/node_modules/entities/lib/index.js @@ -0,0 +1,52 @@ +"use strict"; +Object.defineProperty(exports, "__esModule", { value: true }); +exports.decodeXMLStrict = exports.decodeHTML5Strict = exports.decodeHTML4Strict = exports.decodeHTML5 = exports.decodeHTML4 = exports.decodeHTMLStrict = exports.decodeHTML = exports.decodeXML = exports.encodeHTML5 = exports.encodeHTML4 = exports.escape = exports.encodeHTML = exports.encodeXML = exports.encode = exports.decodeStrict = exports.decode = void 0; +var decode_1 = require("./decode"); +var encode_1 = require("./encode"); +/** + * Decodes a string with entities. + * + * @param data String to decode. + * @param level Optional level to decode at. 0 = XML, 1 = HTML. Default is 0. + */ +function decode(data, level) { + return (!level || level <= 0 ? decode_1.decodeXML : decode_1.decodeHTML)(data); +} +exports.decode = decode; +/** + * Decodes a string with entities. Does not allow missing trailing semicolons for entities. + * + * @param data String to decode. + * @param level Optional level to decode at. 0 = XML, 1 = HTML. Default is 0. + */ +function decodeStrict(data, level) { + return (!level || level <= 0 ? decode_1.decodeXML : decode_1.decodeHTMLStrict)(data); +} +exports.decodeStrict = decodeStrict; +/** + * Encodes a string with entities. + * + * @param data String to encode. + * @param level Optional level to encode at. 0 = XML, 1 = HTML. Default is 0. + */ +function encode(data, level) { + return (!level || level <= 0 ? encode_1.encodeXML : encode_1.encodeHTML)(data); +} +exports.encode = encode; +var encode_2 = require("./encode"); +Object.defineProperty(exports, "encodeXML", { enumerable: true, get: function () { return encode_2.encodeXML; } }); +Object.defineProperty(exports, "encodeHTML", { enumerable: true, get: function () { return encode_2.encodeHTML; } }); +Object.defineProperty(exports, "escape", { enumerable: true, get: function () { return encode_2.escape; } }); +// Legacy aliases +Object.defineProperty(exports, "encodeHTML4", { enumerable: true, get: function () { return encode_2.encodeHTML; } }); +Object.defineProperty(exports, "encodeHTML5", { enumerable: true, get: function () { return encode_2.encodeHTML; } }); +var decode_2 = require("./decode"); +Object.defineProperty(exports, "decodeXML", { enumerable: true, get: function () { return decode_2.decodeXML; } }); +Object.defineProperty(exports, "decodeHTML", { enumerable: true, get: function () { return decode_2.decodeHTML; } }); +Object.defineProperty(exports, "decodeHTMLStrict", { enumerable: true, get: function () { return decode_2.decodeHTMLStrict; } }); +// Legacy aliases +Object.defineProperty(exports, "decodeHTML4", { enumerable: true, get: function () { return decode_2.decodeHTML; } }); +Object.defineProperty(exports, "decodeHTML5", { enumerable: true, get: function () { return decode_2.decodeHTML; } }); +Object.defineProperty(exports, "decodeHTML4Strict", { enumerable: true, get: function () { return decode_2.decodeHTMLStrict; } }); +Object.defineProperty(exports, "decodeHTML5Strict", { enumerable: true, get: function () { return decode_2.decodeHTMLStrict; } }); +Object.defineProperty(exports, "decodeXMLStrict", { enumerable: true, get: function () { return decode_2.decodeXML; } }); diff --git a/node_modules/entities/lib/maps/decode.json b/node_modules/entities/lib/maps/decode.json new file mode 100644 index 0000000..80ef449 --- /dev/null +++ b/node_modules/entities/lib/maps/decode.json @@ -0,0 +1 @@ +{"0":65533,"128":8364,"130":8218,"131":402,"132":8222,"133":8230,"134":8224,"135":8225,"136":710,"137":8240,"138":352,"139":8249,"140":338,"142":381,"145":8216,"146":8217,"147":8220,"148":8221,"149":8226,"150":8211,"151":8212,"152":732,"153":8482,"154":353,"155":8250,"156":339,"158":382,"159":376} diff --git a/node_modules/entities/lib/maps/entities.json b/node_modules/entities/lib/maps/entities.json new file mode 100644 index 0000000..c5b1c4e --- /dev/null +++ b/node_modules/entities/lib/maps/entities.json @@ -0,0 +1 @@ +{"Aacute":"Á","aacute":"á","Abreve":"Ă","abreve":"ă","ac":"∾","acd":"∿","acE":"∾̳","Acirc":"Â","acirc":"â","acute":"´","Acy":"А","acy":"а","AElig":"Æ","aelig":"æ","af":"","Afr":"𝔄","afr":"𝔞","Agrave":"À","agrave":"à","alefsym":"ℵ","aleph":"ℵ","Alpha":"Α","alpha":"α","Amacr":"Ā","amacr":"ā","amalg":"⨿","amp":"&","AMP":"&","andand":"⩕","And":"⩓","and":"∧","andd":"⩜","andslope":"⩘","andv":"⩚","ang":"∠","ange":"⦤","angle":"∠","angmsdaa":"⦨","angmsdab":"⦩","angmsdac":"⦪","angmsdad":"⦫","angmsdae":"⦬","angmsdaf":"⦭","angmsdag":"⦮","angmsdah":"⦯","angmsd":"∡","angrt":"∟","angrtvb":"⊾","angrtvbd":"⦝","angsph":"∢","angst":"Å","angzarr":"⍼","Aogon":"Ą","aogon":"ą","Aopf":"𝔸","aopf":"𝕒","apacir":"⩯","ap":"≈","apE":"⩰","ape":"≊","apid":"≋","apos":"'","ApplyFunction":"","approx":"≈","approxeq":"≊","Aring":"Å","aring":"å","Ascr":"𝒜","ascr":"𝒶","Assign":"≔","ast":"*","asymp":"≈","asympeq":"≍","Atilde":"Ã","atilde":"ã","Auml":"Ä","auml":"ä","awconint":"∳","awint":"⨑","backcong":"≌","backepsilon":"϶","backprime":"‵","backsim":"∽","backsimeq":"⋍","Backslash":"∖","Barv":"⫧","barvee":"⊽","barwed":"⌅","Barwed":"⌆","barwedge":"⌅","bbrk":"⎵","bbrktbrk":"⎶","bcong":"≌","Bcy":"Б","bcy":"б","bdquo":"„","becaus":"∵","because":"∵","Because":"∵","bemptyv":"⦰","bepsi":"϶","bernou":"ℬ","Bernoullis":"ℬ","Beta":"Β","beta":"β","beth":"ℶ","between":"≬","Bfr":"𝔅","bfr":"𝔟","bigcap":"⋂","bigcirc":"◯","bigcup":"⋃","bigodot":"⨀","bigoplus":"⨁","bigotimes":"⨂","bigsqcup":"⨆","bigstar":"★","bigtriangledown":"▽","bigtriangleup":"△","biguplus":"⨄","bigvee":"⋁","bigwedge":"⋀","bkarow":"⤍","blacklozenge":"⧫","blacksquare":"▪","blacktriangle":"▴","blacktriangledown":"▾","blacktriangleleft":"◂","blacktriangleright":"▸","blank":"␣","blk12":"▒","blk14":"░","blk34":"▓","block":"█","bne":"=⃥","bnequiv":"≡⃥","bNot":"⫭","bnot":"⌐","Bopf":"𝔹","bopf":"𝕓","bot":"⊥","bottom":"⊥","bowtie":"⋈","boxbox":"⧉","boxdl":"┐","boxdL":"╕","boxDl":"╖","boxDL":"╗","boxdr":"┌","boxdR":"╒","boxDr":"╓","boxDR":"╔","boxh":"─","boxH":"═","boxhd":"┬","boxHd":"╤","boxhD":"╥","boxHD":"╦","boxhu":"┴","boxHu":"╧","boxhU":"╨","boxHU":"╩","boxminus":"⊟","boxplus":"⊞","boxtimes":"⊠","boxul":"┘","boxuL":"╛","boxUl":"╜","boxUL":"╝","boxur":"└","boxuR":"╘","boxUr":"╙","boxUR":"╚","boxv":"│","boxV":"║","boxvh":"┼","boxvH":"╪","boxVh":"╫","boxVH":"╬","boxvl":"┤","boxvL":"╡","boxVl":"╢","boxVL":"╣","boxvr":"├","boxvR":"╞","boxVr":"╟","boxVR":"╠","bprime":"‵","breve":"˘","Breve":"˘","brvbar":"¦","bscr":"𝒷","Bscr":"ℬ","bsemi":"⁏","bsim":"∽","bsime":"⋍","bsolb":"⧅","bsol":"\\","bsolhsub":"⟈","bull":"•","bullet":"•","bump":"≎","bumpE":"⪮","bumpe":"≏","Bumpeq":"≎","bumpeq":"≏","Cacute":"Ć","cacute":"ć","capand":"⩄","capbrcup":"⩉","capcap":"⩋","cap":"∩","Cap":"⋒","capcup":"⩇","capdot":"⩀","CapitalDifferentialD":"ⅅ","caps":"∩︀","caret":"⁁","caron":"ˇ","Cayleys":"ℭ","ccaps":"⩍","Ccaron":"Č","ccaron":"č","Ccedil":"Ç","ccedil":"ç","Ccirc":"Ĉ","ccirc":"ĉ","Cconint":"∰","ccups":"⩌","ccupssm":"⩐","Cdot":"Ċ","cdot":"ċ","cedil":"¸","Cedilla":"¸","cemptyv":"⦲","cent":"¢","centerdot":"·","CenterDot":"·","cfr":"𝔠","Cfr":"ℭ","CHcy":"Ч","chcy":"ч","check":"✓","checkmark":"✓","Chi":"Χ","chi":"χ","circ":"ˆ","circeq":"≗","circlearrowleft":"↺","circlearrowright":"↻","circledast":"⊛","circledcirc":"⊚","circleddash":"⊝","CircleDot":"⊙","circledR":"®","circledS":"Ⓢ","CircleMinus":"⊖","CirclePlus":"⊕","CircleTimes":"⊗","cir":"○","cirE":"⧃","cire":"≗","cirfnint":"⨐","cirmid":"⫯","cirscir":"⧂","ClockwiseContourIntegral":"∲","CloseCurlyDoubleQuote":"”","CloseCurlyQuote":"’","clubs":"♣","clubsuit":"♣","colon":":","Colon":"∷","Colone":"⩴","colone":"≔","coloneq":"≔","comma":",","commat":"@","comp":"∁","compfn":"∘","complement":"∁","complexes":"ℂ","cong":"≅","congdot":"⩭","Congruent":"≡","conint":"∮","Conint":"∯","ContourIntegral":"∮","copf":"𝕔","Copf":"ℂ","coprod":"∐","Coproduct":"∐","copy":"©","COPY":"©","copysr":"℗","CounterClockwiseContourIntegral":"∳","crarr":"↵","cross":"✗","Cross":"⨯","Cscr":"𝒞","cscr":"𝒸","csub":"⫏","csube":"⫑","csup":"⫐","csupe":"⫒","ctdot":"⋯","cudarrl":"⤸","cudarrr":"⤵","cuepr":"⋞","cuesc":"⋟","cularr":"↶","cularrp":"⤽","cupbrcap":"⩈","cupcap":"⩆","CupCap":"≍","cup":"∪","Cup":"⋓","cupcup":"⩊","cupdot":"⊍","cupor":"⩅","cups":"∪︀","curarr":"↷","curarrm":"⤼","curlyeqprec":"⋞","curlyeqsucc":"⋟","curlyvee":"⋎","curlywedge":"⋏","curren":"¤","curvearrowleft":"↶","curvearrowright":"↷","cuvee":"⋎","cuwed":"⋏","cwconint":"∲","cwint":"∱","cylcty":"⌭","dagger":"†","Dagger":"‡","daleth":"ℸ","darr":"↓","Darr":"↡","dArr":"⇓","dash":"‐","Dashv":"⫤","dashv":"⊣","dbkarow":"⤏","dblac":"˝","Dcaron":"Ď","dcaron":"ď","Dcy":"Д","dcy":"д","ddagger":"‡","ddarr":"⇊","DD":"ⅅ","dd":"ⅆ","DDotrahd":"⤑","ddotseq":"⩷","deg":"°","Del":"∇","Delta":"Δ","delta":"δ","demptyv":"⦱","dfisht":"⥿","Dfr":"𝔇","dfr":"𝔡","dHar":"⥥","dharl":"⇃","dharr":"⇂","DiacriticalAcute":"´","DiacriticalDot":"˙","DiacriticalDoubleAcute":"˝","DiacriticalGrave":"`","DiacriticalTilde":"˜","diam":"⋄","diamond":"⋄","Diamond":"⋄","diamondsuit":"♦","diams":"♦","die":"¨","DifferentialD":"ⅆ","digamma":"ϝ","disin":"⋲","div":"÷","divide":"÷","divideontimes":"⋇","divonx":"⋇","DJcy":"Ђ","djcy":"ђ","dlcorn":"⌞","dlcrop":"⌍","dollar":"$","Dopf":"𝔻","dopf":"𝕕","Dot":"¨","dot":"˙","DotDot":"⃜","doteq":"≐","doteqdot":"≑","DotEqual":"≐","dotminus":"∸","dotplus":"∔","dotsquare":"⊡","doublebarwedge":"⌆","DoubleContourIntegral":"∯","DoubleDot":"¨","DoubleDownArrow":"⇓","DoubleLeftArrow":"⇐","DoubleLeftRightArrow":"⇔","DoubleLeftTee":"⫤","DoubleLongLeftArrow":"⟸","DoubleLongLeftRightArrow":"⟺","DoubleLongRightArrow":"⟹","DoubleRightArrow":"⇒","DoubleRightTee":"⊨","DoubleUpArrow":"⇑","DoubleUpDownArrow":"⇕","DoubleVerticalBar":"∥","DownArrowBar":"⤓","downarrow":"↓","DownArrow":"↓","Downarrow":"⇓","DownArrowUpArrow":"⇵","DownBreve":"̑","downdownarrows":"⇊","downharpoonleft":"⇃","downharpoonright":"⇂","DownLeftRightVector":"⥐","DownLeftTeeVector":"⥞","DownLeftVectorBar":"⥖","DownLeftVector":"↽","DownRightTeeVector":"⥟","DownRightVectorBar":"⥗","DownRightVector":"⇁","DownTeeArrow":"↧","DownTee":"⊤","drbkarow":"⤐","drcorn":"⌟","drcrop":"⌌","Dscr":"𝒟","dscr":"𝒹","DScy":"Ѕ","dscy":"ѕ","dsol":"⧶","Dstrok":"Đ","dstrok":"đ","dtdot":"⋱","dtri":"▿","dtrif":"▾","duarr":"⇵","duhar":"⥯","dwangle":"⦦","DZcy":"Џ","dzcy":"џ","dzigrarr":"⟿","Eacute":"É","eacute":"é","easter":"⩮","Ecaron":"Ě","ecaron":"ě","Ecirc":"Ê","ecirc":"ê","ecir":"≖","ecolon":"≕","Ecy":"Э","ecy":"э","eDDot":"⩷","Edot":"Ė","edot":"ė","eDot":"≑","ee":"ⅇ","efDot":"≒","Efr":"𝔈","efr":"𝔢","eg":"⪚","Egrave":"È","egrave":"è","egs":"⪖","egsdot":"⪘","el":"⪙","Element":"∈","elinters":"⏧","ell":"ℓ","els":"⪕","elsdot":"⪗","Emacr":"Ē","emacr":"ē","empty":"∅","emptyset":"∅","EmptySmallSquare":"◻","emptyv":"∅","EmptyVerySmallSquare":"▫","emsp13":" ","emsp14":" ","emsp":" ","ENG":"Ŋ","eng":"ŋ","ensp":" ","Eogon":"Ę","eogon":"ę","Eopf":"𝔼","eopf":"𝕖","epar":"⋕","eparsl":"⧣","eplus":"⩱","epsi":"ε","Epsilon":"Ε","epsilon":"ε","epsiv":"ϵ","eqcirc":"≖","eqcolon":"≕","eqsim":"≂","eqslantgtr":"⪖","eqslantless":"⪕","Equal":"⩵","equals":"=","EqualTilde":"≂","equest":"≟","Equilibrium":"⇌","equiv":"≡","equivDD":"⩸","eqvparsl":"⧥","erarr":"⥱","erDot":"≓","escr":"ℯ","Escr":"ℰ","esdot":"≐","Esim":"⩳","esim":"≂","Eta":"Η","eta":"η","ETH":"Ð","eth":"ð","Euml":"Ë","euml":"ë","euro":"€","excl":"!","exist":"∃","Exists":"∃","expectation":"ℰ","exponentiale":"ⅇ","ExponentialE":"ⅇ","fallingdotseq":"≒","Fcy":"Ф","fcy":"ф","female":"♀","ffilig":"ffi","fflig":"ff","ffllig":"ffl","Ffr":"𝔉","ffr":"𝔣","filig":"fi","FilledSmallSquare":"◼","FilledVerySmallSquare":"▪","fjlig":"fj","flat":"♭","fllig":"fl","fltns":"▱","fnof":"ƒ","Fopf":"𝔽","fopf":"𝕗","forall":"∀","ForAll":"∀","fork":"⋔","forkv":"⫙","Fouriertrf":"ℱ","fpartint":"⨍","frac12":"½","frac13":"⅓","frac14":"¼","frac15":"⅕","frac16":"⅙","frac18":"⅛","frac23":"⅔","frac25":"⅖","frac34":"¾","frac35":"⅗","frac38":"⅜","frac45":"⅘","frac56":"⅚","frac58":"⅝","frac78":"⅞","frasl":"⁄","frown":"⌢","fscr":"𝒻","Fscr":"ℱ","gacute":"ǵ","Gamma":"Γ","gamma":"γ","Gammad":"Ϝ","gammad":"ϝ","gap":"⪆","Gbreve":"Ğ","gbreve":"ğ","Gcedil":"Ģ","Gcirc":"Ĝ","gcirc":"ĝ","Gcy":"Г","gcy":"г","Gdot":"Ġ","gdot":"ġ","ge":"≥","gE":"≧","gEl":"⪌","gel":"⋛","geq":"≥","geqq":"≧","geqslant":"⩾","gescc":"⪩","ges":"⩾","gesdot":"⪀","gesdoto":"⪂","gesdotol":"⪄","gesl":"⋛︀","gesles":"⪔","Gfr":"𝔊","gfr":"𝔤","gg":"≫","Gg":"⋙","ggg":"⋙","gimel":"ℷ","GJcy":"Ѓ","gjcy":"ѓ","gla":"⪥","gl":"≷","glE":"⪒","glj":"⪤","gnap":"⪊","gnapprox":"⪊","gne":"⪈","gnE":"≩","gneq":"⪈","gneqq":"≩","gnsim":"⋧","Gopf":"𝔾","gopf":"𝕘","grave":"`","GreaterEqual":"≥","GreaterEqualLess":"⋛","GreaterFullEqual":"≧","GreaterGreater":"⪢","GreaterLess":"≷","GreaterSlantEqual":"⩾","GreaterTilde":"≳","Gscr":"𝒢","gscr":"ℊ","gsim":"≳","gsime":"⪎","gsiml":"⪐","gtcc":"⪧","gtcir":"⩺","gt":">","GT":">","Gt":"≫","gtdot":"⋗","gtlPar":"⦕","gtquest":"⩼","gtrapprox":"⪆","gtrarr":"⥸","gtrdot":"⋗","gtreqless":"⋛","gtreqqless":"⪌","gtrless":"≷","gtrsim":"≳","gvertneqq":"≩︀","gvnE":"≩︀","Hacek":"ˇ","hairsp":" ","half":"½","hamilt":"ℋ","HARDcy":"Ъ","hardcy":"ъ","harrcir":"⥈","harr":"↔","hArr":"⇔","harrw":"↭","Hat":"^","hbar":"ℏ","Hcirc":"Ĥ","hcirc":"ĥ","hearts":"♥","heartsuit":"♥","hellip":"…","hercon":"⊹","hfr":"𝔥","Hfr":"ℌ","HilbertSpace":"ℋ","hksearow":"⤥","hkswarow":"⤦","hoarr":"⇿","homtht":"∻","hookleftarrow":"↩","hookrightarrow":"↪","hopf":"𝕙","Hopf":"ℍ","horbar":"―","HorizontalLine":"─","hscr":"𝒽","Hscr":"ℋ","hslash":"ℏ","Hstrok":"Ħ","hstrok":"ħ","HumpDownHump":"≎","HumpEqual":"≏","hybull":"⁃","hyphen":"‐","Iacute":"Í","iacute":"í","ic":"","Icirc":"Î","icirc":"î","Icy":"И","icy":"и","Idot":"İ","IEcy":"Е","iecy":"е","iexcl":"¡","iff":"⇔","ifr":"𝔦","Ifr":"ℑ","Igrave":"Ì","igrave":"ì","ii":"ⅈ","iiiint":"⨌","iiint":"∭","iinfin":"⧜","iiota":"℩","IJlig":"IJ","ijlig":"ij","Imacr":"Ī","imacr":"ī","image":"ℑ","ImaginaryI":"ⅈ","imagline":"ℐ","imagpart":"ℑ","imath":"ı","Im":"ℑ","imof":"⊷","imped":"Ƶ","Implies":"⇒","incare":"℅","in":"∈","infin":"∞","infintie":"⧝","inodot":"ı","intcal":"⊺","int":"∫","Int":"∬","integers":"ℤ","Integral":"∫","intercal":"⊺","Intersection":"⋂","intlarhk":"⨗","intprod":"⨼","InvisibleComma":"","InvisibleTimes":"","IOcy":"Ё","iocy":"ё","Iogon":"Į","iogon":"į","Iopf":"𝕀","iopf":"𝕚","Iota":"Ι","iota":"ι","iprod":"⨼","iquest":"¿","iscr":"𝒾","Iscr":"ℐ","isin":"∈","isindot":"⋵","isinE":"⋹","isins":"⋴","isinsv":"⋳","isinv":"∈","it":"","Itilde":"Ĩ","itilde":"ĩ","Iukcy":"І","iukcy":"і","Iuml":"Ï","iuml":"ï","Jcirc":"Ĵ","jcirc":"ĵ","Jcy":"Й","jcy":"й","Jfr":"𝔍","jfr":"𝔧","jmath":"ȷ","Jopf":"𝕁","jopf":"𝕛","Jscr":"𝒥","jscr":"𝒿","Jsercy":"Ј","jsercy":"ј","Jukcy":"Є","jukcy":"є","Kappa":"Κ","kappa":"κ","kappav":"ϰ","Kcedil":"Ķ","kcedil":"ķ","Kcy":"К","kcy":"к","Kfr":"𝔎","kfr":"𝔨","kgreen":"ĸ","KHcy":"Х","khcy":"х","KJcy":"Ќ","kjcy":"ќ","Kopf":"𝕂","kopf":"𝕜","Kscr":"𝒦","kscr":"𝓀","lAarr":"⇚","Lacute":"Ĺ","lacute":"ĺ","laemptyv":"⦴","lagran":"ℒ","Lambda":"Λ","lambda":"λ","lang":"⟨","Lang":"⟪","langd":"⦑","langle":"⟨","lap":"⪅","Laplacetrf":"ℒ","laquo":"«","larrb":"⇤","larrbfs":"⤟","larr":"←","Larr":"↞","lArr":"⇐","larrfs":"⤝","larrhk":"↩","larrlp":"↫","larrpl":"⤹","larrsim":"⥳","larrtl":"↢","latail":"⤙","lAtail":"⤛","lat":"⪫","late":"⪭","lates":"⪭︀","lbarr":"⤌","lBarr":"⤎","lbbrk":"❲","lbrace":"{","lbrack":"[","lbrke":"⦋","lbrksld":"⦏","lbrkslu":"⦍","Lcaron":"Ľ","lcaron":"ľ","Lcedil":"Ļ","lcedil":"ļ","lceil":"⌈","lcub":"{","Lcy":"Л","lcy":"л","ldca":"⤶","ldquo":"“","ldquor":"„","ldrdhar":"⥧","ldrushar":"⥋","ldsh":"↲","le":"≤","lE":"≦","LeftAngleBracket":"⟨","LeftArrowBar":"⇤","leftarrow":"←","LeftArrow":"←","Leftarrow":"⇐","LeftArrowRightArrow":"⇆","leftarrowtail":"↢","LeftCeiling":"⌈","LeftDoubleBracket":"⟦","LeftDownTeeVector":"⥡","LeftDownVectorBar":"⥙","LeftDownVector":"⇃","LeftFloor":"⌊","leftharpoondown":"↽","leftharpoonup":"↼","leftleftarrows":"⇇","leftrightarrow":"↔","LeftRightArrow":"↔","Leftrightarrow":"⇔","leftrightarrows":"⇆","leftrightharpoons":"⇋","leftrightsquigarrow":"↭","LeftRightVector":"⥎","LeftTeeArrow":"↤","LeftTee":"⊣","LeftTeeVector":"⥚","leftthreetimes":"⋋","LeftTriangleBar":"⧏","LeftTriangle":"⊲","LeftTriangleEqual":"⊴","LeftUpDownVector":"⥑","LeftUpTeeVector":"⥠","LeftUpVectorBar":"⥘","LeftUpVector":"↿","LeftVectorBar":"⥒","LeftVector":"↼","lEg":"⪋","leg":"⋚","leq":"≤","leqq":"≦","leqslant":"⩽","lescc":"⪨","les":"⩽","lesdot":"⩿","lesdoto":"⪁","lesdotor":"⪃","lesg":"⋚︀","lesges":"⪓","lessapprox":"⪅","lessdot":"⋖","lesseqgtr":"⋚","lesseqqgtr":"⪋","LessEqualGreater":"⋚","LessFullEqual":"≦","LessGreater":"≶","lessgtr":"≶","LessLess":"⪡","lesssim":"≲","LessSlantEqual":"⩽","LessTilde":"≲","lfisht":"⥼","lfloor":"⌊","Lfr":"𝔏","lfr":"𝔩","lg":"≶","lgE":"⪑","lHar":"⥢","lhard":"↽","lharu":"↼","lharul":"⥪","lhblk":"▄","LJcy":"Љ","ljcy":"љ","llarr":"⇇","ll":"≪","Ll":"⋘","llcorner":"⌞","Lleftarrow":"⇚","llhard":"⥫","lltri":"◺","Lmidot":"Ŀ","lmidot":"ŀ","lmoustache":"⎰","lmoust":"⎰","lnap":"⪉","lnapprox":"⪉","lne":"⪇","lnE":"≨","lneq":"⪇","lneqq":"≨","lnsim":"⋦","loang":"⟬","loarr":"⇽","lobrk":"⟦","longleftarrow":"⟵","LongLeftArrow":"⟵","Longleftarrow":"⟸","longleftrightarrow":"⟷","LongLeftRightArrow":"⟷","Longleftrightarrow":"⟺","longmapsto":"⟼","longrightarrow":"⟶","LongRightArrow":"⟶","Longrightarrow":"⟹","looparrowleft":"↫","looparrowright":"↬","lopar":"⦅","Lopf":"𝕃","lopf":"𝕝","loplus":"⨭","lotimes":"⨴","lowast":"∗","lowbar":"_","LowerLeftArrow":"↙","LowerRightArrow":"↘","loz":"◊","lozenge":"◊","lozf":"⧫","lpar":"(","lparlt":"⦓","lrarr":"⇆","lrcorner":"⌟","lrhar":"⇋","lrhard":"⥭","lrm":"","lrtri":"⊿","lsaquo":"‹","lscr":"𝓁","Lscr":"ℒ","lsh":"↰","Lsh":"↰","lsim":"≲","lsime":"⪍","lsimg":"⪏","lsqb":"[","lsquo":"‘","lsquor":"‚","Lstrok":"Ł","lstrok":"ł","ltcc":"⪦","ltcir":"⩹","lt":"<","LT":"<","Lt":"≪","ltdot":"⋖","lthree":"⋋","ltimes":"⋉","ltlarr":"⥶","ltquest":"⩻","ltri":"◃","ltrie":"⊴","ltrif":"◂","ltrPar":"⦖","lurdshar":"⥊","luruhar":"⥦","lvertneqq":"≨︀","lvnE":"≨︀","macr":"¯","male":"♂","malt":"✠","maltese":"✠","Map":"⤅","map":"↦","mapsto":"↦","mapstodown":"↧","mapstoleft":"↤","mapstoup":"↥","marker":"▮","mcomma":"⨩","Mcy":"М","mcy":"м","mdash":"—","mDDot":"∺","measuredangle":"∡","MediumSpace":" ","Mellintrf":"ℳ","Mfr":"𝔐","mfr":"𝔪","mho":"℧","micro":"µ","midast":"*","midcir":"⫰","mid":"∣","middot":"·","minusb":"⊟","minus":"−","minusd":"∸","minusdu":"⨪","MinusPlus":"∓","mlcp":"⫛","mldr":"…","mnplus":"∓","models":"⊧","Mopf":"𝕄","mopf":"𝕞","mp":"∓","mscr":"𝓂","Mscr":"ℳ","mstpos":"∾","Mu":"Μ","mu":"μ","multimap":"⊸","mumap":"⊸","nabla":"∇","Nacute":"Ń","nacute":"ń","nang":"∠⃒","nap":"≉","napE":"⩰̸","napid":"≋̸","napos":"ʼn","napprox":"≉","natural":"♮","naturals":"ℕ","natur":"♮","nbsp":" ","nbump":"≎̸","nbumpe":"≏̸","ncap":"⩃","Ncaron":"Ň","ncaron":"ň","Ncedil":"Ņ","ncedil":"ņ","ncong":"≇","ncongdot":"⩭̸","ncup":"⩂","Ncy":"Н","ncy":"н","ndash":"–","nearhk":"⤤","nearr":"↗","neArr":"⇗","nearrow":"↗","ne":"≠","nedot":"≐̸","NegativeMediumSpace":"","NegativeThickSpace":"","NegativeThinSpace":"","NegativeVeryThinSpace":"","nequiv":"≢","nesear":"⤨","nesim":"≂̸","NestedGreaterGreater":"≫","NestedLessLess":"≪","NewLine":"\n","nexist":"∄","nexists":"∄","Nfr":"𝔑","nfr":"𝔫","ngE":"≧̸","nge":"≱","ngeq":"≱","ngeqq":"≧̸","ngeqslant":"⩾̸","nges":"⩾̸","nGg":"⋙̸","ngsim":"≵","nGt":"≫⃒","ngt":"≯","ngtr":"≯","nGtv":"≫̸","nharr":"↮","nhArr":"⇎","nhpar":"⫲","ni":"∋","nis":"⋼","nisd":"⋺","niv":"∋","NJcy":"Њ","njcy":"њ","nlarr":"↚","nlArr":"⇍","nldr":"‥","nlE":"≦̸","nle":"≰","nleftarrow":"↚","nLeftarrow":"⇍","nleftrightarrow":"↮","nLeftrightarrow":"⇎","nleq":"≰","nleqq":"≦̸","nleqslant":"⩽̸","nles":"⩽̸","nless":"≮","nLl":"⋘̸","nlsim":"≴","nLt":"≪⃒","nlt":"≮","nltri":"⋪","nltrie":"⋬","nLtv":"≪̸","nmid":"∤","NoBreak":"","NonBreakingSpace":" ","nopf":"𝕟","Nopf":"ℕ","Not":"⫬","not":"¬","NotCongruent":"≢","NotCupCap":"≭","NotDoubleVerticalBar":"∦","NotElement":"∉","NotEqual":"≠","NotEqualTilde":"≂̸","NotExists":"∄","NotGreater":"≯","NotGreaterEqual":"≱","NotGreaterFullEqual":"≧̸","NotGreaterGreater":"≫̸","NotGreaterLess":"≹","NotGreaterSlantEqual":"⩾̸","NotGreaterTilde":"≵","NotHumpDownHump":"≎̸","NotHumpEqual":"≏̸","notin":"∉","notindot":"⋵̸","notinE":"⋹̸","notinva":"∉","notinvb":"⋷","notinvc":"⋶","NotLeftTriangleBar":"⧏̸","NotLeftTriangle":"⋪","NotLeftTriangleEqual":"⋬","NotLess":"≮","NotLessEqual":"≰","NotLessGreater":"≸","NotLessLess":"≪̸","NotLessSlantEqual":"⩽̸","NotLessTilde":"≴","NotNestedGreaterGreater":"⪢̸","NotNestedLessLess":"⪡̸","notni":"∌","notniva":"∌","notnivb":"⋾","notnivc":"⋽","NotPrecedes":"⊀","NotPrecedesEqual":"⪯̸","NotPrecedesSlantEqual":"⋠","NotReverseElement":"∌","NotRightTriangleBar":"⧐̸","NotRightTriangle":"⋫","NotRightTriangleEqual":"⋭","NotSquareSubset":"⊏̸","NotSquareSubsetEqual":"⋢","NotSquareSuperset":"⊐̸","NotSquareSupersetEqual":"⋣","NotSubset":"⊂⃒","NotSubsetEqual":"⊈","NotSucceeds":"⊁","NotSucceedsEqual":"⪰̸","NotSucceedsSlantEqual":"⋡","NotSucceedsTilde":"≿̸","NotSuperset":"⊃⃒","NotSupersetEqual":"⊉","NotTilde":"≁","NotTildeEqual":"≄","NotTildeFullEqual":"≇","NotTildeTilde":"≉","NotVerticalBar":"∤","nparallel":"∦","npar":"∦","nparsl":"⫽⃥","npart":"∂̸","npolint":"⨔","npr":"⊀","nprcue":"⋠","nprec":"⊀","npreceq":"⪯̸","npre":"⪯̸","nrarrc":"⤳̸","nrarr":"↛","nrArr":"⇏","nrarrw":"↝̸","nrightarrow":"↛","nRightarrow":"⇏","nrtri":"⋫","nrtrie":"⋭","nsc":"⊁","nsccue":"⋡","nsce":"⪰̸","Nscr":"𝒩","nscr":"𝓃","nshortmid":"∤","nshortparallel":"∦","nsim":"≁","nsime":"≄","nsimeq":"≄","nsmid":"∤","nspar":"∦","nsqsube":"⋢","nsqsupe":"⋣","nsub":"⊄","nsubE":"⫅̸","nsube":"⊈","nsubset":"⊂⃒","nsubseteq":"⊈","nsubseteqq":"⫅̸","nsucc":"⊁","nsucceq":"⪰̸","nsup":"⊅","nsupE":"⫆̸","nsupe":"⊉","nsupset":"⊃⃒","nsupseteq":"⊉","nsupseteqq":"⫆̸","ntgl":"≹","Ntilde":"Ñ","ntilde":"ñ","ntlg":"≸","ntriangleleft":"⋪","ntrianglelefteq":"⋬","ntriangleright":"⋫","ntrianglerighteq":"⋭","Nu":"Ν","nu":"ν","num":"#","numero":"№","numsp":" ","nvap":"≍⃒","nvdash":"⊬","nvDash":"⊭","nVdash":"⊮","nVDash":"⊯","nvge":"≥⃒","nvgt":">⃒","nvHarr":"⤄","nvinfin":"⧞","nvlArr":"⤂","nvle":"≤⃒","nvlt":"<⃒","nvltrie":"⊴⃒","nvrArr":"⤃","nvrtrie":"⊵⃒","nvsim":"∼⃒","nwarhk":"⤣","nwarr":"↖","nwArr":"⇖","nwarrow":"↖","nwnear":"⤧","Oacute":"Ó","oacute":"ó","oast":"⊛","Ocirc":"Ô","ocirc":"ô","ocir":"⊚","Ocy":"О","ocy":"о","odash":"⊝","Odblac":"Ő","odblac":"ő","odiv":"⨸","odot":"⊙","odsold":"⦼","OElig":"Œ","oelig":"œ","ofcir":"⦿","Ofr":"𝔒","ofr":"𝔬","ogon":"˛","Ograve":"Ò","ograve":"ò","ogt":"⧁","ohbar":"⦵","ohm":"Ω","oint":"∮","olarr":"↺","olcir":"⦾","olcross":"⦻","oline":"‾","olt":"⧀","Omacr":"Ō","omacr":"ō","Omega":"Ω","omega":"ω","Omicron":"Ο","omicron":"ο","omid":"⦶","ominus":"⊖","Oopf":"𝕆","oopf":"𝕠","opar":"⦷","OpenCurlyDoubleQuote":"“","OpenCurlyQuote":"‘","operp":"⦹","oplus":"⊕","orarr":"↻","Or":"⩔","or":"∨","ord":"⩝","order":"ℴ","orderof":"ℴ","ordf":"ª","ordm":"º","origof":"⊶","oror":"⩖","orslope":"⩗","orv":"⩛","oS":"Ⓢ","Oscr":"𝒪","oscr":"ℴ","Oslash":"Ø","oslash":"ø","osol":"⊘","Otilde":"Õ","otilde":"õ","otimesas":"⨶","Otimes":"⨷","otimes":"⊗","Ouml":"Ö","ouml":"ö","ovbar":"⌽","OverBar":"‾","OverBrace":"⏞","OverBracket":"⎴","OverParenthesis":"⏜","para":"¶","parallel":"∥","par":"∥","parsim":"⫳","parsl":"⫽","part":"∂","PartialD":"∂","Pcy":"П","pcy":"п","percnt":"%","period":".","permil":"‰","perp":"⊥","pertenk":"‱","Pfr":"𝔓","pfr":"𝔭","Phi":"Φ","phi":"φ","phiv":"ϕ","phmmat":"ℳ","phone":"☎","Pi":"Π","pi":"π","pitchfork":"⋔","piv":"ϖ","planck":"ℏ","planckh":"ℎ","plankv":"ℏ","plusacir":"⨣","plusb":"⊞","pluscir":"⨢","plus":"+","plusdo":"∔","plusdu":"⨥","pluse":"⩲","PlusMinus":"±","plusmn":"±","plussim":"⨦","plustwo":"⨧","pm":"±","Poincareplane":"ℌ","pointint":"⨕","popf":"𝕡","Popf":"ℙ","pound":"£","prap":"⪷","Pr":"⪻","pr":"≺","prcue":"≼","precapprox":"⪷","prec":"≺","preccurlyeq":"≼","Precedes":"≺","PrecedesEqual":"⪯","PrecedesSlantEqual":"≼","PrecedesTilde":"≾","preceq":"⪯","precnapprox":"⪹","precneqq":"⪵","precnsim":"⋨","pre":"⪯","prE":"⪳","precsim":"≾","prime":"′","Prime":"″","primes":"ℙ","prnap":"⪹","prnE":"⪵","prnsim":"⋨","prod":"∏","Product":"∏","profalar":"⌮","profline":"⌒","profsurf":"⌓","prop":"∝","Proportional":"∝","Proportion":"∷","propto":"∝","prsim":"≾","prurel":"⊰","Pscr":"𝒫","pscr":"𝓅","Psi":"Ψ","psi":"ψ","puncsp":" ","Qfr":"𝔔","qfr":"𝔮","qint":"⨌","qopf":"𝕢","Qopf":"ℚ","qprime":"⁗","Qscr":"𝒬","qscr":"𝓆","quaternions":"ℍ","quatint":"⨖","quest":"?","questeq":"≟","quot":"\"","QUOT":"\"","rAarr":"⇛","race":"∽̱","Racute":"Ŕ","racute":"ŕ","radic":"√","raemptyv":"⦳","rang":"⟩","Rang":"⟫","rangd":"⦒","range":"⦥","rangle":"⟩","raquo":"»","rarrap":"⥵","rarrb":"⇥","rarrbfs":"⤠","rarrc":"⤳","rarr":"→","Rarr":"↠","rArr":"⇒","rarrfs":"⤞","rarrhk":"↪","rarrlp":"↬","rarrpl":"⥅","rarrsim":"⥴","Rarrtl":"⤖","rarrtl":"↣","rarrw":"↝","ratail":"⤚","rAtail":"⤜","ratio":"∶","rationals":"ℚ","rbarr":"⤍","rBarr":"⤏","RBarr":"⤐","rbbrk":"❳","rbrace":"}","rbrack":"]","rbrke":"⦌","rbrksld":"⦎","rbrkslu":"⦐","Rcaron":"Ř","rcaron":"ř","Rcedil":"Ŗ","rcedil":"ŗ","rceil":"⌉","rcub":"}","Rcy":"Р","rcy":"р","rdca":"⤷","rdldhar":"⥩","rdquo":"”","rdquor":"”","rdsh":"↳","real":"ℜ","realine":"ℛ","realpart":"ℜ","reals":"ℝ","Re":"ℜ","rect":"▭","reg":"®","REG":"®","ReverseElement":"∋","ReverseEquilibrium":"⇋","ReverseUpEquilibrium":"⥯","rfisht":"⥽","rfloor":"⌋","rfr":"𝔯","Rfr":"ℜ","rHar":"⥤","rhard":"⇁","rharu":"⇀","rharul":"⥬","Rho":"Ρ","rho":"ρ","rhov":"ϱ","RightAngleBracket":"⟩","RightArrowBar":"⇥","rightarrow":"→","RightArrow":"→","Rightarrow":"⇒","RightArrowLeftArrow":"⇄","rightarrowtail":"↣","RightCeiling":"⌉","RightDoubleBracket":"⟧","RightDownTeeVector":"⥝","RightDownVectorBar":"⥕","RightDownVector":"⇂","RightFloor":"⌋","rightharpoondown":"⇁","rightharpoonup":"⇀","rightleftarrows":"⇄","rightleftharpoons":"⇌","rightrightarrows":"⇉","rightsquigarrow":"↝","RightTeeArrow":"↦","RightTee":"⊢","RightTeeVector":"⥛","rightthreetimes":"⋌","RightTriangleBar":"⧐","RightTriangle":"⊳","RightTriangleEqual":"⊵","RightUpDownVector":"⥏","RightUpTeeVector":"⥜","RightUpVectorBar":"⥔","RightUpVector":"↾","RightVectorBar":"⥓","RightVector":"⇀","ring":"˚","risingdotseq":"≓","rlarr":"⇄","rlhar":"⇌","rlm":"","rmoustache":"⎱","rmoust":"⎱","rnmid":"⫮","roang":"⟭","roarr":"⇾","robrk":"⟧","ropar":"⦆","ropf":"𝕣","Ropf":"ℝ","roplus":"⨮","rotimes":"⨵","RoundImplies":"⥰","rpar":")","rpargt":"⦔","rppolint":"⨒","rrarr":"⇉","Rrightarrow":"⇛","rsaquo":"›","rscr":"𝓇","Rscr":"ℛ","rsh":"↱","Rsh":"↱","rsqb":"]","rsquo":"’","rsquor":"’","rthree":"⋌","rtimes":"⋊","rtri":"▹","rtrie":"⊵","rtrif":"▸","rtriltri":"⧎","RuleDelayed":"⧴","ruluhar":"⥨","rx":"℞","Sacute":"Ś","sacute":"ś","sbquo":"‚","scap":"⪸","Scaron":"Š","scaron":"š","Sc":"⪼","sc":"≻","sccue":"≽","sce":"⪰","scE":"⪴","Scedil":"Ş","scedil":"ş","Scirc":"Ŝ","scirc":"ŝ","scnap":"⪺","scnE":"⪶","scnsim":"⋩","scpolint":"⨓","scsim":"≿","Scy":"С","scy":"с","sdotb":"⊡","sdot":"⋅","sdote":"⩦","searhk":"⤥","searr":"↘","seArr":"⇘","searrow":"↘","sect":"§","semi":";","seswar":"⤩","setminus":"∖","setmn":"∖","sext":"✶","Sfr":"𝔖","sfr":"𝔰","sfrown":"⌢","sharp":"♯","SHCHcy":"Щ","shchcy":"щ","SHcy":"Ш","shcy":"ш","ShortDownArrow":"↓","ShortLeftArrow":"←","shortmid":"∣","shortparallel":"∥","ShortRightArrow":"→","ShortUpArrow":"↑","shy":"","Sigma":"Σ","sigma":"σ","sigmaf":"ς","sigmav":"ς","sim":"∼","simdot":"⩪","sime":"≃","simeq":"≃","simg":"⪞","simgE":"⪠","siml":"⪝","simlE":"⪟","simne":"≆","simplus":"⨤","simrarr":"⥲","slarr":"←","SmallCircle":"∘","smallsetminus":"∖","smashp":"⨳","smeparsl":"⧤","smid":"∣","smile":"⌣","smt":"⪪","smte":"⪬","smtes":"⪬︀","SOFTcy":"Ь","softcy":"ь","solbar":"⌿","solb":"⧄","sol":"/","Sopf":"𝕊","sopf":"𝕤","spades":"♠","spadesuit":"♠","spar":"∥","sqcap":"⊓","sqcaps":"⊓︀","sqcup":"⊔","sqcups":"⊔︀","Sqrt":"√","sqsub":"⊏","sqsube":"⊑","sqsubset":"⊏","sqsubseteq":"⊑","sqsup":"⊐","sqsupe":"⊒","sqsupset":"⊐","sqsupseteq":"⊒","square":"□","Square":"□","SquareIntersection":"⊓","SquareSubset":"⊏","SquareSubsetEqual":"⊑","SquareSuperset":"⊐","SquareSupersetEqual":"⊒","SquareUnion":"⊔","squarf":"▪","squ":"□","squf":"▪","srarr":"→","Sscr":"𝒮","sscr":"𝓈","ssetmn":"∖","ssmile":"⌣","sstarf":"⋆","Star":"⋆","star":"☆","starf":"★","straightepsilon":"ϵ","straightphi":"ϕ","strns":"¯","sub":"⊂","Sub":"⋐","subdot":"⪽","subE":"⫅","sube":"⊆","subedot":"⫃","submult":"⫁","subnE":"⫋","subne":"⊊","subplus":"⪿","subrarr":"⥹","subset":"⊂","Subset":"⋐","subseteq":"⊆","subseteqq":"⫅","SubsetEqual":"⊆","subsetneq":"⊊","subsetneqq":"⫋","subsim":"⫇","subsub":"⫕","subsup":"⫓","succapprox":"⪸","succ":"≻","succcurlyeq":"≽","Succeeds":"≻","SucceedsEqual":"⪰","SucceedsSlantEqual":"≽","SucceedsTilde":"≿","succeq":"⪰","succnapprox":"⪺","succneqq":"⪶","succnsim":"⋩","succsim":"≿","SuchThat":"∋","sum":"∑","Sum":"∑","sung":"♪","sup1":"¹","sup2":"²","sup3":"³","sup":"⊃","Sup":"⋑","supdot":"⪾","supdsub":"⫘","supE":"⫆","supe":"⊇","supedot":"⫄","Superset":"⊃","SupersetEqual":"⊇","suphsol":"⟉","suphsub":"⫗","suplarr":"⥻","supmult":"⫂","supnE":"⫌","supne":"⊋","supplus":"⫀","supset":"⊃","Supset":"⋑","supseteq":"⊇","supseteqq":"⫆","supsetneq":"⊋","supsetneqq":"⫌","supsim":"⫈","supsub":"⫔","supsup":"⫖","swarhk":"⤦","swarr":"↙","swArr":"⇙","swarrow":"↙","swnwar":"⤪","szlig":"ß","Tab":"\t","target":"⌖","Tau":"Τ","tau":"τ","tbrk":"⎴","Tcaron":"Ť","tcaron":"ť","Tcedil":"Ţ","tcedil":"ţ","Tcy":"Т","tcy":"т","tdot":"⃛","telrec":"⌕","Tfr":"𝔗","tfr":"𝔱","there4":"∴","therefore":"∴","Therefore":"∴","Theta":"Θ","theta":"θ","thetasym":"ϑ","thetav":"ϑ","thickapprox":"≈","thicksim":"∼","ThickSpace":" ","ThinSpace":" ","thinsp":" ","thkap":"≈","thksim":"∼","THORN":"Þ","thorn":"þ","tilde":"˜","Tilde":"∼","TildeEqual":"≃","TildeFullEqual":"≅","TildeTilde":"≈","timesbar":"⨱","timesb":"⊠","times":"×","timesd":"⨰","tint":"∭","toea":"⤨","topbot":"⌶","topcir":"⫱","top":"⊤","Topf":"𝕋","topf":"𝕥","topfork":"⫚","tosa":"⤩","tprime":"‴","trade":"™","TRADE":"™","triangle":"▵","triangledown":"▿","triangleleft":"◃","trianglelefteq":"⊴","triangleq":"≜","triangleright":"▹","trianglerighteq":"⊵","tridot":"◬","trie":"≜","triminus":"⨺","TripleDot":"⃛","triplus":"⨹","trisb":"⧍","tritime":"⨻","trpezium":"⏢","Tscr":"𝒯","tscr":"𝓉","TScy":"Ц","tscy":"ц","TSHcy":"Ћ","tshcy":"ћ","Tstrok":"Ŧ","tstrok":"ŧ","twixt":"≬","twoheadleftarrow":"↞","twoheadrightarrow":"↠","Uacute":"Ú","uacute":"ú","uarr":"↑","Uarr":"↟","uArr":"⇑","Uarrocir":"⥉","Ubrcy":"Ў","ubrcy":"ў","Ubreve":"Ŭ","ubreve":"ŭ","Ucirc":"Û","ucirc":"û","Ucy":"У","ucy":"у","udarr":"⇅","Udblac":"Ű","udblac":"ű","udhar":"⥮","ufisht":"⥾","Ufr":"𝔘","ufr":"𝔲","Ugrave":"Ù","ugrave":"ù","uHar":"⥣","uharl":"↿","uharr":"↾","uhblk":"▀","ulcorn":"⌜","ulcorner":"⌜","ulcrop":"⌏","ultri":"◸","Umacr":"Ū","umacr":"ū","uml":"¨","UnderBar":"_","UnderBrace":"⏟","UnderBracket":"⎵","UnderParenthesis":"⏝","Union":"⋃","UnionPlus":"⊎","Uogon":"Ų","uogon":"ų","Uopf":"𝕌","uopf":"𝕦","UpArrowBar":"⤒","uparrow":"↑","UpArrow":"↑","Uparrow":"⇑","UpArrowDownArrow":"⇅","updownarrow":"↕","UpDownArrow":"↕","Updownarrow":"⇕","UpEquilibrium":"⥮","upharpoonleft":"↿","upharpoonright":"↾","uplus":"⊎","UpperLeftArrow":"↖","UpperRightArrow":"↗","upsi":"υ","Upsi":"ϒ","upsih":"ϒ","Upsilon":"Υ","upsilon":"υ","UpTeeArrow":"↥","UpTee":"⊥","upuparrows":"⇈","urcorn":"⌝","urcorner":"⌝","urcrop":"⌎","Uring":"Ů","uring":"ů","urtri":"◹","Uscr":"𝒰","uscr":"𝓊","utdot":"⋰","Utilde":"Ũ","utilde":"ũ","utri":"▵","utrif":"▴","uuarr":"⇈","Uuml":"Ü","uuml":"ü","uwangle":"⦧","vangrt":"⦜","varepsilon":"ϵ","varkappa":"ϰ","varnothing":"∅","varphi":"ϕ","varpi":"ϖ","varpropto":"∝","varr":"↕","vArr":"⇕","varrho":"ϱ","varsigma":"ς","varsubsetneq":"⊊︀","varsubsetneqq":"⫋︀","varsupsetneq":"⊋︀","varsupsetneqq":"⫌︀","vartheta":"ϑ","vartriangleleft":"⊲","vartriangleright":"⊳","vBar":"⫨","Vbar":"⫫","vBarv":"⫩","Vcy":"В","vcy":"в","vdash":"⊢","vDash":"⊨","Vdash":"⊩","VDash":"⊫","Vdashl":"⫦","veebar":"⊻","vee":"∨","Vee":"⋁","veeeq":"≚","vellip":"⋮","verbar":"|","Verbar":"‖","vert":"|","Vert":"‖","VerticalBar":"∣","VerticalLine":"|","VerticalSeparator":"❘","VerticalTilde":"≀","VeryThinSpace":" ","Vfr":"𝔙","vfr":"𝔳","vltri":"⊲","vnsub":"⊂⃒","vnsup":"⊃⃒","Vopf":"𝕍","vopf":"𝕧","vprop":"∝","vrtri":"⊳","Vscr":"𝒱","vscr":"𝓋","vsubnE":"⫋︀","vsubne":"⊊︀","vsupnE":"⫌︀","vsupne":"⊋︀","Vvdash":"⊪","vzigzag":"⦚","Wcirc":"Ŵ","wcirc":"ŵ","wedbar":"⩟","wedge":"∧","Wedge":"⋀","wedgeq":"≙","weierp":"℘","Wfr":"𝔚","wfr":"𝔴","Wopf":"𝕎","wopf":"𝕨","wp":"℘","wr":"≀","wreath":"≀","Wscr":"𝒲","wscr":"𝓌","xcap":"⋂","xcirc":"◯","xcup":"⋃","xdtri":"▽","Xfr":"𝔛","xfr":"𝔵","xharr":"⟷","xhArr":"⟺","Xi":"Ξ","xi":"ξ","xlarr":"⟵","xlArr":"⟸","xmap":"⟼","xnis":"⋻","xodot":"⨀","Xopf":"𝕏","xopf":"𝕩","xoplus":"⨁","xotime":"⨂","xrarr":"⟶","xrArr":"⟹","Xscr":"𝒳","xscr":"𝓍","xsqcup":"⨆","xuplus":"⨄","xutri":"△","xvee":"⋁","xwedge":"⋀","Yacute":"Ý","yacute":"ý","YAcy":"Я","yacy":"я","Ycirc":"Ŷ","ycirc":"ŷ","Ycy":"Ы","ycy":"ы","yen":"¥","Yfr":"𝔜","yfr":"𝔶","YIcy":"Ї","yicy":"ї","Yopf":"𝕐","yopf":"𝕪","Yscr":"𝒴","yscr":"𝓎","YUcy":"Ю","yucy":"ю","yuml":"ÿ","Yuml":"Ÿ","Zacute":"Ź","zacute":"ź","Zcaron":"Ž","zcaron":"ž","Zcy":"З","zcy":"з","Zdot":"Ż","zdot":"ż","zeetrf":"ℨ","ZeroWidthSpace":"","Zeta":"Ζ","zeta":"ζ","zfr":"𝔷","Zfr":"ℨ","ZHcy":"Ж","zhcy":"ж","zigrarr":"⇝","zopf":"𝕫","Zopf":"ℤ","Zscr":"𝒵","zscr":"𝓏","zwj":"","zwnj":""} diff --git a/node_modules/entities/lib/maps/legacy.json b/node_modules/entities/lib/maps/legacy.json new file mode 100644 index 0000000..43dbea6 --- /dev/null +++ b/node_modules/entities/lib/maps/legacy.json @@ -0,0 +1 @@ +{"Aacute":"Á","aacute":"á","Acirc":"Â","acirc":"â","acute":"´","AElig":"Æ","aelig":"æ","Agrave":"À","agrave":"à","amp":"&","AMP":"&","Aring":"Å","aring":"å","Atilde":"Ã","atilde":"ã","Auml":"Ä","auml":"ä","brvbar":"¦","Ccedil":"Ç","ccedil":"ç","cedil":"¸","cent":"¢","copy":"©","COPY":"©","curren":"¤","deg":"°","divide":"÷","Eacute":"É","eacute":"é","Ecirc":"Ê","ecirc":"ê","Egrave":"È","egrave":"è","ETH":"Ð","eth":"ð","Euml":"Ë","euml":"ë","frac12":"½","frac14":"¼","frac34":"¾","gt":">","GT":">","Iacute":"Í","iacute":"í","Icirc":"Î","icirc":"î","iexcl":"¡","Igrave":"Ì","igrave":"ì","iquest":"¿","Iuml":"Ï","iuml":"ï","laquo":"«","lt":"<","LT":"<","macr":"¯","micro":"µ","middot":"·","nbsp":" ","not":"¬","Ntilde":"Ñ","ntilde":"ñ","Oacute":"Ó","oacute":"ó","Ocirc":"Ô","ocirc":"ô","Ograve":"Ò","ograve":"ò","ordf":"ª","ordm":"º","Oslash":"Ø","oslash":"ø","Otilde":"Õ","otilde":"õ","Ouml":"Ö","ouml":"ö","para":"¶","plusmn":"±","pound":"£","quot":"\"","QUOT":"\"","raquo":"»","reg":"®","REG":"®","sect":"§","shy":"","sup1":"¹","sup2":"²","sup3":"³","szlig":"ß","THORN":"Þ","thorn":"þ","times":"×","Uacute":"Ú","uacute":"ú","Ucirc":"Û","ucirc":"û","Ugrave":"Ù","ugrave":"ù","uml":"¨","Uuml":"Ü","uuml":"ü","Yacute":"Ý","yacute":"ý","yen":"¥","yuml":"ÿ"} diff --git a/node_modules/entities/lib/maps/xml.json b/node_modules/entities/lib/maps/xml.json new file mode 100644 index 0000000..de8db10 --- /dev/null +++ b/node_modules/entities/lib/maps/xml.json @@ -0,0 +1 @@ +{"amp":"&","apos":"'","gt":">","lt":"<","quot":"\""} diff --git a/node_modules/entities/package.json b/node_modules/entities/package.json new file mode 100644 index 0000000..4dfb501 --- /dev/null +++ b/node_modules/entities/package.json @@ -0,0 +1,63 @@ +{ + "name": "entities", + "version": "2.1.0", + "description": "Encode & decode XML and HTML entities with ease", + "author": "Felix Boehm <me@feedic.com>", + "funding": "https://github.com/fb55/entities?sponsor=1", + "sideEffects": false, + "keywords": [ + "entity", + "decoding", + "encoding", + "html", + "xml", + "html entities" + ], + "directories": { + "lib": "lib/" + }, + "main": "lib/index.js", + "types": "lib/index.d.ts", + "files": [ + "lib/**/*" + ], + "devDependencies": { + "@types/jest": "^26.0.0", + "@types/node": "^14.11.8", + "@typescript-eslint/eslint-plugin": "^4.4.1", + "@typescript-eslint/parser": "^4.4.1", + "coveralls": "*", + "eslint": "^7.11.0", + "eslint-config-prettier": "^6.0.0", + "eslint-plugin-node": "^11.1.0", + "jest": "^26.5.3", + "prettier": "^2.0.5", + "ts-jest": "^26.1.0", + "typescript": "^4.0.2" + }, + "scripts": { + "test": "jest --coverage && npm run lint", + "coverage": "cat coverage/lcov.info | coveralls", + "lint": "npm run lint:es && npm run lint:prettier", + "lint:es": "eslint .", + "lint:prettier": "npm run prettier -- --check", + "format": "npm run format:es && npm run format:prettier", + "format:es": "npm run lint:es -- --fix", + "format:prettier": "npm run prettier -- --write", + "prettier": "prettier '**/*.{ts,md,json,yml}'", + "build": "tsc && cp -r src/maps lib", + "prepare": "npm run build" + }, + "repository": { + "type": "git", + "url": "git://github.com/fb55/entities.git" + }, + "license": "BSD-2-Clause", + "jest": { + "preset": "ts-jest", + "testEnvironment": "node" + }, + "prettier": { + "tabWidth": 4 + } +} diff --git a/node_modules/entities/readme.md b/node_modules/entities/readme.md new file mode 100644 index 0000000..7c7679d --- /dev/null +++ b/node_modules/entities/readme.md @@ -0,0 +1,50 @@ +# entities [![NPM version](http://img.shields.io/npm/v/entities.svg)](https://npmjs.org/package/entities) [![Downloads](https://img.shields.io/npm/dm/entities.svg)](https://npmjs.org/package/entities) [![Build Status](http://img.shields.io/travis/fb55/entities.svg)](http://travis-ci.org/fb55/entities) [![Coverage](http://img.shields.io/coveralls/fb55/entities.svg)](https://coveralls.io/r/fb55/entities) + +Encode & decode HTML & XML entities with ease & speed. + +## How to… + +### …install `entities` + + npm install entities + +### …use `entities` + +```javascript +const entities = require("entities"); + +//encoding +entities.escape("&"); // "&#38;" +entities.encodeXML("&"); // "&#38;" +entities.encodeHTML("&"); // "&#38;" + +//decoding +entities.decodeXML("asdf & ÿ ü '"); // "asdf & ÿ ü '" +entities.decodeHTML("asdf & ÿ ü '"); // "asdf & ÿ ü '" +``` + +## Performance + +This is how `entities` compares to other libraries on a very basic benchmark (see `scripts/benchmark.ts`, for 10,000,000 iterations): + +| Library | `decode` performance | `encode` performance | Bundle size | +| -------------- | -------------------- | -------------------- | -------------------------------------------------------------------------- | +| entities | 10.809s | 17.683s | ![npm bundle size](https://img.shields.io/bundlephobia/min/entities) | +| html-entities | 14.029s | 22.670s | ![npm bundle size](https://img.shields.io/bundlephobia/min/html-entities) | +| he | 16.163s | 44.010s | ![npm bundle size](https://img.shields.io/bundlephobia/min/he) | +| parse-entities | 28.507s | N/A | ![npm bundle size](https://img.shields.io/bundlephobia/min/parse-entities) | + +--- + +License: BSD-2-Clause + +## Security contact information + +To report a security vulnerability, please use the [Tidelift security contact](https://tidelift.com/security). +Tidelift will coordinate the fix and disclosure. + +## `entities` for enterprise + +Available as part of the Tidelift Subscription + +The maintainers of `entities` and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-entities?utm_source=npm-entities&utm_medium=referral&utm_campaign=enterprise&utm_term=repo) diff --git a/node_modules/linkify-it/CHANGELOG.md b/node_modules/linkify-it/CHANGELOG.md new file mode 100644 index 0000000..6fa47da --- /dev/null +++ b/node_modules/linkify-it/CHANGELOG.md @@ -0,0 +1,182 @@ +3.0.3 / 2021-10-01 +------------------ + +- Fixed #98. Don't count `;` at the end of link (when followed with space). + + +3.0.2 / 2020-05-20 +------------------ + +- Proper fix for #54. Allow multiple `!` in links (but not at the end). + + +3.0.1 / 2020-05-19 +------------------ + +- Reverted #54 fix (allowed multiple `!` in links), and added collision + sample. + + +3.0.0 / 2020-05-19 +------------------ + +- Allow unlimited `.` inside link params, #81. This should not be breaking, but + bumped version for sure. +- Allow `..&` in params, #87. +- Allow multiple `!` in links, #54. +- Deps bump. +- Rewrite build scripts. + + +2.2.0 / 2019-07-12 +------------------ + +- Improved quoted email detect (disable `"` at email start), #72. +- Fix some google links (allow more consecutive `.`), #66. + + +2.1.0 / 2018-11-27 +------------------ + +- Allow `--` (and more dashes) in domain names, #63. + + +2.0.3 / 2016-12-09 +------------------ + +- Process `|` (asian vertical pipe 0xFF5C) as valid text separator. + + +2.0.2 / 2016-10-15 +------------------ + +- Allow dashes in local domains, #43. + + +2.0.1 / 2016-09-28 +------------------ + +- Restrict user:pass@... content - prohibit "()[]" chars in auth, #41. + + +2.0.0 / 2016-06-22 +------------------ + +- `---` no longer terminates link. Use option `{ '---': true }` to return old + behaviour. +- `.onCompile()` hook to modify base regexp constants. +- Allow `foo'-bar` in path + + +1.2.4 / 2016-06-03 +------------------ + +- Consider `<` & `>` as invalid in links. +- Support links in lt/gt braces: `<user@domain.com>`, `<http://example.com>`. + + +1.2.3 / 2016-05-31 +------------------ + +- Allow digits in local domains, #36. +- Restrict user/pass (prohibit [@/] chars) to avoid wrong domain fetch. +- More restrictions for protocol-transparent links. Don't allow single-level + (local) domains, except '//localhost', #19. + + +1.2.2 / 2016-05-30 +------------------ + +- Security fix: due problem in `Any` class regexp from old `unicode-7.0.0` + package (used in `uc-micro`), hang happend with astral char patterns like + `😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡😡 .com` if fuzzy + options used. New installs will use fixed `uc-micro` automatically. + Old installs need to be updated. #36. +- Unicode rules updated to 8.+ version. + + +1.2.1 / 2016-04-29 +------------------ + +- Fix detect email after opening parenthesis: `(my@email.com)`, #32. + + +1.2.0 / 2015-06-29 +------------------ + +- Allow dash at the end of url, thanks to @Mumakil. + + +1.1.1 / 2015-06-09 +------------------ + +- Allow ".." in link paths. + + +1.1.0 / 2015-04-21 +------------------ + +- Added options to control fuzzy links recognition (`fuzzyLink: true`, + `fuzzyEmail: true`, `fuzzyIP: false`). +- Disabled IP-links without schema prefix by default. + + +1.0.1 / 2015-04-19 +------------------ + +- More strict default 2-characters tlds handle in fuzzy links, to avoid + false positives for `node.js`, `io.js` and so on. + + +1.0.0 / 2015-03-25 +------------------ + +- Version bump to 1.0.0 for semver. +- Removed `Cf` class from whitespace & punctuation sets (#10). +- API change. Exported regex names renamed to reflect changes. Update your + custom rules if needed: + - `src_ZPCcCf` -> `src_ZPCc` + - `src_ZCcCf` -> `src_ZCc` + + +0.1.5 / 2015-03-13 +------------------ + +- Fixed special chars handling (line breaks). +- Fixed demo permalink encode/decode. + + +0.1.4 / 2015-03-12 +------------------ + +- Allow `..` and `...` inside of link paths (#9). Useful for github links with + commit ranges. +- Added `.pretest()` method for speed optimizations. +- Autogenerate demo sample from fixtures. + + +0.1.3 / 2015-03-11 +------------------ + +- Maintenance release. Deps update. + + +0.1.2 / 2015-02-26 +------------------ + +- Fixed blockquoted links (some symbols exclusions), thanks to @MayhemYDG. +- Fixed demo permalinks, thanks to @MayhemYDG. + + +0.1.1 / 2015-02-22 +------------------ + +- Moved unicode data to external package. +- Demo permalink improvements. +- Docs update. + + +0.1.0 / 2015-02-12 +------------------ + +- First release. diff --git a/node_modules/linkify-it/LICENSE b/node_modules/linkify-it/LICENSE new file mode 100644 index 0000000..67596f5 --- /dev/null +++ b/node_modules/linkify-it/LICENSE @@ -0,0 +1,22 @@ +Copyright (c) 2015 Vitaly Puzrin. + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/linkify-it/README.md b/node_modules/linkify-it/README.md new file mode 100644 index 0000000..76eed7e --- /dev/null +++ b/node_modules/linkify-it/README.md @@ -0,0 +1,188 @@ +linkify-it +========== + +[![Build Status](https://img.shields.io/travis/markdown-it/linkify-it/master.svg?style=flat)](https://travis-ci.org/markdown-it/linkify-it) +[![NPM version](https://img.shields.io/npm/v/linkify-it.svg?style=flat)](https://www.npmjs.org/package/linkify-it) +[![Coverage Status](https://img.shields.io/coveralls/markdown-it/linkify-it/master.svg?style=flat)](https://coveralls.io/r/markdown-it/linkify-it?branch=master) +[![Gitter](https://badges.gitter.im/Join%20Chat.svg)](https://gitter.im/markdown-it/linkify-it) + +> Links recognition library with FULL unicode support. +> Focused on high quality link patterns detection in plain text. + +__[Demo](http://markdown-it.github.io/linkify-it/)__ + +Why it's awesome: + +- Full unicode support, _with astral characters_! +- International domains support. +- Allows rules extension & custom normalizers. + + +Install +------- + +```bash +npm install linkify-it --save +``` + +Browserification is also supported. + + +Usage examples +-------------- + +##### Example 1 + +```js +var linkify = require('linkify-it')(); + +// Reload full tlds list & add unofficial `.onion` domain. +linkify + .tlds(require('tlds')) // Reload with full tlds list + .tlds('onion', true) // Add unofficial `.onion` domain + .add('git:', 'http:') // Add `git:` protocol as "alias" + .add('ftp:', null) // Disable `ftp:` protocol + .set({ fuzzyIP: true }); // Enable IPs in fuzzy links (without schema) + +console.log(linkify.test('Site github.com!')); // true + +console.log(linkify.match('Site github.com!')); // [ { + // schema: "", + // index: 5, + // lastIndex: 15, + // raw: "github.com", + // text: "github.com", + // url: "http://github.com", + // } ] +``` + +##### Example 2. Add twitter mentions handler + +```js +linkify.add('@', { + validate: function (text, pos, self) { + var tail = text.slice(pos); + + if (!self.re.twitter) { + self.re.twitter = new RegExp( + '^([a-zA-Z0-9_]){1,15}(?!_)(?=$|' + self.re.src_ZPCc + ')' + ); + } + if (self.re.twitter.test(tail)) { + // Linkifier allows punctuation chars before prefix, + // but we additionally disable `@` ("@@mention" is invalid) + if (pos >= 2 && tail[pos - 2] === '@') { + return false; + } + return tail.match(self.re.twitter)[0].length; + } + return 0; + }, + normalize: function (match) { + match.url = 'https://twitter.com/' + match.url.replace(/^@/, ''); + } +}); +``` + + +API +--- + +__[API documentation](http://markdown-it.github.io/linkify-it/doc)__ + +### new LinkifyIt(schemas, options) + +Creates new linkifier instance with optional additional schemas. +Can be called without `new` keyword for convenience. + +By default understands: + +- `http(s)://...` , `ftp://...`, `mailto:...` & `//...` links +- "fuzzy" links and emails (google.com, foo@bar.com). + +`schemas` is an object, where each key/value describes protocol/rule: + +- __key__ - link prefix (usually, protocol name with `:` at the end, `skype:` + for example). `linkify-it` makes sure that prefix is not preceded with + alphanumeric char. +- __value__ - rule to check tail after link prefix + - _String_ - just alias to existing rule + - _Object_ + - _validate_ - either a `RegExp` (start with `^`, and don't include the + link prefix itself), or a validator function which, given arguments + _text_, _pos_, and _self_, returns the length of a match in _text_ + starting at index _pos_. _pos_ is the index right after the link prefix. + _self_ can be used to access the linkify object to cache data. + - _normalize_ - optional function to normalize text & url of matched result + (for example, for twitter mentions). + +`options`: + +- __fuzzyLink__ - recognize URL-s without `http(s)://` head. Default `true`. +- __fuzzyIP__ - allow IPs in fuzzy links above. Can conflict with some texts + like version numbers. Default `false`. +- __fuzzyEmail__ - recognize emails without `mailto:` prefix. Default `true`. +- __---__ - set `true` to terminate link with `---` (if it's considered as long dash). + + +### .test(text) + +Searches linkifiable pattern and returns `true` on success or `false` on fail. + + +### .pretest(text) + +Quick check if link MAY BE can exist. Can be used to optimize more expensive +`.test()` calls. Return `false` if link can not be found, `true` - if `.test()` +call needed to know exactly. + + +### .testSchemaAt(text, name, offset) + +Similar to `.test()` but checks only specific protocol tail exactly at given +position. Returns length of found pattern (0 on fail). + + +### .match(text) + +Returns `Array` of found link matches or null if nothing found. + +Each match has: + +- __schema__ - link schema, can be empty for fuzzy links, or `//` for + protocol-neutral links. +- __index__ - offset of matched text +- __lastIndex__ - index of next char after mathch end +- __raw__ - matched text +- __text__ - normalized text +- __url__ - link, generated from matched text + + +### .tlds(list[, keepOld]) + +Load (or merge) new tlds list. Those are needed for fuzzy links (without schema) +to avoid false positives. By default: + +- 2-letter root zones are ok. +- biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|рф are ok. +- encoded (`xn--...`) root zones are ok. + +If that's not enough, you can reload defaults with more detailed zones list. + +### .add(key, value) + +Add a new schema to the schemas object. As described in the constructor +definition, `key` is a link prefix (`skype:`, for example), and `value` +is a String to alias to another schema, or an Object with `validate` and +optionally `normalize` definitions. To disable an existing rule, use +`.add(key, null)`. + + +### .set(options) + +Override default options. Missed properties will not be changed. + + +## License + +[MIT](https://github.com/markdown-it/linkify-it/blob/master/LICENSE) diff --git a/node_modules/linkify-it/index.js b/node_modules/linkify-it/index.js new file mode 100644 index 0000000..5c0d572 --- /dev/null +++ b/node_modules/linkify-it/index.js @@ -0,0 +1,636 @@ +'use strict'; + + +//////////////////////////////////////////////////////////////////////////////// +// Helpers + +// Merge objects +// +function assign(obj /*from1, from2, from3, ...*/) { + var sources = Array.prototype.slice.call(arguments, 1); + + sources.forEach(function (source) { + if (!source) { return; } + + Object.keys(source).forEach(function (key) { + obj[key] = source[key]; + }); + }); + + return obj; +} + +function _class(obj) { return Object.prototype.toString.call(obj); } +function isString(obj) { return _class(obj) === '[object String]'; } +function isObject(obj) { return _class(obj) === '[object Object]'; } +function isRegExp(obj) { return _class(obj) === '[object RegExp]'; } +function isFunction(obj) { return _class(obj) === '[object Function]'; } + + +function escapeRE(str) { return str.replace(/[.?*+^$[\]\\(){}|-]/g, '\\$&'); } + +//////////////////////////////////////////////////////////////////////////////// + + +var defaultOptions = { + fuzzyLink: true, + fuzzyEmail: true, + fuzzyIP: false +}; + + +function isOptionsObj(obj) { + return Object.keys(obj || {}).reduce(function (acc, k) { + return acc || defaultOptions.hasOwnProperty(k); + }, false); +} + + +var defaultSchemas = { + 'http:': { + validate: function (text, pos, self) { + var tail = text.slice(pos); + + if (!self.re.http) { + // compile lazily, because "host"-containing variables can change on tlds update. + self.re.http = new RegExp( + '^\\/\\/' + self.re.src_auth + self.re.src_host_port_strict + self.re.src_path, 'i' + ); + } + if (self.re.http.test(tail)) { + return tail.match(self.re.http)[0].length; + } + return 0; + } + }, + 'https:': 'http:', + 'ftp:': 'http:', + '//': { + validate: function (text, pos, self) { + var tail = text.slice(pos); + + if (!self.re.no_http) { + // compile lazily, because "host"-containing variables can change on tlds update. + self.re.no_http = new RegExp( + '^' + + self.re.src_auth + + // Don't allow single-level domains, because of false positives like '//test' + // with code comments + '(?:localhost|(?:(?:' + self.re.src_domain + ')\\.)+' + self.re.src_domain_root + ')' + + self.re.src_port + + self.re.src_host_terminator + + self.re.src_path, + + 'i' + ); + } + + if (self.re.no_http.test(tail)) { + // should not be `://` & `///`, that protects from errors in protocol name + if (pos >= 3 && text[pos - 3] === ':') { return 0; } + if (pos >= 3 && text[pos - 3] === '/') { return 0; } + return tail.match(self.re.no_http)[0].length; + } + return 0; + } + }, + 'mailto:': { + validate: function (text, pos, self) { + var tail = text.slice(pos); + + if (!self.re.mailto) { + self.re.mailto = new RegExp( + '^' + self.re.src_email_name + '@' + self.re.src_host_strict, 'i' + ); + } + if (self.re.mailto.test(tail)) { + return tail.match(self.re.mailto)[0].length; + } + return 0; + } + } +}; + +/*eslint-disable max-len*/ + +// RE pattern for 2-character tlds (autogenerated by ./support/tlds_2char_gen.js) +var tlds_2ch_src_re = 'a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]'; + +// DON'T try to make PRs with changes. Extend TLDs with LinkifyIt.tlds() instead +var tlds_default = 'biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|рф'.split('|'); + +/*eslint-enable max-len*/ + +//////////////////////////////////////////////////////////////////////////////// + +function resetScanCache(self) { + self.__index__ = -1; + self.__text_cache__ = ''; +} + +function createValidator(re) { + return function (text, pos) { + var tail = text.slice(pos); + + if (re.test(tail)) { + return tail.match(re)[0].length; + } + return 0; + }; +} + +function createNormalizer() { + return function (match, self) { + self.normalize(match); + }; +} + +// Schemas compiler. Build regexps. +// +function compile(self) { + + // Load & clone RE patterns. + var re = self.re = require('./lib/re')(self.__opts__); + + // Define dynamic patterns + var tlds = self.__tlds__.slice(); + + self.onCompile(); + + if (!self.__tlds_replaced__) { + tlds.push(tlds_2ch_src_re); + } + tlds.push(re.src_xn); + + re.src_tlds = tlds.join('|'); + + function untpl(tpl) { return tpl.replace('%TLDS%', re.src_tlds); } + + re.email_fuzzy = RegExp(untpl(re.tpl_email_fuzzy), 'i'); + re.link_fuzzy = RegExp(untpl(re.tpl_link_fuzzy), 'i'); + re.link_no_ip_fuzzy = RegExp(untpl(re.tpl_link_no_ip_fuzzy), 'i'); + re.host_fuzzy_test = RegExp(untpl(re.tpl_host_fuzzy_test), 'i'); + + // + // Compile each schema + // + + var aliases = []; + + self.__compiled__ = {}; // Reset compiled data + + function schemaError(name, val) { + throw new Error('(LinkifyIt) Invalid schema "' + name + '": ' + val); + } + + Object.keys(self.__schemas__).forEach(function (name) { + var val = self.__schemas__[name]; + + // skip disabled methods + if (val === null) { return; } + + var compiled = { validate: null, link: null }; + + self.__compiled__[name] = compiled; + + if (isObject(val)) { + if (isRegExp(val.validate)) { + compiled.validate = createValidator(val.validate); + } else if (isFunction(val.validate)) { + compiled.validate = val.validate; + } else { + schemaError(name, val); + } + + if (isFunction(val.normalize)) { + compiled.normalize = val.normalize; + } else if (!val.normalize) { + compiled.normalize = createNormalizer(); + } else { + schemaError(name, val); + } + + return; + } + + if (isString(val)) { + aliases.push(name); + return; + } + + schemaError(name, val); + }); + + // + // Compile postponed aliases + // + + aliases.forEach(function (alias) { + if (!self.__compiled__[self.__schemas__[alias]]) { + // Silently fail on missed schemas to avoid errons on disable. + // schemaError(alias, self.__schemas__[alias]); + return; + } + + self.__compiled__[alias].validate = + self.__compiled__[self.__schemas__[alias]].validate; + self.__compiled__[alias].normalize = + self.__compiled__[self.__schemas__[alias]].normalize; + }); + + // + // Fake record for guessed links + // + self.__compiled__[''] = { validate: null, normalize: createNormalizer() }; + + // + // Build schema condition + // + var slist = Object.keys(self.__compiled__) + .filter(function (name) { + // Filter disabled & fake schemas + return name.length > 0 && self.__compiled__[name]; + }) + .map(escapeRE) + .join('|'); + // (?!_) cause 1.5x slowdown + self.re.schema_test = RegExp('(^|(?!_)(?:[><\uff5c]|' + re.src_ZPCc + '))(' + slist + ')', 'i'); + self.re.schema_search = RegExp('(^|(?!_)(?:[><\uff5c]|' + re.src_ZPCc + '))(' + slist + ')', 'ig'); + + self.re.pretest = RegExp( + '(' + self.re.schema_test.source + ')|(' + self.re.host_fuzzy_test.source + ')|@', + 'i' + ); + + // + // Cleanup + // + + resetScanCache(self); +} + +/** + * class Match + * + * Match result. Single element of array, returned by [[LinkifyIt#match]] + **/ +function Match(self, shift) { + var start = self.__index__, + end = self.__last_index__, + text = self.__text_cache__.slice(start, end); + + /** + * Match#schema -> String + * + * Prefix (protocol) for matched string. + **/ + this.schema = self.__schema__.toLowerCase(); + /** + * Match#index -> Number + * + * First position of matched string. + **/ + this.index = start + shift; + /** + * Match#lastIndex -> Number + * + * Next position after matched string. + **/ + this.lastIndex = end + shift; + /** + * Match#raw -> String + * + * Matched string. + **/ + this.raw = text; + /** + * Match#text -> String + * + * Notmalized text of matched string. + **/ + this.text = text; + /** + * Match#url -> String + * + * Normalized url of matched string. + **/ + this.url = text; +} + +function createMatch(self, shift) { + var match = new Match(self, shift); + + self.__compiled__[match.schema].normalize(match, self); + + return match; +} + + +/** + * class LinkifyIt + **/ + +/** + * new LinkifyIt(schemas, options) + * - schemas (Object): Optional. Additional schemas to validate (prefix/validator) + * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false } + * + * Creates new linkifier instance with optional additional schemas. + * Can be called without `new` keyword for convenience. + * + * By default understands: + * + * - `http(s)://...` , `ftp://...`, `mailto:...` & `//...` links + * - "fuzzy" links and emails (example.com, foo@bar.com). + * + * `schemas` is an object, where each key/value describes protocol/rule: + * + * - __key__ - link prefix (usually, protocol name with `:` at the end, `skype:` + * for example). `linkify-it` makes shure that prefix is not preceeded with + * alphanumeric char and symbols. Only whitespaces and punctuation allowed. + * - __value__ - rule to check tail after link prefix + * - _String_ - just alias to existing rule + * - _Object_ + * - _validate_ - validator function (should return matched length on success), + * or `RegExp`. + * - _normalize_ - optional function to normalize text & url of matched result + * (for example, for @twitter mentions). + * + * `options`: + * + * - __fuzzyLink__ - recognige URL-s without `http(s):` prefix. Default `true`. + * - __fuzzyIP__ - allow IPs in fuzzy links above. Can conflict with some texts + * like version numbers. Default `false`. + * - __fuzzyEmail__ - recognize emails without `mailto:` prefix. + * + **/ +function LinkifyIt(schemas, options) { + if (!(this instanceof LinkifyIt)) { + return new LinkifyIt(schemas, options); + } + + if (!options) { + if (isOptionsObj(schemas)) { + options = schemas; + schemas = {}; + } + } + + this.__opts__ = assign({}, defaultOptions, options); + + // Cache last tested result. Used to skip repeating steps on next `match` call. + this.__index__ = -1; + this.__last_index__ = -1; // Next scan position + this.__schema__ = ''; + this.__text_cache__ = ''; + + this.__schemas__ = assign({}, defaultSchemas, schemas); + this.__compiled__ = {}; + + this.__tlds__ = tlds_default; + this.__tlds_replaced__ = false; + + this.re = {}; + + compile(this); +} + + +/** chainable + * LinkifyIt#add(schema, definition) + * - schema (String): rule name (fixed pattern prefix) + * - definition (String|RegExp|Object): schema definition + * + * Add new rule definition. See constructor description for details. + **/ +LinkifyIt.prototype.add = function add(schema, definition) { + this.__schemas__[schema] = definition; + compile(this); + return this; +}; + + +/** chainable + * LinkifyIt#set(options) + * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false } + * + * Set recognition options for links without schema. + **/ +LinkifyIt.prototype.set = function set(options) { + this.__opts__ = assign(this.__opts__, options); + return this; +}; + + +/** + * LinkifyIt#test(text) -> Boolean + * + * Searches linkifiable pattern and returns `true` on success or `false` on fail. + **/ +LinkifyIt.prototype.test = function test(text) { + // Reset scan cache + this.__text_cache__ = text; + this.__index__ = -1; + + if (!text.length) { return false; } + + var m, ml, me, len, shift, next, re, tld_pos, at_pos; + + // try to scan for link with schema - that's the most simple rule + if (this.re.schema_test.test(text)) { + re = this.re.schema_search; + re.lastIndex = 0; + while ((m = re.exec(text)) !== null) { + len = this.testSchemaAt(text, m[2], re.lastIndex); + if (len) { + this.__schema__ = m[2]; + this.__index__ = m.index + m[1].length; + this.__last_index__ = m.index + m[0].length + len; + break; + } + } + } + + if (this.__opts__.fuzzyLink && this.__compiled__['http:']) { + // guess schemaless links + tld_pos = text.search(this.re.host_fuzzy_test); + if (tld_pos >= 0) { + // if tld is located after found link - no need to check fuzzy pattern + if (this.__index__ < 0 || tld_pos < this.__index__) { + if ((ml = text.match(this.__opts__.fuzzyIP ? this.re.link_fuzzy : this.re.link_no_ip_fuzzy)) !== null) { + + shift = ml.index + ml[1].length; + + if (this.__index__ < 0 || shift < this.__index__) { + this.__schema__ = ''; + this.__index__ = shift; + this.__last_index__ = ml.index + ml[0].length; + } + } + } + } + } + + if (this.__opts__.fuzzyEmail && this.__compiled__['mailto:']) { + // guess schemaless emails + at_pos = text.indexOf('@'); + if (at_pos >= 0) { + // We can't skip this check, because this cases are possible: + // 192.168.1.1@gmail.com, my.in@example.com + if ((me = text.match(this.re.email_fuzzy)) !== null) { + + shift = me.index + me[1].length; + next = me.index + me[0].length; + + if (this.__index__ < 0 || shift < this.__index__ || + (shift === this.__index__ && next > this.__last_index__)) { + this.__schema__ = 'mailto:'; + this.__index__ = shift; + this.__last_index__ = next; + } + } + } + } + + return this.__index__ >= 0; +}; + + +/** + * LinkifyIt#pretest(text) -> Boolean + * + * Very quick check, that can give false positives. Returns true if link MAY BE + * can exists. Can be used for speed optimization, when you need to check that + * link NOT exists. + **/ +LinkifyIt.prototype.pretest = function pretest(text) { + return this.re.pretest.test(text); +}; + + +/** + * LinkifyIt#testSchemaAt(text, name, position) -> Number + * - text (String): text to scan + * - name (String): rule (schema) name + * - position (Number): text offset to check from + * + * Similar to [[LinkifyIt#test]] but checks only specific protocol tail exactly + * at given position. Returns length of found pattern (0 on fail). + **/ +LinkifyIt.prototype.testSchemaAt = function testSchemaAt(text, schema, pos) { + // If not supported schema check requested - terminate + if (!this.__compiled__[schema.toLowerCase()]) { + return 0; + } + return this.__compiled__[schema.toLowerCase()].validate(text, pos, this); +}; + + +/** + * LinkifyIt#match(text) -> Array|null + * + * Returns array of found link descriptions or `null` on fail. We strongly + * recommend to use [[LinkifyIt#test]] first, for best speed. + * + * ##### Result match description + * + * - __schema__ - link schema, can be empty for fuzzy links, or `//` for + * protocol-neutral links. + * - __index__ - offset of matched text + * - __lastIndex__ - index of next char after mathch end + * - __raw__ - matched text + * - __text__ - normalized text + * - __url__ - link, generated from matched text + **/ +LinkifyIt.prototype.match = function match(text) { + var shift = 0, result = []; + + // Try to take previous element from cache, if .test() called before + if (this.__index__ >= 0 && this.__text_cache__ === text) { + result.push(createMatch(this, shift)); + shift = this.__last_index__; + } + + // Cut head if cache was used + var tail = shift ? text.slice(shift) : text; + + // Scan string until end reached + while (this.test(tail)) { + result.push(createMatch(this, shift)); + + tail = tail.slice(this.__last_index__); + shift += this.__last_index__; + } + + if (result.length) { + return result; + } + + return null; +}; + + +/** chainable + * LinkifyIt#tlds(list [, keepOld]) -> this + * - list (Array): list of tlds + * - keepOld (Boolean): merge with current list if `true` (`false` by default) + * + * Load (or merge) new tlds list. Those are user for fuzzy links (without prefix) + * to avoid false positives. By default this algorythm used: + * + * - hostname with any 2-letter root zones are ok. + * - biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|рф + * are ok. + * - encoded (`xn--...`) root zones are ok. + * + * If list is replaced, then exact match for 2-chars root zones will be checked. + **/ +LinkifyIt.prototype.tlds = function tlds(list, keepOld) { + list = Array.isArray(list) ? list : [ list ]; + + if (!keepOld) { + this.__tlds__ = list.slice(); + this.__tlds_replaced__ = true; + compile(this); + return this; + } + + this.__tlds__ = this.__tlds__.concat(list) + .sort() + .filter(function (el, idx, arr) { + return el !== arr[idx - 1]; + }) + .reverse(); + + compile(this); + return this; +}; + +/** + * LinkifyIt#normalize(match) + * + * Default normalizer (if schema does not define it's own). + **/ +LinkifyIt.prototype.normalize = function normalize(match) { + + // Do minimal possible changes by default. Need to collect feedback prior + // to move forward https://github.com/markdown-it/linkify-it/issues/1 + + if (!match.schema) { match.url = 'http://' + match.url; } + + if (match.schema === 'mailto:' && !/^mailto:/i.test(match.url)) { + match.url = 'mailto:' + match.url; + } +}; + + +/** + * LinkifyIt#onCompile() + * + * Override to modify basic RegExp-s. + **/ +LinkifyIt.prototype.onCompile = function onCompile() { +}; + + +module.exports = LinkifyIt; diff --git a/node_modules/linkify-it/lib/re.js b/node_modules/linkify-it/lib/re.js new file mode 100644 index 0000000..5f34a72 --- /dev/null +++ b/node_modules/linkify-it/lib/re.js @@ -0,0 +1,181 @@ +'use strict'; + + +module.exports = function (opts) { + var re = {}; + + // Use direct extract instead of `regenerate` to reduse browserified size + re.src_Any = require('uc.micro/properties/Any/regex').source; + re.src_Cc = require('uc.micro/categories/Cc/regex').source; + re.src_Z = require('uc.micro/categories/Z/regex').source; + re.src_P = require('uc.micro/categories/P/regex').source; + + // \p{\Z\P\Cc\CF} (white spaces + control + format + punctuation) + re.src_ZPCc = [ re.src_Z, re.src_P, re.src_Cc ].join('|'); + + // \p{\Z\Cc} (white spaces + control) + re.src_ZCc = [ re.src_Z, re.src_Cc ].join('|'); + + // Experimental. List of chars, completely prohibited in links + // because can separate it from other part of text + var text_separators = '[><\uff5c]'; + + // All possible word characters (everything without punctuation, spaces & controls) + // Defined via punctuation & spaces to save space + // Should be something like \p{\L\N\S\M} (\w but without `_`) + re.src_pseudo_letter = '(?:(?!' + text_separators + '|' + re.src_ZPCc + ')' + re.src_Any + ')'; + // The same as abothe but without [0-9] + // var src_pseudo_letter_non_d = '(?:(?![0-9]|' + src_ZPCc + ')' + src_Any + ')'; + + //////////////////////////////////////////////////////////////////////////////// + + re.src_ip4 = + + '(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)'; + + // Prohibit any of "@/[]()" in user/pass to avoid wrong domain fetch. + re.src_auth = '(?:(?:(?!' + re.src_ZCc + '|[@/\\[\\]()]).)+@)?'; + + re.src_port = + + '(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?'; + + re.src_host_terminator = + + '(?=$|' + text_separators + '|' + re.src_ZPCc + ')(?!-|_|:\\d|\\.-|\\.(?!$|' + re.src_ZPCc + '))'; + + re.src_path = + + '(?:' + + '[/?#]' + + '(?:' + + '(?!' + re.src_ZCc + '|' + text_separators + '|[()[\\]{}.,"\'?!\\-;]).|' + + '\\[(?:(?!' + re.src_ZCc + '|\\]).)*\\]|' + + '\\((?:(?!' + re.src_ZCc + '|[)]).)*\\)|' + + '\\{(?:(?!' + re.src_ZCc + '|[}]).)*\\}|' + + '\\"(?:(?!' + re.src_ZCc + '|["]).)+\\"|' + + "\\'(?:(?!" + re.src_ZCc + "|[']).)+\\'|" + + "\\'(?=" + re.src_pseudo_letter + '|[-]).|' + // allow `I'm_king` if no pair found + '\\.{2,}[a-zA-Z0-9%/&]|' + // google has many dots in "google search" links (#66, #81). + // github has ... in commit range links, + // Restrict to + // - english + // - percent-encoded + // - parts of file path + // - params separator + // until more examples found. + '\\.(?!' + re.src_ZCc + '|[.]).|' + + (opts && opts['---'] ? + '\\-(?!--(?:[^-]|$))(?:-*)|' // `---` => long dash, terminate + : + '\\-+|' + ) + + ',(?!' + re.src_ZCc + ').|' + // allow `,,,` in paths + ';(?!' + re.src_ZCc + ').|' + // allow `;` if not followed by space-like char + '\\!+(?!' + re.src_ZCc + '|[!]).|' + // allow `!!!` in paths, but not at the end + '\\?(?!' + re.src_ZCc + '|[?]).' + + ')+' + + '|\\/' + + ')?'; + + // Allow anything in markdown spec, forbid quote (") at the first position + // because emails enclosed in quotes are far more common + re.src_email_name = + + '[\\-;:&=\\+\\$,\\.a-zA-Z0-9_][\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]*'; + + re.src_xn = + + 'xn--[a-z0-9\\-]{1,59}'; + + // More to read about domain names + // http://serverfault.com/questions/638260/ + + re.src_domain_root = + + // Allow letters & digits (http://test1) + '(?:' + + re.src_xn + + '|' + + re.src_pseudo_letter + '{1,63}' + + ')'; + + re.src_domain = + + '(?:' + + re.src_xn + + '|' + + '(?:' + re.src_pseudo_letter + ')' + + '|' + + '(?:' + re.src_pseudo_letter + '(?:-|' + re.src_pseudo_letter + '){0,61}' + re.src_pseudo_letter + ')' + + ')'; + + re.src_host = + + '(?:' + + // Don't need IP check, because digits are already allowed in normal domain names + // src_ip4 + + // '|' + + '(?:(?:(?:' + re.src_domain + ')\\.)*' + re.src_domain/*_root*/ + ')' + + ')'; + + re.tpl_host_fuzzy = + + '(?:' + + re.src_ip4 + + '|' + + '(?:(?:(?:' + re.src_domain + ')\\.)+(?:%TLDS%))' + + ')'; + + re.tpl_host_no_ip_fuzzy = + + '(?:(?:(?:' + re.src_domain + ')\\.)+(?:%TLDS%))'; + + re.src_host_strict = + + re.src_host + re.src_host_terminator; + + re.tpl_host_fuzzy_strict = + + re.tpl_host_fuzzy + re.src_host_terminator; + + re.src_host_port_strict = + + re.src_host + re.src_port + re.src_host_terminator; + + re.tpl_host_port_fuzzy_strict = + + re.tpl_host_fuzzy + re.src_port + re.src_host_terminator; + + re.tpl_host_port_no_ip_fuzzy_strict = + + re.tpl_host_no_ip_fuzzy + re.src_port + re.src_host_terminator; + + + //////////////////////////////////////////////////////////////////////////////// + // Main rules + + // Rude test fuzzy links by host, for quick deny + re.tpl_host_fuzzy_test = + + 'localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:' + re.src_ZPCc + '|>|$))'; + + re.tpl_email_fuzzy = + + '(^|' + text_separators + '|"|\\(|' + re.src_ZCc + ')' + + '(' + re.src_email_name + '@' + re.tpl_host_fuzzy_strict + ')'; + + re.tpl_link_fuzzy = + // Fuzzy link can't be prepended with .:/\- and non punctuation. + // but can start with > (markdown blockquote) + '(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|' + re.src_ZPCc + '))' + + '((?![$+<=>^`|\uff5c])' + re.tpl_host_port_fuzzy_strict + re.src_path + ')'; + + re.tpl_link_no_ip_fuzzy = + // Fuzzy link can't be prepended with .:/\- and non punctuation. + // but can start with > (markdown blockquote) + '(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|' + re.src_ZPCc + '))' + + '((?![$+<=>^`|\uff5c])' + re.tpl_host_port_no_ip_fuzzy_strict + re.src_path + ')'; + + return re; +}; diff --git a/node_modules/linkify-it/package.json b/node_modules/linkify-it/package.json new file mode 100644 index 0000000..b6c36d2 --- /dev/null +++ b/node_modules/linkify-it/package.json @@ -0,0 +1,48 @@ +{ + "name": "linkify-it", + "version": "3.0.3", + "description": "Links recognition library with FULL unicode support", + "keywords": [ + "linkify", + "linkifier", + "autolink", + "autolinker" + ], + "repository": "markdown-it/linkify-it", + "files": [ + "index.js", + "lib/" + ], + "license": "MIT", + "scripts": { + "lint": "eslint .", + "test": "npm run lint && nyc mocha", + "coverage": "npm run test && nyc report --reporter html", + "report-coveralls": "nyc report --reporter=text-lcov | coveralls", + "demo": "npm run lint && node support/build_demo.js", + "doc": "node support/build_doc.js", + "gh-pages": "npm run demo && npm run doc && shx cp -R doc/ demo/ && gh-pages -d demo -f", + "prepublishOnly": "npm run gh-pages" + }, + "dependencies": { + "uc.micro": "^1.0.1" + }, + "devDependencies": { + "ansi": "^0.3.0", + "autoprefixer-stylus": "^0.14.0", + "benchmark": "^2.1.0", + "browserify": "^16.2.3", + "coveralls": "^3.0.2", + "eslint": "^7.0.0", + "gh-pages": "^2.2.0", + "mdurl": "^1.0.0", + "mocha": "^7.1.2", + "ndoc": "^5.0.1", + "nyc": "^15.0.1", + "pug-cli": "^1.0.0-alpha6", + "shelljs": "^0.8.4", + "shx": "^0.3.2", + "stylus": "~0.54.5", + "tlds": "^1.166.0" + } +} diff --git a/node_modules/markdown-it/LICENSE b/node_modules/markdown-it/LICENSE new file mode 100644 index 0000000..7ffa058 --- /dev/null +++ b/node_modules/markdown-it/LICENSE @@ -0,0 +1,22 @@ +Copyright (c) 2014 Vitaly Puzrin, Alex Kocharin. + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/markdown-it/README.md b/node_modules/markdown-it/README.md new file mode 100644 index 0000000..0e866de --- /dev/null +++ b/node_modules/markdown-it/README.md @@ -0,0 +1,307 @@ +# markdown-it <!-- omit in toc --> + +[![CI](https://github.com/markdown-it/markdown-it/workflows/CI/badge.svg)](https://github.com/markdown-it/markdown-it/actions) +[![NPM version](https://img.shields.io/npm/v/markdown-it.svg?style=flat)](https://www.npmjs.org/package/markdown-it) +[![Coverage Status](https://coveralls.io/repos/markdown-it/markdown-it/badge.svg?branch=master&service=github)](https://coveralls.io/github/markdown-it/markdown-it?branch=master) +[![Gitter](https://badges.gitter.im/Join%20Chat.svg)](https://gitter.im/markdown-it/markdown-it) + +> Markdown parser done right. Fast and easy to extend. + +__[Live demo](https://markdown-it.github.io)__ + +- Follows the __[CommonMark spec](http://spec.commonmark.org/)__ + adds syntax extensions & sugar (URL autolinking, typographer). +- Configurable syntax! You can add new rules and even replace existing ones. +- High speed. +- [Safe](https://github.com/markdown-it/markdown-it/tree/master/docs/security.md) by default. +- Community-written __[plugins](https://www.npmjs.org/browse/keyword/markdown-it-plugin)__ and [other packages](https://www.npmjs.org/browse/keyword/markdown-it) on npm. + +__Table of content__ + +- [Install](#install) +- [Usage examples](#usage-examples) + - [Simple](#simple) + - [Init with presets and options](#init-with-presets-and-options) + - [Plugins load](#plugins-load) + - [Syntax highlighting](#syntax-highlighting) + - [Linkify](#linkify) +- [API](#api) +- [Syntax extensions](#syntax-extensions) + - [Manage rules](#manage-rules) +- [Benchmark](#benchmark) +- [markdown-it for enterprise](#markdown-it-for-enterprise) +- [Authors](#authors) +- [References / Thanks](#references--thanks) + +## Install + +**node.js**: + +```bash +npm install markdown-it --save +``` + +**browser (CDN):** + +- [jsDeliver CDN](http://www.jsdelivr.com/#!markdown-it "jsDelivr CDN") +- [cdnjs.com CDN](https://cdnjs.com/libraries/markdown-it "cdnjs.com") + + +## Usage examples + +See also: + +- __[API documentation](https://markdown-it.github.io/markdown-it/)__ - for more + info and examples. +- [Development info](https://github.com/markdown-it/markdown-it/tree/master/docs) - + for plugins writers. + + +### Simple + +```js +// node.js, "classic" way: +var MarkdownIt = require('markdown-it'), + md = new MarkdownIt(); +var result = md.render('# markdown-it rulezz!'); + +// node.js, the same, but with sugar: +var md = require('markdown-it')(); +var result = md.render('# markdown-it rulezz!'); + +// browser without AMD, added to "window" on script load +// Note, there is no dash in "markdownit". +var md = window.markdownit(); +var result = md.render('# markdown-it rulezz!'); +``` + +Single line rendering, without paragraph wrap: + +```js +var md = require('markdown-it')(); +var result = md.renderInline('__markdown-it__ rulezz!'); +``` + + +### Init with presets and options + +(*) presets define combinations of active rules and options. Can be +`"commonmark"`, `"zero"` or `"default"` (if skipped). See +[API docs](https://markdown-it.github.io/markdown-it/#MarkdownIt.new) for more details. + +```js +// commonmark mode +var md = require('markdown-it')('commonmark'); + +// default mode +var md = require('markdown-it')(); + +// enable everything +var md = require('markdown-it')({ + html: true, + linkify: true, + typographer: true +}); + +// full options list (defaults) +var md = require('markdown-it')({ + html: false, // Enable HTML tags in source + xhtmlOut: false, // Use '/' to close single tags (<br />). + // This is only for full CommonMark compatibility. + breaks: false, // Convert '\n' in paragraphs into <br> + langPrefix: 'language-', // CSS language prefix for fenced blocks. Can be + // useful for external highlighters. + linkify: false, // Autoconvert URL-like text to links + + // Enable some language-neutral replacement + quotes beautification + // For the full list of replacements, see https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js + typographer: false, + + // Double + single quotes replacement pairs, when typographer enabled, + // and smartquotes on. Could be either a String or an Array. + // + // For example, you can use '«»„“' for Russian, '„“‚‘' for German, + // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). + quotes: '“”‘’', + + // Highlighter function. Should return escaped HTML, + // or '' if the source string is not changed and should be escaped externally. + // If result starts with <pre... internal wrapper is skipped. + highlight: function (/*str, lang*/) { return ''; } +}); +``` + +### Plugins load + +```js +var md = require('markdown-it')() + .use(plugin1) + .use(plugin2, opts, ...) + .use(plugin3); +``` + + +### Syntax highlighting + +Apply syntax highlighting to fenced code blocks with the `highlight` option: + +```js +var hljs = require('highlight.js'); // https://highlightjs.org/ + +// Actual default values +var md = require('markdown-it')({ + highlight: function (str, lang) { + if (lang && hljs.getLanguage(lang)) { + try { + return hljs.highlight(str, { language: lang }).value; + } catch (__) {} + } + + return ''; // use external default escaping + } +}); +``` + +Or with full wrapper override (if you need assign class to `<pre>`): + +```js +var hljs = require('highlight.js'); // https://highlightjs.org/ + +// Actual default values +var md = require('markdown-it')({ + highlight: function (str, lang) { + if (lang && hljs.getLanguage(lang)) { + try { + return '<pre class="hljs"><code>' + + hljs.highlight(str, { language: lang, ignoreIllegals: true }).value + + '</code></pre>'; + } catch (__) {} + } + + return '<pre class="hljs"><code>' + md.utils.escapeHtml(str) + '</code></pre>'; + } +}); +``` + +### Linkify + +`linkify: true` uses [linkify-it](https://github.com/markdown-it/linkify-it). To +configure linkify-it, access the linkify instance through `md.linkify`: + +```js +md.linkify.set({ fuzzyEmail: false }); // disables converting email to link +``` + + +## API + +__[API documentation](https://markdown-it.github.io/markdown-it/)__ + +If you are going to write plugins - take a look at +[Development info](https://github.com/markdown-it/markdown-it/tree/master/docs). + + +## Syntax extensions + +Embedded (enabled by default): + +- [Tables](https://help.github.com/articles/organizing-information-with-tables/) (GFM) +- [Strikethrough](https://help.github.com/articles/basic-writing-and-formatting-syntax/#styling-text) (GFM) + +Via plugins: + +- [subscript](https://github.com/markdown-it/markdown-it-sub) +- [superscript](https://github.com/markdown-it/markdown-it-sup) +- [footnote](https://github.com/markdown-it/markdown-it-footnote) +- [definition list](https://github.com/markdown-it/markdown-it-deflist) +- [abbreviation](https://github.com/markdown-it/markdown-it-abbr) +- [emoji](https://github.com/markdown-it/markdown-it-emoji) +- [custom container](https://github.com/markdown-it/markdown-it-container) +- [insert](https://github.com/markdown-it/markdown-it-ins) +- [mark](https://github.com/markdown-it/markdown-it-mark) +- ... and [others](https://www.npmjs.org/browse/keyword/markdown-it-plugin) + + +### Manage rules + +By default all rules are enabled, but can be restricted by options. On plugin +load all its rules are enabled automatically. + +```js +// Activate/deactivate rules, with curring +var md = require('markdown-it')() + .disable([ 'link', 'image' ]) + .enable([ 'link' ]) + .enable('image'); + +// Enable everything +md = require('markdown-it')({ + html: true, + linkify: true, + typographer: true, +}); +``` + +You can find all rules in sources: +[parser_core.js](lib/parser_core.js), [parser_block](lib/parser_block.js), +[parser_inline](lib/parser_inline.js). + + +## Benchmark + +Here is the result of readme parse at MB Pro Retina 2013 (2.4 GHz): + +```bash +make benchmark-deps +benchmark/benchmark.js readme + +Selected samples: (1 of 28) + > README + +Sample: README.md (7774 bytes) + > commonmark-reference x 1,222 ops/sec ±0.96% (97 runs sampled) + > current x 743 ops/sec ±0.84% (97 runs sampled) + > current-commonmark x 1,568 ops/sec ±0.84% (98 runs sampled) + > marked x 1,587 ops/sec ±4.31% (93 runs sampled) +``` + +__Note.__ CommonMark version runs with [simplified link normalizers](https://github.com/markdown-it/markdown-it/blob/master/benchmark/implementations/current-commonmark/index.js) +for more "honest" compare. Difference is ~ 1.5x. + +As you can see, `markdown-it` doesn't pay with speed for it's flexibility. +Slowdown of "full" version caused by additional features not available in +other implementations. + + +## markdown-it for enterprise + +Available as part of the Tidelift Subscription. + +The maintainers of `markdown-it` and thousands of other packages are working with Tidelift to deliver commercial support and maintenance for the open source dependencies you use to build your applications. Save time, reduce risk, and improve code health, while paying the maintainers of the exact dependencies you use. [Learn more.](https://tidelift.com/subscription/pkg/npm-markdown-it?utm_source=npm-markdown-it&utm_medium=referral&utm_campaign=enterprise&utm_term=repo) + + +## Authors + +- Alex Kocharin [github/rlidwka](https://github.com/rlidwka) +- Vitaly Puzrin [github/puzrin](https://github.com/puzrin) + +_markdown-it_ is the result of the decision of the authors who contributed to +99% of the _Remarkable_ code to move to a project with the same authorship but +new leadership (Vitaly and Alex). It's not a fork. + +## References / Thanks + +Big thanks to [John MacFarlane](https://github.com/jgm) for his work on the +CommonMark spec and reference implementations. His work saved us a lot of time +during this project's development. + +**Related Links:** + +- https://github.com/jgm/CommonMark - reference CommonMark implementations in C & JS, + also contains latest spec & online demo. +- http://talk.commonmark.org - CommonMark forum, good place to collaborate + developers' efforts. + +**Ports** + +- [motion-markdown-it](https://github.com/digitalmoksha/motion-markdown-it) - Ruby/RubyMotion +- [markdown-it-py](https://github.com/ExecutableBookProject/markdown-it-py)- Python diff --git a/node_modules/markdown-it/bin/markdown-it.js b/node_modules/markdown-it/bin/markdown-it.js new file mode 100644 index 0000000..d916635 --- /dev/null +++ b/node_modules/markdown-it/bin/markdown-it.js @@ -0,0 +1,117 @@ +#!/usr/bin/env node +/*eslint no-console:0*/ + +'use strict'; + + +var fs = require('fs'); +var argparse = require('argparse'); + + +//////////////////////////////////////////////////////////////////////////////// + +var cli = new argparse.ArgumentParser({ + prog: 'markdown-it', + add_help: true +}); + +cli.add_argument('-v', '--version', { + action: 'version', + version: require('../package.json').version +}); + +cli.add_argument('--no-html', { + help: 'Disable embedded HTML', + action: 'store_true' +}); + +cli.add_argument('-l', '--linkify', { + help: 'Autolink text', + action: 'store_true' +}); + +cli.add_argument('-t', '--typographer', { + help: 'Enable smartquotes and other typographic replacements', + action: 'store_true' +}); + +cli.add_argument('--trace', { + help: 'Show stack trace on error', + action: 'store_true' +}); + +cli.add_argument('file', { + help: 'File to read', + nargs: '?', + default: '-' +}); + +cli.add_argument('-o', '--output', { + help: 'File to write', + default: '-' +}); + +var options = cli.parse_args(); + + +function readFile(filename, encoding, callback) { + if (options.file === '-') { + // read from stdin + var chunks = []; + + process.stdin.on('data', function (chunk) { chunks.push(chunk); }); + + process.stdin.on('end', function () { + return callback(null, Buffer.concat(chunks).toString(encoding)); + }); + } else { + fs.readFile(filename, encoding, callback); + } +} + + +//////////////////////////////////////////////////////////////////////////////// + +readFile(options.file, 'utf8', function (err, input) { + var output, md; + + if (err) { + if (err.code === 'ENOENT') { + console.error('File not found: ' + options.file); + process.exit(2); + } + + console.error( + options.trace && err.stack || + err.message || + String(err)); + + process.exit(1); + } + + md = require('..')({ + html: !options.no_html, + xhtmlOut: false, + typographer: options.typographer, + linkify: options.linkify + }); + + try { + output = md.render(input); + + } catch (e) { + console.error( + options.trace && e.stack || + e.message || + String(e)); + + process.exit(1); + } + + if (options.output === '-') { + // write to stdout + process.stdout.write(output); + } else { + fs.writeFileSync(options.output, output); + } +}); diff --git a/node_modules/markdown-it/dist/markdown-it.js b/node_modules/markdown-it/dist/markdown-it.js new file mode 100644 index 0000000..1ef5530 --- /dev/null +++ b/node_modules/markdown-it/dist/markdown-it.js @@ -0,0 +1,8356 @@ +/*! markdown-it 12.3.2 https://github.com/markdown-it/markdown-it @license MIT */ +(function(global, factory) { + typeof exports === "object" && typeof module !== "undefined" ? module.exports = factory() : typeof define === "function" && define.amd ? define(factory) : (global = typeof globalThis !== "undefined" ? globalThis : global || self, + global.markdownit = factory()); +})(this, (function() { + "use strict"; + function createCommonjsModule(fn, basedir, module) { + return module = { + path: basedir, + exports: {}, + require: function(path, base) { + return commonjsRequire(path, base === undefined || base === null ? module.path : base); + } + }, fn(module, module.exports), module.exports; + } + function getAugmentedNamespace(n) { + if (n.__esModule) return n; + var a = Object.defineProperty({}, "__esModule", { + value: true + }); + Object.keys(n).forEach((function(k) { + var d = Object.getOwnPropertyDescriptor(n, k); + Object.defineProperty(a, k, d.get ? d : { + enumerable: true, + get: function() { + return n[k]; + } + }); + })); + return a; + } + function commonjsRequire() { + throw new Error("Dynamic requires are not currently supported by @rollup/plugin-commonjs"); + } + var require$$0 = { + Aacute: "\xc1", + aacute: "\xe1", + Abreve: "\u0102", + abreve: "\u0103", + ac: "\u223e", + acd: "\u223f", + acE: "\u223e\u0333", + Acirc: "\xc2", + acirc: "\xe2", + acute: "\xb4", + Acy: "\u0410", + acy: "\u0430", + AElig: "\xc6", + aelig: "\xe6", + af: "\u2061", + Afr: "\ud835\udd04", + afr: "\ud835\udd1e", + Agrave: "\xc0", + agrave: "\xe0", + alefsym: "\u2135", + aleph: "\u2135", + Alpha: "\u0391", + alpha: "\u03b1", + Amacr: "\u0100", + amacr: "\u0101", + amalg: "\u2a3f", + amp: "&", + AMP: "&", + andand: "\u2a55", + And: "\u2a53", + and: "\u2227", + andd: "\u2a5c", + andslope: "\u2a58", + andv: "\u2a5a", + ang: "\u2220", + ange: "\u29a4", + angle: "\u2220", + angmsdaa: "\u29a8", + angmsdab: "\u29a9", + angmsdac: "\u29aa", + angmsdad: "\u29ab", + angmsdae: "\u29ac", + angmsdaf: "\u29ad", + angmsdag: "\u29ae", + angmsdah: "\u29af", + angmsd: "\u2221", + angrt: "\u221f", + angrtvb: "\u22be", + angrtvbd: "\u299d", + angsph: "\u2222", + angst: "\xc5", + angzarr: "\u237c", + Aogon: "\u0104", + aogon: "\u0105", + Aopf: "\ud835\udd38", + aopf: "\ud835\udd52", + apacir: "\u2a6f", + ap: "\u2248", + apE: "\u2a70", + ape: "\u224a", + apid: "\u224b", + apos: "'", + ApplyFunction: "\u2061", + approx: "\u2248", + approxeq: "\u224a", + Aring: "\xc5", + aring: "\xe5", + Ascr: "\ud835\udc9c", + ascr: "\ud835\udcb6", + Assign: "\u2254", + ast: "*", + asymp: "\u2248", + asympeq: "\u224d", + Atilde: "\xc3", + atilde: "\xe3", + Auml: "\xc4", + auml: "\xe4", + awconint: "\u2233", + awint: "\u2a11", + backcong: "\u224c", + backepsilon: "\u03f6", + backprime: "\u2035", + backsim: "\u223d", + backsimeq: "\u22cd", + Backslash: "\u2216", + Barv: "\u2ae7", + barvee: "\u22bd", + barwed: "\u2305", + Barwed: "\u2306", + barwedge: "\u2305", + bbrk: "\u23b5", + bbrktbrk: "\u23b6", + bcong: "\u224c", + Bcy: "\u0411", + bcy: "\u0431", + bdquo: "\u201e", + becaus: "\u2235", + because: "\u2235", + Because: "\u2235", + bemptyv: "\u29b0", + bepsi: "\u03f6", + bernou: "\u212c", + Bernoullis: "\u212c", + Beta: "\u0392", + beta: "\u03b2", + beth: "\u2136", + between: "\u226c", + Bfr: "\ud835\udd05", + bfr: "\ud835\udd1f", + bigcap: "\u22c2", + bigcirc: "\u25ef", + bigcup: "\u22c3", + bigodot: "\u2a00", + bigoplus: "\u2a01", + bigotimes: "\u2a02", + bigsqcup: "\u2a06", + bigstar: "\u2605", + bigtriangledown: "\u25bd", + bigtriangleup: "\u25b3", + biguplus: "\u2a04", + bigvee: "\u22c1", + bigwedge: "\u22c0", + bkarow: "\u290d", + blacklozenge: "\u29eb", + blacksquare: "\u25aa", + blacktriangle: "\u25b4", + blacktriangledown: "\u25be", + blacktriangleleft: "\u25c2", + blacktriangleright: "\u25b8", + blank: "\u2423", + blk12: "\u2592", + blk14: "\u2591", + blk34: "\u2593", + block: "\u2588", + bne: "=\u20e5", + bnequiv: "\u2261\u20e5", + bNot: "\u2aed", + bnot: "\u2310", + Bopf: "\ud835\udd39", + bopf: "\ud835\udd53", + bot: "\u22a5", + bottom: "\u22a5", + bowtie: "\u22c8", + boxbox: "\u29c9", + boxdl: "\u2510", + boxdL: "\u2555", + boxDl: "\u2556", + boxDL: "\u2557", + boxdr: "\u250c", + boxdR: "\u2552", + boxDr: "\u2553", + boxDR: "\u2554", + boxh: "\u2500", + boxH: "\u2550", + boxhd: "\u252c", + boxHd: "\u2564", + boxhD: "\u2565", + boxHD: "\u2566", + boxhu: "\u2534", + boxHu: "\u2567", + boxhU: "\u2568", + boxHU: "\u2569", + boxminus: "\u229f", + boxplus: "\u229e", + boxtimes: "\u22a0", + boxul: "\u2518", + boxuL: "\u255b", + boxUl: "\u255c", + boxUL: "\u255d", + boxur: "\u2514", + boxuR: "\u2558", + boxUr: "\u2559", + boxUR: "\u255a", + boxv: "\u2502", + boxV: "\u2551", + boxvh: "\u253c", + boxvH: "\u256a", + boxVh: "\u256b", + boxVH: "\u256c", + boxvl: "\u2524", + boxvL: "\u2561", + boxVl: "\u2562", + boxVL: "\u2563", + boxvr: "\u251c", + boxvR: "\u255e", + boxVr: "\u255f", + boxVR: "\u2560", + bprime: "\u2035", + breve: "\u02d8", + Breve: "\u02d8", + brvbar: "\xa6", + bscr: "\ud835\udcb7", + Bscr: "\u212c", + bsemi: "\u204f", + bsim: "\u223d", + bsime: "\u22cd", + bsolb: "\u29c5", + bsol: "\\", + bsolhsub: "\u27c8", + bull: "\u2022", + bullet: "\u2022", + bump: "\u224e", + bumpE: "\u2aae", + bumpe: "\u224f", + Bumpeq: "\u224e", + bumpeq: "\u224f", + Cacute: "\u0106", + cacute: "\u0107", + capand: "\u2a44", + capbrcup: "\u2a49", + capcap: "\u2a4b", + cap: "\u2229", + Cap: "\u22d2", + capcup: "\u2a47", + capdot: "\u2a40", + CapitalDifferentialD: "\u2145", + caps: "\u2229\ufe00", + caret: "\u2041", + caron: "\u02c7", + Cayleys: "\u212d", + ccaps: "\u2a4d", + Ccaron: "\u010c", + ccaron: "\u010d", + Ccedil: "\xc7", + ccedil: "\xe7", + Ccirc: "\u0108", + ccirc: "\u0109", + Cconint: "\u2230", + ccups: "\u2a4c", + ccupssm: "\u2a50", + Cdot: "\u010a", + cdot: "\u010b", + cedil: "\xb8", + Cedilla: "\xb8", + cemptyv: "\u29b2", + cent: "\xa2", + centerdot: "\xb7", + CenterDot: "\xb7", + cfr: "\ud835\udd20", + Cfr: "\u212d", + CHcy: "\u0427", + chcy: "\u0447", + check: "\u2713", + checkmark: "\u2713", + Chi: "\u03a7", + chi: "\u03c7", + circ: "\u02c6", + circeq: "\u2257", + circlearrowleft: "\u21ba", + circlearrowright: "\u21bb", + circledast: "\u229b", + circledcirc: "\u229a", + circleddash: "\u229d", + CircleDot: "\u2299", + circledR: "\xae", + circledS: "\u24c8", + CircleMinus: "\u2296", + CirclePlus: "\u2295", + CircleTimes: "\u2297", + cir: "\u25cb", + cirE: "\u29c3", + cire: "\u2257", + cirfnint: "\u2a10", + cirmid: "\u2aef", + cirscir: "\u29c2", + ClockwiseContourIntegral: "\u2232", + CloseCurlyDoubleQuote: "\u201d", + CloseCurlyQuote: "\u2019", + clubs: "\u2663", + clubsuit: "\u2663", + colon: ":", + Colon: "\u2237", + Colone: "\u2a74", + colone: "\u2254", + coloneq: "\u2254", + comma: ",", + commat: "@", + comp: "\u2201", + compfn: "\u2218", + complement: "\u2201", + complexes: "\u2102", + cong: "\u2245", + congdot: "\u2a6d", + Congruent: "\u2261", + conint: "\u222e", + Conint: "\u222f", + ContourIntegral: "\u222e", + copf: "\ud835\udd54", + Copf: "\u2102", + coprod: "\u2210", + Coproduct: "\u2210", + copy: "\xa9", + COPY: "\xa9", + copysr: "\u2117", + CounterClockwiseContourIntegral: "\u2233", + crarr: "\u21b5", + cross: "\u2717", + Cross: "\u2a2f", + Cscr: "\ud835\udc9e", + cscr: "\ud835\udcb8", + csub: "\u2acf", + csube: "\u2ad1", + csup: "\u2ad0", + csupe: "\u2ad2", + ctdot: "\u22ef", + cudarrl: "\u2938", + cudarrr: "\u2935", + cuepr: "\u22de", + cuesc: "\u22df", + cularr: "\u21b6", + cularrp: "\u293d", + cupbrcap: "\u2a48", + cupcap: "\u2a46", + CupCap: "\u224d", + cup: "\u222a", + Cup: "\u22d3", + cupcup: "\u2a4a", + cupdot: "\u228d", + cupor: "\u2a45", + cups: "\u222a\ufe00", + curarr: "\u21b7", + curarrm: "\u293c", + curlyeqprec: "\u22de", + curlyeqsucc: "\u22df", + curlyvee: "\u22ce", + curlywedge: "\u22cf", + curren: "\xa4", + curvearrowleft: "\u21b6", + curvearrowright: "\u21b7", + cuvee: "\u22ce", + cuwed: "\u22cf", + cwconint: "\u2232", + cwint: "\u2231", + cylcty: "\u232d", + dagger: "\u2020", + Dagger: "\u2021", + daleth: "\u2138", + darr: "\u2193", + Darr: "\u21a1", + dArr: "\u21d3", + dash: "\u2010", + Dashv: "\u2ae4", + dashv: "\u22a3", + dbkarow: "\u290f", + dblac: "\u02dd", + Dcaron: "\u010e", + dcaron: "\u010f", + Dcy: "\u0414", + dcy: "\u0434", + ddagger: "\u2021", + ddarr: "\u21ca", + DD: "\u2145", + dd: "\u2146", + DDotrahd: "\u2911", + ddotseq: "\u2a77", + deg: "\xb0", + Del: "\u2207", + Delta: "\u0394", + delta: "\u03b4", + demptyv: "\u29b1", + dfisht: "\u297f", + Dfr: "\ud835\udd07", + dfr: "\ud835\udd21", + dHar: "\u2965", + dharl: "\u21c3", + dharr: "\u21c2", + DiacriticalAcute: "\xb4", + DiacriticalDot: "\u02d9", + DiacriticalDoubleAcute: "\u02dd", + DiacriticalGrave: "`", + DiacriticalTilde: "\u02dc", + diam: "\u22c4", + diamond: "\u22c4", + Diamond: "\u22c4", + diamondsuit: "\u2666", + diams: "\u2666", + die: "\xa8", + DifferentialD: "\u2146", + digamma: "\u03dd", + disin: "\u22f2", + div: "\xf7", + divide: "\xf7", + divideontimes: "\u22c7", + divonx: "\u22c7", + DJcy: "\u0402", + djcy: "\u0452", + dlcorn: "\u231e", + dlcrop: "\u230d", + dollar: "$", + Dopf: "\ud835\udd3b", + dopf: "\ud835\udd55", + Dot: "\xa8", + dot: "\u02d9", + DotDot: "\u20dc", + doteq: "\u2250", + doteqdot: "\u2251", + DotEqual: "\u2250", + dotminus: "\u2238", + dotplus: "\u2214", + dotsquare: "\u22a1", + doublebarwedge: "\u2306", + DoubleContourIntegral: "\u222f", + DoubleDot: "\xa8", + DoubleDownArrow: "\u21d3", + DoubleLeftArrow: "\u21d0", + DoubleLeftRightArrow: "\u21d4", + DoubleLeftTee: "\u2ae4", + DoubleLongLeftArrow: "\u27f8", + DoubleLongLeftRightArrow: "\u27fa", + DoubleLongRightArrow: "\u27f9", + DoubleRightArrow: "\u21d2", + DoubleRightTee: "\u22a8", + DoubleUpArrow: "\u21d1", + DoubleUpDownArrow: "\u21d5", + DoubleVerticalBar: "\u2225", + DownArrowBar: "\u2913", + downarrow: "\u2193", + DownArrow: "\u2193", + Downarrow: "\u21d3", + DownArrowUpArrow: "\u21f5", + DownBreve: "\u0311", + downdownarrows: "\u21ca", + downharpoonleft: "\u21c3", + downharpoonright: "\u21c2", + DownLeftRightVector: "\u2950", + DownLeftTeeVector: "\u295e", + DownLeftVectorBar: "\u2956", + DownLeftVector: "\u21bd", + DownRightTeeVector: "\u295f", + DownRightVectorBar: "\u2957", + DownRightVector: "\u21c1", + DownTeeArrow: "\u21a7", + DownTee: "\u22a4", + drbkarow: "\u2910", + drcorn: "\u231f", + drcrop: "\u230c", + Dscr: "\ud835\udc9f", + dscr: "\ud835\udcb9", + DScy: "\u0405", + dscy: "\u0455", + dsol: "\u29f6", + Dstrok: "\u0110", + dstrok: "\u0111", + dtdot: "\u22f1", + dtri: "\u25bf", + dtrif: "\u25be", + duarr: "\u21f5", + duhar: "\u296f", + dwangle: "\u29a6", + DZcy: "\u040f", + dzcy: "\u045f", + dzigrarr: "\u27ff", + Eacute: "\xc9", + eacute: "\xe9", + easter: "\u2a6e", + Ecaron: "\u011a", + ecaron: "\u011b", + Ecirc: "\xca", + ecirc: "\xea", + ecir: "\u2256", + ecolon: "\u2255", + Ecy: "\u042d", + ecy: "\u044d", + eDDot: "\u2a77", + Edot: "\u0116", + edot: "\u0117", + eDot: "\u2251", + ee: "\u2147", + efDot: "\u2252", + Efr: "\ud835\udd08", + efr: "\ud835\udd22", + eg: "\u2a9a", + Egrave: "\xc8", + egrave: "\xe8", + egs: "\u2a96", + egsdot: "\u2a98", + el: "\u2a99", + Element: "\u2208", + elinters: "\u23e7", + ell: "\u2113", + els: "\u2a95", + elsdot: "\u2a97", + Emacr: "\u0112", + emacr: "\u0113", + empty: "\u2205", + emptyset: "\u2205", + EmptySmallSquare: "\u25fb", + emptyv: "\u2205", + EmptyVerySmallSquare: "\u25ab", + emsp13: "\u2004", + emsp14: "\u2005", + emsp: "\u2003", + ENG: "\u014a", + eng: "\u014b", + ensp: "\u2002", + Eogon: "\u0118", + eogon: "\u0119", + Eopf: "\ud835\udd3c", + eopf: "\ud835\udd56", + epar: "\u22d5", + eparsl: "\u29e3", + eplus: "\u2a71", + epsi: "\u03b5", + Epsilon: "\u0395", + epsilon: "\u03b5", + epsiv: "\u03f5", + eqcirc: "\u2256", + eqcolon: "\u2255", + eqsim: "\u2242", + eqslantgtr: "\u2a96", + eqslantless: "\u2a95", + Equal: "\u2a75", + equals: "=", + EqualTilde: "\u2242", + equest: "\u225f", + Equilibrium: "\u21cc", + equiv: "\u2261", + equivDD: "\u2a78", + eqvparsl: "\u29e5", + erarr: "\u2971", + erDot: "\u2253", + escr: "\u212f", + Escr: "\u2130", + esdot: "\u2250", + Esim: "\u2a73", + esim: "\u2242", + Eta: "\u0397", + eta: "\u03b7", + ETH: "\xd0", + eth: "\xf0", + Euml: "\xcb", + euml: "\xeb", + euro: "\u20ac", + excl: "!", + exist: "\u2203", + Exists: "\u2203", + expectation: "\u2130", + exponentiale: "\u2147", + ExponentialE: "\u2147", + fallingdotseq: "\u2252", + Fcy: "\u0424", + fcy: "\u0444", + female: "\u2640", + ffilig: "\ufb03", + fflig: "\ufb00", + ffllig: "\ufb04", + Ffr: "\ud835\udd09", + ffr: "\ud835\udd23", + filig: "\ufb01", + FilledSmallSquare: "\u25fc", + FilledVerySmallSquare: "\u25aa", + fjlig: "fj", + flat: "\u266d", + fllig: "\ufb02", + fltns: "\u25b1", + fnof: "\u0192", + Fopf: "\ud835\udd3d", + fopf: "\ud835\udd57", + forall: "\u2200", + ForAll: "\u2200", + fork: "\u22d4", + forkv: "\u2ad9", + Fouriertrf: "\u2131", + fpartint: "\u2a0d", + frac12: "\xbd", + frac13: "\u2153", + frac14: "\xbc", + frac15: "\u2155", + frac16: "\u2159", + frac18: "\u215b", + frac23: "\u2154", + frac25: "\u2156", + frac34: "\xbe", + frac35: "\u2157", + frac38: "\u215c", + frac45: "\u2158", + frac56: "\u215a", + frac58: "\u215d", + frac78: "\u215e", + frasl: "\u2044", + frown: "\u2322", + fscr: "\ud835\udcbb", + Fscr: "\u2131", + gacute: "\u01f5", + Gamma: "\u0393", + gamma: "\u03b3", + Gammad: "\u03dc", + gammad: "\u03dd", + gap: "\u2a86", + Gbreve: "\u011e", + gbreve: "\u011f", + Gcedil: "\u0122", + Gcirc: "\u011c", + gcirc: "\u011d", + Gcy: "\u0413", + gcy: "\u0433", + Gdot: "\u0120", + gdot: "\u0121", + ge: "\u2265", + gE: "\u2267", + gEl: "\u2a8c", + gel: "\u22db", + geq: "\u2265", + geqq: "\u2267", + geqslant: "\u2a7e", + gescc: "\u2aa9", + ges: "\u2a7e", + gesdot: "\u2a80", + gesdoto: "\u2a82", + gesdotol: "\u2a84", + gesl: "\u22db\ufe00", + gesles: "\u2a94", + Gfr: "\ud835\udd0a", + gfr: "\ud835\udd24", + gg: "\u226b", + Gg: "\u22d9", + ggg: "\u22d9", + gimel: "\u2137", + GJcy: "\u0403", + gjcy: "\u0453", + gla: "\u2aa5", + gl: "\u2277", + glE: "\u2a92", + glj: "\u2aa4", + gnap: "\u2a8a", + gnapprox: "\u2a8a", + gne: "\u2a88", + gnE: "\u2269", + gneq: "\u2a88", + gneqq: "\u2269", + gnsim: "\u22e7", + Gopf: "\ud835\udd3e", + gopf: "\ud835\udd58", + grave: "`", + GreaterEqual: "\u2265", + GreaterEqualLess: "\u22db", + GreaterFullEqual: "\u2267", + GreaterGreater: "\u2aa2", + GreaterLess: "\u2277", + GreaterSlantEqual: "\u2a7e", + GreaterTilde: "\u2273", + Gscr: "\ud835\udca2", + gscr: "\u210a", + gsim: "\u2273", + gsime: "\u2a8e", + gsiml: "\u2a90", + gtcc: "\u2aa7", + gtcir: "\u2a7a", + gt: ">", + GT: ">", + Gt: "\u226b", + gtdot: "\u22d7", + gtlPar: "\u2995", + gtquest: "\u2a7c", + gtrapprox: "\u2a86", + gtrarr: "\u2978", + gtrdot: "\u22d7", + gtreqless: "\u22db", + gtreqqless: "\u2a8c", + gtrless: "\u2277", + gtrsim: "\u2273", + gvertneqq: "\u2269\ufe00", + gvnE: "\u2269\ufe00", + Hacek: "\u02c7", + hairsp: "\u200a", + half: "\xbd", + hamilt: "\u210b", + HARDcy: "\u042a", + hardcy: "\u044a", + harrcir: "\u2948", + harr: "\u2194", + hArr: "\u21d4", + harrw: "\u21ad", + Hat: "^", + hbar: "\u210f", + Hcirc: "\u0124", + hcirc: "\u0125", + hearts: "\u2665", + heartsuit: "\u2665", + hellip: "\u2026", + hercon: "\u22b9", + hfr: "\ud835\udd25", + Hfr: "\u210c", + HilbertSpace: "\u210b", + hksearow: "\u2925", + hkswarow: "\u2926", + hoarr: "\u21ff", + homtht: "\u223b", + hookleftarrow: "\u21a9", + hookrightarrow: "\u21aa", + hopf: "\ud835\udd59", + Hopf: "\u210d", + horbar: "\u2015", + HorizontalLine: "\u2500", + hscr: "\ud835\udcbd", + Hscr: "\u210b", + hslash: "\u210f", + Hstrok: "\u0126", + hstrok: "\u0127", + HumpDownHump: "\u224e", + HumpEqual: "\u224f", + hybull: "\u2043", + hyphen: "\u2010", + Iacute: "\xcd", + iacute: "\xed", + ic: "\u2063", + Icirc: "\xce", + icirc: "\xee", + Icy: "\u0418", + icy: "\u0438", + Idot: "\u0130", + IEcy: "\u0415", + iecy: "\u0435", + iexcl: "\xa1", + iff: "\u21d4", + ifr: "\ud835\udd26", + Ifr: "\u2111", + Igrave: "\xcc", + igrave: "\xec", + ii: "\u2148", + iiiint: "\u2a0c", + iiint: "\u222d", + iinfin: "\u29dc", + iiota: "\u2129", + IJlig: "\u0132", + ijlig: "\u0133", + Imacr: "\u012a", + imacr: "\u012b", + image: "\u2111", + ImaginaryI: "\u2148", + imagline: "\u2110", + imagpart: "\u2111", + imath: "\u0131", + Im: "\u2111", + imof: "\u22b7", + imped: "\u01b5", + Implies: "\u21d2", + incare: "\u2105", + in: "\u2208", + infin: "\u221e", + infintie: "\u29dd", + inodot: "\u0131", + intcal: "\u22ba", + int: "\u222b", + Int: "\u222c", + integers: "\u2124", + Integral: "\u222b", + intercal: "\u22ba", + Intersection: "\u22c2", + intlarhk: "\u2a17", + intprod: "\u2a3c", + InvisibleComma: "\u2063", + InvisibleTimes: "\u2062", + IOcy: "\u0401", + iocy: "\u0451", + Iogon: "\u012e", + iogon: "\u012f", + Iopf: "\ud835\udd40", + iopf: "\ud835\udd5a", + Iota: "\u0399", + iota: "\u03b9", + iprod: "\u2a3c", + iquest: "\xbf", + iscr: "\ud835\udcbe", + Iscr: "\u2110", + isin: "\u2208", + isindot: "\u22f5", + isinE: "\u22f9", + isins: "\u22f4", + isinsv: "\u22f3", + isinv: "\u2208", + it: "\u2062", + Itilde: "\u0128", + itilde: "\u0129", + Iukcy: "\u0406", + iukcy: "\u0456", + Iuml: "\xcf", + iuml: "\xef", + Jcirc: "\u0134", + jcirc: "\u0135", + Jcy: "\u0419", + jcy: "\u0439", + Jfr: "\ud835\udd0d", + jfr: "\ud835\udd27", + jmath: "\u0237", + Jopf: "\ud835\udd41", + jopf: "\ud835\udd5b", + Jscr: "\ud835\udca5", + jscr: "\ud835\udcbf", + Jsercy: "\u0408", + jsercy: "\u0458", + Jukcy: "\u0404", + jukcy: "\u0454", + Kappa: "\u039a", + kappa: "\u03ba", + kappav: "\u03f0", + Kcedil: "\u0136", + kcedil: "\u0137", + Kcy: "\u041a", + kcy: "\u043a", + Kfr: "\ud835\udd0e", + kfr: "\ud835\udd28", + kgreen: "\u0138", + KHcy: "\u0425", + khcy: "\u0445", + KJcy: "\u040c", + kjcy: "\u045c", + Kopf: "\ud835\udd42", + kopf: "\ud835\udd5c", + Kscr: "\ud835\udca6", + kscr: "\ud835\udcc0", + lAarr: "\u21da", + Lacute: "\u0139", + lacute: "\u013a", + laemptyv: "\u29b4", + lagran: "\u2112", + Lambda: "\u039b", + lambda: "\u03bb", + lang: "\u27e8", + Lang: "\u27ea", + langd: "\u2991", + langle: "\u27e8", + lap: "\u2a85", + Laplacetrf: "\u2112", + laquo: "\xab", + larrb: "\u21e4", + larrbfs: "\u291f", + larr: "\u2190", + Larr: "\u219e", + lArr: "\u21d0", + larrfs: "\u291d", + larrhk: "\u21a9", + larrlp: "\u21ab", + larrpl: "\u2939", + larrsim: "\u2973", + larrtl: "\u21a2", + latail: "\u2919", + lAtail: "\u291b", + lat: "\u2aab", + late: "\u2aad", + lates: "\u2aad\ufe00", + lbarr: "\u290c", + lBarr: "\u290e", + lbbrk: "\u2772", + lbrace: "{", + lbrack: "[", + lbrke: "\u298b", + lbrksld: "\u298f", + lbrkslu: "\u298d", + Lcaron: "\u013d", + lcaron: "\u013e", + Lcedil: "\u013b", + lcedil: "\u013c", + lceil: "\u2308", + lcub: "{", + Lcy: "\u041b", + lcy: "\u043b", + ldca: "\u2936", + ldquo: "\u201c", + ldquor: "\u201e", + ldrdhar: "\u2967", + ldrushar: "\u294b", + ldsh: "\u21b2", + le: "\u2264", + lE: "\u2266", + LeftAngleBracket: "\u27e8", + LeftArrowBar: "\u21e4", + leftarrow: "\u2190", + LeftArrow: "\u2190", + Leftarrow: "\u21d0", + LeftArrowRightArrow: "\u21c6", + leftarrowtail: "\u21a2", + LeftCeiling: "\u2308", + LeftDoubleBracket: "\u27e6", + LeftDownTeeVector: "\u2961", + LeftDownVectorBar: "\u2959", + LeftDownVector: "\u21c3", + LeftFloor: "\u230a", + leftharpoondown: "\u21bd", + leftharpoonup: "\u21bc", + leftleftarrows: "\u21c7", + leftrightarrow: "\u2194", + LeftRightArrow: "\u2194", + Leftrightarrow: "\u21d4", + leftrightarrows: "\u21c6", + leftrightharpoons: "\u21cb", + leftrightsquigarrow: "\u21ad", + LeftRightVector: "\u294e", + LeftTeeArrow: "\u21a4", + LeftTee: "\u22a3", + LeftTeeVector: "\u295a", + leftthreetimes: "\u22cb", + LeftTriangleBar: "\u29cf", + LeftTriangle: "\u22b2", + LeftTriangleEqual: "\u22b4", + LeftUpDownVector: "\u2951", + LeftUpTeeVector: "\u2960", + LeftUpVectorBar: "\u2958", + LeftUpVector: "\u21bf", + LeftVectorBar: "\u2952", + LeftVector: "\u21bc", + lEg: "\u2a8b", + leg: "\u22da", + leq: "\u2264", + leqq: "\u2266", + leqslant: "\u2a7d", + lescc: "\u2aa8", + les: "\u2a7d", + lesdot: "\u2a7f", + lesdoto: "\u2a81", + lesdotor: "\u2a83", + lesg: "\u22da\ufe00", + lesges: "\u2a93", + lessapprox: "\u2a85", + lessdot: "\u22d6", + lesseqgtr: "\u22da", + lesseqqgtr: "\u2a8b", + LessEqualGreater: "\u22da", + LessFullEqual: "\u2266", + LessGreater: "\u2276", + lessgtr: "\u2276", + LessLess: "\u2aa1", + lesssim: "\u2272", + LessSlantEqual: "\u2a7d", + LessTilde: "\u2272", + lfisht: "\u297c", + lfloor: "\u230a", + Lfr: "\ud835\udd0f", + lfr: "\ud835\udd29", + lg: "\u2276", + lgE: "\u2a91", + lHar: "\u2962", + lhard: "\u21bd", + lharu: "\u21bc", + lharul: "\u296a", + lhblk: "\u2584", + LJcy: "\u0409", + ljcy: "\u0459", + llarr: "\u21c7", + ll: "\u226a", + Ll: "\u22d8", + llcorner: "\u231e", + Lleftarrow: "\u21da", + llhard: "\u296b", + lltri: "\u25fa", + Lmidot: "\u013f", + lmidot: "\u0140", + lmoustache: "\u23b0", + lmoust: "\u23b0", + lnap: "\u2a89", + lnapprox: "\u2a89", + lne: "\u2a87", + lnE: "\u2268", + lneq: "\u2a87", + lneqq: "\u2268", + lnsim: "\u22e6", + loang: "\u27ec", + loarr: "\u21fd", + lobrk: "\u27e6", + longleftarrow: "\u27f5", + LongLeftArrow: "\u27f5", + Longleftarrow: "\u27f8", + longleftrightarrow: "\u27f7", + LongLeftRightArrow: "\u27f7", + Longleftrightarrow: "\u27fa", + longmapsto: "\u27fc", + longrightarrow: "\u27f6", + LongRightArrow: "\u27f6", + Longrightarrow: "\u27f9", + looparrowleft: "\u21ab", + looparrowright: "\u21ac", + lopar: "\u2985", + Lopf: "\ud835\udd43", + lopf: "\ud835\udd5d", + loplus: "\u2a2d", + lotimes: "\u2a34", + lowast: "\u2217", + lowbar: "_", + LowerLeftArrow: "\u2199", + LowerRightArrow: "\u2198", + loz: "\u25ca", + lozenge: "\u25ca", + lozf: "\u29eb", + lpar: "(", + lparlt: "\u2993", + lrarr: "\u21c6", + lrcorner: "\u231f", + lrhar: "\u21cb", + lrhard: "\u296d", + lrm: "\u200e", + lrtri: "\u22bf", + lsaquo: "\u2039", + lscr: "\ud835\udcc1", + Lscr: "\u2112", + lsh: "\u21b0", + Lsh: "\u21b0", + lsim: "\u2272", + lsime: "\u2a8d", + lsimg: "\u2a8f", + lsqb: "[", + lsquo: "\u2018", + lsquor: "\u201a", + Lstrok: "\u0141", + lstrok: "\u0142", + ltcc: "\u2aa6", + ltcir: "\u2a79", + lt: "<", + LT: "<", + Lt: "\u226a", + ltdot: "\u22d6", + lthree: "\u22cb", + ltimes: "\u22c9", + ltlarr: "\u2976", + ltquest: "\u2a7b", + ltri: "\u25c3", + ltrie: "\u22b4", + ltrif: "\u25c2", + ltrPar: "\u2996", + lurdshar: "\u294a", + luruhar: "\u2966", + lvertneqq: "\u2268\ufe00", + lvnE: "\u2268\ufe00", + macr: "\xaf", + male: "\u2642", + malt: "\u2720", + maltese: "\u2720", + Map: "\u2905", + map: "\u21a6", + mapsto: "\u21a6", + mapstodown: "\u21a7", + mapstoleft: "\u21a4", + mapstoup: "\u21a5", + marker: "\u25ae", + mcomma: "\u2a29", + Mcy: "\u041c", + mcy: "\u043c", + mdash: "\u2014", + mDDot: "\u223a", + measuredangle: "\u2221", + MediumSpace: "\u205f", + Mellintrf: "\u2133", + Mfr: "\ud835\udd10", + mfr: "\ud835\udd2a", + mho: "\u2127", + micro: "\xb5", + midast: "*", + midcir: "\u2af0", + mid: "\u2223", + middot: "\xb7", + minusb: "\u229f", + minus: "\u2212", + minusd: "\u2238", + minusdu: "\u2a2a", + MinusPlus: "\u2213", + mlcp: "\u2adb", + mldr: "\u2026", + mnplus: "\u2213", + models: "\u22a7", + Mopf: "\ud835\udd44", + mopf: "\ud835\udd5e", + mp: "\u2213", + mscr: "\ud835\udcc2", + Mscr: "\u2133", + mstpos: "\u223e", + Mu: "\u039c", + mu: "\u03bc", + multimap: "\u22b8", + mumap: "\u22b8", + nabla: "\u2207", + Nacute: "\u0143", + nacute: "\u0144", + nang: "\u2220\u20d2", + nap: "\u2249", + napE: "\u2a70\u0338", + napid: "\u224b\u0338", + napos: "\u0149", + napprox: "\u2249", + natural: "\u266e", + naturals: "\u2115", + natur: "\u266e", + nbsp: "\xa0", + nbump: "\u224e\u0338", + nbumpe: "\u224f\u0338", + ncap: "\u2a43", + Ncaron: "\u0147", + ncaron: "\u0148", + Ncedil: "\u0145", + ncedil: "\u0146", + ncong: "\u2247", + ncongdot: "\u2a6d\u0338", + ncup: "\u2a42", + Ncy: "\u041d", + ncy: "\u043d", + ndash: "\u2013", + nearhk: "\u2924", + nearr: "\u2197", + neArr: "\u21d7", + nearrow: "\u2197", + ne: "\u2260", + nedot: "\u2250\u0338", + NegativeMediumSpace: "\u200b", + NegativeThickSpace: "\u200b", + NegativeThinSpace: "\u200b", + NegativeVeryThinSpace: "\u200b", + nequiv: "\u2262", + nesear: "\u2928", + nesim: "\u2242\u0338", + NestedGreaterGreater: "\u226b", + NestedLessLess: "\u226a", + NewLine: "\n", + nexist: "\u2204", + nexists: "\u2204", + Nfr: "\ud835\udd11", + nfr: "\ud835\udd2b", + ngE: "\u2267\u0338", + nge: "\u2271", + ngeq: "\u2271", + ngeqq: "\u2267\u0338", + ngeqslant: "\u2a7e\u0338", + nges: "\u2a7e\u0338", + nGg: "\u22d9\u0338", + ngsim: "\u2275", + nGt: "\u226b\u20d2", + ngt: "\u226f", + ngtr: "\u226f", + nGtv: "\u226b\u0338", + nharr: "\u21ae", + nhArr: "\u21ce", + nhpar: "\u2af2", + ni: "\u220b", + nis: "\u22fc", + nisd: "\u22fa", + niv: "\u220b", + NJcy: "\u040a", + njcy: "\u045a", + nlarr: "\u219a", + nlArr: "\u21cd", + nldr: "\u2025", + nlE: "\u2266\u0338", + nle: "\u2270", + nleftarrow: "\u219a", + nLeftarrow: "\u21cd", + nleftrightarrow: "\u21ae", + nLeftrightarrow: "\u21ce", + nleq: "\u2270", + nleqq: "\u2266\u0338", + nleqslant: "\u2a7d\u0338", + nles: "\u2a7d\u0338", + nless: "\u226e", + nLl: "\u22d8\u0338", + nlsim: "\u2274", + nLt: "\u226a\u20d2", + nlt: "\u226e", + nltri: "\u22ea", + nltrie: "\u22ec", + nLtv: "\u226a\u0338", + nmid: "\u2224", + NoBreak: "\u2060", + NonBreakingSpace: "\xa0", + nopf: "\ud835\udd5f", + Nopf: "\u2115", + Not: "\u2aec", + not: "\xac", + NotCongruent: "\u2262", + NotCupCap: "\u226d", + NotDoubleVerticalBar: "\u2226", + NotElement: "\u2209", + NotEqual: "\u2260", + NotEqualTilde: "\u2242\u0338", + NotExists: "\u2204", + NotGreater: "\u226f", + NotGreaterEqual: "\u2271", + NotGreaterFullEqual: "\u2267\u0338", + NotGreaterGreater: "\u226b\u0338", + NotGreaterLess: "\u2279", + NotGreaterSlantEqual: "\u2a7e\u0338", + NotGreaterTilde: "\u2275", + NotHumpDownHump: "\u224e\u0338", + NotHumpEqual: "\u224f\u0338", + notin: "\u2209", + notindot: "\u22f5\u0338", + notinE: "\u22f9\u0338", + notinva: "\u2209", + notinvb: "\u22f7", + notinvc: "\u22f6", + NotLeftTriangleBar: "\u29cf\u0338", + NotLeftTriangle: "\u22ea", + NotLeftTriangleEqual: "\u22ec", + NotLess: "\u226e", + NotLessEqual: "\u2270", + NotLessGreater: "\u2278", + NotLessLess: "\u226a\u0338", + NotLessSlantEqual: "\u2a7d\u0338", + NotLessTilde: "\u2274", + NotNestedGreaterGreater: "\u2aa2\u0338", + NotNestedLessLess: "\u2aa1\u0338", + notni: "\u220c", + notniva: "\u220c", + notnivb: "\u22fe", + notnivc: "\u22fd", + NotPrecedes: "\u2280", + NotPrecedesEqual: "\u2aaf\u0338", + NotPrecedesSlantEqual: "\u22e0", + NotReverseElement: "\u220c", + NotRightTriangleBar: "\u29d0\u0338", + NotRightTriangle: "\u22eb", + NotRightTriangleEqual: "\u22ed", + NotSquareSubset: "\u228f\u0338", + NotSquareSubsetEqual: "\u22e2", + NotSquareSuperset: "\u2290\u0338", + NotSquareSupersetEqual: "\u22e3", + NotSubset: "\u2282\u20d2", + NotSubsetEqual: "\u2288", + NotSucceeds: "\u2281", + NotSucceedsEqual: "\u2ab0\u0338", + NotSucceedsSlantEqual: "\u22e1", + NotSucceedsTilde: "\u227f\u0338", + NotSuperset: "\u2283\u20d2", + NotSupersetEqual: "\u2289", + NotTilde: "\u2241", + NotTildeEqual: "\u2244", + NotTildeFullEqual: "\u2247", + NotTildeTilde: "\u2249", + NotVerticalBar: "\u2224", + nparallel: "\u2226", + npar: "\u2226", + nparsl: "\u2afd\u20e5", + npart: "\u2202\u0338", + npolint: "\u2a14", + npr: "\u2280", + nprcue: "\u22e0", + nprec: "\u2280", + npreceq: "\u2aaf\u0338", + npre: "\u2aaf\u0338", + nrarrc: "\u2933\u0338", + nrarr: "\u219b", + nrArr: "\u21cf", + nrarrw: "\u219d\u0338", + nrightarrow: "\u219b", + nRightarrow: "\u21cf", + nrtri: "\u22eb", + nrtrie: "\u22ed", + nsc: "\u2281", + nsccue: "\u22e1", + nsce: "\u2ab0\u0338", + Nscr: "\ud835\udca9", + nscr: "\ud835\udcc3", + nshortmid: "\u2224", + nshortparallel: "\u2226", + nsim: "\u2241", + nsime: "\u2244", + nsimeq: "\u2244", + nsmid: "\u2224", + nspar: "\u2226", + nsqsube: "\u22e2", + nsqsupe: "\u22e3", + nsub: "\u2284", + nsubE: "\u2ac5\u0338", + nsube: "\u2288", + nsubset: "\u2282\u20d2", + nsubseteq: "\u2288", + nsubseteqq: "\u2ac5\u0338", + nsucc: "\u2281", + nsucceq: "\u2ab0\u0338", + nsup: "\u2285", + nsupE: "\u2ac6\u0338", + nsupe: "\u2289", + nsupset: "\u2283\u20d2", + nsupseteq: "\u2289", + nsupseteqq: "\u2ac6\u0338", + ntgl: "\u2279", + Ntilde: "\xd1", + ntilde: "\xf1", + ntlg: "\u2278", + ntriangleleft: "\u22ea", + ntrianglelefteq: "\u22ec", + ntriangleright: "\u22eb", + ntrianglerighteq: "\u22ed", + Nu: "\u039d", + nu: "\u03bd", + num: "#", + numero: "\u2116", + numsp: "\u2007", + nvap: "\u224d\u20d2", + nvdash: "\u22ac", + nvDash: "\u22ad", + nVdash: "\u22ae", + nVDash: "\u22af", + nvge: "\u2265\u20d2", + nvgt: ">\u20d2", + nvHarr: "\u2904", + nvinfin: "\u29de", + nvlArr: "\u2902", + nvle: "\u2264\u20d2", + nvlt: "<\u20d2", + nvltrie: "\u22b4\u20d2", + nvrArr: "\u2903", + nvrtrie: "\u22b5\u20d2", + nvsim: "\u223c\u20d2", + nwarhk: "\u2923", + nwarr: "\u2196", + nwArr: "\u21d6", + nwarrow: "\u2196", + nwnear: "\u2927", + Oacute: "\xd3", + oacute: "\xf3", + oast: "\u229b", + Ocirc: "\xd4", + ocirc: "\xf4", + ocir: "\u229a", + Ocy: "\u041e", + ocy: "\u043e", + odash: "\u229d", + Odblac: "\u0150", + odblac: "\u0151", + odiv: "\u2a38", + odot: "\u2299", + odsold: "\u29bc", + OElig: "\u0152", + oelig: "\u0153", + ofcir: "\u29bf", + Ofr: "\ud835\udd12", + ofr: "\ud835\udd2c", + ogon: "\u02db", + Ograve: "\xd2", + ograve: "\xf2", + ogt: "\u29c1", + ohbar: "\u29b5", + ohm: "\u03a9", + oint: "\u222e", + olarr: "\u21ba", + olcir: "\u29be", + olcross: "\u29bb", + oline: "\u203e", + olt: "\u29c0", + Omacr: "\u014c", + omacr: "\u014d", + Omega: "\u03a9", + omega: "\u03c9", + Omicron: "\u039f", + omicron: "\u03bf", + omid: "\u29b6", + ominus: "\u2296", + Oopf: "\ud835\udd46", + oopf: "\ud835\udd60", + opar: "\u29b7", + OpenCurlyDoubleQuote: "\u201c", + OpenCurlyQuote: "\u2018", + operp: "\u29b9", + oplus: "\u2295", + orarr: "\u21bb", + Or: "\u2a54", + or: "\u2228", + ord: "\u2a5d", + order: "\u2134", + orderof: "\u2134", + ordf: "\xaa", + ordm: "\xba", + origof: "\u22b6", + oror: "\u2a56", + orslope: "\u2a57", + orv: "\u2a5b", + oS: "\u24c8", + Oscr: "\ud835\udcaa", + oscr: "\u2134", + Oslash: "\xd8", + oslash: "\xf8", + osol: "\u2298", + Otilde: "\xd5", + otilde: "\xf5", + otimesas: "\u2a36", + Otimes: "\u2a37", + otimes: "\u2297", + Ouml: "\xd6", + ouml: "\xf6", + ovbar: "\u233d", + OverBar: "\u203e", + OverBrace: "\u23de", + OverBracket: "\u23b4", + OverParenthesis: "\u23dc", + para: "\xb6", + parallel: "\u2225", + par: "\u2225", + parsim: "\u2af3", + parsl: "\u2afd", + part: "\u2202", + PartialD: "\u2202", + Pcy: "\u041f", + pcy: "\u043f", + percnt: "%", + period: ".", + permil: "\u2030", + perp: "\u22a5", + pertenk: "\u2031", + Pfr: "\ud835\udd13", + pfr: "\ud835\udd2d", + Phi: "\u03a6", + phi: "\u03c6", + phiv: "\u03d5", + phmmat: "\u2133", + phone: "\u260e", + Pi: "\u03a0", + pi: "\u03c0", + pitchfork: "\u22d4", + piv: "\u03d6", + planck: "\u210f", + planckh: "\u210e", + plankv: "\u210f", + plusacir: "\u2a23", + plusb: "\u229e", + pluscir: "\u2a22", + plus: "+", + plusdo: "\u2214", + plusdu: "\u2a25", + pluse: "\u2a72", + PlusMinus: "\xb1", + plusmn: "\xb1", + plussim: "\u2a26", + plustwo: "\u2a27", + pm: "\xb1", + Poincareplane: "\u210c", + pointint: "\u2a15", + popf: "\ud835\udd61", + Popf: "\u2119", + pound: "\xa3", + prap: "\u2ab7", + Pr: "\u2abb", + pr: "\u227a", + prcue: "\u227c", + precapprox: "\u2ab7", + prec: "\u227a", + preccurlyeq: "\u227c", + Precedes: "\u227a", + PrecedesEqual: "\u2aaf", + PrecedesSlantEqual: "\u227c", + PrecedesTilde: "\u227e", + preceq: "\u2aaf", + precnapprox: "\u2ab9", + precneqq: "\u2ab5", + precnsim: "\u22e8", + pre: "\u2aaf", + prE: "\u2ab3", + precsim: "\u227e", + prime: "\u2032", + Prime: "\u2033", + primes: "\u2119", + prnap: "\u2ab9", + prnE: "\u2ab5", + prnsim: "\u22e8", + prod: "\u220f", + Product: "\u220f", + profalar: "\u232e", + profline: "\u2312", + profsurf: "\u2313", + prop: "\u221d", + Proportional: "\u221d", + Proportion: "\u2237", + propto: "\u221d", + prsim: "\u227e", + prurel: "\u22b0", + Pscr: "\ud835\udcab", + pscr: "\ud835\udcc5", + Psi: "\u03a8", + psi: "\u03c8", + puncsp: "\u2008", + Qfr: "\ud835\udd14", + qfr: "\ud835\udd2e", + qint: "\u2a0c", + qopf: "\ud835\udd62", + Qopf: "\u211a", + qprime: "\u2057", + Qscr: "\ud835\udcac", + qscr: "\ud835\udcc6", + quaternions: "\u210d", + quatint: "\u2a16", + quest: "?", + questeq: "\u225f", + quot: '"', + QUOT: '"', + rAarr: "\u21db", + race: "\u223d\u0331", + Racute: "\u0154", + racute: "\u0155", + radic: "\u221a", + raemptyv: "\u29b3", + rang: "\u27e9", + Rang: "\u27eb", + rangd: "\u2992", + range: "\u29a5", + rangle: "\u27e9", + raquo: "\xbb", + rarrap: "\u2975", + rarrb: "\u21e5", + rarrbfs: "\u2920", + rarrc: "\u2933", + rarr: "\u2192", + Rarr: "\u21a0", + rArr: "\u21d2", + rarrfs: "\u291e", + rarrhk: "\u21aa", + rarrlp: "\u21ac", + rarrpl: "\u2945", + rarrsim: "\u2974", + Rarrtl: "\u2916", + rarrtl: "\u21a3", + rarrw: "\u219d", + ratail: "\u291a", + rAtail: "\u291c", + ratio: "\u2236", + rationals: "\u211a", + rbarr: "\u290d", + rBarr: "\u290f", + RBarr: "\u2910", + rbbrk: "\u2773", + rbrace: "}", + rbrack: "]", + rbrke: "\u298c", + rbrksld: "\u298e", + rbrkslu: "\u2990", + Rcaron: "\u0158", + rcaron: "\u0159", + Rcedil: "\u0156", + rcedil: "\u0157", + rceil: "\u2309", + rcub: "}", + Rcy: "\u0420", + rcy: "\u0440", + rdca: "\u2937", + rdldhar: "\u2969", + rdquo: "\u201d", + rdquor: "\u201d", + rdsh: "\u21b3", + real: "\u211c", + realine: "\u211b", + realpart: "\u211c", + reals: "\u211d", + Re: "\u211c", + rect: "\u25ad", + reg: "\xae", + REG: "\xae", + ReverseElement: "\u220b", + ReverseEquilibrium: "\u21cb", + ReverseUpEquilibrium: "\u296f", + rfisht: "\u297d", + rfloor: "\u230b", + rfr: "\ud835\udd2f", + Rfr: "\u211c", + rHar: "\u2964", + rhard: "\u21c1", + rharu: "\u21c0", + rharul: "\u296c", + Rho: "\u03a1", + rho: "\u03c1", + rhov: "\u03f1", + RightAngleBracket: "\u27e9", + RightArrowBar: "\u21e5", + rightarrow: "\u2192", + RightArrow: "\u2192", + Rightarrow: "\u21d2", + RightArrowLeftArrow: "\u21c4", + rightarrowtail: "\u21a3", + RightCeiling: "\u2309", + RightDoubleBracket: "\u27e7", + RightDownTeeVector: "\u295d", + RightDownVectorBar: "\u2955", + RightDownVector: "\u21c2", + RightFloor: "\u230b", + rightharpoondown: "\u21c1", + rightharpoonup: "\u21c0", + rightleftarrows: "\u21c4", + rightleftharpoons: "\u21cc", + rightrightarrows: "\u21c9", + rightsquigarrow: "\u219d", + RightTeeArrow: "\u21a6", + RightTee: "\u22a2", + RightTeeVector: "\u295b", + rightthreetimes: "\u22cc", + RightTriangleBar: "\u29d0", + RightTriangle: "\u22b3", + RightTriangleEqual: "\u22b5", + RightUpDownVector: "\u294f", + RightUpTeeVector: "\u295c", + RightUpVectorBar: "\u2954", + RightUpVector: "\u21be", + RightVectorBar: "\u2953", + RightVector: "\u21c0", + ring: "\u02da", + risingdotseq: "\u2253", + rlarr: "\u21c4", + rlhar: "\u21cc", + rlm: "\u200f", + rmoustache: "\u23b1", + rmoust: "\u23b1", + rnmid: "\u2aee", + roang: "\u27ed", + roarr: "\u21fe", + robrk: "\u27e7", + ropar: "\u2986", + ropf: "\ud835\udd63", + Ropf: "\u211d", + roplus: "\u2a2e", + rotimes: "\u2a35", + RoundImplies: "\u2970", + rpar: ")", + rpargt: "\u2994", + rppolint: "\u2a12", + rrarr: "\u21c9", + Rrightarrow: "\u21db", + rsaquo: "\u203a", + rscr: "\ud835\udcc7", + Rscr: "\u211b", + rsh: "\u21b1", + Rsh: "\u21b1", + rsqb: "]", + rsquo: "\u2019", + rsquor: "\u2019", + rthree: "\u22cc", + rtimes: "\u22ca", + rtri: "\u25b9", + rtrie: "\u22b5", + rtrif: "\u25b8", + rtriltri: "\u29ce", + RuleDelayed: "\u29f4", + ruluhar: "\u2968", + rx: "\u211e", + Sacute: "\u015a", + sacute: "\u015b", + sbquo: "\u201a", + scap: "\u2ab8", + Scaron: "\u0160", + scaron: "\u0161", + Sc: "\u2abc", + sc: "\u227b", + sccue: "\u227d", + sce: "\u2ab0", + scE: "\u2ab4", + Scedil: "\u015e", + scedil: "\u015f", + Scirc: "\u015c", + scirc: "\u015d", + scnap: "\u2aba", + scnE: "\u2ab6", + scnsim: "\u22e9", + scpolint: "\u2a13", + scsim: "\u227f", + Scy: "\u0421", + scy: "\u0441", + sdotb: "\u22a1", + sdot: "\u22c5", + sdote: "\u2a66", + searhk: "\u2925", + searr: "\u2198", + seArr: "\u21d8", + searrow: "\u2198", + sect: "\xa7", + semi: ";", + seswar: "\u2929", + setminus: "\u2216", + setmn: "\u2216", + sext: "\u2736", + Sfr: "\ud835\udd16", + sfr: "\ud835\udd30", + sfrown: "\u2322", + sharp: "\u266f", + SHCHcy: "\u0429", + shchcy: "\u0449", + SHcy: "\u0428", + shcy: "\u0448", + ShortDownArrow: "\u2193", + ShortLeftArrow: "\u2190", + shortmid: "\u2223", + shortparallel: "\u2225", + ShortRightArrow: "\u2192", + ShortUpArrow: "\u2191", + shy: "\xad", + Sigma: "\u03a3", + sigma: "\u03c3", + sigmaf: "\u03c2", + sigmav: "\u03c2", + sim: "\u223c", + simdot: "\u2a6a", + sime: "\u2243", + simeq: "\u2243", + simg: "\u2a9e", + simgE: "\u2aa0", + siml: "\u2a9d", + simlE: "\u2a9f", + simne: "\u2246", + simplus: "\u2a24", + simrarr: "\u2972", + slarr: "\u2190", + SmallCircle: "\u2218", + smallsetminus: "\u2216", + smashp: "\u2a33", + smeparsl: "\u29e4", + smid: "\u2223", + smile: "\u2323", + smt: "\u2aaa", + smte: "\u2aac", + smtes: "\u2aac\ufe00", + SOFTcy: "\u042c", + softcy: "\u044c", + solbar: "\u233f", + solb: "\u29c4", + sol: "/", + Sopf: "\ud835\udd4a", + sopf: "\ud835\udd64", + spades: "\u2660", + spadesuit: "\u2660", + spar: "\u2225", + sqcap: "\u2293", + sqcaps: "\u2293\ufe00", + sqcup: "\u2294", + sqcups: "\u2294\ufe00", + Sqrt: "\u221a", + sqsub: "\u228f", + sqsube: "\u2291", + sqsubset: "\u228f", + sqsubseteq: "\u2291", + sqsup: "\u2290", + sqsupe: "\u2292", + sqsupset: "\u2290", + sqsupseteq: "\u2292", + square: "\u25a1", + Square: "\u25a1", + SquareIntersection: "\u2293", + SquareSubset: "\u228f", + SquareSubsetEqual: "\u2291", + SquareSuperset: "\u2290", + SquareSupersetEqual: "\u2292", + SquareUnion: "\u2294", + squarf: "\u25aa", + squ: "\u25a1", + squf: "\u25aa", + srarr: "\u2192", + Sscr: "\ud835\udcae", + sscr: "\ud835\udcc8", + ssetmn: "\u2216", + ssmile: "\u2323", + sstarf: "\u22c6", + Star: "\u22c6", + star: "\u2606", + starf: "\u2605", + straightepsilon: "\u03f5", + straightphi: "\u03d5", + strns: "\xaf", + sub: "\u2282", + Sub: "\u22d0", + subdot: "\u2abd", + subE: "\u2ac5", + sube: "\u2286", + subedot: "\u2ac3", + submult: "\u2ac1", + subnE: "\u2acb", + subne: "\u228a", + subplus: "\u2abf", + subrarr: "\u2979", + subset: "\u2282", + Subset: "\u22d0", + subseteq: "\u2286", + subseteqq: "\u2ac5", + SubsetEqual: "\u2286", + subsetneq: "\u228a", + subsetneqq: "\u2acb", + subsim: "\u2ac7", + subsub: "\u2ad5", + subsup: "\u2ad3", + succapprox: "\u2ab8", + succ: "\u227b", + succcurlyeq: "\u227d", + Succeeds: "\u227b", + SucceedsEqual: "\u2ab0", + SucceedsSlantEqual: "\u227d", + SucceedsTilde: "\u227f", + succeq: "\u2ab0", + succnapprox: "\u2aba", + succneqq: "\u2ab6", + succnsim: "\u22e9", + succsim: "\u227f", + SuchThat: "\u220b", + sum: "\u2211", + Sum: "\u2211", + sung: "\u266a", + sup1: "\xb9", + sup2: "\xb2", + sup3: "\xb3", + sup: "\u2283", + Sup: "\u22d1", + supdot: "\u2abe", + supdsub: "\u2ad8", + supE: "\u2ac6", + supe: "\u2287", + supedot: "\u2ac4", + Superset: "\u2283", + SupersetEqual: "\u2287", + suphsol: "\u27c9", + suphsub: "\u2ad7", + suplarr: "\u297b", + supmult: "\u2ac2", + supnE: "\u2acc", + supne: "\u228b", + supplus: "\u2ac0", + supset: "\u2283", + Supset: "\u22d1", + supseteq: "\u2287", + supseteqq: "\u2ac6", + supsetneq: "\u228b", + supsetneqq: "\u2acc", + supsim: "\u2ac8", + supsub: "\u2ad4", + supsup: "\u2ad6", + swarhk: "\u2926", + swarr: "\u2199", + swArr: "\u21d9", + swarrow: "\u2199", + swnwar: "\u292a", + szlig: "\xdf", + Tab: "\t", + target: "\u2316", + Tau: "\u03a4", + tau: "\u03c4", + tbrk: "\u23b4", + Tcaron: "\u0164", + tcaron: "\u0165", + Tcedil: "\u0162", + tcedil: "\u0163", + Tcy: "\u0422", + tcy: "\u0442", + tdot: "\u20db", + telrec: "\u2315", + Tfr: "\ud835\udd17", + tfr: "\ud835\udd31", + there4: "\u2234", + therefore: "\u2234", + Therefore: "\u2234", + Theta: "\u0398", + theta: "\u03b8", + thetasym: "\u03d1", + thetav: "\u03d1", + thickapprox: "\u2248", + thicksim: "\u223c", + ThickSpace: "\u205f\u200a", + ThinSpace: "\u2009", + thinsp: "\u2009", + thkap: "\u2248", + thksim: "\u223c", + THORN: "\xde", + thorn: "\xfe", + tilde: "\u02dc", + Tilde: "\u223c", + TildeEqual: "\u2243", + TildeFullEqual: "\u2245", + TildeTilde: "\u2248", + timesbar: "\u2a31", + timesb: "\u22a0", + times: "\xd7", + timesd: "\u2a30", + tint: "\u222d", + toea: "\u2928", + topbot: "\u2336", + topcir: "\u2af1", + top: "\u22a4", + Topf: "\ud835\udd4b", + topf: "\ud835\udd65", + topfork: "\u2ada", + tosa: "\u2929", + tprime: "\u2034", + trade: "\u2122", + TRADE: "\u2122", + triangle: "\u25b5", + triangledown: "\u25bf", + triangleleft: "\u25c3", + trianglelefteq: "\u22b4", + triangleq: "\u225c", + triangleright: "\u25b9", + trianglerighteq: "\u22b5", + tridot: "\u25ec", + trie: "\u225c", + triminus: "\u2a3a", + TripleDot: "\u20db", + triplus: "\u2a39", + trisb: "\u29cd", + tritime: "\u2a3b", + trpezium: "\u23e2", + Tscr: "\ud835\udcaf", + tscr: "\ud835\udcc9", + TScy: "\u0426", + tscy: "\u0446", + TSHcy: "\u040b", + tshcy: "\u045b", + Tstrok: "\u0166", + tstrok: "\u0167", + twixt: "\u226c", + twoheadleftarrow: "\u219e", + twoheadrightarrow: "\u21a0", + Uacute: "\xda", + uacute: "\xfa", + uarr: "\u2191", + Uarr: "\u219f", + uArr: "\u21d1", + Uarrocir: "\u2949", + Ubrcy: "\u040e", + ubrcy: "\u045e", + Ubreve: "\u016c", + ubreve: "\u016d", + Ucirc: "\xdb", + ucirc: "\xfb", + Ucy: "\u0423", + ucy: "\u0443", + udarr: "\u21c5", + Udblac: "\u0170", + udblac: "\u0171", + udhar: "\u296e", + ufisht: "\u297e", + Ufr: "\ud835\udd18", + ufr: "\ud835\udd32", + Ugrave: "\xd9", + ugrave: "\xf9", + uHar: "\u2963", + uharl: "\u21bf", + uharr: "\u21be", + uhblk: "\u2580", + ulcorn: "\u231c", + ulcorner: "\u231c", + ulcrop: "\u230f", + ultri: "\u25f8", + Umacr: "\u016a", + umacr: "\u016b", + uml: "\xa8", + UnderBar: "_", + UnderBrace: "\u23df", + UnderBracket: "\u23b5", + UnderParenthesis: "\u23dd", + Union: "\u22c3", + UnionPlus: "\u228e", + Uogon: "\u0172", + uogon: "\u0173", + Uopf: "\ud835\udd4c", + uopf: "\ud835\udd66", + UpArrowBar: "\u2912", + uparrow: "\u2191", + UpArrow: "\u2191", + Uparrow: "\u21d1", + UpArrowDownArrow: "\u21c5", + updownarrow: "\u2195", + UpDownArrow: "\u2195", + Updownarrow: "\u21d5", + UpEquilibrium: "\u296e", + upharpoonleft: "\u21bf", + upharpoonright: "\u21be", + uplus: "\u228e", + UpperLeftArrow: "\u2196", + UpperRightArrow: "\u2197", + upsi: "\u03c5", + Upsi: "\u03d2", + upsih: "\u03d2", + Upsilon: "\u03a5", + upsilon: "\u03c5", + UpTeeArrow: "\u21a5", + UpTee: "\u22a5", + upuparrows: "\u21c8", + urcorn: "\u231d", + urcorner: "\u231d", + urcrop: "\u230e", + Uring: "\u016e", + uring: "\u016f", + urtri: "\u25f9", + Uscr: "\ud835\udcb0", + uscr: "\ud835\udcca", + utdot: "\u22f0", + Utilde: "\u0168", + utilde: "\u0169", + utri: "\u25b5", + utrif: "\u25b4", + uuarr: "\u21c8", + Uuml: "\xdc", + uuml: "\xfc", + uwangle: "\u29a7", + vangrt: "\u299c", + varepsilon: "\u03f5", + varkappa: "\u03f0", + varnothing: "\u2205", + varphi: "\u03d5", + varpi: "\u03d6", + varpropto: "\u221d", + varr: "\u2195", + vArr: "\u21d5", + varrho: "\u03f1", + varsigma: "\u03c2", + varsubsetneq: "\u228a\ufe00", + varsubsetneqq: "\u2acb\ufe00", + varsupsetneq: "\u228b\ufe00", + varsupsetneqq: "\u2acc\ufe00", + vartheta: "\u03d1", + vartriangleleft: "\u22b2", + vartriangleright: "\u22b3", + vBar: "\u2ae8", + Vbar: "\u2aeb", + vBarv: "\u2ae9", + Vcy: "\u0412", + vcy: "\u0432", + vdash: "\u22a2", + vDash: "\u22a8", + Vdash: "\u22a9", + VDash: "\u22ab", + Vdashl: "\u2ae6", + veebar: "\u22bb", + vee: "\u2228", + Vee: "\u22c1", + veeeq: "\u225a", + vellip: "\u22ee", + verbar: "|", + Verbar: "\u2016", + vert: "|", + Vert: "\u2016", + VerticalBar: "\u2223", + VerticalLine: "|", + VerticalSeparator: "\u2758", + VerticalTilde: "\u2240", + VeryThinSpace: "\u200a", + Vfr: "\ud835\udd19", + vfr: "\ud835\udd33", + vltri: "\u22b2", + vnsub: "\u2282\u20d2", + vnsup: "\u2283\u20d2", + Vopf: "\ud835\udd4d", + vopf: "\ud835\udd67", + vprop: "\u221d", + vrtri: "\u22b3", + Vscr: "\ud835\udcb1", + vscr: "\ud835\udccb", + vsubnE: "\u2acb\ufe00", + vsubne: "\u228a\ufe00", + vsupnE: "\u2acc\ufe00", + vsupne: "\u228b\ufe00", + Vvdash: "\u22aa", + vzigzag: "\u299a", + Wcirc: "\u0174", + wcirc: "\u0175", + wedbar: "\u2a5f", + wedge: "\u2227", + Wedge: "\u22c0", + wedgeq: "\u2259", + weierp: "\u2118", + Wfr: "\ud835\udd1a", + wfr: "\ud835\udd34", + Wopf: "\ud835\udd4e", + wopf: "\ud835\udd68", + wp: "\u2118", + wr: "\u2240", + wreath: "\u2240", + Wscr: "\ud835\udcb2", + wscr: "\ud835\udccc", + xcap: "\u22c2", + xcirc: "\u25ef", + xcup: "\u22c3", + xdtri: "\u25bd", + Xfr: "\ud835\udd1b", + xfr: "\ud835\udd35", + xharr: "\u27f7", + xhArr: "\u27fa", + Xi: "\u039e", + xi: "\u03be", + xlarr: "\u27f5", + xlArr: "\u27f8", + xmap: "\u27fc", + xnis: "\u22fb", + xodot: "\u2a00", + Xopf: "\ud835\udd4f", + xopf: "\ud835\udd69", + xoplus: "\u2a01", + xotime: "\u2a02", + xrarr: "\u27f6", + xrArr: "\u27f9", + Xscr: "\ud835\udcb3", + xscr: "\ud835\udccd", + xsqcup: "\u2a06", + xuplus: "\u2a04", + xutri: "\u25b3", + xvee: "\u22c1", + xwedge: "\u22c0", + Yacute: "\xdd", + yacute: "\xfd", + YAcy: "\u042f", + yacy: "\u044f", + Ycirc: "\u0176", + ycirc: "\u0177", + Ycy: "\u042b", + ycy: "\u044b", + yen: "\xa5", + Yfr: "\ud835\udd1c", + yfr: "\ud835\udd36", + YIcy: "\u0407", + yicy: "\u0457", + Yopf: "\ud835\udd50", + yopf: "\ud835\udd6a", + Yscr: "\ud835\udcb4", + yscr: "\ud835\udcce", + YUcy: "\u042e", + yucy: "\u044e", + yuml: "\xff", + Yuml: "\u0178", + Zacute: "\u0179", + zacute: "\u017a", + Zcaron: "\u017d", + zcaron: "\u017e", + Zcy: "\u0417", + zcy: "\u0437", + Zdot: "\u017b", + zdot: "\u017c", + zeetrf: "\u2128", + ZeroWidthSpace: "\u200b", + Zeta: "\u0396", + zeta: "\u03b6", + zfr: "\ud835\udd37", + Zfr: "\u2128", + ZHcy: "\u0416", + zhcy: "\u0436", + zigrarr: "\u21dd", + zopf: "\ud835\udd6b", + Zopf: "\u2124", + Zscr: "\ud835\udcb5", + zscr: "\ud835\udccf", + zwj: "\u200d", + zwnj: "\u200c" + }; + /*eslint quotes:0*/ var entities = require$$0; + var regex$4 = /[!-#%-\*,-\/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0A76\u0AF0\u0C84\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E4E\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD803[\uDF55-\uDF59]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC8\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDC3B\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71\uDEF7\uDEF8]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD81B[\uDE97-\uDE9A]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/; + var encodeCache = {}; + // Create a lookup array where anything but characters in `chars` string + // and alphanumeric chars is percent-encoded. + + function getEncodeCache(exclude) { + var i, ch, cache = encodeCache[exclude]; + if (cache) { + return cache; + } + cache = encodeCache[exclude] = []; + for (i = 0; i < 128; i++) { + ch = String.fromCharCode(i); + if (/^[0-9a-z]$/i.test(ch)) { + // always allow unencoded alphanumeric characters + cache.push(ch); + } else { + cache.push("%" + ("0" + i.toString(16).toUpperCase()).slice(-2)); + } + } + for (i = 0; i < exclude.length; i++) { + cache[exclude.charCodeAt(i)] = exclude[i]; + } + return cache; + } + // Encode unsafe characters with percent-encoding, skipping already + // encoded sequences. + + // - string - string to encode + // - exclude - list of characters to ignore (in addition to a-zA-Z0-9) + // - keepEscaped - don't encode '%' in a correct escape sequence (default: true) + + function encode$2(string, exclude, keepEscaped) { + var i, l, code, nextCode, cache, result = ""; + if (typeof exclude !== "string") { + // encode(string, keepEscaped) + keepEscaped = exclude; + exclude = encode$2.defaultChars; + } + if (typeof keepEscaped === "undefined") { + keepEscaped = true; + } + cache = getEncodeCache(exclude); + for (i = 0, l = string.length; i < l; i++) { + code = string.charCodeAt(i); + if (keepEscaped && code === 37 /* % */ && i + 2 < l) { + if (/^[0-9a-f]{2}$/i.test(string.slice(i + 1, i + 3))) { + result += string.slice(i, i + 3); + i += 2; + continue; + } + } + if (code < 128) { + result += cache[code]; + continue; + } + if (code >= 55296 && code <= 57343) { + if (code >= 55296 && code <= 56319 && i + 1 < l) { + nextCode = string.charCodeAt(i + 1); + if (nextCode >= 56320 && nextCode <= 57343) { + result += encodeURIComponent(string[i] + string[i + 1]); + i++; + continue; + } + } + result += "%EF%BF%BD"; + continue; + } + result += encodeURIComponent(string[i]); + } + return result; + } + encode$2.defaultChars = ";/?:@&=+$,-_.!~*'()#"; + encode$2.componentChars = "-_.!~*'()"; + var encode_1 = encode$2; + /* eslint-disable no-bitwise */ var decodeCache = {}; + function getDecodeCache(exclude) { + var i, ch, cache = decodeCache[exclude]; + if (cache) { + return cache; + } + cache = decodeCache[exclude] = []; + for (i = 0; i < 128; i++) { + ch = String.fromCharCode(i); + cache.push(ch); + } + for (i = 0; i < exclude.length; i++) { + ch = exclude.charCodeAt(i); + cache[ch] = "%" + ("0" + ch.toString(16).toUpperCase()).slice(-2); + } + return cache; + } + // Decode percent-encoded string. + + function decode$2(string, exclude) { + var cache; + if (typeof exclude !== "string") { + exclude = decode$2.defaultChars; + } + cache = getDecodeCache(exclude); + return string.replace(/(%[a-f0-9]{2})+/gi, (function(seq) { + var i, l, b1, b2, b3, b4, chr, result = ""; + for (i = 0, l = seq.length; i < l; i += 3) { + b1 = parseInt(seq.slice(i + 1, i + 3), 16); + if (b1 < 128) { + result += cache[b1]; + continue; + } + if ((b1 & 224) === 192 && i + 3 < l) { + // 110xxxxx 10xxxxxx + b2 = parseInt(seq.slice(i + 4, i + 6), 16); + if ((b2 & 192) === 128) { + chr = b1 << 6 & 1984 | b2 & 63; + if (chr < 128) { + result += "\ufffd\ufffd"; + } else { + result += String.fromCharCode(chr); + } + i += 3; + continue; + } + } + if ((b1 & 240) === 224 && i + 6 < l) { + // 1110xxxx 10xxxxxx 10xxxxxx + b2 = parseInt(seq.slice(i + 4, i + 6), 16); + b3 = parseInt(seq.slice(i + 7, i + 9), 16); + if ((b2 & 192) === 128 && (b3 & 192) === 128) { + chr = b1 << 12 & 61440 | b2 << 6 & 4032 | b3 & 63; + if (chr < 2048 || chr >= 55296 && chr <= 57343) { + result += "\ufffd\ufffd\ufffd"; + } else { + result += String.fromCharCode(chr); + } + i += 6; + continue; + } + } + if ((b1 & 248) === 240 && i + 9 < l) { + // 111110xx 10xxxxxx 10xxxxxx 10xxxxxx + b2 = parseInt(seq.slice(i + 4, i + 6), 16); + b3 = parseInt(seq.slice(i + 7, i + 9), 16); + b4 = parseInt(seq.slice(i + 10, i + 12), 16); + if ((b2 & 192) === 128 && (b3 & 192) === 128 && (b4 & 192) === 128) { + chr = b1 << 18 & 1835008 | b2 << 12 & 258048 | b3 << 6 & 4032 | b4 & 63; + if (chr < 65536 || chr > 1114111) { + result += "\ufffd\ufffd\ufffd\ufffd"; + } else { + chr -= 65536; + result += String.fromCharCode(55296 + (chr >> 10), 56320 + (chr & 1023)); + } + i += 9; + continue; + } + } + result += "\ufffd"; + } + return result; + })); + } + decode$2.defaultChars = ";/?:@&=+$,#"; + decode$2.componentChars = ""; + var decode_1 = decode$2; + var format$1 = function format(url) { + var result = ""; + result += url.protocol || ""; + result += url.slashes ? "//" : ""; + result += url.auth ? url.auth + "@" : ""; + if (url.hostname && url.hostname.indexOf(":") !== -1) { + // ipv6 address + result += "[" + url.hostname + "]"; + } else { + result += url.hostname || ""; + } + result += url.port ? ":" + url.port : ""; + result += url.pathname || ""; + result += url.search || ""; + result += url.hash || ""; + return result; + }; + // Copyright Joyent, Inc. and other Node contributors. + + // Changes from joyent/node: + + // 1. No leading slash in paths, + // e.g. in `url.parse('http://foo?bar')` pathname is ``, not `/` + + // 2. Backslashes are not replaced with slashes, + // so `http:\\example.org\` is treated like a relative path + + // 3. Trailing colon is treated like a part of the path, + // i.e. in `http://example.org:foo` pathname is `:foo` + + // 4. Nothing is URL-encoded in the resulting object, + // (in joyent/node some chars in auth and paths are encoded) + + // 5. `url.parse()` does not have `parseQueryString` argument + + // 6. Removed extraneous result properties: `host`, `path`, `query`, etc., + // which can be constructed using other parts of the url. + + function Url() { + this.protocol = null; + this.slashes = null; + this.auth = null; + this.port = null; + this.hostname = null; + this.hash = null; + this.search = null; + this.pathname = null; + } + // Reference: RFC 3986, RFC 1808, RFC 2396 + // define these here so at least they only have to be + // compiled once on the first module load. + var protocolPattern = /^([a-z0-9.+-]+:)/i, portPattern = /:[0-9]*$/, + // Special case for a simple path URL + simplePathPattern = /^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/, + // RFC 2396: characters reserved for delimiting URLs. + // We actually just auto-escape these. + delims = [ "<", ">", '"', "`", " ", "\r", "\n", "\t" ], + // RFC 2396: characters not allowed for various reasons. + unwise = [ "{", "}", "|", "\\", "^", "`" ].concat(delims), + // Allowed by RFCs, but cause of XSS attacks. Always escape these. + autoEscape = [ "'" ].concat(unwise), + // Characters that are never ever allowed in a hostname. + // Note that any invalid chars are also handled, but these + // are the ones that are *expected* to be seen, so we fast-path + // them. + nonHostChars = [ "%", "/", "?", ";", "#" ].concat(autoEscape), hostEndingChars = [ "/", "?", "#" ], hostnameMaxLen = 255, hostnamePartPattern = /^[+a-z0-9A-Z_-]{0,63}$/, hostnamePartStart = /^([+a-z0-9A-Z_-]{0,63})(.*)$/, + // protocols that can allow "unsafe" and "unwise" chars. + /* eslint-disable no-script-url */ + // protocols that never have a hostname. + hostlessProtocol = { + javascript: true, + "javascript:": true + }, + // protocols that always contain a // bit. + slashedProtocol = { + http: true, + https: true, + ftp: true, + gopher: true, + file: true, + "http:": true, + "https:": true, + "ftp:": true, + "gopher:": true, + "file:": true + }; + /* eslint-enable no-script-url */ function urlParse(url, slashesDenoteHost) { + if (url && url instanceof Url) { + return url; + } + var u = new Url; + u.parse(url, slashesDenoteHost); + return u; + } + Url.prototype.parse = function(url, slashesDenoteHost) { + var i, l, lowerProto, hec, slashes, rest = url; + // trim before proceeding. + // This is to support parse stuff like " http://foo.com \n" + rest = rest.trim(); + if (!slashesDenoteHost && url.split("#").length === 1) { + // Try fast path regexp + var simplePath = simplePathPattern.exec(rest); + if (simplePath) { + this.pathname = simplePath[1]; + if (simplePath[2]) { + this.search = simplePath[2]; + } + return this; + } + } + var proto = protocolPattern.exec(rest); + if (proto) { + proto = proto[0]; + lowerProto = proto.toLowerCase(); + this.protocol = proto; + rest = rest.substr(proto.length); + } + // figure out if it's got a host + // user@server is *always* interpreted as a hostname, and url + // resolution will treat //foo/bar as host=foo,path=bar because that's + // how the browser resolves relative URLs. + if (slashesDenoteHost || proto || rest.match(/^\/\/[^@\/]+@[^@\/]+/)) { + slashes = rest.substr(0, 2) === "//"; + if (slashes && !(proto && hostlessProtocol[proto])) { + rest = rest.substr(2); + this.slashes = true; + } + } + if (!hostlessProtocol[proto] && (slashes || proto && !slashedProtocol[proto])) { + // there's a hostname. + // the first instance of /, ?, ;, or # ends the host. + // If there is an @ in the hostname, then non-host chars *are* allowed + // to the left of the last @ sign, unless some host-ending character + // comes *before* the @-sign. + // URLs are obnoxious. + // ex: + // http://a@b@c/ => user:a@b host:c + // http://a@b?@c => user:a host:c path:/?@c + // v0.12 TODO(isaacs): This is not quite how Chrome does things. + // Review our test case against browsers more comprehensively. + // find the first instance of any hostEndingChars + var hostEnd = -1; + for (i = 0; i < hostEndingChars.length; i++) { + hec = rest.indexOf(hostEndingChars[i]); + if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) { + hostEnd = hec; + } + } + // at this point, either we have an explicit point where the + // auth portion cannot go past, or the last @ char is the decider. + var auth, atSign; + if (hostEnd === -1) { + // atSign can be anywhere. + atSign = rest.lastIndexOf("@"); + } else { + // atSign must be in auth portion. + // http://a@b/c@d => host:b auth:a path:/c@d + atSign = rest.lastIndexOf("@", hostEnd); + } + // Now we have a portion which is definitely the auth. + // Pull that off. + if (atSign !== -1) { + auth = rest.slice(0, atSign); + rest = rest.slice(atSign + 1); + this.auth = auth; + } + // the host is the remaining to the left of the first non-host char + hostEnd = -1; + for (i = 0; i < nonHostChars.length; i++) { + hec = rest.indexOf(nonHostChars[i]); + if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) { + hostEnd = hec; + } + } + // if we still have not hit it, then the entire thing is a host. + if (hostEnd === -1) { + hostEnd = rest.length; + } + if (rest[hostEnd - 1] === ":") { + hostEnd--; + } + var host = rest.slice(0, hostEnd); + rest = rest.slice(hostEnd); + // pull out port. + this.parseHost(host); + // we've indicated that there is a hostname, + // so even if it's empty, it has to be present. + this.hostname = this.hostname || ""; + // if hostname begins with [ and ends with ] + // assume that it's an IPv6 address. + var ipv6Hostname = this.hostname[0] === "[" && this.hostname[this.hostname.length - 1] === "]"; + // validate a little. + if (!ipv6Hostname) { + var hostparts = this.hostname.split(/\./); + for (i = 0, l = hostparts.length; i < l; i++) { + var part = hostparts[i]; + if (!part) { + continue; + } + if (!part.match(hostnamePartPattern)) { + var newpart = ""; + for (var j = 0, k = part.length; j < k; j++) { + if (part.charCodeAt(j) > 127) { + // we replace non-ASCII char with a temporary placeholder + // we need this to make sure size of hostname is not + // broken by replacing non-ASCII by nothing + newpart += "x"; + } else { + newpart += part[j]; + } + } + // we test again with ASCII char only + if (!newpart.match(hostnamePartPattern)) { + var validParts = hostparts.slice(0, i); + var notHost = hostparts.slice(i + 1); + var bit = part.match(hostnamePartStart); + if (bit) { + validParts.push(bit[1]); + notHost.unshift(bit[2]); + } + if (notHost.length) { + rest = notHost.join(".") + rest; + } + this.hostname = validParts.join("."); + break; + } + } + } + } + if (this.hostname.length > hostnameMaxLen) { + this.hostname = ""; + } + // strip [ and ] from the hostname + // the host field still retains them, though + if (ipv6Hostname) { + this.hostname = this.hostname.substr(1, this.hostname.length - 2); + } + } + // chop off from the tail first. + var hash = rest.indexOf("#"); + if (hash !== -1) { + // got a fragment string. + this.hash = rest.substr(hash); + rest = rest.slice(0, hash); + } + var qm = rest.indexOf("?"); + if (qm !== -1) { + this.search = rest.substr(qm); + rest = rest.slice(0, qm); + } + if (rest) { + this.pathname = rest; + } + if (slashedProtocol[lowerProto] && this.hostname && !this.pathname) { + this.pathname = ""; + } + return this; + }; + Url.prototype.parseHost = function(host) { + var port = portPattern.exec(host); + if (port) { + port = port[0]; + if (port !== ":") { + this.port = port.substr(1); + } + host = host.substr(0, host.length - port.length); + } + if (host) { + this.hostname = host; + } + }; + var parse$1 = urlParse; + var encode$1 = encode_1; + var decode$1 = decode_1; + var format = format$1; + var parse = parse$1; + var mdurl = { + encode: encode$1, + decode: decode$1, + format: format, + parse: parse + }; + var regex$3 = /[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/; + var regex$2 = /[\0-\x1F\x7F-\x9F]/; + var regex$1 = /[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804[\uDCBD\uDCCD]|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/; + var regex = /[ \xA0\u1680\u2000-\u200A\u2028\u2029\u202F\u205F\u3000]/; + var Any = regex$3; + var Cc = regex$2; + var Cf = regex$1; + var P = regex$4; + var Z = regex; + var uc_micro = { + Any: Any, + Cc: Cc, + Cf: Cf, + P: P, + Z: Z + }; + var utils = createCommonjsModule((function(module, exports) { + function _class(obj) { + return Object.prototype.toString.call(obj); + } + function isString(obj) { + return _class(obj) === "[object String]"; + } + var _hasOwnProperty = Object.prototype.hasOwnProperty; + function has(object, key) { + return _hasOwnProperty.call(object, key); + } + // Merge objects + + function assign(obj /*from1, from2, from3, ...*/) { + var sources = Array.prototype.slice.call(arguments, 1); + sources.forEach((function(source) { + if (!source) { + return; + } + if (typeof source !== "object") { + throw new TypeError(source + "must be object"); + } + Object.keys(source).forEach((function(key) { + obj[key] = source[key]; + })); + })); + return obj; + } + // Remove element from array and put another array at those position. + // Useful for some operations with tokens + function arrayReplaceAt(src, pos, newElements) { + return [].concat(src.slice(0, pos), newElements, src.slice(pos + 1)); + } + //////////////////////////////////////////////////////////////////////////////// + function isValidEntityCode(c) { + /*eslint no-bitwise:0*/ + // broken sequence + if (c >= 55296 && c <= 57343) { + return false; + } + // never used + if (c >= 64976 && c <= 65007) { + return false; + } + if ((c & 65535) === 65535 || (c & 65535) === 65534) { + return false; + } + // control codes + if (c >= 0 && c <= 8) { + return false; + } + if (c === 11) { + return false; + } + if (c >= 14 && c <= 31) { + return false; + } + if (c >= 127 && c <= 159) { + return false; + } + // out of range + if (c > 1114111) { + return false; + } + return true; + } + function fromCodePoint(c) { + /*eslint no-bitwise:0*/ + if (c > 65535) { + c -= 65536; + var surrogate1 = 55296 + (c >> 10), surrogate2 = 56320 + (c & 1023); + return String.fromCharCode(surrogate1, surrogate2); + } + return String.fromCharCode(c); + } + var UNESCAPE_MD_RE = /\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g; + var ENTITY_RE = /&([a-z#][a-z0-9]{1,31});/gi; + var UNESCAPE_ALL_RE = new RegExp(UNESCAPE_MD_RE.source + "|" + ENTITY_RE.source, "gi"); + var DIGITAL_ENTITY_TEST_RE = /^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i; + function replaceEntityPattern(match, name) { + var code = 0; + if (has(entities, name)) { + return entities[name]; + } + if (name.charCodeAt(0) === 35 /* # */ && DIGITAL_ENTITY_TEST_RE.test(name)) { + code = name[1].toLowerCase() === "x" ? parseInt(name.slice(2), 16) : parseInt(name.slice(1), 10); + if (isValidEntityCode(code)) { + return fromCodePoint(code); + } + } + return match; + } + /*function replaceEntities(str) { + if (str.indexOf('&') < 0) { return str; } + + return str.replace(ENTITY_RE, replaceEntityPattern); + }*/ function unescapeMd(str) { + if (str.indexOf("\\") < 0) { + return str; + } + return str.replace(UNESCAPE_MD_RE, "$1"); + } + function unescapeAll(str) { + if (str.indexOf("\\") < 0 && str.indexOf("&") < 0) { + return str; + } + return str.replace(UNESCAPE_ALL_RE, (function(match, escaped, entity) { + if (escaped) { + return escaped; + } + return replaceEntityPattern(match, entity); + })); + } + //////////////////////////////////////////////////////////////////////////////// + var HTML_ESCAPE_TEST_RE = /[&<>"]/; + var HTML_ESCAPE_REPLACE_RE = /[&<>"]/g; + var HTML_REPLACEMENTS = { + "&": "&", + "<": "<", + ">": ">", + '"': """ + }; + function replaceUnsafeChar(ch) { + return HTML_REPLACEMENTS[ch]; + } + function escapeHtml(str) { + if (HTML_ESCAPE_TEST_RE.test(str)) { + return str.replace(HTML_ESCAPE_REPLACE_RE, replaceUnsafeChar); + } + return str; + } + //////////////////////////////////////////////////////////////////////////////// + var REGEXP_ESCAPE_RE = /[.?*+^$[\]\\(){}|-]/g; + function escapeRE(str) { + return str.replace(REGEXP_ESCAPE_RE, "\\$&"); + } + //////////////////////////////////////////////////////////////////////////////// + function isSpace(code) { + switch (code) { + case 9: + case 32: + return true; + } + return false; + } + // Zs (unicode class) || [\t\f\v\r\n] + function isWhiteSpace(code) { + if (code >= 8192 && code <= 8202) { + return true; + } + switch (code) { + case 9: + // \t + case 10: + // \n + case 11: + // \v + case 12: + // \f + case 13: + // \r + case 32: + case 160: + case 5760: + case 8239: + case 8287: + case 12288: + return true; + } + return false; + } + //////////////////////////////////////////////////////////////////////////////// + /*eslint-disable max-len*/ + // Currently without astral characters support. + function isPunctChar(ch) { + return regex$4.test(ch); + } + // Markdown ASCII punctuation characters. + + // !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~ + // http://spec.commonmark.org/0.15/#ascii-punctuation-character + + // Don't confuse with unicode punctuation !!! It lacks some chars in ascii range. + + function isMdAsciiPunct(ch) { + switch (ch) { + case 33 /* ! */ : + case 34 /* " */ : + case 35 /* # */ : + case 36 /* $ */ : + case 37 /* % */ : + case 38 /* & */ : + case 39 /* ' */ : + case 40 /* ( */ : + case 41 /* ) */ : + case 42 /* * */ : + case 43 /* + */ : + case 44 /* , */ : + case 45 /* - */ : + case 46 /* . */ : + case 47 /* / */ : + case 58 /* : */ : + case 59 /* ; */ : + case 60 /* < */ : + case 61 /* = */ : + case 62 /* > */ : + case 63 /* ? */ : + case 64 /* @ */ : + case 91 /* [ */ : + case 92 /* \ */ : + case 93 /* ] */ : + case 94 /* ^ */ : + case 95 /* _ */ : + case 96 /* ` */ : + case 123 /* { */ : + case 124 /* | */ : + case 125 /* } */ : + case 126 /* ~ */ : + return true; + + default: + return false; + } + } + // Hepler to unify [reference labels]. + + function normalizeReference(str) { + // Trim and collapse whitespace + str = str.trim().replace(/\s+/g, " "); + // In node v10 'ẞ'.toLowerCase() === 'Ṿ', which is presumed to be a bug + // fixed in v12 (couldn't find any details). + + // So treat this one as a special case + // (remove this when node v10 is no longer supported). + + if ("\u1e9e".toLowerCase() === "\u1e7e") { + str = str.replace(/\u1e9e/g, "\xdf"); + } + // .toLowerCase().toUpperCase() should get rid of all differences + // between letter variants. + + // Simple .toLowerCase() doesn't normalize 125 code points correctly, + // and .toUpperCase doesn't normalize 6 of them (list of exceptions: + // İ, ϴ, ẞ, Ω, K, Å - those are already uppercased, but have differently + // uppercased versions). + + // Here's an example showing how it happens. Lets take greek letter omega: + // uppercase U+0398 (Θ), U+03f4 (ϴ) and lowercase U+03b8 (θ), U+03d1 (ϑ) + + // Unicode entries: + // 0398;GREEK CAPITAL LETTER THETA;Lu;0;L;;;;;N;;;;03B8; + // 03B8;GREEK SMALL LETTER THETA;Ll;0;L;;;;;N;;;0398;;0398 + // 03D1;GREEK THETA SYMBOL;Ll;0;L;<compat> 03B8;;;;N;GREEK SMALL LETTER SCRIPT THETA;;0398;;0398 + // 03F4;GREEK CAPITAL THETA SYMBOL;Lu;0;L;<compat> 0398;;;;N;;;;03B8; + + // Case-insensitive comparison should treat all of them as equivalent. + + // But .toLowerCase() doesn't change ϑ (it's already lowercase), + // and .toUpperCase() doesn't change ϴ (already uppercase). + + // Applying first lower then upper case normalizes any character: + // '\u0398\u03f4\u03b8\u03d1'.toLowerCase().toUpperCase() === '\u0398\u0398\u0398\u0398' + + // Note: this is equivalent to unicode case folding; unicode normalization + // is a different step that is not required here. + + // Final result should be uppercased, because it's later stored in an object + // (this avoid a conflict with Object.prototype members, + // most notably, `__proto__`) + + return str.toLowerCase().toUpperCase(); + } + //////////////////////////////////////////////////////////////////////////////// + // Re-export libraries commonly used in both markdown-it and its plugins, + // so plugins won't have to depend on them explicitly, which reduces their + // bundled size (e.g. a browser build). + + exports.lib = {}; + exports.lib.mdurl = mdurl; + exports.lib.ucmicro = uc_micro; + exports.assign = assign; + exports.isString = isString; + exports.has = has; + exports.unescapeMd = unescapeMd; + exports.unescapeAll = unescapeAll; + exports.isValidEntityCode = isValidEntityCode; + exports.fromCodePoint = fromCodePoint; + // exports.replaceEntities = replaceEntities; + exports.escapeHtml = escapeHtml; + exports.arrayReplaceAt = arrayReplaceAt; + exports.isSpace = isSpace; + exports.isWhiteSpace = isWhiteSpace; + exports.isMdAsciiPunct = isMdAsciiPunct; + exports.isPunctChar = isPunctChar; + exports.escapeRE = escapeRE; + exports.normalizeReference = normalizeReference; + })); + // Parse link label + var parse_link_label = function parseLinkLabel(state, start, disableNested) { + var level, found, marker, prevPos, labelEnd = -1, max = state.posMax, oldPos = state.pos; + state.pos = start + 1; + level = 1; + while (state.pos < max) { + marker = state.src.charCodeAt(state.pos); + if (marker === 93 /* ] */) { + level--; + if (level === 0) { + found = true; + break; + } + } + prevPos = state.pos; + state.md.inline.skipToken(state); + if (marker === 91 /* [ */) { + if (prevPos === state.pos - 1) { + // increase level if we find text `[`, which is not a part of any token + level++; + } else if (disableNested) { + state.pos = oldPos; + return -1; + } + } + } + if (found) { + labelEnd = state.pos; + } + // restore old state + state.pos = oldPos; + return labelEnd; + }; + var unescapeAll$2 = utils.unescapeAll; + var parse_link_destination = function parseLinkDestination(str, pos, max) { + var code, level, lines = 0, start = pos, result = { + ok: false, + pos: 0, + lines: 0, + str: "" + }; + if (str.charCodeAt(pos) === 60 /* < */) { + pos++; + while (pos < max) { + code = str.charCodeAt(pos); + if (code === 10 /* \n */) { + return result; + } + if (code === 60 /* < */) { + return result; + } + if (code === 62 /* > */) { + result.pos = pos + 1; + result.str = unescapeAll$2(str.slice(start + 1, pos)); + result.ok = true; + return result; + } + if (code === 92 /* \ */ && pos + 1 < max) { + pos += 2; + continue; + } + pos++; + } + // no closing '>' + return result; + } + // this should be ... } else { ... branch + level = 0; + while (pos < max) { + code = str.charCodeAt(pos); + if (code === 32) { + break; + } + // ascii control characters + if (code < 32 || code === 127) { + break; + } + if (code === 92 /* \ */ && pos + 1 < max) { + if (str.charCodeAt(pos + 1) === 32) { + break; + } + pos += 2; + continue; + } + if (code === 40 /* ( */) { + level++; + if (level > 32) { + return result; + } + } + if (code === 41 /* ) */) { + if (level === 0) { + break; + } + level--; + } + pos++; + } + if (start === pos) { + return result; + } + if (level !== 0) { + return result; + } + result.str = unescapeAll$2(str.slice(start, pos)); + result.lines = lines; + result.pos = pos; + result.ok = true; + return result; + }; + var unescapeAll$1 = utils.unescapeAll; + var parse_link_title = function parseLinkTitle(str, pos, max) { + var code, marker, lines = 0, start = pos, result = { + ok: false, + pos: 0, + lines: 0, + str: "" + }; + if (pos >= max) { + return result; + } + marker = str.charCodeAt(pos); + if (marker !== 34 /* " */ && marker !== 39 /* ' */ && marker !== 40 /* ( */) { + return result; + } + pos++; + // if opening marker is "(", switch it to closing marker ")" + if (marker === 40) { + marker = 41; + } + while (pos < max) { + code = str.charCodeAt(pos); + if (code === marker) { + result.pos = pos + 1; + result.lines = lines; + result.str = unescapeAll$1(str.slice(start + 1, pos)); + result.ok = true; + return result; + } else if (code === 40 /* ( */ && marker === 41 /* ) */) { + return result; + } else if (code === 10) { + lines++; + } else if (code === 92 /* \ */ && pos + 1 < max) { + pos++; + if (str.charCodeAt(pos) === 10) { + lines++; + } + } + pos++; + } + return result; + }; + var parseLinkLabel = parse_link_label; + var parseLinkDestination = parse_link_destination; + var parseLinkTitle = parse_link_title; + var helpers = { + parseLinkLabel: parseLinkLabel, + parseLinkDestination: parseLinkDestination, + parseLinkTitle: parseLinkTitle + }; + var assign$1 = utils.assign; + var unescapeAll = utils.unescapeAll; + var escapeHtml = utils.escapeHtml; + //////////////////////////////////////////////////////////////////////////////// + var default_rules = {}; + default_rules.code_inline = function(tokens, idx, options, env, slf) { + var token = tokens[idx]; + return "<code" + slf.renderAttrs(token) + ">" + escapeHtml(tokens[idx].content) + "</code>"; + }; + default_rules.code_block = function(tokens, idx, options, env, slf) { + var token = tokens[idx]; + return "<pre" + slf.renderAttrs(token) + "><code>" + escapeHtml(tokens[idx].content) + "</code></pre>\n"; + }; + default_rules.fence = function(tokens, idx, options, env, slf) { + var token = tokens[idx], info = token.info ? unescapeAll(token.info).trim() : "", langName = "", langAttrs = "", highlighted, i, arr, tmpAttrs, tmpToken; + if (info) { + arr = info.split(/(\s+)/g); + langName = arr[0]; + langAttrs = arr.slice(2).join(""); + } + if (options.highlight) { + highlighted = options.highlight(token.content, langName, langAttrs) || escapeHtml(token.content); + } else { + highlighted = escapeHtml(token.content); + } + if (highlighted.indexOf("<pre") === 0) { + return highlighted + "\n"; + } + // If language exists, inject class gently, without modifying original token. + // May be, one day we will add .deepClone() for token and simplify this part, but + // now we prefer to keep things local. + if (info) { + i = token.attrIndex("class"); + tmpAttrs = token.attrs ? token.attrs.slice() : []; + if (i < 0) { + tmpAttrs.push([ "class", options.langPrefix + langName ]); + } else { + tmpAttrs[i] = tmpAttrs[i].slice(); + tmpAttrs[i][1] += " " + options.langPrefix + langName; + } + // Fake token just to render attributes + tmpToken = { + attrs: tmpAttrs + }; + return "<pre><code" + slf.renderAttrs(tmpToken) + ">" + highlighted + "</code></pre>\n"; + } + return "<pre><code" + slf.renderAttrs(token) + ">" + highlighted + "</code></pre>\n"; + }; + default_rules.image = function(tokens, idx, options, env, slf) { + var token = tokens[idx]; + // "alt" attr MUST be set, even if empty. Because it's mandatory and + // should be placed on proper position for tests. + + // Replace content with actual value + token.attrs[token.attrIndex("alt")][1] = slf.renderInlineAsText(token.children, options, env); + return slf.renderToken(tokens, idx, options); + }; + default_rules.hardbreak = function(tokens, idx, options /*, env */) { + return options.xhtmlOut ? "<br />\n" : "<br>\n"; + }; + default_rules.softbreak = function(tokens, idx, options /*, env */) { + return options.breaks ? options.xhtmlOut ? "<br />\n" : "<br>\n" : "\n"; + }; + default_rules.text = function(tokens, idx /*, options, env */) { + return escapeHtml(tokens[idx].content); + }; + default_rules.html_block = function(tokens, idx /*, options, env */) { + return tokens[idx].content; + }; + default_rules.html_inline = function(tokens, idx /*, options, env */) { + return tokens[idx].content; + }; + /** + * new Renderer() + * + * Creates new [[Renderer]] instance and fill [[Renderer#rules]] with defaults. + **/ function Renderer() { + /** + * Renderer#rules -> Object + * + * Contains render rules for tokens. Can be updated and extended. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.renderer.rules.strong_open = function () { return '<b>'; }; + * md.renderer.rules.strong_close = function () { return '</b>'; }; + * + * var result = md.renderInline(...); + * ``` + * + * Each rule is called as independent static function with fixed signature: + * + * ```javascript + * function my_token_render(tokens, idx, options, env, renderer) { + * // ... + * return renderedHTML; + * } + * ``` + * + * See [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js) + * for more details and examples. + **/ + this.rules = assign$1({}, default_rules); + } + /** + * Renderer.renderAttrs(token) -> String + * + * Render token attributes to string. + **/ Renderer.prototype.renderAttrs = function renderAttrs(token) { + var i, l, result; + if (!token.attrs) { + return ""; + } + result = ""; + for (i = 0, l = token.attrs.length; i < l; i++) { + result += " " + escapeHtml(token.attrs[i][0]) + '="' + escapeHtml(token.attrs[i][1]) + '"'; + } + return result; + }; + /** + * Renderer.renderToken(tokens, idx, options) -> String + * - tokens (Array): list of tokens + * - idx (Numbed): token index to render + * - options (Object): params of parser instance + * + * Default token renderer. Can be overriden by custom function + * in [[Renderer#rules]]. + **/ Renderer.prototype.renderToken = function renderToken(tokens, idx, options) { + var nextToken, result = "", needLf = false, token = tokens[idx]; + // Tight list paragraphs + if (token.hidden) { + return ""; + } + // Insert a newline between hidden paragraph and subsequent opening + // block-level tag. + + // For example, here we should insert a newline before blockquote: + // - a + // > + + if (token.block && token.nesting !== -1 && idx && tokens[idx - 1].hidden) { + result += "\n"; + } + // Add token name, e.g. `<img` + result += (token.nesting === -1 ? "</" : "<") + token.tag; + // Encode attributes, e.g. `<img src="foo"` + result += this.renderAttrs(token); + // Add a slash for self-closing tags, e.g. `<img src="foo" /` + if (token.nesting === 0 && options.xhtmlOut) { + result += " /"; + } + // Check if we need to add a newline after this tag + if (token.block) { + needLf = true; + if (token.nesting === 1) { + if (idx + 1 < tokens.length) { + nextToken = tokens[idx + 1]; + if (nextToken.type === "inline" || nextToken.hidden) { + // Block-level tag containing an inline tag. + needLf = false; + } else if (nextToken.nesting === -1 && nextToken.tag === token.tag) { + // Opening tag + closing tag of the same type. E.g. `<li></li>`. + needLf = false; + } + } + } + } + result += needLf ? ">\n" : ">"; + return result; + }; + /** + * Renderer.renderInline(tokens, options, env) -> String + * - tokens (Array): list on block tokens to render + * - options (Object): params of parser instance + * - env (Object): additional data from parsed input (references, for example) + * + * The same as [[Renderer.render]], but for single token of `inline` type. + **/ Renderer.prototype.renderInline = function(tokens, options, env) { + var type, result = "", rules = this.rules; + for (var i = 0, len = tokens.length; i < len; i++) { + type = tokens[i].type; + if (typeof rules[type] !== "undefined") { + result += rules[type](tokens, i, options, env, this); + } else { + result += this.renderToken(tokens, i, options); + } + } + return result; + }; + /** internal + * Renderer.renderInlineAsText(tokens, options, env) -> String + * - tokens (Array): list on block tokens to render + * - options (Object): params of parser instance + * - env (Object): additional data from parsed input (references, for example) + * + * Special kludge for image `alt` attributes to conform CommonMark spec. + * Don't try to use it! Spec requires to show `alt` content with stripped markup, + * instead of simple escaping. + **/ Renderer.prototype.renderInlineAsText = function(tokens, options, env) { + var result = ""; + for (var i = 0, len = tokens.length; i < len; i++) { + if (tokens[i].type === "text") { + result += tokens[i].content; + } else if (tokens[i].type === "image") { + result += this.renderInlineAsText(tokens[i].children, options, env); + } else if (tokens[i].type === "softbreak") { + result += "\n"; + } + } + return result; + }; + /** + * Renderer.render(tokens, options, env) -> String + * - tokens (Array): list on block tokens to render + * - options (Object): params of parser instance + * - env (Object): additional data from parsed input (references, for example) + * + * Takes token stream and generates HTML. Probably, you will never need to call + * this method directly. + **/ Renderer.prototype.render = function(tokens, options, env) { + var i, len, type, result = "", rules = this.rules; + for (i = 0, len = tokens.length; i < len; i++) { + type = tokens[i].type; + if (type === "inline") { + result += this.renderInline(tokens[i].children, options, env); + } else if (typeof rules[type] !== "undefined") { + result += rules[tokens[i].type](tokens, i, options, env, this); + } else { + result += this.renderToken(tokens, i, options, env); + } + } + return result; + }; + var renderer = Renderer; + /** + * class Ruler + * + * Helper class, used by [[MarkdownIt#core]], [[MarkdownIt#block]] and + * [[MarkdownIt#inline]] to manage sequences of functions (rules): + * + * - keep rules in defined order + * - assign the name to each rule + * - enable/disable rules + * - add/replace rules + * - allow assign rules to additional named chains (in the same) + * - cacheing lists of active rules + * + * You will not need use this class directly until write plugins. For simple + * rules control use [[MarkdownIt.disable]], [[MarkdownIt.enable]] and + * [[MarkdownIt.use]]. + **/ + /** + * new Ruler() + **/ function Ruler() { + // List of added rules. Each element is: + // { + // name: XXX, + // enabled: Boolean, + // fn: Function(), + // alt: [ name2, name3 ] + // } + this.__rules__ = []; + // Cached rule chains. + + // First level - chain name, '' for default. + // Second level - diginal anchor for fast filtering by charcodes. + + this.__cache__ = null; + } + //////////////////////////////////////////////////////////////////////////////// + // Helper methods, should not be used directly + // Find rule index by name + + Ruler.prototype.__find__ = function(name) { + for (var i = 0; i < this.__rules__.length; i++) { + if (this.__rules__[i].name === name) { + return i; + } + } + return -1; + }; + // Build rules lookup cache + + Ruler.prototype.__compile__ = function() { + var self = this; + var chains = [ "" ]; + // collect unique names + self.__rules__.forEach((function(rule) { + if (!rule.enabled) { + return; + } + rule.alt.forEach((function(altName) { + if (chains.indexOf(altName) < 0) { + chains.push(altName); + } + })); + })); + self.__cache__ = {}; + chains.forEach((function(chain) { + self.__cache__[chain] = []; + self.__rules__.forEach((function(rule) { + if (!rule.enabled) { + return; + } + if (chain && rule.alt.indexOf(chain) < 0) { + return; + } + self.__cache__[chain].push(rule.fn); + })); + })); + }; + /** + * Ruler.at(name, fn [, options]) + * - name (String): rule name to replace. + * - fn (Function): new rule function. + * - options (Object): new rule options (not mandatory). + * + * Replace rule by name with new function & options. Throws error if name not + * found. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * Replace existing typographer replacement rule with new one: + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.core.ruler.at('replacements', function replace(state) { + * //... + * }); + * ``` + **/ Ruler.prototype.at = function(name, fn, options) { + var index = this.__find__(name); + var opt = options || {}; + if (index === -1) { + throw new Error("Parser rule not found: " + name); + } + this.__rules__[index].fn = fn; + this.__rules__[index].alt = opt.alt || []; + this.__cache__ = null; + }; + /** + * Ruler.before(beforeName, ruleName, fn [, options]) + * - beforeName (String): new rule will be added before this one. + * - ruleName (String): name of added rule. + * - fn (Function): rule function. + * - options (Object): rule options (not mandatory). + * + * Add new rule to chain before one with given name. See also + * [[Ruler.after]], [[Ruler.push]]. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.block.ruler.before('paragraph', 'my_rule', function replace(state) { + * //... + * }); + * ``` + **/ Ruler.prototype.before = function(beforeName, ruleName, fn, options) { + var index = this.__find__(beforeName); + var opt = options || {}; + if (index === -1) { + throw new Error("Parser rule not found: " + beforeName); + } + this.__rules__.splice(index, 0, { + name: ruleName, + enabled: true, + fn: fn, + alt: opt.alt || [] + }); + this.__cache__ = null; + }; + /** + * Ruler.after(afterName, ruleName, fn [, options]) + * - afterName (String): new rule will be added after this one. + * - ruleName (String): name of added rule. + * - fn (Function): rule function. + * - options (Object): rule options (not mandatory). + * + * Add new rule to chain after one with given name. See also + * [[Ruler.before]], [[Ruler.push]]. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.inline.ruler.after('text', 'my_rule', function replace(state) { + * //... + * }); + * ``` + **/ Ruler.prototype.after = function(afterName, ruleName, fn, options) { + var index = this.__find__(afterName); + var opt = options || {}; + if (index === -1) { + throw new Error("Parser rule not found: " + afterName); + } + this.__rules__.splice(index + 1, 0, { + name: ruleName, + enabled: true, + fn: fn, + alt: opt.alt || [] + }); + this.__cache__ = null; + }; + /** + * Ruler.push(ruleName, fn [, options]) + * - ruleName (String): name of added rule. + * - fn (Function): rule function. + * - options (Object): rule options (not mandatory). + * + * Push new rule to the end of chain. See also + * [[Ruler.before]], [[Ruler.after]]. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.core.ruler.push('my_rule', function replace(state) { + * //... + * }); + * ``` + **/ Ruler.prototype.push = function(ruleName, fn, options) { + var opt = options || {}; + this.__rules__.push({ + name: ruleName, + enabled: true, + fn: fn, + alt: opt.alt || [] + }); + this.__cache__ = null; + }; + /** + * Ruler.enable(list [, ignoreInvalid]) -> Array + * - list (String|Array): list of rule names to enable. + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Enable rules with given names. If any rule name not found - throw Error. + * Errors can be disabled by second param. + * + * Returns list of found rule names (if no exception happened). + * + * See also [[Ruler.disable]], [[Ruler.enableOnly]]. + **/ Ruler.prototype.enable = function(list, ignoreInvalid) { + if (!Array.isArray(list)) { + list = [ list ]; + } + var result = []; + // Search by name and enable + list.forEach((function(name) { + var idx = this.__find__(name); + if (idx < 0) { + if (ignoreInvalid) { + return; + } + throw new Error("Rules manager: invalid rule name " + name); + } + this.__rules__[idx].enabled = true; + result.push(name); + }), this); + this.__cache__ = null; + return result; + }; + /** + * Ruler.enableOnly(list [, ignoreInvalid]) + * - list (String|Array): list of rule names to enable (whitelist). + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Enable rules with given names, and disable everything else. If any rule name + * not found - throw Error. Errors can be disabled by second param. + * + * See also [[Ruler.disable]], [[Ruler.enable]]. + **/ Ruler.prototype.enableOnly = function(list, ignoreInvalid) { + if (!Array.isArray(list)) { + list = [ list ]; + } + this.__rules__.forEach((function(rule) { + rule.enabled = false; + })); + this.enable(list, ignoreInvalid); + }; + /** + * Ruler.disable(list [, ignoreInvalid]) -> Array + * - list (String|Array): list of rule names to disable. + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Disable rules with given names. If any rule name not found - throw Error. + * Errors can be disabled by second param. + * + * Returns list of found rule names (if no exception happened). + * + * See also [[Ruler.enable]], [[Ruler.enableOnly]]. + **/ Ruler.prototype.disable = function(list, ignoreInvalid) { + if (!Array.isArray(list)) { + list = [ list ]; + } + var result = []; + // Search by name and disable + list.forEach((function(name) { + var idx = this.__find__(name); + if (idx < 0) { + if (ignoreInvalid) { + return; + } + throw new Error("Rules manager: invalid rule name " + name); + } + this.__rules__[idx].enabled = false; + result.push(name); + }), this); + this.__cache__ = null; + return result; + }; + /** + * Ruler.getRules(chainName) -> Array + * + * Return array of active functions (rules) for given chain name. It analyzes + * rules configuration, compiles caches if not exists and returns result. + * + * Default chain name is `''` (empty string). It can't be skipped. That's + * done intentionally, to keep signature monomorphic for high speed. + **/ Ruler.prototype.getRules = function(chainName) { + if (this.__cache__ === null) { + this.__compile__(); + } + // Chain can be empty, if rules disabled. But we still have to return Array. + return this.__cache__[chainName] || []; + }; + var ruler = Ruler; + // Normalize input string + // https://spec.commonmark.org/0.29/#line-ending + var NEWLINES_RE = /\r\n?|\n/g; + var NULL_RE = /\0/g; + var normalize = function normalize(state) { + var str; + // Normalize newlines + str = state.src.replace(NEWLINES_RE, "\n"); + // Replace NULL characters + str = str.replace(NULL_RE, "\ufffd"); + state.src = str; + }; + var block = function block(state) { + var token; + if (state.inlineMode) { + token = new state.Token("inline", "", 0); + token.content = state.src; + token.map = [ 0, 1 ]; + token.children = []; + state.tokens.push(token); + } else { + state.md.block.parse(state.src, state.md, state.env, state.tokens); + } + }; + var inline = function inline(state) { + var tokens = state.tokens, tok, i, l; + // Parse inlines + for (i = 0, l = tokens.length; i < l; i++) { + tok = tokens[i]; + if (tok.type === "inline") { + state.md.inline.parse(tok.content, state.md, state.env, tok.children); + } + } + }; + var arrayReplaceAt = utils.arrayReplaceAt; + function isLinkOpen(str) { + return /^<a[>\s]/i.test(str); + } + function isLinkClose(str) { + return /^<\/a\s*>/i.test(str); + } + var linkify = function linkify(state) { + var i, j, l, tokens, token, currentToken, nodes, ln, text, pos, lastPos, level, htmlLinkLevel, url, fullUrl, urlText, blockTokens = state.tokens, links; + if (!state.md.options.linkify) { + return; + } + for (j = 0, l = blockTokens.length; j < l; j++) { + if (blockTokens[j].type !== "inline" || !state.md.linkify.pretest(blockTokens[j].content)) { + continue; + } + tokens = blockTokens[j].children; + htmlLinkLevel = 0; + // We scan from the end, to keep position when new tags added. + // Use reversed logic in links start/end match + for (i = tokens.length - 1; i >= 0; i--) { + currentToken = tokens[i]; + // Skip content of markdown links + if (currentToken.type === "link_close") { + i--; + while (tokens[i].level !== currentToken.level && tokens[i].type !== "link_open") { + i--; + } + continue; + } + // Skip content of html tag links + if (currentToken.type === "html_inline") { + if (isLinkOpen(currentToken.content) && htmlLinkLevel > 0) { + htmlLinkLevel--; + } + if (isLinkClose(currentToken.content)) { + htmlLinkLevel++; + } + } + if (htmlLinkLevel > 0) { + continue; + } + if (currentToken.type === "text" && state.md.linkify.test(currentToken.content)) { + text = currentToken.content; + links = state.md.linkify.match(text); + // Now split string to nodes + nodes = []; + level = currentToken.level; + lastPos = 0; + for (ln = 0; ln < links.length; ln++) { + url = links[ln].url; + fullUrl = state.md.normalizeLink(url); + if (!state.md.validateLink(fullUrl)) { + continue; + } + urlText = links[ln].text; + // Linkifier might send raw hostnames like "example.com", where url + // starts with domain name. So we prepend http:// in those cases, + // and remove it afterwards. + + if (!links[ln].schema) { + urlText = state.md.normalizeLinkText("http://" + urlText).replace(/^http:\/\//, ""); + } else if (links[ln].schema === "mailto:" && !/^mailto:/i.test(urlText)) { + urlText = state.md.normalizeLinkText("mailto:" + urlText).replace(/^mailto:/, ""); + } else { + urlText = state.md.normalizeLinkText(urlText); + } + pos = links[ln].index; + if (pos > lastPos) { + token = new state.Token("text", "", 0); + token.content = text.slice(lastPos, pos); + token.level = level; + nodes.push(token); + } + token = new state.Token("link_open", "a", 1); + token.attrs = [ [ "href", fullUrl ] ]; + token.level = level++; + token.markup = "linkify"; + token.info = "auto"; + nodes.push(token); + token = new state.Token("text", "", 0); + token.content = urlText; + token.level = level; + nodes.push(token); + token = new state.Token("link_close", "a", -1); + token.level = --level; + token.markup = "linkify"; + token.info = "auto"; + nodes.push(token); + lastPos = links[ln].lastIndex; + } + if (lastPos < text.length) { + token = new state.Token("text", "", 0); + token.content = text.slice(lastPos); + token.level = level; + nodes.push(token); + } + // replace current node + blockTokens[j].children = tokens = arrayReplaceAt(tokens, i, nodes); + } + } + } + }; + // Simple typographic replacements + // TODO: + // - fractionals 1/2, 1/4, 3/4 -> ½, ¼, ¾ + // - miltiplication 2 x 4 -> 2 × 4 + var RARE_RE = /\+-|\.\.|\?\?\?\?|!!!!|,,|--/; + // Workaround for phantomjs - need regex without /g flag, + // or root check will fail every second time + var SCOPED_ABBR_TEST_RE = /\((c|tm|r|p)\)/i; + var SCOPED_ABBR_RE = /\((c|tm|r|p)\)/gi; + var SCOPED_ABBR = { + c: "\xa9", + r: "\xae", + p: "\xa7", + tm: "\u2122" + }; + function replaceFn(match, name) { + return SCOPED_ABBR[name.toLowerCase()]; + } + function replace_scoped(inlineTokens) { + var i, token, inside_autolink = 0; + for (i = inlineTokens.length - 1; i >= 0; i--) { + token = inlineTokens[i]; + if (token.type === "text" && !inside_autolink) { + token.content = token.content.replace(SCOPED_ABBR_RE, replaceFn); + } + if (token.type === "link_open" && token.info === "auto") { + inside_autolink--; + } + if (token.type === "link_close" && token.info === "auto") { + inside_autolink++; + } + } + } + function replace_rare(inlineTokens) { + var i, token, inside_autolink = 0; + for (i = inlineTokens.length - 1; i >= 0; i--) { + token = inlineTokens[i]; + if (token.type === "text" && !inside_autolink) { + if (RARE_RE.test(token.content)) { + token.content = token.content.replace(/\+-/g, "\xb1").replace(/\.{2,}/g, "\u2026").replace(/([?!])\u2026/g, "$1..").replace(/([?!]){4,}/g, "$1$1$1").replace(/,{2,}/g, ",").replace(/(^|[^-])---(?=[^-]|$)/gm, "$1\u2014").replace(/(^|\s)--(?=\s|$)/gm, "$1\u2013").replace(/(^|[^-\s])--(?=[^-\s]|$)/gm, "$1\u2013"); + } + } + if (token.type === "link_open" && token.info === "auto") { + inside_autolink--; + } + if (token.type === "link_close" && token.info === "auto") { + inside_autolink++; + } + } + } + var replacements = function replace(state) { + var blkIdx; + if (!state.md.options.typographer) { + return; + } + for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) { + if (state.tokens[blkIdx].type !== "inline") { + continue; + } + if (SCOPED_ABBR_TEST_RE.test(state.tokens[blkIdx].content)) { + replace_scoped(state.tokens[blkIdx].children); + } + if (RARE_RE.test(state.tokens[blkIdx].content)) { + replace_rare(state.tokens[blkIdx].children); + } + } + }; + var isWhiteSpace$1 = utils.isWhiteSpace; + var isPunctChar$1 = utils.isPunctChar; + var isMdAsciiPunct$1 = utils.isMdAsciiPunct; + var QUOTE_TEST_RE = /['"]/; + var QUOTE_RE = /['"]/g; + var APOSTROPHE = "\u2019"; + /* ’ */ function replaceAt(str, index, ch) { + return str.substr(0, index) + ch + str.substr(index + 1); + } + function process_inlines(tokens, state) { + var i, token, text, t, pos, max, thisLevel, item, lastChar, nextChar, isLastPunctChar, isNextPunctChar, isLastWhiteSpace, isNextWhiteSpace, canOpen, canClose, j, isSingle, stack, openQuote, closeQuote; + stack = []; + for (i = 0; i < tokens.length; i++) { + token = tokens[i]; + thisLevel = tokens[i].level; + for (j = stack.length - 1; j >= 0; j--) { + if (stack[j].level <= thisLevel) { + break; + } + } + stack.length = j + 1; + if (token.type !== "text") { + continue; + } + text = token.content; + pos = 0; + max = text.length; + /*eslint no-labels:0,block-scoped-var:0*/ OUTER: while (pos < max) { + QUOTE_RE.lastIndex = pos; + t = QUOTE_RE.exec(text); + if (!t) { + break; + } + canOpen = canClose = true; + pos = t.index + 1; + isSingle = t[0] === "'"; + // Find previous character, + // default to space if it's the beginning of the line + + lastChar = 32; + if (t.index - 1 >= 0) { + lastChar = text.charCodeAt(t.index - 1); + } else { + for (j = i - 1; j >= 0; j--) { + if (tokens[j].type === "softbreak" || tokens[j].type === "hardbreak") break; + // lastChar defaults to 0x20 + if (!tokens[j].content) continue; + // should skip all tokens except 'text', 'html_inline' or 'code_inline' + lastChar = tokens[j].content.charCodeAt(tokens[j].content.length - 1); + break; + } + } + // Find next character, + // default to space if it's the end of the line + + nextChar = 32; + if (pos < max) { + nextChar = text.charCodeAt(pos); + } else { + for (j = i + 1; j < tokens.length; j++) { + if (tokens[j].type === "softbreak" || tokens[j].type === "hardbreak") break; + // nextChar defaults to 0x20 + if (!tokens[j].content) continue; + // should skip all tokens except 'text', 'html_inline' or 'code_inline' + nextChar = tokens[j].content.charCodeAt(0); + break; + } + } + isLastPunctChar = isMdAsciiPunct$1(lastChar) || isPunctChar$1(String.fromCharCode(lastChar)); + isNextPunctChar = isMdAsciiPunct$1(nextChar) || isPunctChar$1(String.fromCharCode(nextChar)); + isLastWhiteSpace = isWhiteSpace$1(lastChar); + isNextWhiteSpace = isWhiteSpace$1(nextChar); + if (isNextWhiteSpace) { + canOpen = false; + } else if (isNextPunctChar) { + if (!(isLastWhiteSpace || isLastPunctChar)) { + canOpen = false; + } + } + if (isLastWhiteSpace) { + canClose = false; + } else if (isLastPunctChar) { + if (!(isNextWhiteSpace || isNextPunctChar)) { + canClose = false; + } + } + if (nextChar === 34 /* " */ && t[0] === '"') { + if (lastChar >= 48 /* 0 */ && lastChar <= 57 /* 9 */) { + // special case: 1"" - count first quote as an inch + canClose = canOpen = false; + } + } + if (canOpen && canClose) { + // Replace quotes in the middle of punctuation sequence, but not + // in the middle of the words, i.e.: + // 1. foo " bar " baz - not replaced + // 2. foo-"-bar-"-baz - replaced + // 3. foo"bar"baz - not replaced + canOpen = isLastPunctChar; + canClose = isNextPunctChar; + } + if (!canOpen && !canClose) { + // middle of word + if (isSingle) { + token.content = replaceAt(token.content, t.index, APOSTROPHE); + } + continue; + } + if (canClose) { + // this could be a closing quote, rewind the stack to get a match + for (j = stack.length - 1; j >= 0; j--) { + item = stack[j]; + if (stack[j].level < thisLevel) { + break; + } + if (item.single === isSingle && stack[j].level === thisLevel) { + item = stack[j]; + if (isSingle) { + openQuote = state.md.options.quotes[2]; + closeQuote = state.md.options.quotes[3]; + } else { + openQuote = state.md.options.quotes[0]; + closeQuote = state.md.options.quotes[1]; + } + // replace token.content *before* tokens[item.token].content, + // because, if they are pointing at the same token, replaceAt + // could mess up indices when quote length != 1 + token.content = replaceAt(token.content, t.index, closeQuote); + tokens[item.token].content = replaceAt(tokens[item.token].content, item.pos, openQuote); + pos += closeQuote.length - 1; + if (item.token === i) { + pos += openQuote.length - 1; + } + text = token.content; + max = text.length; + stack.length = j; + continue OUTER; + } + } + } + if (canOpen) { + stack.push({ + token: i, + pos: t.index, + single: isSingle, + level: thisLevel + }); + } else if (canClose && isSingle) { + token.content = replaceAt(token.content, t.index, APOSTROPHE); + } + } + } + } + var smartquotes = function smartquotes(state) { + /*eslint max-depth:0*/ + var blkIdx; + if (!state.md.options.typographer) { + return; + } + for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) { + if (state.tokens[blkIdx].type !== "inline" || !QUOTE_TEST_RE.test(state.tokens[blkIdx].content)) { + continue; + } + process_inlines(state.tokens[blkIdx].children, state); + } + }; + // Token class + /** + * class Token + **/ + /** + * new Token(type, tag, nesting) + * + * Create new token and fill passed properties. + **/ function Token(type, tag, nesting) { + /** + * Token#type -> String + * + * Type of the token (string, e.g. "paragraph_open") + **/ + this.type = type; + /** + * Token#tag -> String + * + * html tag name, e.g. "p" + **/ this.tag = tag; + /** + * Token#attrs -> Array + * + * Html attributes. Format: `[ [ name1, value1 ], [ name2, value2 ] ]` + **/ this.attrs = null; + /** + * Token#map -> Array + * + * Source map info. Format: `[ line_begin, line_end ]` + **/ this.map = null; + /** + * Token#nesting -> Number + * + * Level change (number in {-1, 0, 1} set), where: + * + * - `1` means the tag is opening + * - `0` means the tag is self-closing + * - `-1` means the tag is closing + **/ this.nesting = nesting; + /** + * Token#level -> Number + * + * nesting level, the same as `state.level` + **/ this.level = 0; + /** + * Token#children -> Array + * + * An array of child nodes (inline and img tokens) + **/ this.children = null; + /** + * Token#content -> String + * + * In a case of self-closing tag (code, html, fence, etc.), + * it has contents of this tag. + **/ this.content = ""; + /** + * Token#markup -> String + * + * '*' or '_' for emphasis, fence string for fence, etc. + **/ this.markup = ""; + /** + * Token#info -> String + * + * Additional information: + * + * - Info string for "fence" tokens + * - The value "auto" for autolink "link_open" and "link_close" tokens + * - The string value of the item marker for ordered-list "list_item_open" tokens + **/ this.info = ""; + /** + * Token#meta -> Object + * + * A place for plugins to store an arbitrary data + **/ this.meta = null; + /** + * Token#block -> Boolean + * + * True for block-level tokens, false for inline tokens. + * Used in renderer to calculate line breaks + **/ this.block = false; + /** + * Token#hidden -> Boolean + * + * If it's true, ignore this element when rendering. Used for tight lists + * to hide paragraphs. + **/ this.hidden = false; + } + /** + * Token.attrIndex(name) -> Number + * + * Search attribute index by name. + **/ Token.prototype.attrIndex = function attrIndex(name) { + var attrs, i, len; + if (!this.attrs) { + return -1; + } + attrs = this.attrs; + for (i = 0, len = attrs.length; i < len; i++) { + if (attrs[i][0] === name) { + return i; + } + } + return -1; + }; + /** + * Token.attrPush(attrData) + * + * Add `[ name, value ]` attribute to list. Init attrs if necessary + **/ Token.prototype.attrPush = function attrPush(attrData) { + if (this.attrs) { + this.attrs.push(attrData); + } else { + this.attrs = [ attrData ]; + } + }; + /** + * Token.attrSet(name, value) + * + * Set `name` attribute to `value`. Override old value if exists. + **/ Token.prototype.attrSet = function attrSet(name, value) { + var idx = this.attrIndex(name), attrData = [ name, value ]; + if (idx < 0) { + this.attrPush(attrData); + } else { + this.attrs[idx] = attrData; + } + }; + /** + * Token.attrGet(name) + * + * Get the value of attribute `name`, or null if it does not exist. + **/ Token.prototype.attrGet = function attrGet(name) { + var idx = this.attrIndex(name), value = null; + if (idx >= 0) { + value = this.attrs[idx][1]; + } + return value; + }; + /** + * Token.attrJoin(name, value) + * + * Join value to existing attribute via space. Or create new attribute if not + * exists. Useful to operate with token classes. + **/ Token.prototype.attrJoin = function attrJoin(name, value) { + var idx = this.attrIndex(name); + if (idx < 0) { + this.attrPush([ name, value ]); + } else { + this.attrs[idx][1] = this.attrs[idx][1] + " " + value; + } + }; + var token = Token; + function StateCore(src, md, env) { + this.src = src; + this.env = env; + this.tokens = []; + this.inlineMode = false; + this.md = md; + // link to parser instance + } + // re-export Token class to use in core rules + StateCore.prototype.Token = token; + var state_core = StateCore; + var _rules$2 = [ [ "normalize", normalize ], [ "block", block ], [ "inline", inline ], [ "linkify", linkify ], [ "replacements", replacements ], [ "smartquotes", smartquotes ] ]; + /** + * new Core() + **/ function Core() { + /** + * Core#ruler -> Ruler + * + * [[Ruler]] instance. Keep configuration of core rules. + **/ + this.ruler = new ruler; + for (var i = 0; i < _rules$2.length; i++) { + this.ruler.push(_rules$2[i][0], _rules$2[i][1]); + } + } + /** + * Core.process(state) + * + * Executes core chain rules. + **/ Core.prototype.process = function(state) { + var i, l, rules; + rules = this.ruler.getRules(""); + for (i = 0, l = rules.length; i < l; i++) { + rules[i](state); + } + }; + Core.prototype.State = state_core; + var parser_core = Core; + var isSpace$a = utils.isSpace; + function getLine(state, line) { + var pos = state.bMarks[line] + state.tShift[line], max = state.eMarks[line]; + return state.src.substr(pos, max - pos); + } + function escapedSplit(str) { + var result = [], pos = 0, max = str.length, ch, isEscaped = false, lastPos = 0, current = ""; + ch = str.charCodeAt(pos); + while (pos < max) { + if (ch === 124 /* | */) { + if (!isEscaped) { + // pipe separating cells, '|' + result.push(current + str.substring(lastPos, pos)); + current = ""; + lastPos = pos + 1; + } else { + // escaped pipe, '\|' + current += str.substring(lastPos, pos - 1); + lastPos = pos; + } + } + isEscaped = ch === 92 /* \ */; + pos++; + ch = str.charCodeAt(pos); + } + result.push(current + str.substring(lastPos)); + return result; + } + var table = function table(state, startLine, endLine, silent) { + var ch, lineText, pos, i, l, nextLine, columns, columnCount, token, aligns, t, tableLines, tbodyLines, oldParentType, terminate, terminatorRules, firstCh, secondCh; + // should have at least two lines + if (startLine + 2 > endLine) { + return false; + } + nextLine = startLine + 1; + if (state.sCount[nextLine] < state.blkIndent) { + return false; + } + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[nextLine] - state.blkIndent >= 4) { + return false; + } + // first character of the second line should be '|', '-', ':', + // and no other characters are allowed but spaces; + // basically, this is the equivalent of /^[-:|][-:|\s]*$/ regexp + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + if (pos >= state.eMarks[nextLine]) { + return false; + } + firstCh = state.src.charCodeAt(pos++); + if (firstCh !== 124 /* | */ && firstCh !== 45 /* - */ && firstCh !== 58 /* : */) { + return false; + } + if (pos >= state.eMarks[nextLine]) { + return false; + } + secondCh = state.src.charCodeAt(pos++); + if (secondCh !== 124 /* | */ && secondCh !== 45 /* - */ && secondCh !== 58 /* : */ && !isSpace$a(secondCh)) { + return false; + } + // if first character is '-', then second character must not be a space + // (due to parsing ambiguity with list) + if (firstCh === 45 /* - */ && isSpace$a(secondCh)) { + return false; + } + while (pos < state.eMarks[nextLine]) { + ch = state.src.charCodeAt(pos); + if (ch !== 124 /* | */ && ch !== 45 /* - */ && ch !== 58 /* : */ && !isSpace$a(ch)) { + return false; + } + pos++; + } + lineText = getLine(state, startLine + 1); + columns = lineText.split("|"); + aligns = []; + for (i = 0; i < columns.length; i++) { + t = columns[i].trim(); + if (!t) { + // allow empty columns before and after table, but not in between columns; + // e.g. allow ` |---| `, disallow ` ---||--- ` + if (i === 0 || i === columns.length - 1) { + continue; + } else { + return false; + } + } + if (!/^:?-+:?$/.test(t)) { + return false; + } + if (t.charCodeAt(t.length - 1) === 58 /* : */) { + aligns.push(t.charCodeAt(0) === 58 /* : */ ? "center" : "right"); + } else if (t.charCodeAt(0) === 58 /* : */) { + aligns.push("left"); + } else { + aligns.push(""); + } + } + lineText = getLine(state, startLine).trim(); + if (lineText.indexOf("|") === -1) { + return false; + } + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + columns = escapedSplit(lineText); + if (columns.length && columns[0] === "") columns.shift(); + if (columns.length && columns[columns.length - 1] === "") columns.pop(); + // header row will define an amount of columns in the entire table, + // and align row should be exactly the same (the rest of the rows can differ) + columnCount = columns.length; + if (columnCount === 0 || columnCount !== aligns.length) { + return false; + } + if (silent) { + return true; + } + oldParentType = state.parentType; + state.parentType = "table"; + // use 'blockquote' lists for termination because it's + // the most similar to tables + terminatorRules = state.md.block.ruler.getRules("blockquote"); + token = state.push("table_open", "table", 1); + token.map = tableLines = [ startLine, 0 ]; + token = state.push("thead_open", "thead", 1); + token.map = [ startLine, startLine + 1 ]; + token = state.push("tr_open", "tr", 1); + token.map = [ startLine, startLine + 1 ]; + for (i = 0; i < columns.length; i++) { + token = state.push("th_open", "th", 1); + if (aligns[i]) { + token.attrs = [ [ "style", "text-align:" + aligns[i] ] ]; + } + token = state.push("inline", "", 0); + token.content = columns[i].trim(); + token.children = []; + token = state.push("th_close", "th", -1); + } + token = state.push("tr_close", "tr", -1); + token = state.push("thead_close", "thead", -1); + for (nextLine = startLine + 2; nextLine < endLine; nextLine++) { + if (state.sCount[nextLine] < state.blkIndent) { + break; + } + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + break; + } + lineText = getLine(state, nextLine).trim(); + if (!lineText) { + break; + } + if (state.sCount[nextLine] - state.blkIndent >= 4) { + break; + } + columns = escapedSplit(lineText); + if (columns.length && columns[0] === "") columns.shift(); + if (columns.length && columns[columns.length - 1] === "") columns.pop(); + if (nextLine === startLine + 2) { + token = state.push("tbody_open", "tbody", 1); + token.map = tbodyLines = [ startLine + 2, 0 ]; + } + token = state.push("tr_open", "tr", 1); + token.map = [ nextLine, nextLine + 1 ]; + for (i = 0; i < columnCount; i++) { + token = state.push("td_open", "td", 1); + if (aligns[i]) { + token.attrs = [ [ "style", "text-align:" + aligns[i] ] ]; + } + token = state.push("inline", "", 0); + token.content = columns[i] ? columns[i].trim() : ""; + token.children = []; + token = state.push("td_close", "td", -1); + } + token = state.push("tr_close", "tr", -1); + } + if (tbodyLines) { + token = state.push("tbody_close", "tbody", -1); + tbodyLines[1] = nextLine; + } + token = state.push("table_close", "table", -1); + tableLines[1] = nextLine; + state.parentType = oldParentType; + state.line = nextLine; + return true; + }; + // Code block (4 spaces padded) + var code = function code(state, startLine, endLine /*, silent*/) { + var nextLine, last, token; + if (state.sCount[startLine] - state.blkIndent < 4) { + return false; + } + last = nextLine = startLine + 1; + while (nextLine < endLine) { + if (state.isEmpty(nextLine)) { + nextLine++; + continue; + } + if (state.sCount[nextLine] - state.blkIndent >= 4) { + nextLine++; + last = nextLine; + continue; + } + break; + } + state.line = last; + token = state.push("code_block", "code", 0); + token.content = state.getLines(startLine, last, 4 + state.blkIndent, false) + "\n"; + token.map = [ startLine, state.line ]; + return true; + }; + // fences (``` lang, ~~~ lang) + var fence = function fence(state, startLine, endLine, silent) { + var marker, len, params, nextLine, mem, token, markup, haveEndMarker = false, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + if (pos + 3 > max) { + return false; + } + marker = state.src.charCodeAt(pos); + if (marker !== 126 /* ~ */ && marker !== 96 /* ` */) { + return false; + } + // scan marker length + mem = pos; + pos = state.skipChars(pos, marker); + len = pos - mem; + if (len < 3) { + return false; + } + markup = state.src.slice(mem, pos); + params = state.src.slice(pos, max); + if (marker === 96 /* ` */) { + if (params.indexOf(String.fromCharCode(marker)) >= 0) { + return false; + } + } + // Since start is found, we can report success here in validation mode + if (silent) { + return true; + } + // search end of block + nextLine = startLine; + for (;;) { + nextLine++; + if (nextLine >= endLine) { + // unclosed block should be autoclosed by end of document. + // also block seems to be autoclosed by end of parent + break; + } + pos = mem = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + if (pos < max && state.sCount[nextLine] < state.blkIndent) { + // non-empty line with negative indent should stop the list: + // - ``` + // test + break; + } + if (state.src.charCodeAt(pos) !== marker) { + continue; + } + if (state.sCount[nextLine] - state.blkIndent >= 4) { + // closing fence should be indented less than 4 spaces + continue; + } + pos = state.skipChars(pos, marker); + // closing code fence must be at least as long as the opening one + if (pos - mem < len) { + continue; + } + // make sure tail has spaces only + pos = state.skipSpaces(pos); + if (pos < max) { + continue; + } + haveEndMarker = true; + // found! + break; + } + // If a fence has heading spaces, they should be removed from its inner block + len = state.sCount[startLine]; + state.line = nextLine + (haveEndMarker ? 1 : 0); + token = state.push("fence", "code", 0); + token.info = params; + token.content = state.getLines(startLine + 1, nextLine, len, true); + token.markup = markup; + token.map = [ startLine, state.line ]; + return true; + }; + var isSpace$9 = utils.isSpace; + var blockquote = function blockquote(state, startLine, endLine, silent) { + var adjustTab, ch, i, initial, l, lastLineEmpty, lines, nextLine, offset, oldBMarks, oldBSCount, oldIndent, oldParentType, oldSCount, oldTShift, spaceAfterMarker, terminate, terminatorRules, token, isOutdented, oldLineMax = state.lineMax, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + // check the block quote marker + if (state.src.charCodeAt(pos++) !== 62 /* > */) { + return false; + } + // we know that it's going to be a valid blockquote, + // so no point trying to find the end of it in silent mode + if (silent) { + return true; + } + // set offset past spaces and ">" + initial = offset = state.sCount[startLine] + 1; + // skip one optional space after '>' + if (state.src.charCodeAt(pos) === 32 /* space */) { + // ' > test ' + // ^ -- position start of line here: + pos++; + initial++; + offset++; + adjustTab = false; + spaceAfterMarker = true; + } else if (state.src.charCodeAt(pos) === 9 /* tab */) { + spaceAfterMarker = true; + if ((state.bsCount[startLine] + offset) % 4 === 3) { + // ' >\t test ' + // ^ -- position start of line here (tab has width===1) + pos++; + initial++; + offset++; + adjustTab = false; + } else { + // ' >\t test ' + // ^ -- position start of line here + shift bsCount slightly + // to make extra space appear + adjustTab = true; + } + } else { + spaceAfterMarker = false; + } + oldBMarks = [ state.bMarks[startLine] ]; + state.bMarks[startLine] = pos; + while (pos < max) { + ch = state.src.charCodeAt(pos); + if (isSpace$9(ch)) { + if (ch === 9) { + offset += 4 - (offset + state.bsCount[startLine] + (adjustTab ? 1 : 0)) % 4; + } else { + offset++; + } + } else { + break; + } + pos++; + } + oldBSCount = [ state.bsCount[startLine] ]; + state.bsCount[startLine] = state.sCount[startLine] + 1 + (spaceAfterMarker ? 1 : 0); + lastLineEmpty = pos >= max; + oldSCount = [ state.sCount[startLine] ]; + state.sCount[startLine] = offset - initial; + oldTShift = [ state.tShift[startLine] ]; + state.tShift[startLine] = pos - state.bMarks[startLine]; + terminatorRules = state.md.block.ruler.getRules("blockquote"); + oldParentType = state.parentType; + state.parentType = "blockquote"; + // Search the end of the block + + // Block ends with either: + // 1. an empty line outside: + // ``` + // > test + + // ``` + // 2. an empty line inside: + // ``` + // > + // test + // ``` + // 3. another tag: + // ``` + // > test + // - - - + // ``` + for (nextLine = startLine + 1; nextLine < endLine; nextLine++) { + // check if it's outdented, i.e. it's inside list item and indented + // less than said list item: + // ``` + // 1. anything + // > current blockquote + // 2. checking this line + // ``` + isOutdented = state.sCount[nextLine] < state.blkIndent; + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + if (pos >= max) { + // Case 1: line is not inside the blockquote, and this line is empty. + break; + } + if (state.src.charCodeAt(pos++) === 62 /* > */ && !isOutdented) { + // This line is inside the blockquote. + // set offset past spaces and ">" + initial = offset = state.sCount[nextLine] + 1; + // skip one optional space after '>' + if (state.src.charCodeAt(pos) === 32 /* space */) { + // ' > test ' + // ^ -- position start of line here: + pos++; + initial++; + offset++; + adjustTab = false; + spaceAfterMarker = true; + } else if (state.src.charCodeAt(pos) === 9 /* tab */) { + spaceAfterMarker = true; + if ((state.bsCount[nextLine] + offset) % 4 === 3) { + // ' >\t test ' + // ^ -- position start of line here (tab has width===1) + pos++; + initial++; + offset++; + adjustTab = false; + } else { + // ' >\t test ' + // ^ -- position start of line here + shift bsCount slightly + // to make extra space appear + adjustTab = true; + } + } else { + spaceAfterMarker = false; + } + oldBMarks.push(state.bMarks[nextLine]); + state.bMarks[nextLine] = pos; + while (pos < max) { + ch = state.src.charCodeAt(pos); + if (isSpace$9(ch)) { + if (ch === 9) { + offset += 4 - (offset + state.bsCount[nextLine] + (adjustTab ? 1 : 0)) % 4; + } else { + offset++; + } + } else { + break; + } + pos++; + } + lastLineEmpty = pos >= max; + oldBSCount.push(state.bsCount[nextLine]); + state.bsCount[nextLine] = state.sCount[nextLine] + 1 + (spaceAfterMarker ? 1 : 0); + oldSCount.push(state.sCount[nextLine]); + state.sCount[nextLine] = offset - initial; + oldTShift.push(state.tShift[nextLine]); + state.tShift[nextLine] = pos - state.bMarks[nextLine]; + continue; + } + // Case 2: line is not inside the blockquote, and the last line was empty. + if (lastLineEmpty) { + break; + } + // Case 3: another tag found. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + // Quirk to enforce "hard termination mode" for paragraphs; + // normally if you call `tokenize(state, startLine, nextLine)`, + // paragraphs will look below nextLine for paragraph continuation, + // but if blockquote is terminated by another tag, they shouldn't + state.lineMax = nextLine; + if (state.blkIndent !== 0) { + // state.blkIndent was non-zero, we now set it to zero, + // so we need to re-calculate all offsets to appear as + // if indent wasn't changed + oldBMarks.push(state.bMarks[nextLine]); + oldBSCount.push(state.bsCount[nextLine]); + oldTShift.push(state.tShift[nextLine]); + oldSCount.push(state.sCount[nextLine]); + state.sCount[nextLine] -= state.blkIndent; + } + break; + } + oldBMarks.push(state.bMarks[nextLine]); + oldBSCount.push(state.bsCount[nextLine]); + oldTShift.push(state.tShift[nextLine]); + oldSCount.push(state.sCount[nextLine]); + // A negative indentation means that this is a paragraph continuation + + state.sCount[nextLine] = -1; + } + oldIndent = state.blkIndent; + state.blkIndent = 0; + token = state.push("blockquote_open", "blockquote", 1); + token.markup = ">"; + token.map = lines = [ startLine, 0 ]; + state.md.block.tokenize(state, startLine, nextLine); + token = state.push("blockquote_close", "blockquote", -1); + token.markup = ">"; + state.lineMax = oldLineMax; + state.parentType = oldParentType; + lines[1] = state.line; + // Restore original tShift; this might not be necessary since the parser + // has already been here, but just to make sure we can do that. + for (i = 0; i < oldTShift.length; i++) { + state.bMarks[i + startLine] = oldBMarks[i]; + state.tShift[i + startLine] = oldTShift[i]; + state.sCount[i + startLine] = oldSCount[i]; + state.bsCount[i + startLine] = oldBSCount[i]; + } + state.blkIndent = oldIndent; + return true; + }; + var isSpace$8 = utils.isSpace; + var hr = function hr(state, startLine, endLine, silent) { + var marker, cnt, ch, token, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + marker = state.src.charCodeAt(pos++); + // Check hr marker + if (marker !== 42 /* * */ && marker !== 45 /* - */ && marker !== 95 /* _ */) { + return false; + } + // markers can be mixed with spaces, but there should be at least 3 of them + cnt = 1; + while (pos < max) { + ch = state.src.charCodeAt(pos++); + if (ch !== marker && !isSpace$8(ch)) { + return false; + } + if (ch === marker) { + cnt++; + } + } + if (cnt < 3) { + return false; + } + if (silent) { + return true; + } + state.line = startLine + 1; + token = state.push("hr", "hr", 0); + token.map = [ startLine, state.line ]; + token.markup = Array(cnt + 1).join(String.fromCharCode(marker)); + return true; + }; + var isSpace$7 = utils.isSpace; + // Search `[-+*][\n ]`, returns next pos after marker on success + // or -1 on fail. + function skipBulletListMarker(state, startLine) { + var marker, pos, max, ch; + pos = state.bMarks[startLine] + state.tShift[startLine]; + max = state.eMarks[startLine]; + marker = state.src.charCodeAt(pos++); + // Check bullet + if (marker !== 42 /* * */ && marker !== 45 /* - */ && marker !== 43 /* + */) { + return -1; + } + if (pos < max) { + ch = state.src.charCodeAt(pos); + if (!isSpace$7(ch)) { + // " -test " - is not a list item + return -1; + } + } + return pos; + } + // Search `\d+[.)][\n ]`, returns next pos after marker on success + // or -1 on fail. + function skipOrderedListMarker(state, startLine) { + var ch, start = state.bMarks[startLine] + state.tShift[startLine], pos = start, max = state.eMarks[startLine]; + // List marker should have at least 2 chars (digit + dot) + if (pos + 1 >= max) { + return -1; + } + ch = state.src.charCodeAt(pos++); + if (ch < 48 /* 0 */ || ch > 57 /* 9 */) { + return -1; + } + for (;;) { + // EOL -> fail + if (pos >= max) { + return -1; + } + ch = state.src.charCodeAt(pos++); + if (ch >= 48 /* 0 */ && ch <= 57 /* 9 */) { + // List marker should have no more than 9 digits + // (prevents integer overflow in browsers) + if (pos - start >= 10) { + return -1; + } + continue; + } + // found valid marker + if (ch === 41 /* ) */ || ch === 46 /* . */) { + break; + } + return -1; + } + if (pos < max) { + ch = state.src.charCodeAt(pos); + if (!isSpace$7(ch)) { + // " 1.test " - is not a list item + return -1; + } + } + return pos; + } + function markTightParagraphs(state, idx) { + var i, l, level = state.level + 2; + for (i = idx + 2, l = state.tokens.length - 2; i < l; i++) { + if (state.tokens[i].level === level && state.tokens[i].type === "paragraph_open") { + state.tokens[i + 2].hidden = true; + state.tokens[i].hidden = true; + i += 2; + } + } + } + var list = function list(state, startLine, endLine, silent) { + var ch, contentStart, i, indent, indentAfterMarker, initial, isOrdered, itemLines, l, listLines, listTokIdx, markerCharCode, markerValue, max, nextLine, offset, oldListIndent, oldParentType, oldSCount, oldTShift, oldTight, pos, posAfterMarker, prevEmptyEnd, start, terminate, terminatorRules, token, isTerminatingParagraph = false, tight = true; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + // Special case: + // - item 1 + // - item 2 + // - item 3 + // - item 4 + // - this one is a paragraph continuation + if (state.listIndent >= 0 && state.sCount[startLine] - state.listIndent >= 4 && state.sCount[startLine] < state.blkIndent) { + return false; + } + // limit conditions when list can interrupt + // a paragraph (validation mode only) + if (silent && state.parentType === "paragraph") { + // Next list item should still terminate previous list item; + // This code can fail if plugins use blkIndent as well as lists, + // but I hope the spec gets fixed long before that happens. + if (state.sCount[startLine] >= state.blkIndent) { + isTerminatingParagraph = true; + } + } + // Detect list type and position after marker + if ((posAfterMarker = skipOrderedListMarker(state, startLine)) >= 0) { + isOrdered = true; + start = state.bMarks[startLine] + state.tShift[startLine]; + markerValue = Number(state.src.slice(start, posAfterMarker - 1)); + // If we're starting a new ordered list right after + // a paragraph, it should start with 1. + if (isTerminatingParagraph && markerValue !== 1) return false; + } else if ((posAfterMarker = skipBulletListMarker(state, startLine)) >= 0) { + isOrdered = false; + } else { + return false; + } + // If we're starting a new unordered list right after + // a paragraph, first line should not be empty. + if (isTerminatingParagraph) { + if (state.skipSpaces(posAfterMarker) >= state.eMarks[startLine]) return false; + } + // We should terminate list on style change. Remember first one to compare. + markerCharCode = state.src.charCodeAt(posAfterMarker - 1); + // For validation mode we can terminate immediately + if (silent) { + return true; + } + // Start list + listTokIdx = state.tokens.length; + if (isOrdered) { + token = state.push("ordered_list_open", "ol", 1); + if (markerValue !== 1) { + token.attrs = [ [ "start", markerValue ] ]; + } + } else { + token = state.push("bullet_list_open", "ul", 1); + } + token.map = listLines = [ startLine, 0 ]; + token.markup = String.fromCharCode(markerCharCode); + + // Iterate list items + + nextLine = startLine; + prevEmptyEnd = false; + terminatorRules = state.md.block.ruler.getRules("list"); + oldParentType = state.parentType; + state.parentType = "list"; + while (nextLine < endLine) { + pos = posAfterMarker; + max = state.eMarks[nextLine]; + initial = offset = state.sCount[nextLine] + posAfterMarker - (state.bMarks[startLine] + state.tShift[startLine]); + while (pos < max) { + ch = state.src.charCodeAt(pos); + if (ch === 9) { + offset += 4 - (offset + state.bsCount[nextLine]) % 4; + } else if (ch === 32) { + offset++; + } else { + break; + } + pos++; + } + contentStart = pos; + if (contentStart >= max) { + // trimming space in "- \n 3" case, indent is 1 here + indentAfterMarker = 1; + } else { + indentAfterMarker = offset - initial; + } + // If we have more than 4 spaces, the indent is 1 + // (the rest is just indented code block) + if (indentAfterMarker > 4) { + indentAfterMarker = 1; + } + // " - test" + // ^^^^^ - calculating total length of this thing + indent = initial + indentAfterMarker; + // Run subparser & write tokens + token = state.push("list_item_open", "li", 1); + token.markup = String.fromCharCode(markerCharCode); + token.map = itemLines = [ startLine, 0 ]; + if (isOrdered) { + token.info = state.src.slice(start, posAfterMarker - 1); + } + // change current state, then restore it after parser subcall + oldTight = state.tight; + oldTShift = state.tShift[startLine]; + oldSCount = state.sCount[startLine]; + // - example list + // ^ listIndent position will be here + // ^ blkIndent position will be here + + oldListIndent = state.listIndent; + state.listIndent = state.blkIndent; + state.blkIndent = indent; + state.tight = true; + state.tShift[startLine] = contentStart - state.bMarks[startLine]; + state.sCount[startLine] = offset; + if (contentStart >= max && state.isEmpty(startLine + 1)) { + // workaround for this case + // (list item is empty, list terminates before "foo"): + // ~~~~~~~~ + // - + // foo + // ~~~~~~~~ + state.line = Math.min(state.line + 2, endLine); + } else { + state.md.block.tokenize(state, startLine, endLine, true); + } + // If any of list item is tight, mark list as tight + if (!state.tight || prevEmptyEnd) { + tight = false; + } + // Item become loose if finish with empty line, + // but we should filter last element, because it means list finish + prevEmptyEnd = state.line - startLine > 1 && state.isEmpty(state.line - 1); + state.blkIndent = state.listIndent; + state.listIndent = oldListIndent; + state.tShift[startLine] = oldTShift; + state.sCount[startLine] = oldSCount; + state.tight = oldTight; + token = state.push("list_item_close", "li", -1); + token.markup = String.fromCharCode(markerCharCode); + nextLine = startLine = state.line; + itemLines[1] = nextLine; + contentStart = state.bMarks[startLine]; + if (nextLine >= endLine) { + break; + } + + // Try to check if list is terminated or continued. + + if (state.sCount[nextLine] < state.blkIndent) { + break; + } + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + break; + } + // fail if terminating block found + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + break; + } + // fail if list has another type + if (isOrdered) { + posAfterMarker = skipOrderedListMarker(state, nextLine); + if (posAfterMarker < 0) { + break; + } + start = state.bMarks[nextLine] + state.tShift[nextLine]; + } else { + posAfterMarker = skipBulletListMarker(state, nextLine); + if (posAfterMarker < 0) { + break; + } + } + if (markerCharCode !== state.src.charCodeAt(posAfterMarker - 1)) { + break; + } + } + // Finalize list + if (isOrdered) { + token = state.push("ordered_list_close", "ol", -1); + } else { + token = state.push("bullet_list_close", "ul", -1); + } + token.markup = String.fromCharCode(markerCharCode); + listLines[1] = nextLine; + state.line = nextLine; + state.parentType = oldParentType; + // mark paragraphs tight if needed + if (tight) { + markTightParagraphs(state, listTokIdx); + } + return true; + }; + var normalizeReference$2 = utils.normalizeReference; + var isSpace$6 = utils.isSpace; + var reference = function reference(state, startLine, _endLine, silent) { + var ch, destEndPos, destEndLineNo, endLine, href, i, l, label, labelEnd, oldParentType, res, start, str, terminate, terminatorRules, title, lines = 0, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine], nextLine = startLine + 1; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + if (state.src.charCodeAt(pos) !== 91 /* [ */) { + return false; + } + // Simple check to quickly interrupt scan on [link](url) at the start of line. + // Can be useful on practice: https://github.com/markdown-it/markdown-it/issues/54 + while (++pos < max) { + if (state.src.charCodeAt(pos) === 93 /* ] */ && state.src.charCodeAt(pos - 1) !== 92 /* \ */) { + if (pos + 1 === max) { + return false; + } + if (state.src.charCodeAt(pos + 1) !== 58 /* : */) { + return false; + } + break; + } + } + endLine = state.lineMax; + // jump line-by-line until empty one or EOF + terminatorRules = state.md.block.ruler.getRules("reference"); + oldParentType = state.parentType; + state.parentType = "reference"; + for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { + // this would be a code block normally, but after paragraph + // it's considered a lazy continuation regardless of what's there + if (state.sCount[nextLine] - state.blkIndent > 3) { + continue; + } + // quirk for blockquotes, this line should already be checked by that rule + if (state.sCount[nextLine] < 0) { + continue; + } + // Some tags can terminate paragraph without empty line. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + break; + } + } + str = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); + max = str.length; + for (pos = 1; pos < max; pos++) { + ch = str.charCodeAt(pos); + if (ch === 91 /* [ */) { + return false; + } else if (ch === 93 /* ] */) { + labelEnd = pos; + break; + } else if (ch === 10 /* \n */) { + lines++; + } else if (ch === 92 /* \ */) { + pos++; + if (pos < max && str.charCodeAt(pos) === 10) { + lines++; + } + } + } + if (labelEnd < 0 || str.charCodeAt(labelEnd + 1) !== 58 /* : */) { + return false; + } + // [label]: destination 'title' + // ^^^ skip optional whitespace here + for (pos = labelEnd + 2; pos < max; pos++) { + ch = str.charCodeAt(pos); + if (ch === 10) { + lines++; + } else if (isSpace$6(ch)) ; else { + break; + } + } + // [label]: destination 'title' + // ^^^^^^^^^^^ parse this + res = state.md.helpers.parseLinkDestination(str, pos, max); + if (!res.ok) { + return false; + } + href = state.md.normalizeLink(res.str); + if (!state.md.validateLink(href)) { + return false; + } + pos = res.pos; + lines += res.lines; + // save cursor state, we could require to rollback later + destEndPos = pos; + destEndLineNo = lines; + // [label]: destination 'title' + // ^^^ skipping those spaces + start = pos; + for (;pos < max; pos++) { + ch = str.charCodeAt(pos); + if (ch === 10) { + lines++; + } else if (isSpace$6(ch)) ; else { + break; + } + } + // [label]: destination 'title' + // ^^^^^^^ parse this + res = state.md.helpers.parseLinkTitle(str, pos, max); + if (pos < max && start !== pos && res.ok) { + title = res.str; + pos = res.pos; + lines += res.lines; + } else { + title = ""; + pos = destEndPos; + lines = destEndLineNo; + } + // skip trailing spaces until the rest of the line + while (pos < max) { + ch = str.charCodeAt(pos); + if (!isSpace$6(ch)) { + break; + } + pos++; + } + if (pos < max && str.charCodeAt(pos) !== 10) { + if (title) { + // garbage at the end of the line after title, + // but it could still be a valid reference if we roll back + title = ""; + pos = destEndPos; + lines = destEndLineNo; + while (pos < max) { + ch = str.charCodeAt(pos); + if (!isSpace$6(ch)) { + break; + } + pos++; + } + } + } + if (pos < max && str.charCodeAt(pos) !== 10) { + // garbage at the end of the line + return false; + } + label = normalizeReference$2(str.slice(1, labelEnd)); + if (!label) { + // CommonMark 0.20 disallows empty labels + return false; + } + // Reference can not terminate anything. This check is for safety only. + /*istanbul ignore if*/ if (silent) { + return true; + } + if (typeof state.env.references === "undefined") { + state.env.references = {}; + } + if (typeof state.env.references[label] === "undefined") { + state.env.references[label] = { + title: title, + href: href + }; + } + state.parentType = oldParentType; + state.line = startLine + lines + 1; + return true; + }; + // List of valid html blocks names, accorting to commonmark spec + var html_blocks = [ "address", "article", "aside", "base", "basefont", "blockquote", "body", "caption", "center", "col", "colgroup", "dd", "details", "dialog", "dir", "div", "dl", "dt", "fieldset", "figcaption", "figure", "footer", "form", "frame", "frameset", "h1", "h2", "h3", "h4", "h5", "h6", "head", "header", "hr", "html", "iframe", "legend", "li", "link", "main", "menu", "menuitem", "nav", "noframes", "ol", "optgroup", "option", "p", "param", "section", "source", "summary", "table", "tbody", "td", "tfoot", "th", "thead", "title", "tr", "track", "ul" ]; + // Regexps to match html elements + var attr_name = "[a-zA-Z_:][a-zA-Z0-9:._-]*"; + var unquoted = "[^\"'=<>`\\x00-\\x20]+"; + var single_quoted = "'[^']*'"; + var double_quoted = '"[^"]*"'; + var attr_value = "(?:" + unquoted + "|" + single_quoted + "|" + double_quoted + ")"; + var attribute = "(?:\\s+" + attr_name + "(?:\\s*=\\s*" + attr_value + ")?)"; + var open_tag = "<[A-Za-z][A-Za-z0-9\\-]*" + attribute + "*\\s*\\/?>"; + var close_tag = "<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>"; + var comment = "\x3c!----\x3e|\x3c!--(?:-?[^>-])(?:-?[^-])*--\x3e"; + var processing = "<[?][\\s\\S]*?[?]>"; + var declaration = "<![A-Z]+\\s+[^>]*>"; + var cdata = "<!\\[CDATA\\[[\\s\\S]*?\\]\\]>"; + var HTML_TAG_RE$1 = new RegExp("^(?:" + open_tag + "|" + close_tag + "|" + comment + "|" + processing + "|" + declaration + "|" + cdata + ")"); + var HTML_OPEN_CLOSE_TAG_RE$1 = new RegExp("^(?:" + open_tag + "|" + close_tag + ")"); + var HTML_TAG_RE_1 = HTML_TAG_RE$1; + var HTML_OPEN_CLOSE_TAG_RE_1 = HTML_OPEN_CLOSE_TAG_RE$1; + var html_re = { + HTML_TAG_RE: HTML_TAG_RE_1, + HTML_OPEN_CLOSE_TAG_RE: HTML_OPEN_CLOSE_TAG_RE_1 + }; + var HTML_OPEN_CLOSE_TAG_RE = html_re.HTML_OPEN_CLOSE_TAG_RE; + // An array of opening and corresponding closing sequences for html tags, + // last argument defines whether it can terminate a paragraph or not + + var HTML_SEQUENCES = [ [ /^<(script|pre|style|textarea)(?=(\s|>|$))/i, /<\/(script|pre|style|textarea)>/i, true ], [ /^<!--/, /-->/, true ], [ /^<\?/, /\?>/, true ], [ /^<![A-Z]/, />/, true ], [ /^<!\[CDATA\[/, /\]\]>/, true ], [ new RegExp("^</?(" + html_blocks.join("|") + ")(?=(\\s|/?>|$))", "i"), /^$/, true ], [ new RegExp(HTML_OPEN_CLOSE_TAG_RE.source + "\\s*$"), /^$/, false ] ]; + var html_block = function html_block(state, startLine, endLine, silent) { + var i, nextLine, token, lineText, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + if (!state.md.options.html) { + return false; + } + if (state.src.charCodeAt(pos) !== 60 /* < */) { + return false; + } + lineText = state.src.slice(pos, max); + for (i = 0; i < HTML_SEQUENCES.length; i++) { + if (HTML_SEQUENCES[i][0].test(lineText)) { + break; + } + } + if (i === HTML_SEQUENCES.length) { + return false; + } + if (silent) { + // true if this sequence can be a terminator, false otherwise + return HTML_SEQUENCES[i][2]; + } + nextLine = startLine + 1; + // If we are here - we detected HTML block. + // Let's roll down till block end. + if (!HTML_SEQUENCES[i][1].test(lineText)) { + for (;nextLine < endLine; nextLine++) { + if (state.sCount[nextLine] < state.blkIndent) { + break; + } + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + lineText = state.src.slice(pos, max); + if (HTML_SEQUENCES[i][1].test(lineText)) { + if (lineText.length !== 0) { + nextLine++; + } + break; + } + } + } + state.line = nextLine; + token = state.push("html_block", "", 0); + token.map = [ startLine, nextLine ]; + token.content = state.getLines(startLine, nextLine, state.blkIndent, true); + return true; + }; + var isSpace$5 = utils.isSpace; + var heading = function heading(state, startLine, endLine, silent) { + var ch, level, tmp, token, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + ch = state.src.charCodeAt(pos); + if (ch !== 35 /* # */ || pos >= max) { + return false; + } + // count heading level + level = 1; + ch = state.src.charCodeAt(++pos); + while (ch === 35 /* # */ && pos < max && level <= 6) { + level++; + ch = state.src.charCodeAt(++pos); + } + if (level > 6 || pos < max && !isSpace$5(ch)) { + return false; + } + if (silent) { + return true; + } + // Let's cut tails like ' ### ' from the end of string + max = state.skipSpacesBack(max, pos); + tmp = state.skipCharsBack(max, 35, pos); + // # + if (tmp > pos && isSpace$5(state.src.charCodeAt(tmp - 1))) { + max = tmp; + } + state.line = startLine + 1; + token = state.push("heading_open", "h" + String(level), 1); + token.markup = "########".slice(0, level); + token.map = [ startLine, state.line ]; + token = state.push("inline", "", 0); + token.content = state.src.slice(pos, max).trim(); + token.map = [ startLine, state.line ]; + token.children = []; + token = state.push("heading_close", "h" + String(level), -1); + token.markup = "########".slice(0, level); + return true; + }; + // lheading (---, ===) + var lheading = function lheading(state, startLine, endLine /*, silent*/) { + var content, terminate, i, l, token, pos, max, level, marker, nextLine = startLine + 1, oldParentType, terminatorRules = state.md.block.ruler.getRules("paragraph"); + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { + return false; + } + oldParentType = state.parentType; + state.parentType = "paragraph"; + // use paragraph to match terminatorRules + // jump line-by-line until empty one or EOF + for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { + // this would be a code block normally, but after paragraph + // it's considered a lazy continuation regardless of what's there + if (state.sCount[nextLine] - state.blkIndent > 3) { + continue; + } + + // Check for underline in setext header + + if (state.sCount[nextLine] >= state.blkIndent) { + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + if (pos < max) { + marker = state.src.charCodeAt(pos); + if (marker === 45 /* - */ || marker === 61 /* = */) { + pos = state.skipChars(pos, marker); + pos = state.skipSpaces(pos); + if (pos >= max) { + level = marker === 61 /* = */ ? 1 : 2; + break; + } + } + } + } + // quirk for blockquotes, this line should already be checked by that rule + if (state.sCount[nextLine] < 0) { + continue; + } + // Some tags can terminate paragraph without empty line. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + break; + } + } + if (!level) { + // Didn't find valid underline + return false; + } + content = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); + state.line = nextLine + 1; + token = state.push("heading_open", "h" + String(level), 1); + token.markup = String.fromCharCode(marker); + token.map = [ startLine, state.line ]; + token = state.push("inline", "", 0); + token.content = content; + token.map = [ startLine, state.line - 1 ]; + token.children = []; + token = state.push("heading_close", "h" + String(level), -1); + token.markup = String.fromCharCode(marker); + state.parentType = oldParentType; + return true; + }; + // Paragraph + var paragraph = function paragraph(state, startLine /*, endLine*/) { + var content, terminate, i, l, token, oldParentType, nextLine = startLine + 1, terminatorRules = state.md.block.ruler.getRules("paragraph"), endLine = state.lineMax; + oldParentType = state.parentType; + state.parentType = "paragraph"; + // jump line-by-line until empty one or EOF + for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { + // this would be a code block normally, but after paragraph + // it's considered a lazy continuation regardless of what's there + if (state.sCount[nextLine] - state.blkIndent > 3) { + continue; + } + // quirk for blockquotes, this line should already be checked by that rule + if (state.sCount[nextLine] < 0) { + continue; + } + // Some tags can terminate paragraph without empty line. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { + break; + } + } + content = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); + state.line = nextLine; + token = state.push("paragraph_open", "p", 1); + token.map = [ startLine, state.line ]; + token = state.push("inline", "", 0); + token.content = content; + token.map = [ startLine, state.line ]; + token.children = []; + token = state.push("paragraph_close", "p", -1); + state.parentType = oldParentType; + return true; + }; + var isSpace$4 = utils.isSpace; + function StateBlock(src, md, env, tokens) { + var ch, s, start, pos, len, indent, offset, indent_found; + this.src = src; + // link to parser instance + this.md = md; + this.env = env; + + // Internal state vartiables + + this.tokens = tokens; + this.bMarks = []; + // line begin offsets for fast jumps + this.eMarks = []; + // line end offsets for fast jumps + this.tShift = []; + // offsets of the first non-space characters (tabs not expanded) + this.sCount = []; + // indents for each line (tabs expanded) + // An amount of virtual spaces (tabs expanded) between beginning + // of each line (bMarks) and real beginning of that line. + + // It exists only as a hack because blockquotes override bMarks + // losing information in the process. + + // It's used only when expanding tabs, you can think about it as + // an initial tab length, e.g. bsCount=21 applied to string `\t123` + // means first tab should be expanded to 4-21%4 === 3 spaces. + + this.bsCount = []; + // block parser variables + this.blkIndent = 0; + // required block content indent (for example, if we are + // inside a list, it would be positioned after list marker) + this.line = 0; + // line index in src + this.lineMax = 0; + // lines count + this.tight = false; + // loose/tight mode for lists + this.ddIndent = -1; + // indent of the current dd block (-1 if there isn't any) + this.listIndent = -1; + // indent of the current list block (-1 if there isn't any) + // can be 'blockquote', 'list', 'root', 'paragraph' or 'reference' + // used in lists to determine if they interrupt a paragraph + this.parentType = "root"; + this.level = 0; + // renderer + this.result = ""; + // Create caches + // Generate markers. + s = this.src; + indent_found = false; + for (start = pos = indent = offset = 0, len = s.length; pos < len; pos++) { + ch = s.charCodeAt(pos); + if (!indent_found) { + if (isSpace$4(ch)) { + indent++; + if (ch === 9) { + offset += 4 - offset % 4; + } else { + offset++; + } + continue; + } else { + indent_found = true; + } + } + if (ch === 10 || pos === len - 1) { + if (ch !== 10) { + pos++; + } + this.bMarks.push(start); + this.eMarks.push(pos); + this.tShift.push(indent); + this.sCount.push(offset); + this.bsCount.push(0); + indent_found = false; + indent = 0; + offset = 0; + start = pos + 1; + } + } + // Push fake entry to simplify cache bounds checks + this.bMarks.push(s.length); + this.eMarks.push(s.length); + this.tShift.push(0); + this.sCount.push(0); + this.bsCount.push(0); + this.lineMax = this.bMarks.length - 1; + // don't count last fake line + } + // Push new token to "stream". + + StateBlock.prototype.push = function(type, tag, nesting) { + var token$1 = new token(type, tag, nesting); + token$1.block = true; + if (nesting < 0) this.level--; + // closing tag + token$1.level = this.level; + if (nesting > 0) this.level++; + // opening tag + this.tokens.push(token$1); + return token$1; + }; + StateBlock.prototype.isEmpty = function isEmpty(line) { + return this.bMarks[line] + this.tShift[line] >= this.eMarks[line]; + }; + StateBlock.prototype.skipEmptyLines = function skipEmptyLines(from) { + for (var max = this.lineMax; from < max; from++) { + if (this.bMarks[from] + this.tShift[from] < this.eMarks[from]) { + break; + } + } + return from; + }; + // Skip spaces from given position. + StateBlock.prototype.skipSpaces = function skipSpaces(pos) { + var ch; + for (var max = this.src.length; pos < max; pos++) { + ch = this.src.charCodeAt(pos); + if (!isSpace$4(ch)) { + break; + } + } + return pos; + }; + // Skip spaces from given position in reverse. + StateBlock.prototype.skipSpacesBack = function skipSpacesBack(pos, min) { + if (pos <= min) { + return pos; + } + while (pos > min) { + if (!isSpace$4(this.src.charCodeAt(--pos))) { + return pos + 1; + } + } + return pos; + }; + // Skip char codes from given position + StateBlock.prototype.skipChars = function skipChars(pos, code) { + for (var max = this.src.length; pos < max; pos++) { + if (this.src.charCodeAt(pos) !== code) { + break; + } + } + return pos; + }; + // Skip char codes reverse from given position - 1 + StateBlock.prototype.skipCharsBack = function skipCharsBack(pos, code, min) { + if (pos <= min) { + return pos; + } + while (pos > min) { + if (code !== this.src.charCodeAt(--pos)) { + return pos + 1; + } + } + return pos; + }; + // cut lines range from source. + StateBlock.prototype.getLines = function getLines(begin, end, indent, keepLastLF) { + var i, lineIndent, ch, first, last, queue, lineStart, line = begin; + if (begin >= end) { + return ""; + } + queue = new Array(end - begin); + for (i = 0; line < end; line++, i++) { + lineIndent = 0; + lineStart = first = this.bMarks[line]; + if (line + 1 < end || keepLastLF) { + // No need for bounds check because we have fake entry on tail. + last = this.eMarks[line] + 1; + } else { + last = this.eMarks[line]; + } + while (first < last && lineIndent < indent) { + ch = this.src.charCodeAt(first); + if (isSpace$4(ch)) { + if (ch === 9) { + lineIndent += 4 - (lineIndent + this.bsCount[line]) % 4; + } else { + lineIndent++; + } + } else if (first - lineStart < this.tShift[line]) { + // patched tShift masked characters to look like spaces (blockquotes, list markers) + lineIndent++; + } else { + break; + } + first++; + } + if (lineIndent > indent) { + // partially expanding tabs in code blocks, e.g '\t\tfoobar' + // with indent=2 becomes ' \tfoobar' + queue[i] = new Array(lineIndent - indent + 1).join(" ") + this.src.slice(first, last); + } else { + queue[i] = this.src.slice(first, last); + } + } + return queue.join(""); + }; + // re-export Token class to use in block rules + StateBlock.prototype.Token = token; + var state_block = StateBlock; + var _rules$1 = [ + // First 2 params - rule name & source. Secondary array - list of rules, + // which can be terminated by this one. + [ "table", table, [ "paragraph", "reference" ] ], [ "code", code ], [ "fence", fence, [ "paragraph", "reference", "blockquote", "list" ] ], [ "blockquote", blockquote, [ "paragraph", "reference", "blockquote", "list" ] ], [ "hr", hr, [ "paragraph", "reference", "blockquote", "list" ] ], [ "list", list, [ "paragraph", "reference", "blockquote" ] ], [ "reference", reference ], [ "html_block", html_block, [ "paragraph", "reference", "blockquote" ] ], [ "heading", heading, [ "paragraph", "reference", "blockquote" ] ], [ "lheading", lheading ], [ "paragraph", paragraph ] ]; + /** + * new ParserBlock() + **/ function ParserBlock() { + /** + * ParserBlock#ruler -> Ruler + * + * [[Ruler]] instance. Keep configuration of block rules. + **/ + this.ruler = new ruler; + for (var i = 0; i < _rules$1.length; i++) { + this.ruler.push(_rules$1[i][0], _rules$1[i][1], { + alt: (_rules$1[i][2] || []).slice() + }); + } + } + // Generate tokens for input range + + ParserBlock.prototype.tokenize = function(state, startLine, endLine) { + var ok, i, rules = this.ruler.getRules(""), len = rules.length, line = startLine, hasEmptyLines = false, maxNesting = state.md.options.maxNesting; + while (line < endLine) { + state.line = line = state.skipEmptyLines(line); + if (line >= endLine) { + break; + } + // Termination condition for nested calls. + // Nested calls currently used for blockquotes & lists + if (state.sCount[line] < state.blkIndent) { + break; + } + // If nesting level exceeded - skip tail to the end. That's not ordinary + // situation and we should not care about content. + if (state.level >= maxNesting) { + state.line = endLine; + break; + } + // Try all possible rules. + // On success, rule should: + + // - update `state.line` + // - update `state.tokens` + // - return true + for (i = 0; i < len; i++) { + ok = rules[i](state, line, endLine, false); + if (ok) { + break; + } + } + // set state.tight if we had an empty line before current tag + // i.e. latest empty line should not count + state.tight = !hasEmptyLines; + // paragraph might "eat" one newline after it in nested lists + if (state.isEmpty(state.line - 1)) { + hasEmptyLines = true; + } + line = state.line; + if (line < endLine && state.isEmpty(line)) { + hasEmptyLines = true; + line++; + state.line = line; + } + } + }; + /** + * ParserBlock.parse(str, md, env, outTokens) + * + * Process input string and push block tokens into `outTokens` + **/ ParserBlock.prototype.parse = function(src, md, env, outTokens) { + var state; + if (!src) { + return; + } + state = new this.State(src, md, env, outTokens); + this.tokenize(state, state.line, state.lineMax); + }; + ParserBlock.prototype.State = state_block; + var parser_block = ParserBlock; + // Skip text characters for text token, place those to pending buffer + // Rule to skip pure text + // '{}$%@~+=:' reserved for extentions + // !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~ + // !!!! Don't confuse with "Markdown ASCII Punctuation" chars + // http://spec.commonmark.org/0.15/#ascii-punctuation-character + function isTerminatorChar(ch) { + switch (ch) { + case 10 /* \n */ : + case 33 /* ! */ : + case 35 /* # */ : + case 36 /* $ */ : + case 37 /* % */ : + case 38 /* & */ : + case 42 /* * */ : + case 43 /* + */ : + case 45 /* - */ : + case 58 /* : */ : + case 60 /* < */ : + case 61 /* = */ : + case 62 /* > */ : + case 64 /* @ */ : + case 91 /* [ */ : + case 92 /* \ */ : + case 93 /* ] */ : + case 94 /* ^ */ : + case 95 /* _ */ : + case 96 /* ` */ : + case 123 /* { */ : + case 125 /* } */ : + case 126 /* ~ */ : + return true; + + default: + return false; + } + } + var text = function text(state, silent) { + var pos = state.pos; + while (pos < state.posMax && !isTerminatorChar(state.src.charCodeAt(pos))) { + pos++; + } + if (pos === state.pos) { + return false; + } + if (!silent) { + state.pending += state.src.slice(state.pos, pos); + } + state.pos = pos; + return true; + }; + var isSpace$3 = utils.isSpace; + var newline = function newline(state, silent) { + var pmax, max, ws, pos = state.pos; + if (state.src.charCodeAt(pos) !== 10 /* \n */) { + return false; + } + pmax = state.pending.length - 1; + max = state.posMax; + // ' \n' -> hardbreak + // Lookup in pending chars is bad practice! Don't copy to other rules! + // Pending string is stored in concat mode, indexed lookups will cause + // convertion to flat mode. + if (!silent) { + if (pmax >= 0 && state.pending.charCodeAt(pmax) === 32) { + if (pmax >= 1 && state.pending.charCodeAt(pmax - 1) === 32) { + // Find whitespaces tail of pending chars. + ws = pmax - 1; + while (ws >= 1 && state.pending.charCodeAt(ws - 1) === 32) ws--; + state.pending = state.pending.slice(0, ws); + state.push("hardbreak", "br", 0); + } else { + state.pending = state.pending.slice(0, -1); + state.push("softbreak", "br", 0); + } + } else { + state.push("softbreak", "br", 0); + } + } + pos++; + // skip heading spaces for next line + while (pos < max && isSpace$3(state.src.charCodeAt(pos))) { + pos++; + } + state.pos = pos; + return true; + }; + var isSpace$2 = utils.isSpace; + var ESCAPED = []; + for (var i = 0; i < 256; i++) { + ESCAPED.push(0); + } + "\\!\"#$%&'()*+,./:;<=>?@[]^_`{|}~-".split("").forEach((function(ch) { + ESCAPED[ch.charCodeAt(0)] = 1; + })); + var _escape = function escape(state, silent) { + var ch, pos = state.pos, max = state.posMax; + if (state.src.charCodeAt(pos) !== 92 /* \ */) { + return false; + } + pos++; + if (pos < max) { + ch = state.src.charCodeAt(pos); + if (ch < 256 && ESCAPED[ch] !== 0) { + if (!silent) { + state.pending += state.src[pos]; + } + state.pos += 2; + return true; + } + if (ch === 10) { + if (!silent) { + state.push("hardbreak", "br", 0); + } + pos++; + // skip leading whitespaces from next line + while (pos < max) { + ch = state.src.charCodeAt(pos); + if (!isSpace$2(ch)) { + break; + } + pos++; + } + state.pos = pos; + return true; + } + } + if (!silent) { + state.pending += "\\"; + } + state.pos++; + return true; + }; + // Parse backticks + var backticks = function backtick(state, silent) { + var start, max, marker, token, matchStart, matchEnd, openerLength, closerLength, pos = state.pos, ch = state.src.charCodeAt(pos); + if (ch !== 96 /* ` */) { + return false; + } + start = pos; + pos++; + max = state.posMax; + // scan marker length + while (pos < max && state.src.charCodeAt(pos) === 96 /* ` */) { + pos++; + } + marker = state.src.slice(start, pos); + openerLength = marker.length; + if (state.backticksScanned && (state.backticks[openerLength] || 0) <= start) { + if (!silent) state.pending += marker; + state.pos += openerLength; + return true; + } + matchStart = matchEnd = pos; + // Nothing found in the cache, scan until the end of the line (or until marker is found) + while ((matchStart = state.src.indexOf("`", matchEnd)) !== -1) { + matchEnd = matchStart + 1; + // scan marker length + while (matchEnd < max && state.src.charCodeAt(matchEnd) === 96 /* ` */) { + matchEnd++; + } + closerLength = matchEnd - matchStart; + if (closerLength === openerLength) { + // Found matching closer length. + if (!silent) { + token = state.push("code_inline", "code", 0); + token.markup = marker; + token.content = state.src.slice(pos, matchStart).replace(/\n/g, " ").replace(/^ (.+) $/, "$1"); + } + state.pos = matchEnd; + return true; + } + // Some different length found, put it in cache as upper limit of where closer can be found + state.backticks[closerLength] = matchStart; + } + // Scanned through the end, didn't find anything + state.backticksScanned = true; + if (!silent) state.pending += marker; + state.pos += openerLength; + return true; + }; + // ~~strike through~~ + // Insert each marker as a separate text token, and add it to delimiter list + + var tokenize$1 = function strikethrough(state, silent) { + var i, scanned, token, len, ch, start = state.pos, marker = state.src.charCodeAt(start); + if (silent) { + return false; + } + if (marker !== 126 /* ~ */) { + return false; + } + scanned = state.scanDelims(state.pos, true); + len = scanned.length; + ch = String.fromCharCode(marker); + if (len < 2) { + return false; + } + if (len % 2) { + token = state.push("text", "", 0); + token.content = ch; + len--; + } + for (i = 0; i < len; i += 2) { + token = state.push("text", "", 0); + token.content = ch + ch; + state.delimiters.push({ + marker: marker, + length: 0, + // disable "rule of 3" length checks meant for emphasis + token: state.tokens.length - 1, + end: -1, + open: scanned.can_open, + close: scanned.can_close + }); + } + state.pos += scanned.length; + return true; + }; + function postProcess$1(state, delimiters) { + var i, j, startDelim, endDelim, token, loneMarkers = [], max = delimiters.length; + for (i = 0; i < max; i++) { + startDelim = delimiters[i]; + if (startDelim.marker !== 126 /* ~ */) { + continue; + } + if (startDelim.end === -1) { + continue; + } + endDelim = delimiters[startDelim.end]; + token = state.tokens[startDelim.token]; + token.type = "s_open"; + token.tag = "s"; + token.nesting = 1; + token.markup = "~~"; + token.content = ""; + token = state.tokens[endDelim.token]; + token.type = "s_close"; + token.tag = "s"; + token.nesting = -1; + token.markup = "~~"; + token.content = ""; + if (state.tokens[endDelim.token - 1].type === "text" && state.tokens[endDelim.token - 1].content === "~") { + loneMarkers.push(endDelim.token - 1); + } + } + // If a marker sequence has an odd number of characters, it's splitted + // like this: `~~~~~` -> `~` + `~~` + `~~`, leaving one marker at the + // start of the sequence. + + // So, we have to move all those markers after subsequent s_close tags. + + while (loneMarkers.length) { + i = loneMarkers.pop(); + j = i + 1; + while (j < state.tokens.length && state.tokens[j].type === "s_close") { + j++; + } + j--; + if (i !== j) { + token = state.tokens[j]; + state.tokens[j] = state.tokens[i]; + state.tokens[i] = token; + } + } + } + // Walk through delimiter list and replace text tokens with tags + + var postProcess_1$1 = function strikethrough(state) { + var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length; + postProcess$1(state, state.delimiters); + for (curr = 0; curr < max; curr++) { + if (tokens_meta[curr] && tokens_meta[curr].delimiters) { + postProcess$1(state, tokens_meta[curr].delimiters); + } + } + }; + var strikethrough = { + tokenize: tokenize$1, + postProcess: postProcess_1$1 + }; + // Process *this* and _that_ + // Insert each marker as a separate text token, and add it to delimiter list + + var tokenize = function emphasis(state, silent) { + var i, scanned, token, start = state.pos, marker = state.src.charCodeAt(start); + if (silent) { + return false; + } + if (marker !== 95 /* _ */ && marker !== 42 /* * */) { + return false; + } + scanned = state.scanDelims(state.pos, marker === 42); + for (i = 0; i < scanned.length; i++) { + token = state.push("text", "", 0); + token.content = String.fromCharCode(marker); + state.delimiters.push({ + // Char code of the starting marker (number). + marker: marker, + // Total length of these series of delimiters. + length: scanned.length, + // A position of the token this delimiter corresponds to. + token: state.tokens.length - 1, + // If this delimiter is matched as a valid opener, `end` will be + // equal to its position, otherwise it's `-1`. + end: -1, + // Boolean flags that determine if this delimiter could open or close + // an emphasis. + open: scanned.can_open, + close: scanned.can_close + }); + } + state.pos += scanned.length; + return true; + }; + function postProcess(state, delimiters) { + var i, startDelim, endDelim, token, ch, isStrong, max = delimiters.length; + for (i = max - 1; i >= 0; i--) { + startDelim = delimiters[i]; + if (startDelim.marker !== 95 /* _ */ && startDelim.marker !== 42 /* * */) { + continue; + } + // Process only opening markers + if (startDelim.end === -1) { + continue; + } + endDelim = delimiters[startDelim.end]; + // If the previous delimiter has the same marker and is adjacent to this one, + // merge those into one strong delimiter. + + // `<em><em>whatever</em></em>` -> `<strong>whatever</strong>` + + isStrong = i > 0 && delimiters[i - 1].end === startDelim.end + 1 && + // check that first two markers match and adjacent + delimiters[i - 1].marker === startDelim.marker && delimiters[i - 1].token === startDelim.token - 1 && + // check that last two markers are adjacent (we can safely assume they match) + delimiters[startDelim.end + 1].token === endDelim.token + 1; + ch = String.fromCharCode(startDelim.marker); + token = state.tokens[startDelim.token]; + token.type = isStrong ? "strong_open" : "em_open"; + token.tag = isStrong ? "strong" : "em"; + token.nesting = 1; + token.markup = isStrong ? ch + ch : ch; + token.content = ""; + token = state.tokens[endDelim.token]; + token.type = isStrong ? "strong_close" : "em_close"; + token.tag = isStrong ? "strong" : "em"; + token.nesting = -1; + token.markup = isStrong ? ch + ch : ch; + token.content = ""; + if (isStrong) { + state.tokens[delimiters[i - 1].token].content = ""; + state.tokens[delimiters[startDelim.end + 1].token].content = ""; + i--; + } + } + } + // Walk through delimiter list and replace text tokens with tags + + var postProcess_1 = function emphasis(state) { + var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length; + postProcess(state, state.delimiters); + for (curr = 0; curr < max; curr++) { + if (tokens_meta[curr] && tokens_meta[curr].delimiters) { + postProcess(state, tokens_meta[curr].delimiters); + } + } + }; + var emphasis = { + tokenize: tokenize, + postProcess: postProcess_1 + }; + var normalizeReference$1 = utils.normalizeReference; + var isSpace$1 = utils.isSpace; + var link = function link(state, silent) { + var attrs, code, label, labelEnd, labelStart, pos, res, ref, token, href = "", title = "", oldPos = state.pos, max = state.posMax, start = state.pos, parseReference = true; + if (state.src.charCodeAt(state.pos) !== 91 /* [ */) { + return false; + } + labelStart = state.pos + 1; + labelEnd = state.md.helpers.parseLinkLabel(state, state.pos, true); + // parser failed to find ']', so it's not a valid link + if (labelEnd < 0) { + return false; + } + pos = labelEnd + 1; + if (pos < max && state.src.charCodeAt(pos) === 40 /* ( */) { + // Inline link + // might have found a valid shortcut link, disable reference parsing + parseReference = false; + // [link]( <href> "title" ) + // ^^ skipping these spaces + pos++; + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace$1(code) && code !== 10) { + break; + } + } + if (pos >= max) { + return false; + } + // [link]( <href> "title" ) + // ^^^^^^ parsing link destination + start = pos; + res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax); + if (res.ok) { + href = state.md.normalizeLink(res.str); + if (state.md.validateLink(href)) { + pos = res.pos; + } else { + href = ""; + } + // [link]( <href> "title" ) + // ^^ skipping these spaces + start = pos; + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace$1(code) && code !== 10) { + break; + } + } + // [link]( <href> "title" ) + // ^^^^^^^ parsing link title + res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax); + if (pos < max && start !== pos && res.ok) { + title = res.str; + pos = res.pos; + // [link]( <href> "title" ) + // ^^ skipping these spaces + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace$1(code) && code !== 10) { + break; + } + } + } + } + if (pos >= max || state.src.charCodeAt(pos) !== 41 /* ) */) { + // parsing a valid shortcut link failed, fallback to reference + parseReference = true; + } + pos++; + } + if (parseReference) { + // Link reference + if (typeof state.env.references === "undefined") { + return false; + } + if (pos < max && state.src.charCodeAt(pos) === 91 /* [ */) { + start = pos + 1; + pos = state.md.helpers.parseLinkLabel(state, pos); + if (pos >= 0) { + label = state.src.slice(start, pos++); + } else { + pos = labelEnd + 1; + } + } else { + pos = labelEnd + 1; + } + // covers label === '' and label === undefined + // (collapsed reference link and shortcut reference link respectively) + if (!label) { + label = state.src.slice(labelStart, labelEnd); + } + ref = state.env.references[normalizeReference$1(label)]; + if (!ref) { + state.pos = oldPos; + return false; + } + href = ref.href; + title = ref.title; + } + + // We found the end of the link, and know for a fact it's a valid link; + // so all that's left to do is to call tokenizer. + + if (!silent) { + state.pos = labelStart; + state.posMax = labelEnd; + token = state.push("link_open", "a", 1); + token.attrs = attrs = [ [ "href", href ] ]; + if (title) { + attrs.push([ "title", title ]); + } + state.md.inline.tokenize(state); + token = state.push("link_close", "a", -1); + } + state.pos = pos; + state.posMax = max; + return true; + }; + var normalizeReference = utils.normalizeReference; + var isSpace = utils.isSpace; + var image = function image(state, silent) { + var attrs, code, content, label, labelEnd, labelStart, pos, ref, res, title, token, tokens, start, href = "", oldPos = state.pos, max = state.posMax; + if (state.src.charCodeAt(state.pos) !== 33 /* ! */) { + return false; + } + if (state.src.charCodeAt(state.pos + 1) !== 91 /* [ */) { + return false; + } + labelStart = state.pos + 2; + labelEnd = state.md.helpers.parseLinkLabel(state, state.pos + 1, false); + // parser failed to find ']', so it's not a valid link + if (labelEnd < 0) { + return false; + } + pos = labelEnd + 1; + if (pos < max && state.src.charCodeAt(pos) === 40 /* ( */) { + // Inline link + // [link]( <href> "title" ) + // ^^ skipping these spaces + pos++; + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 10) { + break; + } + } + if (pos >= max) { + return false; + } + // [link]( <href> "title" ) + // ^^^^^^ parsing link destination + start = pos; + res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax); + if (res.ok) { + href = state.md.normalizeLink(res.str); + if (state.md.validateLink(href)) { + pos = res.pos; + } else { + href = ""; + } + } + // [link]( <href> "title" ) + // ^^ skipping these spaces + start = pos; + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 10) { + break; + } + } + // [link]( <href> "title" ) + // ^^^^^^^ parsing link title + res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax); + if (pos < max && start !== pos && res.ok) { + title = res.str; + pos = res.pos; + // [link]( <href> "title" ) + // ^^ skipping these spaces + for (;pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 10) { + break; + } + } + } else { + title = ""; + } + if (pos >= max || state.src.charCodeAt(pos) !== 41 /* ) */) { + state.pos = oldPos; + return false; + } + pos++; + } else { + // Link reference + if (typeof state.env.references === "undefined") { + return false; + } + if (pos < max && state.src.charCodeAt(pos) === 91 /* [ */) { + start = pos + 1; + pos = state.md.helpers.parseLinkLabel(state, pos); + if (pos >= 0) { + label = state.src.slice(start, pos++); + } else { + pos = labelEnd + 1; + } + } else { + pos = labelEnd + 1; + } + // covers label === '' and label === undefined + // (collapsed reference link and shortcut reference link respectively) + if (!label) { + label = state.src.slice(labelStart, labelEnd); + } + ref = state.env.references[normalizeReference(label)]; + if (!ref) { + state.pos = oldPos; + return false; + } + href = ref.href; + title = ref.title; + } + + // We found the end of the link, and know for a fact it's a valid link; + // so all that's left to do is to call tokenizer. + + if (!silent) { + content = state.src.slice(labelStart, labelEnd); + state.md.inline.parse(content, state.md, state.env, tokens = []); + token = state.push("image", "img", 0); + token.attrs = attrs = [ [ "src", href ], [ "alt", "" ] ]; + token.children = tokens; + token.content = content; + if (title) { + attrs.push([ "title", title ]); + } + } + state.pos = pos; + state.posMax = max; + return true; + }; + // Process autolinks '<protocol:...>' + /*eslint max-len:0*/ var EMAIL_RE = /^([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)$/; + var AUTOLINK_RE = /^([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)$/; + var autolink = function autolink(state, silent) { + var url, fullUrl, token, ch, start, max, pos = state.pos; + if (state.src.charCodeAt(pos) !== 60 /* < */) { + return false; + } + start = state.pos; + max = state.posMax; + for (;;) { + if (++pos >= max) return false; + ch = state.src.charCodeAt(pos); + if (ch === 60 /* < */) return false; + if (ch === 62 /* > */) break; + } + url = state.src.slice(start + 1, pos); + if (AUTOLINK_RE.test(url)) { + fullUrl = state.md.normalizeLink(url); + if (!state.md.validateLink(fullUrl)) { + return false; + } + if (!silent) { + token = state.push("link_open", "a", 1); + token.attrs = [ [ "href", fullUrl ] ]; + token.markup = "autolink"; + token.info = "auto"; + token = state.push("text", "", 0); + token.content = state.md.normalizeLinkText(url); + token = state.push("link_close", "a", -1); + token.markup = "autolink"; + token.info = "auto"; + } + state.pos += url.length + 2; + return true; + } + if (EMAIL_RE.test(url)) { + fullUrl = state.md.normalizeLink("mailto:" + url); + if (!state.md.validateLink(fullUrl)) { + return false; + } + if (!silent) { + token = state.push("link_open", "a", 1); + token.attrs = [ [ "href", fullUrl ] ]; + token.markup = "autolink"; + token.info = "auto"; + token = state.push("text", "", 0); + token.content = state.md.normalizeLinkText(url); + token = state.push("link_close", "a", -1); + token.markup = "autolink"; + token.info = "auto"; + } + state.pos += url.length + 2; + return true; + } + return false; + }; + var HTML_TAG_RE = html_re.HTML_TAG_RE; + function isLetter(ch) { + /*eslint no-bitwise:0*/ + var lc = ch | 32; + // to lower case + return lc >= 97 /* a */ && lc <= 122 /* z */; + } + var html_inline = function html_inline(state, silent) { + var ch, match, max, token, pos = state.pos; + if (!state.md.options.html) { + return false; + } + // Check start + max = state.posMax; + if (state.src.charCodeAt(pos) !== 60 /* < */ || pos + 2 >= max) { + return false; + } + // Quick fail on second char + ch = state.src.charCodeAt(pos + 1); + if (ch !== 33 /* ! */ && ch !== 63 /* ? */ && ch !== 47 /* / */ && !isLetter(ch)) { + return false; + } + match = state.src.slice(pos).match(HTML_TAG_RE); + if (!match) { + return false; + } + if (!silent) { + token = state.push("html_inline", "", 0); + token.content = state.src.slice(pos, pos + match[0].length); + } + state.pos += match[0].length; + return true; + }; + var has = utils.has; + var isValidEntityCode = utils.isValidEntityCode; + var fromCodePoint = utils.fromCodePoint; + var DIGITAL_RE = /^&#((?:x[a-f0-9]{1,6}|[0-9]{1,7}));/i; + var NAMED_RE = /^&([a-z][a-z0-9]{1,31});/i; + var entity = function entity(state, silent) { + var ch, code, match, pos = state.pos, max = state.posMax; + if (state.src.charCodeAt(pos) !== 38 /* & */) { + return false; + } + if (pos + 1 < max) { + ch = state.src.charCodeAt(pos + 1); + if (ch === 35 /* # */) { + match = state.src.slice(pos).match(DIGITAL_RE); + if (match) { + if (!silent) { + code = match[1][0].toLowerCase() === "x" ? parseInt(match[1].slice(1), 16) : parseInt(match[1], 10); + state.pending += isValidEntityCode(code) ? fromCodePoint(code) : fromCodePoint(65533); + } + state.pos += match[0].length; + return true; + } + } else { + match = state.src.slice(pos).match(NAMED_RE); + if (match) { + if (has(entities, match[1])) { + if (!silent) { + state.pending += entities[match[1]]; + } + state.pos += match[0].length; + return true; + } + } + } + } + if (!silent) { + state.pending += "&"; + } + state.pos++; + return true; + }; + // For each opening emphasis-like marker find a matching closing one + function processDelimiters(state, delimiters) { + var closerIdx, openerIdx, closer, opener, minOpenerIdx, newMinOpenerIdx, isOddMatch, lastJump, openersBottom = {}, max = delimiters.length; + if (!max) return; + // headerIdx is the first delimiter of the current (where closer is) delimiter run + var headerIdx = 0; + var lastTokenIdx = -2; + // needs any value lower than -1 + var jumps = []; + for (closerIdx = 0; closerIdx < max; closerIdx++) { + closer = delimiters[closerIdx]; + jumps.push(0); + // markers belong to same delimiter run if: + // - they have adjacent tokens + // - AND markers are the same + + if (delimiters[headerIdx].marker !== closer.marker || lastTokenIdx !== closer.token - 1) { + headerIdx = closerIdx; + } + lastTokenIdx = closer.token; + // Length is only used for emphasis-specific "rule of 3", + // if it's not defined (in strikethrough or 3rd party plugins), + // we can default it to 0 to disable those checks. + + closer.length = closer.length || 0; + if (!closer.close) continue; + // Previously calculated lower bounds (previous fails) + // for each marker, each delimiter length modulo 3, + // and for whether this closer can be an opener; + // https://github.com/commonmark/cmark/commit/34250e12ccebdc6372b8b49c44fab57c72443460 + if (!openersBottom.hasOwnProperty(closer.marker)) { + openersBottom[closer.marker] = [ -1, -1, -1, -1, -1, -1 ]; + } + minOpenerIdx = openersBottom[closer.marker][(closer.open ? 3 : 0) + closer.length % 3]; + openerIdx = headerIdx - jumps[headerIdx] - 1; + newMinOpenerIdx = openerIdx; + for (;openerIdx > minOpenerIdx; openerIdx -= jumps[openerIdx] + 1) { + opener = delimiters[openerIdx]; + if (opener.marker !== closer.marker) continue; + if (opener.open && opener.end < 0) { + isOddMatch = false; + // from spec: + + // If one of the delimiters can both open and close emphasis, then the + // sum of the lengths of the delimiter runs containing the opening and + // closing delimiters must not be a multiple of 3 unless both lengths + // are multiples of 3. + + if (opener.close || closer.open) { + if ((opener.length + closer.length) % 3 === 0) { + if (opener.length % 3 !== 0 || closer.length % 3 !== 0) { + isOddMatch = true; + } + } + } + if (!isOddMatch) { + // If previous delimiter cannot be an opener, we can safely skip + // the entire sequence in future checks. This is required to make + // sure algorithm has linear complexity (see *_*_*_*_*_... case). + lastJump = openerIdx > 0 && !delimiters[openerIdx - 1].open ? jumps[openerIdx - 1] + 1 : 0; + jumps[closerIdx] = closerIdx - openerIdx + lastJump; + jumps[openerIdx] = lastJump; + closer.open = false; + opener.end = closerIdx; + opener.close = false; + newMinOpenerIdx = -1; + // treat next token as start of run, + // it optimizes skips in **<...>**a**<...>** pathological case + lastTokenIdx = -2; + break; + } + } + } + if (newMinOpenerIdx !== -1) { + // If match for this delimiter run failed, we want to set lower bound for + // future lookups. This is required to make sure algorithm has linear + // complexity. + // See details here: + // https://github.com/commonmark/cmark/issues/178#issuecomment-270417442 + openersBottom[closer.marker][(closer.open ? 3 : 0) + (closer.length || 0) % 3] = newMinOpenerIdx; + } + } + } + var balance_pairs = function link_pairs(state) { + var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length; + processDelimiters(state, state.delimiters); + for (curr = 0; curr < max; curr++) { + if (tokens_meta[curr] && tokens_meta[curr].delimiters) { + processDelimiters(state, tokens_meta[curr].delimiters); + } + } + }; + // Clean up tokens after emphasis and strikethrough postprocessing: + var text_collapse = function text_collapse(state) { + var curr, last, level = 0, tokens = state.tokens, max = state.tokens.length; + for (curr = last = 0; curr < max; curr++) { + // re-calculate levels after emphasis/strikethrough turns some text nodes + // into opening/closing tags + if (tokens[curr].nesting < 0) level--; + // closing tag + tokens[curr].level = level; + if (tokens[curr].nesting > 0) level++; + // opening tag + if (tokens[curr].type === "text" && curr + 1 < max && tokens[curr + 1].type === "text") { + // collapse two adjacent text nodes + tokens[curr + 1].content = tokens[curr].content + tokens[curr + 1].content; + } else { + if (curr !== last) { + tokens[last] = tokens[curr]; + } + last++; + } + } + if (curr !== last) { + tokens.length = last; + } + }; + var isWhiteSpace = utils.isWhiteSpace; + var isPunctChar = utils.isPunctChar; + var isMdAsciiPunct = utils.isMdAsciiPunct; + function StateInline(src, md, env, outTokens) { + this.src = src; + this.env = env; + this.md = md; + this.tokens = outTokens; + this.tokens_meta = Array(outTokens.length); + this.pos = 0; + this.posMax = this.src.length; + this.level = 0; + this.pending = ""; + this.pendingLevel = 0; + // Stores { start: end } pairs. Useful for backtrack + // optimization of pairs parse (emphasis, strikes). + this.cache = {}; + // List of emphasis-like delimiters for current tag + this.delimiters = []; + // Stack of delimiter lists for upper level tags + this._prev_delimiters = []; + // backtick length => last seen position + this.backticks = {}; + this.backticksScanned = false; + } + // Flush pending text + + StateInline.prototype.pushPending = function() { + var token$1 = new token("text", "", 0); + token$1.content = this.pending; + token$1.level = this.pendingLevel; + this.tokens.push(token$1); + this.pending = ""; + return token$1; + }; + // Push new token to "stream". + // If pending text exists - flush it as text token + + StateInline.prototype.push = function(type, tag, nesting) { + if (this.pending) { + this.pushPending(); + } + var token$1 = new token(type, tag, nesting); + var token_meta = null; + if (nesting < 0) { + // closing tag + this.level--; + this.delimiters = this._prev_delimiters.pop(); + } + token$1.level = this.level; + if (nesting > 0) { + // opening tag + this.level++; + this._prev_delimiters.push(this.delimiters); + this.delimiters = []; + token_meta = { + delimiters: this.delimiters + }; + } + this.pendingLevel = this.level; + this.tokens.push(token$1); + this.tokens_meta.push(token_meta); + return token$1; + }; + // Scan a sequence of emphasis-like markers, and determine whether + // it can start an emphasis sequence or end an emphasis sequence. + + // - start - position to scan from (it should point at a valid marker); + // - canSplitWord - determine if these markers can be found inside a word + + StateInline.prototype.scanDelims = function(start, canSplitWord) { + var pos = start, lastChar, nextChar, count, can_open, can_close, isLastWhiteSpace, isLastPunctChar, isNextWhiteSpace, isNextPunctChar, left_flanking = true, right_flanking = true, max = this.posMax, marker = this.src.charCodeAt(start); + // treat beginning of the line as a whitespace + lastChar = start > 0 ? this.src.charCodeAt(start - 1) : 32; + while (pos < max && this.src.charCodeAt(pos) === marker) { + pos++; + } + count = pos - start; + // treat end of the line as a whitespace + nextChar = pos < max ? this.src.charCodeAt(pos) : 32; + isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar)); + isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar)); + isLastWhiteSpace = isWhiteSpace(lastChar); + isNextWhiteSpace = isWhiteSpace(nextChar); + if (isNextWhiteSpace) { + left_flanking = false; + } else if (isNextPunctChar) { + if (!(isLastWhiteSpace || isLastPunctChar)) { + left_flanking = false; + } + } + if (isLastWhiteSpace) { + right_flanking = false; + } else if (isLastPunctChar) { + if (!(isNextWhiteSpace || isNextPunctChar)) { + right_flanking = false; + } + } + if (!canSplitWord) { + can_open = left_flanking && (!right_flanking || isLastPunctChar); + can_close = right_flanking && (!left_flanking || isNextPunctChar); + } else { + can_open = left_flanking; + can_close = right_flanking; + } + return { + can_open: can_open, + can_close: can_close, + length: count + }; + }; + // re-export Token class to use in block rules + StateInline.prototype.Token = token; + var state_inline = StateInline; + //////////////////////////////////////////////////////////////////////////////// + // Parser rules + var _rules = [ [ "text", text ], [ "newline", newline ], [ "escape", _escape ], [ "backticks", backticks ], [ "strikethrough", strikethrough.tokenize ], [ "emphasis", emphasis.tokenize ], [ "link", link ], [ "image", image ], [ "autolink", autolink ], [ "html_inline", html_inline ], [ "entity", entity ] ]; + var _rules2 = [ [ "balance_pairs", balance_pairs ], [ "strikethrough", strikethrough.postProcess ], [ "emphasis", emphasis.postProcess ], [ "text_collapse", text_collapse ] ]; + /** + * new ParserInline() + **/ function ParserInline() { + var i; + /** + * ParserInline#ruler -> Ruler + * + * [[Ruler]] instance. Keep configuration of inline rules. + **/ this.ruler = new ruler; + for (i = 0; i < _rules.length; i++) { + this.ruler.push(_rules[i][0], _rules[i][1]); + } + /** + * ParserInline#ruler2 -> Ruler + * + * [[Ruler]] instance. Second ruler used for post-processing + * (e.g. in emphasis-like rules). + **/ this.ruler2 = new ruler; + for (i = 0; i < _rules2.length; i++) { + this.ruler2.push(_rules2[i][0], _rules2[i][1]); + } + } + // Skip single token by running all rules in validation mode; + // returns `true` if any rule reported success + + ParserInline.prototype.skipToken = function(state) { + var ok, i, pos = state.pos, rules = this.ruler.getRules(""), len = rules.length, maxNesting = state.md.options.maxNesting, cache = state.cache; + if (typeof cache[pos] !== "undefined") { + state.pos = cache[pos]; + return; + } + if (state.level < maxNesting) { + for (i = 0; i < len; i++) { + // Increment state.level and decrement it later to limit recursion. + // It's harmless to do here, because no tokens are created. But ideally, + // we'd need a separate private state variable for this purpose. + state.level++; + ok = rules[i](state, true); + state.level--; + if (ok) { + break; + } + } + } else { + // Too much nesting, just skip until the end of the paragraph. + // NOTE: this will cause links to behave incorrectly in the following case, + // when an amount of `[` is exactly equal to `maxNesting + 1`: + // [[[[[[[[[[[[[[[[[[[[[foo]() + // TODO: remove this workaround when CM standard will allow nested links + // (we can replace it by preventing links from being parsed in + // validation mode) + state.pos = state.posMax; + } + if (!ok) { + state.pos++; + } + cache[pos] = state.pos; + }; + // Generate tokens for input range + + ParserInline.prototype.tokenize = function(state) { + var ok, i, rules = this.ruler.getRules(""), len = rules.length, end = state.posMax, maxNesting = state.md.options.maxNesting; + while (state.pos < end) { + // Try all possible rules. + // On success, rule should: + // - update `state.pos` + // - update `state.tokens` + // - return true + if (state.level < maxNesting) { + for (i = 0; i < len; i++) { + ok = rules[i](state, false); + if (ok) { + break; + } + } + } + if (ok) { + if (state.pos >= end) { + break; + } + continue; + } + state.pending += state.src[state.pos++]; + } + if (state.pending) { + state.pushPending(); + } + }; + /** + * ParserInline.parse(str, md, env, outTokens) + * + * Process input string and push inline tokens into `outTokens` + **/ ParserInline.prototype.parse = function(str, md, env, outTokens) { + var i, rules, len; + var state = new this.State(str, md, env, outTokens); + this.tokenize(state); + rules = this.ruler2.getRules(""); + len = rules.length; + for (i = 0; i < len; i++) { + rules[i](state); + } + }; + ParserInline.prototype.State = state_inline; + var parser_inline = ParserInline; + var re = function(opts) { + var re = {}; + // Use direct extract instead of `regenerate` to reduse browserified size + re.src_Any = regex$3.source; + re.src_Cc = regex$2.source; + re.src_Z = regex.source; + re.src_P = regex$4.source; + // \p{\Z\P\Cc\CF} (white spaces + control + format + punctuation) + re.src_ZPCc = [ re.src_Z, re.src_P, re.src_Cc ].join("|"); + // \p{\Z\Cc} (white spaces + control) + re.src_ZCc = [ re.src_Z, re.src_Cc ].join("|"); + // Experimental. List of chars, completely prohibited in links + // because can separate it from other part of text + var text_separators = "[><\uff5c]"; + // All possible word characters (everything without punctuation, spaces & controls) + // Defined via punctuation & spaces to save space + // Should be something like \p{\L\N\S\M} (\w but without `_`) + re.src_pseudo_letter = "(?:(?!" + text_separators + "|" + re.src_ZPCc + ")" + re.src_Any + ")"; + // The same as abothe but without [0-9] + // var src_pseudo_letter_non_d = '(?:(?![0-9]|' + src_ZPCc + ')' + src_Any + ')'; + //////////////////////////////////////////////////////////////////////////////// + re.src_ip4 = "(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)"; + // Prohibit any of "@/[]()" in user/pass to avoid wrong domain fetch. + re.src_auth = "(?:(?:(?!" + re.src_ZCc + "|[@/\\[\\]()]).)+@)?"; + re.src_port = "(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?"; + re.src_host_terminator = "(?=$|" + text_separators + "|" + re.src_ZPCc + ")(?!-|_|:\\d|\\.-|\\.(?!$|" + re.src_ZPCc + "))"; + re.src_path = "(?:" + "[/?#]" + "(?:" + "(?!" + re.src_ZCc + "|" + text_separators + "|[()[\\]{}.,\"'?!\\-;]).|" + "\\[(?:(?!" + re.src_ZCc + "|\\]).)*\\]|" + "\\((?:(?!" + re.src_ZCc + "|[)]).)*\\)|" + "\\{(?:(?!" + re.src_ZCc + "|[}]).)*\\}|" + '\\"(?:(?!' + re.src_ZCc + '|["]).)+\\"|' + "\\'(?:(?!" + re.src_ZCc + "|[']).)+\\'|" + "\\'(?=" + re.src_pseudo_letter + "|[-]).|" + // allow `I'm_king` if no pair found + "\\.{2,}[a-zA-Z0-9%/&]|" + // google has many dots in "google search" links (#66, #81). + // github has ... in commit range links, + // Restrict to + // - english + // - percent-encoded + // - parts of file path + // - params separator + // until more examples found. + "\\.(?!" + re.src_ZCc + "|[.]).|" + (opts && opts["---"] ? "\\-(?!--(?:[^-]|$))(?:-*)|" : "\\-+|") + ",(?!" + re.src_ZCc + ").|" + // allow `,,,` in paths + ";(?!" + re.src_ZCc + ").|" + // allow `;` if not followed by space-like char + "\\!+(?!" + re.src_ZCc + "|[!]).|" + // allow `!!!` in paths, but not at the end + "\\?(?!" + re.src_ZCc + "|[?])." + ")+" + "|\\/" + ")?"; + // Allow anything in markdown spec, forbid quote (") at the first position + // because emails enclosed in quotes are far more common + re.src_email_name = '[\\-;:&=\\+\\$,\\.a-zA-Z0-9_][\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]*'; + re.src_xn = "xn--[a-z0-9\\-]{1,59}"; + // More to read about domain names + // http://serverfault.com/questions/638260/ + re.src_domain_root = + // Allow letters & digits (http://test1) + "(?:" + re.src_xn + "|" + re.src_pseudo_letter + "{1,63}" + ")"; + re.src_domain = "(?:" + re.src_xn + "|" + "(?:" + re.src_pseudo_letter + ")" + "|" + "(?:" + re.src_pseudo_letter + "(?:-|" + re.src_pseudo_letter + "){0,61}" + re.src_pseudo_letter + ")" + ")"; + re.src_host = "(?:" + + // Don't need IP check, because digits are already allowed in normal domain names + // src_ip4 + + // '|' + + "(?:(?:(?:" + re.src_domain + ")\\.)*" + re.src_domain /*_root*/ + ")" + ")"; + re.tpl_host_fuzzy = "(?:" + re.src_ip4 + "|" + "(?:(?:(?:" + re.src_domain + ")\\.)+(?:%TLDS%))" + ")"; + re.tpl_host_no_ip_fuzzy = "(?:(?:(?:" + re.src_domain + ")\\.)+(?:%TLDS%))"; + re.src_host_strict = re.src_host + re.src_host_terminator; + re.tpl_host_fuzzy_strict = re.tpl_host_fuzzy + re.src_host_terminator; + re.src_host_port_strict = re.src_host + re.src_port + re.src_host_terminator; + re.tpl_host_port_fuzzy_strict = re.tpl_host_fuzzy + re.src_port + re.src_host_terminator; + re.tpl_host_port_no_ip_fuzzy_strict = re.tpl_host_no_ip_fuzzy + re.src_port + re.src_host_terminator; + //////////////////////////////////////////////////////////////////////////////// + // Main rules + // Rude test fuzzy links by host, for quick deny + re.tpl_host_fuzzy_test = "localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:" + re.src_ZPCc + "|>|$))"; + re.tpl_email_fuzzy = "(^|" + text_separators + '|"|\\(|' + re.src_ZCc + ")" + "(" + re.src_email_name + "@" + re.tpl_host_fuzzy_strict + ")"; + re.tpl_link_fuzzy = + // Fuzzy link can't be prepended with .:/\- and non punctuation. + // but can start with > (markdown blockquote) + "(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|" + re.src_ZPCc + "))" + "((?![$+<=>^`|\uff5c])" + re.tpl_host_port_fuzzy_strict + re.src_path + ")"; + re.tpl_link_no_ip_fuzzy = + // Fuzzy link can't be prepended with .:/\- and non punctuation. + // but can start with > (markdown blockquote) + "(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|" + re.src_ZPCc + "))" + "((?![$+<=>^`|\uff5c])" + re.tpl_host_port_no_ip_fuzzy_strict + re.src_path + ")"; + return re; + }; + //////////////////////////////////////////////////////////////////////////////// + // Helpers + // Merge objects + + function assign(obj /*from1, from2, from3, ...*/) { + var sources = Array.prototype.slice.call(arguments, 1); + sources.forEach((function(source) { + if (!source) { + return; + } + Object.keys(source).forEach((function(key) { + obj[key] = source[key]; + })); + })); + return obj; + } + function _class(obj) { + return Object.prototype.toString.call(obj); + } + function isString(obj) { + return _class(obj) === "[object String]"; + } + function isObject(obj) { + return _class(obj) === "[object Object]"; + } + function isRegExp(obj) { + return _class(obj) === "[object RegExp]"; + } + function isFunction(obj) { + return _class(obj) === "[object Function]"; + } + function escapeRE(str) { + return str.replace(/[.?*+^$[\]\\(){}|-]/g, "\\$&"); + } + //////////////////////////////////////////////////////////////////////////////// + var defaultOptions = { + fuzzyLink: true, + fuzzyEmail: true, + fuzzyIP: false + }; + function isOptionsObj(obj) { + return Object.keys(obj || {}).reduce((function(acc, k) { + return acc || defaultOptions.hasOwnProperty(k); + }), false); + } + var defaultSchemas = { + "http:": { + validate: function(text, pos, self) { + var tail = text.slice(pos); + if (!self.re.http) { + // compile lazily, because "host"-containing variables can change on tlds update. + self.re.http = new RegExp("^\\/\\/" + self.re.src_auth + self.re.src_host_port_strict + self.re.src_path, "i"); + } + if (self.re.http.test(tail)) { + return tail.match(self.re.http)[0].length; + } + return 0; + } + }, + "https:": "http:", + "ftp:": "http:", + "//": { + validate: function(text, pos, self) { + var tail = text.slice(pos); + if (!self.re.no_http) { + // compile lazily, because "host"-containing variables can change on tlds update. + self.re.no_http = new RegExp("^" + self.re.src_auth + + // Don't allow single-level domains, because of false positives like '//test' + // with code comments + "(?:localhost|(?:(?:" + self.re.src_domain + ")\\.)+" + self.re.src_domain_root + ")" + self.re.src_port + self.re.src_host_terminator + self.re.src_path, "i"); + } + if (self.re.no_http.test(tail)) { + // should not be `://` & `///`, that protects from errors in protocol name + if (pos >= 3 && text[pos - 3] === ":") { + return 0; + } + if (pos >= 3 && text[pos - 3] === "/") { + return 0; + } + return tail.match(self.re.no_http)[0].length; + } + return 0; + } + }, + "mailto:": { + validate: function(text, pos, self) { + var tail = text.slice(pos); + if (!self.re.mailto) { + self.re.mailto = new RegExp("^" + self.re.src_email_name + "@" + self.re.src_host_strict, "i"); + } + if (self.re.mailto.test(tail)) { + return tail.match(self.re.mailto)[0].length; + } + return 0; + } + } + }; + /*eslint-disable max-len*/ + // RE pattern for 2-character tlds (autogenerated by ./support/tlds_2char_gen.js) + var tlds_2ch_src_re = "a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]"; + // DON'T try to make PRs with changes. Extend TLDs with LinkifyIt.tlds() instead + var tlds_default = "biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|\u0440\u0444".split("|"); + /*eslint-enable max-len*/ + //////////////////////////////////////////////////////////////////////////////// + function resetScanCache(self) { + self.__index__ = -1; + self.__text_cache__ = ""; + } + function createValidator(re) { + return function(text, pos) { + var tail = text.slice(pos); + if (re.test(tail)) { + return tail.match(re)[0].length; + } + return 0; + }; + } + function createNormalizer() { + return function(match, self) { + self.normalize(match); + }; + } + // Schemas compiler. Build regexps. + + function compile(self) { + // Load & clone RE patterns. + var re$1 = self.re = re(self.__opts__); + // Define dynamic patterns + var tlds = self.__tlds__.slice(); + self.onCompile(); + if (!self.__tlds_replaced__) { + tlds.push(tlds_2ch_src_re); + } + tlds.push(re$1.src_xn); + re$1.src_tlds = tlds.join("|"); + function untpl(tpl) { + return tpl.replace("%TLDS%", re$1.src_tlds); + } + re$1.email_fuzzy = RegExp(untpl(re$1.tpl_email_fuzzy), "i"); + re$1.link_fuzzy = RegExp(untpl(re$1.tpl_link_fuzzy), "i"); + re$1.link_no_ip_fuzzy = RegExp(untpl(re$1.tpl_link_no_ip_fuzzy), "i"); + re$1.host_fuzzy_test = RegExp(untpl(re$1.tpl_host_fuzzy_test), "i"); + + // Compile each schema + + var aliases = []; + self.__compiled__ = {}; + // Reset compiled data + function schemaError(name, val) { + throw new Error('(LinkifyIt) Invalid schema "' + name + '": ' + val); + } + Object.keys(self.__schemas__).forEach((function(name) { + var val = self.__schemas__[name]; + // skip disabled methods + if (val === null) { + return; + } + var compiled = { + validate: null, + link: null + }; + self.__compiled__[name] = compiled; + if (isObject(val)) { + if (isRegExp(val.validate)) { + compiled.validate = createValidator(val.validate); + } else if (isFunction(val.validate)) { + compiled.validate = val.validate; + } else { + schemaError(name, val); + } + if (isFunction(val.normalize)) { + compiled.normalize = val.normalize; + } else if (!val.normalize) { + compiled.normalize = createNormalizer(); + } else { + schemaError(name, val); + } + return; + } + if (isString(val)) { + aliases.push(name); + return; + } + schemaError(name, val); + })); + + // Compile postponed aliases + + aliases.forEach((function(alias) { + if (!self.__compiled__[self.__schemas__[alias]]) { + // Silently fail on missed schemas to avoid errons on disable. + // schemaError(alias, self.__schemas__[alias]); + return; + } + self.__compiled__[alias].validate = self.__compiled__[self.__schemas__[alias]].validate; + self.__compiled__[alias].normalize = self.__compiled__[self.__schemas__[alias]].normalize; + })); + + // Fake record for guessed links + + self.__compiled__[""] = { + validate: null, + normalize: createNormalizer() + }; + + // Build schema condition + + var slist = Object.keys(self.__compiled__).filter((function(name) { + // Filter disabled & fake schemas + return name.length > 0 && self.__compiled__[name]; + })).map(escapeRE).join("|"); + // (?!_) cause 1.5x slowdown + self.re.schema_test = RegExp("(^|(?!_)(?:[><\uff5c]|" + re$1.src_ZPCc + "))(" + slist + ")", "i"); + self.re.schema_search = RegExp("(^|(?!_)(?:[><\uff5c]|" + re$1.src_ZPCc + "))(" + slist + ")", "ig"); + self.re.pretest = RegExp("(" + self.re.schema_test.source + ")|(" + self.re.host_fuzzy_test.source + ")|@", "i"); + + // Cleanup + + resetScanCache(self); + } + /** + * class Match + * + * Match result. Single element of array, returned by [[LinkifyIt#match]] + **/ function Match(self, shift) { + var start = self.__index__, end = self.__last_index__, text = self.__text_cache__.slice(start, end); + /** + * Match#schema -> String + * + * Prefix (protocol) for matched string. + **/ this.schema = self.__schema__.toLowerCase(); + /** + * Match#index -> Number + * + * First position of matched string. + **/ this.index = start + shift; + /** + * Match#lastIndex -> Number + * + * Next position after matched string. + **/ this.lastIndex = end + shift; + /** + * Match#raw -> String + * + * Matched string. + **/ this.raw = text; + /** + * Match#text -> String + * + * Notmalized text of matched string. + **/ this.text = text; + /** + * Match#url -> String + * + * Normalized url of matched string. + **/ this.url = text; + } + function createMatch(self, shift) { + var match = new Match(self, shift); + self.__compiled__[match.schema].normalize(match, self); + return match; + } + /** + * class LinkifyIt + **/ + /** + * new LinkifyIt(schemas, options) + * - schemas (Object): Optional. Additional schemas to validate (prefix/validator) + * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false } + * + * Creates new linkifier instance with optional additional schemas. + * Can be called without `new` keyword for convenience. + * + * By default understands: + * + * - `http(s)://...` , `ftp://...`, `mailto:...` & `//...` links + * - "fuzzy" links and emails (example.com, foo@bar.com). + * + * `schemas` is an object, where each key/value describes protocol/rule: + * + * - __key__ - link prefix (usually, protocol name with `:` at the end, `skype:` + * for example). `linkify-it` makes shure that prefix is not preceeded with + * alphanumeric char and symbols. Only whitespaces and punctuation allowed. + * - __value__ - rule to check tail after link prefix + * - _String_ - just alias to existing rule + * - _Object_ + * - _validate_ - validator function (should return matched length on success), + * or `RegExp`. + * - _normalize_ - optional function to normalize text & url of matched result + * (for example, for @twitter mentions). + * + * `options`: + * + * - __fuzzyLink__ - recognige URL-s without `http(s):` prefix. Default `true`. + * - __fuzzyIP__ - allow IPs in fuzzy links above. Can conflict with some texts + * like version numbers. Default `false`. + * - __fuzzyEmail__ - recognize emails without `mailto:` prefix. + * + **/ function LinkifyIt(schemas, options) { + if (!(this instanceof LinkifyIt)) { + return new LinkifyIt(schemas, options); + } + if (!options) { + if (isOptionsObj(schemas)) { + options = schemas; + schemas = {}; + } + } + this.__opts__ = assign({}, defaultOptions, options); + // Cache last tested result. Used to skip repeating steps on next `match` call. + this.__index__ = -1; + this.__last_index__ = -1; + // Next scan position + this.__schema__ = ""; + this.__text_cache__ = ""; + this.__schemas__ = assign({}, defaultSchemas, schemas); + this.__compiled__ = {}; + this.__tlds__ = tlds_default; + this.__tlds_replaced__ = false; + this.re = {}; + compile(this); + } + /** chainable + * LinkifyIt#add(schema, definition) + * - schema (String): rule name (fixed pattern prefix) + * - definition (String|RegExp|Object): schema definition + * + * Add new rule definition. See constructor description for details. + **/ LinkifyIt.prototype.add = function add(schema, definition) { + this.__schemas__[schema] = definition; + compile(this); + return this; + }; + /** chainable + * LinkifyIt#set(options) + * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false } + * + * Set recognition options for links without schema. + **/ LinkifyIt.prototype.set = function set(options) { + this.__opts__ = assign(this.__opts__, options); + return this; + }; + /** + * LinkifyIt#test(text) -> Boolean + * + * Searches linkifiable pattern and returns `true` on success or `false` on fail. + **/ LinkifyIt.prototype.test = function test(text) { + // Reset scan cache + this.__text_cache__ = text; + this.__index__ = -1; + if (!text.length) { + return false; + } + var m, ml, me, len, shift, next, re, tld_pos, at_pos; + // try to scan for link with schema - that's the most simple rule + if (this.re.schema_test.test(text)) { + re = this.re.schema_search; + re.lastIndex = 0; + while ((m = re.exec(text)) !== null) { + len = this.testSchemaAt(text, m[2], re.lastIndex); + if (len) { + this.__schema__ = m[2]; + this.__index__ = m.index + m[1].length; + this.__last_index__ = m.index + m[0].length + len; + break; + } + } + } + if (this.__opts__.fuzzyLink && this.__compiled__["http:"]) { + // guess schemaless links + tld_pos = text.search(this.re.host_fuzzy_test); + if (tld_pos >= 0) { + // if tld is located after found link - no need to check fuzzy pattern + if (this.__index__ < 0 || tld_pos < this.__index__) { + if ((ml = text.match(this.__opts__.fuzzyIP ? this.re.link_fuzzy : this.re.link_no_ip_fuzzy)) !== null) { + shift = ml.index + ml[1].length; + if (this.__index__ < 0 || shift < this.__index__) { + this.__schema__ = ""; + this.__index__ = shift; + this.__last_index__ = ml.index + ml[0].length; + } + } + } + } + } + if (this.__opts__.fuzzyEmail && this.__compiled__["mailto:"]) { + // guess schemaless emails + at_pos = text.indexOf("@"); + if (at_pos >= 0) { + // We can't skip this check, because this cases are possible: + // 192.168.1.1@gmail.com, my.in@example.com + if ((me = text.match(this.re.email_fuzzy)) !== null) { + shift = me.index + me[1].length; + next = me.index + me[0].length; + if (this.__index__ < 0 || shift < this.__index__ || shift === this.__index__ && next > this.__last_index__) { + this.__schema__ = "mailto:"; + this.__index__ = shift; + this.__last_index__ = next; + } + } + } + } + return this.__index__ >= 0; + }; + /** + * LinkifyIt#pretest(text) -> Boolean + * + * Very quick check, that can give false positives. Returns true if link MAY BE + * can exists. Can be used for speed optimization, when you need to check that + * link NOT exists. + **/ LinkifyIt.prototype.pretest = function pretest(text) { + return this.re.pretest.test(text); + }; + /** + * LinkifyIt#testSchemaAt(text, name, position) -> Number + * - text (String): text to scan + * - name (String): rule (schema) name + * - position (Number): text offset to check from + * + * Similar to [[LinkifyIt#test]] but checks only specific protocol tail exactly + * at given position. Returns length of found pattern (0 on fail). + **/ LinkifyIt.prototype.testSchemaAt = function testSchemaAt(text, schema, pos) { + // If not supported schema check requested - terminate + if (!this.__compiled__[schema.toLowerCase()]) { + return 0; + } + return this.__compiled__[schema.toLowerCase()].validate(text, pos, this); + }; + /** + * LinkifyIt#match(text) -> Array|null + * + * Returns array of found link descriptions or `null` on fail. We strongly + * recommend to use [[LinkifyIt#test]] first, for best speed. + * + * ##### Result match description + * + * - __schema__ - link schema, can be empty for fuzzy links, or `//` for + * protocol-neutral links. + * - __index__ - offset of matched text + * - __lastIndex__ - index of next char after mathch end + * - __raw__ - matched text + * - __text__ - normalized text + * - __url__ - link, generated from matched text + **/ LinkifyIt.prototype.match = function match(text) { + var shift = 0, result = []; + // Try to take previous element from cache, if .test() called before + if (this.__index__ >= 0 && this.__text_cache__ === text) { + result.push(createMatch(this, shift)); + shift = this.__last_index__; + } + // Cut head if cache was used + var tail = shift ? text.slice(shift) : text; + // Scan string until end reached + while (this.test(tail)) { + result.push(createMatch(this, shift)); + tail = tail.slice(this.__last_index__); + shift += this.__last_index__; + } + if (result.length) { + return result; + } + return null; + }; + /** chainable + * LinkifyIt#tlds(list [, keepOld]) -> this + * - list (Array): list of tlds + * - keepOld (Boolean): merge with current list if `true` (`false` by default) + * + * Load (or merge) new tlds list. Those are user for fuzzy links (without prefix) + * to avoid false positives. By default this algorythm used: + * + * - hostname with any 2-letter root zones are ok. + * - biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|рф + * are ok. + * - encoded (`xn--...`) root zones are ok. + * + * If list is replaced, then exact match for 2-chars root zones will be checked. + **/ LinkifyIt.prototype.tlds = function tlds(list, keepOld) { + list = Array.isArray(list) ? list : [ list ]; + if (!keepOld) { + this.__tlds__ = list.slice(); + this.__tlds_replaced__ = true; + compile(this); + return this; + } + this.__tlds__ = this.__tlds__.concat(list).sort().filter((function(el, idx, arr) { + return el !== arr[idx - 1]; + })).reverse(); + compile(this); + return this; + }; + /** + * LinkifyIt#normalize(match) + * + * Default normalizer (if schema does not define it's own). + **/ LinkifyIt.prototype.normalize = function normalize(match) { + // Do minimal possible changes by default. Need to collect feedback prior + // to move forward https://github.com/markdown-it/linkify-it/issues/1 + if (!match.schema) { + match.url = "http://" + match.url; + } + if (match.schema === "mailto:" && !/^mailto:/i.test(match.url)) { + match.url = "mailto:" + match.url; + } + }; + /** + * LinkifyIt#onCompile() + * + * Override to modify basic RegExp-s. + **/ LinkifyIt.prototype.onCompile = function onCompile() {}; + var linkifyIt = LinkifyIt; + /*! https://mths.be/punycode v1.4.1 by @mathias */ + /** Highest positive signed 32-bit float value */ var maxInt = 2147483647; + // aka. 0x7FFFFFFF or 2^31-1 + /** Bootstring parameters */ var base = 36; + var tMin = 1; + var tMax = 26; + var skew = 38; + var damp = 700; + var initialBias = 72; + var initialN = 128; + // 0x80 + var delimiter = "-"; + // '\x2D' + /** Regular expressions */ var regexPunycode = /^xn--/; + var regexNonASCII = /[^\x20-\x7E]/; + // unprintable ASCII chars + non-ASCII chars + var regexSeparators = /[\x2E\u3002\uFF0E\uFF61]/g; + // RFC 3490 separators + /** Error messages */ var errors = { + overflow: "Overflow: input needs wider integers to process", + "not-basic": "Illegal input >= 0x80 (not a basic code point)", + "invalid-input": "Invalid input" + }; + /** Convenience shortcuts */ var baseMinusTMin = base - tMin; + var floor = Math.floor; + var stringFromCharCode = String.fromCharCode; + /*--------------------------------------------------------------------------*/ + /** + * A generic error utility function. + * @private + * @param {String} type The error type. + * @returns {Error} Throws a `RangeError` with the applicable error message. + */ function error(type) { + throw new RangeError(errors[type]); + } + /** + * A generic `Array#map` utility function. + * @private + * @param {Array} array The array to iterate over. + * @param {Function} callback The function that gets called for every array + * item. + * @returns {Array} A new array of values returned by the callback function. + */ function map(array, fn) { + var length = array.length; + var result = []; + while (length--) { + result[length] = fn(array[length]); + } + return result; + } + /** + * A simple `Array#map`-like wrapper to work with domain name strings or email + * addresses. + * @private + * @param {String} domain The domain name or email address. + * @param {Function} callback The function that gets called for every + * character. + * @returns {Array} A new string of characters returned by the callback + * function. + */ function mapDomain(string, fn) { + var parts = string.split("@"); + var result = ""; + if (parts.length > 1) { + // In email addresses, only the domain name should be punycoded. Leave + // the local part (i.e. everything up to `@`) intact. + result = parts[0] + "@"; + string = parts[1]; + } + // Avoid `split(regex)` for IE8 compatibility. See #17. + string = string.replace(regexSeparators, "."); + var labels = string.split("."); + var encoded = map(labels, fn).join("."); + return result + encoded; + } + /** + * Creates an array containing the numeric code points of each Unicode + * character in the string. While JavaScript uses UCS-2 internally, + * this function will convert a pair of surrogate halves (each of which + * UCS-2 exposes as separate characters) into a single code point, + * matching UTF-16. + * @see `punycode.ucs2.encode` + * @see <https://mathiasbynens.be/notes/javascript-encoding> + * @memberOf punycode.ucs2 + * @name decode + * @param {String} string The Unicode input string (UCS-2). + * @returns {Array} The new array of code points. + */ function ucs2decode(string) { + var output = [], counter = 0, length = string.length, value, extra; + while (counter < length) { + value = string.charCodeAt(counter++); + if (value >= 55296 && value <= 56319 && counter < length) { + // high surrogate, and there is a next character + extra = string.charCodeAt(counter++); + if ((extra & 64512) == 56320) { + // low surrogate + output.push(((value & 1023) << 10) + (extra & 1023) + 65536); + } else { + // unmatched surrogate; only append this code unit, in case the next + // code unit is the high surrogate of a surrogate pair + output.push(value); + counter--; + } + } else { + output.push(value); + } + } + return output; + } + /** + * Creates a string based on an array of numeric code points. + * @see `punycode.ucs2.decode` + * @memberOf punycode.ucs2 + * @name encode + * @param {Array} codePoints The array of numeric code points. + * @returns {String} The new Unicode string (UCS-2). + */ function ucs2encode(array) { + return map(array, (function(value) { + var output = ""; + if (value > 65535) { + value -= 65536; + output += stringFromCharCode(value >>> 10 & 1023 | 55296); + value = 56320 | value & 1023; + } + output += stringFromCharCode(value); + return output; + })).join(""); + } + /** + * Converts a basic code point into a digit/integer. + * @see `digitToBasic()` + * @private + * @param {Number} codePoint The basic numeric code point value. + * @returns {Number} The numeric value of a basic code point (for use in + * representing integers) in the range `0` to `base - 1`, or `base` if + * the code point does not represent a value. + */ function basicToDigit(codePoint) { + if (codePoint - 48 < 10) { + return codePoint - 22; + } + if (codePoint - 65 < 26) { + return codePoint - 65; + } + if (codePoint - 97 < 26) { + return codePoint - 97; + } + return base; + } + /** + * Converts a digit/integer into a basic code point. + * @see `basicToDigit()` + * @private + * @param {Number} digit The numeric value of a basic code point. + * @returns {Number} The basic code point whose value (when used for + * representing integers) is `digit`, which needs to be in the range + * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is + * used; else, the lowercase form is used. The behavior is undefined + * if `flag` is non-zero and `digit` has no uppercase form. + */ function digitToBasic(digit, flag) { + // 0..25 map to ASCII a..z or A..Z + // 26..35 map to ASCII 0..9 + return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5); + } + /** + * Bias adaptation function as per section 3.4 of RFC 3492. + * https://tools.ietf.org/html/rfc3492#section-3.4 + * @private + */ function adapt(delta, numPoints, firstTime) { + var k = 0; + delta = firstTime ? floor(delta / damp) : delta >> 1; + delta += floor(delta / numPoints); + for (;delta > baseMinusTMin * tMax >> 1; k += base) { + delta = floor(delta / baseMinusTMin); + } + return floor(k + (baseMinusTMin + 1) * delta / (delta + skew)); + } + /** + * Converts a Punycode string of ASCII-only symbols to a string of Unicode + * symbols. + * @memberOf punycode + * @param {String} input The Punycode string of ASCII-only symbols. + * @returns {String} The resulting string of Unicode symbols. + */ function decode(input) { + // Don't use UCS-2 + var output = [], inputLength = input.length, out, i = 0, n = initialN, bias = initialBias, basic, j, index, oldi, w, k, digit, t, + /** Cached calculation results */ + baseMinusT; + // Handle the basic code points: let `basic` be the number of input code + // points before the last delimiter, or `0` if there is none, then copy + // the first basic code points to the output. + basic = input.lastIndexOf(delimiter); + if (basic < 0) { + basic = 0; + } + for (j = 0; j < basic; ++j) { + // if it's not a basic code point + if (input.charCodeAt(j) >= 128) { + error("not-basic"); + } + output.push(input.charCodeAt(j)); + } + // Main decoding loop: start just after the last delimiter if any basic code + // points were copied; start at the beginning otherwise. + for (index = basic > 0 ? basic + 1 : 0; index < inputLength; ) { + // `index` is the index of the next character to be consumed. + // Decode a generalized variable-length integer into `delta`, + // which gets added to `i`. The overflow checking is easier + // if we increase `i` as we go, then subtract off its starting + // value at the end to obtain `delta`. + for (oldi = i, w = 1, k = base; ;k += base) { + if (index >= inputLength) { + error("invalid-input"); + } + digit = basicToDigit(input.charCodeAt(index++)); + if (digit >= base || digit > floor((maxInt - i) / w)) { + error("overflow"); + } + i += digit * w; + t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; + if (digit < t) { + break; + } + baseMinusT = base - t; + if (w > floor(maxInt / baseMinusT)) { + error("overflow"); + } + w *= baseMinusT; + } + out = output.length + 1; + bias = adapt(i - oldi, out, oldi == 0); + // `i` was supposed to wrap around from `out` to `0`, + // incrementing `n` each time, so we'll fix that now: + if (floor(i / out) > maxInt - n) { + error("overflow"); + } + n += floor(i / out); + i %= out; + // Insert `n` at position `i` of the output + output.splice(i++, 0, n); + } + return ucs2encode(output); + } + /** + * Converts a string of Unicode symbols (e.g. a domain name label) to a + * Punycode string of ASCII-only symbols. + * @memberOf punycode + * @param {String} input The string of Unicode symbols. + * @returns {String} The resulting Punycode string of ASCII-only symbols. + */ function encode(input) { + var n, delta, handledCPCount, basicLength, bias, j, m, q, k, t, currentValue, output = [], + /** `inputLength` will hold the number of code points in `input`. */ + inputLength, + /** Cached calculation results */ + handledCPCountPlusOne, baseMinusT, qMinusT; + // Convert the input in UCS-2 to Unicode + input = ucs2decode(input); + // Cache the length + inputLength = input.length; + // Initialize the state + n = initialN; + delta = 0; + bias = initialBias; + // Handle the basic code points + for (j = 0; j < inputLength; ++j) { + currentValue = input[j]; + if (currentValue < 128) { + output.push(stringFromCharCode(currentValue)); + } + } + handledCPCount = basicLength = output.length; + // `handledCPCount` is the number of code points that have been handled; + // `basicLength` is the number of basic code points. + // Finish the basic string - if it is not empty - with a delimiter + if (basicLength) { + output.push(delimiter); + } + // Main encoding loop: + while (handledCPCount < inputLength) { + // All non-basic code points < n have been handled already. Find the next + // larger one: + for (m = maxInt, j = 0; j < inputLength; ++j) { + currentValue = input[j]; + if (currentValue >= n && currentValue < m) { + m = currentValue; + } + } + // Increase `delta` enough to advance the decoder's <n,i> state to <m,0>, + // but guard against overflow + handledCPCountPlusOne = handledCPCount + 1; + if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) { + error("overflow"); + } + delta += (m - n) * handledCPCountPlusOne; + n = m; + for (j = 0; j < inputLength; ++j) { + currentValue = input[j]; + if (currentValue < n && ++delta > maxInt) { + error("overflow"); + } + if (currentValue == n) { + // Represent delta as a generalized variable-length integer + for (q = delta, k = base; ;k += base) { + t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; + if (q < t) { + break; + } + qMinusT = q - t; + baseMinusT = base - t; + output.push(stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0))); + q = floor(qMinusT / baseMinusT); + } + output.push(stringFromCharCode(digitToBasic(q, 0))); + bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength); + delta = 0; + ++handledCPCount; + } + } + ++delta; + ++n; + } + return output.join(""); + } + /** + * Converts a Punycode string representing a domain name or an email address + * to Unicode. Only the Punycoded parts of the input will be converted, i.e. + * it doesn't matter if you call it on a string that has already been + * converted to Unicode. + * @memberOf punycode + * @param {String} input The Punycoded domain name or email address to + * convert to Unicode. + * @returns {String} The Unicode representation of the given Punycode + * string. + */ function toUnicode(input) { + return mapDomain(input, (function(string) { + return regexPunycode.test(string) ? decode(string.slice(4).toLowerCase()) : string; + })); + } + /** + * Converts a Unicode string representing a domain name or an email address to + * Punycode. Only the non-ASCII parts of the domain name will be converted, + * i.e. it doesn't matter if you call it with a domain that's already in + * ASCII. + * @memberOf punycode + * @param {String} input The domain name or email address to convert, as a + * Unicode string. + * @returns {String} The Punycode representation of the given domain name or + * email address. + */ function toASCII(input) { + return mapDomain(input, (function(string) { + return regexNonASCII.test(string) ? "xn--" + encode(string) : string; + })); + } + var version = "1.4.1"; + /** + * An object of methods to convert from JavaScript's internal character + * representation (UCS-2) to Unicode code points, and back. + * @see <https://mathiasbynens.be/notes/javascript-encoding> + * @memberOf punycode + * @type Object + */ var ucs2 = { + decode: ucs2decode, + encode: ucs2encode + }; + var punycode$1 = { + version: version, + ucs2: ucs2, + toASCII: toASCII, + toUnicode: toUnicode, + encode: encode, + decode: decode + }; + var punycode$2 = Object.freeze({ + __proto__: null, + decode: decode, + encode: encode, + toUnicode: toUnicode, + toASCII: toASCII, + version: version, + ucs2: ucs2, + default: punycode$1 + }); + // markdown-it default options + var _default = { + options: { + html: false, + // Enable HTML tags in source + xhtmlOut: false, + // Use '/' to close single tags (<br />) + breaks: false, + // Convert '\n' in paragraphs into <br> + langPrefix: "language-", + // CSS language prefix for fenced blocks + linkify: false, + // autoconvert URL-like texts to links + // Enable some language-neutral replacements + quotes beautification + typographer: false, + // Double + single quotes replacement pairs, when typographer enabled, + // and smartquotes on. Could be either a String or an Array. + // For example, you can use '«»„“' for Russian, '„“‚‘' for German, + // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). + quotes: "\u201c\u201d\u2018\u2019", + /* “”‘’ */ + // Highlighter function. Should return escaped HTML, + // or '' if the source string is not changed and should be escaped externaly. + // If result starts with <pre... internal wrapper is skipped. + // function (/*str, lang*/) { return ''; } + highlight: null, + maxNesting: 100 + }, + components: { + core: {}, + block: {}, + inline: {} + } + }; + // "Zero" preset, with nothing enabled. Useful for manual configuring of simple + var zero = { + options: { + html: false, + // Enable HTML tags in source + xhtmlOut: false, + // Use '/' to close single tags (<br />) + breaks: false, + // Convert '\n' in paragraphs into <br> + langPrefix: "language-", + // CSS language prefix for fenced blocks + linkify: false, + // autoconvert URL-like texts to links + // Enable some language-neutral replacements + quotes beautification + typographer: false, + // Double + single quotes replacement pairs, when typographer enabled, + // and smartquotes on. Could be either a String or an Array. + // For example, you can use '«»„“' for Russian, '„“‚‘' for German, + // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). + quotes: "\u201c\u201d\u2018\u2019", + /* “”‘’ */ + // Highlighter function. Should return escaped HTML, + // or '' if the source string is not changed and should be escaped externaly. + // If result starts with <pre... internal wrapper is skipped. + // function (/*str, lang*/) { return ''; } + highlight: null, + maxNesting: 20 + }, + components: { + core: { + rules: [ "normalize", "block", "inline" ] + }, + block: { + rules: [ "paragraph" ] + }, + inline: { + rules: [ "text" ], + rules2: [ "balance_pairs", "text_collapse" ] + } + } + }; + // Commonmark default options + var commonmark = { + options: { + html: true, + // Enable HTML tags in source + xhtmlOut: true, + // Use '/' to close single tags (<br />) + breaks: false, + // Convert '\n' in paragraphs into <br> + langPrefix: "language-", + // CSS language prefix for fenced blocks + linkify: false, + // autoconvert URL-like texts to links + // Enable some language-neutral replacements + quotes beautification + typographer: false, + // Double + single quotes replacement pairs, when typographer enabled, + // and smartquotes on. Could be either a String or an Array. + // For example, you can use '«»„“' for Russian, '„“‚‘' for German, + // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). + quotes: "\u201c\u201d\u2018\u2019", + /* “”‘’ */ + // Highlighter function. Should return escaped HTML, + // or '' if the source string is not changed and should be escaped externaly. + // If result starts with <pre... internal wrapper is skipped. + // function (/*str, lang*/) { return ''; } + highlight: null, + maxNesting: 20 + }, + components: { + core: { + rules: [ "normalize", "block", "inline" ] + }, + block: { + rules: [ "blockquote", "code", "fence", "heading", "hr", "html_block", "lheading", "list", "reference", "paragraph" ] + }, + inline: { + rules: [ "autolink", "backticks", "emphasis", "entity", "escape", "html_inline", "image", "link", "newline", "text" ], + rules2: [ "balance_pairs", "emphasis", "text_collapse" ] + } + } + }; + var punycode = getAugmentedNamespace(punycode$2); + var config = { + default: _default, + zero: zero, + commonmark: commonmark + }; + //////////////////////////////////////////////////////////////////////////////// + + // This validator can prohibit more than really needed to prevent XSS. It's a + // tradeoff to keep code simple and to be secure by default. + + // If you need different setup - override validator method as you wish. Or + // replace it with dummy function and use external sanitizer. + + var BAD_PROTO_RE = /^(vbscript|javascript|file|data):/; + var GOOD_DATA_RE = /^data:image\/(gif|png|jpeg|webp);/; + function validateLink(url) { + // url should be normalized at this point, and existing entities are decoded + var str = url.trim().toLowerCase(); + return BAD_PROTO_RE.test(str) ? GOOD_DATA_RE.test(str) ? true : false : true; + } + //////////////////////////////////////////////////////////////////////////////// + var RECODE_HOSTNAME_FOR = [ "http:", "https:", "mailto:" ]; + function normalizeLink(url) { + var parsed = mdurl.parse(url, true); + if (parsed.hostname) { + // Encode hostnames in urls like: + // `http://host/`, `https://host/`, `mailto:user@host`, `//host/` + // We don't encode unknown schemas, because it's likely that we encode + // something we shouldn't (e.g. `skype:name` treated as `skype:host`) + if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) { + try { + parsed.hostname = punycode.toASCII(parsed.hostname); + } catch (er) {} + } + } + return mdurl.encode(mdurl.format(parsed)); + } + function normalizeLinkText(url) { + var parsed = mdurl.parse(url, true); + if (parsed.hostname) { + // Encode hostnames in urls like: + // `http://host/`, `https://host/`, `mailto:user@host`, `//host/` + // We don't encode unknown schemas, because it's likely that we encode + // something we shouldn't (e.g. `skype:name` treated as `skype:host`) + if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) { + try { + parsed.hostname = punycode.toUnicode(parsed.hostname); + } catch (er) {} + } + } + // add '%' to exclude list because of https://github.com/markdown-it/markdown-it/issues/720 + return mdurl.decode(mdurl.format(parsed), mdurl.decode.defaultChars + "%"); + } + /** + * class MarkdownIt + * + * Main parser/renderer class. + * + * ##### Usage + * + * ```javascript + * // node.js, "classic" way: + * var MarkdownIt = require('markdown-it'), + * md = new MarkdownIt(); + * var result = md.render('# markdown-it rulezz!'); + * + * // node.js, the same, but with sugar: + * var md = require('markdown-it')(); + * var result = md.render('# markdown-it rulezz!'); + * + * // browser without AMD, added to "window" on script load + * // Note, there are no dash. + * var md = window.markdownit(); + * var result = md.render('# markdown-it rulezz!'); + * ``` + * + * Single line rendering, without paragraph wrap: + * + * ```javascript + * var md = require('markdown-it')(); + * var result = md.renderInline('__markdown-it__ rulezz!'); + * ``` + **/ + /** + * new MarkdownIt([presetName, options]) + * - presetName (String): optional, `commonmark` / `zero` + * - options (Object) + * + * Creates parser instanse with given config. Can be called without `new`. + * + * ##### presetName + * + * MarkdownIt provides named presets as a convenience to quickly + * enable/disable active syntax rules and options for common use cases. + * + * - ["commonmark"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/commonmark.js) - + * configures parser to strict [CommonMark](http://commonmark.org/) mode. + * - [default](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/default.js) - + * similar to GFM, used when no preset name given. Enables all available rules, + * but still without html, typographer & autolinker. + * - ["zero"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/zero.js) - + * all rules disabled. Useful to quickly setup your config via `.enable()`. + * For example, when you need only `bold` and `italic` markup and nothing else. + * + * ##### options: + * + * - __html__ - `false`. Set `true` to enable HTML tags in source. Be careful! + * That's not safe! You may need external sanitizer to protect output from XSS. + * It's better to extend features via plugins, instead of enabling HTML. + * - __xhtmlOut__ - `false`. Set `true` to add '/' when closing single tags + * (`<br />`). This is needed only for full CommonMark compatibility. In real + * world you will need HTML output. + * - __breaks__ - `false`. Set `true` to convert `\n` in paragraphs into `<br>`. + * - __langPrefix__ - `language-`. CSS language class prefix for fenced blocks. + * Can be useful for external highlighters. + * - __linkify__ - `false`. Set `true` to autoconvert URL-like text to links. + * - __typographer__ - `false`. Set `true` to enable [some language-neutral + * replacement](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js) + + * quotes beautification (smartquotes). + * - __quotes__ - `“”‘’`, String or Array. Double + single quotes replacement + * pairs, when typographer enabled and smartquotes on. For example, you can + * use `'«»„“'` for Russian, `'„“‚‘'` for German, and + * `['«\xA0', '\xA0»', '‹\xA0', '\xA0›']` for French (including nbsp). + * - __highlight__ - `null`. Highlighter function for fenced code blocks. + * Highlighter `function (str, lang)` should return escaped HTML. It can also + * return empty string if the source was not changed and should be escaped + * externaly. If result starts with <pre... internal wrapper is skipped. + * + * ##### Example + * + * ```javascript + * // commonmark mode + * var md = require('markdown-it')('commonmark'); + * + * // default mode + * var md = require('markdown-it')(); + * + * // enable everything + * var md = require('markdown-it')({ + * html: true, + * linkify: true, + * typographer: true + * }); + * ``` + * + * ##### Syntax highlighting + * + * ```js + * var hljs = require('highlight.js') // https://highlightjs.org/ + * + * var md = require('markdown-it')({ + * highlight: function (str, lang) { + * if (lang && hljs.getLanguage(lang)) { + * try { + * return hljs.highlight(str, { language: lang, ignoreIllegals: true }).value; + * } catch (__) {} + * } + * + * return ''; // use external default escaping + * } + * }); + * ``` + * + * Or with full wrapper override (if you need assign class to `<pre>`): + * + * ```javascript + * var hljs = require('highlight.js') // https://highlightjs.org/ + * + * // Actual default values + * var md = require('markdown-it')({ + * highlight: function (str, lang) { + * if (lang && hljs.getLanguage(lang)) { + * try { + * return '<pre class="hljs"><code>' + + * hljs.highlight(str, { language: lang, ignoreIllegals: true }).value + + * '</code></pre>'; + * } catch (__) {} + * } + * + * return '<pre class="hljs"><code>' + md.utils.escapeHtml(str) + '</code></pre>'; + * } + * }); + * ``` + * + **/ function MarkdownIt(presetName, options) { + if (!(this instanceof MarkdownIt)) { + return new MarkdownIt(presetName, options); + } + if (!options) { + if (!utils.isString(presetName)) { + options = presetName || {}; + presetName = "default"; + } + } + /** + * MarkdownIt#inline -> ParserInline + * + * Instance of [[ParserInline]]. You may need it to add new rules when + * writing plugins. For simple rules control use [[MarkdownIt.disable]] and + * [[MarkdownIt.enable]]. + **/ this.inline = new parser_inline; + /** + * MarkdownIt#block -> ParserBlock + * + * Instance of [[ParserBlock]]. You may need it to add new rules when + * writing plugins. For simple rules control use [[MarkdownIt.disable]] and + * [[MarkdownIt.enable]]. + **/ this.block = new parser_block; + /** + * MarkdownIt#core -> Core + * + * Instance of [[Core]] chain executor. You may need it to add new rules when + * writing plugins. For simple rules control use [[MarkdownIt.disable]] and + * [[MarkdownIt.enable]]. + **/ this.core = new parser_core; + /** + * MarkdownIt#renderer -> Renderer + * + * Instance of [[Renderer]]. Use it to modify output look. Or to add rendering + * rules for new token types, generated by plugins. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * function myToken(tokens, idx, options, env, self) { + * //... + * return result; + * }; + * + * md.renderer.rules['my_token'] = myToken + * ``` + * + * See [[Renderer]] docs and [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js). + **/ this.renderer = new renderer; + /** + * MarkdownIt#linkify -> LinkifyIt + * + * [linkify-it](https://github.com/markdown-it/linkify-it) instance. + * Used by [linkify](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/linkify.js) + * rule. + **/ this.linkify = new linkifyIt; + /** + * MarkdownIt#validateLink(url) -> Boolean + * + * Link validation function. CommonMark allows too much in links. By default + * we disable `javascript:`, `vbscript:`, `file:` schemas, and almost all `data:...` schemas + * except some embedded image types. + * + * You can change this behaviour: + * + * ```javascript + * var md = require('markdown-it')(); + * // enable everything + * md.validateLink = function () { return true; } + * ``` + **/ this.validateLink = validateLink; + /** + * MarkdownIt#normalizeLink(url) -> String + * + * Function used to encode link url to a machine-readable format, + * which includes url-encoding, punycode, etc. + **/ this.normalizeLink = normalizeLink; + /** + * MarkdownIt#normalizeLinkText(url) -> String + * + * Function used to decode link url to a human-readable format` + **/ this.normalizeLinkText = normalizeLinkText; + // Expose utils & helpers for easy acces from plugins + /** + * MarkdownIt#utils -> utils + * + * Assorted utility functions, useful to write plugins. See details + * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/common/utils.js). + **/ this.utils = utils; + /** + * MarkdownIt#helpers -> helpers + * + * Link components parser functions, useful to write plugins. See details + * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/helpers). + **/ this.helpers = utils.assign({}, helpers); + this.options = {}; + this.configure(presetName); + if (options) { + this.set(options); + } + } + /** chainable + * MarkdownIt.set(options) + * + * Set parser options (in the same format as in constructor). Probably, you + * will never need it, but you can change options after constructor call. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')() + * .set({ html: true, breaks: true }) + * .set({ typographer, true }); + * ``` + * + * __Note:__ To achieve the best possible performance, don't modify a + * `markdown-it` instance options on the fly. If you need multiple configurations + * it's best to create multiple instances and initialize each with separate + * config. + **/ MarkdownIt.prototype.set = function(options) { + utils.assign(this.options, options); + return this; + }; + /** chainable, internal + * MarkdownIt.configure(presets) + * + * Batch load of all options and compenent settings. This is internal method, + * and you probably will not need it. But if you will - see available presets + * and data structure [here](https://github.com/markdown-it/markdown-it/tree/master/lib/presets) + * + * We strongly recommend to use presets instead of direct config loads. That + * will give better compatibility with next versions. + **/ MarkdownIt.prototype.configure = function(presets) { + var self = this, presetName; + if (utils.isString(presets)) { + presetName = presets; + presets = config[presetName]; + if (!presets) { + throw new Error('Wrong `markdown-it` preset "' + presetName + '", check name'); + } + } + if (!presets) { + throw new Error("Wrong `markdown-it` preset, can't be empty"); + } + if (presets.options) { + self.set(presets.options); + } + if (presets.components) { + Object.keys(presets.components).forEach((function(name) { + if (presets.components[name].rules) { + self[name].ruler.enableOnly(presets.components[name].rules); + } + if (presets.components[name].rules2) { + self[name].ruler2.enableOnly(presets.components[name].rules2); + } + })); + } + return this; + }; + /** chainable + * MarkdownIt.enable(list, ignoreInvalid) + * - list (String|Array): rule name or list of rule names to enable + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Enable list or rules. It will automatically find appropriate components, + * containing rules with given names. If rule not found, and `ignoreInvalid` + * not set - throws exception. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')() + * .enable(['sub', 'sup']) + * .disable('smartquotes'); + * ``` + **/ MarkdownIt.prototype.enable = function(list, ignoreInvalid) { + var result = []; + if (!Array.isArray(list)) { + list = [ list ]; + } + [ "core", "block", "inline" ].forEach((function(chain) { + result = result.concat(this[chain].ruler.enable(list, true)); + }), this); + result = result.concat(this.inline.ruler2.enable(list, true)); + var missed = list.filter((function(name) { + return result.indexOf(name) < 0; + })); + if (missed.length && !ignoreInvalid) { + throw new Error("MarkdownIt. Failed to enable unknown rule(s): " + missed); + } + return this; + }; + /** chainable + * MarkdownIt.disable(list, ignoreInvalid) + * - list (String|Array): rule name or list of rule names to disable. + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * The same as [[MarkdownIt.enable]], but turn specified rules off. + **/ MarkdownIt.prototype.disable = function(list, ignoreInvalid) { + var result = []; + if (!Array.isArray(list)) { + list = [ list ]; + } + [ "core", "block", "inline" ].forEach((function(chain) { + result = result.concat(this[chain].ruler.disable(list, true)); + }), this); + result = result.concat(this.inline.ruler2.disable(list, true)); + var missed = list.filter((function(name) { + return result.indexOf(name) < 0; + })); + if (missed.length && !ignoreInvalid) { + throw new Error("MarkdownIt. Failed to disable unknown rule(s): " + missed); + } + return this; + }; + /** chainable + * MarkdownIt.use(plugin, params) + * + * Load specified plugin with given params into current parser instance. + * It's just a sugar to call `plugin(md, params)` with curring. + * + * ##### Example + * + * ```javascript + * var iterator = require('markdown-it-for-inline'); + * var md = require('markdown-it')() + * .use(iterator, 'foo_replace', 'text', function (tokens, idx) { + * tokens[idx].content = tokens[idx].content.replace(/foo/g, 'bar'); + * }); + * ``` + **/ MarkdownIt.prototype.use = function(plugin /*, params, ... */) { + var args = [ this ].concat(Array.prototype.slice.call(arguments, 1)); + plugin.apply(plugin, args); + return this; + }; + /** internal + * MarkdownIt.parse(src, env) -> Array + * - src (String): source string + * - env (Object): environment sandbox + * + * Parse input string and return list of block tokens (special token type + * "inline" will contain list of inline tokens). You should not call this + * method directly, until you write custom renderer (for example, to produce + * AST). + * + * `env` is used to pass data between "distributed" rules and return additional + * metadata like reference info, needed for the renderer. It also can be used to + * inject data in specific cases. Usually, you will be ok to pass `{}`, + * and then pass updated object to renderer. + **/ MarkdownIt.prototype.parse = function(src, env) { + if (typeof src !== "string") { + throw new Error("Input data should be a String"); + } + var state = new this.core.State(src, this, env); + this.core.process(state); + return state.tokens; + }; + /** + * MarkdownIt.render(src [, env]) -> String + * - src (String): source string + * - env (Object): environment sandbox + * + * Render markdown string into html. It does all magic for you :). + * + * `env` can be used to inject additional metadata (`{}` by default). + * But you will not need it with high probability. See also comment + * in [[MarkdownIt.parse]]. + **/ MarkdownIt.prototype.render = function(src, env) { + env = env || {}; + return this.renderer.render(this.parse(src, env), this.options, env); + }; + /** internal + * MarkdownIt.parseInline(src, env) -> Array + * - src (String): source string + * - env (Object): environment sandbox + * + * The same as [[MarkdownIt.parse]] but skip all block rules. It returns the + * block tokens list with the single `inline` element, containing parsed inline + * tokens in `children` property. Also updates `env` object. + **/ MarkdownIt.prototype.parseInline = function(src, env) { + var state = new this.core.State(src, this, env); + state.inlineMode = true; + this.core.process(state); + return state.tokens; + }; + /** + * MarkdownIt.renderInline(src [, env]) -> String + * - src (String): source string + * - env (Object): environment sandbox + * + * Similar to [[MarkdownIt.render]] but for single paragraph content. Result + * will NOT be wrapped into `<p>` tags. + **/ MarkdownIt.prototype.renderInline = function(src, env) { + env = env || {}; + return this.renderer.render(this.parseInline(src, env), this.options, env); + }; + var lib = MarkdownIt; + var markdownIt = lib; + return markdownIt; +})); diff --git a/node_modules/markdown-it/dist/markdown-it.min.js b/node_modules/markdown-it/dist/markdown-it.min.js new file mode 100644 index 0000000..5df7d1b --- /dev/null +++ b/node_modules/markdown-it/dist/markdown-it.min.js @@ -0,0 +1,3 @@ +/*! markdown-it 12.3.2 https://github.com/markdown-it/markdown-it @license MIT */ +!function(e,r){"object"==typeof exports&&"undefined"!=typeof module?module.exports=r():"function"==typeof define&&define.amd?define(r):(e="undefined"!=typeof globalThis?globalThis:e||self).markdownit=r()}(this,(function(){"use strict";function e(e){if(e.__esModule)return e;var r=Object.defineProperty({},"__esModule",{value:!0});return Object.keys(e).forEach((function(t){var n=Object.getOwnPropertyDescriptor(e,t);Object.defineProperty(r,t,n.get?n:{enumerable:!0,get:function(){return e[t]}})})),r}var r={Aacute:"\xc1",aacute:"\xe1",Abreve:"\u0102",abreve:"\u0103",ac:"\u223e",acd:"\u223f",acE:"\u223e\u0333",Acirc:"\xc2",acirc:"\xe2",acute:"\xb4",Acy:"\u0410",acy:"\u0430",AElig:"\xc6",aelig:"\xe6",af:"\u2061",Afr:"\ud835\udd04",afr:"\ud835\udd1e",Agrave:"\xc0",agrave:"\xe0",alefsym:"\u2135",aleph:"\u2135",Alpha:"\u0391",alpha:"\u03b1",Amacr:"\u0100",amacr:"\u0101",amalg:"\u2a3f",amp:"&",AMP:"&",andand:"\u2a55",And:"\u2a53",and:"\u2227",andd:"\u2a5c",andslope:"\u2a58",andv:"\u2a5a",ang:"\u2220",ange:"\u29a4",angle:"\u2220",angmsdaa:"\u29a8",angmsdab:"\u29a9",angmsdac:"\u29aa",angmsdad:"\u29ab",angmsdae:"\u29ac",angmsdaf:"\u29ad",angmsdag:"\u29ae",angmsdah:"\u29af",angmsd:"\u2221",angrt:"\u221f",angrtvb:"\u22be",angrtvbd:"\u299d",angsph:"\u2222",angst:"\xc5",angzarr:"\u237c",Aogon:"\u0104",aogon:"\u0105",Aopf:"\ud835\udd38",aopf:"\ud835\udd52",apacir:"\u2a6f",ap:"\u2248",apE:"\u2a70",ape:"\u224a",apid:"\u224b",apos:"'",ApplyFunction:"\u2061",approx:"\u2248",approxeq:"\u224a",Aring:"\xc5",aring:"\xe5",Ascr:"\ud835\udc9c",ascr:"\ud835\udcb6",Assign:"\u2254",ast:"*",asymp:"\u2248",asympeq:"\u224d",Atilde:"\xc3",atilde:"\xe3",Auml:"\xc4",auml:"\xe4",awconint:"\u2233",awint:"\u2a11",backcong:"\u224c",backepsilon:"\u03f6",backprime:"\u2035",backsim:"\u223d",backsimeq:"\u22cd",Backslash:"\u2216",Barv:"\u2ae7",barvee:"\u22bd",barwed:"\u2305",Barwed:"\u2306",barwedge:"\u2305",bbrk:"\u23b5",bbrktbrk:"\u23b6",bcong:"\u224c",Bcy:"\u0411",bcy:"\u0431",bdquo:"\u201e",becaus:"\u2235",because:"\u2235",Because:"\u2235",bemptyv:"\u29b0",bepsi:"\u03f6",bernou:"\u212c",Bernoullis:"\u212c",Beta:"\u0392",beta:"\u03b2",beth:"\u2136",between:"\u226c",Bfr:"\ud835\udd05",bfr:"\ud835\udd1f",bigcap:"\u22c2",bigcirc:"\u25ef",bigcup:"\u22c3",bigodot:"\u2a00",bigoplus:"\u2a01",bigotimes:"\u2a02",bigsqcup:"\u2a06",bigstar:"\u2605",bigtriangledown:"\u25bd",bigtriangleup:"\u25b3",biguplus:"\u2a04",bigvee:"\u22c1",bigwedge:"\u22c0",bkarow:"\u290d",blacklozenge:"\u29eb",blacksquare:"\u25aa",blacktriangle:"\u25b4",blacktriangledown:"\u25be",blacktriangleleft:"\u25c2",blacktriangleright:"\u25b8",blank:"\u2423",blk12:"\u2592",blk14:"\u2591",blk34:"\u2593",block:"\u2588",bne:"=\u20e5",bnequiv:"\u2261\u20e5",bNot:"\u2aed",bnot:"\u2310",Bopf:"\ud835\udd39",bopf:"\ud835\udd53",bot:"\u22a5",bottom:"\u22a5",bowtie:"\u22c8",boxbox:"\u29c9",boxdl:"\u2510",boxdL:"\u2555",boxDl:"\u2556",boxDL:"\u2557",boxdr:"\u250c",boxdR:"\u2552",boxDr:"\u2553",boxDR:"\u2554",boxh:"\u2500",boxH:"\u2550",boxhd:"\u252c",boxHd:"\u2564",boxhD:"\u2565",boxHD:"\u2566",boxhu:"\u2534",boxHu:"\u2567",boxhU:"\u2568",boxHU:"\u2569",boxminus:"\u229f",boxplus:"\u229e",boxtimes:"\u22a0",boxul:"\u2518",boxuL:"\u255b",boxUl:"\u255c",boxUL:"\u255d",boxur:"\u2514",boxuR:"\u2558",boxUr:"\u2559",boxUR:"\u255a",boxv:"\u2502",boxV:"\u2551",boxvh:"\u253c",boxvH:"\u256a",boxVh:"\u256b",boxVH:"\u256c",boxvl:"\u2524",boxvL:"\u2561",boxVl:"\u2562",boxVL:"\u2563",boxvr:"\u251c",boxvR:"\u255e",boxVr:"\u255f",boxVR:"\u2560",bprime:"\u2035",breve:"\u02d8",Breve:"\u02d8",brvbar:"\xa6",bscr:"\ud835\udcb7",Bscr:"\u212c",bsemi:"\u204f",bsim:"\u223d",bsime:"\u22cd",bsolb:"\u29c5",bsol:"\\",bsolhsub:"\u27c8",bull:"\u2022",bullet:"\u2022",bump:"\u224e",bumpE:"\u2aae",bumpe:"\u224f",Bumpeq:"\u224e",bumpeq:"\u224f",Cacute:"\u0106",cacute:"\u0107",capand:"\u2a44",capbrcup:"\u2a49",capcap:"\u2a4b",cap:"\u2229",Cap:"\u22d2",capcup:"\u2a47",capdot:"\u2a40",CapitalDifferentialD:"\u2145",caps:"\u2229\ufe00",caret:"\u2041",caron:"\u02c7",Cayleys:"\u212d",ccaps:"\u2a4d",Ccaron:"\u010c",ccaron:"\u010d",Ccedil:"\xc7",ccedil:"\xe7",Ccirc:"\u0108",ccirc:"\u0109",Cconint:"\u2230",ccups:"\u2a4c",ccupssm:"\u2a50",Cdot:"\u010a",cdot:"\u010b",cedil:"\xb8",Cedilla:"\xb8",cemptyv:"\u29b2",cent:"\xa2",centerdot:"\xb7",CenterDot:"\xb7",cfr:"\ud835\udd20",Cfr:"\u212d",CHcy:"\u0427",chcy:"\u0447",check:"\u2713",checkmark:"\u2713",Chi:"\u03a7",chi:"\u03c7",circ:"\u02c6",circeq:"\u2257",circlearrowleft:"\u21ba",circlearrowright:"\u21bb",circledast:"\u229b",circledcirc:"\u229a",circleddash:"\u229d",CircleDot:"\u2299",circledR:"\xae",circledS:"\u24c8",CircleMinus:"\u2296",CirclePlus:"\u2295",CircleTimes:"\u2297",cir:"\u25cb",cirE:"\u29c3",cire:"\u2257",cirfnint:"\u2a10",cirmid:"\u2aef",cirscir:"\u29c2",ClockwiseContourIntegral:"\u2232",CloseCurlyDoubleQuote:"\u201d",CloseCurlyQuote:"\u2019",clubs:"\u2663",clubsuit:"\u2663",colon:":",Colon:"\u2237",Colone:"\u2a74",colone:"\u2254",coloneq:"\u2254",comma:",",commat:"@",comp:"\u2201",compfn:"\u2218",complement:"\u2201",complexes:"\u2102",cong:"\u2245",congdot:"\u2a6d",Congruent:"\u2261",conint:"\u222e",Conint:"\u222f",ContourIntegral:"\u222e",copf:"\ud835\udd54",Copf:"\u2102",coprod:"\u2210",Coproduct:"\u2210",copy:"\xa9",COPY:"\xa9",copysr:"\u2117",CounterClockwiseContourIntegral:"\u2233",crarr:"\u21b5",cross:"\u2717",Cross:"\u2a2f",Cscr:"\ud835\udc9e",cscr:"\ud835\udcb8",csub:"\u2acf",csube:"\u2ad1",csup:"\u2ad0",csupe:"\u2ad2",ctdot:"\u22ef",cudarrl:"\u2938",cudarrr:"\u2935",cuepr:"\u22de",cuesc:"\u22df",cularr:"\u21b6",cularrp:"\u293d",cupbrcap:"\u2a48",cupcap:"\u2a46",CupCap:"\u224d",cup:"\u222a",Cup:"\u22d3",cupcup:"\u2a4a",cupdot:"\u228d",cupor:"\u2a45",cups:"\u222a\ufe00",curarr:"\u21b7",curarrm:"\u293c",curlyeqprec:"\u22de",curlyeqsucc:"\u22df",curlyvee:"\u22ce",curlywedge:"\u22cf",curren:"\xa4",curvearrowleft:"\u21b6",curvearrowright:"\u21b7",cuvee:"\u22ce",cuwed:"\u22cf",cwconint:"\u2232",cwint:"\u2231",cylcty:"\u232d",dagger:"\u2020",Dagger:"\u2021",daleth:"\u2138",darr:"\u2193",Darr:"\u21a1",dArr:"\u21d3",dash:"\u2010",Dashv:"\u2ae4",dashv:"\u22a3",dbkarow:"\u290f",dblac:"\u02dd",Dcaron:"\u010e",dcaron:"\u010f",Dcy:"\u0414",dcy:"\u0434",ddagger:"\u2021",ddarr:"\u21ca",DD:"\u2145",dd:"\u2146",DDotrahd:"\u2911",ddotseq:"\u2a77",deg:"\xb0",Del:"\u2207",Delta:"\u0394",delta:"\u03b4",demptyv:"\u29b1",dfisht:"\u297f",Dfr:"\ud835\udd07",dfr:"\ud835\udd21",dHar:"\u2965",dharl:"\u21c3",dharr:"\u21c2",DiacriticalAcute:"\xb4",DiacriticalDot:"\u02d9",DiacriticalDoubleAcute:"\u02dd",DiacriticalGrave:"`",DiacriticalTilde:"\u02dc",diam:"\u22c4",diamond:"\u22c4",Diamond:"\u22c4",diamondsuit:"\u2666",diams:"\u2666",die:"\xa8",DifferentialD:"\u2146",digamma:"\u03dd",disin:"\u22f2",div:"\xf7",divide:"\xf7",divideontimes:"\u22c7",divonx:"\u22c7",DJcy:"\u0402",djcy:"\u0452",dlcorn:"\u231e",dlcrop:"\u230d",dollar:"$",Dopf:"\ud835\udd3b",dopf:"\ud835\udd55",Dot:"\xa8",dot:"\u02d9",DotDot:"\u20dc",doteq:"\u2250",doteqdot:"\u2251",DotEqual:"\u2250",dotminus:"\u2238",dotplus:"\u2214",dotsquare:"\u22a1",doublebarwedge:"\u2306",DoubleContourIntegral:"\u222f",DoubleDot:"\xa8",DoubleDownArrow:"\u21d3",DoubleLeftArrow:"\u21d0",DoubleLeftRightArrow:"\u21d4",DoubleLeftTee:"\u2ae4",DoubleLongLeftArrow:"\u27f8",DoubleLongLeftRightArrow:"\u27fa",DoubleLongRightArrow:"\u27f9",DoubleRightArrow:"\u21d2",DoubleRightTee:"\u22a8",DoubleUpArrow:"\u21d1",DoubleUpDownArrow:"\u21d5",DoubleVerticalBar:"\u2225",DownArrowBar:"\u2913",downarrow:"\u2193",DownArrow:"\u2193",Downarrow:"\u21d3",DownArrowUpArrow:"\u21f5",DownBreve:"\u0311",downdownarrows:"\u21ca",downharpoonleft:"\u21c3",downharpoonright:"\u21c2",DownLeftRightVector:"\u2950",DownLeftTeeVector:"\u295e",DownLeftVectorBar:"\u2956",DownLeftVector:"\u21bd",DownRightTeeVector:"\u295f",DownRightVectorBar:"\u2957",DownRightVector:"\u21c1",DownTeeArrow:"\u21a7",DownTee:"\u22a4",drbkarow:"\u2910",drcorn:"\u231f",drcrop:"\u230c",Dscr:"\ud835\udc9f",dscr:"\ud835\udcb9",DScy:"\u0405",dscy:"\u0455",dsol:"\u29f6",Dstrok:"\u0110",dstrok:"\u0111",dtdot:"\u22f1",dtri:"\u25bf",dtrif:"\u25be",duarr:"\u21f5",duhar:"\u296f",dwangle:"\u29a6",DZcy:"\u040f",dzcy:"\u045f",dzigrarr:"\u27ff",Eacute:"\xc9",eacute:"\xe9",easter:"\u2a6e",Ecaron:"\u011a",ecaron:"\u011b",Ecirc:"\xca",ecirc:"\xea",ecir:"\u2256",ecolon:"\u2255",Ecy:"\u042d",ecy:"\u044d",eDDot:"\u2a77",Edot:"\u0116",edot:"\u0117",eDot:"\u2251",ee:"\u2147",efDot:"\u2252",Efr:"\ud835\udd08",efr:"\ud835\udd22",eg:"\u2a9a",Egrave:"\xc8",egrave:"\xe8",egs:"\u2a96",egsdot:"\u2a98",el:"\u2a99",Element:"\u2208",elinters:"\u23e7",ell:"\u2113",els:"\u2a95",elsdot:"\u2a97",Emacr:"\u0112",emacr:"\u0113",empty:"\u2205",emptyset:"\u2205",EmptySmallSquare:"\u25fb",emptyv:"\u2205",EmptyVerySmallSquare:"\u25ab",emsp13:"\u2004",emsp14:"\u2005",emsp:"\u2003",ENG:"\u014a",eng:"\u014b",ensp:"\u2002",Eogon:"\u0118",eogon:"\u0119",Eopf:"\ud835\udd3c",eopf:"\ud835\udd56",epar:"\u22d5",eparsl:"\u29e3",eplus:"\u2a71",epsi:"\u03b5",Epsilon:"\u0395",epsilon:"\u03b5",epsiv:"\u03f5",eqcirc:"\u2256",eqcolon:"\u2255",eqsim:"\u2242",eqslantgtr:"\u2a96",eqslantless:"\u2a95",Equal:"\u2a75",equals:"=",EqualTilde:"\u2242",equest:"\u225f",Equilibrium:"\u21cc",equiv:"\u2261",equivDD:"\u2a78",eqvparsl:"\u29e5",erarr:"\u2971",erDot:"\u2253",escr:"\u212f",Escr:"\u2130",esdot:"\u2250",Esim:"\u2a73",esim:"\u2242",Eta:"\u0397",eta:"\u03b7",ETH:"\xd0",eth:"\xf0",Euml:"\xcb",euml:"\xeb",euro:"\u20ac",excl:"!",exist:"\u2203",Exists:"\u2203",expectation:"\u2130",exponentiale:"\u2147",ExponentialE:"\u2147",fallingdotseq:"\u2252",Fcy:"\u0424",fcy:"\u0444",female:"\u2640",ffilig:"\ufb03",fflig:"\ufb00",ffllig:"\ufb04",Ffr:"\ud835\udd09",ffr:"\ud835\udd23",filig:"\ufb01",FilledSmallSquare:"\u25fc",FilledVerySmallSquare:"\u25aa",fjlig:"fj",flat:"\u266d",fllig:"\ufb02",fltns:"\u25b1",fnof:"\u0192",Fopf:"\ud835\udd3d",fopf:"\ud835\udd57",forall:"\u2200",ForAll:"\u2200",fork:"\u22d4",forkv:"\u2ad9",Fouriertrf:"\u2131",fpartint:"\u2a0d",frac12:"\xbd",frac13:"\u2153",frac14:"\xbc",frac15:"\u2155",frac16:"\u2159",frac18:"\u215b",frac23:"\u2154",frac25:"\u2156",frac34:"\xbe",frac35:"\u2157",frac38:"\u215c",frac45:"\u2158",frac56:"\u215a",frac58:"\u215d",frac78:"\u215e",frasl:"\u2044",frown:"\u2322",fscr:"\ud835\udcbb",Fscr:"\u2131",gacute:"\u01f5",Gamma:"\u0393",gamma:"\u03b3",Gammad:"\u03dc",gammad:"\u03dd",gap:"\u2a86",Gbreve:"\u011e",gbreve:"\u011f",Gcedil:"\u0122",Gcirc:"\u011c",gcirc:"\u011d",Gcy:"\u0413",gcy:"\u0433",Gdot:"\u0120",gdot:"\u0121",ge:"\u2265",gE:"\u2267",gEl:"\u2a8c",gel:"\u22db",geq:"\u2265",geqq:"\u2267",geqslant:"\u2a7e",gescc:"\u2aa9",ges:"\u2a7e",gesdot:"\u2a80",gesdoto:"\u2a82",gesdotol:"\u2a84",gesl:"\u22db\ufe00",gesles:"\u2a94",Gfr:"\ud835\udd0a",gfr:"\ud835\udd24",gg:"\u226b",Gg:"\u22d9",ggg:"\u22d9",gimel:"\u2137",GJcy:"\u0403",gjcy:"\u0453",gla:"\u2aa5",gl:"\u2277",glE:"\u2a92",glj:"\u2aa4",gnap:"\u2a8a",gnapprox:"\u2a8a",gne:"\u2a88",gnE:"\u2269",gneq:"\u2a88",gneqq:"\u2269",gnsim:"\u22e7",Gopf:"\ud835\udd3e",gopf:"\ud835\udd58",grave:"`",GreaterEqual:"\u2265",GreaterEqualLess:"\u22db",GreaterFullEqual:"\u2267",GreaterGreater:"\u2aa2",GreaterLess:"\u2277",GreaterSlantEqual:"\u2a7e",GreaterTilde:"\u2273",Gscr:"\ud835\udca2",gscr:"\u210a",gsim:"\u2273",gsime:"\u2a8e",gsiml:"\u2a90",gtcc:"\u2aa7",gtcir:"\u2a7a",gt:">",GT:">",Gt:"\u226b",gtdot:"\u22d7",gtlPar:"\u2995",gtquest:"\u2a7c",gtrapprox:"\u2a86",gtrarr:"\u2978",gtrdot:"\u22d7",gtreqless:"\u22db",gtreqqless:"\u2a8c",gtrless:"\u2277",gtrsim:"\u2273",gvertneqq:"\u2269\ufe00",gvnE:"\u2269\ufe00",Hacek:"\u02c7",hairsp:"\u200a",half:"\xbd",hamilt:"\u210b",HARDcy:"\u042a",hardcy:"\u044a",harrcir:"\u2948",harr:"\u2194",hArr:"\u21d4",harrw:"\u21ad",Hat:"^",hbar:"\u210f",Hcirc:"\u0124",hcirc:"\u0125",hearts:"\u2665",heartsuit:"\u2665",hellip:"\u2026",hercon:"\u22b9",hfr:"\ud835\udd25",Hfr:"\u210c",HilbertSpace:"\u210b",hksearow:"\u2925",hkswarow:"\u2926",hoarr:"\u21ff",homtht:"\u223b",hookleftarrow:"\u21a9",hookrightarrow:"\u21aa",hopf:"\ud835\udd59",Hopf:"\u210d",horbar:"\u2015",HorizontalLine:"\u2500",hscr:"\ud835\udcbd",Hscr:"\u210b",hslash:"\u210f",Hstrok:"\u0126",hstrok:"\u0127",HumpDownHump:"\u224e",HumpEqual:"\u224f",hybull:"\u2043",hyphen:"\u2010",Iacute:"\xcd",iacute:"\xed",ic:"\u2063",Icirc:"\xce",icirc:"\xee",Icy:"\u0418",icy:"\u0438",Idot:"\u0130",IEcy:"\u0415",iecy:"\u0435",iexcl:"\xa1",iff:"\u21d4",ifr:"\ud835\udd26",Ifr:"\u2111",Igrave:"\xcc",igrave:"\xec",ii:"\u2148",iiiint:"\u2a0c",iiint:"\u222d",iinfin:"\u29dc",iiota:"\u2129",IJlig:"\u0132",ijlig:"\u0133",Imacr:"\u012a",imacr:"\u012b",image:"\u2111",ImaginaryI:"\u2148",imagline:"\u2110",imagpart:"\u2111",imath:"\u0131",Im:"\u2111",imof:"\u22b7",imped:"\u01b5",Implies:"\u21d2",incare:"\u2105",in:"\u2208",infin:"\u221e",infintie:"\u29dd",inodot:"\u0131",intcal:"\u22ba",int:"\u222b",Int:"\u222c",integers:"\u2124",Integral:"\u222b",intercal:"\u22ba",Intersection:"\u22c2",intlarhk:"\u2a17",intprod:"\u2a3c",InvisibleComma:"\u2063",InvisibleTimes:"\u2062",IOcy:"\u0401",iocy:"\u0451",Iogon:"\u012e",iogon:"\u012f",Iopf:"\ud835\udd40",iopf:"\ud835\udd5a",Iota:"\u0399",iota:"\u03b9",iprod:"\u2a3c",iquest:"\xbf",iscr:"\ud835\udcbe",Iscr:"\u2110",isin:"\u2208",isindot:"\u22f5",isinE:"\u22f9",isins:"\u22f4",isinsv:"\u22f3",isinv:"\u2208",it:"\u2062",Itilde:"\u0128",itilde:"\u0129",Iukcy:"\u0406",iukcy:"\u0456",Iuml:"\xcf",iuml:"\xef",Jcirc:"\u0134",jcirc:"\u0135",Jcy:"\u0419",jcy:"\u0439",Jfr:"\ud835\udd0d",jfr:"\ud835\udd27",jmath:"\u0237",Jopf:"\ud835\udd41",jopf:"\ud835\udd5b",Jscr:"\ud835\udca5",jscr:"\ud835\udcbf",Jsercy:"\u0408",jsercy:"\u0458",Jukcy:"\u0404",jukcy:"\u0454",Kappa:"\u039a",kappa:"\u03ba",kappav:"\u03f0",Kcedil:"\u0136",kcedil:"\u0137",Kcy:"\u041a",kcy:"\u043a",Kfr:"\ud835\udd0e",kfr:"\ud835\udd28",kgreen:"\u0138",KHcy:"\u0425",khcy:"\u0445",KJcy:"\u040c",kjcy:"\u045c",Kopf:"\ud835\udd42",kopf:"\ud835\udd5c",Kscr:"\ud835\udca6",kscr:"\ud835\udcc0",lAarr:"\u21da",Lacute:"\u0139",lacute:"\u013a",laemptyv:"\u29b4",lagran:"\u2112",Lambda:"\u039b",lambda:"\u03bb",lang:"\u27e8",Lang:"\u27ea",langd:"\u2991",langle:"\u27e8",lap:"\u2a85",Laplacetrf:"\u2112",laquo:"\xab",larrb:"\u21e4",larrbfs:"\u291f",larr:"\u2190",Larr:"\u219e",lArr:"\u21d0",larrfs:"\u291d",larrhk:"\u21a9",larrlp:"\u21ab",larrpl:"\u2939",larrsim:"\u2973",larrtl:"\u21a2",latail:"\u2919",lAtail:"\u291b",lat:"\u2aab",late:"\u2aad",lates:"\u2aad\ufe00",lbarr:"\u290c",lBarr:"\u290e",lbbrk:"\u2772",lbrace:"{",lbrack:"[",lbrke:"\u298b",lbrksld:"\u298f",lbrkslu:"\u298d",Lcaron:"\u013d",lcaron:"\u013e",Lcedil:"\u013b",lcedil:"\u013c",lceil:"\u2308",lcub:"{",Lcy:"\u041b",lcy:"\u043b",ldca:"\u2936",ldquo:"\u201c",ldquor:"\u201e",ldrdhar:"\u2967",ldrushar:"\u294b",ldsh:"\u21b2",le:"\u2264",lE:"\u2266",LeftAngleBracket:"\u27e8",LeftArrowBar:"\u21e4",leftarrow:"\u2190",LeftArrow:"\u2190",Leftarrow:"\u21d0",LeftArrowRightArrow:"\u21c6",leftarrowtail:"\u21a2",LeftCeiling:"\u2308",LeftDoubleBracket:"\u27e6",LeftDownTeeVector:"\u2961",LeftDownVectorBar:"\u2959",LeftDownVector:"\u21c3",LeftFloor:"\u230a",leftharpoondown:"\u21bd",leftharpoonup:"\u21bc",leftleftarrows:"\u21c7",leftrightarrow:"\u2194",LeftRightArrow:"\u2194",Leftrightarrow:"\u21d4",leftrightarrows:"\u21c6",leftrightharpoons:"\u21cb",leftrightsquigarrow:"\u21ad",LeftRightVector:"\u294e",LeftTeeArrow:"\u21a4",LeftTee:"\u22a3",LeftTeeVector:"\u295a",leftthreetimes:"\u22cb",LeftTriangleBar:"\u29cf",LeftTriangle:"\u22b2",LeftTriangleEqual:"\u22b4",LeftUpDownVector:"\u2951",LeftUpTeeVector:"\u2960",LeftUpVectorBar:"\u2958",LeftUpVector:"\u21bf",LeftVectorBar:"\u2952",LeftVector:"\u21bc",lEg:"\u2a8b",leg:"\u22da",leq:"\u2264",leqq:"\u2266",leqslant:"\u2a7d",lescc:"\u2aa8",les:"\u2a7d",lesdot:"\u2a7f",lesdoto:"\u2a81",lesdotor:"\u2a83",lesg:"\u22da\ufe00",lesges:"\u2a93",lessapprox:"\u2a85",lessdot:"\u22d6",lesseqgtr:"\u22da",lesseqqgtr:"\u2a8b",LessEqualGreater:"\u22da",LessFullEqual:"\u2266",LessGreater:"\u2276",lessgtr:"\u2276",LessLess:"\u2aa1",lesssim:"\u2272",LessSlantEqual:"\u2a7d",LessTilde:"\u2272",lfisht:"\u297c",lfloor:"\u230a",Lfr:"\ud835\udd0f",lfr:"\ud835\udd29",lg:"\u2276",lgE:"\u2a91",lHar:"\u2962",lhard:"\u21bd",lharu:"\u21bc",lharul:"\u296a",lhblk:"\u2584",LJcy:"\u0409",ljcy:"\u0459",llarr:"\u21c7",ll:"\u226a",Ll:"\u22d8",llcorner:"\u231e",Lleftarrow:"\u21da",llhard:"\u296b",lltri:"\u25fa",Lmidot:"\u013f",lmidot:"\u0140",lmoustache:"\u23b0",lmoust:"\u23b0",lnap:"\u2a89",lnapprox:"\u2a89",lne:"\u2a87",lnE:"\u2268",lneq:"\u2a87",lneqq:"\u2268",lnsim:"\u22e6",loang:"\u27ec",loarr:"\u21fd",lobrk:"\u27e6",longleftarrow:"\u27f5",LongLeftArrow:"\u27f5",Longleftarrow:"\u27f8",longleftrightarrow:"\u27f7",LongLeftRightArrow:"\u27f7",Longleftrightarrow:"\u27fa",longmapsto:"\u27fc",longrightarrow:"\u27f6",LongRightArrow:"\u27f6",Longrightarrow:"\u27f9",looparrowleft:"\u21ab",looparrowright:"\u21ac",lopar:"\u2985",Lopf:"\ud835\udd43",lopf:"\ud835\udd5d",loplus:"\u2a2d",lotimes:"\u2a34",lowast:"\u2217",lowbar:"_",LowerLeftArrow:"\u2199",LowerRightArrow:"\u2198",loz:"\u25ca",lozenge:"\u25ca",lozf:"\u29eb",lpar:"(",lparlt:"\u2993",lrarr:"\u21c6",lrcorner:"\u231f",lrhar:"\u21cb",lrhard:"\u296d",lrm:"\u200e",lrtri:"\u22bf",lsaquo:"\u2039",lscr:"\ud835\udcc1",Lscr:"\u2112",lsh:"\u21b0",Lsh:"\u21b0",lsim:"\u2272",lsime:"\u2a8d",lsimg:"\u2a8f",lsqb:"[",lsquo:"\u2018",lsquor:"\u201a",Lstrok:"\u0141",lstrok:"\u0142",ltcc:"\u2aa6",ltcir:"\u2a79",lt:"<",LT:"<",Lt:"\u226a",ltdot:"\u22d6",lthree:"\u22cb",ltimes:"\u22c9",ltlarr:"\u2976",ltquest:"\u2a7b",ltri:"\u25c3",ltrie:"\u22b4",ltrif:"\u25c2",ltrPar:"\u2996",lurdshar:"\u294a",luruhar:"\u2966",lvertneqq:"\u2268\ufe00",lvnE:"\u2268\ufe00",macr:"\xaf",male:"\u2642",malt:"\u2720",maltese:"\u2720",Map:"\u2905",map:"\u21a6",mapsto:"\u21a6",mapstodown:"\u21a7",mapstoleft:"\u21a4",mapstoup:"\u21a5",marker:"\u25ae",mcomma:"\u2a29",Mcy:"\u041c",mcy:"\u043c",mdash:"\u2014",mDDot:"\u223a",measuredangle:"\u2221",MediumSpace:"\u205f",Mellintrf:"\u2133",Mfr:"\ud835\udd10",mfr:"\ud835\udd2a",mho:"\u2127",micro:"\xb5",midast:"*",midcir:"\u2af0",mid:"\u2223",middot:"\xb7",minusb:"\u229f",minus:"\u2212",minusd:"\u2238",minusdu:"\u2a2a",MinusPlus:"\u2213",mlcp:"\u2adb",mldr:"\u2026",mnplus:"\u2213",models:"\u22a7",Mopf:"\ud835\udd44",mopf:"\ud835\udd5e",mp:"\u2213",mscr:"\ud835\udcc2",Mscr:"\u2133",mstpos:"\u223e",Mu:"\u039c",mu:"\u03bc",multimap:"\u22b8",mumap:"\u22b8",nabla:"\u2207",Nacute:"\u0143",nacute:"\u0144",nang:"\u2220\u20d2",nap:"\u2249",napE:"\u2a70\u0338",napid:"\u224b\u0338",napos:"\u0149",napprox:"\u2249",natural:"\u266e",naturals:"\u2115",natur:"\u266e",nbsp:"\xa0",nbump:"\u224e\u0338",nbumpe:"\u224f\u0338",ncap:"\u2a43",Ncaron:"\u0147",ncaron:"\u0148",Ncedil:"\u0145",ncedil:"\u0146",ncong:"\u2247",ncongdot:"\u2a6d\u0338",ncup:"\u2a42",Ncy:"\u041d",ncy:"\u043d",ndash:"\u2013",nearhk:"\u2924",nearr:"\u2197",neArr:"\u21d7",nearrow:"\u2197",ne:"\u2260",nedot:"\u2250\u0338",NegativeMediumSpace:"\u200b",NegativeThickSpace:"\u200b",NegativeThinSpace:"\u200b",NegativeVeryThinSpace:"\u200b",nequiv:"\u2262",nesear:"\u2928",nesim:"\u2242\u0338",NestedGreaterGreater:"\u226b",NestedLessLess:"\u226a",NewLine:"\n",nexist:"\u2204",nexists:"\u2204",Nfr:"\ud835\udd11",nfr:"\ud835\udd2b",ngE:"\u2267\u0338",nge:"\u2271",ngeq:"\u2271",ngeqq:"\u2267\u0338",ngeqslant:"\u2a7e\u0338",nges:"\u2a7e\u0338",nGg:"\u22d9\u0338",ngsim:"\u2275",nGt:"\u226b\u20d2",ngt:"\u226f",ngtr:"\u226f",nGtv:"\u226b\u0338",nharr:"\u21ae",nhArr:"\u21ce",nhpar:"\u2af2",ni:"\u220b",nis:"\u22fc",nisd:"\u22fa",niv:"\u220b",NJcy:"\u040a",njcy:"\u045a",nlarr:"\u219a",nlArr:"\u21cd",nldr:"\u2025",nlE:"\u2266\u0338",nle:"\u2270",nleftarrow:"\u219a",nLeftarrow:"\u21cd",nleftrightarrow:"\u21ae",nLeftrightarrow:"\u21ce",nleq:"\u2270",nleqq:"\u2266\u0338",nleqslant:"\u2a7d\u0338",nles:"\u2a7d\u0338",nless:"\u226e",nLl:"\u22d8\u0338",nlsim:"\u2274",nLt:"\u226a\u20d2",nlt:"\u226e",nltri:"\u22ea",nltrie:"\u22ec",nLtv:"\u226a\u0338",nmid:"\u2224",NoBreak:"\u2060",NonBreakingSpace:"\xa0",nopf:"\ud835\udd5f",Nopf:"\u2115",Not:"\u2aec",not:"\xac",NotCongruent:"\u2262",NotCupCap:"\u226d",NotDoubleVerticalBar:"\u2226",NotElement:"\u2209",NotEqual:"\u2260",NotEqualTilde:"\u2242\u0338",NotExists:"\u2204",NotGreater:"\u226f",NotGreaterEqual:"\u2271",NotGreaterFullEqual:"\u2267\u0338",NotGreaterGreater:"\u226b\u0338",NotGreaterLess:"\u2279",NotGreaterSlantEqual:"\u2a7e\u0338",NotGreaterTilde:"\u2275",NotHumpDownHump:"\u224e\u0338",NotHumpEqual:"\u224f\u0338",notin:"\u2209",notindot:"\u22f5\u0338",notinE:"\u22f9\u0338",notinva:"\u2209",notinvb:"\u22f7",notinvc:"\u22f6",NotLeftTriangleBar:"\u29cf\u0338",NotLeftTriangle:"\u22ea",NotLeftTriangleEqual:"\u22ec",NotLess:"\u226e",NotLessEqual:"\u2270",NotLessGreater:"\u2278",NotLessLess:"\u226a\u0338",NotLessSlantEqual:"\u2a7d\u0338",NotLessTilde:"\u2274",NotNestedGreaterGreater:"\u2aa2\u0338",NotNestedLessLess:"\u2aa1\u0338",notni:"\u220c",notniva:"\u220c",notnivb:"\u22fe",notnivc:"\u22fd",NotPrecedes:"\u2280",NotPrecedesEqual:"\u2aaf\u0338",NotPrecedesSlantEqual:"\u22e0",NotReverseElement:"\u220c",NotRightTriangleBar:"\u29d0\u0338",NotRightTriangle:"\u22eb",NotRightTriangleEqual:"\u22ed",NotSquareSubset:"\u228f\u0338",NotSquareSubsetEqual:"\u22e2",NotSquareSuperset:"\u2290\u0338",NotSquareSupersetEqual:"\u22e3",NotSubset:"\u2282\u20d2",NotSubsetEqual:"\u2288",NotSucceeds:"\u2281",NotSucceedsEqual:"\u2ab0\u0338",NotSucceedsSlantEqual:"\u22e1",NotSucceedsTilde:"\u227f\u0338",NotSuperset:"\u2283\u20d2",NotSupersetEqual:"\u2289",NotTilde:"\u2241",NotTildeEqual:"\u2244",NotTildeFullEqual:"\u2247",NotTildeTilde:"\u2249",NotVerticalBar:"\u2224",nparallel:"\u2226",npar:"\u2226",nparsl:"\u2afd\u20e5",npart:"\u2202\u0338",npolint:"\u2a14",npr:"\u2280",nprcue:"\u22e0",nprec:"\u2280",npreceq:"\u2aaf\u0338",npre:"\u2aaf\u0338",nrarrc:"\u2933\u0338",nrarr:"\u219b",nrArr:"\u21cf",nrarrw:"\u219d\u0338",nrightarrow:"\u219b",nRightarrow:"\u21cf",nrtri:"\u22eb",nrtrie:"\u22ed",nsc:"\u2281",nsccue:"\u22e1",nsce:"\u2ab0\u0338",Nscr:"\ud835\udca9",nscr:"\ud835\udcc3",nshortmid:"\u2224",nshortparallel:"\u2226",nsim:"\u2241",nsime:"\u2244",nsimeq:"\u2244",nsmid:"\u2224",nspar:"\u2226",nsqsube:"\u22e2",nsqsupe:"\u22e3",nsub:"\u2284",nsubE:"\u2ac5\u0338",nsube:"\u2288",nsubset:"\u2282\u20d2",nsubseteq:"\u2288",nsubseteqq:"\u2ac5\u0338",nsucc:"\u2281",nsucceq:"\u2ab0\u0338",nsup:"\u2285",nsupE:"\u2ac6\u0338",nsupe:"\u2289",nsupset:"\u2283\u20d2",nsupseteq:"\u2289",nsupseteqq:"\u2ac6\u0338",ntgl:"\u2279",Ntilde:"\xd1",ntilde:"\xf1",ntlg:"\u2278",ntriangleleft:"\u22ea",ntrianglelefteq:"\u22ec",ntriangleright:"\u22eb",ntrianglerighteq:"\u22ed",Nu:"\u039d",nu:"\u03bd",num:"#",numero:"\u2116",numsp:"\u2007",nvap:"\u224d\u20d2",nvdash:"\u22ac",nvDash:"\u22ad",nVdash:"\u22ae",nVDash:"\u22af",nvge:"\u2265\u20d2",nvgt:">\u20d2",nvHarr:"\u2904",nvinfin:"\u29de",nvlArr:"\u2902",nvle:"\u2264\u20d2",nvlt:"<\u20d2",nvltrie:"\u22b4\u20d2",nvrArr:"\u2903",nvrtrie:"\u22b5\u20d2",nvsim:"\u223c\u20d2",nwarhk:"\u2923",nwarr:"\u2196",nwArr:"\u21d6",nwarrow:"\u2196",nwnear:"\u2927",Oacute:"\xd3",oacute:"\xf3",oast:"\u229b",Ocirc:"\xd4",ocirc:"\xf4",ocir:"\u229a",Ocy:"\u041e",ocy:"\u043e",odash:"\u229d",Odblac:"\u0150",odblac:"\u0151",odiv:"\u2a38",odot:"\u2299",odsold:"\u29bc",OElig:"\u0152",oelig:"\u0153",ofcir:"\u29bf",Ofr:"\ud835\udd12",ofr:"\ud835\udd2c",ogon:"\u02db",Ograve:"\xd2",ograve:"\xf2",ogt:"\u29c1",ohbar:"\u29b5",ohm:"\u03a9",oint:"\u222e",olarr:"\u21ba",olcir:"\u29be",olcross:"\u29bb",oline:"\u203e",olt:"\u29c0",Omacr:"\u014c",omacr:"\u014d",Omega:"\u03a9",omega:"\u03c9",Omicron:"\u039f",omicron:"\u03bf",omid:"\u29b6",ominus:"\u2296",Oopf:"\ud835\udd46",oopf:"\ud835\udd60",opar:"\u29b7",OpenCurlyDoubleQuote:"\u201c",OpenCurlyQuote:"\u2018",operp:"\u29b9",oplus:"\u2295",orarr:"\u21bb",Or:"\u2a54",or:"\u2228",ord:"\u2a5d",order:"\u2134",orderof:"\u2134",ordf:"\xaa",ordm:"\xba",origof:"\u22b6",oror:"\u2a56",orslope:"\u2a57",orv:"\u2a5b",oS:"\u24c8",Oscr:"\ud835\udcaa",oscr:"\u2134",Oslash:"\xd8",oslash:"\xf8",osol:"\u2298",Otilde:"\xd5",otilde:"\xf5",otimesas:"\u2a36",Otimes:"\u2a37",otimes:"\u2297",Ouml:"\xd6",ouml:"\xf6",ovbar:"\u233d",OverBar:"\u203e",OverBrace:"\u23de",OverBracket:"\u23b4",OverParenthesis:"\u23dc",para:"\xb6",parallel:"\u2225",par:"\u2225",parsim:"\u2af3",parsl:"\u2afd",part:"\u2202",PartialD:"\u2202",Pcy:"\u041f",pcy:"\u043f",percnt:"%",period:".",permil:"\u2030",perp:"\u22a5",pertenk:"\u2031",Pfr:"\ud835\udd13",pfr:"\ud835\udd2d",Phi:"\u03a6",phi:"\u03c6",phiv:"\u03d5",phmmat:"\u2133",phone:"\u260e",Pi:"\u03a0",pi:"\u03c0",pitchfork:"\u22d4",piv:"\u03d6",planck:"\u210f",planckh:"\u210e",plankv:"\u210f",plusacir:"\u2a23",plusb:"\u229e",pluscir:"\u2a22",plus:"+",plusdo:"\u2214",plusdu:"\u2a25",pluse:"\u2a72",PlusMinus:"\xb1",plusmn:"\xb1",plussim:"\u2a26",plustwo:"\u2a27",pm:"\xb1",Poincareplane:"\u210c",pointint:"\u2a15",popf:"\ud835\udd61",Popf:"\u2119",pound:"\xa3",prap:"\u2ab7",Pr:"\u2abb",pr:"\u227a",prcue:"\u227c",precapprox:"\u2ab7",prec:"\u227a",preccurlyeq:"\u227c",Precedes:"\u227a",PrecedesEqual:"\u2aaf",PrecedesSlantEqual:"\u227c",PrecedesTilde:"\u227e",preceq:"\u2aaf",precnapprox:"\u2ab9",precneqq:"\u2ab5",precnsim:"\u22e8",pre:"\u2aaf",prE:"\u2ab3",precsim:"\u227e",prime:"\u2032",Prime:"\u2033",primes:"\u2119",prnap:"\u2ab9",prnE:"\u2ab5",prnsim:"\u22e8",prod:"\u220f",Product:"\u220f",profalar:"\u232e",profline:"\u2312",profsurf:"\u2313",prop:"\u221d",Proportional:"\u221d",Proportion:"\u2237",propto:"\u221d",prsim:"\u227e",prurel:"\u22b0",Pscr:"\ud835\udcab",pscr:"\ud835\udcc5",Psi:"\u03a8",psi:"\u03c8",puncsp:"\u2008",Qfr:"\ud835\udd14",qfr:"\ud835\udd2e",qint:"\u2a0c",qopf:"\ud835\udd62",Qopf:"\u211a",qprime:"\u2057",Qscr:"\ud835\udcac",qscr:"\ud835\udcc6",quaternions:"\u210d",quatint:"\u2a16",quest:"?",questeq:"\u225f",quot:'"',QUOT:'"',rAarr:"\u21db",race:"\u223d\u0331",Racute:"\u0154",racute:"\u0155",radic:"\u221a",raemptyv:"\u29b3",rang:"\u27e9",Rang:"\u27eb",rangd:"\u2992",range:"\u29a5",rangle:"\u27e9",raquo:"\xbb",rarrap:"\u2975",rarrb:"\u21e5",rarrbfs:"\u2920",rarrc:"\u2933",rarr:"\u2192",Rarr:"\u21a0",rArr:"\u21d2",rarrfs:"\u291e",rarrhk:"\u21aa",rarrlp:"\u21ac",rarrpl:"\u2945",rarrsim:"\u2974",Rarrtl:"\u2916",rarrtl:"\u21a3",rarrw:"\u219d",ratail:"\u291a",rAtail:"\u291c",ratio:"\u2236",rationals:"\u211a",rbarr:"\u290d",rBarr:"\u290f",RBarr:"\u2910",rbbrk:"\u2773",rbrace:"}",rbrack:"]",rbrke:"\u298c",rbrksld:"\u298e",rbrkslu:"\u2990",Rcaron:"\u0158",rcaron:"\u0159",Rcedil:"\u0156",rcedil:"\u0157",rceil:"\u2309",rcub:"}",Rcy:"\u0420",rcy:"\u0440",rdca:"\u2937",rdldhar:"\u2969",rdquo:"\u201d",rdquor:"\u201d",rdsh:"\u21b3",real:"\u211c",realine:"\u211b",realpart:"\u211c",reals:"\u211d",Re:"\u211c",rect:"\u25ad",reg:"\xae",REG:"\xae",ReverseElement:"\u220b",ReverseEquilibrium:"\u21cb",ReverseUpEquilibrium:"\u296f",rfisht:"\u297d",rfloor:"\u230b",rfr:"\ud835\udd2f",Rfr:"\u211c",rHar:"\u2964",rhard:"\u21c1",rharu:"\u21c0",rharul:"\u296c",Rho:"\u03a1",rho:"\u03c1",rhov:"\u03f1",RightAngleBracket:"\u27e9",RightArrowBar:"\u21e5",rightarrow:"\u2192",RightArrow:"\u2192",Rightarrow:"\u21d2",RightArrowLeftArrow:"\u21c4",rightarrowtail:"\u21a3",RightCeiling:"\u2309",RightDoubleBracket:"\u27e7",RightDownTeeVector:"\u295d",RightDownVectorBar:"\u2955",RightDownVector:"\u21c2",RightFloor:"\u230b",rightharpoondown:"\u21c1",rightharpoonup:"\u21c0",rightleftarrows:"\u21c4",rightleftharpoons:"\u21cc",rightrightarrows:"\u21c9",rightsquigarrow:"\u219d",RightTeeArrow:"\u21a6",RightTee:"\u22a2",RightTeeVector:"\u295b",rightthreetimes:"\u22cc",RightTriangleBar:"\u29d0",RightTriangle:"\u22b3",RightTriangleEqual:"\u22b5",RightUpDownVector:"\u294f",RightUpTeeVector:"\u295c",RightUpVectorBar:"\u2954",RightUpVector:"\u21be",RightVectorBar:"\u2953",RightVector:"\u21c0",ring:"\u02da",risingdotseq:"\u2253",rlarr:"\u21c4",rlhar:"\u21cc",rlm:"\u200f",rmoustache:"\u23b1",rmoust:"\u23b1",rnmid:"\u2aee",roang:"\u27ed",roarr:"\u21fe",robrk:"\u27e7",ropar:"\u2986",ropf:"\ud835\udd63",Ropf:"\u211d",roplus:"\u2a2e",rotimes:"\u2a35",RoundImplies:"\u2970",rpar:")",rpargt:"\u2994",rppolint:"\u2a12",rrarr:"\u21c9",Rrightarrow:"\u21db",rsaquo:"\u203a",rscr:"\ud835\udcc7",Rscr:"\u211b",rsh:"\u21b1",Rsh:"\u21b1",rsqb:"]",rsquo:"\u2019",rsquor:"\u2019",rthree:"\u22cc",rtimes:"\u22ca",rtri:"\u25b9",rtrie:"\u22b5",rtrif:"\u25b8",rtriltri:"\u29ce",RuleDelayed:"\u29f4",ruluhar:"\u2968",rx:"\u211e",Sacute:"\u015a",sacute:"\u015b",sbquo:"\u201a",scap:"\u2ab8",Scaron:"\u0160",scaron:"\u0161",Sc:"\u2abc",sc:"\u227b",sccue:"\u227d",sce:"\u2ab0",scE:"\u2ab4",Scedil:"\u015e",scedil:"\u015f",Scirc:"\u015c",scirc:"\u015d",scnap:"\u2aba",scnE:"\u2ab6",scnsim:"\u22e9",scpolint:"\u2a13",scsim:"\u227f",Scy:"\u0421",scy:"\u0441",sdotb:"\u22a1",sdot:"\u22c5",sdote:"\u2a66",searhk:"\u2925",searr:"\u2198",seArr:"\u21d8",searrow:"\u2198",sect:"\xa7",semi:";",seswar:"\u2929",setminus:"\u2216",setmn:"\u2216",sext:"\u2736",Sfr:"\ud835\udd16",sfr:"\ud835\udd30",sfrown:"\u2322",sharp:"\u266f",SHCHcy:"\u0429",shchcy:"\u0449",SHcy:"\u0428",shcy:"\u0448",ShortDownArrow:"\u2193",ShortLeftArrow:"\u2190",shortmid:"\u2223",shortparallel:"\u2225",ShortRightArrow:"\u2192",ShortUpArrow:"\u2191",shy:"\xad",Sigma:"\u03a3",sigma:"\u03c3",sigmaf:"\u03c2",sigmav:"\u03c2",sim:"\u223c",simdot:"\u2a6a",sime:"\u2243",simeq:"\u2243",simg:"\u2a9e",simgE:"\u2aa0",siml:"\u2a9d",simlE:"\u2a9f",simne:"\u2246",simplus:"\u2a24",simrarr:"\u2972",slarr:"\u2190",SmallCircle:"\u2218",smallsetminus:"\u2216",smashp:"\u2a33",smeparsl:"\u29e4",smid:"\u2223",smile:"\u2323",smt:"\u2aaa",smte:"\u2aac",smtes:"\u2aac\ufe00",SOFTcy:"\u042c",softcy:"\u044c",solbar:"\u233f",solb:"\u29c4",sol:"/",Sopf:"\ud835\udd4a",sopf:"\ud835\udd64",spades:"\u2660",spadesuit:"\u2660",spar:"\u2225",sqcap:"\u2293",sqcaps:"\u2293\ufe00",sqcup:"\u2294",sqcups:"\u2294\ufe00",Sqrt:"\u221a",sqsub:"\u228f",sqsube:"\u2291",sqsubset:"\u228f",sqsubseteq:"\u2291",sqsup:"\u2290",sqsupe:"\u2292",sqsupset:"\u2290",sqsupseteq:"\u2292",square:"\u25a1",Square:"\u25a1",SquareIntersection:"\u2293",SquareSubset:"\u228f",SquareSubsetEqual:"\u2291",SquareSuperset:"\u2290",SquareSupersetEqual:"\u2292",SquareUnion:"\u2294",squarf:"\u25aa",squ:"\u25a1",squf:"\u25aa",srarr:"\u2192",Sscr:"\ud835\udcae",sscr:"\ud835\udcc8",ssetmn:"\u2216",ssmile:"\u2323",sstarf:"\u22c6",Star:"\u22c6",star:"\u2606",starf:"\u2605",straightepsilon:"\u03f5",straightphi:"\u03d5",strns:"\xaf",sub:"\u2282",Sub:"\u22d0",subdot:"\u2abd",subE:"\u2ac5",sube:"\u2286",subedot:"\u2ac3",submult:"\u2ac1",subnE:"\u2acb",subne:"\u228a",subplus:"\u2abf",subrarr:"\u2979",subset:"\u2282",Subset:"\u22d0",subseteq:"\u2286",subseteqq:"\u2ac5",SubsetEqual:"\u2286",subsetneq:"\u228a",subsetneqq:"\u2acb",subsim:"\u2ac7",subsub:"\u2ad5",subsup:"\u2ad3",succapprox:"\u2ab8",succ:"\u227b",succcurlyeq:"\u227d",Succeeds:"\u227b",SucceedsEqual:"\u2ab0",SucceedsSlantEqual:"\u227d",SucceedsTilde:"\u227f",succeq:"\u2ab0",succnapprox:"\u2aba",succneqq:"\u2ab6",succnsim:"\u22e9",succsim:"\u227f",SuchThat:"\u220b",sum:"\u2211",Sum:"\u2211",sung:"\u266a",sup1:"\xb9",sup2:"\xb2",sup3:"\xb3",sup:"\u2283",Sup:"\u22d1",supdot:"\u2abe",supdsub:"\u2ad8",supE:"\u2ac6",supe:"\u2287",supedot:"\u2ac4",Superset:"\u2283",SupersetEqual:"\u2287",suphsol:"\u27c9",suphsub:"\u2ad7",suplarr:"\u297b",supmult:"\u2ac2",supnE:"\u2acc",supne:"\u228b",supplus:"\u2ac0",supset:"\u2283",Supset:"\u22d1",supseteq:"\u2287",supseteqq:"\u2ac6",supsetneq:"\u228b",supsetneqq:"\u2acc",supsim:"\u2ac8",supsub:"\u2ad4",supsup:"\u2ad6",swarhk:"\u2926",swarr:"\u2199",swArr:"\u21d9",swarrow:"\u2199",swnwar:"\u292a",szlig:"\xdf",Tab:"\t",target:"\u2316",Tau:"\u03a4",tau:"\u03c4",tbrk:"\u23b4",Tcaron:"\u0164",tcaron:"\u0165",Tcedil:"\u0162",tcedil:"\u0163",Tcy:"\u0422",tcy:"\u0442",tdot:"\u20db",telrec:"\u2315",Tfr:"\ud835\udd17",tfr:"\ud835\udd31",there4:"\u2234",therefore:"\u2234",Therefore:"\u2234",Theta:"\u0398",theta:"\u03b8",thetasym:"\u03d1",thetav:"\u03d1",thickapprox:"\u2248",thicksim:"\u223c",ThickSpace:"\u205f\u200a",ThinSpace:"\u2009",thinsp:"\u2009",thkap:"\u2248",thksim:"\u223c",THORN:"\xde",thorn:"\xfe",tilde:"\u02dc",Tilde:"\u223c",TildeEqual:"\u2243",TildeFullEqual:"\u2245",TildeTilde:"\u2248",timesbar:"\u2a31",timesb:"\u22a0",times:"\xd7",timesd:"\u2a30",tint:"\u222d",toea:"\u2928",topbot:"\u2336",topcir:"\u2af1",top:"\u22a4",Topf:"\ud835\udd4b",topf:"\ud835\udd65",topfork:"\u2ada",tosa:"\u2929",tprime:"\u2034",trade:"\u2122",TRADE:"\u2122",triangle:"\u25b5",triangledown:"\u25bf",triangleleft:"\u25c3",trianglelefteq:"\u22b4",triangleq:"\u225c",triangleright:"\u25b9",trianglerighteq:"\u22b5",tridot:"\u25ec",trie:"\u225c",triminus:"\u2a3a",TripleDot:"\u20db",triplus:"\u2a39",trisb:"\u29cd",tritime:"\u2a3b",trpezium:"\u23e2",Tscr:"\ud835\udcaf",tscr:"\ud835\udcc9",TScy:"\u0426",tscy:"\u0446",TSHcy:"\u040b",tshcy:"\u045b",Tstrok:"\u0166",tstrok:"\u0167",twixt:"\u226c",twoheadleftarrow:"\u219e",twoheadrightarrow:"\u21a0",Uacute:"\xda",uacute:"\xfa",uarr:"\u2191",Uarr:"\u219f",uArr:"\u21d1",Uarrocir:"\u2949",Ubrcy:"\u040e",ubrcy:"\u045e",Ubreve:"\u016c",ubreve:"\u016d",Ucirc:"\xdb",ucirc:"\xfb",Ucy:"\u0423",ucy:"\u0443",udarr:"\u21c5",Udblac:"\u0170",udblac:"\u0171",udhar:"\u296e",ufisht:"\u297e",Ufr:"\ud835\udd18",ufr:"\ud835\udd32",Ugrave:"\xd9",ugrave:"\xf9",uHar:"\u2963",uharl:"\u21bf",uharr:"\u21be",uhblk:"\u2580",ulcorn:"\u231c",ulcorner:"\u231c",ulcrop:"\u230f",ultri:"\u25f8",Umacr:"\u016a",umacr:"\u016b",uml:"\xa8",UnderBar:"_",UnderBrace:"\u23df",UnderBracket:"\u23b5",UnderParenthesis:"\u23dd",Union:"\u22c3",UnionPlus:"\u228e",Uogon:"\u0172",uogon:"\u0173",Uopf:"\ud835\udd4c",uopf:"\ud835\udd66",UpArrowBar:"\u2912",uparrow:"\u2191",UpArrow:"\u2191",Uparrow:"\u21d1",UpArrowDownArrow:"\u21c5",updownarrow:"\u2195",UpDownArrow:"\u2195",Updownarrow:"\u21d5",UpEquilibrium:"\u296e",upharpoonleft:"\u21bf",upharpoonright:"\u21be",uplus:"\u228e",UpperLeftArrow:"\u2196",UpperRightArrow:"\u2197",upsi:"\u03c5",Upsi:"\u03d2",upsih:"\u03d2",Upsilon:"\u03a5",upsilon:"\u03c5",UpTeeArrow:"\u21a5",UpTee:"\u22a5",upuparrows:"\u21c8",urcorn:"\u231d",urcorner:"\u231d",urcrop:"\u230e",Uring:"\u016e",uring:"\u016f",urtri:"\u25f9",Uscr:"\ud835\udcb0",uscr:"\ud835\udcca",utdot:"\u22f0",Utilde:"\u0168",utilde:"\u0169",utri:"\u25b5",utrif:"\u25b4",uuarr:"\u21c8",Uuml:"\xdc",uuml:"\xfc",uwangle:"\u29a7",vangrt:"\u299c",varepsilon:"\u03f5",varkappa:"\u03f0",varnothing:"\u2205",varphi:"\u03d5",varpi:"\u03d6",varpropto:"\u221d",varr:"\u2195",vArr:"\u21d5",varrho:"\u03f1",varsigma:"\u03c2",varsubsetneq:"\u228a\ufe00",varsubsetneqq:"\u2acb\ufe00",varsupsetneq:"\u228b\ufe00",varsupsetneqq:"\u2acc\ufe00",vartheta:"\u03d1",vartriangleleft:"\u22b2",vartriangleright:"\u22b3",vBar:"\u2ae8",Vbar:"\u2aeb",vBarv:"\u2ae9",Vcy:"\u0412",vcy:"\u0432",vdash:"\u22a2",vDash:"\u22a8",Vdash:"\u22a9",VDash:"\u22ab",Vdashl:"\u2ae6",veebar:"\u22bb",vee:"\u2228",Vee:"\u22c1",veeeq:"\u225a",vellip:"\u22ee",verbar:"|",Verbar:"\u2016",vert:"|",Vert:"\u2016",VerticalBar:"\u2223",VerticalLine:"|",VerticalSeparator:"\u2758",VerticalTilde:"\u2240",VeryThinSpace:"\u200a",Vfr:"\ud835\udd19",vfr:"\ud835\udd33",vltri:"\u22b2",vnsub:"\u2282\u20d2",vnsup:"\u2283\u20d2",Vopf:"\ud835\udd4d",vopf:"\ud835\udd67",vprop:"\u221d",vrtri:"\u22b3",Vscr:"\ud835\udcb1",vscr:"\ud835\udccb",vsubnE:"\u2acb\ufe00",vsubne:"\u228a\ufe00",vsupnE:"\u2acc\ufe00",vsupne:"\u228b\ufe00",Vvdash:"\u22aa",vzigzag:"\u299a",Wcirc:"\u0174",wcirc:"\u0175",wedbar:"\u2a5f",wedge:"\u2227",Wedge:"\u22c0",wedgeq:"\u2259",weierp:"\u2118",Wfr:"\ud835\udd1a",wfr:"\ud835\udd34",Wopf:"\ud835\udd4e",wopf:"\ud835\udd68",wp:"\u2118",wr:"\u2240",wreath:"\u2240",Wscr:"\ud835\udcb2",wscr:"\ud835\udccc",xcap:"\u22c2",xcirc:"\u25ef",xcup:"\u22c3",xdtri:"\u25bd",Xfr:"\ud835\udd1b",xfr:"\ud835\udd35",xharr:"\u27f7",xhArr:"\u27fa",Xi:"\u039e",xi:"\u03be",xlarr:"\u27f5",xlArr:"\u27f8",xmap:"\u27fc",xnis:"\u22fb",xodot:"\u2a00",Xopf:"\ud835\udd4f",xopf:"\ud835\udd69",xoplus:"\u2a01",xotime:"\u2a02",xrarr:"\u27f6",xrArr:"\u27f9",Xscr:"\ud835\udcb3",xscr:"\ud835\udccd",xsqcup:"\u2a06",xuplus:"\u2a04",xutri:"\u25b3",xvee:"\u22c1",xwedge:"\u22c0",Yacute:"\xdd",yacute:"\xfd",YAcy:"\u042f",yacy:"\u044f",Ycirc:"\u0176",ycirc:"\u0177",Ycy:"\u042b",ycy:"\u044b",yen:"\xa5",Yfr:"\ud835\udd1c",yfr:"\ud835\udd36",YIcy:"\u0407",yicy:"\u0457",Yopf:"\ud835\udd50",yopf:"\ud835\udd6a",Yscr:"\ud835\udcb4",yscr:"\ud835\udcce",YUcy:"\u042e",yucy:"\u044e",yuml:"\xff",Yuml:"\u0178",Zacute:"\u0179",zacute:"\u017a",Zcaron:"\u017d",zcaron:"\u017e",Zcy:"\u0417",zcy:"\u0437",Zdot:"\u017b",zdot:"\u017c",zeetrf:"\u2128",ZeroWidthSpace:"\u200b",Zeta:"\u0396",zeta:"\u03b6",zfr:"\ud835\udd37",Zfr:"\u2128",ZHcy:"\u0416",zhcy:"\u0436",zigrarr:"\u21dd",zopf:"\ud835\udd6b",Zopf:"\u2124",Zscr:"\ud835\udcb5",zscr:"\ud835\udccf",zwj:"\u200d",zwnj:"\u200c"},t=/[!-#%-\*,-\/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0A76\u0AF0\u0C84\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E4E\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD803[\uDF55-\uDF59]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC8\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDC3B\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71\uDEF7\uDEF8]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD81B[\uDE97-\uDE9A]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/,n={};function s(e,r,t){var o,i,a,c,l,u="";for("string"!=typeof r&&(t=r,r=s.defaultChars),void 0===t&&(t=!0),l=function(e){var r,t,s=n[e];if(s)return s;for(s=n[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),/^[0-9a-z]$/i.test(t)?s.push(t):s.push("%"+("0"+r.toString(16).toUpperCase()).slice(-2));for(r=0;r<e.length;r++)s[e.charCodeAt(r)]=e[r];return s}(r),o=0,i=e.length;o<i;o++)if(a=e.charCodeAt(o),t&&37===a&&o+2<i&&/^[0-9a-f]{2}$/i.test(e.slice(o+1,o+3)))u+=e.slice(o,o+3),o+=2;else if(a<128)u+=l[a];else if(a>=55296&&a<=57343){if(a>=55296&&a<=56319&&o+1<i&&(c=e.charCodeAt(o+1))>=56320&&c<=57343){u+=encodeURIComponent(e[o]+e[o+1]),o++;continue}u+="%EF%BF%BD"}else u+=encodeURIComponent(e[o]);return u}s.defaultChars=";/?:@&=+$,-_.!~*'()#",s.componentChars="-_.!~*'()";var o=s,i={};function a(e,r){var t;return"string"!=typeof r&&(r=a.defaultChars),t=function(e){var r,t,n=i[e];if(n)return n;for(n=i[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),n.push(t);for(r=0;r<e.length;r++)n[t=e.charCodeAt(r)]="%"+("0"+t.toString(16).toUpperCase()).slice(-2);return n}(r),e.replace(/(%[a-f0-9]{2})+/gi,(function(e){var r,n,s,o,i,a,c,l="";for(r=0,n=e.length;r<n;r+=3)(s=parseInt(e.slice(r+1,r+3),16))<128?l+=t[s]:192==(224&s)&&r+3<n&&128==(192&(o=parseInt(e.slice(r+4,r+6),16)))?(l+=(c=s<<6&1984|63&o)<128?"\ufffd\ufffd":String.fromCharCode(c),r+=3):224==(240&s)&&r+6<n&&(o=parseInt(e.slice(r+4,r+6),16),i=parseInt(e.slice(r+7,r+9),16),128==(192&o)&&128==(192&i))?(l+=(c=s<<12&61440|o<<6&4032|63&i)<2048||c>=55296&&c<=57343?"\ufffd\ufffd\ufffd":String.fromCharCode(c),r+=6):240==(248&s)&&r+9<n&&(o=parseInt(e.slice(r+4,r+6),16),i=parseInt(e.slice(r+7,r+9),16),a=parseInt(e.slice(r+10,r+12),16),128==(192&o)&&128==(192&i)&&128==(192&a))?((c=s<<18&1835008|o<<12&258048|i<<6&4032|63&a)<65536||c>1114111?l+="\ufffd\ufffd\ufffd\ufffd":(c-=65536,l+=String.fromCharCode(55296+(c>>10),56320+(1023&c))),r+=9):l+="\ufffd";return l}))}a.defaultChars=";/?:@&=+$,#",a.componentChars="";var c=a;function l(){this.protocol=null,this.slashes=null,this.auth=null,this.port=null,this.hostname=null,this.hash=null,this.search=null,this.pathname=null}var u=/^([a-z0-9.+-]+:)/i,p=/:[0-9]*$/,h=/^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/,f=["{","}","|","\\","^","`"].concat(["<",">",'"',"`"," ","\r","\n","\t"]),d=["'"].concat(f),m=["%","/","?",";","#"].concat(d),g=["/","?","#"],_=/^[+a-z0-9A-Z_-]{0,63}$/,k=/^([+a-z0-9A-Z_-]{0,63})(.*)$/,b={javascript:!0,"javascript:":!0},v={http:!0,https:!0,ftp:!0,gopher:!0,file:!0,"http:":!0,"https:":!0,"ftp:":!0,"gopher:":!0,"file:":!0};l.prototype.parse=function(e,r){var t,n,s,o,i,a=e;if(a=a.trim(),!r&&1===e.split("#").length){var c=h.exec(a);if(c)return this.pathname=c[1],c[2]&&(this.search=c[2]),this}var l=u.exec(a);if(l&&(s=(l=l[0]).toLowerCase(),this.protocol=l,a=a.substr(l.length)),(r||l||a.match(/^\/\/[^@\/]+@[^@\/]+/))&&(!(i="//"===a.substr(0,2))||l&&b[l]||(a=a.substr(2),this.slashes=!0)),!b[l]&&(i||l&&!v[l])){var p,f,d=-1;for(t=0;t<g.length;t++)-1!==(o=a.indexOf(g[t]))&&(-1===d||o<d)&&(d=o);for(-1!==(f=-1===d?a.lastIndexOf("@"):a.lastIndexOf("@",d))&&(p=a.slice(0,f),a=a.slice(f+1),this.auth=p),d=-1,t=0;t<m.length;t++)-1!==(o=a.indexOf(m[t]))&&(-1===d||o<d)&&(d=o);-1===d&&(d=a.length),":"===a[d-1]&&d--;var C=a.slice(0,d);a=a.slice(d),this.parseHost(C),this.hostname=this.hostname||"";var y="["===this.hostname[0]&&"]"===this.hostname[this.hostname.length-1];if(!y){var A=this.hostname.split(/\./);for(t=0,n=A.length;t<n;t++){var x=A[t];if(x&&!x.match(_)){for(var D="",w=0,E=x.length;w<E;w++)x.charCodeAt(w)>127?D+="x":D+=x[w];if(!D.match(_)){var q=A.slice(0,t),S=A.slice(t+1),F=x.match(k);F&&(q.push(F[1]),S.unshift(F[2])),S.length&&(a=S.join(".")+a),this.hostname=q.join(".");break}}}}this.hostname.length>255&&(this.hostname=""),y&&(this.hostname=this.hostname.substr(1,this.hostname.length-2))}var L=a.indexOf("#");-1!==L&&(this.hash=a.substr(L),a=a.slice(0,L));var z=a.indexOf("?");return-1!==z&&(this.search=a.substr(z),a=a.slice(0,z)),a&&(this.pathname=a),v[s]&&this.hostname&&!this.pathname&&(this.pathname=""),this},l.prototype.parseHost=function(e){var r=p.exec(e);r&&(":"!==(r=r[0])&&(this.port=r.substr(1)),e=e.substr(0,e.length-r.length)),e&&(this.hostname=e)};var C={encode:o,decode:c,format:function(e){var r="";return r+=e.protocol||"",r+=e.slashes?"//":"",r+=e.auth?e.auth+"@":"",e.hostname&&-1!==e.hostname.indexOf(":")?r+="["+e.hostname+"]":r+=e.hostname||"",r+=e.port?":"+e.port:"",r+=e.pathname||"",r+=e.search||"",r+=e.hash||""},parse:function(e,r){if(e&&e instanceof l)return e;var t=new l;return t.parse(e,r),t}},y=/[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/,A=/[\0-\x1F\x7F-\x9F]/,x=/[ \xA0\u1680\u2000-\u200A\u2028\u2029\u202F\u205F\u3000]/,D={Any:y,Cc:A,Cf:/[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804[\uDCBD\uDCCD]|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/,P:t,Z:x},w=function(e,r,t){return t={path:r,exports:{},require:function(e,r){return function(){throw new Error("Dynamic requires are not currently supported by @rollup/plugin-commonjs")}(null==r&&t.path)}},e(t,t.exports),t.exports}((function(e,n){var s=Object.prototype.hasOwnProperty;function o(e,r){return s.call(e,r)}function i(e){return!(e>=55296&&e<=57343)&&(!(e>=64976&&e<=65007)&&(65535!=(65535&e)&&65534!=(65535&e)&&(!(e>=0&&e<=8)&&(11!==e&&(!(e>=14&&e<=31)&&(!(e>=127&&e<=159)&&!(e>1114111)))))))}function a(e){if(e>65535){var r=55296+((e-=65536)>>10),t=56320+(1023&e);return String.fromCharCode(r,t)}return String.fromCharCode(e)}var c=/\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g,l=new RegExp(c.source+"|"+/&([a-z#][a-z0-9]{1,31});/gi.source,"gi"),u=/^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i;var p=/[&<>"]/,h=/[&<>"]/g,f={"&":"&","<":"<",">":">",'"':"""};function d(e){return f[e]}var m=/[.?*+^$[\]\\(){}|-]/g;n.lib={},n.lib.mdurl=C,n.lib.ucmicro=D,n.assign=function(e){var r=Array.prototype.slice.call(arguments,1);return r.forEach((function(r){if(r){if("object"!=typeof r)throw new TypeError(r+"must be object");Object.keys(r).forEach((function(t){e[t]=r[t]}))}})),e},n.isString=function(e){return"[object String]"===function(e){return Object.prototype.toString.call(e)}(e)},n.has=o,n.unescapeMd=function(e){return e.indexOf("\\")<0?e:e.replace(c,"$1")},n.unescapeAll=function(e){return e.indexOf("\\")<0&&e.indexOf("&")<0?e:e.replace(l,(function(e,t,n){return t||function(e,t){var n=0;return o(r,t)?r[t]:35===t.charCodeAt(0)&&u.test(t)&&i(n="x"===t[1].toLowerCase()?parseInt(t.slice(2),16):parseInt(t.slice(1),10))?a(n):e}(e,n)}))},n.isValidEntityCode=i,n.fromCodePoint=a,n.escapeHtml=function(e){return p.test(e)?e.replace(h,d):e},n.arrayReplaceAt=function(e,r,t){return[].concat(e.slice(0,r),t,e.slice(r+1))},n.isSpace=function(e){switch(e){case 9:case 32:return!0}return!1},n.isWhiteSpace=function(e){if(e>=8192&&e<=8202)return!0;switch(e){case 9:case 10:case 11:case 12:case 13:case 32:case 160:case 5760:case 8239:case 8287:case 12288:return!0}return!1},n.isMdAsciiPunct=function(e){switch(e){case 33:case 34:case 35:case 36:case 37:case 38:case 39:case 40:case 41:case 42:case 43:case 44:case 45:case 46:case 47:case 58:case 59:case 60:case 61:case 62:case 63:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 124:case 125:case 126:return!0;default:return!1}},n.isPunctChar=function(e){return t.test(e)},n.escapeRE=function(e){return e.replace(m,"\\$&")},n.normalizeReference=function(e){return e=e.trim().replace(/\s+/g," "),"\u1e7e"==="\u1e9e".toLowerCase()&&(e=e.replace(/\u1e9e/g,"\xdf")),e.toLowerCase().toUpperCase()}})),E=w.unescapeAll,q=w.unescapeAll,S=function(e,r,t){var n,s,o=r,i={ok:!1,pos:0,lines:0,str:""};if(60===e.charCodeAt(r)){for(r++;r<t;){if(10===(n=e.charCodeAt(r)))return i;if(60===n)return i;if(62===n)return i.pos=r+1,i.str=E(e.slice(o+1,r)),i.ok=!0,i;92===n&&r+1<t?r+=2:r++}return i}for(s=0;r<t&&32!==(n=e.charCodeAt(r))&&!(n<32||127===n);)if(92===n&&r+1<t){if(32===e.charCodeAt(r+1))break;r+=2}else{if(40===n&&++s>32)return i;if(41===n){if(0===s)break;s--}r++}return o===r||0!==s||(i.str=E(e.slice(o,r)),i.lines=0,i.pos=r,i.ok=!0),i},F=function(e,r,t){var n,s,o=0,i=r,a={ok:!1,pos:0,lines:0,str:""};if(r>=t)return a;if(34!==(s=e.charCodeAt(r))&&39!==s&&40!==s)return a;for(r++,40===s&&(s=41);r<t;){if((n=e.charCodeAt(r))===s)return a.pos=r+1,a.lines=o,a.str=q(e.slice(i+1,r)),a.ok=!0,a;if(40===n&&41===s)return a;10===n?o++:92===n&&r+1<t&&(r++,10===e.charCodeAt(r)&&o++),r++}return a},L={parseLinkLabel:function(e,r,t){var n,s,o,i,a=-1,c=e.posMax,l=e.pos;for(e.pos=r+1,n=1;e.pos<c;){if(93===(o=e.src.charCodeAt(e.pos))&&0===--n){s=!0;break}if(i=e.pos,e.md.inline.skipToken(e),91===o)if(i===e.pos-1)n++;else if(t)return e.pos=l,-1}return s&&(a=e.pos),e.pos=l,a},parseLinkDestination:S,parseLinkTitle:F},z=w.assign,T=w.unescapeAll,I=w.escapeHtml,M={};function R(){this.rules=z({},M)}M.code_inline=function(e,r,t,n,s){var o=e[r];return"<code"+s.renderAttrs(o)+">"+I(e[r].content)+"</code>"},M.code_block=function(e,r,t,n,s){var o=e[r];return"<pre"+s.renderAttrs(o)+"><code>"+I(e[r].content)+"</code></pre>\n"},M.fence=function(e,r,t,n,s){var o,i,a,c,l,u=e[r],p=u.info?T(u.info).trim():"",h="",f="";return p&&(h=(a=p.split(/(\s+)/g))[0],f=a.slice(2).join("")),0===(o=t.highlight&&t.highlight(u.content,h,f)||I(u.content)).indexOf("<pre")?o+"\n":p?(i=u.attrIndex("class"),c=u.attrs?u.attrs.slice():[],i<0?c.push(["class",t.langPrefix+h]):(c[i]=c[i].slice(),c[i][1]+=" "+t.langPrefix+h),l={attrs:c},"<pre><code"+s.renderAttrs(l)+">"+o+"</code></pre>\n"):"<pre><code"+s.renderAttrs(u)+">"+o+"</code></pre>\n"},M.image=function(e,r,t,n,s){var o=e[r];return o.attrs[o.attrIndex("alt")][1]=s.renderInlineAsText(o.children,t,n),s.renderToken(e,r,t)},M.hardbreak=function(e,r,t){return t.xhtmlOut?"<br />\n":"<br>\n"},M.softbreak=function(e,r,t){return t.breaks?t.xhtmlOut?"<br />\n":"<br>\n":"\n"},M.text=function(e,r){return I(e[r].content)},M.html_block=function(e,r){return e[r].content},M.html_inline=function(e,r){return e[r].content},R.prototype.renderAttrs=function(e){var r,t,n;if(!e.attrs)return"";for(n="",r=0,t=e.attrs.length;r<t;r++)n+=" "+I(e.attrs[r][0])+'="'+I(e.attrs[r][1])+'"';return n},R.prototype.renderToken=function(e,r,t){var n,s="",o=!1,i=e[r];return i.hidden?"":(i.block&&-1!==i.nesting&&r&&e[r-1].hidden&&(s+="\n"),s+=(-1===i.nesting?"</":"<")+i.tag,s+=this.renderAttrs(i),0===i.nesting&&t.xhtmlOut&&(s+=" /"),i.block&&(o=!0,1===i.nesting&&r+1<e.length&&("inline"===(n=e[r+1]).type||n.hidden||-1===n.nesting&&n.tag===i.tag)&&(o=!1)),s+=o?">\n":">")},R.prototype.renderInline=function(e,r,t){for(var n,s="",o=this.rules,i=0,a=e.length;i<a;i++)void 0!==o[n=e[i].type]?s+=o[n](e,i,r,t,this):s+=this.renderToken(e,i,r);return s},R.prototype.renderInlineAsText=function(e,r,t){for(var n="",s=0,o=e.length;s<o;s++)"text"===e[s].type?n+=e[s].content:"image"===e[s].type?n+=this.renderInlineAsText(e[s].children,r,t):"softbreak"===e[s].type&&(n+="\n");return n},R.prototype.render=function(e,r,t){var n,s,o,i="",a=this.rules;for(n=0,s=e.length;n<s;n++)"inline"===(o=e[n].type)?i+=this.renderInline(e[n].children,r,t):void 0!==a[o]?i+=a[e[n].type](e,n,r,t,this):i+=this.renderToken(e,n,r,t);return i};var B=R;function N(){this.__rules__=[],this.__cache__=null}N.prototype.__find__=function(e){for(var r=0;r<this.__rules__.length;r++)if(this.__rules__[r].name===e)return r;return-1},N.prototype.__compile__=function(){var e=this,r=[""];e.__rules__.forEach((function(e){e.enabled&&e.alt.forEach((function(e){r.indexOf(e)<0&&r.push(e)}))})),e.__cache__={},r.forEach((function(r){e.__cache__[r]=[],e.__rules__.forEach((function(t){t.enabled&&(r&&t.alt.indexOf(r)<0||e.__cache__[r].push(t.fn))}))}))},N.prototype.at=function(e,r,t){var n=this.__find__(e),s=t||{};if(-1===n)throw new Error("Parser rule not found: "+e);this.__rules__[n].fn=r,this.__rules__[n].alt=s.alt||[],this.__cache__=null},N.prototype.before=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},N.prototype.after=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s+1,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},N.prototype.push=function(e,r,t){var n=t||{};this.__rules__.push({name:e,enabled:!0,fn:r,alt:n.alt||[]}),this.__cache__=null},N.prototype.enable=function(e,r){Array.isArray(e)||(e=[e]);var t=[];return e.forEach((function(e){var n=this.__find__(e);if(n<0){if(r)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[n].enabled=!0,t.push(e)}),this),this.__cache__=null,t},N.prototype.enableOnly=function(e,r){Array.isArray(e)||(e=[e]),this.__rules__.forEach((function(e){e.enabled=!1})),this.enable(e,r)},N.prototype.disable=function(e,r){Array.isArray(e)||(e=[e]);var t=[];return e.forEach((function(e){var n=this.__find__(e);if(n<0){if(r)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[n].enabled=!1,t.push(e)}),this),this.__cache__=null,t},N.prototype.getRules=function(e){return null===this.__cache__&&this.__compile__(),this.__cache__[e]||[]};var O=N,P=/\r\n?|\n/g,j=/\0/g,U=w.arrayReplaceAt;function V(e){return/^<\/a\s*>/i.test(e)}var Z=/\+-|\.\.|\?\?\?\?|!!!!|,,|--/,G=/\((c|tm|r|p)\)/i,$=/\((c|tm|r|p)\)/gi,H={c:"\xa9",r:"\xae",p:"\xa7",tm:"\u2122"};function J(e,r){return H[r.toLowerCase()]}function W(e){var r,t,n=0;for(r=e.length-1;r>=0;r--)"text"!==(t=e[r]).type||n||(t.content=t.content.replace($,J)),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}function Y(e){var r,t,n=0;for(r=e.length-1;r>=0;r--)"text"!==(t=e[r]).type||n||Z.test(t.content)&&(t.content=t.content.replace(/\+-/g,"\xb1").replace(/\.{2,}/g,"\u2026").replace(/([?!])\u2026/g,"$1..").replace(/([?!]){4,}/g,"$1$1$1").replace(/,{2,}/g,",").replace(/(^|[^-])---(?=[^-]|$)/gm,"$1\u2014").replace(/(^|\s)--(?=\s|$)/gm,"$1\u2013").replace(/(^|[^-\s])--(?=[^-\s]|$)/gm,"$1\u2013")),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}var K=w.isWhiteSpace,Q=w.isPunctChar,X=w.isMdAsciiPunct,ee=/['"]/,re=/['"]/g;function te(e,r,t){return e.substr(0,r)+t+e.substr(r+1)}function ne(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C,y;for(v=[],t=0;t<e.length;t++){for(n=e[t],c=e[t].level,k=v.length-1;k>=0&&!(v[k].level<=c);k--);if(v.length=k+1,"text"===n.type){i=0,a=(s=n.content).length;e:for(;i<a&&(re.lastIndex=i,o=re.exec(s));){if(g=_=!0,i=o.index+1,b="'"===o[0],u=32,o.index-1>=0)u=s.charCodeAt(o.index-1);else for(k=t-1;k>=0&&("softbreak"!==e[k].type&&"hardbreak"!==e[k].type);k--)if(e[k].content){u=e[k].content.charCodeAt(e[k].content.length-1);break}if(p=32,i<a)p=s.charCodeAt(i);else for(k=t+1;k<e.length&&("softbreak"!==e[k].type&&"hardbreak"!==e[k].type);k++)if(e[k].content){p=e[k].content.charCodeAt(0);break}if(h=X(u)||Q(String.fromCharCode(u)),f=X(p)||Q(String.fromCharCode(p)),d=K(u),(m=K(p))?g=!1:f&&(d||h||(g=!1)),d?_=!1:h&&(m||f||(_=!1)),34===p&&'"'===o[0]&&u>=48&&u<=57&&(_=g=!1),g&&_&&(g=h,_=f),g||_){if(_)for(k=v.length-1;k>=0&&(l=v[k],!(v[k].level<c));k--)if(l.single===b&&v[k].level===c){l=v[k],b?(C=r.md.options.quotes[2],y=r.md.options.quotes[3]):(C=r.md.options.quotes[0],y=r.md.options.quotes[1]),n.content=te(n.content,o.index,y),e[l.token].content=te(e[l.token].content,l.pos,C),i+=y.length-1,l.token===t&&(i+=C.length-1),a=(s=n.content).length,v.length=k;continue e}g?v.push({token:t,pos:o.index,single:b,level:c}):_&&b&&(n.content=te(n.content,o.index,"\u2019"))}else b&&(n.content=te(n.content,o.index,"\u2019"))}}}}function se(e,r,t){this.type=e,this.tag=r,this.attrs=null,this.map=null,this.nesting=t,this.level=0,this.children=null,this.content="",this.markup="",this.info="",this.meta=null,this.block=!1,this.hidden=!1}se.prototype.attrIndex=function(e){var r,t,n;if(!this.attrs)return-1;for(t=0,n=(r=this.attrs).length;t<n;t++)if(r[t][0]===e)return t;return-1},se.prototype.attrPush=function(e){this.attrs?this.attrs.push(e):this.attrs=[e]},se.prototype.attrSet=function(e,r){var t=this.attrIndex(e),n=[e,r];t<0?this.attrPush(n):this.attrs[t]=n},se.prototype.attrGet=function(e){var r=this.attrIndex(e),t=null;return r>=0&&(t=this.attrs[r][1]),t},se.prototype.attrJoin=function(e,r){var t=this.attrIndex(e);t<0?this.attrPush([e,r]):this.attrs[t][1]=this.attrs[t][1]+" "+r};var oe=se;function ie(e,r,t){this.src=e,this.env=t,this.tokens=[],this.inlineMode=!1,this.md=r}ie.prototype.Token=oe;var ae=ie,ce=[["normalize",function(e){var r;r=(r=e.src.replace(P,"\n")).replace(j,"\ufffd"),e.src=r}],["block",function(e){var r;e.inlineMode?((r=new e.Token("inline","",0)).content=e.src,r.map=[0,1],r.children=[],e.tokens.push(r)):e.md.block.parse(e.src,e.md,e.env,e.tokens)}],["inline",function(e){var r,t,n,s=e.tokens;for(t=0,n=s.length;t<n;t++)"inline"===(r=s[t]).type&&e.md.inline.parse(r.content,e.md,e.env,r.children)}],["linkify",function(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b=e.tokens;if(e.md.options.linkify)for(t=0,n=b.length;t<n;t++)if("inline"===b[t].type&&e.md.linkify.pretest(b[t].content))for(f=0,r=(s=b[t].children).length-1;r>=0;r--)if("link_close"!==(i=s[r]).type){if("html_inline"===i.type&&(k=i.content,/^<a[>\s]/i.test(k)&&f>0&&f--,V(i.content)&&f++),!(f>0)&&"text"===i.type&&e.md.linkify.test(i.content)){for(l=i.content,_=e.md.linkify.match(l),a=[],h=i.level,p=0,c=0;c<_.length;c++)d=_[c].url,m=e.md.normalizeLink(d),e.md.validateLink(m)&&(g=_[c].text,g=_[c].schema?"mailto:"!==_[c].schema||/^mailto:/i.test(g)?e.md.normalizeLinkText(g):e.md.normalizeLinkText("mailto:"+g).replace(/^mailto:/,""):e.md.normalizeLinkText("http://"+g).replace(/^http:\/\//,""),(u=_[c].index)>p&&((o=new e.Token("text","",0)).content=l.slice(p,u),o.level=h,a.push(o)),(o=new e.Token("link_open","a",1)).attrs=[["href",m]],o.level=h++,o.markup="linkify",o.info="auto",a.push(o),(o=new e.Token("text","",0)).content=g,o.level=h,a.push(o),(o=new e.Token("link_close","a",-1)).level=--h,o.markup="linkify",o.info="auto",a.push(o),p=_[c].lastIndex);p<l.length&&((o=new e.Token("text","",0)).content=l.slice(p),o.level=h,a.push(o)),b[t].children=s=U(s,r,a)}}else for(r--;s[r].level!==i.level&&"link_open"!==s[r].type;)r--}],["replacements",function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;r>=0;r--)"inline"===e.tokens[r].type&&(G.test(e.tokens[r].content)&&W(e.tokens[r].children),Z.test(e.tokens[r].content)&&Y(e.tokens[r].children))}],["smartquotes",function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;r>=0;r--)"inline"===e.tokens[r].type&&ee.test(e.tokens[r].content)&&ne(e.tokens[r].children,e)}]];function le(){this.ruler=new O;for(var e=0;e<ce.length;e++)this.ruler.push(ce[e][0],ce[e][1])}le.prototype.process=function(e){var r,t,n;for(r=0,t=(n=this.ruler.getRules("")).length;r<t;r++)n[r](e)},le.prototype.State=ae;var ue=le,pe=w.isSpace;function he(e,r){var t=e.bMarks[r]+e.tShift[r],n=e.eMarks[r];return e.src.substr(t,n-t)}function fe(e){var r,t=[],n=0,s=e.length,o=!1,i=0,a="";for(r=e.charCodeAt(n);n<s;)124===r&&(o?(a+=e.substring(i,n-1),i=n):(t.push(a+e.substring(i,n)),a="",i=n+1)),o=92===r,n++,r=e.charCodeAt(n);return t.push(a+e.substring(i)),t}var de=w.isSpace,me=w.isSpace,ge=w.isSpace;function _e(e,r){var t,n,s,o;return n=e.bMarks[r]+e.tShift[r],s=e.eMarks[r],42!==(t=e.src.charCodeAt(n++))&&45!==t&&43!==t||n<s&&(o=e.src.charCodeAt(n),!ge(o))?-1:n}function ke(e,r){var t,n=e.bMarks[r]+e.tShift[r],s=n,o=e.eMarks[r];if(s+1>=o)return-1;if((t=e.src.charCodeAt(s++))<48||t>57)return-1;for(;;){if(s>=o)return-1;if(!((t=e.src.charCodeAt(s++))>=48&&t<=57)){if(41===t||46===t)break;return-1}if(s-n>=10)return-1}return s<o&&(t=e.src.charCodeAt(s),!ge(t))?-1:s}var be=w.normalizeReference,ve=w.isSpace,Ce="<[A-Za-z][A-Za-z0-9\\-]*(?:\\s+[a-zA-Z_:][a-zA-Z0-9:._-]*(?:\\s*=\\s*(?:[^\"'=<>`\\x00-\\x20]+|'[^']*'|\"[^\"]*\"))?)*\\s*\\/?>",ye="<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>",Ae={HTML_TAG_RE:new RegExp("^(?:"+Ce+"|"+ye+"|\x3c!----\x3e|\x3c!--(?:-?[^>-])(?:-?[^-])*--\x3e|<[?][\\s\\S]*?[?]>|<![A-Z]+\\s+[^>]*>|<!\\[CDATA\\[[\\s\\S]*?\\]\\]>)"),HTML_OPEN_CLOSE_TAG_RE:new RegExp("^(?:"+Ce+"|"+ye+")")},xe=Ae.HTML_OPEN_CLOSE_TAG_RE,De=[[/^<(script|pre|style|textarea)(?=(\s|>|$))/i,/<\/(script|pre|style|textarea)>/i,!0],[/^<!--/,/-->/,!0],[/^<\?/,/\?>/,!0],[/^<![A-Z]/,/>/,!0],[/^<!\[CDATA\[/,/\]\]>/,!0],[new RegExp("^</?("+["address","article","aside","base","basefont","blockquote","body","caption","center","col","colgroup","dd","details","dialog","dir","div","dl","dt","fieldset","figcaption","figure","footer","form","frame","frameset","h1","h2","h3","h4","h5","h6","head","header","hr","html","iframe","legend","li","link","main","menu","menuitem","nav","noframes","ol","optgroup","option","p","param","section","source","summary","table","tbody","td","tfoot","th","thead","title","tr","track","ul"].join("|")+")(?=(\\s|/?>|$))","i"),/^$/,!0],[new RegExp(xe.source+"\\s*$"),/^$/,!1]],we=w.isSpace,Ee=w.isSpace;function qe(e,r,t,n){var s,o,i,a,c,l,u,p;for(this.src=e,this.md=r,this.env=t,this.tokens=n,this.bMarks=[],this.eMarks=[],this.tShift=[],this.sCount=[],this.bsCount=[],this.blkIndent=0,this.line=0,this.lineMax=0,this.tight=!1,this.ddIndent=-1,this.listIndent=-1,this.parentType="root",this.level=0,this.result="",p=!1,i=a=l=u=0,c=(o=this.src).length;a<c;a++){if(s=o.charCodeAt(a),!p){if(Ee(s)){l++,9===s?u+=4-u%4:u++;continue}p=!0}10!==s&&a!==c-1||(10!==s&&a++,this.bMarks.push(i),this.eMarks.push(a),this.tShift.push(l),this.sCount.push(u),this.bsCount.push(0),p=!1,l=0,u=0,i=a+1)}this.bMarks.push(o.length),this.eMarks.push(o.length),this.tShift.push(0),this.sCount.push(0),this.bsCount.push(0),this.lineMax=this.bMarks.length-1}qe.prototype.push=function(e,r,t){var n=new oe(e,r,t);return n.block=!0,t<0&&this.level--,n.level=this.level,t>0&&this.level++,this.tokens.push(n),n},qe.prototype.isEmpty=function(e){return this.bMarks[e]+this.tShift[e]>=this.eMarks[e]},qe.prototype.skipEmptyLines=function(e){for(var r=this.lineMax;e<r&&!(this.bMarks[e]+this.tShift[e]<this.eMarks[e]);e++);return e},qe.prototype.skipSpaces=function(e){for(var r,t=this.src.length;e<t&&(r=this.src.charCodeAt(e),Ee(r));e++);return e},qe.prototype.skipSpacesBack=function(e,r){if(e<=r)return e;for(;e>r;)if(!Ee(this.src.charCodeAt(--e)))return e+1;return e},qe.prototype.skipChars=function(e,r){for(var t=this.src.length;e<t&&this.src.charCodeAt(e)===r;e++);return e},qe.prototype.skipCharsBack=function(e,r,t){if(e<=t)return e;for(;e>t;)if(r!==this.src.charCodeAt(--e))return e+1;return e},qe.prototype.getLines=function(e,r,t,n){var s,o,i,a,c,l,u,p=e;if(e>=r)return"";for(l=new Array(r-e),s=0;p<r;p++,s++){for(o=0,u=a=this.bMarks[p],c=p+1<r||n?this.eMarks[p]+1:this.eMarks[p];a<c&&o<t;){if(i=this.src.charCodeAt(a),Ee(i))9===i?o+=4-(o+this.bsCount[p])%4:o++;else{if(!(a-u<this.tShift[p]))break;o++}a++}l[s]=o>t?new Array(o-t+1).join(" ")+this.src.slice(a,c):this.src.slice(a,c)}return l.join("")},qe.prototype.Token=oe;var Se=qe,Fe=[["table",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C;if(r+2>t)return!1;if(l=r+1,e.sCount[l]<e.blkIndent)return!1;if(e.sCount[l]-e.blkIndent>=4)return!1;if((i=e.bMarks[l]+e.tShift[l])>=e.eMarks[l])return!1;if(124!==(v=e.src.charCodeAt(i++))&&45!==v&&58!==v)return!1;if(i>=e.eMarks[l])return!1;if(124!==(C=e.src.charCodeAt(i++))&&45!==C&&58!==C&&!pe(C))return!1;if(45===v&&pe(C))return!1;for(;i<e.eMarks[l];){if(124!==(s=e.src.charCodeAt(i))&&45!==s&&58!==s&&!pe(s))return!1;i++}for(u=(o=he(e,r+1)).split("|"),f=[],a=0;a<u.length;a++){if(!(d=u[a].trim())){if(0===a||a===u.length-1)continue;return!1}if(!/^:?-+:?$/.test(d))return!1;58===d.charCodeAt(d.length-1)?f.push(58===d.charCodeAt(0)?"center":"right"):58===d.charCodeAt(0)?f.push("left"):f.push("")}if(-1===(o=he(e,r).trim()).indexOf("|"))return!1;if(e.sCount[r]-e.blkIndent>=4)return!1;if((u=fe(o)).length&&""===u[0]&&u.shift(),u.length&&""===u[u.length-1]&&u.pop(),0===(p=u.length)||p!==f.length)return!1;if(n)return!0;for(_=e.parentType,e.parentType="table",b=e.md.block.ruler.getRules("blockquote"),(h=e.push("table_open","table",1)).map=m=[r,0],(h=e.push("thead_open","thead",1)).map=[r,r+1],(h=e.push("tr_open","tr",1)).map=[r,r+1],a=0;a<u.length;a++)h=e.push("th_open","th",1),f[a]&&(h.attrs=[["style","text-align:"+f[a]]]),(h=e.push("inline","",0)).content=u[a].trim(),h.children=[],h=e.push("th_close","th",-1);for(h=e.push("tr_close","tr",-1),h=e.push("thead_close","thead",-1),l=r+2;l<t&&!(e.sCount[l]<e.blkIndent);l++){for(k=!1,a=0,c=b.length;a<c;a++)if(b[a](e,l,t,!0)){k=!0;break}if(k)break;if(!(o=he(e,l).trim()))break;if(e.sCount[l]-e.blkIndent>=4)break;for((u=fe(o)).length&&""===u[0]&&u.shift(),u.length&&""===u[u.length-1]&&u.pop(),l===r+2&&((h=e.push("tbody_open","tbody",1)).map=g=[r+2,0]),(h=e.push("tr_open","tr",1)).map=[l,l+1],a=0;a<p;a++)h=e.push("td_open","td",1),f[a]&&(h.attrs=[["style","text-align:"+f[a]]]),(h=e.push("inline","",0)).content=u[a]?u[a].trim():"",h.children=[],h=e.push("td_close","td",-1);h=e.push("tr_close","tr",-1)}return g&&(h=e.push("tbody_close","tbody",-1),g[1]=l),h=e.push("table_close","table",-1),m[1]=l,e.parentType=_,e.line=l,!0},["paragraph","reference"]],["code",function(e,r,t){var n,s,o;if(e.sCount[r]-e.blkIndent<4)return!1;for(s=n=r+1;n<t;)if(e.isEmpty(n))n++;else{if(!(e.sCount[n]-e.blkIndent>=4))break;s=++n}return e.line=s,(o=e.push("code_block","code",0)).content=e.getLines(r,s,4+e.blkIndent,!1)+"\n",o.map=[r,e.line],!0}],["fence",function(e,r,t,n){var s,o,i,a,c,l,u,p=!1,h=e.bMarks[r]+e.tShift[r],f=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(h+3>f)return!1;if(126!==(s=e.src.charCodeAt(h))&&96!==s)return!1;if(c=h,(o=(h=e.skipChars(h,s))-c)<3)return!1;if(u=e.src.slice(c,h),i=e.src.slice(h,f),96===s&&i.indexOf(String.fromCharCode(s))>=0)return!1;if(n)return!0;for(a=r;!(++a>=t)&&!((h=c=e.bMarks[a]+e.tShift[a])<(f=e.eMarks[a])&&e.sCount[a]<e.blkIndent);)if(e.src.charCodeAt(h)===s&&!(e.sCount[a]-e.blkIndent>=4||(h=e.skipChars(h,s))-c<o||(h=e.skipSpaces(h))<f)){p=!0;break}return o=e.sCount[r],e.line=a+(p?1:0),(l=e.push("fence","code",0)).info=i,l.content=e.getLines(r+1,a,o,!0),l.markup=u,l.map=[r,e.line],!0},["paragraph","reference","blockquote","list"]],["blockquote",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C,y,A,x=e.lineMax,D=e.bMarks[r]+e.tShift[r],w=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(62!==e.src.charCodeAt(D++))return!1;if(n)return!0;for(a=h=e.sCount[r]+1,32===e.src.charCodeAt(D)?(D++,a++,h++,s=!1,b=!0):9===e.src.charCodeAt(D)?(b=!0,(e.bsCount[r]+h)%4==3?(D++,a++,h++,s=!1):s=!0):b=!1,f=[e.bMarks[r]],e.bMarks[r]=D;D<w&&(o=e.src.charCodeAt(D),de(o));)9===o?h+=4-(h+e.bsCount[r]+(s?1:0))%4:h++,D++;for(d=[e.bsCount[r]],e.bsCount[r]=e.sCount[r]+1+(b?1:0),l=D>=w,_=[e.sCount[r]],e.sCount[r]=h-a,k=[e.tShift[r]],e.tShift[r]=D-e.bMarks[r],C=e.md.block.ruler.getRules("blockquote"),g=e.parentType,e.parentType="blockquote",p=r+1;p<t&&(A=e.sCount[p]<e.blkIndent,!((D=e.bMarks[p]+e.tShift[p])>=(w=e.eMarks[p])));p++)if(62!==e.src.charCodeAt(D++)||A){if(l)break;for(v=!1,i=0,c=C.length;i<c;i++)if(C[i](e,p,t,!0)){v=!0;break}if(v){e.lineMax=p,0!==e.blkIndent&&(f.push(e.bMarks[p]),d.push(e.bsCount[p]),k.push(e.tShift[p]),_.push(e.sCount[p]),e.sCount[p]-=e.blkIndent);break}f.push(e.bMarks[p]),d.push(e.bsCount[p]),k.push(e.tShift[p]),_.push(e.sCount[p]),e.sCount[p]=-1}else{for(a=h=e.sCount[p]+1,32===e.src.charCodeAt(D)?(D++,a++,h++,s=!1,b=!0):9===e.src.charCodeAt(D)?(b=!0,(e.bsCount[p]+h)%4==3?(D++,a++,h++,s=!1):s=!0):b=!1,f.push(e.bMarks[p]),e.bMarks[p]=D;D<w&&(o=e.src.charCodeAt(D),de(o));)9===o?h+=4-(h+e.bsCount[p]+(s?1:0))%4:h++,D++;l=D>=w,d.push(e.bsCount[p]),e.bsCount[p]=e.sCount[p]+1+(b?1:0),_.push(e.sCount[p]),e.sCount[p]=h-a,k.push(e.tShift[p]),e.tShift[p]=D-e.bMarks[p]}for(m=e.blkIndent,e.blkIndent=0,(y=e.push("blockquote_open","blockquote",1)).markup=">",y.map=u=[r,0],e.md.block.tokenize(e,r,p),(y=e.push("blockquote_close","blockquote",-1)).markup=">",e.lineMax=x,e.parentType=g,u[1]=e.line,i=0;i<k.length;i++)e.bMarks[i+r]=f[i],e.tShift[i+r]=k[i],e.sCount[i+r]=_[i],e.bsCount[i+r]=d[i];return e.blkIndent=m,!0},["paragraph","reference","blockquote","list"]],["hr",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(42!==(s=e.src.charCodeAt(c++))&&45!==s&&95!==s)return!1;for(o=1;c<l;){if((i=e.src.charCodeAt(c++))!==s&&!me(i))return!1;i===s&&o++}return!(o<3)&&(n||(e.line=r+1,(a=e.push("hr","hr",0)).map=[r,e.line],a.markup=Array(o+1).join(String.fromCharCode(s))),!0)},["paragraph","reference","blockquote","list"]],["list",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v,C,y,A,x,D,w,E,q,S,F,L,z=!1,T=!0;if(e.sCount[r]-e.blkIndent>=4)return!1;if(e.listIndent>=0&&e.sCount[r]-e.listIndent>=4&&e.sCount[r]<e.blkIndent)return!1;if(n&&"paragraph"===e.parentType&&e.sCount[r]>=e.blkIndent&&(z=!0),(w=ke(e,r))>=0){if(u=!0,q=e.bMarks[r]+e.tShift[r],g=Number(e.src.slice(q,w-1)),z&&1!==g)return!1}else{if(!((w=_e(e,r))>=0))return!1;u=!1}if(z&&e.skipSpaces(w)>=e.eMarks[r])return!1;if(m=e.src.charCodeAt(w-1),n)return!0;for(d=e.tokens.length,u?(L=e.push("ordered_list_open","ol",1),1!==g&&(L.attrs=[["start",g]])):L=e.push("bullet_list_open","ul",1),L.map=f=[r,0],L.markup=String.fromCharCode(m),k=r,E=!1,F=e.md.block.ruler.getRules("list"),C=e.parentType,e.parentType="list";k<t;){for(D=w,_=e.eMarks[k],l=b=e.sCount[k]+w-(e.bMarks[r]+e.tShift[r]);D<_;){if(9===(s=e.src.charCodeAt(D)))b+=4-(b+e.bsCount[k])%4;else{if(32!==s)break;b++}D++}if((c=(o=D)>=_?1:b-l)>4&&(c=1),a=l+c,(L=e.push("list_item_open","li",1)).markup=String.fromCharCode(m),L.map=p=[r,0],u&&(L.info=e.src.slice(q,w-1)),x=e.tight,A=e.tShift[r],y=e.sCount[r],v=e.listIndent,e.listIndent=e.blkIndent,e.blkIndent=a,e.tight=!0,e.tShift[r]=o-e.bMarks[r],e.sCount[r]=b,o>=_&&e.isEmpty(r+1)?e.line=Math.min(e.line+2,t):e.md.block.tokenize(e,r,t,!0),e.tight&&!E||(T=!1),E=e.line-r>1&&e.isEmpty(e.line-1),e.blkIndent=e.listIndent,e.listIndent=v,e.tShift[r]=A,e.sCount[r]=y,e.tight=x,(L=e.push("list_item_close","li",-1)).markup=String.fromCharCode(m),k=r=e.line,p[1]=k,o=e.bMarks[r],k>=t)break;if(e.sCount[k]<e.blkIndent)break;if(e.sCount[r]-e.blkIndent>=4)break;for(S=!1,i=0,h=F.length;i<h;i++)if(F[i](e,k,t,!0)){S=!0;break}if(S)break;if(u){if((w=ke(e,k))<0)break;q=e.bMarks[k]+e.tShift[k]}else if((w=_e(e,k))<0)break;if(m!==e.src.charCodeAt(w-1))break}return(L=u?e.push("ordered_list_close","ol",-1):e.push("bullet_list_close","ul",-1)).markup=String.fromCharCode(m),f[1]=k,e.line=k,e.parentType=C,T&&function(e,r){var t,n,s=e.level+2;for(t=r+2,n=e.tokens.length-2;t<n;t++)e.tokens[t].level===s&&"paragraph_open"===e.tokens[t].type&&(e.tokens[t+2].hidden=!0,e.tokens[t].hidden=!0,t+=2)}(e,d),!0},["paragraph","reference","blockquote"]],["reference",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,k,b,v=0,C=e.bMarks[r]+e.tShift[r],y=e.eMarks[r],A=r+1;if(e.sCount[r]-e.blkIndent>=4)return!1;if(91!==e.src.charCodeAt(C))return!1;for(;++C<y;)if(93===e.src.charCodeAt(C)&&92!==e.src.charCodeAt(C-1)){if(C+1===y)return!1;if(58!==e.src.charCodeAt(C+1))return!1;break}for(a=e.lineMax,k=e.md.block.ruler.getRules("reference"),f=e.parentType,e.parentType="reference";A<a&&!e.isEmpty(A);A++)if(!(e.sCount[A]-e.blkIndent>3||e.sCount[A]<0)){for(_=!1,l=0,u=k.length;l<u;l++)if(k[l](e,A,a,!0)){_=!0;break}if(_)break}for(y=(g=e.getLines(r,A,e.blkIndent,!1).trim()).length,C=1;C<y;C++){if(91===(s=g.charCodeAt(C)))return!1;if(93===s){h=C;break}(10===s||92===s&&++C<y&&10===g.charCodeAt(C))&&v++}if(h<0||58!==g.charCodeAt(h+1))return!1;for(C=h+2;C<y;C++)if(10===(s=g.charCodeAt(C)))v++;else if(!ve(s))break;if(!(d=e.md.helpers.parseLinkDestination(g,C,y)).ok)return!1;if(c=e.md.normalizeLink(d.str),!e.md.validateLink(c))return!1;for(o=C=d.pos,i=v+=d.lines,m=C;C<y;C++)if(10===(s=g.charCodeAt(C)))v++;else if(!ve(s))break;for(d=e.md.helpers.parseLinkTitle(g,C,y),C<y&&m!==C&&d.ok?(b=d.str,C=d.pos,v+=d.lines):(b="",C=o,v=i);C<y&&(s=g.charCodeAt(C),ve(s));)C++;if(C<y&&10!==g.charCodeAt(C)&&b)for(b="",C=o,v=i;C<y&&(s=g.charCodeAt(C),ve(s));)C++;return!(C<y&&10!==g.charCodeAt(C))&&(!!(p=be(g.slice(1,h)))&&(n||(void 0===e.env.references&&(e.env.references={}),void 0===e.env.references[p]&&(e.env.references[p]={title:b,href:c}),e.parentType=f,e.line=r+v+1),!0))}],["html_block",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(!e.md.options.html)return!1;if(60!==e.src.charCodeAt(c))return!1;for(a=e.src.slice(c,l),s=0;s<De.length&&!De[s][0].test(a);s++);if(s===De.length)return!1;if(n)return De[s][2];if(o=r+1,!De[s][1].test(a))for(;o<t&&!(e.sCount[o]<e.blkIndent);o++)if(c=e.bMarks[o]+e.tShift[o],l=e.eMarks[o],a=e.src.slice(c,l),De[s][1].test(a)){0!==a.length&&o++;break}return e.line=o,(i=e.push("html_block","",0)).map=[r,o],i.content=e.getLines(r,o,e.blkIndent,!0),!0},["paragraph","reference","blockquote"]],["heading",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(35!==(s=e.src.charCodeAt(c))||c>=l)return!1;for(o=1,s=e.src.charCodeAt(++c);35===s&&c<l&&o<=6;)o++,s=e.src.charCodeAt(++c);return!(o>6||c<l&&!we(s))&&(n||(l=e.skipSpacesBack(l,c),(i=e.skipCharsBack(l,35,c))>c&&we(e.src.charCodeAt(i-1))&&(l=i),e.line=r+1,(a=e.push("heading_open","h"+String(o),1)).markup="########".slice(0,o),a.map=[r,e.line],(a=e.push("inline","",0)).content=e.src.slice(c,l).trim(),a.map=[r,e.line],a.children=[],(a=e.push("heading_close","h"+String(o),-1)).markup="########".slice(0,o)),!0)},["paragraph","reference","blockquote"]],["lheading",function(e,r,t){var n,s,o,i,a,c,l,u,p,h,f=r+1,d=e.md.block.ruler.getRules("paragraph");if(e.sCount[r]-e.blkIndent>=4)return!1;for(h=e.parentType,e.parentType="paragraph";f<t&&!e.isEmpty(f);f++)if(!(e.sCount[f]-e.blkIndent>3)){if(e.sCount[f]>=e.blkIndent&&(c=e.bMarks[f]+e.tShift[f])<(l=e.eMarks[f])&&(45===(p=e.src.charCodeAt(c))||61===p)&&(c=e.skipChars(c,p),(c=e.skipSpaces(c))>=l)){u=61===p?1:2;break}if(!(e.sCount[f]<0)){for(s=!1,o=0,i=d.length;o<i;o++)if(d[o](e,f,t,!0)){s=!0;break}if(s)break}}return!!u&&(n=e.getLines(r,f,e.blkIndent,!1).trim(),e.line=f+1,(a=e.push("heading_open","h"+String(u),1)).markup=String.fromCharCode(p),a.map=[r,e.line],(a=e.push("inline","",0)).content=n,a.map=[r,e.line-1],a.children=[],(a=e.push("heading_close","h"+String(u),-1)).markup=String.fromCharCode(p),e.parentType=h,!0)}],["paragraph",function(e,r){var t,n,s,o,i,a,c=r+1,l=e.md.block.ruler.getRules("paragraph"),u=e.lineMax;for(a=e.parentType,e.parentType="paragraph";c<u&&!e.isEmpty(c);c++)if(!(e.sCount[c]-e.blkIndent>3||e.sCount[c]<0)){for(n=!1,s=0,o=l.length;s<o;s++)if(l[s](e,c,u,!0)){n=!0;break}if(n)break}return t=e.getLines(r,c,e.blkIndent,!1).trim(),e.line=c,(i=e.push("paragraph_open","p",1)).map=[r,e.line],(i=e.push("inline","",0)).content=t,i.map=[r,e.line],i.children=[],i=e.push("paragraph_close","p",-1),e.parentType=a,!0}]];function Le(){this.ruler=new O;for(var e=0;e<Fe.length;e++)this.ruler.push(Fe[e][0],Fe[e][1],{alt:(Fe[e][2]||[]).slice()})}Le.prototype.tokenize=function(e,r,t){for(var n,s=this.ruler.getRules(""),o=s.length,i=r,a=!1,c=e.md.options.maxNesting;i<t&&(e.line=i=e.skipEmptyLines(i),!(i>=t))&&!(e.sCount[i]<e.blkIndent);){if(e.level>=c){e.line=t;break}for(n=0;n<o&&!s[n](e,i,t,!1);n++);e.tight=!a,e.isEmpty(e.line-1)&&(a=!0),(i=e.line)<t&&e.isEmpty(i)&&(a=!0,i++,e.line=i)}},Le.prototype.parse=function(e,r,t,n){var s;e&&(s=new this.State(e,r,t,n),this.tokenize(s,s.line,s.lineMax))},Le.prototype.State=Se;var ze=Le;function Te(e){switch(e){case 10:case 33:case 35:case 36:case 37:case 38:case 42:case 43:case 45:case 58:case 60:case 61:case 62:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 125:case 126:return!0;default:return!1}}for(var Ie=w.isSpace,Me=w.isSpace,Re=[],Be=0;Be<256;Be++)Re.push(0);"\\!\"#$%&'()*+,./:;<=>?@[]^_`{|}~-".split("").forEach((function(e){Re[e.charCodeAt(0)]=1}));function Ne(e,r){var t,n,s,o,i,a=[],c=r.length;for(t=0;t<c;t++)126===(s=r[t]).marker&&-1!==s.end&&(o=r[s.end],(i=e.tokens[s.token]).type="s_open",i.tag="s",i.nesting=1,i.markup="~~",i.content="",(i=e.tokens[o.token]).type="s_close",i.tag="s",i.nesting=-1,i.markup="~~",i.content="","text"===e.tokens[o.token-1].type&&"~"===e.tokens[o.token-1].content&&a.push(o.token-1));for(;a.length;){for(n=(t=a.pop())+1;n<e.tokens.length&&"s_close"===e.tokens[n].type;)n++;t!==--n&&(i=e.tokens[n],e.tokens[n]=e.tokens[t],e.tokens[t]=i)}}var Oe={tokenize:function(e,r){var t,n,s,o,i=e.pos,a=e.src.charCodeAt(i);if(r)return!1;if(126!==a)return!1;if(s=(n=e.scanDelims(e.pos,!0)).length,o=String.fromCharCode(a),s<2)return!1;for(s%2&&(e.push("text","",0).content=o,s--),t=0;t<s;t+=2)e.push("text","",0).content=o+o,e.delimiters.push({marker:a,length:0,token:e.tokens.length-1,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},postProcess:function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Ne(e,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Ne(e,t[r].delimiters)}};function Pe(e,r){var t,n,s,o,i,a;for(t=r.length-1;t>=0;t--)95!==(n=r[t]).marker&&42!==n.marker||-1!==n.end&&(s=r[n.end],a=t>0&&r[t-1].end===n.end+1&&r[t-1].marker===n.marker&&r[t-1].token===n.token-1&&r[n.end+1].token===s.token+1,i=String.fromCharCode(n.marker),(o=e.tokens[n.token]).type=a?"strong_open":"em_open",o.tag=a?"strong":"em",o.nesting=1,o.markup=a?i+i:i,o.content="",(o=e.tokens[s.token]).type=a?"strong_close":"em_close",o.tag=a?"strong":"em",o.nesting=-1,o.markup=a?i+i:i,o.content="",a&&(e.tokens[r[t-1].token].content="",e.tokens[r[n.end+1].token].content="",t--))}var je={tokenize:function(e,r){var t,n,s=e.pos,o=e.src.charCodeAt(s);if(r)return!1;if(95!==o&&42!==o)return!1;for(n=e.scanDelims(e.pos,42===o),t=0;t<n.length;t++)e.push("text","",0).content=String.fromCharCode(o),e.delimiters.push({marker:o,length:n.length,token:e.tokens.length-1,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},postProcess:function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Pe(e,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Pe(e,t[r].delimiters)}},Ue=w.normalizeReference,Ve=w.isSpace,Ze=w.normalizeReference,Ge=w.isSpace,$e=/^([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)$/,He=/^([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)$/,Je=Ae.HTML_TAG_RE;var We=w.has,Ye=w.isValidEntityCode,Ke=w.fromCodePoint,Qe=/^&#((?:x[a-f0-9]{1,6}|[0-9]{1,7}));/i,Xe=/^&([a-z][a-z0-9]{1,31});/i;function er(e,r){var t,n,s,o,i,a,c,l,u={},p=r.length;if(p){var h=0,f=-2,d=[];for(t=0;t<p;t++)if(s=r[t],d.push(0),r[h].marker===s.marker&&f===s.token-1||(h=t),f=s.token,s.length=s.length||0,s.close){for(u.hasOwnProperty(s.marker)||(u[s.marker]=[-1,-1,-1,-1,-1,-1]),i=u[s.marker][(s.open?3:0)+s.length%3],a=n=h-d[h]-1;n>i;n-=d[n]+1)if((o=r[n]).marker===s.marker&&o.open&&o.end<0&&(c=!1,(o.close||s.open)&&(o.length+s.length)%3==0&&(o.length%3==0&&s.length%3==0||(c=!0)),!c)){l=n>0&&!r[n-1].open?d[n-1]+1:0,d[t]=t-n+l,d[n]=l,s.open=!1,o.end=t,o.close=!1,a=-1,f=-2;break}-1!==a&&(u[s.marker][(s.open?3:0)+(s.length||0)%3]=a)}}}var rr=w.isWhiteSpace,tr=w.isPunctChar,nr=w.isMdAsciiPunct;function sr(e,r,t,n){this.src=e,this.env=t,this.md=r,this.tokens=n,this.tokens_meta=Array(n.length),this.pos=0,this.posMax=this.src.length,this.level=0,this.pending="",this.pendingLevel=0,this.cache={},this.delimiters=[],this._prev_delimiters=[],this.backticks={},this.backticksScanned=!1}sr.prototype.pushPending=function(){var e=new oe("text","",0);return e.content=this.pending,e.level=this.pendingLevel,this.tokens.push(e),this.pending="",e},sr.prototype.push=function(e,r,t){this.pending&&this.pushPending();var n=new oe(e,r,t),s=null;return t<0&&(this.level--,this.delimiters=this._prev_delimiters.pop()),n.level=this.level,t>0&&(this.level++,this._prev_delimiters.push(this.delimiters),this.delimiters=[],s={delimiters:this.delimiters}),this.pendingLevel=this.level,this.tokens.push(n),this.tokens_meta.push(s),n},sr.prototype.scanDelims=function(e,r){var t,n,s,o,i,a,c,l,u,p=e,h=!0,f=!0,d=this.posMax,m=this.src.charCodeAt(e);for(t=e>0?this.src.charCodeAt(e-1):32;p<d&&this.src.charCodeAt(p)===m;)p++;return s=p-e,n=p<d?this.src.charCodeAt(p):32,c=nr(t)||tr(String.fromCharCode(t)),u=nr(n)||tr(String.fromCharCode(n)),a=rr(t),(l=rr(n))?h=!1:u&&(a||c||(h=!1)),a?f=!1:c&&(l||u||(f=!1)),r?(o=h,i=f):(o=h&&(!f||c),i=f&&(!h||u)),{can_open:o,can_close:i,length:s}},sr.prototype.Token=oe;var or=sr,ir=[["text",function(e,r){for(var t=e.pos;t<e.posMax&&!Te(e.src.charCodeAt(t));)t++;return t!==e.pos&&(r||(e.pending+=e.src.slice(e.pos,t)),e.pos=t,!0)}],["newline",function(e,r){var t,n,s,o=e.pos;if(10!==e.src.charCodeAt(o))return!1;if(t=e.pending.length-1,n=e.posMax,!r)if(t>=0&&32===e.pending.charCodeAt(t))if(t>=1&&32===e.pending.charCodeAt(t-1)){for(s=t-1;s>=1&&32===e.pending.charCodeAt(s-1);)s--;e.pending=e.pending.slice(0,s),e.push("hardbreak","br",0)}else e.pending=e.pending.slice(0,-1),e.push("softbreak","br",0);else e.push("softbreak","br",0);for(o++;o<n&&Ie(e.src.charCodeAt(o));)o++;return e.pos=o,!0}],["escape",function(e,r){var t,n=e.pos,s=e.posMax;if(92!==e.src.charCodeAt(n))return!1;if(++n<s){if((t=e.src.charCodeAt(n))<256&&0!==Re[t])return r||(e.pending+=e.src[n]),e.pos+=2,!0;if(10===t){for(r||e.push("hardbreak","br",0),n++;n<s&&(t=e.src.charCodeAt(n),Me(t));)n++;return e.pos=n,!0}}return r||(e.pending+="\\"),e.pos++,!0}],["backticks",function(e,r){var t,n,s,o,i,a,c,l,u=e.pos;if(96!==e.src.charCodeAt(u))return!1;for(t=u,u++,n=e.posMax;u<n&&96===e.src.charCodeAt(u);)u++;if(c=(s=e.src.slice(t,u)).length,e.backticksScanned&&(e.backticks[c]||0)<=t)return r||(e.pending+=s),e.pos+=c,!0;for(i=a=u;-1!==(i=e.src.indexOf("`",a));){for(a=i+1;a<n&&96===e.src.charCodeAt(a);)a++;if((l=a-i)===c)return r||((o=e.push("code_inline","code",0)).markup=s,o.content=e.src.slice(u,i).replace(/\n/g," ").replace(/^ (.+) $/,"$1")),e.pos=a,!0;e.backticks[l]=i}return e.backticksScanned=!0,r||(e.pending+=s),e.pos+=c,!0}],["strikethrough",Oe.tokenize],["emphasis",je.tokenize],["link",function(e,r){var t,n,s,o,i,a,c,l,u="",p="",h=e.pos,f=e.posMax,d=e.pos,m=!0;if(91!==e.src.charCodeAt(e.pos))return!1;if(i=e.pos+1,(o=e.md.helpers.parseLinkLabel(e,e.pos,!0))<0)return!1;if((a=o+1)<f&&40===e.src.charCodeAt(a)){for(m=!1,a++;a<f&&(n=e.src.charCodeAt(a),Ve(n)||10===n);a++);if(a>=f)return!1;if(d=a,(c=e.md.helpers.parseLinkDestination(e.src,a,e.posMax)).ok){for(u=e.md.normalizeLink(c.str),e.md.validateLink(u)?a=c.pos:u="",d=a;a<f&&(n=e.src.charCodeAt(a),Ve(n)||10===n);a++);if(c=e.md.helpers.parseLinkTitle(e.src,a,e.posMax),a<f&&d!==a&&c.ok)for(p=c.str,a=c.pos;a<f&&(n=e.src.charCodeAt(a),Ve(n)||10===n);a++);}(a>=f||41!==e.src.charCodeAt(a))&&(m=!0),a++}if(m){if(void 0===e.env.references)return!1;if(a<f&&91===e.src.charCodeAt(a)?(d=a+1,(a=e.md.helpers.parseLinkLabel(e,a))>=0?s=e.src.slice(d,a++):a=o+1):a=o+1,s||(s=e.src.slice(i,o)),!(l=e.env.references[Ue(s)]))return e.pos=h,!1;u=l.href,p=l.title}return r||(e.pos=i,e.posMax=o,e.push("link_open","a",1).attrs=t=[["href",u]],p&&t.push(["title",p]),e.md.inline.tokenize(e),e.push("link_close","a",-1)),e.pos=a,e.posMax=f,!0}],["image",function(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m="",g=e.pos,_=e.posMax;if(33!==e.src.charCodeAt(e.pos))return!1;if(91!==e.src.charCodeAt(e.pos+1))return!1;if(a=e.pos+2,(i=e.md.helpers.parseLinkLabel(e,e.pos+1,!1))<0)return!1;if((c=i+1)<_&&40===e.src.charCodeAt(c)){for(c++;c<_&&(n=e.src.charCodeAt(c),Ge(n)||10===n);c++);if(c>=_)return!1;for(d=c,(u=e.md.helpers.parseLinkDestination(e.src,c,e.posMax)).ok&&(m=e.md.normalizeLink(u.str),e.md.validateLink(m)?c=u.pos:m=""),d=c;c<_&&(n=e.src.charCodeAt(c),Ge(n)||10===n);c++);if(u=e.md.helpers.parseLinkTitle(e.src,c,e.posMax),c<_&&d!==c&&u.ok)for(p=u.str,c=u.pos;c<_&&(n=e.src.charCodeAt(c),Ge(n)||10===n);c++);else p="";if(c>=_||41!==e.src.charCodeAt(c))return e.pos=g,!1;c++}else{if(void 0===e.env.references)return!1;if(c<_&&91===e.src.charCodeAt(c)?(d=c+1,(c=e.md.helpers.parseLinkLabel(e,c))>=0?o=e.src.slice(d,c++):c=i+1):c=i+1,o||(o=e.src.slice(a,i)),!(l=e.env.references[Ze(o)]))return e.pos=g,!1;m=l.href,p=l.title}return r||(s=e.src.slice(a,i),e.md.inline.parse(s,e.md,e.env,f=[]),(h=e.push("image","img",0)).attrs=t=[["src",m],["alt",""]],h.children=f,h.content=s,p&&t.push(["title",p])),e.pos=c,e.posMax=_,!0}],["autolink",function(e,r){var t,n,s,o,i,a,c=e.pos;if(60!==e.src.charCodeAt(c))return!1;for(i=e.pos,a=e.posMax;;){if(++c>=a)return!1;if(60===(o=e.src.charCodeAt(c)))return!1;if(62===o)break}return t=e.src.slice(i+1,c),He.test(t)?(n=e.md.normalizeLink(t),!!e.md.validateLink(n)&&(r||((s=e.push("link_open","a",1)).attrs=[["href",n]],s.markup="autolink",s.info="auto",(s=e.push("text","",0)).content=e.md.normalizeLinkText(t),(s=e.push("link_close","a",-1)).markup="autolink",s.info="auto"),e.pos+=t.length+2,!0)):!!$e.test(t)&&(n=e.md.normalizeLink("mailto:"+t),!!e.md.validateLink(n)&&(r||((s=e.push("link_open","a",1)).attrs=[["href",n]],s.markup="autolink",s.info="auto",(s=e.push("text","",0)).content=e.md.normalizeLinkText(t),(s=e.push("link_close","a",-1)).markup="autolink",s.info="auto"),e.pos+=t.length+2,!0))}],["html_inline",function(e,r){var t,n,s,o=e.pos;return!!e.md.options.html&&(s=e.posMax,!(60!==e.src.charCodeAt(o)||o+2>=s)&&(!(33!==(t=e.src.charCodeAt(o+1))&&63!==t&&47!==t&&!function(e){var r=32|e;return r>=97&&r<=122}(t))&&(!!(n=e.src.slice(o).match(Je))&&(r||(e.push("html_inline","",0).content=e.src.slice(o,o+n[0].length)),e.pos+=n[0].length,!0))))}],["entity",function(e,t){var n,s,o=e.pos,i=e.posMax;if(38!==e.src.charCodeAt(o))return!1;if(o+1<i)if(35===e.src.charCodeAt(o+1)){if(s=e.src.slice(o).match(Qe))return t||(n="x"===s[1][0].toLowerCase()?parseInt(s[1].slice(1),16):parseInt(s[1],10),e.pending+=Ye(n)?Ke(n):Ke(65533)),e.pos+=s[0].length,!0}else if((s=e.src.slice(o).match(Xe))&&We(r,s[1]))return t||(e.pending+=r[s[1]]),e.pos+=s[0].length,!0;return t||(e.pending+="&"),e.pos++,!0}]],ar=[["balance_pairs",function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(er(0,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&er(0,t[r].delimiters)}],["strikethrough",Oe.postProcess],["emphasis",je.postProcess],["text_collapse",function(e){var r,t,n=0,s=e.tokens,o=e.tokens.length;for(r=t=0;r<o;r++)s[r].nesting<0&&n--,s[r].level=n,s[r].nesting>0&&n++,"text"===s[r].type&&r+1<o&&"text"===s[r+1].type?s[r+1].content=s[r].content+s[r+1].content:(r!==t&&(s[t]=s[r]),t++);r!==t&&(s.length=t)}]];function cr(){var e;for(this.ruler=new O,e=0;e<ir.length;e++)this.ruler.push(ir[e][0],ir[e][1]);for(this.ruler2=new O,e=0;e<ar.length;e++)this.ruler2.push(ar[e][0],ar[e][1])}cr.prototype.skipToken=function(e){var r,t,n=e.pos,s=this.ruler.getRules(""),o=s.length,i=e.md.options.maxNesting,a=e.cache;if(void 0===a[n]){if(e.level<i)for(t=0;t<o&&(e.level++,r=s[t](e,!0),e.level--,!r);t++);else e.pos=e.posMax;r||e.pos++,a[n]=e.pos}else e.pos=a[n]},cr.prototype.tokenize=function(e){for(var r,t,n=this.ruler.getRules(""),s=n.length,o=e.posMax,i=e.md.options.maxNesting;e.pos<o;){if(e.level<i)for(t=0;t<s&&!(r=n[t](e,!1));t++);if(r){if(e.pos>=o)break}else e.pending+=e.src[e.pos++]}e.pending&&e.pushPending()},cr.prototype.parse=function(e,r,t,n){var s,o,i,a=new this.State(e,r,t,n);for(this.tokenize(a),i=(o=this.ruler2.getRules("")).length,s=0;s<i;s++)o[s](a)},cr.prototype.State=or;var lr=cr;function ur(e){var r=Array.prototype.slice.call(arguments,1);return r.forEach((function(r){r&&Object.keys(r).forEach((function(t){e[t]=r[t]}))})),e}function pr(e){return Object.prototype.toString.call(e)}function hr(e){return"[object Function]"===pr(e)}function fr(e){return e.replace(/[.?*+^$[\]\\(){}|-]/g,"\\$&")}var dr={fuzzyLink:!0,fuzzyEmail:!0,fuzzyIP:!1};var mr={"http:":{validate:function(e,r,t){var n=e.slice(r);return t.re.http||(t.re.http=new RegExp("^\\/\\/"+t.re.src_auth+t.re.src_host_port_strict+t.re.src_path,"i")),t.re.http.test(n)?n.match(t.re.http)[0].length:0}},"https:":"http:","ftp:":"http:","//":{validate:function(e,r,t){var n=e.slice(r);return t.re.no_http||(t.re.no_http=new RegExp("^"+t.re.src_auth+"(?:localhost|(?:(?:"+t.re.src_domain+")\\.)+"+t.re.src_domain_root+")"+t.re.src_port+t.re.src_host_terminator+t.re.src_path,"i")),t.re.no_http.test(n)?r>=3&&":"===e[r-3]||r>=3&&"/"===e[r-3]?0:n.match(t.re.no_http)[0].length:0}},"mailto:":{validate:function(e,r,t){var n=e.slice(r);return t.re.mailto||(t.re.mailto=new RegExp("^"+t.re.src_email_name+"@"+t.re.src_host_strict,"i")),t.re.mailto.test(n)?n.match(t.re.mailto)[0].length:0}}},gr="biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|\u0440\u0444".split("|");function _r(e){var r=e.re=function(e){var r={};return r.src_Any=y.source,r.src_Cc=A.source,r.src_Z=x.source,r.src_P=t.source,r.src_ZPCc=[r.src_Z,r.src_P,r.src_Cc].join("|"),r.src_ZCc=[r.src_Z,r.src_Cc].join("|"),r.src_pseudo_letter="(?:(?![><\uff5c]|"+r.src_ZPCc+")"+r.src_Any+")",r.src_ip4="(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)",r.src_auth="(?:(?:(?!"+r.src_ZCc+"|[@/\\[\\]()]).)+@)?",r.src_port="(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?",r.src_host_terminator="(?=$|[><\uff5c]|"+r.src_ZPCc+")(?!-|_|:\\d|\\.-|\\.(?!$|"+r.src_ZPCc+"))",r.src_path="(?:[/?#](?:(?!"+r.src_ZCc+"|[><\uff5c]|[()[\\]{}.,\"'?!\\-;]).|\\[(?:(?!"+r.src_ZCc+"|\\]).)*\\]|\\((?:(?!"+r.src_ZCc+"|[)]).)*\\)|\\{(?:(?!"+r.src_ZCc+'|[}]).)*\\}|\\"(?:(?!'+r.src_ZCc+'|["]).)+\\"|\\\'(?:(?!'+r.src_ZCc+"|[']).)+\\'|\\'(?="+r.src_pseudo_letter+"|[-]).|\\.{2,}[a-zA-Z0-9%/&]|\\.(?!"+r.src_ZCc+"|[.]).|"+(e&&e["---"]?"\\-(?!--(?:[^-]|$))(?:-*)|":"\\-+|")+",(?!"+r.src_ZCc+").|;(?!"+r.src_ZCc+").|\\!+(?!"+r.src_ZCc+"|[!]).|\\?(?!"+r.src_ZCc+"|[?]).)+|\\/)?",r.src_email_name='[\\-;:&=\\+\\$,\\.a-zA-Z0-9_][\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]*',r.src_xn="xn--[a-z0-9\\-]{1,59}",r.src_domain_root="(?:"+r.src_xn+"|"+r.src_pseudo_letter+"{1,63})",r.src_domain="(?:"+r.src_xn+"|(?:"+r.src_pseudo_letter+")|(?:"+r.src_pseudo_letter+"(?:-|"+r.src_pseudo_letter+"){0,61}"+r.src_pseudo_letter+"))",r.src_host="(?:(?:(?:(?:"+r.src_domain+")\\.)*"+r.src_domain+"))",r.tpl_host_fuzzy="(?:"+r.src_ip4+"|(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%)))",r.tpl_host_no_ip_fuzzy="(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%))",r.src_host_strict=r.src_host+r.src_host_terminator,r.tpl_host_fuzzy_strict=r.tpl_host_fuzzy+r.src_host_terminator,r.src_host_port_strict=r.src_host+r.src_port+r.src_host_terminator,r.tpl_host_port_fuzzy_strict=r.tpl_host_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_port_no_ip_fuzzy_strict=r.tpl_host_no_ip_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_fuzzy_test="localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:"+r.src_ZPCc+"|>|$))",r.tpl_email_fuzzy='(^|[><\uff5c]|"|\\(|'+r.src_ZCc+")("+r.src_email_name+"@"+r.tpl_host_fuzzy_strict+")",r.tpl_link_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_fuzzy_strict+r.src_path+")",r.tpl_link_no_ip_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_no_ip_fuzzy_strict+r.src_path+")",r}(e.__opts__),n=e.__tlds__.slice();function s(e){return e.replace("%TLDS%",r.src_tlds)}e.onCompile(),e.__tlds_replaced__||n.push("a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]"),n.push(r.src_xn),r.src_tlds=n.join("|"),r.email_fuzzy=RegExp(s(r.tpl_email_fuzzy),"i"),r.link_fuzzy=RegExp(s(r.tpl_link_fuzzy),"i"),r.link_no_ip_fuzzy=RegExp(s(r.tpl_link_no_ip_fuzzy),"i"),r.host_fuzzy_test=RegExp(s(r.tpl_host_fuzzy_test),"i");var o=[];function i(e,r){throw new Error('(LinkifyIt) Invalid schema "'+e+'": '+r)}e.__compiled__={},Object.keys(e.__schemas__).forEach((function(r){var t=e.__schemas__[r];if(null!==t){var n={validate:null,link:null};if(e.__compiled__[r]=n,"[object Object]"===pr(t))return!function(e){return"[object RegExp]"===pr(e)}(t.validate)?hr(t.validate)?n.validate=t.validate:i(r,t):n.validate=function(e){return function(r,t){var n=r.slice(t);return e.test(n)?n.match(e)[0].length:0}}(t.validate),void(hr(t.normalize)?n.normalize=t.normalize:t.normalize?i(r,t):n.normalize=function(e,r){r.normalize(e)});!function(e){return"[object String]"===pr(e)}(t)?i(r,t):o.push(r)}})),o.forEach((function(r){e.__compiled__[e.__schemas__[r]]&&(e.__compiled__[r].validate=e.__compiled__[e.__schemas__[r]].validate,e.__compiled__[r].normalize=e.__compiled__[e.__schemas__[r]].normalize)})),e.__compiled__[""]={validate:null,normalize:function(e,r){r.normalize(e)}};var a=Object.keys(e.__compiled__).filter((function(r){return r.length>0&&e.__compiled__[r]})).map(fr).join("|");e.re.schema_test=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","i"),e.re.schema_search=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","ig"),e.re.pretest=RegExp("("+e.re.schema_test.source+")|("+e.re.host_fuzzy_test.source+")|@","i"),function(e){e.__index__=-1,e.__text_cache__=""}(e)}function kr(e,r){var t=e.__index__,n=e.__last_index__,s=e.__text_cache__.slice(t,n);this.schema=e.__schema__.toLowerCase(),this.index=t+r,this.lastIndex=n+r,this.raw=s,this.text=s,this.url=s}function br(e,r){var t=new kr(e,r);return e.__compiled__[t.schema].normalize(t,e),t}function vr(e,r){if(!(this instanceof vr))return new vr(e,r);var t;r||(t=e,Object.keys(t||{}).reduce((function(e,r){return e||dr.hasOwnProperty(r)}),!1)&&(r=e,e={})),this.__opts__=ur({},dr,r),this.__index__=-1,this.__last_index__=-1,this.__schema__="",this.__text_cache__="",this.__schemas__=ur({},mr,e),this.__compiled__={},this.__tlds__=gr,this.__tlds_replaced__=!1,this.re={},_r(this)}vr.prototype.add=function(e,r){return this.__schemas__[e]=r,_r(this),this},vr.prototype.set=function(e){return this.__opts__=ur(this.__opts__,e),this},vr.prototype.test=function(e){if(this.__text_cache__=e,this.__index__=-1,!e.length)return!1;var r,t,n,s,o,i,a,c;if(this.re.schema_test.test(e))for((a=this.re.schema_search).lastIndex=0;null!==(r=a.exec(e));)if(s=this.testSchemaAt(e,r[2],a.lastIndex)){this.__schema__=r[2],this.__index__=r.index+r[1].length,this.__last_index__=r.index+r[0].length+s;break}return this.__opts__.fuzzyLink&&this.__compiled__["http:"]&&(c=e.search(this.re.host_fuzzy_test))>=0&&(this.__index__<0||c<this.__index__)&&null!==(t=e.match(this.__opts__.fuzzyIP?this.re.link_fuzzy:this.re.link_no_ip_fuzzy))&&(o=t.index+t[1].length,(this.__index__<0||o<this.__index__)&&(this.__schema__="",this.__index__=o,this.__last_index__=t.index+t[0].length)),this.__opts__.fuzzyEmail&&this.__compiled__["mailto:"]&&e.indexOf("@")>=0&&null!==(n=e.match(this.re.email_fuzzy))&&(o=n.index+n[1].length,i=n.index+n[0].length,(this.__index__<0||o<this.__index__||o===this.__index__&&i>this.__last_index__)&&(this.__schema__="mailto:",this.__index__=o,this.__last_index__=i)),this.__index__>=0},vr.prototype.pretest=function(e){return this.re.pretest.test(e)},vr.prototype.testSchemaAt=function(e,r,t){return this.__compiled__[r.toLowerCase()]?this.__compiled__[r.toLowerCase()].validate(e,t,this):0},vr.prototype.match=function(e){var r=0,t=[];this.__index__>=0&&this.__text_cache__===e&&(t.push(br(this,r)),r=this.__last_index__);for(var n=r?e.slice(r):e;this.test(n);)t.push(br(this,r)),n=n.slice(this.__last_index__),r+=this.__last_index__;return t.length?t:null},vr.prototype.tlds=function(e,r){return e=Array.isArray(e)?e:[e],r?(this.__tlds__=this.__tlds__.concat(e).sort().filter((function(e,r,t){return e!==t[r-1]})).reverse(),_r(this),this):(this.__tlds__=e.slice(),this.__tlds_replaced__=!0,_r(this),this)},vr.prototype.normalize=function(e){e.schema||(e.url="http://"+e.url),"mailto:"!==e.schema||/^mailto:/i.test(e.url)||(e.url="mailto:"+e.url)},vr.prototype.onCompile=function(){};var Cr=vr,yr=2147483647,Ar=36,xr=/^xn--/,Dr=/[^\x20-\x7E]/,wr=/[\x2E\u3002\uFF0E\uFF61]/g,Er={overflow:"Overflow: input needs wider integers to process","not-basic":"Illegal input >= 0x80 (not a basic code point)","invalid-input":"Invalid input"},qr=Math.floor,Sr=String.fromCharCode; +/*! https://mths.be/punycode v1.4.1 by @mathias */function Fr(e){throw new RangeError(Er[e])}function Lr(e,r){for(var t=e.length,n=[];t--;)n[t]=r(e[t]);return n}function zr(e,r){var t=e.split("@"),n="";return t.length>1&&(n=t[0]+"@",e=t[1]),n+Lr((e=e.replace(wr,".")).split("."),r).join(".")}function Tr(e){for(var r,t,n=[],s=0,o=e.length;s<o;)(r=e.charCodeAt(s++))>=55296&&r<=56319&&s<o?56320==(64512&(t=e.charCodeAt(s++)))?n.push(((1023&r)<<10)+(1023&t)+65536):(n.push(r),s--):n.push(r);return n}function Ir(e){return Lr(e,(function(e){var r="";return e>65535&&(r+=Sr((e-=65536)>>>10&1023|55296),e=56320|1023&e),r+=Sr(e)})).join("")}function Mr(e,r){return e+22+75*(e<26)-((0!=r)<<5)}function Rr(e,r,t){var n=0;for(e=t?qr(e/700):e>>1,e+=qr(e/r);e>455;n+=Ar)e=qr(e/35);return qr(n+36*e/(e+38))}function Br(e){var r,t,n,s,o,i,a,c,l,u,p,h=[],f=e.length,d=0,m=128,g=72;for((t=e.lastIndexOf("-"))<0&&(t=0),n=0;n<t;++n)e.charCodeAt(n)>=128&&Fr("not-basic"),h.push(e.charCodeAt(n));for(s=t>0?t+1:0;s<f;){for(o=d,i=1,a=Ar;s>=f&&Fr("invalid-input"),((c=(p=e.charCodeAt(s++))-48<10?p-22:p-65<26?p-65:p-97<26?p-97:Ar)>=Ar||c>qr((yr-d)/i))&&Fr("overflow"),d+=c*i,!(c<(l=a<=g?1:a>=g+26?26:a-g));a+=Ar)i>qr(yr/(u=Ar-l))&&Fr("overflow"),i*=u;g=Rr(d-o,r=h.length+1,0==o),qr(d/r)>yr-m&&Fr("overflow"),m+=qr(d/r),d%=r,h.splice(d++,0,m)}return Ir(h)}function Nr(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,g=[];for(h=(e=Tr(e)).length,r=128,t=0,o=72,i=0;i<h;++i)(p=e[i])<128&&g.push(Sr(p));for(n=s=g.length,s&&g.push("-");n<h;){for(a=yr,i=0;i<h;++i)(p=e[i])>=r&&p<a&&(a=p);for(a-r>qr((yr-t)/(f=n+1))&&Fr("overflow"),t+=(a-r)*f,r=a,i=0;i<h;++i)if((p=e[i])<r&&++t>yr&&Fr("overflow"),p==r){for(c=t,l=Ar;!(c<(u=l<=o?1:l>=o+26?26:l-o));l+=Ar)m=c-u,d=Ar-u,g.push(Sr(Mr(u+m%d,0))),c=qr(m/d);g.push(Sr(Mr(c,0))),o=Rr(t,f,n==s),t=0,++n}++t,++r}return g.join("")}function Or(e){return zr(e,(function(e){return xr.test(e)?Br(e.slice(4).toLowerCase()):e}))}function Pr(e){return zr(e,(function(e){return Dr.test(e)?"xn--"+Nr(e):e}))}var jr="1.4.1",Ur={decode:Tr,encode:Ir},Vr={version:jr,ucs2:Ur,toASCII:Pr,toUnicode:Or,encode:Nr,decode:Br},Zr=e(Object.freeze({__proto__:null,decode:Br,encode:Nr,toUnicode:Or,toASCII:Pr,version:jr,ucs2:Ur,default:Vr})),Gr={default:{options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:100},components:{core:{},block:{},inline:{}}},zero:{options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["paragraph"]},inline:{rules:["text"],rules2:["balance_pairs","text_collapse"]}}},commonmark:{options:{html:!0,xhtmlOut:!0,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["blockquote","code","fence","heading","hr","html_block","lheading","list","reference","paragraph"]},inline:{rules:["autolink","backticks","emphasis","entity","escape","html_inline","image","link","newline","text"],rules2:["balance_pairs","emphasis","text_collapse"]}}}},$r=/^(vbscript|javascript|file|data):/,Hr=/^data:image\/(gif|png|jpeg|webp);/;function Jr(e){var r=e.trim().toLowerCase();return!$r.test(r)||!!Hr.test(r)}var Wr=["http:","https:","mailto:"];function Yr(e){var r=C.parse(e,!0);if(r.hostname&&(!r.protocol||Wr.indexOf(r.protocol)>=0))try{r.hostname=Zr.toASCII(r.hostname)}catch(e){}return C.encode(C.format(r))}function Kr(e){var r=C.parse(e,!0);if(r.hostname&&(!r.protocol||Wr.indexOf(r.protocol)>=0))try{r.hostname=Zr.toUnicode(r.hostname)}catch(e){}return C.decode(C.format(r),C.decode.defaultChars+"%")}function Qr(e,r){if(!(this instanceof Qr))return new Qr(e,r);r||w.isString(e)||(r=e||{},e="default"),this.inline=new lr,this.block=new ze,this.core=new ue,this.renderer=new B,this.linkify=new Cr,this.validateLink=Jr,this.normalizeLink=Yr,this.normalizeLinkText=Kr,this.utils=w,this.helpers=w.assign({},L),this.options={},this.configure(e),r&&this.set(r)}return Qr.prototype.set=function(e){return w.assign(this.options,e),this},Qr.prototype.configure=function(e){var r,t=this;if(w.isString(e)&&!(e=Gr[r=e]))throw new Error('Wrong `markdown-it` preset "'+r+'", check name');if(!e)throw new Error("Wrong `markdown-it` preset, can't be empty");return e.options&&t.set(e.options),e.components&&Object.keys(e.components).forEach((function(r){e.components[r].rules&&t[r].ruler.enableOnly(e.components[r].rules),e.components[r].rules2&&t[r].ruler2.enableOnly(e.components[r].rules2)})),this},Qr.prototype.enable=function(e,r){var t=[];Array.isArray(e)||(e=[e]),["core","block","inline"].forEach((function(r){t=t.concat(this[r].ruler.enable(e,!0))}),this),t=t.concat(this.inline.ruler2.enable(e,!0));var n=e.filter((function(e){return t.indexOf(e)<0}));if(n.length&&!r)throw new Error("MarkdownIt. Failed to enable unknown rule(s): "+n);return this},Qr.prototype.disable=function(e,r){var t=[];Array.isArray(e)||(e=[e]),["core","block","inline"].forEach((function(r){t=t.concat(this[r].ruler.disable(e,!0))}),this),t=t.concat(this.inline.ruler2.disable(e,!0));var n=e.filter((function(e){return t.indexOf(e)<0}));if(n.length&&!r)throw new Error("MarkdownIt. Failed to disable unknown rule(s): "+n);return this},Qr.prototype.use=function(e){var r=[this].concat(Array.prototype.slice.call(arguments,1));return e.apply(e,r),this},Qr.prototype.parse=function(e,r){if("string"!=typeof e)throw new Error("Input data should be a String");var t=new this.core.State(e,this,r);return this.core.process(t),t.tokens},Qr.prototype.render=function(e,r){return r=r||{},this.renderer.render(this.parse(e,r),this.options,r)},Qr.prototype.parseInline=function(e,r){var t=new this.core.State(e,this,r);return t.inlineMode=!0,this.core.process(t),t.tokens},Qr.prototype.renderInline=function(e,r){return r=r||{},this.renderer.render(this.parseInline(e,r),this.options,r)},Qr})); diff --git a/node_modules/markdown-it/index.js b/node_modules/markdown-it/index.js new file mode 100644 index 0000000..f71477e --- /dev/null +++ b/node_modules/markdown-it/index.js @@ -0,0 +1,4 @@ +'use strict'; + + +module.exports = require('./lib/'); diff --git a/node_modules/markdown-it/lib/common/entities.js b/node_modules/markdown-it/lib/common/entities.js new file mode 100644 index 0000000..c2e23e9 --- /dev/null +++ b/node_modules/markdown-it/lib/common/entities.js @@ -0,0 +1,6 @@ +// HTML5 entities map: { name -> utf16string } +// +'use strict'; + +/*eslint quotes:0*/ +module.exports = require('entities/lib/maps/entities.json'); diff --git a/node_modules/markdown-it/lib/common/html_blocks.js b/node_modules/markdown-it/lib/common/html_blocks.js new file mode 100644 index 0000000..daa6b46 --- /dev/null +++ b/node_modules/markdown-it/lib/common/html_blocks.js @@ -0,0 +1,70 @@ +// List of valid html blocks names, accorting to commonmark spec +// http://jgm.github.io/CommonMark/spec.html#html-blocks + +'use strict'; + + +module.exports = [ + 'address', + 'article', + 'aside', + 'base', + 'basefont', + 'blockquote', + 'body', + 'caption', + 'center', + 'col', + 'colgroup', + 'dd', + 'details', + 'dialog', + 'dir', + 'div', + 'dl', + 'dt', + 'fieldset', + 'figcaption', + 'figure', + 'footer', + 'form', + 'frame', + 'frameset', + 'h1', + 'h2', + 'h3', + 'h4', + 'h5', + 'h6', + 'head', + 'header', + 'hr', + 'html', + 'iframe', + 'legend', + 'li', + 'link', + 'main', + 'menu', + 'menuitem', + 'nav', + 'noframes', + 'ol', + 'optgroup', + 'option', + 'p', + 'param', + 'section', + 'source', + 'summary', + 'table', + 'tbody', + 'td', + 'tfoot', + 'th', + 'thead', + 'title', + 'tr', + 'track', + 'ul' +]; diff --git a/node_modules/markdown-it/lib/common/html_re.js b/node_modules/markdown-it/lib/common/html_re.js new file mode 100644 index 0000000..df81906 --- /dev/null +++ b/node_modules/markdown-it/lib/common/html_re.js @@ -0,0 +1,28 @@ +// Regexps to match html elements + +'use strict'; + +var attr_name = '[a-zA-Z_:][a-zA-Z0-9:._-]*'; + +var unquoted = '[^"\'=<>`\\x00-\\x20]+'; +var single_quoted = "'[^']*'"; +var double_quoted = '"[^"]*"'; + +var attr_value = '(?:' + unquoted + '|' + single_quoted + '|' + double_quoted + ')'; + +var attribute = '(?:\\s+' + attr_name + '(?:\\s*=\\s*' + attr_value + ')?)'; + +var open_tag = '<[A-Za-z][A-Za-z0-9\\-]*' + attribute + '*\\s*\\/?>'; + +var close_tag = '<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>'; +var comment = '<!---->|<!--(?:-?[^>-])(?:-?[^-])*-->'; +var processing = '<[?][\\s\\S]*?[?]>'; +var declaration = '<![A-Z]+\\s+[^>]*>'; +var cdata = '<!\\[CDATA\\[[\\s\\S]*?\\]\\]>'; + +var HTML_TAG_RE = new RegExp('^(?:' + open_tag + '|' + close_tag + '|' + comment + + '|' + processing + '|' + declaration + '|' + cdata + ')'); +var HTML_OPEN_CLOSE_TAG_RE = new RegExp('^(?:' + open_tag + '|' + close_tag + ')'); + +module.exports.HTML_TAG_RE = HTML_TAG_RE; +module.exports.HTML_OPEN_CLOSE_TAG_RE = HTML_OPEN_CLOSE_TAG_RE; diff --git a/node_modules/markdown-it/lib/common/utils.js b/node_modules/markdown-it/lib/common/utils.js new file mode 100644 index 0000000..712cd29 --- /dev/null +++ b/node_modules/markdown-it/lib/common/utils.js @@ -0,0 +1,317 @@ +// Utilities +// +'use strict'; + + +function _class(obj) { return Object.prototype.toString.call(obj); } + +function isString(obj) { return _class(obj) === '[object String]'; } + +var _hasOwnProperty = Object.prototype.hasOwnProperty; + +function has(object, key) { + return _hasOwnProperty.call(object, key); +} + +// Merge objects +// +function assign(obj /*from1, from2, from3, ...*/) { + var sources = Array.prototype.slice.call(arguments, 1); + + sources.forEach(function (source) { + if (!source) { return; } + + if (typeof source !== 'object') { + throw new TypeError(source + 'must be object'); + } + + Object.keys(source).forEach(function (key) { + obj[key] = source[key]; + }); + }); + + return obj; +} + +// Remove element from array and put another array at those position. +// Useful for some operations with tokens +function arrayReplaceAt(src, pos, newElements) { + return [].concat(src.slice(0, pos), newElements, src.slice(pos + 1)); +} + +//////////////////////////////////////////////////////////////////////////////// + +function isValidEntityCode(c) { + /*eslint no-bitwise:0*/ + // broken sequence + if (c >= 0xD800 && c <= 0xDFFF) { return false; } + // never used + if (c >= 0xFDD0 && c <= 0xFDEF) { return false; } + if ((c & 0xFFFF) === 0xFFFF || (c & 0xFFFF) === 0xFFFE) { return false; } + // control codes + if (c >= 0x00 && c <= 0x08) { return false; } + if (c === 0x0B) { return false; } + if (c >= 0x0E && c <= 0x1F) { return false; } + if (c >= 0x7F && c <= 0x9F) { return false; } + // out of range + if (c > 0x10FFFF) { return false; } + return true; +} + +function fromCodePoint(c) { + /*eslint no-bitwise:0*/ + if (c > 0xffff) { + c -= 0x10000; + var surrogate1 = 0xd800 + (c >> 10), + surrogate2 = 0xdc00 + (c & 0x3ff); + + return String.fromCharCode(surrogate1, surrogate2); + } + return String.fromCharCode(c); +} + + +var UNESCAPE_MD_RE = /\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g; +var ENTITY_RE = /&([a-z#][a-z0-9]{1,31});/gi; +var UNESCAPE_ALL_RE = new RegExp(UNESCAPE_MD_RE.source + '|' + ENTITY_RE.source, 'gi'); + +var DIGITAL_ENTITY_TEST_RE = /^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i; + +var entities = require('./entities'); + +function replaceEntityPattern(match, name) { + var code = 0; + + if (has(entities, name)) { + return entities[name]; + } + + if (name.charCodeAt(0) === 0x23/* # */ && DIGITAL_ENTITY_TEST_RE.test(name)) { + code = name[1].toLowerCase() === 'x' ? + parseInt(name.slice(2), 16) : parseInt(name.slice(1), 10); + + if (isValidEntityCode(code)) { + return fromCodePoint(code); + } + } + + return match; +} + +/*function replaceEntities(str) { + if (str.indexOf('&') < 0) { return str; } + + return str.replace(ENTITY_RE, replaceEntityPattern); +}*/ + +function unescapeMd(str) { + if (str.indexOf('\\') < 0) { return str; } + return str.replace(UNESCAPE_MD_RE, '$1'); +} + +function unescapeAll(str) { + if (str.indexOf('\\') < 0 && str.indexOf('&') < 0) { return str; } + + return str.replace(UNESCAPE_ALL_RE, function (match, escaped, entity) { + if (escaped) { return escaped; } + return replaceEntityPattern(match, entity); + }); +} + +//////////////////////////////////////////////////////////////////////////////// + +var HTML_ESCAPE_TEST_RE = /[&<>"]/; +var HTML_ESCAPE_REPLACE_RE = /[&<>"]/g; +var HTML_REPLACEMENTS = { + '&': '&', + '<': '<', + '>': '>', + '"': '"' +}; + +function replaceUnsafeChar(ch) { + return HTML_REPLACEMENTS[ch]; +} + +function escapeHtml(str) { + if (HTML_ESCAPE_TEST_RE.test(str)) { + return str.replace(HTML_ESCAPE_REPLACE_RE, replaceUnsafeChar); + } + return str; +} + +//////////////////////////////////////////////////////////////////////////////// + +var REGEXP_ESCAPE_RE = /[.?*+^$[\]\\(){}|-]/g; + +function escapeRE(str) { + return str.replace(REGEXP_ESCAPE_RE, '\\$&'); +} + +//////////////////////////////////////////////////////////////////////////////// + +function isSpace(code) { + switch (code) { + case 0x09: + case 0x20: + return true; + } + return false; +} + +// Zs (unicode class) || [\t\f\v\r\n] +function isWhiteSpace(code) { + if (code >= 0x2000 && code <= 0x200A) { return true; } + switch (code) { + case 0x09: // \t + case 0x0A: // \n + case 0x0B: // \v + case 0x0C: // \f + case 0x0D: // \r + case 0x20: + case 0xA0: + case 0x1680: + case 0x202F: + case 0x205F: + case 0x3000: + return true; + } + return false; +} + +//////////////////////////////////////////////////////////////////////////////// + +/*eslint-disable max-len*/ +var UNICODE_PUNCT_RE = require('uc.micro/categories/P/regex'); + +// Currently without astral characters support. +function isPunctChar(ch) { + return UNICODE_PUNCT_RE.test(ch); +} + + +// Markdown ASCII punctuation characters. +// +// !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~ +// http://spec.commonmark.org/0.15/#ascii-punctuation-character +// +// Don't confuse with unicode punctuation !!! It lacks some chars in ascii range. +// +function isMdAsciiPunct(ch) { + switch (ch) { + case 0x21/* ! */: + case 0x22/* " */: + case 0x23/* # */: + case 0x24/* $ */: + case 0x25/* % */: + case 0x26/* & */: + case 0x27/* ' */: + case 0x28/* ( */: + case 0x29/* ) */: + case 0x2A/* * */: + case 0x2B/* + */: + case 0x2C/* , */: + case 0x2D/* - */: + case 0x2E/* . */: + case 0x2F/* / */: + case 0x3A/* : */: + case 0x3B/* ; */: + case 0x3C/* < */: + case 0x3D/* = */: + case 0x3E/* > */: + case 0x3F/* ? */: + case 0x40/* @ */: + case 0x5B/* [ */: + case 0x5C/* \ */: + case 0x5D/* ] */: + case 0x5E/* ^ */: + case 0x5F/* _ */: + case 0x60/* ` */: + case 0x7B/* { */: + case 0x7C/* | */: + case 0x7D/* } */: + case 0x7E/* ~ */: + return true; + default: + return false; + } +} + +// Hepler to unify [reference labels]. +// +function normalizeReference(str) { + // Trim and collapse whitespace + // + str = str.trim().replace(/\s+/g, ' '); + + // In node v10 'ẞ'.toLowerCase() === 'Ṿ', which is presumed to be a bug + // fixed in v12 (couldn't find any details). + // + // So treat this one as a special case + // (remove this when node v10 is no longer supported). + // + if ('ẞ'.toLowerCase() === 'Ṿ') { + str = str.replace(/ẞ/g, 'ß'); + } + + // .toLowerCase().toUpperCase() should get rid of all differences + // between letter variants. + // + // Simple .toLowerCase() doesn't normalize 125 code points correctly, + // and .toUpperCase doesn't normalize 6 of them (list of exceptions: + // İ, ϴ, ẞ, Ω, K, Å - those are already uppercased, but have differently + // uppercased versions). + // + // Here's an example showing how it happens. Lets take greek letter omega: + // uppercase U+0398 (Θ), U+03f4 (ϴ) and lowercase U+03b8 (θ), U+03d1 (ϑ) + // + // Unicode entries: + // 0398;GREEK CAPITAL LETTER THETA;Lu;0;L;;;;;N;;;;03B8; + // 03B8;GREEK SMALL LETTER THETA;Ll;0;L;;;;;N;;;0398;;0398 + // 03D1;GREEK THETA SYMBOL;Ll;0;L;<compat> 03B8;;;;N;GREEK SMALL LETTER SCRIPT THETA;;0398;;0398 + // 03F4;GREEK CAPITAL THETA SYMBOL;Lu;0;L;<compat> 0398;;;;N;;;;03B8; + // + // Case-insensitive comparison should treat all of them as equivalent. + // + // But .toLowerCase() doesn't change ϑ (it's already lowercase), + // and .toUpperCase() doesn't change ϴ (already uppercase). + // + // Applying first lower then upper case normalizes any character: + // '\u0398\u03f4\u03b8\u03d1'.toLowerCase().toUpperCase() === '\u0398\u0398\u0398\u0398' + // + // Note: this is equivalent to unicode case folding; unicode normalization + // is a different step that is not required here. + // + // Final result should be uppercased, because it's later stored in an object + // (this avoid a conflict with Object.prototype members, + // most notably, `__proto__`) + // + return str.toLowerCase().toUpperCase(); +} + +//////////////////////////////////////////////////////////////////////////////// + +// Re-export libraries commonly used in both markdown-it and its plugins, +// so plugins won't have to depend on them explicitly, which reduces their +// bundled size (e.g. a browser build). +// +exports.lib = {}; +exports.lib.mdurl = require('mdurl'); +exports.lib.ucmicro = require('uc.micro'); + +exports.assign = assign; +exports.isString = isString; +exports.has = has; +exports.unescapeMd = unescapeMd; +exports.unescapeAll = unescapeAll; +exports.isValidEntityCode = isValidEntityCode; +exports.fromCodePoint = fromCodePoint; +// exports.replaceEntities = replaceEntities; +exports.escapeHtml = escapeHtml; +exports.arrayReplaceAt = arrayReplaceAt; +exports.isSpace = isSpace; +exports.isWhiteSpace = isWhiteSpace; +exports.isMdAsciiPunct = isMdAsciiPunct; +exports.isPunctChar = isPunctChar; +exports.escapeRE = escapeRE; +exports.normalizeReference = normalizeReference; diff --git a/node_modules/markdown-it/lib/helpers/index.js b/node_modules/markdown-it/lib/helpers/index.js new file mode 100644 index 0000000..bfdbfa2 --- /dev/null +++ b/node_modules/markdown-it/lib/helpers/index.js @@ -0,0 +1,7 @@ +// Just a shortcut for bulk export +'use strict'; + + +exports.parseLinkLabel = require('./parse_link_label'); +exports.parseLinkDestination = require('./parse_link_destination'); +exports.parseLinkTitle = require('./parse_link_title'); diff --git a/node_modules/markdown-it/lib/helpers/parse_link_destination.js b/node_modules/markdown-it/lib/helpers/parse_link_destination.js new file mode 100644 index 0000000..637f1f4 --- /dev/null +++ b/node_modules/markdown-it/lib/helpers/parse_link_destination.js @@ -0,0 +1,82 @@ +// Parse link destination +// +'use strict'; + + +var unescapeAll = require('../common/utils').unescapeAll; + + +module.exports = function parseLinkDestination(str, pos, max) { + var code, level, + lines = 0, + start = pos, + result = { + ok: false, + pos: 0, + lines: 0, + str: '' + }; + + if (str.charCodeAt(pos) === 0x3C /* < */) { + pos++; + while (pos < max) { + code = str.charCodeAt(pos); + if (code === 0x0A /* \n */) { return result; } + if (code === 0x3C /* < */) { return result; } + if (code === 0x3E /* > */) { + result.pos = pos + 1; + result.str = unescapeAll(str.slice(start + 1, pos)); + result.ok = true; + return result; + } + if (code === 0x5C /* \ */ && pos + 1 < max) { + pos += 2; + continue; + } + + pos++; + } + + // no closing '>' + return result; + } + + // this should be ... } else { ... branch + + level = 0; + while (pos < max) { + code = str.charCodeAt(pos); + + if (code === 0x20) { break; } + + // ascii control characters + if (code < 0x20 || code === 0x7F) { break; } + + if (code === 0x5C /* \ */ && pos + 1 < max) { + if (str.charCodeAt(pos + 1) === 0x20) { break; } + pos += 2; + continue; + } + + if (code === 0x28 /* ( */) { + level++; + if (level > 32) { return result; } + } + + if (code === 0x29 /* ) */) { + if (level === 0) { break; } + level--; + } + + pos++; + } + + if (start === pos) { return result; } + if (level !== 0) { return result; } + + result.str = unescapeAll(str.slice(start, pos)); + result.lines = lines; + result.pos = pos; + result.ok = true; + return result; +}; diff --git a/node_modules/markdown-it/lib/helpers/parse_link_label.js b/node_modules/markdown-it/lib/helpers/parse_link_label.js new file mode 100644 index 0000000..5a450fd --- /dev/null +++ b/node_modules/markdown-it/lib/helpers/parse_link_label.js @@ -0,0 +1,48 @@ +// Parse link label +// +// this function assumes that first character ("[") already matches; +// returns the end of the label +// +'use strict'; + +module.exports = function parseLinkLabel(state, start, disableNested) { + var level, found, marker, prevPos, + labelEnd = -1, + max = state.posMax, + oldPos = state.pos; + + state.pos = start + 1; + level = 1; + + while (state.pos < max) { + marker = state.src.charCodeAt(state.pos); + if (marker === 0x5D /* ] */) { + level--; + if (level === 0) { + found = true; + break; + } + } + + prevPos = state.pos; + state.md.inline.skipToken(state); + if (marker === 0x5B /* [ */) { + if (prevPos === state.pos - 1) { + // increase level if we find text `[`, which is not a part of any token + level++; + } else if (disableNested) { + state.pos = oldPos; + return -1; + } + } + } + + if (found) { + labelEnd = state.pos; + } + + // restore old state + state.pos = oldPos; + + return labelEnd; +}; diff --git a/node_modules/markdown-it/lib/helpers/parse_link_title.js b/node_modules/markdown-it/lib/helpers/parse_link_title.js new file mode 100644 index 0000000..051d6f4 --- /dev/null +++ b/node_modules/markdown-it/lib/helpers/parse_link_title.js @@ -0,0 +1,55 @@ +// Parse link title +// +'use strict'; + + +var unescapeAll = require('../common/utils').unescapeAll; + + +module.exports = function parseLinkTitle(str, pos, max) { + var code, + marker, + lines = 0, + start = pos, + result = { + ok: false, + pos: 0, + lines: 0, + str: '' + }; + + if (pos >= max) { return result; } + + marker = str.charCodeAt(pos); + + if (marker !== 0x22 /* " */ && marker !== 0x27 /* ' */ && marker !== 0x28 /* ( */) { return result; } + + pos++; + + // if opening marker is "(", switch it to closing marker ")" + if (marker === 0x28) { marker = 0x29; } + + while (pos < max) { + code = str.charCodeAt(pos); + if (code === marker) { + result.pos = pos + 1; + result.lines = lines; + result.str = unescapeAll(str.slice(start + 1, pos)); + result.ok = true; + return result; + } else if (code === 0x28 /* ( */ && marker === 0x29 /* ) */) { + return result; + } else if (code === 0x0A) { + lines++; + } else if (code === 0x5C /* \ */ && pos + 1 < max) { + pos++; + if (str.charCodeAt(pos) === 0x0A) { + lines++; + } + } + + pos++; + } + + return result; +}; diff --git a/node_modules/markdown-it/lib/index.js b/node_modules/markdown-it/lib/index.js new file mode 100644 index 0000000..afec8d8 --- /dev/null +++ b/node_modules/markdown-it/lib/index.js @@ -0,0 +1,582 @@ +// Main parser class + +'use strict'; + + +var utils = require('./common/utils'); +var helpers = require('./helpers'); +var Renderer = require('./renderer'); +var ParserCore = require('./parser_core'); +var ParserBlock = require('./parser_block'); +var ParserInline = require('./parser_inline'); +var LinkifyIt = require('linkify-it'); +var mdurl = require('mdurl'); +var punycode = require('punycode'); + + +var config = { + default: require('./presets/default'), + zero: require('./presets/zero'), + commonmark: require('./presets/commonmark') +}; + +//////////////////////////////////////////////////////////////////////////////// +// +// This validator can prohibit more than really needed to prevent XSS. It's a +// tradeoff to keep code simple and to be secure by default. +// +// If you need different setup - override validator method as you wish. Or +// replace it with dummy function and use external sanitizer. +// + +var BAD_PROTO_RE = /^(vbscript|javascript|file|data):/; +var GOOD_DATA_RE = /^data:image\/(gif|png|jpeg|webp);/; + +function validateLink(url) { + // url should be normalized at this point, and existing entities are decoded + var str = url.trim().toLowerCase(); + + return BAD_PROTO_RE.test(str) ? (GOOD_DATA_RE.test(str) ? true : false) : true; +} + +//////////////////////////////////////////////////////////////////////////////// + + +var RECODE_HOSTNAME_FOR = [ 'http:', 'https:', 'mailto:' ]; + +function normalizeLink(url) { + var parsed = mdurl.parse(url, true); + + if (parsed.hostname) { + // Encode hostnames in urls like: + // `http://host/`, `https://host/`, `mailto:user@host`, `//host/` + // + // We don't encode unknown schemas, because it's likely that we encode + // something we shouldn't (e.g. `skype:name` treated as `skype:host`) + // + if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) { + try { + parsed.hostname = punycode.toASCII(parsed.hostname); + } catch (er) { /**/ } + } + } + + return mdurl.encode(mdurl.format(parsed)); +} + +function normalizeLinkText(url) { + var parsed = mdurl.parse(url, true); + + if (parsed.hostname) { + // Encode hostnames in urls like: + // `http://host/`, `https://host/`, `mailto:user@host`, `//host/` + // + // We don't encode unknown schemas, because it's likely that we encode + // something we shouldn't (e.g. `skype:name` treated as `skype:host`) + // + if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) { + try { + parsed.hostname = punycode.toUnicode(parsed.hostname); + } catch (er) { /**/ } + } + } + + // add '%' to exclude list because of https://github.com/markdown-it/markdown-it/issues/720 + return mdurl.decode(mdurl.format(parsed), mdurl.decode.defaultChars + '%'); +} + + +/** + * class MarkdownIt + * + * Main parser/renderer class. + * + * ##### Usage + * + * ```javascript + * // node.js, "classic" way: + * var MarkdownIt = require('markdown-it'), + * md = new MarkdownIt(); + * var result = md.render('# markdown-it rulezz!'); + * + * // node.js, the same, but with sugar: + * var md = require('markdown-it')(); + * var result = md.render('# markdown-it rulezz!'); + * + * // browser without AMD, added to "window" on script load + * // Note, there are no dash. + * var md = window.markdownit(); + * var result = md.render('# markdown-it rulezz!'); + * ``` + * + * Single line rendering, without paragraph wrap: + * + * ```javascript + * var md = require('markdown-it')(); + * var result = md.renderInline('__markdown-it__ rulezz!'); + * ``` + **/ + +/** + * new MarkdownIt([presetName, options]) + * - presetName (String): optional, `commonmark` / `zero` + * - options (Object) + * + * Creates parser instanse with given config. Can be called without `new`. + * + * ##### presetName + * + * MarkdownIt provides named presets as a convenience to quickly + * enable/disable active syntax rules and options for common use cases. + * + * - ["commonmark"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/commonmark.js) - + * configures parser to strict [CommonMark](http://commonmark.org/) mode. + * - [default](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/default.js) - + * similar to GFM, used when no preset name given. Enables all available rules, + * but still without html, typographer & autolinker. + * - ["zero"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/zero.js) - + * all rules disabled. Useful to quickly setup your config via `.enable()`. + * For example, when you need only `bold` and `italic` markup and nothing else. + * + * ##### options: + * + * - __html__ - `false`. Set `true` to enable HTML tags in source. Be careful! + * That's not safe! You may need external sanitizer to protect output from XSS. + * It's better to extend features via plugins, instead of enabling HTML. + * - __xhtmlOut__ - `false`. Set `true` to add '/' when closing single tags + * (`<br />`). This is needed only for full CommonMark compatibility. In real + * world you will need HTML output. + * - __breaks__ - `false`. Set `true` to convert `\n` in paragraphs into `<br>`. + * - __langPrefix__ - `language-`. CSS language class prefix for fenced blocks. + * Can be useful for external highlighters. + * - __linkify__ - `false`. Set `true` to autoconvert URL-like text to links. + * - __typographer__ - `false`. Set `true` to enable [some language-neutral + * replacement](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js) + + * quotes beautification (smartquotes). + * - __quotes__ - `“”‘’`, String or Array. Double + single quotes replacement + * pairs, when typographer enabled and smartquotes on. For example, you can + * use `'«»„“'` for Russian, `'„“‚‘'` for German, and + * `['«\xA0', '\xA0»', '‹\xA0', '\xA0›']` for French (including nbsp). + * - __highlight__ - `null`. Highlighter function for fenced code blocks. + * Highlighter `function (str, lang)` should return escaped HTML. It can also + * return empty string if the source was not changed and should be escaped + * externaly. If result starts with <pre... internal wrapper is skipped. + * + * ##### Example + * + * ```javascript + * // commonmark mode + * var md = require('markdown-it')('commonmark'); + * + * // default mode + * var md = require('markdown-it')(); + * + * // enable everything + * var md = require('markdown-it')({ + * html: true, + * linkify: true, + * typographer: true + * }); + * ``` + * + * ##### Syntax highlighting + * + * ```js + * var hljs = require('highlight.js') // https://highlightjs.org/ + * + * var md = require('markdown-it')({ + * highlight: function (str, lang) { + * if (lang && hljs.getLanguage(lang)) { + * try { + * return hljs.highlight(str, { language: lang, ignoreIllegals: true }).value; + * } catch (__) {} + * } + * + * return ''; // use external default escaping + * } + * }); + * ``` + * + * Or with full wrapper override (if you need assign class to `<pre>`): + * + * ```javascript + * var hljs = require('highlight.js') // https://highlightjs.org/ + * + * // Actual default values + * var md = require('markdown-it')({ + * highlight: function (str, lang) { + * if (lang && hljs.getLanguage(lang)) { + * try { + * return '<pre class="hljs"><code>' + + * hljs.highlight(str, { language: lang, ignoreIllegals: true }).value + + * '</code></pre>'; + * } catch (__) {} + * } + * + * return '<pre class="hljs"><code>' + md.utils.escapeHtml(str) + '</code></pre>'; + * } + * }); + * ``` + * + **/ +function MarkdownIt(presetName, options) { + if (!(this instanceof MarkdownIt)) { + return new MarkdownIt(presetName, options); + } + + if (!options) { + if (!utils.isString(presetName)) { + options = presetName || {}; + presetName = 'default'; + } + } + + /** + * MarkdownIt#inline -> ParserInline + * + * Instance of [[ParserInline]]. You may need it to add new rules when + * writing plugins. For simple rules control use [[MarkdownIt.disable]] and + * [[MarkdownIt.enable]]. + **/ + this.inline = new ParserInline(); + + /** + * MarkdownIt#block -> ParserBlock + * + * Instance of [[ParserBlock]]. You may need it to add new rules when + * writing plugins. For simple rules control use [[MarkdownIt.disable]] and + * [[MarkdownIt.enable]]. + **/ + this.block = new ParserBlock(); + + /** + * MarkdownIt#core -> Core + * + * Instance of [[Core]] chain executor. You may need it to add new rules when + * writing plugins. For simple rules control use [[MarkdownIt.disable]] and + * [[MarkdownIt.enable]]. + **/ + this.core = new ParserCore(); + + /** + * MarkdownIt#renderer -> Renderer + * + * Instance of [[Renderer]]. Use it to modify output look. Or to add rendering + * rules for new token types, generated by plugins. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * function myToken(tokens, idx, options, env, self) { + * //... + * return result; + * }; + * + * md.renderer.rules['my_token'] = myToken + * ``` + * + * See [[Renderer]] docs and [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js). + **/ + this.renderer = new Renderer(); + + /** + * MarkdownIt#linkify -> LinkifyIt + * + * [linkify-it](https://github.com/markdown-it/linkify-it) instance. + * Used by [linkify](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/linkify.js) + * rule. + **/ + this.linkify = new LinkifyIt(); + + /** + * MarkdownIt#validateLink(url) -> Boolean + * + * Link validation function. CommonMark allows too much in links. By default + * we disable `javascript:`, `vbscript:`, `file:` schemas, and almost all `data:...` schemas + * except some embedded image types. + * + * You can change this behaviour: + * + * ```javascript + * var md = require('markdown-it')(); + * // enable everything + * md.validateLink = function () { return true; } + * ``` + **/ + this.validateLink = validateLink; + + /** + * MarkdownIt#normalizeLink(url) -> String + * + * Function used to encode link url to a machine-readable format, + * which includes url-encoding, punycode, etc. + **/ + this.normalizeLink = normalizeLink; + + /** + * MarkdownIt#normalizeLinkText(url) -> String + * + * Function used to decode link url to a human-readable format` + **/ + this.normalizeLinkText = normalizeLinkText; + + + // Expose utils & helpers for easy acces from plugins + + /** + * MarkdownIt#utils -> utils + * + * Assorted utility functions, useful to write plugins. See details + * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/common/utils.js). + **/ + this.utils = utils; + + /** + * MarkdownIt#helpers -> helpers + * + * Link components parser functions, useful to write plugins. See details + * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/helpers). + **/ + this.helpers = utils.assign({}, helpers); + + + this.options = {}; + this.configure(presetName); + + if (options) { this.set(options); } +} + + +/** chainable + * MarkdownIt.set(options) + * + * Set parser options (in the same format as in constructor). Probably, you + * will never need it, but you can change options after constructor call. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')() + * .set({ html: true, breaks: true }) + * .set({ typographer, true }); + * ``` + * + * __Note:__ To achieve the best possible performance, don't modify a + * `markdown-it` instance options on the fly. If you need multiple configurations + * it's best to create multiple instances and initialize each with separate + * config. + **/ +MarkdownIt.prototype.set = function (options) { + utils.assign(this.options, options); + return this; +}; + + +/** chainable, internal + * MarkdownIt.configure(presets) + * + * Batch load of all options and compenent settings. This is internal method, + * and you probably will not need it. But if you will - see available presets + * and data structure [here](https://github.com/markdown-it/markdown-it/tree/master/lib/presets) + * + * We strongly recommend to use presets instead of direct config loads. That + * will give better compatibility with next versions. + **/ +MarkdownIt.prototype.configure = function (presets) { + var self = this, presetName; + + if (utils.isString(presets)) { + presetName = presets; + presets = config[presetName]; + if (!presets) { throw new Error('Wrong `markdown-it` preset "' + presetName + '", check name'); } + } + + if (!presets) { throw new Error('Wrong `markdown-it` preset, can\'t be empty'); } + + if (presets.options) { self.set(presets.options); } + + if (presets.components) { + Object.keys(presets.components).forEach(function (name) { + if (presets.components[name].rules) { + self[name].ruler.enableOnly(presets.components[name].rules); + } + if (presets.components[name].rules2) { + self[name].ruler2.enableOnly(presets.components[name].rules2); + } + }); + } + return this; +}; + + +/** chainable + * MarkdownIt.enable(list, ignoreInvalid) + * - list (String|Array): rule name or list of rule names to enable + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Enable list or rules. It will automatically find appropriate components, + * containing rules with given names. If rule not found, and `ignoreInvalid` + * not set - throws exception. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')() + * .enable(['sub', 'sup']) + * .disable('smartquotes'); + * ``` + **/ +MarkdownIt.prototype.enable = function (list, ignoreInvalid) { + var result = []; + + if (!Array.isArray(list)) { list = [ list ]; } + + [ 'core', 'block', 'inline' ].forEach(function (chain) { + result = result.concat(this[chain].ruler.enable(list, true)); + }, this); + + result = result.concat(this.inline.ruler2.enable(list, true)); + + var missed = list.filter(function (name) { return result.indexOf(name) < 0; }); + + if (missed.length && !ignoreInvalid) { + throw new Error('MarkdownIt. Failed to enable unknown rule(s): ' + missed); + } + + return this; +}; + + +/** chainable + * MarkdownIt.disable(list, ignoreInvalid) + * - list (String|Array): rule name or list of rule names to disable. + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * The same as [[MarkdownIt.enable]], but turn specified rules off. + **/ +MarkdownIt.prototype.disable = function (list, ignoreInvalid) { + var result = []; + + if (!Array.isArray(list)) { list = [ list ]; } + + [ 'core', 'block', 'inline' ].forEach(function (chain) { + result = result.concat(this[chain].ruler.disable(list, true)); + }, this); + + result = result.concat(this.inline.ruler2.disable(list, true)); + + var missed = list.filter(function (name) { return result.indexOf(name) < 0; }); + + if (missed.length && !ignoreInvalid) { + throw new Error('MarkdownIt. Failed to disable unknown rule(s): ' + missed); + } + return this; +}; + + +/** chainable + * MarkdownIt.use(plugin, params) + * + * Load specified plugin with given params into current parser instance. + * It's just a sugar to call `plugin(md, params)` with curring. + * + * ##### Example + * + * ```javascript + * var iterator = require('markdown-it-for-inline'); + * var md = require('markdown-it')() + * .use(iterator, 'foo_replace', 'text', function (tokens, idx) { + * tokens[idx].content = tokens[idx].content.replace(/foo/g, 'bar'); + * }); + * ``` + **/ +MarkdownIt.prototype.use = function (plugin /*, params, ... */) { + var args = [ this ].concat(Array.prototype.slice.call(arguments, 1)); + plugin.apply(plugin, args); + return this; +}; + + +/** internal + * MarkdownIt.parse(src, env) -> Array + * - src (String): source string + * - env (Object): environment sandbox + * + * Parse input string and return list of block tokens (special token type + * "inline" will contain list of inline tokens). You should not call this + * method directly, until you write custom renderer (for example, to produce + * AST). + * + * `env` is used to pass data between "distributed" rules and return additional + * metadata like reference info, needed for the renderer. It also can be used to + * inject data in specific cases. Usually, you will be ok to pass `{}`, + * and then pass updated object to renderer. + **/ +MarkdownIt.prototype.parse = function (src, env) { + if (typeof src !== 'string') { + throw new Error('Input data should be a String'); + } + + var state = new this.core.State(src, this, env); + + this.core.process(state); + + return state.tokens; +}; + + +/** + * MarkdownIt.render(src [, env]) -> String + * - src (String): source string + * - env (Object): environment sandbox + * + * Render markdown string into html. It does all magic for you :). + * + * `env` can be used to inject additional metadata (`{}` by default). + * But you will not need it with high probability. See also comment + * in [[MarkdownIt.parse]]. + **/ +MarkdownIt.prototype.render = function (src, env) { + env = env || {}; + + return this.renderer.render(this.parse(src, env), this.options, env); +}; + + +/** internal + * MarkdownIt.parseInline(src, env) -> Array + * - src (String): source string + * - env (Object): environment sandbox + * + * The same as [[MarkdownIt.parse]] but skip all block rules. It returns the + * block tokens list with the single `inline` element, containing parsed inline + * tokens in `children` property. Also updates `env` object. + **/ +MarkdownIt.prototype.parseInline = function (src, env) { + var state = new this.core.State(src, this, env); + + state.inlineMode = true; + this.core.process(state); + + return state.tokens; +}; + + +/** + * MarkdownIt.renderInline(src [, env]) -> String + * - src (String): source string + * - env (Object): environment sandbox + * + * Similar to [[MarkdownIt.render]] but for single paragraph content. Result + * will NOT be wrapped into `<p>` tags. + **/ +MarkdownIt.prototype.renderInline = function (src, env) { + env = env || {}; + + return this.renderer.render(this.parseInline(src, env), this.options, env); +}; + + +module.exports = MarkdownIt; diff --git a/node_modules/markdown-it/lib/parser_block.js b/node_modules/markdown-it/lib/parser_block.js new file mode 100644 index 0000000..5450c2a --- /dev/null +++ b/node_modules/markdown-it/lib/parser_block.js @@ -0,0 +1,122 @@ +/** internal + * class ParserBlock + * + * Block-level tokenizer. + **/ +'use strict'; + + +var Ruler = require('./ruler'); + + +var _rules = [ + // First 2 params - rule name & source. Secondary array - list of rules, + // which can be terminated by this one. + [ 'table', require('./rules_block/table'), [ 'paragraph', 'reference' ] ], + [ 'code', require('./rules_block/code') ], + [ 'fence', require('./rules_block/fence'), [ 'paragraph', 'reference', 'blockquote', 'list' ] ], + [ 'blockquote', require('./rules_block/blockquote'), [ 'paragraph', 'reference', 'blockquote', 'list' ] ], + [ 'hr', require('./rules_block/hr'), [ 'paragraph', 'reference', 'blockquote', 'list' ] ], + [ 'list', require('./rules_block/list'), [ 'paragraph', 'reference', 'blockquote' ] ], + [ 'reference', require('./rules_block/reference') ], + [ 'html_block', require('./rules_block/html_block'), [ 'paragraph', 'reference', 'blockquote' ] ], + [ 'heading', require('./rules_block/heading'), [ 'paragraph', 'reference', 'blockquote' ] ], + [ 'lheading', require('./rules_block/lheading') ], + [ 'paragraph', require('./rules_block/paragraph') ] +]; + + +/** + * new ParserBlock() + **/ +function ParserBlock() { + /** + * ParserBlock#ruler -> Ruler + * + * [[Ruler]] instance. Keep configuration of block rules. + **/ + this.ruler = new Ruler(); + + for (var i = 0; i < _rules.length; i++) { + this.ruler.push(_rules[i][0], _rules[i][1], { alt: (_rules[i][2] || []).slice() }); + } +} + + +// Generate tokens for input range +// +ParserBlock.prototype.tokenize = function (state, startLine, endLine) { + var ok, i, + rules = this.ruler.getRules(''), + len = rules.length, + line = startLine, + hasEmptyLines = false, + maxNesting = state.md.options.maxNesting; + + while (line < endLine) { + state.line = line = state.skipEmptyLines(line); + if (line >= endLine) { break; } + + // Termination condition for nested calls. + // Nested calls currently used for blockquotes & lists + if (state.sCount[line] < state.blkIndent) { break; } + + // If nesting level exceeded - skip tail to the end. That's not ordinary + // situation and we should not care about content. + if (state.level >= maxNesting) { + state.line = endLine; + break; + } + + // Try all possible rules. + // On success, rule should: + // + // - update `state.line` + // - update `state.tokens` + // - return true + + for (i = 0; i < len; i++) { + ok = rules[i](state, line, endLine, false); + if (ok) { break; } + } + + // set state.tight if we had an empty line before current tag + // i.e. latest empty line should not count + state.tight = !hasEmptyLines; + + // paragraph might "eat" one newline after it in nested lists + if (state.isEmpty(state.line - 1)) { + hasEmptyLines = true; + } + + line = state.line; + + if (line < endLine && state.isEmpty(line)) { + hasEmptyLines = true; + line++; + state.line = line; + } + } +}; + + +/** + * ParserBlock.parse(str, md, env, outTokens) + * + * Process input string and push block tokens into `outTokens` + **/ +ParserBlock.prototype.parse = function (src, md, env, outTokens) { + var state; + + if (!src) { return; } + + state = new this.State(src, md, env, outTokens); + + this.tokenize(state, state.line, state.lineMax); +}; + + +ParserBlock.prototype.State = require('./rules_block/state_block'); + + +module.exports = ParserBlock; diff --git a/node_modules/markdown-it/lib/parser_core.js b/node_modules/markdown-it/lib/parser_core.js new file mode 100644 index 0000000..1eaa2b0 --- /dev/null +++ b/node_modules/markdown-it/lib/parser_core.js @@ -0,0 +1,58 @@ +/** internal + * class Core + * + * Top-level rules executor. Glues block/inline parsers and does intermediate + * transformations. + **/ +'use strict'; + + +var Ruler = require('./ruler'); + + +var _rules = [ + [ 'normalize', require('./rules_core/normalize') ], + [ 'block', require('./rules_core/block') ], + [ 'inline', require('./rules_core/inline') ], + [ 'linkify', require('./rules_core/linkify') ], + [ 'replacements', require('./rules_core/replacements') ], + [ 'smartquotes', require('./rules_core/smartquotes') ] +]; + + +/** + * new Core() + **/ +function Core() { + /** + * Core#ruler -> Ruler + * + * [[Ruler]] instance. Keep configuration of core rules. + **/ + this.ruler = new Ruler(); + + for (var i = 0; i < _rules.length; i++) { + this.ruler.push(_rules[i][0], _rules[i][1]); + } +} + + +/** + * Core.process(state) + * + * Executes core chain rules. + **/ +Core.prototype.process = function (state) { + var i, l, rules; + + rules = this.ruler.getRules(''); + + for (i = 0, l = rules.length; i < l; i++) { + rules[i](state); + } +}; + +Core.prototype.State = require('./rules_core/state_core'); + + +module.exports = Core; diff --git a/node_modules/markdown-it/lib/parser_inline.js b/node_modules/markdown-it/lib/parser_inline.js new file mode 100644 index 0000000..c8e66d3 --- /dev/null +++ b/node_modules/markdown-it/lib/parser_inline.js @@ -0,0 +1,177 @@ +/** internal + * class ParserInline + * + * Tokenizes paragraph content. + **/ +'use strict'; + + +var Ruler = require('./ruler'); + + +//////////////////////////////////////////////////////////////////////////////// +// Parser rules + +var _rules = [ + [ 'text', require('./rules_inline/text') ], + [ 'newline', require('./rules_inline/newline') ], + [ 'escape', require('./rules_inline/escape') ], + [ 'backticks', require('./rules_inline/backticks') ], + [ 'strikethrough', require('./rules_inline/strikethrough').tokenize ], + [ 'emphasis', require('./rules_inline/emphasis').tokenize ], + [ 'link', require('./rules_inline/link') ], + [ 'image', require('./rules_inline/image') ], + [ 'autolink', require('./rules_inline/autolink') ], + [ 'html_inline', require('./rules_inline/html_inline') ], + [ 'entity', require('./rules_inline/entity') ] +]; + +var _rules2 = [ + [ 'balance_pairs', require('./rules_inline/balance_pairs') ], + [ 'strikethrough', require('./rules_inline/strikethrough').postProcess ], + [ 'emphasis', require('./rules_inline/emphasis').postProcess ], + [ 'text_collapse', require('./rules_inline/text_collapse') ] +]; + + +/** + * new ParserInline() + **/ +function ParserInline() { + var i; + + /** + * ParserInline#ruler -> Ruler + * + * [[Ruler]] instance. Keep configuration of inline rules. + **/ + this.ruler = new Ruler(); + + for (i = 0; i < _rules.length; i++) { + this.ruler.push(_rules[i][0], _rules[i][1]); + } + + /** + * ParserInline#ruler2 -> Ruler + * + * [[Ruler]] instance. Second ruler used for post-processing + * (e.g. in emphasis-like rules). + **/ + this.ruler2 = new Ruler(); + + for (i = 0; i < _rules2.length; i++) { + this.ruler2.push(_rules2[i][0], _rules2[i][1]); + } +} + + +// Skip single token by running all rules in validation mode; +// returns `true` if any rule reported success +// +ParserInline.prototype.skipToken = function (state) { + var ok, i, pos = state.pos, + rules = this.ruler.getRules(''), + len = rules.length, + maxNesting = state.md.options.maxNesting, + cache = state.cache; + + + if (typeof cache[pos] !== 'undefined') { + state.pos = cache[pos]; + return; + } + + if (state.level < maxNesting) { + for (i = 0; i < len; i++) { + // Increment state.level and decrement it later to limit recursion. + // It's harmless to do here, because no tokens are created. But ideally, + // we'd need a separate private state variable for this purpose. + // + state.level++; + ok = rules[i](state, true); + state.level--; + + if (ok) { break; } + } + } else { + // Too much nesting, just skip until the end of the paragraph. + // + // NOTE: this will cause links to behave incorrectly in the following case, + // when an amount of `[` is exactly equal to `maxNesting + 1`: + // + // [[[[[[[[[[[[[[[[[[[[[foo]() + // + // TODO: remove this workaround when CM standard will allow nested links + // (we can replace it by preventing links from being parsed in + // validation mode) + // + state.pos = state.posMax; + } + + if (!ok) { state.pos++; } + cache[pos] = state.pos; +}; + + +// Generate tokens for input range +// +ParserInline.prototype.tokenize = function (state) { + var ok, i, + rules = this.ruler.getRules(''), + len = rules.length, + end = state.posMax, + maxNesting = state.md.options.maxNesting; + + while (state.pos < end) { + // Try all possible rules. + // On success, rule should: + // + // - update `state.pos` + // - update `state.tokens` + // - return true + + if (state.level < maxNesting) { + for (i = 0; i < len; i++) { + ok = rules[i](state, false); + if (ok) { break; } + } + } + + if (ok) { + if (state.pos >= end) { break; } + continue; + } + + state.pending += state.src[state.pos++]; + } + + if (state.pending) { + state.pushPending(); + } +}; + + +/** + * ParserInline.parse(str, md, env, outTokens) + * + * Process input string and push inline tokens into `outTokens` + **/ +ParserInline.prototype.parse = function (str, md, env, outTokens) { + var i, rules, len; + var state = new this.State(str, md, env, outTokens); + + this.tokenize(state); + + rules = this.ruler2.getRules(''); + len = rules.length; + + for (i = 0; i < len; i++) { + rules[i](state); + } +}; + + +ParserInline.prototype.State = require('./rules_inline/state_inline'); + + +module.exports = ParserInline; diff --git a/node_modules/markdown-it/lib/presets/commonmark.js b/node_modules/markdown-it/lib/presets/commonmark.js new file mode 100644 index 0000000..7066553 --- /dev/null +++ b/node_modules/markdown-it/lib/presets/commonmark.js @@ -0,0 +1,80 @@ +// Commonmark default options + +'use strict'; + + +module.exports = { + options: { + html: true, // Enable HTML tags in source + xhtmlOut: true, // Use '/' to close single tags (<br />) + breaks: false, // Convert '\n' in paragraphs into <br> + langPrefix: 'language-', // CSS language prefix for fenced blocks + linkify: false, // autoconvert URL-like texts to links + + // Enable some language-neutral replacements + quotes beautification + typographer: false, + + // Double + single quotes replacement pairs, when typographer enabled, + // and smartquotes on. Could be either a String or an Array. + // + // For example, you can use '«»„“' for Russian, '„“‚‘' for German, + // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). + quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */ + + // Highlighter function. Should return escaped HTML, + // or '' if the source string is not changed and should be escaped externaly. + // If result starts with <pre... internal wrapper is skipped. + // + // function (/*str, lang*/) { return ''; } + // + highlight: null, + + maxNesting: 20 // Internal protection, recursion limit + }, + + components: { + + core: { + rules: [ + 'normalize', + 'block', + 'inline' + ] + }, + + block: { + rules: [ + 'blockquote', + 'code', + 'fence', + 'heading', + 'hr', + 'html_block', + 'lheading', + 'list', + 'reference', + 'paragraph' + ] + }, + + inline: { + rules: [ + 'autolink', + 'backticks', + 'emphasis', + 'entity', + 'escape', + 'html_inline', + 'image', + 'link', + 'newline', + 'text' + ], + rules2: [ + 'balance_pairs', + 'emphasis', + 'text_collapse' + ] + } + } +}; diff --git a/node_modules/markdown-it/lib/presets/default.js b/node_modules/markdown-it/lib/presets/default.js new file mode 100644 index 0000000..17ecef2 --- /dev/null +++ b/node_modules/markdown-it/lib/presets/default.js @@ -0,0 +1,41 @@ +// markdown-it default options + +'use strict'; + + +module.exports = { + options: { + html: false, // Enable HTML tags in source + xhtmlOut: false, // Use '/' to close single tags (<br />) + breaks: false, // Convert '\n' in paragraphs into <br> + langPrefix: 'language-', // CSS language prefix for fenced blocks + linkify: false, // autoconvert URL-like texts to links + + // Enable some language-neutral replacements + quotes beautification + typographer: false, + + // Double + single quotes replacement pairs, when typographer enabled, + // and smartquotes on. Could be either a String or an Array. + // + // For example, you can use '«»„“' for Russian, '„“‚‘' for German, + // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). + quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */ + + // Highlighter function. Should return escaped HTML, + // or '' if the source string is not changed and should be escaped externaly. + // If result starts with <pre... internal wrapper is skipped. + // + // function (/*str, lang*/) { return ''; } + // + highlight: null, + + maxNesting: 100 // Internal protection, recursion limit + }, + + components: { + + core: {}, + block: {}, + inline: {} + } +}; diff --git a/node_modules/markdown-it/lib/presets/zero.js b/node_modules/markdown-it/lib/presets/zero.js new file mode 100644 index 0000000..5da413c --- /dev/null +++ b/node_modules/markdown-it/lib/presets/zero.js @@ -0,0 +1,62 @@ +// "Zero" preset, with nothing enabled. Useful for manual configuring of simple +// modes. For example, to parse bold/italic only. + +'use strict'; + + +module.exports = { + options: { + html: false, // Enable HTML tags in source + xhtmlOut: false, // Use '/' to close single tags (<br />) + breaks: false, // Convert '\n' in paragraphs into <br> + langPrefix: 'language-', // CSS language prefix for fenced blocks + linkify: false, // autoconvert URL-like texts to links + + // Enable some language-neutral replacements + quotes beautification + typographer: false, + + // Double + single quotes replacement pairs, when typographer enabled, + // and smartquotes on. Could be either a String or an Array. + // + // For example, you can use '«»„“' for Russian, '„“‚‘' for German, + // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). + quotes: '\u201c\u201d\u2018\u2019', /* “”‘’ */ + + // Highlighter function. Should return escaped HTML, + // or '' if the source string is not changed and should be escaped externaly. + // If result starts with <pre... internal wrapper is skipped. + // + // function (/*str, lang*/) { return ''; } + // + highlight: null, + + maxNesting: 20 // Internal protection, recursion limit + }, + + components: { + + core: { + rules: [ + 'normalize', + 'block', + 'inline' + ] + }, + + block: { + rules: [ + 'paragraph' + ] + }, + + inline: { + rules: [ + 'text' + ], + rules2: [ + 'balance_pairs', + 'text_collapse' + ] + } + } +}; diff --git a/node_modules/markdown-it/lib/renderer.js b/node_modules/markdown-it/lib/renderer.js new file mode 100644 index 0000000..08eacf3 --- /dev/null +++ b/node_modules/markdown-it/lib/renderer.js @@ -0,0 +1,341 @@ +/** + * class Renderer + * + * Generates HTML from parsed token stream. Each instance has independent + * copy of rules. Those can be rewritten with ease. Also, you can add new + * rules if you create plugin and adds new token types. + **/ +'use strict'; + + +var assign = require('./common/utils').assign; +var unescapeAll = require('./common/utils').unescapeAll; +var escapeHtml = require('./common/utils').escapeHtml; + + +//////////////////////////////////////////////////////////////////////////////// + +var default_rules = {}; + + +default_rules.code_inline = function (tokens, idx, options, env, slf) { + var token = tokens[idx]; + + return '<code' + slf.renderAttrs(token) + '>' + + escapeHtml(tokens[idx].content) + + '</code>'; +}; + + +default_rules.code_block = function (tokens, idx, options, env, slf) { + var token = tokens[idx]; + + return '<pre' + slf.renderAttrs(token) + '><code>' + + escapeHtml(tokens[idx].content) + + '</code></pre>\n'; +}; + + +default_rules.fence = function (tokens, idx, options, env, slf) { + var token = tokens[idx], + info = token.info ? unescapeAll(token.info).trim() : '', + langName = '', + langAttrs = '', + highlighted, i, arr, tmpAttrs, tmpToken; + + if (info) { + arr = info.split(/(\s+)/g); + langName = arr[0]; + langAttrs = arr.slice(2).join(''); + } + + if (options.highlight) { + highlighted = options.highlight(token.content, langName, langAttrs) || escapeHtml(token.content); + } else { + highlighted = escapeHtml(token.content); + } + + if (highlighted.indexOf('<pre') === 0) { + return highlighted + '\n'; + } + + // If language exists, inject class gently, without modifying original token. + // May be, one day we will add .deepClone() for token and simplify this part, but + // now we prefer to keep things local. + if (info) { + i = token.attrIndex('class'); + tmpAttrs = token.attrs ? token.attrs.slice() : []; + + if (i < 0) { + tmpAttrs.push([ 'class', options.langPrefix + langName ]); + } else { + tmpAttrs[i] = tmpAttrs[i].slice(); + tmpAttrs[i][1] += ' ' + options.langPrefix + langName; + } + + // Fake token just to render attributes + tmpToken = { + attrs: tmpAttrs + }; + + return '<pre><code' + slf.renderAttrs(tmpToken) + '>' + + highlighted + + '</code></pre>\n'; + } + + + return '<pre><code' + slf.renderAttrs(token) + '>' + + highlighted + + '</code></pre>\n'; +}; + + +default_rules.image = function (tokens, idx, options, env, slf) { + var token = tokens[idx]; + + // "alt" attr MUST be set, even if empty. Because it's mandatory and + // should be placed on proper position for tests. + // + // Replace content with actual value + + token.attrs[token.attrIndex('alt')][1] = + slf.renderInlineAsText(token.children, options, env); + + return slf.renderToken(tokens, idx, options); +}; + + +default_rules.hardbreak = function (tokens, idx, options /*, env */) { + return options.xhtmlOut ? '<br />\n' : '<br>\n'; +}; +default_rules.softbreak = function (tokens, idx, options /*, env */) { + return options.breaks ? (options.xhtmlOut ? '<br />\n' : '<br>\n') : '\n'; +}; + + +default_rules.text = function (tokens, idx /*, options, env */) { + return escapeHtml(tokens[idx].content); +}; + + +default_rules.html_block = function (tokens, idx /*, options, env */) { + return tokens[idx].content; +}; +default_rules.html_inline = function (tokens, idx /*, options, env */) { + return tokens[idx].content; +}; + + +/** + * new Renderer() + * + * Creates new [[Renderer]] instance and fill [[Renderer#rules]] with defaults. + **/ +function Renderer() { + + /** + * Renderer#rules -> Object + * + * Contains render rules for tokens. Can be updated and extended. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.renderer.rules.strong_open = function () { return '<b>'; }; + * md.renderer.rules.strong_close = function () { return '</b>'; }; + * + * var result = md.renderInline(...); + * ``` + * + * Each rule is called as independent static function with fixed signature: + * + * ```javascript + * function my_token_render(tokens, idx, options, env, renderer) { + * // ... + * return renderedHTML; + * } + * ``` + * + * See [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js) + * for more details and examples. + **/ + this.rules = assign({}, default_rules); +} + + +/** + * Renderer.renderAttrs(token) -> String + * + * Render token attributes to string. + **/ +Renderer.prototype.renderAttrs = function renderAttrs(token) { + var i, l, result; + + if (!token.attrs) { return ''; } + + result = ''; + + for (i = 0, l = token.attrs.length; i < l; i++) { + result += ' ' + escapeHtml(token.attrs[i][0]) + '="' + escapeHtml(token.attrs[i][1]) + '"'; + } + + return result; +}; + + +/** + * Renderer.renderToken(tokens, idx, options) -> String + * - tokens (Array): list of tokens + * - idx (Numbed): token index to render + * - options (Object): params of parser instance + * + * Default token renderer. Can be overriden by custom function + * in [[Renderer#rules]]. + **/ +Renderer.prototype.renderToken = function renderToken(tokens, idx, options) { + var nextToken, + result = '', + needLf = false, + token = tokens[idx]; + + // Tight list paragraphs + if (token.hidden) { + return ''; + } + + // Insert a newline between hidden paragraph and subsequent opening + // block-level tag. + // + // For example, here we should insert a newline before blockquote: + // - a + // > + // + if (token.block && token.nesting !== -1 && idx && tokens[idx - 1].hidden) { + result += '\n'; + } + + // Add token name, e.g. `<img` + result += (token.nesting === -1 ? '</' : '<') + token.tag; + + // Encode attributes, e.g. `<img src="foo"` + result += this.renderAttrs(token); + + // Add a slash for self-closing tags, e.g. `<img src="foo" /` + if (token.nesting === 0 && options.xhtmlOut) { + result += ' /'; + } + + // Check if we need to add a newline after this tag + if (token.block) { + needLf = true; + + if (token.nesting === 1) { + if (idx + 1 < tokens.length) { + nextToken = tokens[idx + 1]; + + if (nextToken.type === 'inline' || nextToken.hidden) { + // Block-level tag containing an inline tag. + // + needLf = false; + + } else if (nextToken.nesting === -1 && nextToken.tag === token.tag) { + // Opening tag + closing tag of the same type. E.g. `<li></li>`. + // + needLf = false; + } + } + } + } + + result += needLf ? '>\n' : '>'; + + return result; +}; + + +/** + * Renderer.renderInline(tokens, options, env) -> String + * - tokens (Array): list on block tokens to render + * - options (Object): params of parser instance + * - env (Object): additional data from parsed input (references, for example) + * + * The same as [[Renderer.render]], but for single token of `inline` type. + **/ +Renderer.prototype.renderInline = function (tokens, options, env) { + var type, + result = '', + rules = this.rules; + + for (var i = 0, len = tokens.length; i < len; i++) { + type = tokens[i].type; + + if (typeof rules[type] !== 'undefined') { + result += rules[type](tokens, i, options, env, this); + } else { + result += this.renderToken(tokens, i, options); + } + } + + return result; +}; + + +/** internal + * Renderer.renderInlineAsText(tokens, options, env) -> String + * - tokens (Array): list on block tokens to render + * - options (Object): params of parser instance + * - env (Object): additional data from parsed input (references, for example) + * + * Special kludge for image `alt` attributes to conform CommonMark spec. + * Don't try to use it! Spec requires to show `alt` content with stripped markup, + * instead of simple escaping. + **/ +Renderer.prototype.renderInlineAsText = function (tokens, options, env) { + var result = ''; + + for (var i = 0, len = tokens.length; i < len; i++) { + if (tokens[i].type === 'text') { + result += tokens[i].content; + } else if (tokens[i].type === 'image') { + result += this.renderInlineAsText(tokens[i].children, options, env); + } else if (tokens[i].type === 'softbreak') { + result += '\n'; + } + } + + return result; +}; + + +/** + * Renderer.render(tokens, options, env) -> String + * - tokens (Array): list on block tokens to render + * - options (Object): params of parser instance + * - env (Object): additional data from parsed input (references, for example) + * + * Takes token stream and generates HTML. Probably, you will never need to call + * this method directly. + **/ +Renderer.prototype.render = function (tokens, options, env) { + var i, len, type, + result = '', + rules = this.rules; + + for (i = 0, len = tokens.length; i < len; i++) { + type = tokens[i].type; + + if (type === 'inline') { + result += this.renderInline(tokens[i].children, options, env); + } else if (typeof rules[type] !== 'undefined') { + result += rules[tokens[i].type](tokens, i, options, env, this); + } else { + result += this.renderToken(tokens, i, options, env); + } + } + + return result; +}; + +module.exports = Renderer; diff --git a/node_modules/markdown-it/lib/ruler.js b/node_modules/markdown-it/lib/ruler.js new file mode 100644 index 0000000..9ad5da4 --- /dev/null +++ b/node_modules/markdown-it/lib/ruler.js @@ -0,0 +1,352 @@ +/** + * class Ruler + * + * Helper class, used by [[MarkdownIt#core]], [[MarkdownIt#block]] and + * [[MarkdownIt#inline]] to manage sequences of functions (rules): + * + * - keep rules in defined order + * - assign the name to each rule + * - enable/disable rules + * - add/replace rules + * - allow assign rules to additional named chains (in the same) + * - cacheing lists of active rules + * + * You will not need use this class directly until write plugins. For simple + * rules control use [[MarkdownIt.disable]], [[MarkdownIt.enable]] and + * [[MarkdownIt.use]]. + **/ +'use strict'; + + +/** + * new Ruler() + **/ +function Ruler() { + // List of added rules. Each element is: + // + // { + // name: XXX, + // enabled: Boolean, + // fn: Function(), + // alt: [ name2, name3 ] + // } + // + this.__rules__ = []; + + // Cached rule chains. + // + // First level - chain name, '' for default. + // Second level - diginal anchor for fast filtering by charcodes. + // + this.__cache__ = null; +} + +//////////////////////////////////////////////////////////////////////////////// +// Helper methods, should not be used directly + + +// Find rule index by name +// +Ruler.prototype.__find__ = function (name) { + for (var i = 0; i < this.__rules__.length; i++) { + if (this.__rules__[i].name === name) { + return i; + } + } + return -1; +}; + + +// Build rules lookup cache +// +Ruler.prototype.__compile__ = function () { + var self = this; + var chains = [ '' ]; + + // collect unique names + self.__rules__.forEach(function (rule) { + if (!rule.enabled) { return; } + + rule.alt.forEach(function (altName) { + if (chains.indexOf(altName) < 0) { + chains.push(altName); + } + }); + }); + + self.__cache__ = {}; + + chains.forEach(function (chain) { + self.__cache__[chain] = []; + self.__rules__.forEach(function (rule) { + if (!rule.enabled) { return; } + + if (chain && rule.alt.indexOf(chain) < 0) { return; } + + self.__cache__[chain].push(rule.fn); + }); + }); +}; + + +/** + * Ruler.at(name, fn [, options]) + * - name (String): rule name to replace. + * - fn (Function): new rule function. + * - options (Object): new rule options (not mandatory). + * + * Replace rule by name with new function & options. Throws error if name not + * found. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * Replace existing typographer replacement rule with new one: + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.core.ruler.at('replacements', function replace(state) { + * //... + * }); + * ``` + **/ +Ruler.prototype.at = function (name, fn, options) { + var index = this.__find__(name); + var opt = options || {}; + + if (index === -1) { throw new Error('Parser rule not found: ' + name); } + + this.__rules__[index].fn = fn; + this.__rules__[index].alt = opt.alt || []; + this.__cache__ = null; +}; + + +/** + * Ruler.before(beforeName, ruleName, fn [, options]) + * - beforeName (String): new rule will be added before this one. + * - ruleName (String): name of added rule. + * - fn (Function): rule function. + * - options (Object): rule options (not mandatory). + * + * Add new rule to chain before one with given name. See also + * [[Ruler.after]], [[Ruler.push]]. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.block.ruler.before('paragraph', 'my_rule', function replace(state) { + * //... + * }); + * ``` + **/ +Ruler.prototype.before = function (beforeName, ruleName, fn, options) { + var index = this.__find__(beforeName); + var opt = options || {}; + + if (index === -1) { throw new Error('Parser rule not found: ' + beforeName); } + + this.__rules__.splice(index, 0, { + name: ruleName, + enabled: true, + fn: fn, + alt: opt.alt || [] + }); + + this.__cache__ = null; +}; + + +/** + * Ruler.after(afterName, ruleName, fn [, options]) + * - afterName (String): new rule will be added after this one. + * - ruleName (String): name of added rule. + * - fn (Function): rule function. + * - options (Object): rule options (not mandatory). + * + * Add new rule to chain after one with given name. See also + * [[Ruler.before]], [[Ruler.push]]. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.inline.ruler.after('text', 'my_rule', function replace(state) { + * //... + * }); + * ``` + **/ +Ruler.prototype.after = function (afterName, ruleName, fn, options) { + var index = this.__find__(afterName); + var opt = options || {}; + + if (index === -1) { throw new Error('Parser rule not found: ' + afterName); } + + this.__rules__.splice(index + 1, 0, { + name: ruleName, + enabled: true, + fn: fn, + alt: opt.alt || [] + }); + + this.__cache__ = null; +}; + +/** + * Ruler.push(ruleName, fn [, options]) + * - ruleName (String): name of added rule. + * - fn (Function): rule function. + * - options (Object): rule options (not mandatory). + * + * Push new rule to the end of chain. See also + * [[Ruler.before]], [[Ruler.after]]. + * + * ##### Options: + * + * - __alt__ - array with names of "alternate" chains. + * + * ##### Example + * + * ```javascript + * var md = require('markdown-it')(); + * + * md.core.ruler.push('my_rule', function replace(state) { + * //... + * }); + * ``` + **/ +Ruler.prototype.push = function (ruleName, fn, options) { + var opt = options || {}; + + this.__rules__.push({ + name: ruleName, + enabled: true, + fn: fn, + alt: opt.alt || [] + }); + + this.__cache__ = null; +}; + + +/** + * Ruler.enable(list [, ignoreInvalid]) -> Array + * - list (String|Array): list of rule names to enable. + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Enable rules with given names. If any rule name not found - throw Error. + * Errors can be disabled by second param. + * + * Returns list of found rule names (if no exception happened). + * + * See also [[Ruler.disable]], [[Ruler.enableOnly]]. + **/ +Ruler.prototype.enable = function (list, ignoreInvalid) { + if (!Array.isArray(list)) { list = [ list ]; } + + var result = []; + + // Search by name and enable + list.forEach(function (name) { + var idx = this.__find__(name); + + if (idx < 0) { + if (ignoreInvalid) { return; } + throw new Error('Rules manager: invalid rule name ' + name); + } + this.__rules__[idx].enabled = true; + result.push(name); + }, this); + + this.__cache__ = null; + return result; +}; + + +/** + * Ruler.enableOnly(list [, ignoreInvalid]) + * - list (String|Array): list of rule names to enable (whitelist). + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Enable rules with given names, and disable everything else. If any rule name + * not found - throw Error. Errors can be disabled by second param. + * + * See also [[Ruler.disable]], [[Ruler.enable]]. + **/ +Ruler.prototype.enableOnly = function (list, ignoreInvalid) { + if (!Array.isArray(list)) { list = [ list ]; } + + this.__rules__.forEach(function (rule) { rule.enabled = false; }); + + this.enable(list, ignoreInvalid); +}; + + +/** + * Ruler.disable(list [, ignoreInvalid]) -> Array + * - list (String|Array): list of rule names to disable. + * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. + * + * Disable rules with given names. If any rule name not found - throw Error. + * Errors can be disabled by second param. + * + * Returns list of found rule names (if no exception happened). + * + * See also [[Ruler.enable]], [[Ruler.enableOnly]]. + **/ +Ruler.prototype.disable = function (list, ignoreInvalid) { + if (!Array.isArray(list)) { list = [ list ]; } + + var result = []; + + // Search by name and disable + list.forEach(function (name) { + var idx = this.__find__(name); + + if (idx < 0) { + if (ignoreInvalid) { return; } + throw new Error('Rules manager: invalid rule name ' + name); + } + this.__rules__[idx].enabled = false; + result.push(name); + }, this); + + this.__cache__ = null; + return result; +}; + + +/** + * Ruler.getRules(chainName) -> Array + * + * Return array of active functions (rules) for given chain name. It analyzes + * rules configuration, compiles caches if not exists and returns result. + * + * Default chain name is `''` (empty string). It can't be skipped. That's + * done intentionally, to keep signature monomorphic for high speed. + **/ +Ruler.prototype.getRules = function (chainName) { + if (this.__cache__ === null) { + this.__compile__(); + } + + // Chain can be empty, if rules disabled. But we still have to return Array. + return this.__cache__[chainName] || []; +}; + +module.exports = Ruler; diff --git a/node_modules/markdown-it/lib/rules_block/blockquote.js b/node_modules/markdown-it/lib/rules_block/blockquote.js new file mode 100644 index 0000000..a02699a --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/blockquote.js @@ -0,0 +1,284 @@ +// Block quotes + +'use strict'; + +var isSpace = require('../common/utils').isSpace; + + +module.exports = function blockquote(state, startLine, endLine, silent) { + var adjustTab, + ch, + i, + initial, + l, + lastLineEmpty, + lines, + nextLine, + offset, + oldBMarks, + oldBSCount, + oldIndent, + oldParentType, + oldSCount, + oldTShift, + spaceAfterMarker, + terminate, + terminatorRules, + token, + isOutdented, + oldLineMax = state.lineMax, + pos = state.bMarks[startLine] + state.tShift[startLine], + max = state.eMarks[startLine]; + + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } + + // check the block quote marker + if (state.src.charCodeAt(pos++) !== 0x3E/* > */) { return false; } + + // we know that it's going to be a valid blockquote, + // so no point trying to find the end of it in silent mode + if (silent) { return true; } + + // set offset past spaces and ">" + initial = offset = state.sCount[startLine] + 1; + + // skip one optional space after '>' + if (state.src.charCodeAt(pos) === 0x20 /* space */) { + // ' > test ' + // ^ -- position start of line here: + pos++; + initial++; + offset++; + adjustTab = false; + spaceAfterMarker = true; + } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) { + spaceAfterMarker = true; + + if ((state.bsCount[startLine] + offset) % 4 === 3) { + // ' >\t test ' + // ^ -- position start of line here (tab has width===1) + pos++; + initial++; + offset++; + adjustTab = false; + } else { + // ' >\t test ' + // ^ -- position start of line here + shift bsCount slightly + // to make extra space appear + adjustTab = true; + } + } else { + spaceAfterMarker = false; + } + + oldBMarks = [ state.bMarks[startLine] ]; + state.bMarks[startLine] = pos; + + while (pos < max) { + ch = state.src.charCodeAt(pos); + + if (isSpace(ch)) { + if (ch === 0x09) { + offset += 4 - (offset + state.bsCount[startLine] + (adjustTab ? 1 : 0)) % 4; + } else { + offset++; + } + } else { + break; + } + + pos++; + } + + oldBSCount = [ state.bsCount[startLine] ]; + state.bsCount[startLine] = state.sCount[startLine] + 1 + (spaceAfterMarker ? 1 : 0); + + lastLineEmpty = pos >= max; + + oldSCount = [ state.sCount[startLine] ]; + state.sCount[startLine] = offset - initial; + + oldTShift = [ state.tShift[startLine] ]; + state.tShift[startLine] = pos - state.bMarks[startLine]; + + terminatorRules = state.md.block.ruler.getRules('blockquote'); + + oldParentType = state.parentType; + state.parentType = 'blockquote'; + + // Search the end of the block + // + // Block ends with either: + // 1. an empty line outside: + // ``` + // > test + // + // ``` + // 2. an empty line inside: + // ``` + // > + // test + // ``` + // 3. another tag: + // ``` + // > test + // - - - + // ``` + for (nextLine = startLine + 1; nextLine < endLine; nextLine++) { + // check if it's outdented, i.e. it's inside list item and indented + // less than said list item: + // + // ``` + // 1. anything + // > current blockquote + // 2. checking this line + // ``` + isOutdented = state.sCount[nextLine] < state.blkIndent; + + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + + if (pos >= max) { + // Case 1: line is not inside the blockquote, and this line is empty. + break; + } + + if (state.src.charCodeAt(pos++) === 0x3E/* > */ && !isOutdented) { + // This line is inside the blockquote. + + // set offset past spaces and ">" + initial = offset = state.sCount[nextLine] + 1; + + // skip one optional space after '>' + if (state.src.charCodeAt(pos) === 0x20 /* space */) { + // ' > test ' + // ^ -- position start of line here: + pos++; + initial++; + offset++; + adjustTab = false; + spaceAfterMarker = true; + } else if (state.src.charCodeAt(pos) === 0x09 /* tab */) { + spaceAfterMarker = true; + + if ((state.bsCount[nextLine] + offset) % 4 === 3) { + // ' >\t test ' + // ^ -- position start of line here (tab has width===1) + pos++; + initial++; + offset++; + adjustTab = false; + } else { + // ' >\t test ' + // ^ -- position start of line here + shift bsCount slightly + // to make extra space appear + adjustTab = true; + } + } else { + spaceAfterMarker = false; + } + + oldBMarks.push(state.bMarks[nextLine]); + state.bMarks[nextLine] = pos; + + while (pos < max) { + ch = state.src.charCodeAt(pos); + + if (isSpace(ch)) { + if (ch === 0x09) { + offset += 4 - (offset + state.bsCount[nextLine] + (adjustTab ? 1 : 0)) % 4; + } else { + offset++; + } + } else { + break; + } + + pos++; + } + + lastLineEmpty = pos >= max; + + oldBSCount.push(state.bsCount[nextLine]); + state.bsCount[nextLine] = state.sCount[nextLine] + 1 + (spaceAfterMarker ? 1 : 0); + + oldSCount.push(state.sCount[nextLine]); + state.sCount[nextLine] = offset - initial; + + oldTShift.push(state.tShift[nextLine]); + state.tShift[nextLine] = pos - state.bMarks[nextLine]; + continue; + } + + // Case 2: line is not inside the blockquote, and the last line was empty. + if (lastLineEmpty) { break; } + + // Case 3: another tag found. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + + if (terminate) { + // Quirk to enforce "hard termination mode" for paragraphs; + // normally if you call `tokenize(state, startLine, nextLine)`, + // paragraphs will look below nextLine for paragraph continuation, + // but if blockquote is terminated by another tag, they shouldn't + state.lineMax = nextLine; + + if (state.blkIndent !== 0) { + // state.blkIndent was non-zero, we now set it to zero, + // so we need to re-calculate all offsets to appear as + // if indent wasn't changed + oldBMarks.push(state.bMarks[nextLine]); + oldBSCount.push(state.bsCount[nextLine]); + oldTShift.push(state.tShift[nextLine]); + oldSCount.push(state.sCount[nextLine]); + state.sCount[nextLine] -= state.blkIndent; + } + + break; + } + + oldBMarks.push(state.bMarks[nextLine]); + oldBSCount.push(state.bsCount[nextLine]); + oldTShift.push(state.tShift[nextLine]); + oldSCount.push(state.sCount[nextLine]); + + // A negative indentation means that this is a paragraph continuation + // + state.sCount[nextLine] = -1; + } + + oldIndent = state.blkIndent; + state.blkIndent = 0; + + token = state.push('blockquote_open', 'blockquote', 1); + token.markup = '>'; + token.map = lines = [ startLine, 0 ]; + + state.md.block.tokenize(state, startLine, nextLine); + + token = state.push('blockquote_close', 'blockquote', -1); + token.markup = '>'; + + state.lineMax = oldLineMax; + state.parentType = oldParentType; + lines[1] = state.line; + + // Restore original tShift; this might not be necessary since the parser + // has already been here, but just to make sure we can do that. + for (i = 0; i < oldTShift.length; i++) { + state.bMarks[i + startLine] = oldBMarks[i]; + state.tShift[i + startLine] = oldTShift[i]; + state.sCount[i + startLine] = oldSCount[i]; + state.bsCount[i + startLine] = oldBSCount[i]; + } + state.blkIndent = oldIndent; + + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_block/code.js b/node_modules/markdown-it/lib/rules_block/code.js new file mode 100644 index 0000000..018e019 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/code.js @@ -0,0 +1,34 @@ +// Code block (4 spaces padded) + +'use strict'; + + +module.exports = function code(state, startLine, endLine/*, silent*/) { + var nextLine, last, token; + + if (state.sCount[startLine] - state.blkIndent < 4) { return false; } + + last = nextLine = startLine + 1; + + while (nextLine < endLine) { + if (state.isEmpty(nextLine)) { + nextLine++; + continue; + } + + if (state.sCount[nextLine] - state.blkIndent >= 4) { + nextLine++; + last = nextLine; + continue; + } + break; + } + + state.line = last; + + token = state.push('code_block', 'code', 0); + token.content = state.getLines(startLine, last, 4 + state.blkIndent, false) + '\n'; + token.map = [ startLine, state.line ]; + + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_block/fence.js b/node_modules/markdown-it/lib/rules_block/fence.js new file mode 100644 index 0000000..44f1538 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/fence.js @@ -0,0 +1,98 @@ +// fences (``` lang, ~~~ lang) + +'use strict'; + + +module.exports = function fence(state, startLine, endLine, silent) { + var marker, len, params, nextLine, mem, token, markup, + haveEndMarker = false, + pos = state.bMarks[startLine] + state.tShift[startLine], + max = state.eMarks[startLine]; + + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } + + if (pos + 3 > max) { return false; } + + marker = state.src.charCodeAt(pos); + + if (marker !== 0x7E/* ~ */ && marker !== 0x60 /* ` */) { + return false; + } + + // scan marker length + mem = pos; + pos = state.skipChars(pos, marker); + + len = pos - mem; + + if (len < 3) { return false; } + + markup = state.src.slice(mem, pos); + params = state.src.slice(pos, max); + + if (marker === 0x60 /* ` */) { + if (params.indexOf(String.fromCharCode(marker)) >= 0) { + return false; + } + } + + // Since start is found, we can report success here in validation mode + if (silent) { return true; } + + // search end of block + nextLine = startLine; + + for (;;) { + nextLine++; + if (nextLine >= endLine) { + // unclosed block should be autoclosed by end of document. + // also block seems to be autoclosed by end of parent + break; + } + + pos = mem = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + + if (pos < max && state.sCount[nextLine] < state.blkIndent) { + // non-empty line with negative indent should stop the list: + // - ``` + // test + break; + } + + if (state.src.charCodeAt(pos) !== marker) { continue; } + + if (state.sCount[nextLine] - state.blkIndent >= 4) { + // closing fence should be indented less than 4 spaces + continue; + } + + pos = state.skipChars(pos, marker); + + // closing code fence must be at least as long as the opening one + if (pos - mem < len) { continue; } + + // make sure tail has spaces only + pos = state.skipSpaces(pos); + + if (pos < max) { continue; } + + haveEndMarker = true; + // found! + break; + } + + // If a fence has heading spaces, they should be removed from its inner block + len = state.sCount[startLine]; + + state.line = nextLine + (haveEndMarker ? 1 : 0); + + token = state.push('fence', 'code', 0); + token.info = params; + token.content = state.getLines(startLine + 1, nextLine, len, true); + token.markup = markup; + token.map = [ startLine, state.line ]; + + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_block/heading.js b/node_modules/markdown-it/lib/rules_block/heading.js new file mode 100644 index 0000000..9863f48 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/heading.js @@ -0,0 +1,55 @@ +// heading (#, ##, ...) + +'use strict'; + +var isSpace = require('../common/utils').isSpace; + + +module.exports = function heading(state, startLine, endLine, silent) { + var ch, level, tmp, token, + pos = state.bMarks[startLine] + state.tShift[startLine], + max = state.eMarks[startLine]; + + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } + + ch = state.src.charCodeAt(pos); + + if (ch !== 0x23/* # */ || pos >= max) { return false; } + + // count heading level + level = 1; + ch = state.src.charCodeAt(++pos); + while (ch === 0x23/* # */ && pos < max && level <= 6) { + level++; + ch = state.src.charCodeAt(++pos); + } + + if (level > 6 || (pos < max && !isSpace(ch))) { return false; } + + if (silent) { return true; } + + // Let's cut tails like ' ### ' from the end of string + + max = state.skipSpacesBack(max, pos); + tmp = state.skipCharsBack(max, 0x23, pos); // # + if (tmp > pos && isSpace(state.src.charCodeAt(tmp - 1))) { + max = tmp; + } + + state.line = startLine + 1; + + token = state.push('heading_open', 'h' + String(level), 1); + token.markup = '########'.slice(0, level); + token.map = [ startLine, state.line ]; + + token = state.push('inline', '', 0); + token.content = state.src.slice(pos, max).trim(); + token.map = [ startLine, state.line ]; + token.children = []; + + token = state.push('heading_close', 'h' + String(level), -1); + token.markup = '########'.slice(0, level); + + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_block/hr.js b/node_modules/markdown-it/lib/rules_block/hr.js new file mode 100644 index 0000000..a3bb14e --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/hr.js @@ -0,0 +1,45 @@ +// Horizontal rule + +'use strict'; + +var isSpace = require('../common/utils').isSpace; + + +module.exports = function hr(state, startLine, endLine, silent) { + var marker, cnt, ch, token, + pos = state.bMarks[startLine] + state.tShift[startLine], + max = state.eMarks[startLine]; + + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } + + marker = state.src.charCodeAt(pos++); + + // Check hr marker + if (marker !== 0x2A/* * */ && + marker !== 0x2D/* - */ && + marker !== 0x5F/* _ */) { + return false; + } + + // markers can be mixed with spaces, but there should be at least 3 of them + + cnt = 1; + while (pos < max) { + ch = state.src.charCodeAt(pos++); + if (ch !== marker && !isSpace(ch)) { return false; } + if (ch === marker) { cnt++; } + } + + if (cnt < 3) { return false; } + + if (silent) { return true; } + + state.line = startLine + 1; + + token = state.push('hr', 'hr', 0); + token.map = [ startLine, state.line ]; + token.markup = Array(cnt + 1).join(String.fromCharCode(marker)); + + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_block/html_block.js b/node_modules/markdown-it/lib/rules_block/html_block.js new file mode 100644 index 0000000..2f17675 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/html_block.js @@ -0,0 +1,74 @@ +// HTML block + +'use strict'; + + +var block_names = require('../common/html_blocks'); +var HTML_OPEN_CLOSE_TAG_RE = require('../common/html_re').HTML_OPEN_CLOSE_TAG_RE; + +// An array of opening and corresponding closing sequences for html tags, +// last argument defines whether it can terminate a paragraph or not +// +var HTML_SEQUENCES = [ + [ /^<(script|pre|style|textarea)(?=(\s|>|$))/i, /<\/(script|pre|style|textarea)>/i, true ], + [ /^<!--/, /-->/, true ], + [ /^<\?/, /\?>/, true ], + [ /^<![A-Z]/, />/, true ], + [ /^<!\[CDATA\[/, /\]\]>/, true ], + [ new RegExp('^</?(' + block_names.join('|') + ')(?=(\\s|/?>|$))', 'i'), /^$/, true ], + [ new RegExp(HTML_OPEN_CLOSE_TAG_RE.source + '\\s*$'), /^$/, false ] +]; + + +module.exports = function html_block(state, startLine, endLine, silent) { + var i, nextLine, token, lineText, + pos = state.bMarks[startLine] + state.tShift[startLine], + max = state.eMarks[startLine]; + + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } + + if (!state.md.options.html) { return false; } + + if (state.src.charCodeAt(pos) !== 0x3C/* < */) { return false; } + + lineText = state.src.slice(pos, max); + + for (i = 0; i < HTML_SEQUENCES.length; i++) { + if (HTML_SEQUENCES[i][0].test(lineText)) { break; } + } + + if (i === HTML_SEQUENCES.length) { return false; } + + if (silent) { + // true if this sequence can be a terminator, false otherwise + return HTML_SEQUENCES[i][2]; + } + + nextLine = startLine + 1; + + // If we are here - we detected HTML block. + // Let's roll down till block end. + if (!HTML_SEQUENCES[i][1].test(lineText)) { + for (; nextLine < endLine; nextLine++) { + if (state.sCount[nextLine] < state.blkIndent) { break; } + + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + lineText = state.src.slice(pos, max); + + if (HTML_SEQUENCES[i][1].test(lineText)) { + if (lineText.length !== 0) { nextLine++; } + break; + } + } + } + + state.line = nextLine; + + token = state.push('html_block', '', 0); + token.map = [ startLine, nextLine ]; + token.content = state.getLines(startLine, nextLine, state.blkIndent, true); + + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_block/lheading.js b/node_modules/markdown-it/lib/rules_block/lheading.js new file mode 100644 index 0000000..19bdc39 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/lheading.js @@ -0,0 +1,83 @@ +// lheading (---, ===) + +'use strict'; + + +module.exports = function lheading(state, startLine, endLine/*, silent*/) { + var content, terminate, i, l, token, pos, max, level, marker, + nextLine = startLine + 1, oldParentType, + terminatorRules = state.md.block.ruler.getRules('paragraph'); + + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } + + oldParentType = state.parentType; + state.parentType = 'paragraph'; // use paragraph to match terminatorRules + + // jump line-by-line until empty one or EOF + for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { + // this would be a code block normally, but after paragraph + // it's considered a lazy continuation regardless of what's there + if (state.sCount[nextLine] - state.blkIndent > 3) { continue; } + + // + // Check for underline in setext header + // + if (state.sCount[nextLine] >= state.blkIndent) { + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + max = state.eMarks[nextLine]; + + if (pos < max) { + marker = state.src.charCodeAt(pos); + + if (marker === 0x2D/* - */ || marker === 0x3D/* = */) { + pos = state.skipChars(pos, marker); + pos = state.skipSpaces(pos); + + if (pos >= max) { + level = (marker === 0x3D/* = */ ? 1 : 2); + break; + } + } + } + } + + // quirk for blockquotes, this line should already be checked by that rule + if (state.sCount[nextLine] < 0) { continue; } + + // Some tags can terminate paragraph without empty line. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { break; } + } + + if (!level) { + // Didn't find valid underline + return false; + } + + content = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); + + state.line = nextLine + 1; + + token = state.push('heading_open', 'h' + String(level), 1); + token.markup = String.fromCharCode(marker); + token.map = [ startLine, state.line ]; + + token = state.push('inline', '', 0); + token.content = content; + token.map = [ startLine, state.line - 1 ]; + token.children = []; + + token = state.push('heading_close', 'h' + String(level), -1); + token.markup = String.fromCharCode(marker); + + state.parentType = oldParentType; + + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_block/list.js b/node_modules/markdown-it/lib/rules_block/list.js new file mode 100644 index 0000000..1e5e87b --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/list.js @@ -0,0 +1,364 @@ +// Lists + +'use strict'; + +var isSpace = require('../common/utils').isSpace; + + +// Search `[-+*][\n ]`, returns next pos after marker on success +// or -1 on fail. +function skipBulletListMarker(state, startLine) { + var marker, pos, max, ch; + + pos = state.bMarks[startLine] + state.tShift[startLine]; + max = state.eMarks[startLine]; + + marker = state.src.charCodeAt(pos++); + // Check bullet + if (marker !== 0x2A/* * */ && + marker !== 0x2D/* - */ && + marker !== 0x2B/* + */) { + return -1; + } + + if (pos < max) { + ch = state.src.charCodeAt(pos); + + if (!isSpace(ch)) { + // " -test " - is not a list item + return -1; + } + } + + return pos; +} + +// Search `\d+[.)][\n ]`, returns next pos after marker on success +// or -1 on fail. +function skipOrderedListMarker(state, startLine) { + var ch, + start = state.bMarks[startLine] + state.tShift[startLine], + pos = start, + max = state.eMarks[startLine]; + + // List marker should have at least 2 chars (digit + dot) + if (pos + 1 >= max) { return -1; } + + ch = state.src.charCodeAt(pos++); + + if (ch < 0x30/* 0 */ || ch > 0x39/* 9 */) { return -1; } + + for (;;) { + // EOL -> fail + if (pos >= max) { return -1; } + + ch = state.src.charCodeAt(pos++); + + if (ch >= 0x30/* 0 */ && ch <= 0x39/* 9 */) { + + // List marker should have no more than 9 digits + // (prevents integer overflow in browsers) + if (pos - start >= 10) { return -1; } + + continue; + } + + // found valid marker + if (ch === 0x29/* ) */ || ch === 0x2e/* . */) { + break; + } + + return -1; + } + + + if (pos < max) { + ch = state.src.charCodeAt(pos); + + if (!isSpace(ch)) { + // " 1.test " - is not a list item + return -1; + } + } + return pos; +} + +function markTightParagraphs(state, idx) { + var i, l, + level = state.level + 2; + + for (i = idx + 2, l = state.tokens.length - 2; i < l; i++) { + if (state.tokens[i].level === level && state.tokens[i].type === 'paragraph_open') { + state.tokens[i + 2].hidden = true; + state.tokens[i].hidden = true; + i += 2; + } + } +} + + +module.exports = function list(state, startLine, endLine, silent) { + var ch, + contentStart, + i, + indent, + indentAfterMarker, + initial, + isOrdered, + itemLines, + l, + listLines, + listTokIdx, + markerCharCode, + markerValue, + max, + nextLine, + offset, + oldListIndent, + oldParentType, + oldSCount, + oldTShift, + oldTight, + pos, + posAfterMarker, + prevEmptyEnd, + start, + terminate, + terminatorRules, + token, + isTerminatingParagraph = false, + tight = true; + + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } + + // Special case: + // - item 1 + // - item 2 + // - item 3 + // - item 4 + // - this one is a paragraph continuation + if (state.listIndent >= 0 && + state.sCount[startLine] - state.listIndent >= 4 && + state.sCount[startLine] < state.blkIndent) { + return false; + } + + // limit conditions when list can interrupt + // a paragraph (validation mode only) + if (silent && state.parentType === 'paragraph') { + // Next list item should still terminate previous list item; + // + // This code can fail if plugins use blkIndent as well as lists, + // but I hope the spec gets fixed long before that happens. + // + if (state.sCount[startLine] >= state.blkIndent) { + isTerminatingParagraph = true; + } + } + + // Detect list type and position after marker + if ((posAfterMarker = skipOrderedListMarker(state, startLine)) >= 0) { + isOrdered = true; + start = state.bMarks[startLine] + state.tShift[startLine]; + markerValue = Number(state.src.slice(start, posAfterMarker - 1)); + + // If we're starting a new ordered list right after + // a paragraph, it should start with 1. + if (isTerminatingParagraph && markerValue !== 1) return false; + + } else if ((posAfterMarker = skipBulletListMarker(state, startLine)) >= 0) { + isOrdered = false; + + } else { + return false; + } + + // If we're starting a new unordered list right after + // a paragraph, first line should not be empty. + if (isTerminatingParagraph) { + if (state.skipSpaces(posAfterMarker) >= state.eMarks[startLine]) return false; + } + + // We should terminate list on style change. Remember first one to compare. + markerCharCode = state.src.charCodeAt(posAfterMarker - 1); + + // For validation mode we can terminate immediately + if (silent) { return true; } + + // Start list + listTokIdx = state.tokens.length; + + if (isOrdered) { + token = state.push('ordered_list_open', 'ol', 1); + if (markerValue !== 1) { + token.attrs = [ [ 'start', markerValue ] ]; + } + + } else { + token = state.push('bullet_list_open', 'ul', 1); + } + + token.map = listLines = [ startLine, 0 ]; + token.markup = String.fromCharCode(markerCharCode); + + // + // Iterate list items + // + + nextLine = startLine; + prevEmptyEnd = false; + terminatorRules = state.md.block.ruler.getRules('list'); + + oldParentType = state.parentType; + state.parentType = 'list'; + + while (nextLine < endLine) { + pos = posAfterMarker; + max = state.eMarks[nextLine]; + + initial = offset = state.sCount[nextLine] + posAfterMarker - (state.bMarks[startLine] + state.tShift[startLine]); + + while (pos < max) { + ch = state.src.charCodeAt(pos); + + if (ch === 0x09) { + offset += 4 - (offset + state.bsCount[nextLine]) % 4; + } else if (ch === 0x20) { + offset++; + } else { + break; + } + + pos++; + } + + contentStart = pos; + + if (contentStart >= max) { + // trimming space in "- \n 3" case, indent is 1 here + indentAfterMarker = 1; + } else { + indentAfterMarker = offset - initial; + } + + // If we have more than 4 spaces, the indent is 1 + // (the rest is just indented code block) + if (indentAfterMarker > 4) { indentAfterMarker = 1; } + + // " - test" + // ^^^^^ - calculating total length of this thing + indent = initial + indentAfterMarker; + + // Run subparser & write tokens + token = state.push('list_item_open', 'li', 1); + token.markup = String.fromCharCode(markerCharCode); + token.map = itemLines = [ startLine, 0 ]; + if (isOrdered) { + token.info = state.src.slice(start, posAfterMarker - 1); + } + + // change current state, then restore it after parser subcall + oldTight = state.tight; + oldTShift = state.tShift[startLine]; + oldSCount = state.sCount[startLine]; + + // - example list + // ^ listIndent position will be here + // ^ blkIndent position will be here + // + oldListIndent = state.listIndent; + state.listIndent = state.blkIndent; + state.blkIndent = indent; + + state.tight = true; + state.tShift[startLine] = contentStart - state.bMarks[startLine]; + state.sCount[startLine] = offset; + + if (contentStart >= max && state.isEmpty(startLine + 1)) { + // workaround for this case + // (list item is empty, list terminates before "foo"): + // ~~~~~~~~ + // - + // + // foo + // ~~~~~~~~ + state.line = Math.min(state.line + 2, endLine); + } else { + state.md.block.tokenize(state, startLine, endLine, true); + } + + // If any of list item is tight, mark list as tight + if (!state.tight || prevEmptyEnd) { + tight = false; + } + // Item become loose if finish with empty line, + // but we should filter last element, because it means list finish + prevEmptyEnd = (state.line - startLine) > 1 && state.isEmpty(state.line - 1); + + state.blkIndent = state.listIndent; + state.listIndent = oldListIndent; + state.tShift[startLine] = oldTShift; + state.sCount[startLine] = oldSCount; + state.tight = oldTight; + + token = state.push('list_item_close', 'li', -1); + token.markup = String.fromCharCode(markerCharCode); + + nextLine = startLine = state.line; + itemLines[1] = nextLine; + contentStart = state.bMarks[startLine]; + + if (nextLine >= endLine) { break; } + + // + // Try to check if list is terminated or continued. + // + if (state.sCount[nextLine] < state.blkIndent) { break; } + + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { break; } + + // fail if terminating block found + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { break; } + + // fail if list has another type + if (isOrdered) { + posAfterMarker = skipOrderedListMarker(state, nextLine); + if (posAfterMarker < 0) { break; } + start = state.bMarks[nextLine] + state.tShift[nextLine]; + } else { + posAfterMarker = skipBulletListMarker(state, nextLine); + if (posAfterMarker < 0) { break; } + } + + if (markerCharCode !== state.src.charCodeAt(posAfterMarker - 1)) { break; } + } + + // Finalize list + if (isOrdered) { + token = state.push('ordered_list_close', 'ol', -1); + } else { + token = state.push('bullet_list_close', 'ul', -1); + } + token.markup = String.fromCharCode(markerCharCode); + + listLines[1] = nextLine; + state.line = nextLine; + + state.parentType = oldParentType; + + // mark paragraphs tight if needed + if (tight) { + markTightParagraphs(state, listTokIdx); + } + + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_block/paragraph.js b/node_modules/markdown-it/lib/rules_block/paragraph.js new file mode 100644 index 0000000..f0c6872 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/paragraph.js @@ -0,0 +1,52 @@ +// Paragraph + +'use strict'; + + +module.exports = function paragraph(state, startLine/*, endLine*/) { + var content, terminate, i, l, token, oldParentType, + nextLine = startLine + 1, + terminatorRules = state.md.block.ruler.getRules('paragraph'), + endLine = state.lineMax; + + oldParentType = state.parentType; + state.parentType = 'paragraph'; + + // jump line-by-line until empty one or EOF + for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { + // this would be a code block normally, but after paragraph + // it's considered a lazy continuation regardless of what's there + if (state.sCount[nextLine] - state.blkIndent > 3) { continue; } + + // quirk for blockquotes, this line should already be checked by that rule + if (state.sCount[nextLine] < 0) { continue; } + + // Some tags can terminate paragraph without empty line. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { break; } + } + + content = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); + + state.line = nextLine; + + token = state.push('paragraph_open', 'p', 1); + token.map = [ startLine, state.line ]; + + token = state.push('inline', '', 0); + token.content = content; + token.map = [ startLine, state.line ]; + token.children = []; + + token = state.push('paragraph_close', 'p', -1); + + state.parentType = oldParentType; + + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_block/reference.js b/node_modules/markdown-it/lib/rules_block/reference.js new file mode 100644 index 0000000..78daa26 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/reference.js @@ -0,0 +1,198 @@ +'use strict'; + + +var normalizeReference = require('../common/utils').normalizeReference; +var isSpace = require('../common/utils').isSpace; + + +module.exports = function reference(state, startLine, _endLine, silent) { + var ch, + destEndPos, + destEndLineNo, + endLine, + href, + i, + l, + label, + labelEnd, + oldParentType, + res, + start, + str, + terminate, + terminatorRules, + title, + lines = 0, + pos = state.bMarks[startLine] + state.tShift[startLine], + max = state.eMarks[startLine], + nextLine = startLine + 1; + + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } + + if (state.src.charCodeAt(pos) !== 0x5B/* [ */) { return false; } + + // Simple check to quickly interrupt scan on [link](url) at the start of line. + // Can be useful on practice: https://github.com/markdown-it/markdown-it/issues/54 + while (++pos < max) { + if (state.src.charCodeAt(pos) === 0x5D /* ] */ && + state.src.charCodeAt(pos - 1) !== 0x5C/* \ */) { + if (pos + 1 === max) { return false; } + if (state.src.charCodeAt(pos + 1) !== 0x3A/* : */) { return false; } + break; + } + } + + endLine = state.lineMax; + + // jump line-by-line until empty one or EOF + terminatorRules = state.md.block.ruler.getRules('reference'); + + oldParentType = state.parentType; + state.parentType = 'reference'; + + for (; nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { + // this would be a code block normally, but after paragraph + // it's considered a lazy continuation regardless of what's there + if (state.sCount[nextLine] - state.blkIndent > 3) { continue; } + + // quirk for blockquotes, this line should already be checked by that rule + if (state.sCount[nextLine] < 0) { continue; } + + // Some tags can terminate paragraph without empty line. + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + if (terminate) { break; } + } + + str = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); + max = str.length; + + for (pos = 1; pos < max; pos++) { + ch = str.charCodeAt(pos); + if (ch === 0x5B /* [ */) { + return false; + } else if (ch === 0x5D /* ] */) { + labelEnd = pos; + break; + } else if (ch === 0x0A /* \n */) { + lines++; + } else if (ch === 0x5C /* \ */) { + pos++; + if (pos < max && str.charCodeAt(pos) === 0x0A) { + lines++; + } + } + } + + if (labelEnd < 0 || str.charCodeAt(labelEnd + 1) !== 0x3A/* : */) { return false; } + + // [label]: destination 'title' + // ^^^ skip optional whitespace here + for (pos = labelEnd + 2; pos < max; pos++) { + ch = str.charCodeAt(pos); + if (ch === 0x0A) { + lines++; + } else if (isSpace(ch)) { + /*eslint no-empty:0*/ + } else { + break; + } + } + + // [label]: destination 'title' + // ^^^^^^^^^^^ parse this + res = state.md.helpers.parseLinkDestination(str, pos, max); + if (!res.ok) { return false; } + + href = state.md.normalizeLink(res.str); + if (!state.md.validateLink(href)) { return false; } + + pos = res.pos; + lines += res.lines; + + // save cursor state, we could require to rollback later + destEndPos = pos; + destEndLineNo = lines; + + // [label]: destination 'title' + // ^^^ skipping those spaces + start = pos; + for (; pos < max; pos++) { + ch = str.charCodeAt(pos); + if (ch === 0x0A) { + lines++; + } else if (isSpace(ch)) { + /*eslint no-empty:0*/ + } else { + break; + } + } + + // [label]: destination 'title' + // ^^^^^^^ parse this + res = state.md.helpers.parseLinkTitle(str, pos, max); + if (pos < max && start !== pos && res.ok) { + title = res.str; + pos = res.pos; + lines += res.lines; + } else { + title = ''; + pos = destEndPos; + lines = destEndLineNo; + } + + // skip trailing spaces until the rest of the line + while (pos < max) { + ch = str.charCodeAt(pos); + if (!isSpace(ch)) { break; } + pos++; + } + + if (pos < max && str.charCodeAt(pos) !== 0x0A) { + if (title) { + // garbage at the end of the line after title, + // but it could still be a valid reference if we roll back + title = ''; + pos = destEndPos; + lines = destEndLineNo; + while (pos < max) { + ch = str.charCodeAt(pos); + if (!isSpace(ch)) { break; } + pos++; + } + } + } + + if (pos < max && str.charCodeAt(pos) !== 0x0A) { + // garbage at the end of the line + return false; + } + + label = normalizeReference(str.slice(1, labelEnd)); + if (!label) { + // CommonMark 0.20 disallows empty labels + return false; + } + + // Reference can not terminate anything. This check is for safety only. + /*istanbul ignore if*/ + if (silent) { return true; } + + if (typeof state.env.references === 'undefined') { + state.env.references = {}; + } + if (typeof state.env.references[label] === 'undefined') { + state.env.references[label] = { title: title, href: href }; + } + + state.parentType = oldParentType; + + state.line = startLine + lines + 1; + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_block/state_block.js b/node_modules/markdown-it/lib/rules_block/state_block.js new file mode 100644 index 0000000..e42cb4b --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/state_block.js @@ -0,0 +1,231 @@ +// Parser state class + +'use strict'; + +var Token = require('../token'); +var isSpace = require('../common/utils').isSpace; + + +function StateBlock(src, md, env, tokens) { + var ch, s, start, pos, len, indent, offset, indent_found; + + this.src = src; + + // link to parser instance + this.md = md; + + this.env = env; + + // + // Internal state vartiables + // + + this.tokens = tokens; + + this.bMarks = []; // line begin offsets for fast jumps + this.eMarks = []; // line end offsets for fast jumps + this.tShift = []; // offsets of the first non-space characters (tabs not expanded) + this.sCount = []; // indents for each line (tabs expanded) + + // An amount of virtual spaces (tabs expanded) between beginning + // of each line (bMarks) and real beginning of that line. + // + // It exists only as a hack because blockquotes override bMarks + // losing information in the process. + // + // It's used only when expanding tabs, you can think about it as + // an initial tab length, e.g. bsCount=21 applied to string `\t123` + // means first tab should be expanded to 4-21%4 === 3 spaces. + // + this.bsCount = []; + + // block parser variables + this.blkIndent = 0; // required block content indent (for example, if we are + // inside a list, it would be positioned after list marker) + this.line = 0; // line index in src + this.lineMax = 0; // lines count + this.tight = false; // loose/tight mode for lists + this.ddIndent = -1; // indent of the current dd block (-1 if there isn't any) + this.listIndent = -1; // indent of the current list block (-1 if there isn't any) + + // can be 'blockquote', 'list', 'root', 'paragraph' or 'reference' + // used in lists to determine if they interrupt a paragraph + this.parentType = 'root'; + + this.level = 0; + + // renderer + this.result = ''; + + // Create caches + // Generate markers. + s = this.src; + indent_found = false; + + for (start = pos = indent = offset = 0, len = s.length; pos < len; pos++) { + ch = s.charCodeAt(pos); + + if (!indent_found) { + if (isSpace(ch)) { + indent++; + + if (ch === 0x09) { + offset += 4 - offset % 4; + } else { + offset++; + } + continue; + } else { + indent_found = true; + } + } + + if (ch === 0x0A || pos === len - 1) { + if (ch !== 0x0A) { pos++; } + this.bMarks.push(start); + this.eMarks.push(pos); + this.tShift.push(indent); + this.sCount.push(offset); + this.bsCount.push(0); + + indent_found = false; + indent = 0; + offset = 0; + start = pos + 1; + } + } + + // Push fake entry to simplify cache bounds checks + this.bMarks.push(s.length); + this.eMarks.push(s.length); + this.tShift.push(0); + this.sCount.push(0); + this.bsCount.push(0); + + this.lineMax = this.bMarks.length - 1; // don't count last fake line +} + +// Push new token to "stream". +// +StateBlock.prototype.push = function (type, tag, nesting) { + var token = new Token(type, tag, nesting); + token.block = true; + + if (nesting < 0) this.level--; // closing tag + token.level = this.level; + if (nesting > 0) this.level++; // opening tag + + this.tokens.push(token); + return token; +}; + +StateBlock.prototype.isEmpty = function isEmpty(line) { + return this.bMarks[line] + this.tShift[line] >= this.eMarks[line]; +}; + +StateBlock.prototype.skipEmptyLines = function skipEmptyLines(from) { + for (var max = this.lineMax; from < max; from++) { + if (this.bMarks[from] + this.tShift[from] < this.eMarks[from]) { + break; + } + } + return from; +}; + +// Skip spaces from given position. +StateBlock.prototype.skipSpaces = function skipSpaces(pos) { + var ch; + + for (var max = this.src.length; pos < max; pos++) { + ch = this.src.charCodeAt(pos); + if (!isSpace(ch)) { break; } + } + return pos; +}; + +// Skip spaces from given position in reverse. +StateBlock.prototype.skipSpacesBack = function skipSpacesBack(pos, min) { + if (pos <= min) { return pos; } + + while (pos > min) { + if (!isSpace(this.src.charCodeAt(--pos))) { return pos + 1; } + } + return pos; +}; + +// Skip char codes from given position +StateBlock.prototype.skipChars = function skipChars(pos, code) { + for (var max = this.src.length; pos < max; pos++) { + if (this.src.charCodeAt(pos) !== code) { break; } + } + return pos; +}; + +// Skip char codes reverse from given position - 1 +StateBlock.prototype.skipCharsBack = function skipCharsBack(pos, code, min) { + if (pos <= min) { return pos; } + + while (pos > min) { + if (code !== this.src.charCodeAt(--pos)) { return pos + 1; } + } + return pos; +}; + +// cut lines range from source. +StateBlock.prototype.getLines = function getLines(begin, end, indent, keepLastLF) { + var i, lineIndent, ch, first, last, queue, lineStart, + line = begin; + + if (begin >= end) { + return ''; + } + + queue = new Array(end - begin); + + for (i = 0; line < end; line++, i++) { + lineIndent = 0; + lineStart = first = this.bMarks[line]; + + if (line + 1 < end || keepLastLF) { + // No need for bounds check because we have fake entry on tail. + last = this.eMarks[line] + 1; + } else { + last = this.eMarks[line]; + } + + while (first < last && lineIndent < indent) { + ch = this.src.charCodeAt(first); + + if (isSpace(ch)) { + if (ch === 0x09) { + lineIndent += 4 - (lineIndent + this.bsCount[line]) % 4; + } else { + lineIndent++; + } + } else if (first - lineStart < this.tShift[line]) { + // patched tShift masked characters to look like spaces (blockquotes, list markers) + lineIndent++; + } else { + break; + } + + first++; + } + + if (lineIndent > indent) { + // partially expanding tabs in code blocks, e.g '\t\tfoobar' + // with indent=2 becomes ' \tfoobar' + queue[i] = new Array(lineIndent - indent + 1).join(' ') + this.src.slice(first, last); + } else { + queue[i] = this.src.slice(first, last); + } + } + + return queue.join(''); +}; + +// re-export Token class to use in block rules +StateBlock.prototype.Token = Token; + + +module.exports = StateBlock; diff --git a/node_modules/markdown-it/lib/rules_block/table.js b/node_modules/markdown-it/lib/rules_block/table.js new file mode 100644 index 0000000..7d9208f --- /dev/null +++ b/node_modules/markdown-it/lib/rules_block/table.js @@ -0,0 +1,221 @@ +// GFM table, https://github.github.com/gfm/#tables-extension- + +'use strict'; + +var isSpace = require('../common/utils').isSpace; + + +function getLine(state, line) { + var pos = state.bMarks[line] + state.tShift[line], + max = state.eMarks[line]; + + return state.src.substr(pos, max - pos); +} + +function escapedSplit(str) { + var result = [], + pos = 0, + max = str.length, + ch, + isEscaped = false, + lastPos = 0, + current = ''; + + ch = str.charCodeAt(pos); + + while (pos < max) { + if (ch === 0x7c/* | */) { + if (!isEscaped) { + // pipe separating cells, '|' + result.push(current + str.substring(lastPos, pos)); + current = ''; + lastPos = pos + 1; + } else { + // escaped pipe, '\|' + current += str.substring(lastPos, pos - 1); + lastPos = pos; + } + } + + isEscaped = (ch === 0x5c/* \ */); + pos++; + + ch = str.charCodeAt(pos); + } + + result.push(current + str.substring(lastPos)); + + return result; +} + + +module.exports = function table(state, startLine, endLine, silent) { + var ch, lineText, pos, i, l, nextLine, columns, columnCount, token, + aligns, t, tableLines, tbodyLines, oldParentType, terminate, + terminatorRules, firstCh, secondCh; + + // should have at least two lines + if (startLine + 2 > endLine) { return false; } + + nextLine = startLine + 1; + + if (state.sCount[nextLine] < state.blkIndent) { return false; } + + // if it's indented more than 3 spaces, it should be a code block + if (state.sCount[nextLine] - state.blkIndent >= 4) { return false; } + + // first character of the second line should be '|', '-', ':', + // and no other characters are allowed but spaces; + // basically, this is the equivalent of /^[-:|][-:|\s]*$/ regexp + + pos = state.bMarks[nextLine] + state.tShift[nextLine]; + if (pos >= state.eMarks[nextLine]) { return false; } + + firstCh = state.src.charCodeAt(pos++); + if (firstCh !== 0x7C/* | */ && firstCh !== 0x2D/* - */ && firstCh !== 0x3A/* : */) { return false; } + + if (pos >= state.eMarks[nextLine]) { return false; } + + secondCh = state.src.charCodeAt(pos++); + if (secondCh !== 0x7C/* | */ && secondCh !== 0x2D/* - */ && secondCh !== 0x3A/* : */ && !isSpace(secondCh)) { + return false; + } + + // if first character is '-', then second character must not be a space + // (due to parsing ambiguity with list) + if (firstCh === 0x2D/* - */ && isSpace(secondCh)) { return false; } + + while (pos < state.eMarks[nextLine]) { + ch = state.src.charCodeAt(pos); + + if (ch !== 0x7C/* | */ && ch !== 0x2D/* - */ && ch !== 0x3A/* : */ && !isSpace(ch)) { return false; } + + pos++; + } + + lineText = getLine(state, startLine + 1); + + columns = lineText.split('|'); + aligns = []; + for (i = 0; i < columns.length; i++) { + t = columns[i].trim(); + if (!t) { + // allow empty columns before and after table, but not in between columns; + // e.g. allow ` |---| `, disallow ` ---||--- ` + if (i === 0 || i === columns.length - 1) { + continue; + } else { + return false; + } + } + + if (!/^:?-+:?$/.test(t)) { return false; } + if (t.charCodeAt(t.length - 1) === 0x3A/* : */) { + aligns.push(t.charCodeAt(0) === 0x3A/* : */ ? 'center' : 'right'); + } else if (t.charCodeAt(0) === 0x3A/* : */) { + aligns.push('left'); + } else { + aligns.push(''); + } + } + + lineText = getLine(state, startLine).trim(); + if (lineText.indexOf('|') === -1) { return false; } + if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } + columns = escapedSplit(lineText); + if (columns.length && columns[0] === '') columns.shift(); + if (columns.length && columns[columns.length - 1] === '') columns.pop(); + + // header row will define an amount of columns in the entire table, + // and align row should be exactly the same (the rest of the rows can differ) + columnCount = columns.length; + if (columnCount === 0 || columnCount !== aligns.length) { return false; } + + if (silent) { return true; } + + oldParentType = state.parentType; + state.parentType = 'table'; + + // use 'blockquote' lists for termination because it's + // the most similar to tables + terminatorRules = state.md.block.ruler.getRules('blockquote'); + + token = state.push('table_open', 'table', 1); + token.map = tableLines = [ startLine, 0 ]; + + token = state.push('thead_open', 'thead', 1); + token.map = [ startLine, startLine + 1 ]; + + token = state.push('tr_open', 'tr', 1); + token.map = [ startLine, startLine + 1 ]; + + for (i = 0; i < columns.length; i++) { + token = state.push('th_open', 'th', 1); + if (aligns[i]) { + token.attrs = [ [ 'style', 'text-align:' + aligns[i] ] ]; + } + + token = state.push('inline', '', 0); + token.content = columns[i].trim(); + token.children = []; + + token = state.push('th_close', 'th', -1); + } + + token = state.push('tr_close', 'tr', -1); + token = state.push('thead_close', 'thead', -1); + + for (nextLine = startLine + 2; nextLine < endLine; nextLine++) { + if (state.sCount[nextLine] < state.blkIndent) { break; } + + terminate = false; + for (i = 0, l = terminatorRules.length; i < l; i++) { + if (terminatorRules[i](state, nextLine, endLine, true)) { + terminate = true; + break; + } + } + + if (terminate) { break; } + lineText = getLine(state, nextLine).trim(); + if (!lineText) { break; } + if (state.sCount[nextLine] - state.blkIndent >= 4) { break; } + columns = escapedSplit(lineText); + if (columns.length && columns[0] === '') columns.shift(); + if (columns.length && columns[columns.length - 1] === '') columns.pop(); + + if (nextLine === startLine + 2) { + token = state.push('tbody_open', 'tbody', 1); + token.map = tbodyLines = [ startLine + 2, 0 ]; + } + + token = state.push('tr_open', 'tr', 1); + token.map = [ nextLine, nextLine + 1 ]; + + for (i = 0; i < columnCount; i++) { + token = state.push('td_open', 'td', 1); + if (aligns[i]) { + token.attrs = [ [ 'style', 'text-align:' + aligns[i] ] ]; + } + + token = state.push('inline', '', 0); + token.content = columns[i] ? columns[i].trim() : ''; + token.children = []; + + token = state.push('td_close', 'td', -1); + } + token = state.push('tr_close', 'tr', -1); + } + + if (tbodyLines) { + token = state.push('tbody_close', 'tbody', -1); + tbodyLines[1] = nextLine; + } + + token = state.push('table_close', 'table', -1); + tableLines[1] = nextLine; + + state.parentType = oldParentType; + state.line = nextLine; + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_core/block.js b/node_modules/markdown-it/lib/rules_core/block.js new file mode 100644 index 0000000..2a365fa --- /dev/null +++ b/node_modules/markdown-it/lib/rules_core/block.js @@ -0,0 +1,16 @@ +'use strict'; + + +module.exports = function block(state) { + var token; + + if (state.inlineMode) { + token = new state.Token('inline', '', 0); + token.content = state.src; + token.map = [ 0, 1 ]; + token.children = []; + state.tokens.push(token); + } else { + state.md.block.parse(state.src, state.md, state.env, state.tokens); + } +}; diff --git a/node_modules/markdown-it/lib/rules_core/inline.js b/node_modules/markdown-it/lib/rules_core/inline.js new file mode 100644 index 0000000..4c33d0d --- /dev/null +++ b/node_modules/markdown-it/lib/rules_core/inline.js @@ -0,0 +1,13 @@ +'use strict'; + +module.exports = function inline(state) { + var tokens = state.tokens, tok, i, l; + + // Parse inlines + for (i = 0, l = tokens.length; i < l; i++) { + tok = tokens[i]; + if (tok.type === 'inline') { + state.md.inline.parse(tok.content, state.md, state.env, tok.children); + } + } +}; diff --git a/node_modules/markdown-it/lib/rules_core/linkify.js b/node_modules/markdown-it/lib/rules_core/linkify.js new file mode 100644 index 0000000..7c3ffc8 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_core/linkify.js @@ -0,0 +1,133 @@ +// Replace link-like texts with link nodes. +// +// Currently restricted by `md.validateLink()` to http/https/ftp +// +'use strict'; + + +var arrayReplaceAt = require('../common/utils').arrayReplaceAt; + + +function isLinkOpen(str) { + return /^<a[>\s]/i.test(str); +} +function isLinkClose(str) { + return /^<\/a\s*>/i.test(str); +} + + +module.exports = function linkify(state) { + var i, j, l, tokens, token, currentToken, nodes, ln, text, pos, lastPos, + level, htmlLinkLevel, url, fullUrl, urlText, + blockTokens = state.tokens, + links; + + if (!state.md.options.linkify) { return; } + + for (j = 0, l = blockTokens.length; j < l; j++) { + if (blockTokens[j].type !== 'inline' || + !state.md.linkify.pretest(blockTokens[j].content)) { + continue; + } + + tokens = blockTokens[j].children; + + htmlLinkLevel = 0; + + // We scan from the end, to keep position when new tags added. + // Use reversed logic in links start/end match + for (i = tokens.length - 1; i >= 0; i--) { + currentToken = tokens[i]; + + // Skip content of markdown links + if (currentToken.type === 'link_close') { + i--; + while (tokens[i].level !== currentToken.level && tokens[i].type !== 'link_open') { + i--; + } + continue; + } + + // Skip content of html tag links + if (currentToken.type === 'html_inline') { + if (isLinkOpen(currentToken.content) && htmlLinkLevel > 0) { + htmlLinkLevel--; + } + if (isLinkClose(currentToken.content)) { + htmlLinkLevel++; + } + } + if (htmlLinkLevel > 0) { continue; } + + if (currentToken.type === 'text' && state.md.linkify.test(currentToken.content)) { + + text = currentToken.content; + links = state.md.linkify.match(text); + + // Now split string to nodes + nodes = []; + level = currentToken.level; + lastPos = 0; + + for (ln = 0; ln < links.length; ln++) { + + url = links[ln].url; + fullUrl = state.md.normalizeLink(url); + if (!state.md.validateLink(fullUrl)) { continue; } + + urlText = links[ln].text; + + // Linkifier might send raw hostnames like "example.com", where url + // starts with domain name. So we prepend http:// in those cases, + // and remove it afterwards. + // + if (!links[ln].schema) { + urlText = state.md.normalizeLinkText('http://' + urlText).replace(/^http:\/\//, ''); + } else if (links[ln].schema === 'mailto:' && !/^mailto:/i.test(urlText)) { + urlText = state.md.normalizeLinkText('mailto:' + urlText).replace(/^mailto:/, ''); + } else { + urlText = state.md.normalizeLinkText(urlText); + } + + pos = links[ln].index; + + if (pos > lastPos) { + token = new state.Token('text', '', 0); + token.content = text.slice(lastPos, pos); + token.level = level; + nodes.push(token); + } + + token = new state.Token('link_open', 'a', 1); + token.attrs = [ [ 'href', fullUrl ] ]; + token.level = level++; + token.markup = 'linkify'; + token.info = 'auto'; + nodes.push(token); + + token = new state.Token('text', '', 0); + token.content = urlText; + token.level = level; + nodes.push(token); + + token = new state.Token('link_close', 'a', -1); + token.level = --level; + token.markup = 'linkify'; + token.info = 'auto'; + nodes.push(token); + + lastPos = links[ln].lastIndex; + } + if (lastPos < text.length) { + token = new state.Token('text', '', 0); + token.content = text.slice(lastPos); + token.level = level; + nodes.push(token); + } + + // replace current node + blockTokens[j].children = tokens = arrayReplaceAt(tokens, i, nodes); + } + } + } +}; diff --git a/node_modules/markdown-it/lib/rules_core/normalize.js b/node_modules/markdown-it/lib/rules_core/normalize.js new file mode 100644 index 0000000..ad196cd --- /dev/null +++ b/node_modules/markdown-it/lib/rules_core/normalize.js @@ -0,0 +1,21 @@ +// Normalize input string + +'use strict'; + + +// https://spec.commonmark.org/0.29/#line-ending +var NEWLINES_RE = /\r\n?|\n/g; +var NULL_RE = /\0/g; + + +module.exports = function normalize(state) { + var str; + + // Normalize newlines + str = state.src.replace(NEWLINES_RE, '\n'); + + // Replace NULL characters + str = str.replace(NULL_RE, '\uFFFD'); + + state.src = str; +}; diff --git a/node_modules/markdown-it/lib/rules_core/replacements.js b/node_modules/markdown-it/lib/rules_core/replacements.js new file mode 100644 index 0000000..533496f --- /dev/null +++ b/node_modules/markdown-it/lib/rules_core/replacements.js @@ -0,0 +1,107 @@ +// Simple typographic replacements +// +// (c) (C) → © +// (tm) (TM) → ™ +// (r) (R) → ® +// +- → ± +// (p) (P) -> § +// ... → … (also ?.... → ?.., !.... → !..) +// ???????? → ???, !!!!! → !!!, `,,` → `,` +// -- → –, --- → — +// +'use strict'; + +// TODO: +// - fractionals 1/2, 1/4, 3/4 -> ½, ¼, ¾ +// - miltiplication 2 x 4 -> 2 × 4 + +var RARE_RE = /\+-|\.\.|\?\?\?\?|!!!!|,,|--/; + +// Workaround for phantomjs - need regex without /g flag, +// or root check will fail every second time +var SCOPED_ABBR_TEST_RE = /\((c|tm|r|p)\)/i; + +var SCOPED_ABBR_RE = /\((c|tm|r|p)\)/ig; +var SCOPED_ABBR = { + c: '©', + r: '®', + p: '§', + tm: '™' +}; + +function replaceFn(match, name) { + return SCOPED_ABBR[name.toLowerCase()]; +} + +function replace_scoped(inlineTokens) { + var i, token, inside_autolink = 0; + + for (i = inlineTokens.length - 1; i >= 0; i--) { + token = inlineTokens[i]; + + if (token.type === 'text' && !inside_autolink) { + token.content = token.content.replace(SCOPED_ABBR_RE, replaceFn); + } + + if (token.type === 'link_open' && token.info === 'auto') { + inside_autolink--; + } + + if (token.type === 'link_close' && token.info === 'auto') { + inside_autolink++; + } + } +} + +function replace_rare(inlineTokens) { + var i, token, inside_autolink = 0; + + for (i = inlineTokens.length - 1; i >= 0; i--) { + token = inlineTokens[i]; + + if (token.type === 'text' && !inside_autolink) { + if (RARE_RE.test(token.content)) { + token.content = token.content + .replace(/\+-/g, '±') + // .., ..., ....... -> … + // but ?..... & !..... -> ?.. & !.. + .replace(/\.{2,}/g, '…').replace(/([?!])…/g, '$1..') + .replace(/([?!]){4,}/g, '$1$1$1').replace(/,{2,}/g, ',') + // em-dash + .replace(/(^|[^-])---(?=[^-]|$)/mg, '$1\u2014') + // en-dash + .replace(/(^|\s)--(?=\s|$)/mg, '$1\u2013') + .replace(/(^|[^-\s])--(?=[^-\s]|$)/mg, '$1\u2013'); + } + } + + if (token.type === 'link_open' && token.info === 'auto') { + inside_autolink--; + } + + if (token.type === 'link_close' && token.info === 'auto') { + inside_autolink++; + } + } +} + + +module.exports = function replace(state) { + var blkIdx; + + if (!state.md.options.typographer) { return; } + + for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) { + + if (state.tokens[blkIdx].type !== 'inline') { continue; } + + if (SCOPED_ABBR_TEST_RE.test(state.tokens[blkIdx].content)) { + replace_scoped(state.tokens[blkIdx].children); + } + + if (RARE_RE.test(state.tokens[blkIdx].content)) { + replace_rare(state.tokens[blkIdx].children); + } + + } +}; diff --git a/node_modules/markdown-it/lib/rules_core/smartquotes.js b/node_modules/markdown-it/lib/rules_core/smartquotes.js new file mode 100644 index 0000000..e96fc71 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_core/smartquotes.js @@ -0,0 +1,201 @@ +// Convert straight quotation marks to typographic ones +// +'use strict'; + + +var isWhiteSpace = require('../common/utils').isWhiteSpace; +var isPunctChar = require('../common/utils').isPunctChar; +var isMdAsciiPunct = require('../common/utils').isMdAsciiPunct; + +var QUOTE_TEST_RE = /['"]/; +var QUOTE_RE = /['"]/g; +var APOSTROPHE = '\u2019'; /* ’ */ + + +function replaceAt(str, index, ch) { + return str.substr(0, index) + ch + str.substr(index + 1); +} + +function process_inlines(tokens, state) { + var i, token, text, t, pos, max, thisLevel, item, lastChar, nextChar, + isLastPunctChar, isNextPunctChar, isLastWhiteSpace, isNextWhiteSpace, + canOpen, canClose, j, isSingle, stack, openQuote, closeQuote; + + stack = []; + + for (i = 0; i < tokens.length; i++) { + token = tokens[i]; + + thisLevel = tokens[i].level; + + for (j = stack.length - 1; j >= 0; j--) { + if (stack[j].level <= thisLevel) { break; } + } + stack.length = j + 1; + + if (token.type !== 'text') { continue; } + + text = token.content; + pos = 0; + max = text.length; + + /*eslint no-labels:0,block-scoped-var:0*/ + OUTER: + while (pos < max) { + QUOTE_RE.lastIndex = pos; + t = QUOTE_RE.exec(text); + if (!t) { break; } + + canOpen = canClose = true; + pos = t.index + 1; + isSingle = (t[0] === "'"); + + // Find previous character, + // default to space if it's the beginning of the line + // + lastChar = 0x20; + + if (t.index - 1 >= 0) { + lastChar = text.charCodeAt(t.index - 1); + } else { + for (j = i - 1; j >= 0; j--) { + if (tokens[j].type === 'softbreak' || tokens[j].type === 'hardbreak') break; // lastChar defaults to 0x20 + if (!tokens[j].content) continue; // should skip all tokens except 'text', 'html_inline' or 'code_inline' + + lastChar = tokens[j].content.charCodeAt(tokens[j].content.length - 1); + break; + } + } + + // Find next character, + // default to space if it's the end of the line + // + nextChar = 0x20; + + if (pos < max) { + nextChar = text.charCodeAt(pos); + } else { + for (j = i + 1; j < tokens.length; j++) { + if (tokens[j].type === 'softbreak' || tokens[j].type === 'hardbreak') break; // nextChar defaults to 0x20 + if (!tokens[j].content) continue; // should skip all tokens except 'text', 'html_inline' or 'code_inline' + + nextChar = tokens[j].content.charCodeAt(0); + break; + } + } + + isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar)); + isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar)); + + isLastWhiteSpace = isWhiteSpace(lastChar); + isNextWhiteSpace = isWhiteSpace(nextChar); + + if (isNextWhiteSpace) { + canOpen = false; + } else if (isNextPunctChar) { + if (!(isLastWhiteSpace || isLastPunctChar)) { + canOpen = false; + } + } + + if (isLastWhiteSpace) { + canClose = false; + } else if (isLastPunctChar) { + if (!(isNextWhiteSpace || isNextPunctChar)) { + canClose = false; + } + } + + if (nextChar === 0x22 /* " */ && t[0] === '"') { + if (lastChar >= 0x30 /* 0 */ && lastChar <= 0x39 /* 9 */) { + // special case: 1"" - count first quote as an inch + canClose = canOpen = false; + } + } + + if (canOpen && canClose) { + // Replace quotes in the middle of punctuation sequence, but not + // in the middle of the words, i.e.: + // + // 1. foo " bar " baz - not replaced + // 2. foo-"-bar-"-baz - replaced + // 3. foo"bar"baz - not replaced + // + canOpen = isLastPunctChar; + canClose = isNextPunctChar; + } + + if (!canOpen && !canClose) { + // middle of word + if (isSingle) { + token.content = replaceAt(token.content, t.index, APOSTROPHE); + } + continue; + } + + if (canClose) { + // this could be a closing quote, rewind the stack to get a match + for (j = stack.length - 1; j >= 0; j--) { + item = stack[j]; + if (stack[j].level < thisLevel) { break; } + if (item.single === isSingle && stack[j].level === thisLevel) { + item = stack[j]; + + if (isSingle) { + openQuote = state.md.options.quotes[2]; + closeQuote = state.md.options.quotes[3]; + } else { + openQuote = state.md.options.quotes[0]; + closeQuote = state.md.options.quotes[1]; + } + + // replace token.content *before* tokens[item.token].content, + // because, if they are pointing at the same token, replaceAt + // could mess up indices when quote length != 1 + token.content = replaceAt(token.content, t.index, closeQuote); + tokens[item.token].content = replaceAt( + tokens[item.token].content, item.pos, openQuote); + + pos += closeQuote.length - 1; + if (item.token === i) { pos += openQuote.length - 1; } + + text = token.content; + max = text.length; + + stack.length = j; + continue OUTER; + } + } + } + + if (canOpen) { + stack.push({ + token: i, + pos: t.index, + single: isSingle, + level: thisLevel + }); + } else if (canClose && isSingle) { + token.content = replaceAt(token.content, t.index, APOSTROPHE); + } + } + } +} + + +module.exports = function smartquotes(state) { + /*eslint max-depth:0*/ + var blkIdx; + + if (!state.md.options.typographer) { return; } + + for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) { + + if (state.tokens[blkIdx].type !== 'inline' || + !QUOTE_TEST_RE.test(state.tokens[blkIdx].content)) { + continue; + } + + process_inlines(state.tokens[blkIdx].children, state); + } +}; diff --git a/node_modules/markdown-it/lib/rules_core/state_core.js b/node_modules/markdown-it/lib/rules_core/state_core.js new file mode 100644 index 0000000..87cfd85 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_core/state_core.js @@ -0,0 +1,20 @@ +// Core state object +// +'use strict'; + +var Token = require('../token'); + + +function StateCore(src, md, env) { + this.src = src; + this.env = env; + this.tokens = []; + this.inlineMode = false; + this.md = md; // link to parser instance +} + +// re-export Token class to use in core rules +StateCore.prototype.Token = Token; + + +module.exports = StateCore; diff --git a/node_modules/markdown-it/lib/rules_inline/autolink.js b/node_modules/markdown-it/lib/rules_inline/autolink.js new file mode 100644 index 0000000..66deb90 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/autolink.js @@ -0,0 +1,76 @@ +// Process autolinks '<protocol:...>' + +'use strict'; + + +/*eslint max-len:0*/ +var EMAIL_RE = /^([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)$/; +var AUTOLINK_RE = /^([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)$/; + + +module.exports = function autolink(state, silent) { + var url, fullUrl, token, ch, start, max, + pos = state.pos; + + if (state.src.charCodeAt(pos) !== 0x3C/* < */) { return false; } + + start = state.pos; + max = state.posMax; + + for (;;) { + if (++pos >= max) return false; + + ch = state.src.charCodeAt(pos); + + if (ch === 0x3C /* < */) return false; + if (ch === 0x3E /* > */) break; + } + + url = state.src.slice(start + 1, pos); + + if (AUTOLINK_RE.test(url)) { + fullUrl = state.md.normalizeLink(url); + if (!state.md.validateLink(fullUrl)) { return false; } + + if (!silent) { + token = state.push('link_open', 'a', 1); + token.attrs = [ [ 'href', fullUrl ] ]; + token.markup = 'autolink'; + token.info = 'auto'; + + token = state.push('text', '', 0); + token.content = state.md.normalizeLinkText(url); + + token = state.push('link_close', 'a', -1); + token.markup = 'autolink'; + token.info = 'auto'; + } + + state.pos += url.length + 2; + return true; + } + + if (EMAIL_RE.test(url)) { + fullUrl = state.md.normalizeLink('mailto:' + url); + if (!state.md.validateLink(fullUrl)) { return false; } + + if (!silent) { + token = state.push('link_open', 'a', 1); + token.attrs = [ [ 'href', fullUrl ] ]; + token.markup = 'autolink'; + token.info = 'auto'; + + token = state.push('text', '', 0); + token.content = state.md.normalizeLinkText(url); + + token = state.push('link_close', 'a', -1); + token.markup = 'autolink'; + token.info = 'auto'; + } + + state.pos += url.length + 2; + return true; + } + + return false; +}; diff --git a/node_modules/markdown-it/lib/rules_inline/backticks.js b/node_modules/markdown-it/lib/rules_inline/backticks.js new file mode 100644 index 0000000..b9c9ddb --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/backticks.js @@ -0,0 +1,63 @@ +// Parse backticks + +'use strict'; + + +module.exports = function backtick(state, silent) { + var start, max, marker, token, matchStart, matchEnd, openerLength, closerLength, + pos = state.pos, + ch = state.src.charCodeAt(pos); + + if (ch !== 0x60/* ` */) { return false; } + + start = pos; + pos++; + max = state.posMax; + + // scan marker length + while (pos < max && state.src.charCodeAt(pos) === 0x60/* ` */) { pos++; } + + marker = state.src.slice(start, pos); + openerLength = marker.length; + + if (state.backticksScanned && (state.backticks[openerLength] || 0) <= start) { + if (!silent) state.pending += marker; + state.pos += openerLength; + return true; + } + + matchStart = matchEnd = pos; + + // Nothing found in the cache, scan until the end of the line (or until marker is found) + while ((matchStart = state.src.indexOf('`', matchEnd)) !== -1) { + matchEnd = matchStart + 1; + + // scan marker length + while (matchEnd < max && state.src.charCodeAt(matchEnd) === 0x60/* ` */) { matchEnd++; } + + closerLength = matchEnd - matchStart; + + if (closerLength === openerLength) { + // Found matching closer length. + if (!silent) { + token = state.push('code_inline', 'code', 0); + token.markup = marker; + token.content = state.src.slice(pos, matchStart) + .replace(/\n/g, ' ') + .replace(/^ (.+) $/, '$1'); + } + state.pos = matchEnd; + return true; + } + + // Some different length found, put it in cache as upper limit of where closer can be found + state.backticks[closerLength] = matchStart; + } + + // Scanned through the end, didn't find anything + state.backticksScanned = true; + + if (!silent) state.pending += marker; + state.pos += openerLength; + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_inline/balance_pairs.js b/node_modules/markdown-it/lib/rules_inline/balance_pairs.js new file mode 100644 index 0000000..4faad90 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/balance_pairs.js @@ -0,0 +1,130 @@ +// For each opening emphasis-like marker find a matching closing one +// +'use strict'; + + +function processDelimiters(state, delimiters) { + var closerIdx, openerIdx, closer, opener, minOpenerIdx, newMinOpenerIdx, + isOddMatch, lastJump, + openersBottom = {}, + max = delimiters.length; + + if (!max) return; + + // headerIdx is the first delimiter of the current (where closer is) delimiter run + var headerIdx = 0; + var lastTokenIdx = -2; // needs any value lower than -1 + var jumps = []; + + for (closerIdx = 0; closerIdx < max; closerIdx++) { + closer = delimiters[closerIdx]; + + jumps.push(0); + + // markers belong to same delimiter run if: + // - they have adjacent tokens + // - AND markers are the same + // + if (delimiters[headerIdx].marker !== closer.marker || lastTokenIdx !== closer.token - 1) { + headerIdx = closerIdx; + } + + lastTokenIdx = closer.token; + + // Length is only used for emphasis-specific "rule of 3", + // if it's not defined (in strikethrough or 3rd party plugins), + // we can default it to 0 to disable those checks. + // + closer.length = closer.length || 0; + + if (!closer.close) continue; + + // Previously calculated lower bounds (previous fails) + // for each marker, each delimiter length modulo 3, + // and for whether this closer can be an opener; + // https://github.com/commonmark/cmark/commit/34250e12ccebdc6372b8b49c44fab57c72443460 + if (!openersBottom.hasOwnProperty(closer.marker)) { + openersBottom[closer.marker] = [ -1, -1, -1, -1, -1, -1 ]; + } + + minOpenerIdx = openersBottom[closer.marker][(closer.open ? 3 : 0) + (closer.length % 3)]; + + openerIdx = headerIdx - jumps[headerIdx] - 1; + + newMinOpenerIdx = openerIdx; + + for (; openerIdx > minOpenerIdx; openerIdx -= jumps[openerIdx] + 1) { + opener = delimiters[openerIdx]; + + if (opener.marker !== closer.marker) continue; + + if (opener.open && opener.end < 0) { + + isOddMatch = false; + + // from spec: + // + // If one of the delimiters can both open and close emphasis, then the + // sum of the lengths of the delimiter runs containing the opening and + // closing delimiters must not be a multiple of 3 unless both lengths + // are multiples of 3. + // + if (opener.close || closer.open) { + if ((opener.length + closer.length) % 3 === 0) { + if (opener.length % 3 !== 0 || closer.length % 3 !== 0) { + isOddMatch = true; + } + } + } + + if (!isOddMatch) { + // If previous delimiter cannot be an opener, we can safely skip + // the entire sequence in future checks. This is required to make + // sure algorithm has linear complexity (see *_*_*_*_*_... case). + // + lastJump = openerIdx > 0 && !delimiters[openerIdx - 1].open ? + jumps[openerIdx - 1] + 1 : + 0; + + jumps[closerIdx] = closerIdx - openerIdx + lastJump; + jumps[openerIdx] = lastJump; + + closer.open = false; + opener.end = closerIdx; + opener.close = false; + newMinOpenerIdx = -1; + // treat next token as start of run, + // it optimizes skips in **<...>**a**<...>** pathological case + lastTokenIdx = -2; + break; + } + } + } + + if (newMinOpenerIdx !== -1) { + // If match for this delimiter run failed, we want to set lower bound for + // future lookups. This is required to make sure algorithm has linear + // complexity. + // + // See details here: + // https://github.com/commonmark/cmark/issues/178#issuecomment-270417442 + // + openersBottom[closer.marker][(closer.open ? 3 : 0) + ((closer.length || 0) % 3)] = newMinOpenerIdx; + } + } +} + + +module.exports = function link_pairs(state) { + var curr, + tokens_meta = state.tokens_meta, + max = state.tokens_meta.length; + + processDelimiters(state, state.delimiters); + + for (curr = 0; curr < max; curr++) { + if (tokens_meta[curr] && tokens_meta[curr].delimiters) { + processDelimiters(state, tokens_meta[curr].delimiters); + } + } +}; diff --git a/node_modules/markdown-it/lib/rules_inline/emphasis.js b/node_modules/markdown-it/lib/rules_inline/emphasis.js new file mode 100644 index 0000000..7e8ab4c --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/emphasis.js @@ -0,0 +1,130 @@ +// Process *this* and _that_ +// +'use strict'; + + +// Insert each marker as a separate text token, and add it to delimiter list +// +module.exports.tokenize = function emphasis(state, silent) { + var i, scanned, token, + start = state.pos, + marker = state.src.charCodeAt(start); + + if (silent) { return false; } + + if (marker !== 0x5F /* _ */ && marker !== 0x2A /* * */) { return false; } + + scanned = state.scanDelims(state.pos, marker === 0x2A); + + for (i = 0; i < scanned.length; i++) { + token = state.push('text', '', 0); + token.content = String.fromCharCode(marker); + + state.delimiters.push({ + // Char code of the starting marker (number). + // + marker: marker, + + // Total length of these series of delimiters. + // + length: scanned.length, + + // A position of the token this delimiter corresponds to. + // + token: state.tokens.length - 1, + + // If this delimiter is matched as a valid opener, `end` will be + // equal to its position, otherwise it's `-1`. + // + end: -1, + + // Boolean flags that determine if this delimiter could open or close + // an emphasis. + // + open: scanned.can_open, + close: scanned.can_close + }); + } + + state.pos += scanned.length; + + return true; +}; + + +function postProcess(state, delimiters) { + var i, + startDelim, + endDelim, + token, + ch, + isStrong, + max = delimiters.length; + + for (i = max - 1; i >= 0; i--) { + startDelim = delimiters[i]; + + if (startDelim.marker !== 0x5F/* _ */ && startDelim.marker !== 0x2A/* * */) { + continue; + } + + // Process only opening markers + if (startDelim.end === -1) { + continue; + } + + endDelim = delimiters[startDelim.end]; + + // If the previous delimiter has the same marker and is adjacent to this one, + // merge those into one strong delimiter. + // + // `<em><em>whatever</em></em>` -> `<strong>whatever</strong>` + // + isStrong = i > 0 && + delimiters[i - 1].end === startDelim.end + 1 && + // check that first two markers match and adjacent + delimiters[i - 1].marker === startDelim.marker && + delimiters[i - 1].token === startDelim.token - 1 && + // check that last two markers are adjacent (we can safely assume they match) + delimiters[startDelim.end + 1].token === endDelim.token + 1; + + ch = String.fromCharCode(startDelim.marker); + + token = state.tokens[startDelim.token]; + token.type = isStrong ? 'strong_open' : 'em_open'; + token.tag = isStrong ? 'strong' : 'em'; + token.nesting = 1; + token.markup = isStrong ? ch + ch : ch; + token.content = ''; + + token = state.tokens[endDelim.token]; + token.type = isStrong ? 'strong_close' : 'em_close'; + token.tag = isStrong ? 'strong' : 'em'; + token.nesting = -1; + token.markup = isStrong ? ch + ch : ch; + token.content = ''; + + if (isStrong) { + state.tokens[delimiters[i - 1].token].content = ''; + state.tokens[delimiters[startDelim.end + 1].token].content = ''; + i--; + } + } +} + + +// Walk through delimiter list and replace text tokens with tags +// +module.exports.postProcess = function emphasis(state) { + var curr, + tokens_meta = state.tokens_meta, + max = state.tokens_meta.length; + + postProcess(state, state.delimiters); + + for (curr = 0; curr < max; curr++) { + if (tokens_meta[curr] && tokens_meta[curr].delimiters) { + postProcess(state, tokens_meta[curr].delimiters); + } + } +}; diff --git a/node_modules/markdown-it/lib/rules_inline/entity.js b/node_modules/markdown-it/lib/rules_inline/entity.js new file mode 100644 index 0000000..6fcc889 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/entity.js @@ -0,0 +1,48 @@ +// Process html entity - {, ¯, ", ... + +'use strict'; + +var entities = require('../common/entities'); +var has = require('../common/utils').has; +var isValidEntityCode = require('../common/utils').isValidEntityCode; +var fromCodePoint = require('../common/utils').fromCodePoint; + + +var DIGITAL_RE = /^&#((?:x[a-f0-9]{1,6}|[0-9]{1,7}));/i; +var NAMED_RE = /^&([a-z][a-z0-9]{1,31});/i; + + +module.exports = function entity(state, silent) { + var ch, code, match, pos = state.pos, max = state.posMax; + + if (state.src.charCodeAt(pos) !== 0x26/* & */) { return false; } + + if (pos + 1 < max) { + ch = state.src.charCodeAt(pos + 1); + + if (ch === 0x23 /* # */) { + match = state.src.slice(pos).match(DIGITAL_RE); + if (match) { + if (!silent) { + code = match[1][0].toLowerCase() === 'x' ? parseInt(match[1].slice(1), 16) : parseInt(match[1], 10); + state.pending += isValidEntityCode(code) ? fromCodePoint(code) : fromCodePoint(0xFFFD); + } + state.pos += match[0].length; + return true; + } + } else { + match = state.src.slice(pos).match(NAMED_RE); + if (match) { + if (has(entities, match[1])) { + if (!silent) { state.pending += entities[match[1]]; } + state.pos += match[0].length; + return true; + } + } + } + } + + if (!silent) { state.pending += '&'; } + state.pos++; + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_inline/escape.js b/node_modules/markdown-it/lib/rules_inline/escape.js new file mode 100644 index 0000000..229ead0 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/escape.js @@ -0,0 +1,52 @@ +// Process escaped chars and hardbreaks + +'use strict'; + +var isSpace = require('../common/utils').isSpace; + +var ESCAPED = []; + +for (var i = 0; i < 256; i++) { ESCAPED.push(0); } + +'\\!"#$%&\'()*+,./:;<=>?@[]^_`{|}~-' + .split('').forEach(function (ch) { ESCAPED[ch.charCodeAt(0)] = 1; }); + + +module.exports = function escape(state, silent) { + var ch, pos = state.pos, max = state.posMax; + + if (state.src.charCodeAt(pos) !== 0x5C/* \ */) { return false; } + + pos++; + + if (pos < max) { + ch = state.src.charCodeAt(pos); + + if (ch < 256 && ESCAPED[ch] !== 0) { + if (!silent) { state.pending += state.src[pos]; } + state.pos += 2; + return true; + } + + if (ch === 0x0A) { + if (!silent) { + state.push('hardbreak', 'br', 0); + } + + pos++; + // skip leading whitespaces from next line + while (pos < max) { + ch = state.src.charCodeAt(pos); + if (!isSpace(ch)) { break; } + pos++; + } + + state.pos = pos; + return true; + } + } + + if (!silent) { state.pending += '\\'; } + state.pos++; + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_inline/html_inline.js b/node_modules/markdown-it/lib/rules_inline/html_inline.js new file mode 100644 index 0000000..28c7980 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/html_inline.js @@ -0,0 +1,47 @@ +// Process html tags + +'use strict'; + + +var HTML_TAG_RE = require('../common/html_re').HTML_TAG_RE; + + +function isLetter(ch) { + /*eslint no-bitwise:0*/ + var lc = ch | 0x20; // to lower case + return (lc >= 0x61/* a */) && (lc <= 0x7a/* z */); +} + + +module.exports = function html_inline(state, silent) { + var ch, match, max, token, + pos = state.pos; + + if (!state.md.options.html) { return false; } + + // Check start + max = state.posMax; + if (state.src.charCodeAt(pos) !== 0x3C/* < */ || + pos + 2 >= max) { + return false; + } + + // Quick fail on second char + ch = state.src.charCodeAt(pos + 1); + if (ch !== 0x21/* ! */ && + ch !== 0x3F/* ? */ && + ch !== 0x2F/* / */ && + !isLetter(ch)) { + return false; + } + + match = state.src.slice(pos).match(HTML_TAG_RE); + if (!match) { return false; } + + if (!silent) { + token = state.push('html_inline', '', 0); + token.content = state.src.slice(pos, pos + match[0].length); + } + state.pos += match[0].length; + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_inline/image.js b/node_modules/markdown-it/lib/rules_inline/image.js new file mode 100644 index 0000000..53edd32 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/image.js @@ -0,0 +1,152 @@ +// Process ![image](<src> "title") + +'use strict'; + +var normalizeReference = require('../common/utils').normalizeReference; +var isSpace = require('../common/utils').isSpace; + + +module.exports = function image(state, silent) { + var attrs, + code, + content, + label, + labelEnd, + labelStart, + pos, + ref, + res, + title, + token, + tokens, + start, + href = '', + oldPos = state.pos, + max = state.posMax; + + if (state.src.charCodeAt(state.pos) !== 0x21/* ! */) { return false; } + if (state.src.charCodeAt(state.pos + 1) !== 0x5B/* [ */) { return false; } + + labelStart = state.pos + 2; + labelEnd = state.md.helpers.parseLinkLabel(state, state.pos + 1, false); + + // parser failed to find ']', so it's not a valid link + if (labelEnd < 0) { return false; } + + pos = labelEnd + 1; + if (pos < max && state.src.charCodeAt(pos) === 0x28/* ( */) { + // + // Inline link + // + + // [link]( <href> "title" ) + // ^^ skipping these spaces + pos++; + for (; pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 0x0A) { break; } + } + if (pos >= max) { return false; } + + // [link]( <href> "title" ) + // ^^^^^^ parsing link destination + start = pos; + res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax); + if (res.ok) { + href = state.md.normalizeLink(res.str); + if (state.md.validateLink(href)) { + pos = res.pos; + } else { + href = ''; + } + } + + // [link]( <href> "title" ) + // ^^ skipping these spaces + start = pos; + for (; pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 0x0A) { break; } + } + + // [link]( <href> "title" ) + // ^^^^^^^ parsing link title + res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax); + if (pos < max && start !== pos && res.ok) { + title = res.str; + pos = res.pos; + + // [link]( <href> "title" ) + // ^^ skipping these spaces + for (; pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 0x0A) { break; } + } + } else { + title = ''; + } + + if (pos >= max || state.src.charCodeAt(pos) !== 0x29/* ) */) { + state.pos = oldPos; + return false; + } + pos++; + } else { + // + // Link reference + // + if (typeof state.env.references === 'undefined') { return false; } + + if (pos < max && state.src.charCodeAt(pos) === 0x5B/* [ */) { + start = pos + 1; + pos = state.md.helpers.parseLinkLabel(state, pos); + if (pos >= 0) { + label = state.src.slice(start, pos++); + } else { + pos = labelEnd + 1; + } + } else { + pos = labelEnd + 1; + } + + // covers label === '' and label === undefined + // (collapsed reference link and shortcut reference link respectively) + if (!label) { label = state.src.slice(labelStart, labelEnd); } + + ref = state.env.references[normalizeReference(label)]; + if (!ref) { + state.pos = oldPos; + return false; + } + href = ref.href; + title = ref.title; + } + + // + // We found the end of the link, and know for a fact it's a valid link; + // so all that's left to do is to call tokenizer. + // + if (!silent) { + content = state.src.slice(labelStart, labelEnd); + + state.md.inline.parse( + content, + state.md, + state.env, + tokens = [] + ); + + token = state.push('image', 'img', 0); + token.attrs = attrs = [ [ 'src', href ], [ 'alt', '' ] ]; + token.children = tokens; + token.content = content; + + if (title) { + attrs.push([ 'title', title ]); + } + } + + state.pos = pos; + state.posMax = max; + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_inline/link.js b/node_modules/markdown-it/lib/rules_inline/link.js new file mode 100644 index 0000000..1d242bf --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/link.js @@ -0,0 +1,148 @@ +// Process [link](<to> "stuff") + +'use strict'; + +var normalizeReference = require('../common/utils').normalizeReference; +var isSpace = require('../common/utils').isSpace; + + +module.exports = function link(state, silent) { + var attrs, + code, + label, + labelEnd, + labelStart, + pos, + res, + ref, + token, + href = '', + title = '', + oldPos = state.pos, + max = state.posMax, + start = state.pos, + parseReference = true; + + if (state.src.charCodeAt(state.pos) !== 0x5B/* [ */) { return false; } + + labelStart = state.pos + 1; + labelEnd = state.md.helpers.parseLinkLabel(state, state.pos, true); + + // parser failed to find ']', so it's not a valid link + if (labelEnd < 0) { return false; } + + pos = labelEnd + 1; + if (pos < max && state.src.charCodeAt(pos) === 0x28/* ( */) { + // + // Inline link + // + + // might have found a valid shortcut link, disable reference parsing + parseReference = false; + + // [link]( <href> "title" ) + // ^^ skipping these spaces + pos++; + for (; pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 0x0A) { break; } + } + if (pos >= max) { return false; } + + // [link]( <href> "title" ) + // ^^^^^^ parsing link destination + start = pos; + res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax); + if (res.ok) { + href = state.md.normalizeLink(res.str); + if (state.md.validateLink(href)) { + pos = res.pos; + } else { + href = ''; + } + + // [link]( <href> "title" ) + // ^^ skipping these spaces + start = pos; + for (; pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 0x0A) { break; } + } + + // [link]( <href> "title" ) + // ^^^^^^^ parsing link title + res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax); + if (pos < max && start !== pos && res.ok) { + title = res.str; + pos = res.pos; + + // [link]( <href> "title" ) + // ^^ skipping these spaces + for (; pos < max; pos++) { + code = state.src.charCodeAt(pos); + if (!isSpace(code) && code !== 0x0A) { break; } + } + } + } + + if (pos >= max || state.src.charCodeAt(pos) !== 0x29/* ) */) { + // parsing a valid shortcut link failed, fallback to reference + parseReference = true; + } + pos++; + } + + if (parseReference) { + // + // Link reference + // + if (typeof state.env.references === 'undefined') { return false; } + + if (pos < max && state.src.charCodeAt(pos) === 0x5B/* [ */) { + start = pos + 1; + pos = state.md.helpers.parseLinkLabel(state, pos); + if (pos >= 0) { + label = state.src.slice(start, pos++); + } else { + pos = labelEnd + 1; + } + } else { + pos = labelEnd + 1; + } + + // covers label === '' and label === undefined + // (collapsed reference link and shortcut reference link respectively) + if (!label) { label = state.src.slice(labelStart, labelEnd); } + + ref = state.env.references[normalizeReference(label)]; + if (!ref) { + state.pos = oldPos; + return false; + } + href = ref.href; + title = ref.title; + } + + // + // We found the end of the link, and know for a fact it's a valid link; + // so all that's left to do is to call tokenizer. + // + if (!silent) { + state.pos = labelStart; + state.posMax = labelEnd; + + token = state.push('link_open', 'a', 1); + token.attrs = attrs = [ [ 'href', href ] ]; + if (title) { + attrs.push([ 'title', title ]); + } + + state.md.inline.tokenize(state); + + token = state.push('link_close', 'a', -1); + } + + state.pos = pos; + state.posMax = max; + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_inline/newline.js b/node_modules/markdown-it/lib/rules_inline/newline.js new file mode 100644 index 0000000..9eeead4 --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/newline.js @@ -0,0 +1,46 @@ +// Proceess '\n' + +'use strict'; + +var isSpace = require('../common/utils').isSpace; + + +module.exports = function newline(state, silent) { + var pmax, max, ws, pos = state.pos; + + if (state.src.charCodeAt(pos) !== 0x0A/* \n */) { return false; } + + pmax = state.pending.length - 1; + max = state.posMax; + + // ' \n' -> hardbreak + // Lookup in pending chars is bad practice! Don't copy to other rules! + // Pending string is stored in concat mode, indexed lookups will cause + // convertion to flat mode. + if (!silent) { + if (pmax >= 0 && state.pending.charCodeAt(pmax) === 0x20) { + if (pmax >= 1 && state.pending.charCodeAt(pmax - 1) === 0x20) { + // Find whitespaces tail of pending chars. + ws = pmax - 1; + while (ws >= 1 && state.pending.charCodeAt(ws - 1) === 0x20) ws--; + + state.pending = state.pending.slice(0, ws); + state.push('hardbreak', 'br', 0); + } else { + state.pending = state.pending.slice(0, -1); + state.push('softbreak', 'br', 0); + } + + } else { + state.push('softbreak', 'br', 0); + } + } + + pos++; + + // skip heading spaces for next line + while (pos < max && isSpace(state.src.charCodeAt(pos))) { pos++; } + + state.pos = pos; + return true; +}; diff --git a/node_modules/markdown-it/lib/rules_inline/state_inline.js b/node_modules/markdown-it/lib/rules_inline/state_inline.js new file mode 100644 index 0000000..efbf9bd --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/state_inline.js @@ -0,0 +1,154 @@ +// Inline parser state + +'use strict'; + + +var Token = require('../token'); +var isWhiteSpace = require('../common/utils').isWhiteSpace; +var isPunctChar = require('../common/utils').isPunctChar; +var isMdAsciiPunct = require('../common/utils').isMdAsciiPunct; + + +function StateInline(src, md, env, outTokens) { + this.src = src; + this.env = env; + this.md = md; + this.tokens = outTokens; + this.tokens_meta = Array(outTokens.length); + + this.pos = 0; + this.posMax = this.src.length; + this.level = 0; + this.pending = ''; + this.pendingLevel = 0; + + // Stores { start: end } pairs. Useful for backtrack + // optimization of pairs parse (emphasis, strikes). + this.cache = {}; + + // List of emphasis-like delimiters for current tag + this.delimiters = []; + + // Stack of delimiter lists for upper level tags + this._prev_delimiters = []; + + // backtick length => last seen position + this.backticks = {}; + this.backticksScanned = false; +} + + +// Flush pending text +// +StateInline.prototype.pushPending = function () { + var token = new Token('text', '', 0); + token.content = this.pending; + token.level = this.pendingLevel; + this.tokens.push(token); + this.pending = ''; + return token; +}; + + +// Push new token to "stream". +// If pending text exists - flush it as text token +// +StateInline.prototype.push = function (type, tag, nesting) { + if (this.pending) { + this.pushPending(); + } + + var token = new Token(type, tag, nesting); + var token_meta = null; + + if (nesting < 0) { + // closing tag + this.level--; + this.delimiters = this._prev_delimiters.pop(); + } + + token.level = this.level; + + if (nesting > 0) { + // opening tag + this.level++; + this._prev_delimiters.push(this.delimiters); + this.delimiters = []; + token_meta = { delimiters: this.delimiters }; + } + + this.pendingLevel = this.level; + this.tokens.push(token); + this.tokens_meta.push(token_meta); + return token; +}; + + +// Scan a sequence of emphasis-like markers, and determine whether +// it can start an emphasis sequence or end an emphasis sequence. +// +// - start - position to scan from (it should point at a valid marker); +// - canSplitWord - determine if these markers can be found inside a word +// +StateInline.prototype.scanDelims = function (start, canSplitWord) { + var pos = start, lastChar, nextChar, count, can_open, can_close, + isLastWhiteSpace, isLastPunctChar, + isNextWhiteSpace, isNextPunctChar, + left_flanking = true, + right_flanking = true, + max = this.posMax, + marker = this.src.charCodeAt(start); + + // treat beginning of the line as a whitespace + lastChar = start > 0 ? this.src.charCodeAt(start - 1) : 0x20; + + while (pos < max && this.src.charCodeAt(pos) === marker) { pos++; } + + count = pos - start; + + // treat end of the line as a whitespace + nextChar = pos < max ? this.src.charCodeAt(pos) : 0x20; + + isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar)); + isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar)); + + isLastWhiteSpace = isWhiteSpace(lastChar); + isNextWhiteSpace = isWhiteSpace(nextChar); + + if (isNextWhiteSpace) { + left_flanking = false; + } else if (isNextPunctChar) { + if (!(isLastWhiteSpace || isLastPunctChar)) { + left_flanking = false; + } + } + + if (isLastWhiteSpace) { + right_flanking = false; + } else if (isLastPunctChar) { + if (!(isNextWhiteSpace || isNextPunctChar)) { + right_flanking = false; + } + } + + if (!canSplitWord) { + can_open = left_flanking && (!right_flanking || isLastPunctChar); + can_close = right_flanking && (!left_flanking || isNextPunctChar); + } else { + can_open = left_flanking; + can_close = right_flanking; + } + + return { + can_open: can_open, + can_close: can_close, + length: count + }; +}; + + +// re-export Token class to use in block rules +StateInline.prototype.Token = Token; + + +module.exports = StateInline; diff --git a/node_modules/markdown-it/lib/rules_inline/strikethrough.js b/node_modules/markdown-it/lib/rules_inline/strikethrough.js new file mode 100644 index 0000000..3c35adf --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/strikethrough.js @@ -0,0 +1,130 @@ +// ~~strike through~~ +// +'use strict'; + + +// Insert each marker as a separate text token, and add it to delimiter list +// +module.exports.tokenize = function strikethrough(state, silent) { + var i, scanned, token, len, ch, + start = state.pos, + marker = state.src.charCodeAt(start); + + if (silent) { return false; } + + if (marker !== 0x7E/* ~ */) { return false; } + + scanned = state.scanDelims(state.pos, true); + len = scanned.length; + ch = String.fromCharCode(marker); + + if (len < 2) { return false; } + + if (len % 2) { + token = state.push('text', '', 0); + token.content = ch; + len--; + } + + for (i = 0; i < len; i += 2) { + token = state.push('text', '', 0); + token.content = ch + ch; + + state.delimiters.push({ + marker: marker, + length: 0, // disable "rule of 3" length checks meant for emphasis + token: state.tokens.length - 1, + end: -1, + open: scanned.can_open, + close: scanned.can_close + }); + } + + state.pos += scanned.length; + + return true; +}; + + +function postProcess(state, delimiters) { + var i, j, + startDelim, + endDelim, + token, + loneMarkers = [], + max = delimiters.length; + + for (i = 0; i < max; i++) { + startDelim = delimiters[i]; + + if (startDelim.marker !== 0x7E/* ~ */) { + continue; + } + + if (startDelim.end === -1) { + continue; + } + + endDelim = delimiters[startDelim.end]; + + token = state.tokens[startDelim.token]; + token.type = 's_open'; + token.tag = 's'; + token.nesting = 1; + token.markup = '~~'; + token.content = ''; + + token = state.tokens[endDelim.token]; + token.type = 's_close'; + token.tag = 's'; + token.nesting = -1; + token.markup = '~~'; + token.content = ''; + + if (state.tokens[endDelim.token - 1].type === 'text' && + state.tokens[endDelim.token - 1].content === '~') { + + loneMarkers.push(endDelim.token - 1); + } + } + + // If a marker sequence has an odd number of characters, it's splitted + // like this: `~~~~~` -> `~` + `~~` + `~~`, leaving one marker at the + // start of the sequence. + // + // So, we have to move all those markers after subsequent s_close tags. + // + while (loneMarkers.length) { + i = loneMarkers.pop(); + j = i + 1; + + while (j < state.tokens.length && state.tokens[j].type === 's_close') { + j++; + } + + j--; + + if (i !== j) { + token = state.tokens[j]; + state.tokens[j] = state.tokens[i]; + state.tokens[i] = token; + } + } +} + + +// Walk through delimiter list and replace text tokens with tags +// +module.exports.postProcess = function strikethrough(state) { + var curr, + tokens_meta = state.tokens_meta, + max = state.tokens_meta.length; + + postProcess(state, state.delimiters); + + for (curr = 0; curr < max; curr++) { + if (tokens_meta[curr] && tokens_meta[curr].delimiters) { + postProcess(state, tokens_meta[curr].delimiters); + } + } +}; diff --git a/node_modules/markdown-it/lib/rules_inline/text.js b/node_modules/markdown-it/lib/rules_inline/text.js new file mode 100644 index 0000000..b19591e --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/text.js @@ -0,0 +1,89 @@ +// Skip text characters for text token, place those to pending buffer +// and increment current pos + +'use strict'; + + +// Rule to skip pure text +// '{}$%@~+=:' reserved for extentions + +// !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~ + +// !!!! Don't confuse with "Markdown ASCII Punctuation" chars +// http://spec.commonmark.org/0.15/#ascii-punctuation-character +function isTerminatorChar(ch) { + switch (ch) { + case 0x0A/* \n */: + case 0x21/* ! */: + case 0x23/* # */: + case 0x24/* $ */: + case 0x25/* % */: + case 0x26/* & */: + case 0x2A/* * */: + case 0x2B/* + */: + case 0x2D/* - */: + case 0x3A/* : */: + case 0x3C/* < */: + case 0x3D/* = */: + case 0x3E/* > */: + case 0x40/* @ */: + case 0x5B/* [ */: + case 0x5C/* \ */: + case 0x5D/* ] */: + case 0x5E/* ^ */: + case 0x5F/* _ */: + case 0x60/* ` */: + case 0x7B/* { */: + case 0x7D/* } */: + case 0x7E/* ~ */: + return true; + default: + return false; + } +} + +module.exports = function text(state, silent) { + var pos = state.pos; + + while (pos < state.posMax && !isTerminatorChar(state.src.charCodeAt(pos))) { + pos++; + } + + if (pos === state.pos) { return false; } + + if (!silent) { state.pending += state.src.slice(state.pos, pos); } + + state.pos = pos; + + return true; +}; + +// Alternative implementation, for memory. +// +// It costs 10% of performance, but allows extend terminators list, if place it +// to `ParcerInline` property. Probably, will switch to it sometime, such +// flexibility required. + +/* +var TERMINATOR_RE = /[\n!#$%&*+\-:<=>@[\\\]^_`{}~]/; + +module.exports = function text(state, silent) { + var pos = state.pos, + idx = state.src.slice(pos).search(TERMINATOR_RE); + + // first char is terminator -> empty text + if (idx === 0) { return false; } + + // no terminator -> text till end of string + if (idx < 0) { + if (!silent) { state.pending += state.src.slice(pos); } + state.pos = state.src.length; + return true; + } + + if (!silent) { state.pending += state.src.slice(pos, pos + idx); } + + state.pos += idx; + + return true; +};*/ diff --git a/node_modules/markdown-it/lib/rules_inline/text_collapse.js b/node_modules/markdown-it/lib/rules_inline/text_collapse.js new file mode 100644 index 0000000..390b0fe --- /dev/null +++ b/node_modules/markdown-it/lib/rules_inline/text_collapse.js @@ -0,0 +1,41 @@ +// Clean up tokens after emphasis and strikethrough postprocessing: +// merge adjacent text nodes into one and re-calculate all token levels +// +// This is necessary because initially emphasis delimiter markers (*, _, ~) +// are treated as their own separate text tokens. Then emphasis rule either +// leaves them as text (needed to merge with adjacent text) or turns them +// into opening/closing tags (which messes up levels inside). +// +'use strict'; + + +module.exports = function text_collapse(state) { + var curr, last, + level = 0, + tokens = state.tokens, + max = state.tokens.length; + + for (curr = last = 0; curr < max; curr++) { + // re-calculate levels after emphasis/strikethrough turns some text nodes + // into opening/closing tags + if (tokens[curr].nesting < 0) level--; // closing tag + tokens[curr].level = level; + if (tokens[curr].nesting > 0) level++; // opening tag + + if (tokens[curr].type === 'text' && + curr + 1 < max && + tokens[curr + 1].type === 'text') { + + // collapse two adjacent text nodes + tokens[curr + 1].content = tokens[curr].content + tokens[curr + 1].content; + } else { + if (curr !== last) { tokens[last] = tokens[curr]; } + + last++; + } + } + + if (curr !== last) { + tokens.length = last; + } +}; diff --git a/node_modules/markdown-it/lib/token.js b/node_modules/markdown-it/lib/token.js new file mode 100644 index 0000000..c5fd271 --- /dev/null +++ b/node_modules/markdown-it/lib/token.js @@ -0,0 +1,201 @@ +// Token class + +'use strict'; + + +/** + * class Token + **/ + +/** + * new Token(type, tag, nesting) + * + * Create new token and fill passed properties. + **/ +function Token(type, tag, nesting) { + /** + * Token#type -> String + * + * Type of the token (string, e.g. "paragraph_open") + **/ + this.type = type; + + /** + * Token#tag -> String + * + * html tag name, e.g. "p" + **/ + this.tag = tag; + + /** + * Token#attrs -> Array + * + * Html attributes. Format: `[ [ name1, value1 ], [ name2, value2 ] ]` + **/ + this.attrs = null; + + /** + * Token#map -> Array + * + * Source map info. Format: `[ line_begin, line_end ]` + **/ + this.map = null; + + /** + * Token#nesting -> Number + * + * Level change (number in {-1, 0, 1} set), where: + * + * - `1` means the tag is opening + * - `0` means the tag is self-closing + * - `-1` means the tag is closing + **/ + this.nesting = nesting; + + /** + * Token#level -> Number + * + * nesting level, the same as `state.level` + **/ + this.level = 0; + + /** + * Token#children -> Array + * + * An array of child nodes (inline and img tokens) + **/ + this.children = null; + + /** + * Token#content -> String + * + * In a case of self-closing tag (code, html, fence, etc.), + * it has contents of this tag. + **/ + this.content = ''; + + /** + * Token#markup -> String + * + * '*' or '_' for emphasis, fence string for fence, etc. + **/ + this.markup = ''; + + /** + * Token#info -> String + * + * Additional information: + * + * - Info string for "fence" tokens + * - The value "auto" for autolink "link_open" and "link_close" tokens + * - The string value of the item marker for ordered-list "list_item_open" tokens + **/ + this.info = ''; + + /** + * Token#meta -> Object + * + * A place for plugins to store an arbitrary data + **/ + this.meta = null; + + /** + * Token#block -> Boolean + * + * True for block-level tokens, false for inline tokens. + * Used in renderer to calculate line breaks + **/ + this.block = false; + + /** + * Token#hidden -> Boolean + * + * If it's true, ignore this element when rendering. Used for tight lists + * to hide paragraphs. + **/ + this.hidden = false; +} + + +/** + * Token.attrIndex(name) -> Number + * + * Search attribute index by name. + **/ +Token.prototype.attrIndex = function attrIndex(name) { + var attrs, i, len; + + if (!this.attrs) { return -1; } + + attrs = this.attrs; + + for (i = 0, len = attrs.length; i < len; i++) { + if (attrs[i][0] === name) { return i; } + } + return -1; +}; + + +/** + * Token.attrPush(attrData) + * + * Add `[ name, value ]` attribute to list. Init attrs if necessary + **/ +Token.prototype.attrPush = function attrPush(attrData) { + if (this.attrs) { + this.attrs.push(attrData); + } else { + this.attrs = [ attrData ]; + } +}; + + +/** + * Token.attrSet(name, value) + * + * Set `name` attribute to `value`. Override old value if exists. + **/ +Token.prototype.attrSet = function attrSet(name, value) { + var idx = this.attrIndex(name), + attrData = [ name, value ]; + + if (idx < 0) { + this.attrPush(attrData); + } else { + this.attrs[idx] = attrData; + } +}; + + +/** + * Token.attrGet(name) + * + * Get the value of attribute `name`, or null if it does not exist. + **/ +Token.prototype.attrGet = function attrGet(name) { + var idx = this.attrIndex(name), value = null; + if (idx >= 0) { + value = this.attrs[idx][1]; + } + return value; +}; + + +/** + * Token.attrJoin(name, value) + * + * Join value to existing attribute via space. Or create new attribute if not + * exists. Useful to operate with token classes. + **/ +Token.prototype.attrJoin = function attrJoin(name, value) { + var idx = this.attrIndex(name); + + if (idx < 0) { + this.attrPush([ name, value ]); + } else { + this.attrs[idx][1] = this.attrs[idx][1] + ' ' + value; + } +}; + + +module.exports = Token; diff --git a/node_modules/markdown-it/package.json b/node_modules/markdown-it/package.json new file mode 100644 index 0000000..32a3aff --- /dev/null +++ b/node_modules/markdown-it/package.json @@ -0,0 +1,87 @@ +{ + "name": "markdown-it", + "version": "12.3.2", + "description": "Markdown-it - modern pluggable markdown parser.", + "keywords": [ + "markdown", + "parser", + "commonmark", + "markdown-it", + "markdown-it-plugin" + ], + "repository": "markdown-it/markdown-it", + "license": "MIT", + "main": "index.js", + "bin": { + "markdown-it": "bin/markdown-it.js" + }, + "scripts": { + "lint": "eslint .", + "test": "npm run lint && nyc mocha && node support/specsplit.js", + "coverage": "npm run test && nyc report --reporter html", + "report-coveralls": "nyc --reporter=lcov mocha", + "doc": "node support/build_doc.js", + "gh-doc": "npm run doc && gh-pages -d apidoc -f", + "demo": "npm run lint && node support/build_demo.js", + "gh-demo": "npm run demo && gh-pages -d demo -f -b master -r git@github.com:markdown-it/markdown-it.github.io.git", + "browserify": "rollup -c support/rollup.config.js", + "benchmark-deps": "npm install --prefix benchmark/extra/ -g marked@0.3.6 commonmark@0.26.0 markdown-it/markdown-it.git#2.2.1", + "specsplit": "support/specsplit.js good -o test/fixtures/commonmark/good.txt && support/specsplit.js bad -o test/fixtures/commonmark/bad.txt && support/specsplit.js", + "todo": "grep 'TODO' -n -r ./lib 2>/dev/null", + "prepublishOnly": "npm run gh-demo && npm run gh-doc" + }, + "files": [ + "index.js", + "bin/", + "lib/", + "dist/" + ], + "dependencies": { + "argparse": "^2.0.1", + "entities": "~2.1.0", + "linkify-it": "^3.0.1", + "mdurl": "^1.0.1", + "uc.micro": "^1.0.5" + }, + "devDependencies": { + "@rollup/plugin-commonjs": "^16.0.0", + "@rollup/plugin-json": "^4.1.0", + "@rollup/plugin-node-resolve": "^10.0.0", + "ansi": "^0.3.0", + "autoprefixer-stylus": "^1.0.0", + "benchmark": "~2.1.0", + "chai": "^4.2.0", + "coveralls": "^3.0.4", + "eslint": "^8.4.1", + "express": "^4.14.0", + "gh-pages": "^3.1.0", + "highlight.js": "^10.7.2", + "jest-worker": "^26.6.2", + "markdown-it-abbr": "^1.0.4", + "markdown-it-container": "^3.0.0", + "markdown-it-deflist": "^2.0.0", + "markdown-it-emoji": "^2.0.0", + "markdown-it-footnote": "^3.0.1", + "markdown-it-for-inline": "^0.1.0", + "markdown-it-ins": "^3.0.0", + "markdown-it-mark": "^3.0.0", + "markdown-it-sub": "^1.0.0", + "markdown-it-sup": "^1.0.0", + "markdown-it-testgen": "^0.1.3", + "mocha": "^9.1.3", + "ndoc": "^6.0.0", + "needle": "^3.0.0", + "nyc": "^15.0.1", + "pug-cli": "^1.0.0-alpha6", + "rollup": "^2.29.0", + "rollup-plugin-node-polyfills": "^0.2.1", + "rollup-plugin-terser": "^7.0.2", + "shelljs": "^0.8.4", + "stylus": "^0.55.0", + "supertest": "^6.0.1" + }, + "mocha": { + "inline-diffs": true, + "timeout": 60000 + } +} diff --git a/node_modules/mdurl/CHANGELOG.md b/node_modules/mdurl/CHANGELOG.md new file mode 100644 index 0000000..ed33c78 --- /dev/null +++ b/node_modules/mdurl/CHANGELOG.md @@ -0,0 +1,16 @@ +1.0.1 / 2015-09-15 +------------------ + +- Fixed closure compiler compatibility (#1). + + +1.0.0 / 2015-03-04 +------------------ + +- Added `.decode()`, `.parse()`, `.format()`. + + +0.0.1 / 2015-03-02 +------------------ + +- First release. diff --git a/node_modules/mdurl/LICENSE b/node_modules/mdurl/LICENSE new file mode 100644 index 0000000..3b2c7bf --- /dev/null +++ b/node_modules/mdurl/LICENSE @@ -0,0 +1,45 @@ +Copyright (c) 2015 Vitaly Puzrin, Alex Kocharin. + +Permission is hereby granted, free of charge, to any person +obtaining a copy of this software and associated documentation +files (the "Software"), to deal in the Software without +restriction, including without limitation the rights to use, +copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the +Software is furnished to do so, subject to the following +conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES +OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT +HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. + +-------------------------------------------------------------------------------- + +.parse() is based on Joyent's node.js `url` code: + +Copyright Joyent, Inc. and other Node contributors. All rights reserved. +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to +deal in the Software without restriction, including without limitation the +rights to use, copy, modify, merge, publish, distribute, sublicense, and/or +sell copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS +IN THE SOFTWARE. diff --git a/node_modules/mdurl/README.md b/node_modules/mdurl/README.md new file mode 100644 index 0000000..72aebef --- /dev/null +++ b/node_modules/mdurl/README.md @@ -0,0 +1,102 @@ +# mdurl + +[![Build Status](https://img.shields.io/travis/markdown-it/mdurl/master.svg?style=flat)](https://travis-ci.org/markdown-it/mdurl) +[![NPM version](https://img.shields.io/npm/v/mdurl.svg?style=flat)](https://www.npmjs.org/package/mdurl) + +> URL utilities for [markdown-it](https://github.com/markdown-it/markdown-it) parser. + + +## API + +### .encode(str [, exclude, keepEncoded]) -> String + +Percent-encode a string, avoiding double encoding. Don't touch `/a-zA-Z0-9/` + +excluded chars + `/%[a-fA-F0-9]{2}/` (if not disabled). Broken surrorates are +replaced with `U+FFFD`. + +Params: + +- __str__ - input string. +- __exclude__ - optional, `;/?:@&=+$,-_.!~*'()#`. Additional chars to keep intact + (except `/a-zA-Z0-9/`). +- __keepEncoded__ - optional, `true`. By default it skips already encoded sequences + (`/%[a-fA-F0-9]{2}/`). If set to `false`, `%` will be encoded. + + +### encode.defaultChars, encode.componentChars + +You can use these constants as second argument to `encode` function. + + - `encode.defaultChars` is the same exclude set as in the standard `encodeURI()` function + - `encode.componentChars` is the same exclude set as in the `encodeURIComponent()` function + +For example, `encode('something', encode.componentChars, true)` is roughly the equivalent of +the `encodeURIComponent()` function (except `encode()` doesn't throw). + + +### .decode(str [, exclude]) -> String + +Decode percent-encoded string. Invalid percent-encoded sequences (e.g. `%2G`) +are left as is. Invalid UTF-8 characters are replaced with `U+FFFD`. + + +Params: + +- __str__ - input string. +- __exclude__ - set of characters to leave encoded, optional, `;/?:@&=+$,#`. + + +### decode.defaultChars, decode.componentChars + +You can use these constants as second argument to `decode` function. + + - `decode.defaultChars` is the same exclude set as in the standard `decodeURI()` function + - `decode.componentChars` is the same exclude set as in the `decodeURIComponent()` function + +For example, `decode('something', decode.defaultChars)` has the same behavior as +`decodeURI('something')` on a correctly encoded input. + + +### .parse(url, slashesDenoteHost) -> urlObs + +Parse url string. Similar to node's [url.parse](http://nodejs.org/api/url.html#url_url_parse_urlstr_parsequerystring_slashesdenotehost), but without any +normalizations and query string parse. + + - __url__ - input url (string) + - __slashesDenoteHost__ - if url starts with `//`, expect a hostname after it. Optional, `false`. + +Result (hash): + +- protocol +- slashes +- auth +- port +- hostname +- hash +- search +- pathname + +Difference with node's `url`: + +1. No leading slash in paths, e.g. in `url.parse('http://foo?bar')` pathname is + ``, not `/` +2. Backslashes are not replaced with slashes, so `http:\\example.org\` is + treated like a relative path +3. Trailing colon is treated like a part of the path, i.e. in + `http://example.org:foo` pathname is `:foo` +4. Nothing is URL-encoded in the resulting object, (in joyent/node some chars + in auth and paths are encoded) +5. `url.parse()` does not have `parseQueryString` argument +6. Removed extraneous result properties: `host`, `path`, `query`, etc., + which can be constructed using other parts of the url. + + +### .format(urlObject) + +Format an object previously obtained with `.parse()` function. Similar to node's +[url.format](http://nodejs.org/api/url.html#url_url_format_urlobj). + + +## License + +[MIT](https://github.com/markdown-it/mdurl/blob/master/LICENSE) diff --git a/node_modules/mdurl/decode.js b/node_modules/mdurl/decode.js new file mode 100644 index 0000000..189d7b9 --- /dev/null +++ b/node_modules/mdurl/decode.js @@ -0,0 +1,122 @@ + +'use strict'; + + +/* eslint-disable no-bitwise */ + +var decodeCache = {}; + +function getDecodeCache(exclude) { + var i, ch, cache = decodeCache[exclude]; + if (cache) { return cache; } + + cache = decodeCache[exclude] = []; + + for (i = 0; i < 128; i++) { + ch = String.fromCharCode(i); + cache.push(ch); + } + + for (i = 0; i < exclude.length; i++) { + ch = exclude.charCodeAt(i); + cache[ch] = '%' + ('0' + ch.toString(16).toUpperCase()).slice(-2); + } + + return cache; +} + + +// Decode percent-encoded string. +// +function decode(string, exclude) { + var cache; + + if (typeof exclude !== 'string') { + exclude = decode.defaultChars; + } + + cache = getDecodeCache(exclude); + + return string.replace(/(%[a-f0-9]{2})+/gi, function(seq) { + var i, l, b1, b2, b3, b4, chr, + result = ''; + + for (i = 0, l = seq.length; i < l; i += 3) { + b1 = parseInt(seq.slice(i + 1, i + 3), 16); + + if (b1 < 0x80) { + result += cache[b1]; + continue; + } + + if ((b1 & 0xE0) === 0xC0 && (i + 3 < l)) { + // 110xxxxx 10xxxxxx + b2 = parseInt(seq.slice(i + 4, i + 6), 16); + + if ((b2 & 0xC0) === 0x80) { + chr = ((b1 << 6) & 0x7C0) | (b2 & 0x3F); + + if (chr < 0x80) { + result += '\ufffd\ufffd'; + } else { + result += String.fromCharCode(chr); + } + + i += 3; + continue; + } + } + + if ((b1 & 0xF0) === 0xE0 && (i + 6 < l)) { + // 1110xxxx 10xxxxxx 10xxxxxx + b2 = parseInt(seq.slice(i + 4, i + 6), 16); + b3 = parseInt(seq.slice(i + 7, i + 9), 16); + + if ((b2 & 0xC0) === 0x80 && (b3 & 0xC0) === 0x80) { + chr = ((b1 << 12) & 0xF000) | ((b2 << 6) & 0xFC0) | (b3 & 0x3F); + + if (chr < 0x800 || (chr >= 0xD800 && chr <= 0xDFFF)) { + result += '\ufffd\ufffd\ufffd'; + } else { + result += String.fromCharCode(chr); + } + + i += 6; + continue; + } + } + + if ((b1 & 0xF8) === 0xF0 && (i + 9 < l)) { + // 111110xx 10xxxxxx 10xxxxxx 10xxxxxx + b2 = parseInt(seq.slice(i + 4, i + 6), 16); + b3 = parseInt(seq.slice(i + 7, i + 9), 16); + b4 = parseInt(seq.slice(i + 10, i + 12), 16); + + if ((b2 & 0xC0) === 0x80 && (b3 & 0xC0) === 0x80 && (b4 & 0xC0) === 0x80) { + chr = ((b1 << 18) & 0x1C0000) | ((b2 << 12) & 0x3F000) | ((b3 << 6) & 0xFC0) | (b4 & 0x3F); + + if (chr < 0x10000 || chr > 0x10FFFF) { + result += '\ufffd\ufffd\ufffd\ufffd'; + } else { + chr -= 0x10000; + result += String.fromCharCode(0xD800 + (chr >> 10), 0xDC00 + (chr & 0x3FF)); + } + + i += 9; + continue; + } + } + + result += '\ufffd'; + } + + return result; + }); +} + + +decode.defaultChars = ';/?:@&=+$,#'; +decode.componentChars = ''; + + +module.exports = decode; diff --git a/node_modules/mdurl/encode.js b/node_modules/mdurl/encode.js new file mode 100644 index 0000000..6dff4f9 --- /dev/null +++ b/node_modules/mdurl/encode.js @@ -0,0 +1,98 @@ + +'use strict'; + + +var encodeCache = {}; + + +// Create a lookup array where anything but characters in `chars` string +// and alphanumeric chars is percent-encoded. +// +function getEncodeCache(exclude) { + var i, ch, cache = encodeCache[exclude]; + if (cache) { return cache; } + + cache = encodeCache[exclude] = []; + + for (i = 0; i < 128; i++) { + ch = String.fromCharCode(i); + + if (/^[0-9a-z]$/i.test(ch)) { + // always allow unencoded alphanumeric characters + cache.push(ch); + } else { + cache.push('%' + ('0' + i.toString(16).toUpperCase()).slice(-2)); + } + } + + for (i = 0; i < exclude.length; i++) { + cache[exclude.charCodeAt(i)] = exclude[i]; + } + + return cache; +} + + +// Encode unsafe characters with percent-encoding, skipping already +// encoded sequences. +// +// - string - string to encode +// - exclude - list of characters to ignore (in addition to a-zA-Z0-9) +// - keepEscaped - don't encode '%' in a correct escape sequence (default: true) +// +function encode(string, exclude, keepEscaped) { + var i, l, code, nextCode, cache, + result = ''; + + if (typeof exclude !== 'string') { + // encode(string, keepEscaped) + keepEscaped = exclude; + exclude = encode.defaultChars; + } + + if (typeof keepEscaped === 'undefined') { + keepEscaped = true; + } + + cache = getEncodeCache(exclude); + + for (i = 0, l = string.length; i < l; i++) { + code = string.charCodeAt(i); + + if (keepEscaped && code === 0x25 /* % */ && i + 2 < l) { + if (/^[0-9a-f]{2}$/i.test(string.slice(i + 1, i + 3))) { + result += string.slice(i, i + 3); + i += 2; + continue; + } + } + + if (code < 128) { + result += cache[code]; + continue; + } + + if (code >= 0xD800 && code <= 0xDFFF) { + if (code >= 0xD800 && code <= 0xDBFF && i + 1 < l) { + nextCode = string.charCodeAt(i + 1); + if (nextCode >= 0xDC00 && nextCode <= 0xDFFF) { + result += encodeURIComponent(string[i] + string[i + 1]); + i++; + continue; + } + } + result += '%EF%BF%BD'; + continue; + } + + result += encodeURIComponent(string[i]); + } + + return result; +} + +encode.defaultChars = ";/?:@&=+$,-_.!~*'()#"; +encode.componentChars = "-_.!~*'()"; + + +module.exports = encode; diff --git a/node_modules/mdurl/format.js b/node_modules/mdurl/format.js new file mode 100644 index 0000000..c4eb9f4 --- /dev/null +++ b/node_modules/mdurl/format.js @@ -0,0 +1,25 @@ + +'use strict'; + + +module.exports = function format(url) { + var result = ''; + + result += url.protocol || ''; + result += url.slashes ? '//' : ''; + result += url.auth ? url.auth + '@' : ''; + + if (url.hostname && url.hostname.indexOf(':') !== -1) { + // ipv6 address + result += '[' + url.hostname + ']'; + } else { + result += url.hostname || ''; + } + + result += url.port ? ':' + url.port : ''; + result += url.pathname || ''; + result += url.search || ''; + result += url.hash || ''; + + return result; +}; diff --git a/node_modules/mdurl/index.js b/node_modules/mdurl/index.js new file mode 100644 index 0000000..194abff --- /dev/null +++ b/node_modules/mdurl/index.js @@ -0,0 +1,7 @@ +'use strict'; + + +module.exports.encode = require('./encode'); +module.exports.decode = require('./decode'); +module.exports.format = require('./format'); +module.exports.parse = require('./parse'); diff --git a/node_modules/mdurl/package.json b/node_modules/mdurl/package.json new file mode 100644 index 0000000..017d740 --- /dev/null +++ b/node_modules/mdurl/package.json @@ -0,0 +1,16 @@ +{ + "name": "mdurl", + "version": "1.0.1", + "description": "URL utilities for markdown-it", + "repository": "markdown-it/mdurl", + "license": "MIT", + "scripts": { + "test": "make test" + }, + "devDependencies": { + "mocha": "*", + "eslint": "0.13.0", + "eslint-plugin-nodeca": "^1.0.0", + "istanbul": "*" + } +} diff --git a/node_modules/mdurl/parse.js b/node_modules/mdurl/parse.js new file mode 100644 index 0000000..6c33ac1 --- /dev/null +++ b/node_modules/mdurl/parse.js @@ -0,0 +1,312 @@ +// Copyright Joyent, Inc. and other Node contributors. +// +// Permission is hereby granted, free of charge, to any person obtaining a +// copy of this software and associated documentation files (the +// "Software"), to deal in the Software without restriction, including +// without limitation the rights to use, copy, modify, merge, publish, +// distribute, sublicense, and/or sell copies of the Software, and to permit +// persons to whom the Software is furnished to do so, subject to the +// following conditions: +// +// The above copyright notice and this permission notice shall be included +// in all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN +// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, +// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR +// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE +// USE OR OTHER DEALINGS IN THE SOFTWARE. + +'use strict'; + +// +// Changes from joyent/node: +// +// 1. No leading slash in paths, +// e.g. in `url.parse('http://foo?bar')` pathname is ``, not `/` +// +// 2. Backslashes are not replaced with slashes, +// so `http:\\example.org\` is treated like a relative path +// +// 3. Trailing colon is treated like a part of the path, +// i.e. in `http://example.org:foo` pathname is `:foo` +// +// 4. Nothing is URL-encoded in the resulting object, +// (in joyent/node some chars in auth and paths are encoded) +// +// 5. `url.parse()` does not have `parseQueryString` argument +// +// 6. Removed extraneous result properties: `host`, `path`, `query`, etc., +// which can be constructed using other parts of the url. +// + + +function Url() { + this.protocol = null; + this.slashes = null; + this.auth = null; + this.port = null; + this.hostname = null; + this.hash = null; + this.search = null; + this.pathname = null; +} + +// Reference: RFC 3986, RFC 1808, RFC 2396 + +// define these here so at least they only have to be +// compiled once on the first module load. +var protocolPattern = /^([a-z0-9.+-]+:)/i, + portPattern = /:[0-9]*$/, + + // Special case for a simple path URL + simplePathPattern = /^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/, + + // RFC 2396: characters reserved for delimiting URLs. + // We actually just auto-escape these. + delims = [ '<', '>', '"', '`', ' ', '\r', '\n', '\t' ], + + // RFC 2396: characters not allowed for various reasons. + unwise = [ '{', '}', '|', '\\', '^', '`' ].concat(delims), + + // Allowed by RFCs, but cause of XSS attacks. Always escape these. + autoEscape = [ '\'' ].concat(unwise), + // Characters that are never ever allowed in a hostname. + // Note that any invalid chars are also handled, but these + // are the ones that are *expected* to be seen, so we fast-path + // them. + nonHostChars = [ '%', '/', '?', ';', '#' ].concat(autoEscape), + hostEndingChars = [ '/', '?', '#' ], + hostnameMaxLen = 255, + hostnamePartPattern = /^[+a-z0-9A-Z_-]{0,63}$/, + hostnamePartStart = /^([+a-z0-9A-Z_-]{0,63})(.*)$/, + // protocols that can allow "unsafe" and "unwise" chars. + /* eslint-disable no-script-url */ + // protocols that never have a hostname. + hostlessProtocol = { + 'javascript': true, + 'javascript:': true + }, + // protocols that always contain a // bit. + slashedProtocol = { + 'http': true, + 'https': true, + 'ftp': true, + 'gopher': true, + 'file': true, + 'http:': true, + 'https:': true, + 'ftp:': true, + 'gopher:': true, + 'file:': true + }; + /* eslint-enable no-script-url */ + +function urlParse(url, slashesDenoteHost) { + if (url && url instanceof Url) { return url; } + + var u = new Url(); + u.parse(url, slashesDenoteHost); + return u; +} + +Url.prototype.parse = function(url, slashesDenoteHost) { + var i, l, lowerProto, hec, slashes, + rest = url; + + // trim before proceeding. + // This is to support parse stuff like " http://foo.com \n" + rest = rest.trim(); + + if (!slashesDenoteHost && url.split('#').length === 1) { + // Try fast path regexp + var simplePath = simplePathPattern.exec(rest); + if (simplePath) { + this.pathname = simplePath[1]; + if (simplePath[2]) { + this.search = simplePath[2]; + } + return this; + } + } + + var proto = protocolPattern.exec(rest); + if (proto) { + proto = proto[0]; + lowerProto = proto.toLowerCase(); + this.protocol = proto; + rest = rest.substr(proto.length); + } + + // figure out if it's got a host + // user@server is *always* interpreted as a hostname, and url + // resolution will treat //foo/bar as host=foo,path=bar because that's + // how the browser resolves relative URLs. + if (slashesDenoteHost || proto || rest.match(/^\/\/[^@\/]+@[^@\/]+/)) { + slashes = rest.substr(0, 2) === '//'; + if (slashes && !(proto && hostlessProtocol[proto])) { + rest = rest.substr(2); + this.slashes = true; + } + } + + if (!hostlessProtocol[proto] && + (slashes || (proto && !slashedProtocol[proto]))) { + + // there's a hostname. + // the first instance of /, ?, ;, or # ends the host. + // + // If there is an @ in the hostname, then non-host chars *are* allowed + // to the left of the last @ sign, unless some host-ending character + // comes *before* the @-sign. + // URLs are obnoxious. + // + // ex: + // http://a@b@c/ => user:a@b host:c + // http://a@b?@c => user:a host:c path:/?@c + + // v0.12 TODO(isaacs): This is not quite how Chrome does things. + // Review our test case against browsers more comprehensively. + + // find the first instance of any hostEndingChars + var hostEnd = -1; + for (i = 0; i < hostEndingChars.length; i++) { + hec = rest.indexOf(hostEndingChars[i]); + if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) { + hostEnd = hec; + } + } + + // at this point, either we have an explicit point where the + // auth portion cannot go past, or the last @ char is the decider. + var auth, atSign; + if (hostEnd === -1) { + // atSign can be anywhere. + atSign = rest.lastIndexOf('@'); + } else { + // atSign must be in auth portion. + // http://a@b/c@d => host:b auth:a path:/c@d + atSign = rest.lastIndexOf('@', hostEnd); + } + + // Now we have a portion which is definitely the auth. + // Pull that off. + if (atSign !== -1) { + auth = rest.slice(0, atSign); + rest = rest.slice(atSign + 1); + this.auth = auth; + } + + // the host is the remaining to the left of the first non-host char + hostEnd = -1; + for (i = 0; i < nonHostChars.length; i++) { + hec = rest.indexOf(nonHostChars[i]); + if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) { + hostEnd = hec; + } + } + // if we still have not hit it, then the entire thing is a host. + if (hostEnd === -1) { + hostEnd = rest.length; + } + + if (rest[hostEnd - 1] === ':') { hostEnd--; } + var host = rest.slice(0, hostEnd); + rest = rest.slice(hostEnd); + + // pull out port. + this.parseHost(host); + + // we've indicated that there is a hostname, + // so even if it's empty, it has to be present. + this.hostname = this.hostname || ''; + + // if hostname begins with [ and ends with ] + // assume that it's an IPv6 address. + var ipv6Hostname = this.hostname[0] === '[' && + this.hostname[this.hostname.length - 1] === ']'; + + // validate a little. + if (!ipv6Hostname) { + var hostparts = this.hostname.split(/\./); + for (i = 0, l = hostparts.length; i < l; i++) { + var part = hostparts[i]; + if (!part) { continue; } + if (!part.match(hostnamePartPattern)) { + var newpart = ''; + for (var j = 0, k = part.length; j < k; j++) { + if (part.charCodeAt(j) > 127) { + // we replace non-ASCII char with a temporary placeholder + // we need this to make sure size of hostname is not + // broken by replacing non-ASCII by nothing + newpart += 'x'; + } else { + newpart += part[j]; + } + } + // we test again with ASCII char only + if (!newpart.match(hostnamePartPattern)) { + var validParts = hostparts.slice(0, i); + var notHost = hostparts.slice(i + 1); + var bit = part.match(hostnamePartStart); + if (bit) { + validParts.push(bit[1]); + notHost.unshift(bit[2]); + } + if (notHost.length) { + rest = notHost.join('.') + rest; + } + this.hostname = validParts.join('.'); + break; + } + } + } + } + + if (this.hostname.length > hostnameMaxLen) { + this.hostname = ''; + } + + // strip [ and ] from the hostname + // the host field still retains them, though + if (ipv6Hostname) { + this.hostname = this.hostname.substr(1, this.hostname.length - 2); + } + } + + // chop off from the tail first. + var hash = rest.indexOf('#'); + if (hash !== -1) { + // got a fragment string. + this.hash = rest.substr(hash); + rest = rest.slice(0, hash); + } + var qm = rest.indexOf('?'); + if (qm !== -1) { + this.search = rest.substr(qm); + rest = rest.slice(0, qm); + } + if (rest) { this.pathname = rest; } + if (slashedProtocol[lowerProto] && + this.hostname && !this.pathname) { + this.pathname = ''; + } + + return this; +}; + +Url.prototype.parseHost = function(host) { + var port = portPattern.exec(host); + if (port) { + port = port[0]; + if (port !== ':') { + this.port = port.substr(1); + } + host = host.substr(0, host.length - port.length); + } + if (host) { this.hostname = host; } +}; + +module.exports = urlParse; diff --git a/node_modules/uc.micro/CHANGELOG.md b/node_modules/uc.micro/CHANGELOG.md new file mode 100644 index 0000000..974a969 --- /dev/null +++ b/node_modules/uc.micro/CHANGELOG.md @@ -0,0 +1,52 @@ +1.0.6 / 2019-01-31 +------------------ + +- Unicode update to 10.0.0. +- Fixed `Z` content (added missed line and paragraph seperators), #10. + + +1.0.5 / 2018-01-26 +------------------ + +- Remove outdated license info from readme (missed in previous update). + + +1.0.4 / 2018-01-26 +------------------ + +- Unicode update to 10.0.0. +- Clarified license, should be MIT, #6. + + +1.0.3 / 2016-09-14 +------------------ + +- Unicode update to 9.0.0. +- Rewrite update script (use npm instead of Makefile). +- Added integrity tests. + + +1.0.2 / 2015-06-24 +------------------ + +- License info clarify, #3. + + +1.0.1 / 2015-05-30 +------------------ + +- Update to Unicode 8.+. +- Also automatically fix possible ReDOS in `Any`, if source used to generate + patterns like `(Any)+`. + + +1.0.0 / 2015-03-10 +------------------ + +- Export all in index.js. + + +0.1.0 / 2015-02-22 +------------------ + +- First release. diff --git a/node_modules/uc.micro/LICENSE.txt b/node_modules/uc.micro/LICENSE.txt new file mode 100644 index 0000000..a41e0a7 --- /dev/null +++ b/node_modules/uc.micro/LICENSE.txt @@ -0,0 +1,20 @@ +Copyright Mathias Bynens <https://mathiasbynens.be/> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND +NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE +LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION +OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION +WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/uc.micro/README.md b/node_modules/uc.micro/README.md new file mode 100644 index 0000000..3c555ea --- /dev/null +++ b/node_modules/uc.micro/README.md @@ -0,0 +1,14 @@ +# uc.micro + +[![Build Status](https://img.shields.io/travis/markdown-it/uc.micro/master.svg?style=flat)](https://travis-ci.org/markdown-it/uc.micro) +[![NPM version](https://img.shields.io/npm/v/uc.micro.svg?style=flat)](https://www.npmjs.org/package/uc.micro) + +> Micro subset of unicode data files for [markdown-it](https://github.com/markdown-it) projects. + +Content of this repo is autogenerated from `unicode-<version>` package, +maintained by [Mathias Bynens](https://github.com/mathiasbynens). + +That's just a proxy to reduce dependencies/install size. + +**This package content is ONLY for [markdown-it](https://github.com/markdown-it) +projects needs. Don't ask to extend it!** diff --git a/node_modules/uc.micro/categories/Cc/regex.js b/node_modules/uc.micro/categories/Cc/regex.js new file mode 100644 index 0000000..99be991 --- /dev/null +++ b/node_modules/uc.micro/categories/Cc/regex.js @@ -0,0 +1 @@ +module.exports=/[\0-\x1F\x7F-\x9F]/
\ No newline at end of file diff --git a/node_modules/uc.micro/categories/Cf/regex.js b/node_modules/uc.micro/categories/Cf/regex.js new file mode 100644 index 0000000..e89eff6 --- /dev/null +++ b/node_modules/uc.micro/categories/Cf/regex.js @@ -0,0 +1 @@ +module.exports=/[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804[\uDCBD\uDCCD]|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/
\ No newline at end of file diff --git a/node_modules/uc.micro/categories/P/regex.js b/node_modules/uc.micro/categories/P/regex.js new file mode 100644 index 0000000..7e18fa7 --- /dev/null +++ b/node_modules/uc.micro/categories/P/regex.js @@ -0,0 +1 @@ +module.exports=/[!-#%-\*,-\/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0A76\u0AF0\u0C84\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E4E\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD803[\uDF55-\uDF59]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC8\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDC3B\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71\uDEF7\uDEF8]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD81B[\uDE97-\uDE9A]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/
\ No newline at end of file diff --git a/node_modules/uc.micro/categories/Z/regex.js b/node_modules/uc.micro/categories/Z/regex.js new file mode 100644 index 0000000..76976a4 --- /dev/null +++ b/node_modules/uc.micro/categories/Z/regex.js @@ -0,0 +1 @@ +module.exports=/[ \xA0\u1680\u2000-\u200A\u2028\u2029\u202F\u205F\u3000]/
\ No newline at end of file diff --git a/node_modules/uc.micro/index.js b/node_modules/uc.micro/index.js new file mode 100644 index 0000000..03b6d4a --- /dev/null +++ b/node_modules/uc.micro/index.js @@ -0,0 +1,7 @@ +'use strict'; + +exports.Any = require('./properties/Any/regex'); +exports.Cc = require('./categories/Cc/regex'); +exports.Cf = require('./categories/Cf/regex'); +exports.P = require('./categories/P/regex'); +exports.Z = require('./categories/Z/regex'); diff --git a/node_modules/uc.micro/package.json b/node_modules/uc.micro/package.json new file mode 100644 index 0000000..798e4bb --- /dev/null +++ b/node_modules/uc.micro/package.json @@ -0,0 +1,21 @@ +{ + "name": "uc.micro", + "version": "1.0.6", + "description": "Micro subset of unicode data files for markdown-it projects.", + "repository": "markdown-it/uc.micro", + "license": "MIT", + "files": [ + "categories/", + "properties/", + "index.js" + ], + "scripts": { + "test": "mocha", + "update": "node update.js && npm test" + }, + "devDependencies": { + "mocha": "^5.0.0", + "shelljs": "^0.8.1", + "unicode-11.0.0": "^0.7.8" + } +} diff --git a/node_modules/uc.micro/properties/Any/regex.js b/node_modules/uc.micro/properties/Any/regex.js new file mode 100644 index 0000000..22afa15 --- /dev/null +++ b/node_modules/uc.micro/properties/Any/regex.js @@ -0,0 +1 @@ +module.exports=/[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/
\ No newline at end of file |